From 4f59f2bc1c22d8e60a6929d19aeca36f5bb3848f Mon Sep 17 00:00:00 2001 From: semantic-release-bot Date: Mon, 2 Sep 2024 21:41:04 +0000 Subject: [PATCH] build(release): 1.0.0 [skip ci] # 1.0.0 (2024-09-02) ### Bug Fixes * **action-config:** prepare for release to marketplace ([#10](https://github.com/lepadatu-org/create-github-app-token-aws/issues/10)) ([12aa811](https://github.com/lepadatu-org/create-github-app-token-aws/commit/12aa81137bd7fec724cf23ab0c54092261f59830)) * check for token before revoking ([#30](https://github.com/lepadatu-org/create-github-app-token-aws/issues/30)) ([2540ed4](https://github.com/lepadatu-org/create-github-app-token-aws/commit/2540ed49e5d6bea751bf3da363bb5b5a6fcf0c07)) * **ci:** release configuration ([#6](https://github.com/lepadatu-org/create-github-app-token-aws/issues/6)) ([847634e](https://github.com/lepadatu-org/create-github-app-token-aws/commit/847634eeb36664e2d49db18add847e3fe1a183db)) * clarify `owner` input description ([#118](https://github.com/lepadatu-org/create-github-app-token-aws/issues/118)) ([d9bc169](https://github.com/lepadatu-org/create-github-app-token-aws/commit/d9bc16919cdbdb07543eb732aa872437384e296f)) * **deps:** bump dependencies([#84](https://github.com/lepadatu-org/create-github-app-token-aws/issues/84)) ([474769d](https://github.com/lepadatu-org/create-github-app-token-aws/commit/474769db88900a253a1c4aa9b4398d8a90c4cdab)), closes [#651](https://github.com/lepadatu-org/create-github-app-token-aws/issues/651) [#648](https://github.com/lepadatu-org/create-github-app-token-aws/issues/648) [#649](https://github.com/lepadatu-org/create-github-app-token-aws/issues/649) [#651](https://github.com/lepadatu-org/create-github-app-token-aws/issues/651) [#648](https://github.com/lepadatu-org/create-github-app-token-aws/issues/648) [#646](https://github.com/lepadatu-org/create-github-app-token-aws/issues/646) * **deps:** bump the production-dependencies group with 1 update ([#123](https://github.com/lepadatu-org/create-github-app-token-aws/issues/123)) ([beea7b8](https://github.com/lepadatu-org/create-github-app-token-aws/commit/beea7b860ac0b14ca14258aca701da842aa65e30)), closes [nodejs/undici#2978](https://github.com/nodejs/undici/issues/2978) [nodejs/undici#2971](https://github.com/nodejs/undici/issues/2971) [nodejs/undici#2980](https://github.com/nodejs/undici/issues/2980) [#2982](https://github.com/lepadatu-org/create-github-app-token-aws/issues/2982) [nodejs/undici#2983](https://github.com/nodejs/undici/issues/2983) [nodejs/undici#2987](https://github.com/nodejs/undici/issues/2987) [nodejs/undici#2991](https://github.com/nodejs/undici/issues/2991) [#2986](https://github.com/lepadatu-org/create-github-app-token-aws/issues/2986) [nodejs/undici#2992](https://github.com/nodejs/undici/issues/2992) [nodejs/undici#2985](https://github.com/nodejs/undici/issues/2985) [nodejs/undici#2993](https://github.com/nodejs/undici/issues/2993) [nodejs/undici#2995](https://github.com/nodejs/undici/issues/2995) [nodejs/undici#2998](https://github.com/nodejs/undici/issues/2998) [#2863](https://github.com/lepadatu-org/create-github-app-token-aws/issues/2863) [nodejs/undici#2999](https://github.com/nodejs/undici/issues/2999) [nodejs/undici#3001](https://github.com/nodejs/undici/issues/3001) [nodejs/undici#2971](https://github.com/nodejs/undici/issues/2971) [nodejs/undici#2980](https://github.com/nodejs/undici/issues/2980) [nodejs/undici#2983](https://github.com/nodejs/undici/issues/2983) [nodejs/undici#2987](https://github.com/nodejs/undici/issues/2987) [nodejs/undici#2991](https://github.com/nodejs/undici/issues/2991) [nodejs/undici#2985](https://github.com/nodejs/undici/issues/2985) [nodejs/undici#2995](https://github.com/nodejs/undici/issues/2995) [nodejs/undici#2960](https://github.com/nodejs/undici/issues/2960) [nodejs/undici#2959](https://github.com/nodejs/undici/issues/2959) [nodejs/undici#2969](https://github.com/nodejs/undici/issues/2969) [nodejs/undici#2962](https://github.com/nodejs/undici/issues/2962) [nodejs/undici#2974](https://github.com/nodejs/undici/issues/2974) [nodejs/undici#2967](https://github.com/nodejs/undici/issues/2967) [nodejs/undici#2966](https://github.com/nodejs/undici/issues/2966) [nodejs/undici#2969](https://github.com/nodejs/undici/issues/2969) [nodejs/undici#2962](https://github.com/nodejs/undici/issues/2962) [nodejs/undici#2826](https://github.com/nodejs/undici/issues/2826) [nodejs/undici#2952](https://github.com/nodejs/undici/issues/2952) [#3001](https://github.com/lepadatu-org/create-github-app-token-aws/issues/3001) [#2863](https://github.com/lepadatu-org/create-github-app-token-aws/issues/2863) [#2999](https://github.com/lepadatu-org/create-github-app-token-aws/issues/2999) [#2998](https://github.com/lepadatu-org/create-github-app-token-aws/issues/2998) [#2993](https://github.com/lepadatu-org/create-github-app-token-aws/issues/2993) [#2986](https://github.com/lepadatu-org/create-github-app-token-aws/issues/2986) [#2992](https://github.com/lepadatu-org/create-github-app-token-aws/issues/2992) [#2991](https://github.com/lepadatu-org/create-github-app-token-aws/issues/2991) [#2987](https://github.com/lepadatu-org/create-github-app-token-aws/issues/2987) * **deps:** bump the production-dependencies group with 1 update ([#68](https://github.com/lepadatu-org/create-github-app-token-aws/issues/68)) ([6375dce](https://github.com/lepadatu-org/create-github-app-token-aws/commit/6375dcedb2ea16f4290923bb46ed8a00ea439cae)) * **deps:** bump the production-dependencies group with 2 updates ([#138](https://github.com/lepadatu-org/create-github-app-token-aws/issues/138)) ([8d81a59](https://github.com/lepadatu-org/create-github-app-token-aws/commit/8d81a59103d6d17f5ecc243eb5fd53757607a1d2)), closes [#606](https://github.com/lepadatu-org/create-github-app-token-aws/issues/606) [#606](https://github.com/lepadatu-org/create-github-app-token-aws/issues/606) [#605](https://github.com/lepadatu-org/create-github-app-token-aws/issues/605) [#604](https://github.com/lepadatu-org/create-github-app-token-aws/issues/604) [nodejs/undici#3295](https://github.com/nodejs/undici/issues/3295) [nodejs/undici#3298](https://github.com/nodejs/undici/issues/3298) [nodejs/undici#3294](https://github.com/nodejs/undici/issues/3294) [nodejs/undici#3281](https://github.com/nodejs/undici/issues/3281) [nodejs/undici#3286](https://github.com/nodejs/undici/issues/3286) [nodejs/undici#3284](https://github.com/nodejs/undici/issues/3284) [nodejs/undici#3291](https://github.com/nodejs/undici/issues/3291) [nodejs/undici#3290](https://github.com/nodejs/undici/issues/3290) [nodejs/undici#3283](https://github.com/nodejs/undici/issues/3283) [nodejs/undici#3281](https://github.com/nodejs/undici/issues/3281) [nodejs/undici#3263](https://github.com/nodejs/undici/issues/3263) [nodejs/undici#3279](https://github.com/nodejs/undici/issues/3279) [nodejs/undici#3227](https://github.com/nodejs/undici/issues/3227) [nodejs/undici#3234](https://github.com/nodejs/undici/issues/3234) [nodejs/undici#3240](https://github.com/nodejs/undici/issues/3240) [nodejs/undici#3245](https://github.com/nodejs/undici/issues/3245) [nodejs/undici#3241](https://github.com/nodejs/undici/issues/3241) [nodejs/undici#3247](https://github.com/nodejs/undici/issues/3247) [nodejs/undici#3248](https://github.com/nodejs/undici/issues/3248) [nodejs/undici#3219](https://github.com/nodejs/undici/issues/3219) [nodejs/undici#3251](https://github.com/nodejs/undici/issues/3251) [nodejs/undici#3254](https://github.com/nodejs/undici/issues/3254) [nodejs/undici#3258](https://github.com/nodejs/undici/issues/3258) [nodejs/undici#3257](https://github.com/nodejs/undici/issues/3257) [nodejs/undici#3259](https://github.com/nodejs/undici/issues/3259) [nodejs/undici#3262](https://github.com/nodejs/undici/issues/3262) [nodejs/undici#3264](https://github.com/nodejs/undici/issues/3264) [nodejs/undici#3118](https://github.com/nodejs/undici/issues/3118) [nodejs/undici#3269](https://github.com/nodejs/undici/issues/3269) [#3301](https://github.com/lepadatu-org/create-github-app-token-aws/issues/3301) [#3294](https://github.com/lepadatu-org/create-github-app-token-aws/issues/3294) [#3298](https://github.com/lepadatu-org/create-github-app-token-aws/issues/3298) [#3295](https://github.com/lepadatu-org/create-github-app-token-aws/issues/3295) [#3293](https://github.com/lepadatu-org/create-github-app-token-aws/issues/3293) [#3283](https://github.com/lepadatu-org/create-github-app-token-aws/issues/3283) [#3290](https://github.com/lepadatu-org/create-github-app-token-aws/issues/3290) [#3291](https://github.com/lepadatu-org/create-github-app-token-aws/issues/3291) [#3284](https://github.com/lepadatu-org/create-github-app-token-aws/issues/3284) [#3286](https://github.com/lepadatu-org/create-github-app-token-aws/issues/3286) * **deps:** bump the production-dependencies group with 2 updates ([#94](https://github.com/lepadatu-org/create-github-app-token-aws/issues/94)) ([323044f](https://github.com/lepadatu-org/create-github-app-token-aws/commit/323044ff3180ac0ba3543efbe2b76ff90050e9b6)), closes [#562](https://github.com/lepadatu-org/create-github-app-token-aws/issues/562) [#557](https://github.com/lepadatu-org/create-github-app-token-aws/issues/557) [#562](https://github.com/lepadatu-org/create-github-app-token-aws/issues/562) [#560](https://github.com/lepadatu-org/create-github-app-token-aws/issues/560) [#559](https://github.com/lepadatu-org/create-github-app-token-aws/issues/559) [#558](https://github.com/lepadatu-org/create-github-app-token-aws/issues/558) [#557](https://github.com/lepadatu-org/create-github-app-token-aws/issues/557) [#553](https://github.com/lepadatu-org/create-github-app-token-aws/issues/553) [#552](https://github.com/lepadatu-org/create-github-app-token-aws/issues/552) [#551](https://github.com/lepadatu-org/create-github-app-token-aws/issues/551) [#75](https://github.com/lepadatu-org/create-github-app-token-aws/issues/75) [#75](https://github.com/lepadatu-org/create-github-app-token-aws/issues/75) * **deps:** bump the production-dependencies group with 3 updates ([#107](https://github.com/lepadatu-org/create-github-app-token-aws/issues/107)) ([f83fb27](https://github.com/lepadatu-org/create-github-app-token-aws/commit/f83fb279aa2bc96a80fac0b8cb97b369ae18334f)), closes [#579](https://github.com/lepadatu-org/create-github-app-token-aws/issues/579) [#579](https://github.com/lepadatu-org/create-github-app-token-aws/issues/579) [#576](https://github.com/lepadatu-org/create-github-app-token-aws/issues/576) [#577](https://github.com/lepadatu-org/create-github-app-token-aws/issues/577) [#574](https://github.com/lepadatu-org/create-github-app-token-aws/issues/574) [#572](https://github.com/lepadatu-org/create-github-app-token-aws/issues/572) [#571](https://github.com/lepadatu-org/create-github-app-token-aws/issues/571) [#567](https://github.com/lepadatu-org/create-github-app-token-aws/issues/567) [#681](https://github.com/lepadatu-org/create-github-app-token-aws/issues/681) [#678](https://github.com/lepadatu-org/create-github-app-token-aws/issues/678) [#667](https://github.com/lepadatu-org/create-github-app-token-aws/issues/667) [#681](https://github.com/lepadatu-org/create-github-app-token-aws/issues/681) [#680](https://github.com/lepadatu-org/create-github-app-token-aws/issues/680) [#609](https://github.com/lepadatu-org/create-github-app-token-aws/issues/609) [#678](https://github.com/lepadatu-org/create-github-app-token-aws/issues/678) [#676](https://github.com/lepadatu-org/create-github-app-token-aws/issues/676) [#673](https://github.com/lepadatu-org/create-github-app-token-aws/issues/673) [#669](https://github.com/lepadatu-org/create-github-app-token-aws/issues/669) [#667](https://github.com/lepadatu-org/create-github-app-token-aws/issues/667) [#671](https://github.com/lepadatu-org/create-github-app-token-aws/issues/671) [nodejs/undici#2683](https://github.com/nodejs/undici/issues/2683) [nodejs/undici#2645](https://github.com/nodejs/undici/issues/2645) [nodejs/undici#2695](https://github.com/nodejs/undici/issues/2695) [nodejs/undici#2699](https://github.com/nodejs/undici/issues/2699) [nodejs/undici#2703](https://github.com/nodejs/undici/issues/2703) [nodejs/undici#2644](https://github.com/nodejs/undici/issues/2644) [nodejs/undici#2702](https://github.com/nodejs/undici/issues/2702) [nodejs/undici#2706](https://github.com/nodejs/undici/issues/2706) [nodejs/undici#2707](https://github.com/nodejs/undici/issues/2707) [nodejs/undici#2644](https://github.com/nodejs/undici/issues/2644) [#2707](https://github.com/lepadatu-org/create-github-app-token-aws/issues/2707) [#2706](https://github.com/lepadatu-org/create-github-app-token-aws/issues/2706) [#2702](https://github.com/lepadatu-org/create-github-app-token-aws/issues/2702) [#2644](https://github.com/lepadatu-org/create-github-app-token-aws/issues/2644) [#2703](https://github.com/lepadatu-org/create-github-app-token-aws/issues/2703) [#2699](https://github.com/lepadatu-org/create-github-app-token-aws/issues/2699) [#2695](https://github.com/lepadatu-org/create-github-app-token-aws/issues/2695) [#2645](https://github.com/lepadatu-org/create-github-app-token-aws/issues/2645) [#2683](https://github.com/lepadatu-org/create-github-app-token-aws/issues/2683) * **deps:** bump the production-dependencies group with 3 updates ([#51](https://github.com/lepadatu-org/create-github-app-token-aws/issues/51)) ([6d98b25](https://github.com/lepadatu-org/create-github-app-token-aws/commit/6d98b259d9c6bef17db279eb4aefbbd031400ba4)), closes [#1511](https://github.com/lepadatu-org/create-github-app-token-aws/issues/1511) [#535](https://github.com/lepadatu-org/create-github-app-token-aws/issues/535) [#535](https://github.com/lepadatu-org/create-github-app-token-aws/issues/535) [#533](https://github.com/lepadatu-org/create-github-app-token-aws/issues/533) [#531](https://github.com/lepadatu-org/create-github-app-token-aws/issues/531) [#530](https://github.com/lepadatu-org/create-github-app-token-aws/issues/530) [#524](https://github.com/lepadatu-org/create-github-app-token-aws/issues/524) [#637](https://github.com/lepadatu-org/create-github-app-token-aws/issues/637) [#637](https://github.com/lepadatu-org/create-github-app-token-aws/issues/637) [#631](https://github.com/lepadatu-org/create-github-app-token-aws/issues/631) [#626](https://github.com/lepadatu-org/create-github-app-token-aws/issues/626) * **deps:** bump undici from 6.10.2 to 6.11.1 ([#125](https://github.com/lepadatu-org/create-github-app-token-aws/issues/125)) ([3c223c7](https://github.com/lepadatu-org/create-github-app-token-aws/commit/3c223c7336e276235eb843dd4e6ad42147199cbf)), closes [#3024](https://github.com/lepadatu-org/create-github-app-token-aws/issues/3024) [nodejs/undici#3044](https://github.com/nodejs/undici/issues/3044) [#3023](https://github.com/lepadatu-org/create-github-app-token-aws/issues/3023) [nodejs/undici#3025](https://github.com/nodejs/undici/issues/3025) [nodejs/undici#3024](https://github.com/nodejs/undici/issues/3024) [nodejs/undici#3034](https://github.com/nodejs/undici/issues/3034) [nodejs/undici#3038](https://github.com/nodejs/undici/issues/3038) [nodejs/undici#2947](https://github.com/nodejs/undici/issues/2947) [nodejs/undici#3040](https://github.com/nodejs/undici/issues/3040) [nodejs/undici#3036](https://github.com/nodejs/undici/issues/3036) [nodejs/undici#3041](https://github.com/nodejs/undici/issues/3041) [#3024](https://github.com/lepadatu-org/create-github-app-token-aws/issues/3024) [#3041](https://github.com/lepadatu-org/create-github-app-token-aws/issues/3041) [#3036](https://github.com/lepadatu-org/create-github-app-token-aws/issues/3036) * **deps:** bump undici from 6.18.2 to 6.19.2 in the production-dependencies group ([#149](https://github.com/lepadatu-org/create-github-app-token-aws/issues/149)) ([cc82279](https://github.com/lepadatu-org/create-github-app-token-aws/commit/cc82279e84540c5543078cedc5af4fcfab0a96bb)), closes [#3337](https://github.com/lepadatu-org/create-github-app-token-aws/issues/3337) [nodejs/undici#3338](https://github.com/nodejs/undici/issues/3338) [nodejs/undici#3340](https://github.com/nodejs/undici/issues/3340) [nodejs/undici#3332](https://github.com/nodejs/undici/issues/3332) [nodejs/undici#3335](https://github.com/nodejs/undici/issues/3335) [nodejs/undici#3305](https://github.com/nodejs/undici/issues/3305) [nodejs/undici#3303](https://github.com/nodejs/undici/issues/3303) [nodejs/undici#3304](https://github.com/nodejs/undici/issues/3304) [nodejs/undici#3306](https://github.com/nodejs/undici/issues/3306) [nodejs/undici#3309](https://github.com/nodejs/undici/issues/3309) [nodejs/undici#3313](https://github.com/nodejs/undici/issues/3313) [nodejs/undici#3311](https://github.com/nodejs/undici/issues/3311) [nodejs/undici#3107](https://github.com/nodejs/undici/issues/3107) [nodejs/undici#3302](https://github.com/nodejs/undici/issues/3302) [nodejs/undici#3320](https://github.com/nodejs/undici/issues/3320) [nodejs/undici#3321](https://github.com/nodejs/undici/issues/3321) [nodejs/undici#3316](https://github.com/nodejs/undici/issues/3316) [nodejs/undici#3318](https://github.com/nodejs/undici/issues/3318) [nodejs/undici#3326](https://github.com/nodejs/undici/issues/3326) [nodejs/undici#3324](https://github.com/nodejs/undici/issues/3324) [nodejs/undici#3325](https://github.com/nodejs/undici/issues/3325) [nodejs/undici#3316](https://github.com/nodejs/undici/issues/3316) [nodejs/undici#3318](https://github.com/nodejs/undici/issues/3318) [#3342](https://github.com/lepadatu-org/create-github-app-token-aws/issues/3342) [#3332](https://github.com/lepadatu-org/create-github-app-token-aws/issues/3332) [#3340](https://github.com/lepadatu-org/create-github-app-token-aws/issues/3340) [#3337](https://github.com/lepadatu-org/create-github-app-token-aws/issues/3337) [#3338](https://github.com/lepadatu-org/create-github-app-token-aws/issues/3338) [#3336](https://github.com/lepadatu-org/create-github-app-token-aws/issues/3336) [#3335](https://github.com/lepadatu-org/create-github-app-token-aws/issues/3335) [#3325](https://github.com/lepadatu-org/create-github-app-token-aws/issues/3325) [#3324](https://github.com/lepadatu-org/create-github-app-token-aws/issues/3324) [#3326](https://github.com/lepadatu-org/create-github-app-token-aws/issues/3326) * **deps:** bump undici from 6.6.0 to 6.6.1 ([#103](https://github.com/lepadatu-org/create-github-app-token-aws/issues/103)) ([5195df7](https://github.com/lepadatu-org/create-github-app-token-aws/commit/5195df7c8824728b348fbaa3f0921ce6ca4ecec0)) * **deps:** update `[@octokit](https://github.com/octokit)` packages to latest ([#24](https://github.com/lepadatu-org/create-github-app-token-aws/issues/24)) ([b287cb8](https://github.com/lepadatu-org/create-github-app-token-aws/commit/b287cb86e286e27e7f449cf330ba028f7b97f7ef)) * do not revoke token if already expired ([#147](https://github.com/lepadatu-org/create-github-app-token-aws/issues/147)) ([66a7045](https://github.com/lepadatu-org/create-github-app-token-aws/commit/66a70456860bafc79e37635eea77b8b2a929f6c8)), closes [#140](https://github.com/lepadatu-org/create-github-app-token-aws/issues/140) [#95](https://github.com/lepadatu-org/create-github-app-token-aws/issues/95) * **GHES:** respect `GITHUB_API_URL` when creating installation access token ([#38](https://github.com/lepadatu-org/create-github-app-token-aws/issues/38)) ([c08c5ac](https://github.com/lepadatu-org/create-github-app-token-aws/commit/c08c5ace340664df431bf7f11d51b61d92358c2b)), closes [#36](https://github.com/lepadatu-org/create-github-app-token-aws/issues/36) * handle clock skew ([#87](https://github.com/lepadatu-org/create-github-app-token-aws/issues/87)) ([495056a](https://github.com/lepadatu-org/create-github-app-token-aws/commit/495056a51509f267cd7262080a7bb618ad7b5d08)) * mask the installation token in logs ([#28](https://github.com/lepadatu-org/create-github-app-token-aws/issues/28)) ([bc256c2](https://github.com/lepadatu-org/create-github-app-token-aws/commit/bc256c234bf48ffdee7ae27409ebc7f9aa3c8ab4)) * **README:** fix name in usage examples ([#12](https://github.com/lepadatu-org/create-github-app-token-aws/issues/12)) ([cb1fcdd](https://github.com/lepadatu-org/create-github-app-token-aws/commit/cb1fcdda590f1dd2a7c771cfa62e50bb4ac1cfa5)) * **README:** update action name ([#5](https://github.com/lepadatu-org/create-github-app-token-aws/issues/5)) ([c08b794](https://github.com/lepadatu-org/create-github-app-token-aws/commit/c08b7942e4f16842e11846de387178fdd8a4dc1a)) * **README:** update repository name, remove section for feature that is not yet implemented ([#9](https://github.com/lepadatu-org/create-github-app-token-aws/issues/9)) ([c04bb41](https://github.com/lepadatu-org/create-github-app-token-aws/commit/c04bb41e616d2a16422908c7ca1b81930f23079b)) * **release:** build `dist/` before release ([#33](https://github.com/lepadatu-org/create-github-app-token-aws/issues/33)) ([9a6a017](https://github.com/lepadatu-org/create-github-app-token-aws/commit/9a6a017c104eb1b36533ee8195e814f567934ce8)), closes [#32](https://github.com/lepadatu-org/create-github-app-token-aws/issues/32) * **release:** update version in `package.json` ([#35](https://github.com/lepadatu-org/create-github-app-token-aws/issues/35)) ([1dccc4c](https://github.com/lepadatu-org/create-github-app-token-aws/commit/1dccc4ccc6e1df7d6adc1bde339ce0d7a2ea7df7)), closes [#34](https://github.com/lepadatu-org/create-github-app-token-aws/issues/34) * **revocation:** avoid revoking expired tokens and fail gracefully ([#95](https://github.com/lepadatu-org/create-github-app-token-aws/issues/95)) ([0c01407](https://github.com/lepadatu-org/create-github-app-token-aws/commit/0c014070f93045fed9b48f568f28b2f1cca37088)), closes [#72](https://github.com/lepadatu-org/create-github-app-token-aws/issues/72) ### Features * `github-api-url` ([#88](https://github.com/lepadatu-org/create-github-app-token-aws/issues/88)) ([837e275](https://github.com/lepadatu-org/create-github-app-token-aws/commit/837e2752e017897b136a438ea12a06c044b8414e)), closes [#77](https://github.com/lepadatu-org/create-github-app-token-aws/issues/77) * **`private-key`:** escaped newlines will be replaced ([#132](https://github.com/lepadatu-org/create-github-app-token-aws/issues/132)) ([9d23fb9](https://github.com/lepadatu-org/create-github-app-token-aws/commit/9d23fb93dd620572046d85c7c1032b488c12514f)) * Add a `skip_token_revoke` input for configuring token revocation ([#54](https://github.com/lepadatu-org/create-github-app-token-aws/issues/54)) ([9ec88c4](https://github.com/lepadatu-org/create-github-app-token-aws/commit/9ec88c41eef7052418d233d147c59fbdce19c56f)), closes [1#L46-L47](https://github.com/1/issues/L46-L47) [1#L132](https://github.com/1/issues/L132) * add GitHub Enterprise Server (GHES) support ([#36](https://github.com/lepadatu-org/create-github-app-token-aws/issues/36)) ([ede6c15](https://github.com/lepadatu-org/create-github-app-token-aws/commit/ede6c158812854da7c63aa6635138d168de14bea)) * add proxy support ([#102](https://github.com/lepadatu-org/create-github-app-token-aws/issues/102)) ([1f82f7d](https://github.com/lepadatu-org/create-github-app-token-aws/commit/1f82f7df931fbb9a6ba4a94ffacb46eb12eba094)) * add retry ([#79](https://github.com/lepadatu-org/create-github-app-token-aws/issues/79)) ([0f3b4d7](https://github.com/lepadatu-org/create-github-app-token-aws/commit/0f3b4d7df99b1af7cb8596ba4f855d6de4155aa5)), closes [#71](https://github.com/lepadatu-org/create-github-app-token-aws/issues/71) * initial version ([#1](https://github.com/lepadatu-org/create-github-app-token-aws/issues/1)) ([f456852](https://github.com/lepadatu-org/create-github-app-token-aws/commit/f45685208fd9b88321d74015b5996fc8c3e43d18)) * **outputs:** `app-slug` and `installation-id` ([#105](https://github.com/lepadatu-org/create-github-app-token-aws/issues/105)) ([babaff4](https://github.com/lepadatu-org/create-github-app-token-aws/commit/babaff4320b432cece89fd8d07209bb3f6e98fe3)) * support tokens scoped to multiple repositories within organization ([#46](https://github.com/lepadatu-org/create-github-app-token-aws/issues/46)) ([20fd863](https://github.com/lepadatu-org/create-github-app-token-aws/commit/20fd86373fdcbeffde8b73b17ebb3a7a62c6c407)) * use `node20` as runner ([#23](https://github.com/lepadatu-org/create-github-app-token-aws/issues/23)) ([803e078](https://github.com/lepadatu-org/create-github-app-token-aws/commit/803e078eb599890256679b164357599b8681de13)), closes [/github.com/actions/runner/issues/2619#issuecomment-1679003443](https://github.com//github.com/actions/runner/issues/2619/issues/issuecomment-1679003443) * use dash notation for inputs (deprecates underscore notation) ([#59](https://github.com/lepadatu-org/create-github-app-token-aws/issues/59)) ([7b1d2ae](https://github.com/lepadatu-org/create-github-app-token-aws/commit/7b1d2aef87b41884c03f2e69a0a422d5c69c5d72)), closes [#57](https://github.com/lepadatu-org/create-github-app-token-aws/issues/57) [/github.com/actions/create-github-app-token/issues/57#issuecomment-1751272252](https://github.com//github.com/actions/create-github-app-token/issues/57/issues/issuecomment-1751272252) --- dist/main.cjs | 42728 ++++++++++++++++++++++++++++++++++-------------- dist/post.cjs | 229 +- package.json | 2 +- 3 files changed, 30903 insertions(+), 12056 deletions(-) diff --git a/dist/main.cjs b/dist/main.cjs index 474eaef..ced0478 100644 --- a/dist/main.cjs +++ b/dist/main.cjs @@ -22,7 +22,6 @@ var __copyProps = (to, from, except, desc) => { } return to; }; -var __reExport = (target, mod, secondTarget) => (__copyProps(target, mod, "default"), secondTarget && __copyProps(secondTarget, mod, "default")); var __toESM = (mod, isNodeMode, target) => (target = mod != null ? __create(__getProtoOf(mod)) : {}, __copyProps( // If the importer is in node compatibility mode or this is not an ESM // file that has been converted to a CommonJS file using a Babel- @@ -69,7 +68,7 @@ var require_utils = __commonJS({ var require_command = __commonJS({ "node_modules/@actions/core/lib/command.js"(exports2) { "use strict"; - var __createBinding = exports2 && exports2.__createBinding || (Object.create ? function(o, m, k, k2) { + var __createBinding2 = exports2 && exports2.__createBinding || (Object.create ? function(o, m, k, k2) { if (k2 === void 0) k2 = k; Object.defineProperty(o, k2, { enumerable: true, get: function() { return m[k]; @@ -78,23 +77,23 @@ var require_command = __commonJS({ if (k2 === void 0) k2 = k; o[k2] = m[k]; }); - var __setModuleDefault = exports2 && exports2.__setModuleDefault || (Object.create ? function(o, v) { + var __setModuleDefault2 = exports2 && exports2.__setModuleDefault || (Object.create ? function(o, v) { Object.defineProperty(o, "default", { enumerable: true, value: v }); } : function(o, v) { o["default"] = v; }); - var __importStar = exports2 && exports2.__importStar || function(mod) { + var __importStar2 = exports2 && exports2.__importStar || function(mod) { if (mod && mod.__esModule) return mod; var result = {}; if (mod != null) { - for (var k in mod) if (k !== "default" && Object.hasOwnProperty.call(mod, k)) __createBinding(result, mod, k); + for (var k in mod) if (k !== "default" && Object.hasOwnProperty.call(mod, k)) __createBinding2(result, mod, k); } - __setModuleDefault(result, mod); + __setModuleDefault2(result, mod); return result; }; Object.defineProperty(exports2, "__esModule", { value: true }); exports2.issue = exports2.issueCommand = void 0; - var os = __importStar(require("os")); + var os = __importStar2(require("os")); var utils_1 = require_utils(); function issueCommand(command, properties, message) { const cmd = new Command(command, properties, message); @@ -122,14 +121,14 @@ var require_command = __commonJS({ let first = true; for (const key in this.properties) { if (this.properties.hasOwnProperty(key)) { - const val = this.properties[key]; - if (val) { + const val2 = this.properties[key]; + if (val2) { if (first) { first = false; } else { cmdStr += ","; } - cmdStr += `${key}=${escapeProperty(val)}`; + cmdStr += `${key}=${escapeProperty(val2)}`; } } } @@ -306,7 +305,7 @@ function stringToBytes(str) { } return bytes; } -function v35_default(name, version2, hashfunc) { +function v35_default(name, version3, hashfunc) { function generateUUID(value, namespace, buf, offset) { if (typeof value === "string") { value = stringToBytes(value); @@ -321,7 +320,7 @@ function v35_default(name, version2, hashfunc) { bytes.set(namespace); bytes.set(value, namespace.length); bytes = hashfunc(bytes); - bytes[6] = bytes[6] & 15 | version2; + bytes[6] = bytes[6] & 15 | version3; bytes[8] = bytes[8] & 63 | 128; if (buf) { offset = offset || 0; @@ -484,7 +483,7 @@ var init_esm_node = __esm({ var require_file_command = __commonJS({ "node_modules/@actions/core/lib/file-command.js"(exports2) { "use strict"; - var __createBinding = exports2 && exports2.__createBinding || (Object.create ? function(o, m, k, k2) { + var __createBinding2 = exports2 && exports2.__createBinding || (Object.create ? function(o, m, k, k2) { if (k2 === void 0) k2 = k; Object.defineProperty(o, k2, { enumerable: true, get: function() { return m[k]; @@ -493,24 +492,24 @@ var require_file_command = __commonJS({ if (k2 === void 0) k2 = k; o[k2] = m[k]; }); - var __setModuleDefault = exports2 && exports2.__setModuleDefault || (Object.create ? function(o, v) { + var __setModuleDefault2 = exports2 && exports2.__setModuleDefault || (Object.create ? function(o, v) { Object.defineProperty(o, "default", { enumerable: true, value: v }); } : function(o, v) { o["default"] = v; }); - var __importStar = exports2 && exports2.__importStar || function(mod) { + var __importStar2 = exports2 && exports2.__importStar || function(mod) { if (mod && mod.__esModule) return mod; var result = {}; if (mod != null) { - for (var k in mod) if (k !== "default" && Object.hasOwnProperty.call(mod, k)) __createBinding(result, mod, k); + for (var k in mod) if (k !== "default" && Object.hasOwnProperty.call(mod, k)) __createBinding2(result, mod, k); } - __setModuleDefault(result, mod); + __setModuleDefault2(result, mod); return result; }; Object.defineProperty(exports2, "__esModule", { value: true }); exports2.prepareKeyValueMessage = exports2.issueFileCommand = void 0; - var fs = __importStar(require("fs")); - var os = __importStar(require("os")); + var fs = __importStar2(require("fs")); + var os = __importStar2(require("os")); var uuid_1 = (init_esm_node(), __toCommonJS(esm_node_exports)); var utils_1 = require_utils(); function issueFileCommand(command, message) { @@ -1258,7 +1257,7 @@ var require_util = __commonJS({ var { InvalidArgumentError } = require_errors(); var { Blob: Blob2 } = require("buffer"); var nodeUtil = require("util"); - var { stringify: stringify2 } = require("querystring"); + var { stringify: stringify3 } = require("querystring"); var { headerNameLowerCasedRecord } = require_constants(); var [nodeMajor, nodeMinor] = process.versions.node.split(".").map((v) => Number(v)); function nop() { @@ -1273,7 +1272,7 @@ var require_util = __commonJS({ if (url.includes("?") || url.includes("#")) { throw new Error('Query params cannot be passed when url already contains "?" or "#".'); } - const stringified = stringify2(queryParams); + const stringified = stringify3(queryParams); if (stringified) { url += "?" + stringified; } @@ -1398,8 +1397,8 @@ var require_util = __commonJS({ } } var KEEPALIVE_TIMEOUT_EXPR = /timeout=(\d+)/; - function parseKeepAliveTimeout(val) { - const m = val.toString().match(KEEPALIVE_TIMEOUT_EXPR); + function parseKeepAliveTimeout(val2) { + const m = val2.toString().match(KEEPALIVE_TIMEOUT_EXPR); return m ? parseInt(m[1], 10) * 1e3 : null; } function headerNameToString(value) { @@ -1409,19 +1408,19 @@ var require_util = __commonJS({ if (!Array.isArray(headers)) return headers; for (let i = 0; i < headers.length; i += 2) { const key = headers[i].toString().toLowerCase(); - let val = obj[key]; - if (!val) { + let val2 = obj[key]; + if (!val2) { if (Array.isArray(headers[i + 1])) { obj[key] = headers[i + 1].map((x) => x.toString("utf8")); } else { obj[key] = headers[i + 1].toString("utf8"); } } else { - if (!Array.isArray(val)) { - val = [val]; - obj[key] = val; + if (!Array.isArray(val2)) { + val2 = [val2]; + obj[key] = val2; } - val.push(headers[i + 1].toString("utf8")); + val2.push(headers[i + 1].toString("utf8")); } } if ("content-length" in obj && "content-disposition" in obj) { @@ -1435,14 +1434,14 @@ var require_util = __commonJS({ let contentDispositionIdx = -1; for (let n = 0; n < headers.length; n += 2) { const key = headers[n + 0].toString(); - const val = headers[n + 1].toString("utf8"); + const val2 = headers[n + 1].toString("utf8"); if (key.length === 14 && (key === "content-length" || key.toLowerCase() === "content-length")) { - ret.push(key, val); + ret.push(key, val2); hasContentLength = true; } else if (key.length === 19 && (key === "content-disposition" || key.toLowerCase() === "content-disposition")) { - contentDispositionIdx = ret.push(key, val) - 1; + contentDispositionIdx = ret.push(key, val2) - 1; } else { - ret.push(key, val); + ret.push(key, val2); } } if (hasContentLength && contentDispositionIdx !== -1) { @@ -1571,13 +1570,13 @@ var require_util = __commonJS({ return () => signal.removeListener("abort", listener); } var hasToWellFormed = !!String.prototype.toWellFormed; - function toUSVString(val) { + function toUSVString(val2) { if (hasToWellFormed) { - return `${val}`.toWellFormed(); + return `${val2}`.toWellFormed(); } else if (nodeUtil.toUSVString) { - return nodeUtil.toUSVString(val); + return nodeUtil.toUSVString(val2); } - return `${val}`; + return `${val2}`; } function parseRangeHeader(range) { if (range == null || range === "") return { start: 0, end: null, size: null }; @@ -3947,11 +3946,11 @@ var require_util2 = __commonJS({ var assert = require("assert"); var { isUint8Array } = require("util/types"); var supportedHashes = []; - var crypto4; + var crypto8; try { - crypto4 = require("crypto"); + crypto8 = require("crypto"); const possibleRelevantHashes = ["sha256", "sha384", "sha512"]; - supportedHashes = crypto4.getHashes().filter((hash) => possibleRelevantHashes.includes(hash)); + supportedHashes = crypto8.getHashes().filter((hash) => possibleRelevantHashes.includes(hash)); } catch { } function responseURL(response) { @@ -4214,7 +4213,7 @@ var require_util2 = __commonJS({ } } function bytesMatch(bytes, metadataList) { - if (crypto4 === void 0) { + if (crypto8 === void 0) { return true; } const parsedMetadata = parseMetadata(metadataList); @@ -4229,7 +4228,7 @@ var require_util2 = __commonJS({ for (const item of metadata) { const algorithm = item.algo; const expectedValue = item.hash; - let actualValue = crypto4.createHash(algorithm).update(bytes).digest("base64"); + let actualValue = crypto8.createHash(algorithm).update(bytes).digest("base64"); if (actualValue[actualValue.length - 1] === "=") { if (actualValue[actualValue.length - 2] === "=") { actualValue = actualValue.slice(0, -2); @@ -5950,7 +5949,7 @@ var require_request = __commonJS({ channels.trailers = { hasSubscribers: false }; channels.error = { hasSubscribers: false }; } - var Request = class _Request { + var Request2 = class _Request { constructor(origin, { path, method, @@ -6221,41 +6220,41 @@ var require_request = __commonJS({ return headers; } }; - function processHeaderValue(key, val, skipAppend) { - if (val && typeof val === "object") { + function processHeaderValue(key, val2, skipAppend) { + if (val2 && typeof val2 === "object") { throw new InvalidArgumentError(`invalid ${key} header`); } - val = val != null ? `${val}` : ""; - if (headerCharRegex.exec(val) !== null) { + val2 = val2 != null ? `${val2}` : ""; + if (headerCharRegex.exec(val2) !== null) { throw new InvalidArgumentError(`invalid ${key} header`); } - return skipAppend ? val : `${key}: ${val}\r + return skipAppend ? val2 : `${key}: ${val2}\r `; } - function processHeader(request2, key, val, skipAppend = false) { - if (val && (typeof val === "object" && !Array.isArray(val))) { + function processHeader(request2, key, val2, skipAppend = false) { + if (val2 && (typeof val2 === "object" && !Array.isArray(val2))) { throw new InvalidArgumentError(`invalid ${key} header`); - } else if (val === void 0) { + } else if (val2 === void 0) { return; } if (request2.host === null && key.length === 4 && key.toLowerCase() === "host") { - if (headerCharRegex.exec(val) !== null) { + if (headerCharRegex.exec(val2) !== null) { throw new InvalidArgumentError(`invalid ${key} header`); } - request2.host = val; + request2.host = val2; } else if (request2.contentLength === null && key.length === 14 && key.toLowerCase() === "content-length") { - request2.contentLength = parseInt(val, 10); + request2.contentLength = parseInt(val2, 10); if (!Number.isFinite(request2.contentLength)) { throw new InvalidArgumentError("invalid content-length header"); } } else if (request2.contentType === null && key.length === 12 && key.toLowerCase() === "content-type") { - request2.contentType = val; - if (skipAppend) request2.headers[key] = processHeaderValue(key, val, skipAppend); - else request2.headers += processHeaderValue(key, val); + request2.contentType = val2; + if (skipAppend) request2.headers[key] = processHeaderValue(key, val2, skipAppend); + else request2.headers += processHeaderValue(key, val2); } else if (key.length === 17 && key.toLowerCase() === "transfer-encoding") { throw new InvalidArgumentError("invalid transfer-encoding header"); } else if (key.length === 10 && key.toLowerCase() === "connection") { - const value = typeof val === "string" ? val.toLowerCase() : null; + const value = typeof val2 === "string" ? val2.toLowerCase() : null; if (value !== "close" && value !== "keep-alive") { throw new InvalidArgumentError("invalid connection header"); } else if (value === "close") { @@ -6270,22 +6269,22 @@ var require_request = __commonJS({ } else if (tokenRegExp.exec(key) === null) { throw new InvalidArgumentError("invalid header key"); } else { - if (Array.isArray(val)) { - for (let i = 0; i < val.length; i++) { + if (Array.isArray(val2)) { + for (let i = 0; i < val2.length; i++) { if (skipAppend) { - if (request2.headers[key]) request2.headers[key] += `,${processHeaderValue(key, val[i], skipAppend)}`; - else request2.headers[key] = processHeaderValue(key, val[i], skipAppend); + if (request2.headers[key]) request2.headers[key] += `,${processHeaderValue(key, val2[i], skipAppend)}`; + else request2.headers[key] = processHeaderValue(key, val2[i], skipAppend); } else { - request2.headers += processHeaderValue(key, val[i]); + request2.headers += processHeaderValue(key, val2[i]); } } } else { - if (skipAppend) request2.headers[key] = processHeaderValue(key, val, skipAppend); - else request2.headers += processHeaderValue(key, val); + if (skipAppend) request2.headers[key] = processHeaderValue(key, val2, skipAppend); + else request2.headers += processHeaderValue(key, val2); } } } - module2.exports = Request; + module2.exports = Request2; } }); @@ -6683,12 +6682,12 @@ var require_constants3 = __commonJS({ ERROR2[ERROR2["PAUSED_H2_UPGRADE"] = 23] = "PAUSED_H2_UPGRADE"; ERROR2[ERROR2["USER"] = 24] = "USER"; })(ERROR = exports2.ERROR || (exports2.ERROR = {})); - var TYPE2; - (function(TYPE3) { - TYPE3[TYPE3["BOTH"] = 0] = "BOTH"; - TYPE3[TYPE3["REQUEST"] = 1] = "REQUEST"; - TYPE3[TYPE3["RESPONSE"] = 2] = "RESPONSE"; - })(TYPE2 = exports2.TYPE || (exports2.TYPE = {})); + var TYPE; + (function(TYPE2) { + TYPE2[TYPE2["BOTH"] = 0] = "BOTH"; + TYPE2[TYPE2["REQUEST"] = 1] = "REQUEST"; + TYPE2[TYPE2["RESPONSE"] = 2] = "RESPONSE"; + })(TYPE = exports2.TYPE || (exports2.TYPE = {})); var FLAGS; (function(FLAGS2) { FLAGS2[FLAGS2["CONNECTION_KEEP_ALIVE"] = 1] = "CONNECTION_KEEP_ALIVE"; @@ -7165,7 +7164,7 @@ var require_client = __commonJS({ var { pipeline } = require("stream"); var util = require_util(); var timers = require_timers(); - var Request = require_request(); + var Request2 = require_request(); var DispatcherBase = require_dispatcher_base(); var { RequestContentLengthMismatchError, @@ -7445,7 +7444,7 @@ var require_client = __commonJS({ } [kDispatch](opts, handler) { const origin = opts.origin || this[kUrl].origin; - const request2 = this[kHTTPConnVersion] === "h2" ? Request[kHTTP2BuildRequest](origin, opts, handler) : Request[kHTTP1BuildRequest](origin, opts, handler); + const request2 = this[kHTTPConnVersion] === "h2" ? Request2[kHTTP2BuildRequest](origin, opts, handler) : Request2[kHTTP1BuildRequest](origin, opts, handler); this[kQueue].push(request2); if (this[kResuming]) { } else if (util.bodyLength(request2.body) == null && util.isIterable(request2.body)) { @@ -8398,7 +8397,7 @@ upgrade: ${upgrade}\r function writeH2(client, session, request2) { const { body, method, path, host, upgrade, expectContinue, signal, headers: reqHeaders } = request2; let headers; - if (typeof reqHeaders === "string") headers = Request[kHTTP2CopyHeaders](reqHeaders.trim()); + if (typeof reqHeaders === "string") headers = Request2[kHTTP2CopyHeaders](reqHeaders.trim()); else headers = reqHeaders; if (upgrade) { errorRequest(client, request2, new Error("Upgrade not supported for H2")); @@ -10701,10 +10700,10 @@ var require_mock_utils = __commonJS({ } function getMockDispatch(mockDispatches, key) { const basePath = key.query ? buildURL(key.path, key.query) : key.path; - const resolvedPath = typeof basePath === "string" ? safeUrl(basePath) : basePath; - let matchedMockDispatches = mockDispatches.filter(({ consumed }) => !consumed).filter(({ path }) => matchValue(safeUrl(path), resolvedPath)); + const resolvedPath2 = typeof basePath === "string" ? safeUrl(basePath) : basePath; + let matchedMockDispatches = mockDispatches.filter(({ consumed }) => !consumed).filter(({ path }) => matchValue(safeUrl(path), resolvedPath2)); if (matchedMockDispatches.length === 0) { - throw new MockNotMatchedError(`Mock dispatch not matched for path '${resolvedPath}'`); + throw new MockNotMatchedError(`Mock dispatch not matched for path '${resolvedPath2}'`); } matchedMockDispatches = matchedMockDispatches.filter(({ method }) => matchValue(method, key.method)); if (matchedMockDispatches.length === 0) { @@ -11351,7 +11350,7 @@ var require_proxy_agent = __commonJS({ "node_modules/@actions/http-client/node_modules/undici/lib/proxy-agent.js"(exports2, module2) { "use strict"; var { kProxy, kClose, kDestroy, kInterceptors } = require_symbols(); - var { URL: URL3 } = require("url"); + var { URL: URL4 } = require("url"); var Agent = require_agent(); var Pool = require_pool(); var DispatcherBase = require_dispatcher_base(); @@ -11400,7 +11399,7 @@ var require_proxy_agent = __commonJS({ this[kRequestTls] = opts.requestTls; this[kProxyTls] = opts.proxyTls; this[kProxyHeaders] = opts.headers || {}; - const resolvedUrl = new URL3(opts.uri); + const resolvedUrl = new URL4(opts.uri); const { origin, port, host, username, password } = resolvedUrl; if (opts.auth && opts.token) { throw new InvalidArgumentError("opts.auth cannot be used in combination with opts.token"); @@ -11455,7 +11454,7 @@ var require_proxy_agent = __commonJS({ }); } dispatch(opts, handler) { - const { host } = new URL3(opts.origin); + const { host } = new URL4(opts.origin); const headers = buildHeaders(opts.headers); throwIfProxyAuthIsSent(headers); return this[kAgent].dispatch( @@ -11981,7 +11980,7 @@ var require_headers = __commonJS({ return headers; } }; - var Headers = class _Headers { + var Headers2 = class _Headers { constructor(init = void 0) { if (init === kConstruct) { return; @@ -12176,8 +12175,8 @@ var require_headers = __commonJS({ return this[kHeadersList]; } }; - Headers.prototype[Symbol.iterator] = Headers.prototype.entries; - Object.defineProperties(Headers.prototype, { + Headers2.prototype[Symbol.iterator] = Headers2.prototype.entries; + Object.defineProperties(Headers2.prototype, { append: kEnumerableProperty, delete: kEnumerableProperty, get: kEnumerableProperty, @@ -12209,7 +12208,7 @@ var require_headers = __commonJS({ }; module2.exports = { fill, - Headers, + Headers: Headers2, HeadersList }; } @@ -12219,7 +12218,7 @@ var require_headers = __commonJS({ var require_response = __commonJS({ "node_modules/@actions/http-client/node_modules/undici/lib/fetch/response.js"(exports2, module2) { "use strict"; - var { Headers, HeadersList, fill } = require_headers(); + var { Headers: Headers2, HeadersList, fill } = require_headers(); var { extractBody, cloneBody, mixinBody } = require_body(); var util = require_util(); var { kEnumerableProperty } = util; @@ -12311,7 +12310,7 @@ var require_response = __commonJS({ init = webidl.converters.ResponseInit(init); this[kRealm] = { settingsObject: {} }; this[kState] = makeResponse({}); - this[kHeaders] = new Headers(kConstruct); + this[kHeaders] = new Headers2(kConstruct); this[kHeaders][kGuard] = "response"; this[kHeaders][kHeadersList] = this[kState].headersList; this[kHeaders][kRealm] = this[kRealm]; @@ -12599,7 +12598,7 @@ var require_request2 = __commonJS({ "node_modules/@actions/http-client/node_modules/undici/lib/fetch/request.js"(exports2, module2) { "use strict"; var { extractBody, mixinBody, cloneBody } = require_body(); - var { Headers, fill: fillHeaders, HeadersList } = require_headers(); + var { Headers: Headers2, fill: fillHeaders, HeadersList } = require_headers(); var { FinalizationRegistry: FinalizationRegistry2 } = require_dispatcher_weakref()(); var util = require_util(); var { @@ -12632,7 +12631,7 @@ var require_request2 = __commonJS({ var requestFinalizer = new FinalizationRegistry2(({ signal, abort }) => { signal.removeEventListener("abort", abort); }); - var Request = class _Request { + var Request2 = class _Request { // https://fetch.spec.whatwg.org/#dom-request constructor(input, init = {}) { if (input === kConstruct) { @@ -12674,15 +12673,15 @@ var require_request2 = __commonJS({ signal = input[kSignal]; } const origin = this[kRealm].settingsObject.origin; - let window = "client"; + let window2 = "client"; if (request2.window?.constructor?.name === "EnvironmentSettingsObject" && sameOrigin(request2.window, origin)) { - window = request2.window; + window2 = request2.window; } if (init.window != null) { - throw new TypeError(`'window' option '${window}' must be null`); + throw new TypeError(`'window' option '${window2}' must be null`); } if ("window" in init) { - window = "no-window"; + window2 = "no-window"; } request2 = makeRequest({ // URL request’s URL. @@ -12697,7 +12696,7 @@ var require_request2 = __commonJS({ // client This’s relevant settings object. client: this[kRealm].settingsObject, // window window. - window, + window: window2, // priority request’s priority. priority: request2.priority, // origin request’s origin. The propagation of the origin is only significant for navigation requests @@ -12843,7 +12842,7 @@ var require_request2 = __commonJS({ requestFinalizer.register(ac, { signal, abort }); } } - this[kHeaders] = new Headers(kConstruct); + this[kHeaders] = new Headers2(kConstruct); this[kHeaders][kHeadersList] = request2.headersList; this[kHeaders][kGuard] = "request"; this[kHeaders][kRealm] = this[kRealm]; @@ -12860,8 +12859,8 @@ var require_request2 = __commonJS({ const headers = init.headers !== void 0 ? init.headers : new HeadersList(headersList); headersList.clear(); if (headers instanceof HeadersList) { - for (const [key, val] of headers) { - headersList.append(key, val); + for (const [key, val2] of headers) { + headersList.append(key, val2); } headersList.cookies = headers.cookies; } else { @@ -13042,7 +13041,7 @@ var require_request2 = __commonJS({ const clonedRequestObject = new _Request(kConstruct); clonedRequestObject[kState] = clonedRequest; clonedRequestObject[kRealm] = this[kRealm]; - clonedRequestObject[kHeaders] = new Headers(kConstruct); + clonedRequestObject[kHeaders] = new Headers2(kConstruct); clonedRequestObject[kHeaders][kHeadersList] = clonedRequest.headersList; clonedRequestObject[kHeaders][kGuard] = this[kHeaders][kGuard]; clonedRequestObject[kHeaders][kRealm] = this[kHeaders][kRealm]; @@ -13061,7 +13060,7 @@ var require_request2 = __commonJS({ return clonedRequestObject; } }; - mixinBody(Request); + mixinBody(Request2); function makeRequest(init) { const request2 = { method: "GET", @@ -13112,7 +13111,7 @@ var require_request2 = __commonJS({ } return newRequest; } - Object.defineProperties(Request.prototype, { + Object.defineProperties(Request2.prototype, { method: kEnumerableProperty, url: kEnumerableProperty, headers: kEnumerableProperty, @@ -13139,13 +13138,13 @@ var require_request2 = __commonJS({ } }); webidl.converters.Request = webidl.interfaceConverter( - Request + Request2 ); webidl.converters.RequestInfo = function(V) { if (typeof V === "string") { return webidl.converters.USVString(V); } - if (V instanceof Request) { + if (V instanceof Request2) { return webidl.converters.Request(V); } return webidl.converters.USVString(V); @@ -13229,7 +13228,7 @@ var require_request2 = __commonJS({ allowedValues: requestDuplex } ]); - module2.exports = { Request, makeRequest }; + module2.exports = { Request: Request2, makeRequest }; } }); @@ -13244,8 +13243,8 @@ var require_fetch = __commonJS({ filterResponse, makeResponse } = require_response(); - var { Headers } = require_headers(); - var { Request, makeRequest } = require_request2(); + var { Headers: Headers2 } = require_headers(); + var { Request: Request2, makeRequest } = require_request2(); var zlib = require("zlib"); var { bytesMatch, @@ -13331,12 +13330,12 @@ var require_fetch = __commonJS({ this.emit("terminated", error); } }; - function fetch(input, init = {}) { + function fetch2(input, init = {}) { webidl.argumentLengthCheck(arguments, 1, { header: "globalThis.fetch" }); const p = createDeferredPromise(); let requestObject; try { - requestObject = new Request(input, init); + requestObject = new Request2(input, init); } catch (e) { p.reject(e); return p.promise; @@ -14157,28 +14156,28 @@ var require_fetch = __commonJS({ } let codings = []; let location = ""; - const headers = new Headers(); + const headers = new Headers2(); if (Array.isArray(headersList)) { for (let n = 0; n < headersList.length; n += 2) { const key = headersList[n + 0].toString("latin1"); - const val = headersList[n + 1].toString("latin1"); + const val2 = headersList[n + 1].toString("latin1"); if (key.toLowerCase() === "content-encoding") { - codings = val.toLowerCase().split(",").map((x) => x.trim()); + codings = val2.toLowerCase().split(",").map((x) => x.trim()); } else if (key.toLowerCase() === "location") { - location = val; + location = val2; } - headers[kHeadersList].append(key, val); + headers[kHeadersList].append(key, val2); } } else { const keys = Object.keys(headersList); for (const key of keys) { - const val = headersList[key]; + const val2 = headersList[key]; if (key.toLowerCase() === "content-encoding") { - codings = val.toLowerCase().split(",").map((x) => x.trim()).reverse(); + codings = val2.toLowerCase().split(",").map((x) => x.trim()).reverse(); } else if (key.toLowerCase() === "location") { - location = val; + location = val2; } - headers[kHeadersList].append(key, val); + headers[kHeadersList].append(key, val2); } } this.body = new Readable({ read: resume }); @@ -14242,11 +14241,11 @@ var require_fetch = __commonJS({ if (status !== 101) { return; } - const headers = new Headers(); + const headers = new Headers2(); for (let n = 0; n < headersList.length; n += 2) { const key = headersList[n + 0].toString("latin1"); - const val = headersList[n + 1].toString("latin1"); - headers[kHeadersList].append(key, val); + const val2 = headersList[n + 1].toString("latin1"); + headers[kHeadersList].append(key, val2); } resolve({ status, @@ -14261,7 +14260,7 @@ var require_fetch = __commonJS({ } } module2.exports = { - fetch, + fetch: fetch2, Fetch, fetching, finalizeAndReportTiming @@ -14655,7 +14654,7 @@ var require_util4 = __commonJS({ var { serializeAMimeType, parseMIMEType } = require_dataURL(); var { types } = require("util"); var { StringDecoder } = require("string_decoder"); - var { btoa: btoa2 } = require("buffer"); + var { btoa } = require("buffer"); var staticPropertyDescriptors = { enumerable: true, writable: false, @@ -14747,9 +14746,9 @@ var require_util4 = __commonJS({ dataURL += ";base64,"; const decoder = new StringDecoder("latin1"); for (const chunk of bytes) { - dataURL += btoa2(decoder.write(chunk)); + dataURL += btoa(decoder.write(chunk)); } - dataURL += btoa2(decoder.end()); + dataURL += btoa(decoder.end()); return dataURL; } case "Text": { @@ -14842,7 +14841,7 @@ var require_filereader = __commonJS({ } = require_symbols3(); var { webidl } = require_webidl(); var { kEnumerableProperty } = require_util(); - var FileReader = class _FileReader extends EventTarget { + var FileReader2 = class _FileReader extends EventTarget { constructor() { super(); this[kState] = "empty"; @@ -15044,10 +15043,10 @@ var require_filereader = __commonJS({ } } }; - FileReader.EMPTY = FileReader.prototype.EMPTY = 0; - FileReader.LOADING = FileReader.prototype.LOADING = 1; - FileReader.DONE = FileReader.prototype.DONE = 2; - Object.defineProperties(FileReader.prototype, { + FileReader2.EMPTY = FileReader2.prototype.EMPTY = 0; + FileReader2.LOADING = FileReader2.prototype.LOADING = 1; + FileReader2.DONE = FileReader2.prototype.DONE = 2; + Object.defineProperties(FileReader2.prototype, { EMPTY: staticPropertyDescriptors, LOADING: staticPropertyDescriptors, DONE: staticPropertyDescriptors, @@ -15072,13 +15071,13 @@ var require_filereader = __commonJS({ configurable: true } }); - Object.defineProperties(FileReader, { + Object.defineProperties(FileReader2, { EMPTY: staticPropertyDescriptors, LOADING: staticPropertyDescriptors, DONE: staticPropertyDescriptors }); module2.exports = { - FileReader + FileReader: FileReader2 }; } }); @@ -15136,7 +15135,7 @@ var require_cache = __commonJS({ var { kHeadersList } = require_symbols(); var { webidl } = require_webidl(); var { Response, cloneResponse } = require_response(); - var { Request } = require_request2(); + var { Request: Request2 } = require_request2(); var { kState, kHeaders, kGuard, kRealm } = require_symbols2(); var { fetching } = require_fetch(); var { urlIsHttpHttpsScheme, createDeferredPromise, readAllBytes } = require_util2(); @@ -15171,13 +15170,13 @@ var require_cache = __commonJS({ options = webidl.converters.CacheQueryOptions(options); let r = null; if (request2 !== void 0) { - if (request2 instanceof Request) { + if (request2 instanceof Request2) { r = request2[kState]; if (r.method !== "GET" && !options.ignoreMethod) { return []; } } else if (typeof request2 === "string") { - r = new Request(request2)[kState]; + r = new Request2(request2)[kState]; } } const responses = []; @@ -15231,7 +15230,7 @@ var require_cache = __commonJS({ } const fetchControllers = []; for (const request2 of requests) { - const r = new Request(request2)[kState]; + const r = new Request2(request2)[kState]; if (!urlIsHttpHttpsScheme(r.url)) { throw webidl.errors.exception({ header: "Cache.addAll", @@ -15315,10 +15314,10 @@ var require_cache = __commonJS({ request2 = webidl.converters.RequestInfo(request2); response = webidl.converters.Response(response); let innerRequest = null; - if (request2 instanceof Request) { + if (request2 instanceof Request2) { innerRequest = request2[kState]; } else { - innerRequest = new Request(request2)[kState]; + innerRequest = new Request2(request2)[kState]; } if (!urlIsHttpHttpsScheme(innerRequest.url) || innerRequest.method !== "GET") { throw webidl.errors.exception({ @@ -15395,14 +15394,14 @@ var require_cache = __commonJS({ request2 = webidl.converters.RequestInfo(request2); options = webidl.converters.CacheQueryOptions(options); let r = null; - if (request2 instanceof Request) { + if (request2 instanceof Request2) { r = request2[kState]; if (r.method !== "GET" && !options.ignoreMethod) { return false; } } else { assert(typeof request2 === "string"); - r = new Request(request2)[kState]; + r = new Request2(request2)[kState]; } const operations = []; const operation = { @@ -15440,13 +15439,13 @@ var require_cache = __commonJS({ options = webidl.converters.CacheQueryOptions(options); let r = null; if (request2 !== void 0) { - if (request2 instanceof Request) { + if (request2 instanceof Request2) { r = request2[kState]; if (r.method !== "GET" && !options.ignoreMethod) { return []; } } else if (typeof request2 === "string") { - r = new Request(request2)[kState]; + r = new Request2(request2)[kState]; } } const promise = createDeferredPromise(); @@ -15464,7 +15463,7 @@ var require_cache = __commonJS({ queueMicrotask(() => { const requestList = []; for (const request3 of requests) { - const requestObject = new Request("https://a"); + const requestObject = new Request2("https://a"); requestObject[kState] = request3; requestObject[kHeaders][kHeadersList] = request3.headersList; requestObject[kHeaders][kGuard] = "immutable"; @@ -15865,7 +15864,7 @@ var require_util6 = __commonJS({ throw new Error("Invalid cookie max-age"); } } - function stringify2(cookie) { + function stringify3(cookie) { if (cookie.name.length === 0) { return null; } @@ -15930,7 +15929,7 @@ var require_util6 = __commonJS({ } module2.exports = { isCTLExcludingHtab, - stringify: stringify2, + stringify: stringify3, getHeadersList }; } @@ -16081,12 +16080,12 @@ var require_cookies = __commonJS({ "node_modules/@actions/http-client/node_modules/undici/lib/cookies/index.js"(exports2, module2) { "use strict"; var { parseSetCookie } = require_parse(); - var { stringify: stringify2, getHeadersList } = require_util6(); + var { stringify: stringify3, getHeadersList } = require_util6(); var { webidl } = require_webidl(); - var { Headers } = require_headers(); + var { Headers: Headers2 } = require_headers(); function getCookies(headers) { webidl.argumentLengthCheck(arguments, 1, { header: "getCookies" }); - webidl.brandCheck(headers, Headers, { strict: false }); + webidl.brandCheck(headers, Headers2, { strict: false }); const cookie = headers.get("cookie"); const out = {}; if (!cookie) { @@ -16100,7 +16099,7 @@ var require_cookies = __commonJS({ } function deleteCookie(headers, name, attributes) { webidl.argumentLengthCheck(arguments, 2, { header: "deleteCookie" }); - webidl.brandCheck(headers, Headers, { strict: false }); + webidl.brandCheck(headers, Headers2, { strict: false }); name = webidl.converters.DOMString(name); attributes = webidl.converters.DeleteCookieAttributes(attributes); setCookie(headers, { @@ -16112,7 +16111,7 @@ var require_cookies = __commonJS({ } function getSetCookies(headers) { webidl.argumentLengthCheck(arguments, 1, { header: "getSetCookies" }); - webidl.brandCheck(headers, Headers, { strict: false }); + webidl.brandCheck(headers, Headers2, { strict: false }); const cookies = getHeadersList(headers).cookies; if (!cookies) { return []; @@ -16121,11 +16120,11 @@ var require_cookies = __commonJS({ } function setCookie(headers, cookie) { webidl.argumentLengthCheck(arguments, 2, { header: "setCookie" }); - webidl.brandCheck(headers, Headers, { strict: false }); + webidl.brandCheck(headers, Headers2, { strict: false }); cookie = webidl.converters.Cookie(cookie); - const str = stringify2(cookie); + const str = stringify3(cookie); if (str) { - headers.append("Set-Cookie", stringify2(cookie)); + headers.append("Set-Cookie", stringify3(cookie)); } } webidl.converters.DeleteCookieAttributes = webidl.dictionaryConverter([ @@ -16614,16 +16613,16 @@ var require_connection = __commonJS({ var { CloseEvent } = require_events(); var { makeRequest } = require_request2(); var { fetching } = require_fetch(); - var { Headers } = require_headers(); + var { Headers: Headers2 } = require_headers(); var { getGlobalDispatcher } = require_global2(); var { kHeadersList } = require_symbols(); var channels = {}; channels.open = diagnosticsChannel.channel("undici:websocket:open"); channels.close = diagnosticsChannel.channel("undici:websocket:close"); channels.socketError = diagnosticsChannel.channel("undici:websocket:socket_error"); - var crypto4; + var crypto8; try { - crypto4 = require("crypto"); + crypto8 = require("crypto"); } catch { } function establishWebSocketConnection(url, protocols, ws, onEstablish, options) { @@ -16639,10 +16638,10 @@ var require_connection = __commonJS({ redirect: "error" }); if (options.headers) { - const headersList = new Headers(options.headers)[kHeadersList]; + const headersList = new Headers2(options.headers)[kHeadersList]; request2.headersList = headersList; } - const keyValue = crypto4.randomBytes(16).toString("base64"); + const keyValue = crypto8.randomBytes(16).toString("base64"); request2.headersList.append("sec-websocket-key", keyValue); request2.headersList.append("sec-websocket-version", "13"); for (const protocol of protocols) { @@ -16671,7 +16670,7 @@ var require_connection = __commonJS({ return; } const secWSAccept = response.headersList.get("Sec-WebSocket-Accept"); - const digest = crypto4.createHash("sha1").update(keyValue + uid).digest("base64"); + const digest = crypto8.createHash("sha1").update(keyValue + uid).digest("base64"); if (secWSAccept !== digest) { failWebsocketConnection(ws, "Incorrect hash received in Sec-WebSocket-Accept header."); return; @@ -16751,9 +16750,9 @@ var require_frame = __commonJS({ "node_modules/@actions/http-client/node_modules/undici/lib/websocket/frame.js"(exports2, module2) { "use strict"; var { maxUnsigned16Bit } = require_constants5(); - var crypto4; + var crypto8; try { - crypto4 = require("crypto"); + crypto8 = require("crypto"); } catch { } var WebsocketFrameSend = class { @@ -16762,7 +16761,7 @@ var require_frame = __commonJS({ */ constructor(data) { this.frameData = data; - this.maskKey = crypto4.randomBytes(4); + this.maskKey = crypto8.randomBytes(4); } createFrame(opcode) { const bodyLength = this.frameData?.byteLength ?? 0; @@ -17531,7 +17530,7 @@ var require_undici = __commonJS({ module2.exports.getGlobalDispatcher = getGlobalDispatcher; if (util.nodeMajor > 16 || util.nodeMajor === 16 && util.nodeMinor >= 8) { let fetchImpl = null; - module2.exports.fetch = async function fetch(resource) { + module2.exports.fetch = async function fetch2(resource) { if (!fetchImpl) { fetchImpl = require_fetch().fetch; } @@ -17587,7 +17586,7 @@ var require_undici = __commonJS({ var require_lib = __commonJS({ "node_modules/@actions/http-client/lib/index.js"(exports2) { "use strict"; - var __createBinding = exports2 && exports2.__createBinding || (Object.create ? function(o, m, k, k2) { + var __createBinding2 = exports2 && exports2.__createBinding || (Object.create ? function(o, m, k, k2) { if (k2 === void 0) k2 = k; var desc = Object.getOwnPropertyDescriptor(m, k); if (!desc || ("get" in desc ? !m.__esModule : desc.writable || desc.configurable)) { @@ -17600,21 +17599,21 @@ var require_lib = __commonJS({ if (k2 === void 0) k2 = k; o[k2] = m[k]; }); - var __setModuleDefault = exports2 && exports2.__setModuleDefault || (Object.create ? function(o, v) { + var __setModuleDefault2 = exports2 && exports2.__setModuleDefault || (Object.create ? function(o, v) { Object.defineProperty(o, "default", { enumerable: true, value: v }); } : function(o, v) { o["default"] = v; }); - var __importStar = exports2 && exports2.__importStar || function(mod) { + var __importStar2 = exports2 && exports2.__importStar || function(mod) { if (mod && mod.__esModule) return mod; var result = {}; if (mod != null) { - for (var k in mod) if (k !== "default" && Object.prototype.hasOwnProperty.call(mod, k)) __createBinding(result, mod, k); + for (var k in mod) if (k !== "default" && Object.prototype.hasOwnProperty.call(mod, k)) __createBinding2(result, mod, k); } - __setModuleDefault(result, mod); + __setModuleDefault2(result, mod); return result; }; - var __awaiter = exports2 && exports2.__awaiter || function(thisArg, _arguments, P, generator) { + var __awaiter2 = exports2 && exports2.__awaiter || function(thisArg, _arguments, P, generator) { function adopt(value) { return value instanceof P ? value : new P(function(resolve) { resolve(value); @@ -17643,10 +17642,10 @@ var require_lib = __commonJS({ }; Object.defineProperty(exports2, "__esModule", { value: true }); exports2.HttpClient = exports2.isHttps = exports2.HttpClientResponse = exports2.HttpClientError = exports2.getProxyUrl = exports2.MediaTypes = exports2.Headers = exports2.HttpCodes = void 0; - var http = __importStar(require("http")); - var https = __importStar(require("https")); - var pm = __importStar(require_proxy()); - var tunnel = __importStar(require_tunnel2()); + var http = __importStar2(require("http")); + var https = __importStar2(require("https")); + var pm = __importStar2(require_proxy()); + var tunnel = __importStar2(require_tunnel2()); var undici_1 = require_undici(); var HttpCodes; (function(HttpCodes2) { @@ -17678,11 +17677,11 @@ var require_lib = __commonJS({ HttpCodes2[HttpCodes2["ServiceUnavailable"] = 503] = "ServiceUnavailable"; HttpCodes2[HttpCodes2["GatewayTimeout"] = 504] = "GatewayTimeout"; })(HttpCodes || (exports2.HttpCodes = HttpCodes = {})); - var Headers; - (function(Headers2) { - Headers2["Accept"] = "accept"; - Headers2["ContentType"] = "content-type"; - })(Headers || (exports2.Headers = Headers = {})); + var Headers2; + (function(Headers3) { + Headers3["Accept"] = "accept"; + Headers3["ContentType"] = "content-type"; + })(Headers2 || (exports2.Headers = Headers2 = {})); var MediaTypes; (function(MediaTypes2) { MediaTypes2["ApplicationJson"] = "application/json"; @@ -17721,8 +17720,8 @@ var require_lib = __commonJS({ this.message = message; } readBody() { - return __awaiter(this, void 0, void 0, function* () { - return new Promise((resolve) => __awaiter(this, void 0, void 0, function* () { + return __awaiter2(this, void 0, void 0, function* () { + return new Promise((resolve) => __awaiter2(this, void 0, void 0, function* () { let output = Buffer.alloc(0); this.message.on("data", (chunk) => { output = Buffer.concat([output, chunk]); @@ -17734,8 +17733,8 @@ var require_lib = __commonJS({ }); } readBodyBuffer() { - return __awaiter(this, void 0, void 0, function* () { - return new Promise((resolve) => __awaiter(this, void 0, void 0, function* () { + return __awaiter2(this, void 0, void 0, function* () { + return new Promise((resolve) => __awaiter2(this, void 0, void 0, function* () { const chunks = []; this.message.on("data", (chunk) => { chunks.push(chunk); @@ -17792,42 +17791,42 @@ var require_lib = __commonJS({ } } options(requestUrl, additionalHeaders) { - return __awaiter(this, void 0, void 0, function* () { + return __awaiter2(this, void 0, void 0, function* () { return this.request("OPTIONS", requestUrl, null, additionalHeaders || {}); }); } get(requestUrl, additionalHeaders) { - return __awaiter(this, void 0, void 0, function* () { + return __awaiter2(this, void 0, void 0, function* () { return this.request("GET", requestUrl, null, additionalHeaders || {}); }); } del(requestUrl, additionalHeaders) { - return __awaiter(this, void 0, void 0, function* () { + return __awaiter2(this, void 0, void 0, function* () { return this.request("DELETE", requestUrl, null, additionalHeaders || {}); }); } post(requestUrl, data, additionalHeaders) { - return __awaiter(this, void 0, void 0, function* () { + return __awaiter2(this, void 0, void 0, function* () { return this.request("POST", requestUrl, data, additionalHeaders || {}); }); } patch(requestUrl, data, additionalHeaders) { - return __awaiter(this, void 0, void 0, function* () { + return __awaiter2(this, void 0, void 0, function* () { return this.request("PATCH", requestUrl, data, additionalHeaders || {}); }); } put(requestUrl, data, additionalHeaders) { - return __awaiter(this, void 0, void 0, function* () { + return __awaiter2(this, void 0, void 0, function* () { return this.request("PUT", requestUrl, data, additionalHeaders || {}); }); } head(requestUrl, additionalHeaders) { - return __awaiter(this, void 0, void 0, function* () { + return __awaiter2(this, void 0, void 0, function* () { return this.request("HEAD", requestUrl, null, additionalHeaders || {}); }); } sendStream(verb, requestUrl, stream, additionalHeaders) { - return __awaiter(this, void 0, void 0, function* () { + return __awaiter2(this, void 0, void 0, function* () { return this.request(verb, requestUrl, stream, additionalHeaders); }); } @@ -17836,35 +17835,35 @@ var require_lib = __commonJS({ * Be aware that not found returns a null. Other errors (4xx, 5xx) reject the promise */ getJson(requestUrl, additionalHeaders = {}) { - return __awaiter(this, void 0, void 0, function* () { - additionalHeaders[Headers.Accept] = this._getExistingOrDefaultHeader(additionalHeaders, Headers.Accept, MediaTypes.ApplicationJson); + return __awaiter2(this, void 0, void 0, function* () { + additionalHeaders[Headers2.Accept] = this._getExistingOrDefaultHeader(additionalHeaders, Headers2.Accept, MediaTypes.ApplicationJson); const res = yield this.get(requestUrl, additionalHeaders); return this._processResponse(res, this.requestOptions); }); } postJson(requestUrl, obj, additionalHeaders = {}) { - return __awaiter(this, void 0, void 0, function* () { + return __awaiter2(this, void 0, void 0, function* () { const data = JSON.stringify(obj, null, 2); - additionalHeaders[Headers.Accept] = this._getExistingOrDefaultHeader(additionalHeaders, Headers.Accept, MediaTypes.ApplicationJson); - additionalHeaders[Headers.ContentType] = this._getExistingOrDefaultHeader(additionalHeaders, Headers.ContentType, MediaTypes.ApplicationJson); + additionalHeaders[Headers2.Accept] = this._getExistingOrDefaultHeader(additionalHeaders, Headers2.Accept, MediaTypes.ApplicationJson); + additionalHeaders[Headers2.ContentType] = this._getExistingOrDefaultHeader(additionalHeaders, Headers2.ContentType, MediaTypes.ApplicationJson); const res = yield this.post(requestUrl, data, additionalHeaders); return this._processResponse(res, this.requestOptions); }); } putJson(requestUrl, obj, additionalHeaders = {}) { - return __awaiter(this, void 0, void 0, function* () { + return __awaiter2(this, void 0, void 0, function* () { const data = JSON.stringify(obj, null, 2); - additionalHeaders[Headers.Accept] = this._getExistingOrDefaultHeader(additionalHeaders, Headers.Accept, MediaTypes.ApplicationJson); - additionalHeaders[Headers.ContentType] = this._getExistingOrDefaultHeader(additionalHeaders, Headers.ContentType, MediaTypes.ApplicationJson); + additionalHeaders[Headers2.Accept] = this._getExistingOrDefaultHeader(additionalHeaders, Headers2.Accept, MediaTypes.ApplicationJson); + additionalHeaders[Headers2.ContentType] = this._getExistingOrDefaultHeader(additionalHeaders, Headers2.ContentType, MediaTypes.ApplicationJson); const res = yield this.put(requestUrl, data, additionalHeaders); return this._processResponse(res, this.requestOptions); }); } patchJson(requestUrl, obj, additionalHeaders = {}) { - return __awaiter(this, void 0, void 0, function* () { + return __awaiter2(this, void 0, void 0, function* () { const data = JSON.stringify(obj, null, 2); - additionalHeaders[Headers.Accept] = this._getExistingOrDefaultHeader(additionalHeaders, Headers.Accept, MediaTypes.ApplicationJson); - additionalHeaders[Headers.ContentType] = this._getExistingOrDefaultHeader(additionalHeaders, Headers.ContentType, MediaTypes.ApplicationJson); + additionalHeaders[Headers2.Accept] = this._getExistingOrDefaultHeader(additionalHeaders, Headers2.Accept, MediaTypes.ApplicationJson); + additionalHeaders[Headers2.ContentType] = this._getExistingOrDefaultHeader(additionalHeaders, Headers2.ContentType, MediaTypes.ApplicationJson); const res = yield this.patch(requestUrl, data, additionalHeaders); return this._processResponse(res, this.requestOptions); }); @@ -17875,7 +17874,7 @@ var require_lib = __commonJS({ * Prefer get, del, post and patch */ request(verb, requestUrl, data, headers) { - return __awaiter(this, void 0, void 0, function* () { + return __awaiter2(this, void 0, void 0, function* () { if (this._disposed) { throw new Error("Client has already been disposed."); } @@ -17949,7 +17948,7 @@ var require_lib = __commonJS({ * @param data */ requestRaw(info, data) { - return __awaiter(this, void 0, void 0, function* () { + return __awaiter2(this, void 0, void 0, function* () { return new Promise((resolve, reject) => { function callbackForResult(err, res) { if (err) { @@ -18136,15 +18135,15 @@ var require_lib = __commonJS({ return proxyAgent; } _performExponentialBackoff(retryNumber) { - return __awaiter(this, void 0, void 0, function* () { + return __awaiter2(this, void 0, void 0, function* () { retryNumber = Math.min(ExponentialBackoffCeiling, retryNumber); const ms = ExponentialBackoffTimeSlice * Math.pow(2, retryNumber); return new Promise((resolve) => setTimeout(() => resolve(), ms)); }); } _processResponse(res, options) { - return __awaiter(this, void 0, void 0, function* () { - return new Promise((resolve, reject) => __awaiter(this, void 0, void 0, function* () { + return __awaiter2(this, void 0, void 0, function* () { + return new Promise((resolve, reject) => __awaiter2(this, void 0, void 0, function* () { const statusCode = res.message.statusCode || 0; const response = { statusCode, @@ -18206,7 +18205,7 @@ var require_lib = __commonJS({ var require_auth = __commonJS({ "node_modules/@actions/http-client/lib/auth.js"(exports2) { "use strict"; - var __awaiter = exports2 && exports2.__awaiter || function(thisArg, _arguments, P, generator) { + var __awaiter2 = exports2 && exports2.__awaiter || function(thisArg, _arguments, P, generator) { function adopt(value) { return value instanceof P ? value : new P(function(resolve) { resolve(value); @@ -18251,7 +18250,7 @@ var require_auth = __commonJS({ return false; } handleAuthentication() { - return __awaiter(this, void 0, void 0, function* () { + return __awaiter2(this, void 0, void 0, function* () { throw new Error("not implemented"); }); } @@ -18274,7 +18273,7 @@ var require_auth = __commonJS({ return false; } handleAuthentication() { - return __awaiter(this, void 0, void 0, function* () { + return __awaiter2(this, void 0, void 0, function* () { throw new Error("not implemented"); }); } @@ -18297,7 +18296,7 @@ var require_auth = __commonJS({ return false; } handleAuthentication() { - return __awaiter(this, void 0, void 0, function* () { + return __awaiter2(this, void 0, void 0, function* () { throw new Error("not implemented"); }); } @@ -18310,7 +18309,7 @@ var require_auth = __commonJS({ var require_oidc_utils = __commonJS({ "node_modules/@actions/core/lib/oidc-utils.js"(exports2) { "use strict"; - var __awaiter = exports2 && exports2.__awaiter || function(thisArg, _arguments, P, generator) { + var __awaiter2 = exports2 && exports2.__awaiter || function(thisArg, _arguments, P, generator) { function adopt(value) { return value instanceof P ? value : new P(function(resolve) { resolve(value); @@ -18366,7 +18365,7 @@ var require_oidc_utils = __commonJS({ } static getCall(id_token_url) { var _a; - return __awaiter(this, void 0, void 0, function* () { + return __awaiter2(this, void 0, void 0, function* () { const httpclient = _OidcClient.createHttpClient(); const res = yield httpclient.getJson(id_token_url).catch((error) => { throw new Error(`Failed to get ID Token. @@ -18383,7 +18382,7 @@ var require_oidc_utils = __commonJS({ }); } static getIDToken(audience) { - return __awaiter(this, void 0, void 0, function* () { + return __awaiter2(this, void 0, void 0, function* () { try { let id_token_url = _OidcClient.getIDTokenUrl(); if (audience) { @@ -18408,7 +18407,7 @@ var require_oidc_utils = __commonJS({ var require_summary = __commonJS({ "node_modules/@actions/core/lib/summary.js"(exports2) { "use strict"; - var __awaiter = exports2 && exports2.__awaiter || function(thisArg, _arguments, P, generator) { + var __awaiter2 = exports2 && exports2.__awaiter || function(thisArg, _arguments, P, generator) { function adopt(value) { return value instanceof P ? value : new P(function(resolve) { resolve(value); @@ -18453,7 +18452,7 @@ var require_summary = __commonJS({ * @returns step summary file path */ filePath() { - return __awaiter(this, void 0, void 0, function* () { + return __awaiter2(this, void 0, void 0, function* () { if (this._filePath) { return this._filePath; } @@ -18494,7 +18493,7 @@ var require_summary = __commonJS({ * @returns {Promise} summary instance */ write(options) { - return __awaiter(this, void 0, void 0, function* () { + return __awaiter2(this, void 0, void 0, function* () { const overwrite = !!(options === null || options === void 0 ? void 0 : options.overwrite); const filePath = yield this.filePath(); const writeFunc = overwrite ? writeFile : appendFile; @@ -18508,7 +18507,7 @@ var require_summary = __commonJS({ * @returns {Summary} summary instance */ clear() { - return __awaiter(this, void 0, void 0, function* () { + return __awaiter2(this, void 0, void 0, function* () { return this.emptyBuffer().write({ overwrite: true }); }); } @@ -18702,7 +18701,7 @@ var require_summary = __commonJS({ var require_path_utils = __commonJS({ "node_modules/@actions/core/lib/path-utils.js"(exports2) { "use strict"; - var __createBinding = exports2 && exports2.__createBinding || (Object.create ? function(o, m, k, k2) { + var __createBinding2 = exports2 && exports2.__createBinding || (Object.create ? function(o, m, k, k2) { if (k2 === void 0) k2 = k; Object.defineProperty(o, k2, { enumerable: true, get: function() { return m[k]; @@ -18711,23 +18710,23 @@ var require_path_utils = __commonJS({ if (k2 === void 0) k2 = k; o[k2] = m[k]; }); - var __setModuleDefault = exports2 && exports2.__setModuleDefault || (Object.create ? function(o, v) { + var __setModuleDefault2 = exports2 && exports2.__setModuleDefault || (Object.create ? function(o, v) { Object.defineProperty(o, "default", { enumerable: true, value: v }); } : function(o, v) { o["default"] = v; }); - var __importStar = exports2 && exports2.__importStar || function(mod) { + var __importStar2 = exports2 && exports2.__importStar || function(mod) { if (mod && mod.__esModule) return mod; var result = {}; if (mod != null) { - for (var k in mod) if (k !== "default" && Object.hasOwnProperty.call(mod, k)) __createBinding(result, mod, k); + for (var k in mod) if (k !== "default" && Object.hasOwnProperty.call(mod, k)) __createBinding2(result, mod, k); } - __setModuleDefault(result, mod); + __setModuleDefault2(result, mod); return result; }; Object.defineProperty(exports2, "__esModule", { value: true }); exports2.toPlatformPath = exports2.toWin32Path = exports2.toPosixPath = void 0; - var path = __importStar(require("path")); + var path = __importStar2(require("path")); function toPosixPath(pth) { return pth.replace(/[\\]/g, "/"); } @@ -18747,7 +18746,7 @@ var require_path_utils = __commonJS({ var require_core = __commonJS({ "node_modules/@actions/core/lib/core.js"(exports2) { "use strict"; - var __createBinding = exports2 && exports2.__createBinding || (Object.create ? function(o, m, k, k2) { + var __createBinding2 = exports2 && exports2.__createBinding || (Object.create ? function(o, m, k, k2) { if (k2 === void 0) k2 = k; Object.defineProperty(o, k2, { enumerable: true, get: function() { return m[k]; @@ -18756,21 +18755,21 @@ var require_core = __commonJS({ if (k2 === void 0) k2 = k; o[k2] = m[k]; }); - var __setModuleDefault = exports2 && exports2.__setModuleDefault || (Object.create ? function(o, v) { + var __setModuleDefault2 = exports2 && exports2.__setModuleDefault || (Object.create ? function(o, v) { Object.defineProperty(o, "default", { enumerable: true, value: v }); } : function(o, v) { o["default"] = v; }); - var __importStar = exports2 && exports2.__importStar || function(mod) { + var __importStar2 = exports2 && exports2.__importStar || function(mod) { if (mod && mod.__esModule) return mod; var result = {}; if (mod != null) { - for (var k in mod) if (k !== "default" && Object.hasOwnProperty.call(mod, k)) __createBinding(result, mod, k); + for (var k in mod) if (k !== "default" && Object.hasOwnProperty.call(mod, k)) __createBinding2(result, mod, k); } - __setModuleDefault(result, mod); + __setModuleDefault2(result, mod); return result; }; - var __awaiter = exports2 && exports2.__awaiter || function(thisArg, _arguments, P, generator) { + var __awaiter2 = exports2 && exports2.__awaiter || function(thisArg, _arguments, P, generator) { function adopt(value) { return value instanceof P ? value : new P(function(resolve) { resolve(value); @@ -18802,20 +18801,20 @@ var require_core = __commonJS({ var command_1 = require_command(); var file_command_1 = require_file_command(); var utils_1 = require_utils(); - var os = __importStar(require("os")); - var path = __importStar(require("path")); + var os = __importStar2(require("os")); + var path = __importStar2(require("path")); var oidc_utils_1 = require_oidc_utils(); var ExitCode; (function(ExitCode2) { ExitCode2[ExitCode2["Success"] = 0] = "Success"; ExitCode2[ExitCode2["Failure"] = 1] = "Failure"; })(ExitCode = exports2.ExitCode || (exports2.ExitCode = {})); - function exportVariable(name, val) { - const convertedVal = utils_1.toCommandValue(val); + function exportVariable(name, val2) { + const convertedVal = utils_1.toCommandValue(val2); process.env[name] = convertedVal; const filePath = process.env["GITHUB_ENV"] || ""; if (filePath) { - return file_command_1.issueFileCommand("ENV", file_command_1.prepareKeyValueMessage(name, val)); + return file_command_1.issueFileCommand("ENV", file_command_1.prepareKeyValueMessage(name, val2)); } command_1.issueCommand("set-env", { name }, convertedVal); } @@ -18835,14 +18834,14 @@ var require_core = __commonJS({ } exports2.addPath = addPath; function getInput(name, options) { - const val = process.env[`INPUT_${name.replace(/ /g, "_").toUpperCase()}`] || ""; - if (options && options.required && !val) { + const val2 = process.env[`INPUT_${name.replace(/ /g, "_").toUpperCase()}`] || ""; + if (options && options.required && !val2) { throw new Error(`Input required and not supplied: ${name}`); } if (options && options.trimWhitespace === false) { - return val; + return val2; } - return val.trim(); + return val2.trim(); } exports2.getInput = getInput; function getMultilineInput(name, options) { @@ -18856,10 +18855,10 @@ var require_core = __commonJS({ function getBooleanInput(name, options) { const trueValue = ["true", "True", "TRUE"]; const falseValue = ["false", "False", "FALSE"]; - const val = getInput(name, options); - if (trueValue.includes(val)) + const val2 = getInput(name, options); + if (trueValue.includes(val2)) return true; - if (falseValue.includes(val)) + if (falseValue.includes(val2)) return false; throw new TypeError(`Input does not meet YAML 1.2 "Core Schema" specification: ${name} Support boolean input list: \`true | True | TRUE | false | False | FALSE\``); @@ -18916,7 +18915,7 @@ Support boolean input list: \`true | True | TRUE | false | False | FALSE\``); } exports2.endGroup = endGroup; function group(name, fn) { - return __awaiter(this, void 0, void 0, function* () { + return __awaiter2(this, void 0, void 0, function* () { startGroup(name); let result; try { @@ -18941,7 +18940,7 @@ Support boolean input list: \`true | True | TRUE | false | False | FALSE\``); } exports2.getState = getState; function getIDToken(aud) { - return __awaiter(this, void 0, void 0, function* () { + return __awaiter2(this, void 0, void 0, function* () { return yield oidc_utils_1.OidcClient.getIDToken(aud); }); } @@ -19195,8877 +19194,30125 @@ var require_retry2 = __commonJS({ } }); -// node_modules/undici/lib/core/symbols.js -var require_symbols6 = __commonJS({ - "node_modules/undici/lib/core/symbols.js"(exports2, module2) { - module2.exports = { - kClose: Symbol("close"), - kDestroy: Symbol("destroy"), - kDispatch: Symbol("dispatch"), - kUrl: Symbol("url"), - kWriting: Symbol("writing"), - kResuming: Symbol("resuming"), - kQueue: Symbol("queue"), - kConnect: Symbol("connect"), - kConnecting: Symbol("connecting"), - kKeepAliveDefaultTimeout: Symbol("default keep alive timeout"), - kKeepAliveMaxTimeout: Symbol("max keep alive timeout"), - kKeepAliveTimeoutThreshold: Symbol("keep alive timeout threshold"), - kKeepAliveTimeoutValue: Symbol("keep alive timeout"), - kKeepAlive: Symbol("keep alive"), - kHeadersTimeout: Symbol("headers timeout"), - kBodyTimeout: Symbol("body timeout"), - kServerName: Symbol("server name"), - kLocalAddress: Symbol("local address"), - kHost: Symbol("host"), - kNoRef: Symbol("no ref"), - kBodyUsed: Symbol("used"), - kBody: Symbol("abstracted request body"), - kRunning: Symbol("running"), - kBlocking: Symbol("blocking"), - kPending: Symbol("pending"), - kSize: Symbol("size"), - kBusy: Symbol("busy"), - kQueued: Symbol("queued"), - kFree: Symbol("free"), - kConnected: Symbol("connected"), - kClosed: Symbol("closed"), - kNeedDrain: Symbol("need drain"), - kReset: Symbol("reset"), - kDestroyed: Symbol.for("nodejs.stream.destroyed"), - kResume: Symbol("resume"), - kOnError: Symbol("on error"), - kMaxHeadersSize: Symbol("max headers size"), - kRunningIdx: Symbol("running index"), - kPendingIdx: Symbol("pending index"), - kError: Symbol("error"), - kClients: Symbol("clients"), - kClient: Symbol("client"), - kParser: Symbol("parser"), - kOnDestroyed: Symbol("destroy callbacks"), - kPipelining: Symbol("pipelining"), - kSocket: Symbol("socket"), - kHostHeader: Symbol("host header"), - kConnector: Symbol("connector"), - kStrictContentLength: Symbol("strict content length"), - kMaxRedirections: Symbol("maxRedirections"), - kMaxRequests: Symbol("maxRequestsPerClient"), - kProxy: Symbol("proxy agent options"), - kCounter: Symbol("socket request counter"), - kInterceptors: Symbol("dispatch interceptors"), - kMaxResponseSize: Symbol("max response size"), - kHTTP2Session: Symbol("http2Session"), - kHTTP2SessionState: Symbol("http2Session state"), - kRetryHandlerDefaultRetry: Symbol("retry agent default retry"), - kConstruct: Symbol("constructable"), - kListeners: Symbol("listeners"), - kHTTPContext: Symbol("http context"), - kMaxConcurrentStreams: Symbol("max concurrent streams"), - kNoProxyAgent: Symbol("no proxy agent"), - kHttpProxyAgent: Symbol("http proxy agent"), - kHttpsProxyAgent: Symbol("https proxy agent") - }; +// node_modules/@smithy/types/dist-cjs/index.js +var require_dist_cjs = __commonJS({ + "node_modules/@smithy/types/dist-cjs/index.js"(exports2, module2) { + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); + }; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + } + return to; + }; + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + AlgorithmId: () => AlgorithmId, + EndpointURLScheme: () => EndpointURLScheme, + FieldPosition: () => FieldPosition, + HttpApiKeyAuthLocation: () => HttpApiKeyAuthLocation2, + HttpAuthLocation: () => HttpAuthLocation, + IniSectionType: () => IniSectionType, + RequestHandlerProtocol: () => RequestHandlerProtocol, + SMITHY_CONTEXT_KEY: () => SMITHY_CONTEXT_KEY4, + getDefaultClientConfiguration: () => getDefaultClientConfiguration, + resolveDefaultRuntimeConfig: () => resolveDefaultRuntimeConfig + }); + module2.exports = __toCommonJS2(src_exports); + var HttpAuthLocation = /* @__PURE__ */ ((HttpAuthLocation2) => { + HttpAuthLocation2["HEADER"] = "header"; + HttpAuthLocation2["QUERY"] = "query"; + return HttpAuthLocation2; + })(HttpAuthLocation || {}); + var HttpApiKeyAuthLocation2 = /* @__PURE__ */ ((HttpApiKeyAuthLocation22) => { + HttpApiKeyAuthLocation22["HEADER"] = "header"; + HttpApiKeyAuthLocation22["QUERY"] = "query"; + return HttpApiKeyAuthLocation22; + })(HttpApiKeyAuthLocation2 || {}); + var EndpointURLScheme = /* @__PURE__ */ ((EndpointURLScheme2) => { + EndpointURLScheme2["HTTP"] = "http"; + EndpointURLScheme2["HTTPS"] = "https"; + return EndpointURLScheme2; + })(EndpointURLScheme || {}); + var AlgorithmId = /* @__PURE__ */ ((AlgorithmId2) => { + AlgorithmId2["MD5"] = "md5"; + AlgorithmId2["CRC32"] = "crc32"; + AlgorithmId2["CRC32C"] = "crc32c"; + AlgorithmId2["SHA1"] = "sha1"; + AlgorithmId2["SHA256"] = "sha256"; + return AlgorithmId2; + })(AlgorithmId || {}); + var getChecksumConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { + const checksumAlgorithms = []; + if (runtimeConfig.sha256 !== void 0) { + checksumAlgorithms.push({ + algorithmId: () => "sha256", + checksumConstructor: () => runtimeConfig.sha256 + }); + } + if (runtimeConfig.md5 != void 0) { + checksumAlgorithms.push({ + algorithmId: () => "md5", + checksumConstructor: () => runtimeConfig.md5 + }); + } + return { + _checksumAlgorithms: checksumAlgorithms, + addChecksumAlgorithm(algo) { + this._checksumAlgorithms.push(algo); + }, + checksumAlgorithms() { + return this._checksumAlgorithms; + } + }; + }, "getChecksumConfiguration"); + var resolveChecksumRuntimeConfig = /* @__PURE__ */ __name((clientConfig) => { + const runtimeConfig = {}; + clientConfig.checksumAlgorithms().forEach((checksumAlgorithm) => { + runtimeConfig[checksumAlgorithm.algorithmId()] = checksumAlgorithm.checksumConstructor(); + }); + return runtimeConfig; + }, "resolveChecksumRuntimeConfig"); + var getDefaultClientConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { + return { + ...getChecksumConfiguration(runtimeConfig) + }; + }, "getDefaultClientConfiguration"); + var resolveDefaultRuntimeConfig = /* @__PURE__ */ __name((config) => { + return { + ...resolveChecksumRuntimeConfig(config) + }; + }, "resolveDefaultRuntimeConfig"); + var FieldPosition = /* @__PURE__ */ ((FieldPosition2) => { + FieldPosition2[FieldPosition2["HEADER"] = 0] = "HEADER"; + FieldPosition2[FieldPosition2["TRAILER"] = 1] = "TRAILER"; + return FieldPosition2; + })(FieldPosition || {}); + var SMITHY_CONTEXT_KEY4 = "__smithy_context"; + var IniSectionType = /* @__PURE__ */ ((IniSectionType2) => { + IniSectionType2["PROFILE"] = "profile"; + IniSectionType2["SSO_SESSION"] = "sso-session"; + IniSectionType2["SERVICES"] = "services"; + return IniSectionType2; + })(IniSectionType || {}); + var RequestHandlerProtocol = /* @__PURE__ */ ((RequestHandlerProtocol2) => { + RequestHandlerProtocol2["HTTP_0_9"] = "http/0.9"; + RequestHandlerProtocol2["HTTP_1_0"] = "http/1.0"; + RequestHandlerProtocol2["TDS_8_0"] = "tds/8.0"; + return RequestHandlerProtocol2; + })(RequestHandlerProtocol || {}); } }); -// node_modules/undici/lib/core/errors.js -var require_errors2 = __commonJS({ - "node_modules/undici/lib/core/errors.js"(exports2, module2) { - "use strict"; - var UndiciError = class extends Error { - constructor(message) { - super(message); - this.name = "UndiciError"; - this.code = "UND_ERR"; +// node_modules/@smithy/protocol-http/dist-cjs/index.js +var require_dist_cjs2 = __commonJS({ + "node_modules/@smithy/protocol-http/dist-cjs/index.js"(exports2, module2) { + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); + }; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + } + return to; + }; + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + Field: () => Field, + Fields: () => Fields, + HttpRequest: () => HttpRequest7, + HttpResponse: () => HttpResponse2, + IHttpRequest: () => import_types5.HttpRequest, + getHttpHandlerExtensionConfiguration: () => getHttpHandlerExtensionConfiguration, + isValidHostname: () => isValidHostname, + resolveHttpHandlerRuntimeConfig: () => resolveHttpHandlerRuntimeConfig + }); + module2.exports = __toCommonJS2(src_exports); + var getHttpHandlerExtensionConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { + let httpHandler = runtimeConfig.httpHandler; + return { + setHttpHandler(handler) { + httpHandler = handler; + }, + httpHandler() { + return httpHandler; + }, + updateHttpClientConfig(key, value) { + httpHandler.updateHttpClientConfig(key, value); + }, + httpHandlerConfigs() { + return httpHandler.httpHandlerConfigs(); + } + }; + }, "getHttpHandlerExtensionConfiguration"); + var resolveHttpHandlerRuntimeConfig = /* @__PURE__ */ __name((httpHandlerExtensionConfiguration) => { + return { + httpHandler: httpHandlerExtensionConfiguration.httpHandler() + }; + }, "resolveHttpHandlerRuntimeConfig"); + var import_types5 = require_dist_cjs(); + var _Field = class _Field { + constructor({ name, kind = import_types5.FieldPosition.HEADER, values = [] }) { + this.name = name; + this.kind = kind; + this.values = values; } - }; - var ConnectTimeoutError = class extends UndiciError { - constructor(message) { - super(message); - this.name = "ConnectTimeoutError"; - this.message = message || "Connect Timeout Error"; - this.code = "UND_ERR_CONNECT_TIMEOUT"; + /** + * Appends a value to the field. + * + * @param value The value to append. + */ + add(value) { + this.values.push(value); } - }; - var HeadersTimeoutError = class extends UndiciError { - constructor(message) { - super(message); - this.name = "HeadersTimeoutError"; - this.message = message || "Headers Timeout Error"; - this.code = "UND_ERR_HEADERS_TIMEOUT"; + /** + * Overwrite existing field values. + * + * @param values The new field values. + */ + set(values) { + this.values = values; } - }; - var HeadersOverflowError = class extends UndiciError { - constructor(message) { - super(message); - this.name = "HeadersOverflowError"; - this.message = message || "Headers Overflow Error"; - this.code = "UND_ERR_HEADERS_OVERFLOW"; + /** + * Remove all matching entries from list. + * + * @param value Value to remove. + */ + remove(value) { + this.values = this.values.filter((v) => v !== value); } - }; - var BodyTimeoutError = class extends UndiciError { - constructor(message) { - super(message); - this.name = "BodyTimeoutError"; - this.message = message || "Body Timeout Error"; - this.code = "UND_ERR_BODY_TIMEOUT"; + /** + * Get comma-delimited string. + * + * @returns String representation of {@link Field}. + */ + toString() { + return this.values.map((v) => v.includes(",") || v.includes(" ") ? `"${v}"` : v).join(", "); } - }; - var ResponseStatusCodeError = class extends UndiciError { - constructor(message, statusCode, headers, body) { - super(message); - this.name = "ResponseStatusCodeError"; - this.message = message || "Response Status Code Error"; - this.code = "UND_ERR_RESPONSE_STATUS_CODE"; - this.body = body; - this.status = statusCode; - this.statusCode = statusCode; - this.headers = headers; + /** + * Get string values as a list + * + * @returns Values in {@link Field} as a list. + */ + get() { + return this.values; } }; - var InvalidArgumentError = class extends UndiciError { - constructor(message) { - super(message); - this.name = "InvalidArgumentError"; - this.message = message || "Invalid Argument Error"; - this.code = "UND_ERR_INVALID_ARG"; + __name(_Field, "Field"); + var Field = _Field; + var _Fields = class _Fields { + constructor({ fields = [], encoding = "utf-8" }) { + this.entries = {}; + fields.forEach(this.setField.bind(this)); + this.encoding = encoding; } - }; - var InvalidReturnValueError = class extends UndiciError { - constructor(message) { - super(message); - this.name = "InvalidReturnValueError"; - this.message = message || "Invalid Return Value Error"; - this.code = "UND_ERR_INVALID_RETURN_VALUE"; + /** + * Set entry for a {@link Field} name. The `name` + * attribute will be used to key the collection. + * + * @param field The {@link Field} to set. + */ + setField(field) { + this.entries[field.name.toLowerCase()] = field; } - }; - var AbortError2 = class extends UndiciError { - constructor(message) { - super(message); - this.name = "AbortError"; - this.message = message || "The operation was aborted"; + /** + * Retrieve {@link Field} entry by name. + * + * @param name The name of the {@link Field} entry + * to retrieve + * @returns The {@link Field} if it exists. + */ + getField(name) { + return this.entries[name.toLowerCase()]; } - }; - var RequestAbortedError = class extends AbortError2 { - constructor(message) { - super(message); - this.name = "AbortError"; - this.message = message || "Request aborted"; - this.code = "UND_ERR_ABORTED"; + /** + * Delete entry from collection. + * + * @param name Name of the entry to delete. + */ + removeField(name) { + delete this.entries[name.toLowerCase()]; } - }; - var InformationalError = class extends UndiciError { - constructor(message) { - super(message); - this.name = "InformationalError"; - this.message = message || "Request information"; - this.code = "UND_ERR_INFO"; + /** + * Helper function for retrieving specific types of fields. + * Used to grab all headers or all trailers. + * + * @param kind {@link FieldPosition} of entries to retrieve. + * @returns The {@link Field} entries with the specified + * {@link FieldPosition}. + */ + getByType(kind) { + return Object.values(this.entries).filter((field) => field.kind === kind); + } + }; + __name(_Fields, "Fields"); + var Fields = _Fields; + var _HttpRequest = class _HttpRequest2 { + constructor(options) { + this.method = options.method || "GET"; + this.hostname = options.hostname || "localhost"; + this.port = options.port; + this.query = options.query || {}; + this.headers = options.headers || {}; + this.body = options.body; + this.protocol = options.protocol ? options.protocol.slice(-1) !== ":" ? `${options.protocol}:` : options.protocol : "https:"; + this.path = options.path ? options.path.charAt(0) !== "/" ? `/${options.path}` : options.path : "/"; + this.username = options.username; + this.password = options.password; + this.fragment = options.fragment; } - }; - var RequestContentLengthMismatchError = class extends UndiciError { - constructor(message) { - super(message); - this.name = "RequestContentLengthMismatchError"; - this.message = message || "Request body length does not match content-length header"; - this.code = "UND_ERR_REQ_CONTENT_LENGTH_MISMATCH"; + /** + * Note: this does not deep-clone the body. + */ + static clone(request2) { + const cloned = new _HttpRequest2({ + ...request2, + headers: { ...request2.headers } + }); + if (cloned.query) { + cloned.query = cloneQuery(cloned.query); + } + return cloned; } - }; - var ResponseContentLengthMismatchError = class extends UndiciError { - constructor(message) { - super(message); - this.name = "ResponseContentLengthMismatchError"; - this.message = message || "Response body length does not match content-length header"; - this.code = "UND_ERR_RES_CONTENT_LENGTH_MISMATCH"; + /** + * This method only actually asserts that request is the interface {@link IHttpRequest}, + * and not necessarily this concrete class. Left in place for API stability. + * + * Do not call instance methods on the input of this function, and + * do not assume it has the HttpRequest prototype. + */ + static isInstance(request2) { + if (!request2) { + return false; + } + const req = request2; + return "method" in req && "protocol" in req && "hostname" in req && "path" in req && typeof req["query"] === "object" && typeof req["headers"] === "object"; } - }; - var ClientDestroyedError = class extends UndiciError { - constructor(message) { - super(message); - this.name = "ClientDestroyedError"; - this.message = message || "The client is destroyed"; - this.code = "UND_ERR_DESTROYED"; + /** + * @deprecated use static HttpRequest.clone(request) instead. It's not safe to call + * this method because {@link HttpRequest.isInstance} incorrectly + * asserts that IHttpRequest (interface) objects are of type HttpRequest (class). + */ + clone() { + return _HttpRequest2.clone(this); } }; - var ClientClosedError = class extends UndiciError { - constructor(message) { - super(message); - this.name = "ClientClosedError"; - this.message = message || "The client is closed"; - this.code = "UND_ERR_CLOSED"; + __name(_HttpRequest, "HttpRequest"); + var HttpRequest7 = _HttpRequest; + function cloneQuery(query) { + return Object.keys(query).reduce((carry, paramName) => { + const param = query[paramName]; + return { + ...carry, + [paramName]: Array.isArray(param) ? [...param] : param + }; + }, {}); + } + __name(cloneQuery, "cloneQuery"); + var _HttpResponse = class _HttpResponse { + constructor(options) { + this.statusCode = options.statusCode; + this.reason = options.reason; + this.headers = options.headers || {}; + this.body = options.body; + } + static isInstance(response) { + if (!response) + return false; + const resp = response; + return typeof resp.statusCode === "number" && typeof resp.headers === "object"; } }; - var SocketError = class extends UndiciError { - constructor(message, socket) { - super(message); - this.name = "SocketError"; - this.message = message || "Socket error"; - this.code = "UND_ERR_SOCKET"; - this.socket = socket; + __name(_HttpResponse, "HttpResponse"); + var HttpResponse2 = _HttpResponse; + function isValidHostname(hostname) { + const hostPattern = /^[a-z0-9][a-z0-9\.\-]*[a-z0-9]$/; + return hostPattern.test(hostname); + } + __name(isValidHostname, "isValidHostname"); + } +}); + +// node_modules/@aws-sdk/middleware-host-header/dist-cjs/index.js +var require_dist_cjs3 = __commonJS({ + "node_modules/@aws-sdk/middleware-host-header/dist-cjs/index.js"(exports2, module2) { + "use strict"; + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); + }; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + } + return to; + }; + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + getHostHeaderPlugin: () => getHostHeaderPlugin, + hostHeaderMiddleware: () => hostHeaderMiddleware, + hostHeaderMiddlewareOptions: () => hostHeaderMiddlewareOptions, + resolveHostHeaderConfig: () => resolveHostHeaderConfig + }); + module2.exports = __toCommonJS2(src_exports); + var import_protocol_http8 = require_dist_cjs2(); + function resolveHostHeaderConfig(input) { + return input; + } + __name(resolveHostHeaderConfig, "resolveHostHeaderConfig"); + var hostHeaderMiddleware = /* @__PURE__ */ __name((options) => (next) => async (args) => { + if (!import_protocol_http8.HttpRequest.isInstance(args.request)) + return next(args); + const { request: request2 } = args; + const { handlerProtocol = "" } = options.requestHandler.metadata || {}; + if (handlerProtocol.indexOf("h2") >= 0 && !request2.headers[":authority"]) { + delete request2.headers["host"]; + request2.headers[":authority"] = request2.hostname + (request2.port ? ":" + request2.port : ""); + } else if (!request2.headers["host"]) { + let host = request2.hostname; + if (request2.port != null) + host += `:${request2.port}`; + request2.headers["host"] = host; + } + return next(args); + }, "hostHeaderMiddleware"); + var hostHeaderMiddlewareOptions = { + name: "hostHeaderMiddleware", + step: "build", + priority: "low", + tags: ["HOST"], + override: true + }; + var getHostHeaderPlugin = /* @__PURE__ */ __name((options) => ({ + applyToStack: (clientStack) => { + clientStack.add(hostHeaderMiddleware(options), hostHeaderMiddlewareOptions); + } + }), "getHostHeaderPlugin"); + } +}); + +// node_modules/@aws-sdk/middleware-logger/dist-cjs/index.js +var require_dist_cjs4 = __commonJS({ + "node_modules/@aws-sdk/middleware-logger/dist-cjs/index.js"(exports2, module2) { + "use strict"; + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); + }; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + } + return to; + }; + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + getLoggerPlugin: () => getLoggerPlugin, + loggerMiddleware: () => loggerMiddleware, + loggerMiddlewareOptions: () => loggerMiddlewareOptions + }); + module2.exports = __toCommonJS2(src_exports); + var loggerMiddleware = /* @__PURE__ */ __name(() => (next, context) => async (args) => { + var _a, _b; + try { + const response = await next(args); + const { clientName, commandName, logger, dynamoDbDocumentClientOptions = {} } = context; + const { overrideInputFilterSensitiveLog, overrideOutputFilterSensitiveLog } = dynamoDbDocumentClientOptions; + const inputFilterSensitiveLog = overrideInputFilterSensitiveLog ?? context.inputFilterSensitiveLog; + const outputFilterSensitiveLog = overrideOutputFilterSensitiveLog ?? context.outputFilterSensitiveLog; + const { $metadata, ...outputWithoutMetadata } = response.output; + (_a = logger == null ? void 0 : logger.info) == null ? void 0 : _a.call(logger, { + clientName, + commandName, + input: inputFilterSensitiveLog(args.input), + output: outputFilterSensitiveLog(outputWithoutMetadata), + metadata: $metadata + }); + return response; + } catch (error) { + const { clientName, commandName, logger, dynamoDbDocumentClientOptions = {} } = context; + const { overrideInputFilterSensitiveLog } = dynamoDbDocumentClientOptions; + const inputFilterSensitiveLog = overrideInputFilterSensitiveLog ?? context.inputFilterSensitiveLog; + (_b = logger == null ? void 0 : logger.error) == null ? void 0 : _b.call(logger, { + clientName, + commandName, + input: inputFilterSensitiveLog(args.input), + error, + metadata: error.$metadata + }); + throw error; } + }, "loggerMiddleware"); + var loggerMiddlewareOptions = { + name: "loggerMiddleware", + tags: ["LOGGER"], + step: "initialize", + override: true }; - var NotSupportedError = class extends UndiciError { - constructor(message) { - super(message); - this.name = "NotSupportedError"; - this.message = message || "Not supported error"; - this.code = "UND_ERR_NOT_SUPPORTED"; + var getLoggerPlugin = /* @__PURE__ */ __name((options) => ({ + applyToStack: (clientStack) => { + clientStack.add(loggerMiddleware(), loggerMiddlewareOptions); } + }), "getLoggerPlugin"); + } +}); + +// node_modules/@aws-sdk/middleware-recursion-detection/dist-cjs/index.js +var require_dist_cjs5 = __commonJS({ + "node_modules/@aws-sdk/middleware-recursion-detection/dist-cjs/index.js"(exports2, module2) { + "use strict"; + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); + }; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + } + return to; + }; + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + addRecursionDetectionMiddlewareOptions: () => addRecursionDetectionMiddlewareOptions, + getRecursionDetectionPlugin: () => getRecursionDetectionPlugin, + recursionDetectionMiddleware: () => recursionDetectionMiddleware + }); + module2.exports = __toCommonJS2(src_exports); + var import_protocol_http8 = require_dist_cjs2(); + var TRACE_ID_HEADER_NAME = "X-Amzn-Trace-Id"; + var ENV_LAMBDA_FUNCTION_NAME = "AWS_LAMBDA_FUNCTION_NAME"; + var ENV_TRACE_ID = "_X_AMZN_TRACE_ID"; + var recursionDetectionMiddleware = /* @__PURE__ */ __name((options) => (next) => async (args) => { + const { request: request2 } = args; + if (!import_protocol_http8.HttpRequest.isInstance(request2) || options.runtime !== "node" || request2.headers.hasOwnProperty(TRACE_ID_HEADER_NAME)) { + return next(args); + } + const functionName = process.env[ENV_LAMBDA_FUNCTION_NAME]; + const traceId = process.env[ENV_TRACE_ID]; + const nonEmptyString = /* @__PURE__ */ __name((str) => typeof str === "string" && str.length > 0, "nonEmptyString"); + if (nonEmptyString(functionName) && nonEmptyString(traceId)) { + request2.headers[TRACE_ID_HEADER_NAME] = traceId; + } + return next({ + ...args, + request: request2 + }); + }, "recursionDetectionMiddleware"); + var addRecursionDetectionMiddlewareOptions = { + step: "build", + tags: ["RECURSION_DETECTION"], + name: "recursionDetectionMiddleware", + override: true, + priority: "low" }; - var BalancedPoolMissingUpstreamError = class extends UndiciError { - constructor(message) { - super(message); - this.name = "MissingUpstreamError"; - this.message = message || "No upstream has been added to the BalancedPool"; - this.code = "UND_ERR_BPL_MISSING_UPSTREAM"; + var getRecursionDetectionPlugin = /* @__PURE__ */ __name((options) => ({ + applyToStack: (clientStack) => { + clientStack.add(recursionDetectionMiddleware(options), addRecursionDetectionMiddlewareOptions); } - }; - var HTTPParserError = class extends Error { - constructor(message, code, data) { - super(message); - this.name = "HTTPParserError"; - this.code = code ? `HPE_${code}` : void 0; - this.data = data ? data.toString() : void 0; + }), "getRecursionDetectionPlugin"); + } +}); + +// node_modules/@smithy/util-endpoints/dist-cjs/index.js +var require_dist_cjs6 = __commonJS({ + "node_modules/@smithy/util-endpoints/dist-cjs/index.js"(exports2, module2) { + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); + }; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + } + return to; + }; + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + EndpointError: () => EndpointError2, + customEndpointFunctions: () => customEndpointFunctions, + isIpAddress: () => isIpAddress2, + isValidHostLabel: () => isValidHostLabel, + resolveEndpoint: () => resolveEndpoint2 + }); + module2.exports = __toCommonJS2(src_exports); + var IP_V4_REGEX = new RegExp( + `^(?:25[0-5]|2[0-4]\\d|1\\d\\d|[1-9]\\d|\\d)(?:\\.(?:25[0-5]|2[0-4]\\d|1\\d\\d|[1-9]\\d|\\d)){3}$` + ); + var isIpAddress2 = /* @__PURE__ */ __name((value) => IP_V4_REGEX.test(value) || value.startsWith("[") && value.endsWith("]"), "isIpAddress"); + var VALID_HOST_LABEL_REGEX = new RegExp(`^(?!.*-$)(?!-)[a-zA-Z0-9-]{1,63}$`); + var isValidHostLabel = /* @__PURE__ */ __name((value, allowSubDomains = false) => { + if (!allowSubDomains) { + return VALID_HOST_LABEL_REGEX.test(value); + } + const labels = value.split("."); + for (const label of labels) { + if (!isValidHostLabel(label)) { + return false; + } } - }; - var ResponseExceededMaxSizeError = class extends UndiciError { + return true; + }, "isValidHostLabel"); + var customEndpointFunctions = {}; + var debugId = "endpoints"; + function toDebugString(input) { + if (typeof input !== "object" || input == null) { + return input; + } + if ("ref" in input) { + return `$${toDebugString(input.ref)}`; + } + if ("fn" in input) { + return `${input.fn}(${(input.argv || []).map(toDebugString).join(", ")})`; + } + return JSON.stringify(input, null, 2); + } + __name(toDebugString, "toDebugString"); + var _EndpointError = class _EndpointError extends Error { constructor(message) { super(message); - this.name = "ResponseExceededMaxSizeError"; - this.message = message || "Response content exceeded max size"; - this.code = "UND_ERR_RES_EXCEEDED_MAX_SIZE"; + this.name = "EndpointError"; } }; - var RequestRetryError = class extends UndiciError { - constructor(message, code, { headers, data }) { - super(message); - this.name = "RequestRetryError"; - this.message = message || "Request retry error"; - this.code = "UND_ERR_REQ_RETRY"; - this.statusCode = code; - this.data = data; - this.headers = headers; - } + __name(_EndpointError, "EndpointError"); + var EndpointError2 = _EndpointError; + var booleanEquals = /* @__PURE__ */ __name((value1, value2) => value1 === value2, "booleanEquals"); + var getAttrPathList = /* @__PURE__ */ __name((path) => { + const parts = path.split("."); + const pathList = []; + for (const part of parts) { + const squareBracketIndex = part.indexOf("["); + if (squareBracketIndex !== -1) { + if (part.indexOf("]") !== part.length - 1) { + throw new EndpointError2(`Path: '${path}' does not end with ']'`); + } + const arrayIndex = part.slice(squareBracketIndex + 1, -1); + if (Number.isNaN(parseInt(arrayIndex))) { + throw new EndpointError2(`Invalid array index: '${arrayIndex}' in path: '${path}'`); + } + if (squareBracketIndex !== 0) { + pathList.push(part.slice(0, squareBracketIndex)); + } + pathList.push(arrayIndex); + } else { + pathList.push(part); + } + } + return pathList; + }, "getAttrPathList"); + var getAttr = /* @__PURE__ */ __name((value, path) => getAttrPathList(path).reduce((acc, index) => { + if (typeof acc !== "object") { + throw new EndpointError2(`Index '${index}' in '${path}' not found in '${JSON.stringify(value)}'`); + } else if (Array.isArray(acc)) { + return acc[parseInt(index)]; + } + return acc[index]; + }, value), "getAttr"); + var isSet = /* @__PURE__ */ __name((value) => value != null, "isSet"); + var not = /* @__PURE__ */ __name((value) => !value, "not"); + var import_types32 = require_dist_cjs(); + var DEFAULT_PORTS = { + [import_types32.EndpointURLScheme.HTTP]: 80, + [import_types32.EndpointURLScheme.HTTPS]: 443 }; - var SecureProxyConnectionError = class extends UndiciError { - constructor(cause, message, options) { - super(message, { cause, ...options ?? {} }); - this.name = "SecureProxyConnectionError"; - this.message = message || "Secure Proxy Connection failed"; - this.code = "UND_ERR_PRX_TLS"; - this.cause = cause; + var parseURL = /* @__PURE__ */ __name((value) => { + const whatwgURL = (() => { + try { + if (value instanceof URL) { + return value; + } + if (typeof value === "object" && "hostname" in value) { + const { hostname: hostname2, port, protocol: protocol2 = "", path = "", query = {} } = value; + const url = new URL(`${protocol2}//${hostname2}${port ? `:${port}` : ""}${path}`); + url.search = Object.entries(query).map(([k, v]) => `${k}=${v}`).join("&"); + return url; + } + return new URL(value); + } catch (error) { + return null; + } + })(); + if (!whatwgURL) { + console.error(`Unable to parse ${JSON.stringify(value)} as a whatwg URL.`); + return null; } - }; - module2.exports = { - AbortError: AbortError2, - HTTPParserError, - UndiciError, - HeadersTimeoutError, - HeadersOverflowError, - BodyTimeoutError, - RequestContentLengthMismatchError, - ConnectTimeoutError, - ResponseStatusCodeError, - InvalidArgumentError, - InvalidReturnValueError, - RequestAbortedError, - ClientDestroyedError, - ClientClosedError, - InformationalError, - SocketError, - NotSupportedError, - ResponseContentLengthMismatchError, - BalancedPoolMissingUpstreamError, - ResponseExceededMaxSizeError, - RequestRetryError, - SecureProxyConnectionError - }; + const urlString = whatwgURL.href; + const { host, hostname, pathname, protocol, search } = whatwgURL; + if (search) { + return null; + } + const scheme = protocol.slice(0, -1); + if (!Object.values(import_types32.EndpointURLScheme).includes(scheme)) { + return null; + } + const isIp = isIpAddress2(hostname); + const inputContainsDefaultPort = urlString.includes(`${host}:${DEFAULT_PORTS[scheme]}`) || typeof value === "string" && value.includes(`${host}:${DEFAULT_PORTS[scheme]}`); + const authority = `${host}${inputContainsDefaultPort ? `:${DEFAULT_PORTS[scheme]}` : ``}`; + return { + scheme, + authority, + path: pathname, + normalizedPath: pathname.endsWith("/") ? pathname : `${pathname}/`, + isIp + }; + }, "parseURL"); + var stringEquals = /* @__PURE__ */ __name((value1, value2) => value1 === value2, "stringEquals"); + var substring = /* @__PURE__ */ __name((input, start, stop, reverse) => { + if (start >= stop || input.length < stop) { + return null; + } + if (!reverse) { + return input.substring(start, stop); + } + return input.substring(input.length - stop, input.length - start); + }, "substring"); + var uriEncode = /* @__PURE__ */ __name((value) => encodeURIComponent(value).replace(/[!*'()]/g, (c) => `%${c.charCodeAt(0).toString(16).toUpperCase()}`), "uriEncode"); + var endpointFunctions = { + booleanEquals, + getAttr, + isSet, + isValidHostLabel, + not, + parseURL, + stringEquals, + substring, + uriEncode + }; + var evaluateTemplate = /* @__PURE__ */ __name((template, options) => { + const evaluatedTemplateArr = []; + const templateContext = { + ...options.endpointParams, + ...options.referenceRecord + }; + let currentIndex = 0; + while (currentIndex < template.length) { + const openingBraceIndex = template.indexOf("{", currentIndex); + if (openingBraceIndex === -1) { + evaluatedTemplateArr.push(template.slice(currentIndex)); + break; + } + evaluatedTemplateArr.push(template.slice(currentIndex, openingBraceIndex)); + const closingBraceIndex = template.indexOf("}", openingBraceIndex); + if (closingBraceIndex === -1) { + evaluatedTemplateArr.push(template.slice(openingBraceIndex)); + break; + } + if (template[openingBraceIndex + 1] === "{" && template[closingBraceIndex + 1] === "}") { + evaluatedTemplateArr.push(template.slice(openingBraceIndex + 1, closingBraceIndex)); + currentIndex = closingBraceIndex + 2; + } + const parameterName = template.substring(openingBraceIndex + 1, closingBraceIndex); + if (parameterName.includes("#")) { + const [refName, attrName] = parameterName.split("#"); + evaluatedTemplateArr.push(getAttr(templateContext[refName], attrName)); + } else { + evaluatedTemplateArr.push(templateContext[parameterName]); + } + currentIndex = closingBraceIndex + 1; + } + return evaluatedTemplateArr.join(""); + }, "evaluateTemplate"); + var getReferenceValue = /* @__PURE__ */ __name(({ ref }, options) => { + const referenceRecord = { + ...options.endpointParams, + ...options.referenceRecord + }; + return referenceRecord[ref]; + }, "getReferenceValue"); + var evaluateExpression = /* @__PURE__ */ __name((obj, keyName, options) => { + if (typeof obj === "string") { + return evaluateTemplate(obj, options); + } else if (obj["fn"]) { + return callFunction(obj, options); + } else if (obj["ref"]) { + return getReferenceValue(obj, options); + } + throw new EndpointError2(`'${keyName}': ${String(obj)} is not a string, function or reference.`); + }, "evaluateExpression"); + var callFunction = /* @__PURE__ */ __name(({ fn, argv }, options) => { + const evaluatedArgs = argv.map( + (arg) => ["boolean", "number"].includes(typeof arg) ? arg : evaluateExpression(arg, "arg", options) + ); + const fnSegments = fn.split("."); + if (fnSegments[0] in customEndpointFunctions && fnSegments[1] != null) { + return customEndpointFunctions[fnSegments[0]][fnSegments[1]](...evaluatedArgs); + } + return endpointFunctions[fn](...evaluatedArgs); + }, "callFunction"); + var evaluateCondition = /* @__PURE__ */ __name(({ assign, ...fnArgs }, options) => { + var _a, _b; + if (assign && assign in options.referenceRecord) { + throw new EndpointError2(`'${assign}' is already defined in Reference Record.`); + } + const value = callFunction(fnArgs, options); + (_b = (_a = options.logger) == null ? void 0 : _a.debug) == null ? void 0 : _b.call(_a, `${debugId} evaluateCondition: ${toDebugString(fnArgs)} = ${toDebugString(value)}`); + return { + result: value === "" ? true : !!value, + ...assign != null && { toAssign: { name: assign, value } } + }; + }, "evaluateCondition"); + var evaluateConditions = /* @__PURE__ */ __name((conditions = [], options) => { + var _a, _b; + const conditionsReferenceRecord = {}; + for (const condition of conditions) { + const { result, toAssign } = evaluateCondition(condition, { + ...options, + referenceRecord: { + ...options.referenceRecord, + ...conditionsReferenceRecord + } + }); + if (!result) { + return { result }; + } + if (toAssign) { + conditionsReferenceRecord[toAssign.name] = toAssign.value; + (_b = (_a = options.logger) == null ? void 0 : _a.debug) == null ? void 0 : _b.call(_a, `${debugId} assign: ${toAssign.name} := ${toDebugString(toAssign.value)}`); + } + } + return { result: true, referenceRecord: conditionsReferenceRecord }; + }, "evaluateConditions"); + var getEndpointHeaders = /* @__PURE__ */ __name((headers, options) => Object.entries(headers).reduce( + (acc, [headerKey, headerVal]) => ({ + ...acc, + [headerKey]: headerVal.map((headerValEntry) => { + const processedExpr = evaluateExpression(headerValEntry, "Header value entry", options); + if (typeof processedExpr !== "string") { + throw new EndpointError2(`Header '${headerKey}' value '${processedExpr}' is not a string`); + } + return processedExpr; + }) + }), + {} + ), "getEndpointHeaders"); + var getEndpointProperty = /* @__PURE__ */ __name((property, options) => { + if (Array.isArray(property)) { + return property.map((propertyEntry) => getEndpointProperty(propertyEntry, options)); + } + switch (typeof property) { + case "string": + return evaluateTemplate(property, options); + case "object": + if (property === null) { + throw new EndpointError2(`Unexpected endpoint property: ${property}`); + } + return getEndpointProperties(property, options); + case "boolean": + return property; + default: + throw new EndpointError2(`Unexpected endpoint property type: ${typeof property}`); + } + }, "getEndpointProperty"); + var getEndpointProperties = /* @__PURE__ */ __name((properties, options) => Object.entries(properties).reduce( + (acc, [propertyKey, propertyVal]) => ({ + ...acc, + [propertyKey]: getEndpointProperty(propertyVal, options) + }), + {} + ), "getEndpointProperties"); + var getEndpointUrl = /* @__PURE__ */ __name((endpointUrl, options) => { + const expression = evaluateExpression(endpointUrl, "Endpoint URL", options); + if (typeof expression === "string") { + try { + return new URL(expression); + } catch (error) { + console.error(`Failed to construct URL with ${expression}`, error); + throw error; + } + } + throw new EndpointError2(`Endpoint URL must be a string, got ${typeof expression}`); + }, "getEndpointUrl"); + var evaluateEndpointRule = /* @__PURE__ */ __name((endpointRule, options) => { + var _a, _b; + const { conditions, endpoint: endpoint2 } = endpointRule; + const { result, referenceRecord } = evaluateConditions(conditions, options); + if (!result) { + return; + } + const endpointRuleOptions = { + ...options, + referenceRecord: { ...options.referenceRecord, ...referenceRecord } + }; + const { url, properties, headers } = endpoint2; + (_b = (_a = options.logger) == null ? void 0 : _a.debug) == null ? void 0 : _b.call(_a, `${debugId} Resolving endpoint from template: ${toDebugString(endpoint2)}`); + return { + ...headers != void 0 && { + headers: getEndpointHeaders(headers, endpointRuleOptions) + }, + ...properties != void 0 && { + properties: getEndpointProperties(properties, endpointRuleOptions) + }, + url: getEndpointUrl(url, endpointRuleOptions) + }; + }, "evaluateEndpointRule"); + var evaluateErrorRule = /* @__PURE__ */ __name((errorRule, options) => { + const { conditions, error } = errorRule; + const { result, referenceRecord } = evaluateConditions(conditions, options); + if (!result) { + return; + } + throw new EndpointError2( + evaluateExpression(error, "Error", { + ...options, + referenceRecord: { ...options.referenceRecord, ...referenceRecord } + }) + ); + }, "evaluateErrorRule"); + var evaluateTreeRule = /* @__PURE__ */ __name((treeRule, options) => { + const { conditions, rules } = treeRule; + const { result, referenceRecord } = evaluateConditions(conditions, options); + if (!result) { + return; + } + return evaluateRules(rules, { + ...options, + referenceRecord: { ...options.referenceRecord, ...referenceRecord } + }); + }, "evaluateTreeRule"); + var evaluateRules = /* @__PURE__ */ __name((rules, options) => { + for (const rule of rules) { + if (rule.type === "endpoint") { + const endpointOrUndefined = evaluateEndpointRule(rule, options); + if (endpointOrUndefined) { + return endpointOrUndefined; + } + } else if (rule.type === "error") { + evaluateErrorRule(rule, options); + } else if (rule.type === "tree") { + const endpointOrUndefined = evaluateTreeRule(rule, options); + if (endpointOrUndefined) { + return endpointOrUndefined; + } + } else { + throw new EndpointError2(`Unknown endpoint rule: ${rule}`); + } + } + throw new EndpointError2(`Rules evaluation failed`); + }, "evaluateRules"); + var resolveEndpoint2 = /* @__PURE__ */ __name((ruleSetObject, options) => { + var _a, _b, _c, _d, _e; + const { endpointParams, logger } = options; + const { parameters, rules } = ruleSetObject; + (_b = (_a = options.logger) == null ? void 0 : _a.debug) == null ? void 0 : _b.call(_a, `${debugId} Initial EndpointParams: ${toDebugString(endpointParams)}`); + const paramsWithDefault = Object.entries(parameters).filter(([, v]) => v.default != null).map(([k, v]) => [k, v.default]); + if (paramsWithDefault.length > 0) { + for (const [paramKey, paramDefaultValue] of paramsWithDefault) { + endpointParams[paramKey] = endpointParams[paramKey] ?? paramDefaultValue; + } + } + const requiredParams = Object.entries(parameters).filter(([, v]) => v.required).map(([k]) => k); + for (const requiredParam of requiredParams) { + if (endpointParams[requiredParam] == null) { + throw new EndpointError2(`Missing required parameter: '${requiredParam}'`); + } + } + const endpoint2 = evaluateRules(rules, { endpointParams, logger, referenceRecord: {} }); + if ((_c = options.endpointParams) == null ? void 0 : _c.Endpoint) { + try { + const givenEndpoint = new URL(options.endpointParams.Endpoint); + const { protocol, port } = givenEndpoint; + endpoint2.url.protocol = protocol; + endpoint2.url.port = port; + } catch (e) { + } + } + (_e = (_d = options.logger) == null ? void 0 : _d.debug) == null ? void 0 : _e.call(_d, `${debugId} Resolved endpoint: ${toDebugString(endpoint2)}`); + return endpoint2; + }, "resolveEndpoint"); } }); -// node_modules/undici/lib/core/constants.js -var require_constants6 = __commonJS({ - "node_modules/undici/lib/core/constants.js"(exports2, module2) { +// node_modules/@aws-sdk/util-endpoints/dist-cjs/index.js +var require_dist_cjs7 = __commonJS({ + "node_modules/@aws-sdk/util-endpoints/dist-cjs/index.js"(exports2, module2) { "use strict"; - var headerNameLowerCasedRecord = {}; - var wellknownHeaderNames = [ - "Accept", - "Accept-Encoding", - "Accept-Language", - "Accept-Ranges", - "Access-Control-Allow-Credentials", - "Access-Control-Allow-Headers", - "Access-Control-Allow-Methods", - "Access-Control-Allow-Origin", - "Access-Control-Expose-Headers", - "Access-Control-Max-Age", - "Access-Control-Request-Headers", - "Access-Control-Request-Method", - "Age", - "Allow", - "Alt-Svc", - "Alt-Used", - "Authorization", - "Cache-Control", - "Clear-Site-Data", - "Connection", - "Content-Disposition", - "Content-Encoding", - "Content-Language", - "Content-Length", - "Content-Location", - "Content-Range", - "Content-Security-Policy", - "Content-Security-Policy-Report-Only", - "Content-Type", - "Cookie", - "Cross-Origin-Embedder-Policy", - "Cross-Origin-Opener-Policy", - "Cross-Origin-Resource-Policy", - "Date", - "Device-Memory", - "Downlink", - "ECT", - "ETag", - "Expect", - "Expect-CT", - "Expires", - "Forwarded", - "From", - "Host", - "If-Match", - "If-Modified-Since", - "If-None-Match", - "If-Range", - "If-Unmodified-Since", - "Keep-Alive", - "Last-Modified", - "Link", - "Location", - "Max-Forwards", - "Origin", - "Permissions-Policy", - "Pragma", - "Proxy-Authenticate", - "Proxy-Authorization", - "RTT", - "Range", - "Referer", - "Referrer-Policy", - "Refresh", - "Retry-After", - "Sec-WebSocket-Accept", - "Sec-WebSocket-Extensions", - "Sec-WebSocket-Key", - "Sec-WebSocket-Protocol", - "Sec-WebSocket-Version", - "Server", - "Server-Timing", - "Service-Worker-Allowed", - "Service-Worker-Navigation-Preload", - "Set-Cookie", - "SourceMap", - "Strict-Transport-Security", - "Supports-Loading-Mode", - "TE", - "Timing-Allow-Origin", - "Trailer", - "Transfer-Encoding", - "Upgrade", - "Upgrade-Insecure-Requests", - "User-Agent", - "Vary", - "Via", - "WWW-Authenticate", - "X-Content-Type-Options", - "X-DNS-Prefetch-Control", - "X-Frame-Options", - "X-Permitted-Cross-Domain-Policies", - "X-Powered-By", - "X-Requested-With", - "X-XSS-Protection" - ]; - for (let i = 0; i < wellknownHeaderNames.length; ++i) { - const key = wellknownHeaderNames[i]; - const lowerCasedKey = key.toLowerCase(); - headerNameLowerCasedRecord[key] = headerNameLowerCasedRecord[lowerCasedKey] = lowerCasedKey; + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); + }; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + } + return to; + }; + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + ConditionObject: () => import_util_endpoints.ConditionObject, + DeprecatedObject: () => import_util_endpoints.DeprecatedObject, + EndpointError: () => import_util_endpoints.EndpointError, + EndpointObject: () => import_util_endpoints.EndpointObject, + EndpointObjectHeaders: () => import_util_endpoints.EndpointObjectHeaders, + EndpointObjectProperties: () => import_util_endpoints.EndpointObjectProperties, + EndpointParams: () => import_util_endpoints.EndpointParams, + EndpointResolverOptions: () => import_util_endpoints.EndpointResolverOptions, + EndpointRuleObject: () => import_util_endpoints.EndpointRuleObject, + ErrorRuleObject: () => import_util_endpoints.ErrorRuleObject, + EvaluateOptions: () => import_util_endpoints.EvaluateOptions, + Expression: () => import_util_endpoints.Expression, + FunctionArgv: () => import_util_endpoints.FunctionArgv, + FunctionObject: () => import_util_endpoints.FunctionObject, + FunctionReturn: () => import_util_endpoints.FunctionReturn, + ParameterObject: () => import_util_endpoints.ParameterObject, + ReferenceObject: () => import_util_endpoints.ReferenceObject, + ReferenceRecord: () => import_util_endpoints.ReferenceRecord, + RuleSetObject: () => import_util_endpoints.RuleSetObject, + RuleSetRules: () => import_util_endpoints.RuleSetRules, + TreeRuleObject: () => import_util_endpoints.TreeRuleObject, + awsEndpointFunctions: () => awsEndpointFunctions, + getUserAgentPrefix: () => getUserAgentPrefix, + isIpAddress: () => import_util_endpoints.isIpAddress, + partition: () => partition, + resolveEndpoint: () => import_util_endpoints.resolveEndpoint, + setPartitionInfo: () => setPartitionInfo, + useDefaultPartitionInfo: () => useDefaultPartitionInfo + }); + module2.exports = __toCommonJS2(src_exports); + var import_util_endpoints = require_dist_cjs6(); + var isVirtualHostableS3Bucket = /* @__PURE__ */ __name((value, allowSubDomains = false) => { + if (allowSubDomains) { + for (const label of value.split(".")) { + if (!isVirtualHostableS3Bucket(label)) { + return false; + } + } + return true; + } + if (!(0, import_util_endpoints.isValidHostLabel)(value)) { + return false; + } + if (value.length < 3 || value.length > 63) { + return false; + } + if (value !== value.toLowerCase()) { + return false; + } + if ((0, import_util_endpoints.isIpAddress)(value)) { + return false; + } + return true; + }, "isVirtualHostableS3Bucket"); + var ARN_DELIMITER = ":"; + var RESOURCE_DELIMITER = "/"; + var parseArn = /* @__PURE__ */ __name((value) => { + const segments = value.split(ARN_DELIMITER); + if (segments.length < 6) + return null; + const [arn, partition2, service, region, accountId, ...resourcePath] = segments; + if (arn !== "arn" || partition2 === "" || service === "" || resourcePath.join(ARN_DELIMITER) === "") + return null; + const resourceId = resourcePath.map((resource) => resource.split(RESOURCE_DELIMITER)).flat(); + return { + partition: partition2, + service, + region, + accountId, + resourceId + }; + }, "parseArn"); + var partitions_default = { + partitions: [{ + id: "aws", + outputs: { + dnsSuffix: "amazonaws.com", + dualStackDnsSuffix: "api.aws", + implicitGlobalRegion: "us-east-1", + name: "aws", + supportsDualStack: true, + supportsFIPS: true + }, + regionRegex: "^(us|eu|ap|sa|ca|me|af|il)\\-\\w+\\-\\d+$", + regions: { + "af-south-1": { + description: "Africa (Cape Town)" + }, + "ap-east-1": { + description: "Asia Pacific (Hong Kong)" + }, + "ap-northeast-1": { + description: "Asia Pacific (Tokyo)" + }, + "ap-northeast-2": { + description: "Asia Pacific (Seoul)" + }, + "ap-northeast-3": { + description: "Asia Pacific (Osaka)" + }, + "ap-south-1": { + description: "Asia Pacific (Mumbai)" + }, + "ap-south-2": { + description: "Asia Pacific (Hyderabad)" + }, + "ap-southeast-1": { + description: "Asia Pacific (Singapore)" + }, + "ap-southeast-2": { + description: "Asia Pacific (Sydney)" + }, + "ap-southeast-3": { + description: "Asia Pacific (Jakarta)" + }, + "ap-southeast-4": { + description: "Asia Pacific (Melbourne)" + }, + "aws-global": { + description: "AWS Standard global region" + }, + "ca-central-1": { + description: "Canada (Central)" + }, + "ca-west-1": { + description: "Canada West (Calgary)" + }, + "eu-central-1": { + description: "Europe (Frankfurt)" + }, + "eu-central-2": { + description: "Europe (Zurich)" + }, + "eu-north-1": { + description: "Europe (Stockholm)" + }, + "eu-south-1": { + description: "Europe (Milan)" + }, + "eu-south-2": { + description: "Europe (Spain)" + }, + "eu-west-1": { + description: "Europe (Ireland)" + }, + "eu-west-2": { + description: "Europe (London)" + }, + "eu-west-3": { + description: "Europe (Paris)" + }, + "il-central-1": { + description: "Israel (Tel Aviv)" + }, + "me-central-1": { + description: "Middle East (UAE)" + }, + "me-south-1": { + description: "Middle East (Bahrain)" + }, + "sa-east-1": { + description: "South America (Sao Paulo)" + }, + "us-east-1": { + description: "US East (N. Virginia)" + }, + "us-east-2": { + description: "US East (Ohio)" + }, + "us-west-1": { + description: "US West (N. California)" + }, + "us-west-2": { + description: "US West (Oregon)" + } + } + }, { + id: "aws-cn", + outputs: { + dnsSuffix: "amazonaws.com.cn", + dualStackDnsSuffix: "api.amazonwebservices.com.cn", + implicitGlobalRegion: "cn-northwest-1", + name: "aws-cn", + supportsDualStack: true, + supportsFIPS: true + }, + regionRegex: "^cn\\-\\w+\\-\\d+$", + regions: { + "aws-cn-global": { + description: "AWS China global region" + }, + "cn-north-1": { + description: "China (Beijing)" + }, + "cn-northwest-1": { + description: "China (Ningxia)" + } + } + }, { + id: "aws-us-gov", + outputs: { + dnsSuffix: "amazonaws.com", + dualStackDnsSuffix: "api.aws", + implicitGlobalRegion: "us-gov-west-1", + name: "aws-us-gov", + supportsDualStack: true, + supportsFIPS: true + }, + regionRegex: "^us\\-gov\\-\\w+\\-\\d+$", + regions: { + "aws-us-gov-global": { + description: "AWS GovCloud (US) global region" + }, + "us-gov-east-1": { + description: "AWS GovCloud (US-East)" + }, + "us-gov-west-1": { + description: "AWS GovCloud (US-West)" + } + } + }, { + id: "aws-iso", + outputs: { + dnsSuffix: "c2s.ic.gov", + dualStackDnsSuffix: "c2s.ic.gov", + implicitGlobalRegion: "us-iso-east-1", + name: "aws-iso", + supportsDualStack: false, + supportsFIPS: true + }, + regionRegex: "^us\\-iso\\-\\w+\\-\\d+$", + regions: { + "aws-iso-global": { + description: "AWS ISO (US) global region" + }, + "us-iso-east-1": { + description: "US ISO East" + }, + "us-iso-west-1": { + description: "US ISO WEST" + } + } + }, { + id: "aws-iso-b", + outputs: { + dnsSuffix: "sc2s.sgov.gov", + dualStackDnsSuffix: "sc2s.sgov.gov", + implicitGlobalRegion: "us-isob-east-1", + name: "aws-iso-b", + supportsDualStack: false, + supportsFIPS: true + }, + regionRegex: "^us\\-isob\\-\\w+\\-\\d+$", + regions: { + "aws-iso-b-global": { + description: "AWS ISOB (US) global region" + }, + "us-isob-east-1": { + description: "US ISOB East (Ohio)" + } + } + }, { + id: "aws-iso-e", + outputs: { + dnsSuffix: "cloud.adc-e.uk", + dualStackDnsSuffix: "cloud.adc-e.uk", + implicitGlobalRegion: "eu-isoe-west-1", + name: "aws-iso-e", + supportsDualStack: false, + supportsFIPS: true + }, + regionRegex: "^eu\\-isoe\\-\\w+\\-\\d+$", + regions: { + "eu-isoe-west-1": { + description: "EU ISOE West" + } + } + }, { + id: "aws-iso-f", + outputs: { + dnsSuffix: "csp.hci.ic.gov", + dualStackDnsSuffix: "csp.hci.ic.gov", + implicitGlobalRegion: "us-isof-south-1", + name: "aws-iso-f", + supportsDualStack: false, + supportsFIPS: true + }, + regionRegex: "^us\\-isof\\-\\w+\\-\\d+$", + regions: {} + }], + version: "1.1" + }; + var selectedPartitionsInfo = partitions_default; + var selectedUserAgentPrefix = ""; + var partition = /* @__PURE__ */ __name((value) => { + const { partitions } = selectedPartitionsInfo; + for (const partition2 of partitions) { + const { regions, outputs } = partition2; + for (const [region, regionData] of Object.entries(regions)) { + if (region === value) { + return { + ...outputs, + ...regionData + }; + } + } + } + for (const partition2 of partitions) { + const { regionRegex, outputs } = partition2; + if (new RegExp(regionRegex).test(value)) { + return { + ...outputs + }; + } + } + const DEFAULT_PARTITION = partitions.find((partition2) => partition2.id === "aws"); + if (!DEFAULT_PARTITION) { + throw new Error( + "Provided region was not found in the partition array or regex, and default partition with id 'aws' doesn't exist." + ); + } + return { + ...DEFAULT_PARTITION.outputs + }; + }, "partition"); + var setPartitionInfo = /* @__PURE__ */ __name((partitionsInfo, userAgentPrefix = "") => { + selectedPartitionsInfo = partitionsInfo; + selectedUserAgentPrefix = userAgentPrefix; + }, "setPartitionInfo"); + var useDefaultPartitionInfo = /* @__PURE__ */ __name(() => { + setPartitionInfo(partitions_default, ""); + }, "useDefaultPartitionInfo"); + var getUserAgentPrefix = /* @__PURE__ */ __name(() => selectedUserAgentPrefix, "getUserAgentPrefix"); + var awsEndpointFunctions = { + isVirtualHostableS3Bucket, + parseArn, + partition + }; + import_util_endpoints.customEndpointFunctions.aws = awsEndpointFunctions; + } +}); + +// node_modules/@aws-sdk/middleware-user-agent/dist-cjs/index.js +var require_dist_cjs8 = __commonJS({ + "node_modules/@aws-sdk/middleware-user-agent/dist-cjs/index.js"(exports2, module2) { + "use strict"; + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); + }; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + } + return to; + }; + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + getUserAgentMiddlewareOptions: () => getUserAgentMiddlewareOptions, + getUserAgentPlugin: () => getUserAgentPlugin, + resolveUserAgentConfig: () => resolveUserAgentConfig, + userAgentMiddleware: () => userAgentMiddleware + }); + module2.exports = __toCommonJS2(src_exports); + function resolveUserAgentConfig(input) { + return { + ...input, + customUserAgent: typeof input.customUserAgent === "string" ? [[input.customUserAgent]] : input.customUserAgent + }; } - Object.setPrototypeOf(headerNameLowerCasedRecord, null); - module2.exports = { - wellknownHeaderNames, - headerNameLowerCasedRecord + __name(resolveUserAgentConfig, "resolveUserAgentConfig"); + var import_util_endpoints = require_dist_cjs7(); + var import_protocol_http8 = require_dist_cjs2(); + var USER_AGENT = "user-agent"; + var X_AMZ_USER_AGENT = "x-amz-user-agent"; + var SPACE = " "; + var UA_NAME_SEPARATOR = "/"; + var UA_NAME_ESCAPE_REGEX = /[^\!\$\%\&\'\*\+\-\.\^\_\`\|\~\d\w]/g; + var UA_VALUE_ESCAPE_REGEX = /[^\!\$\%\&\'\*\+\-\.\^\_\`\|\~\d\w\#]/g; + var UA_ESCAPE_CHAR = "-"; + var userAgentMiddleware = /* @__PURE__ */ __name((options) => (next, context) => async (args) => { + var _a, _b; + const { request: request2 } = args; + if (!import_protocol_http8.HttpRequest.isInstance(request2)) + return next(args); + const { headers } = request2; + const userAgent2 = ((_a = context == null ? void 0 : context.userAgent) == null ? void 0 : _a.map(escapeUserAgent)) || []; + const defaultUserAgent = (await options.defaultUserAgentProvider()).map(escapeUserAgent); + const customUserAgent = ((_b = options == null ? void 0 : options.customUserAgent) == null ? void 0 : _b.map(escapeUserAgent)) || []; + const prefix = (0, import_util_endpoints.getUserAgentPrefix)(); + const sdkUserAgentValue = (prefix ? [prefix] : []).concat([...defaultUserAgent, ...userAgent2, ...customUserAgent]).join(SPACE); + const normalUAValue = [ + ...defaultUserAgent.filter((section) => section.startsWith("aws-sdk-")), + ...customUserAgent + ].join(SPACE); + if (options.runtime !== "browser") { + if (normalUAValue) { + headers[X_AMZ_USER_AGENT] = headers[X_AMZ_USER_AGENT] ? `${headers[USER_AGENT]} ${normalUAValue}` : normalUAValue; + } + headers[USER_AGENT] = sdkUserAgentValue; + } else { + headers[X_AMZ_USER_AGENT] = sdkUserAgentValue; + } + return next({ + ...args, + request: request2 + }); + }, "userAgentMiddleware"); + var escapeUserAgent = /* @__PURE__ */ __name((userAgentPair) => { + var _a; + const name = userAgentPair[0].split(UA_NAME_SEPARATOR).map((part) => part.replace(UA_NAME_ESCAPE_REGEX, UA_ESCAPE_CHAR)).join(UA_NAME_SEPARATOR); + const version3 = (_a = userAgentPair[1]) == null ? void 0 : _a.replace(UA_VALUE_ESCAPE_REGEX, UA_ESCAPE_CHAR); + const prefixSeparatorIndex = name.indexOf(UA_NAME_SEPARATOR); + const prefix = name.substring(0, prefixSeparatorIndex); + let uaName = name.substring(prefixSeparatorIndex + 1); + if (prefix === "api") { + uaName = uaName.toLowerCase(); + } + return [prefix, uaName, version3].filter((item) => item && item.length > 0).reduce((acc, item, index) => { + switch (index) { + case 0: + return item; + case 1: + return `${acc}/${item}`; + default: + return `${acc}#${item}`; + } + }, ""); + }, "escapeUserAgent"); + var getUserAgentMiddlewareOptions = { + name: "getUserAgentMiddleware", + step: "build", + priority: "low", + tags: ["SET_USER_AGENT", "USER_AGENT"], + override: true }; + var getUserAgentPlugin = /* @__PURE__ */ __name((config) => ({ + applyToStack: (clientStack) => { + clientStack.add(userAgentMiddleware(config), getUserAgentMiddlewareOptions); + } + }), "getUserAgentPlugin"); } }); -// node_modules/undici/lib/core/tree.js -var require_tree = __commonJS({ - "node_modules/undici/lib/core/tree.js"(exports2, module2) { - "use strict"; - var { - wellknownHeaderNames, - headerNameLowerCasedRecord - } = require_constants6(); - var TstNode = class _TstNode { - /** @type {any} */ - value = null; - /** @type {null | TstNode} */ - left = null; - /** @type {null | TstNode} */ - middle = null; - /** @type {null | TstNode} */ - right = null; - /** @type {number} */ - code; - /** - * @param {string} key - * @param {any} value - * @param {number} index - */ - constructor(key, value, index) { - if (index === void 0 || index >= key.length) { - throw new TypeError("Unreachable"); +// node_modules/@smithy/util-config-provider/dist-cjs/index.js +var require_dist_cjs9 = __commonJS({ + "node_modules/@smithy/util-config-provider/dist-cjs/index.js"(exports2, module2) { + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); + }; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + } + return to; + }; + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + SelectorType: () => SelectorType, + booleanSelector: () => booleanSelector, + numberSelector: () => numberSelector + }); + module2.exports = __toCommonJS2(src_exports); + var booleanSelector = /* @__PURE__ */ __name((obj, key, type) => { + if (!(key in obj)) + return void 0; + if (obj[key] === "true") + return true; + if (obj[key] === "false") + return false; + throw new Error(`Cannot load ${type} "${key}". Expected "true" or "false", got ${obj[key]}.`); + }, "booleanSelector"); + var numberSelector = /* @__PURE__ */ __name((obj, key, type) => { + if (!(key in obj)) + return void 0; + const numberValue = parseInt(obj[key], 10); + if (Number.isNaN(numberValue)) { + throw new TypeError(`Cannot load ${type} '${key}'. Expected number, got '${obj[key]}'.`); + } + return numberValue; + }, "numberSelector"); + var SelectorType = /* @__PURE__ */ ((SelectorType2) => { + SelectorType2["ENV"] = "env"; + SelectorType2["CONFIG"] = "shared config entry"; + return SelectorType2; + })(SelectorType || {}); + } +}); + +// node_modules/@smithy/util-middleware/dist-cjs/index.js +var require_dist_cjs10 = __commonJS({ + "node_modules/@smithy/util-middleware/dist-cjs/index.js"(exports2, module2) { + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); + }; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + } + return to; + }; + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + getSmithyContext: () => getSmithyContext4, + normalizeProvider: () => normalizeProvider2 + }); + module2.exports = __toCommonJS2(src_exports); + var import_types5 = require_dist_cjs(); + var getSmithyContext4 = /* @__PURE__ */ __name((context) => context[import_types5.SMITHY_CONTEXT_KEY] || (context[import_types5.SMITHY_CONTEXT_KEY] = {}), "getSmithyContext"); + var normalizeProvider2 = /* @__PURE__ */ __name((input) => { + if (typeof input === "function") + return input; + const promisified = Promise.resolve(input); + return () => promisified; + }, "normalizeProvider"); + } +}); + +// node_modules/@smithy/config-resolver/dist-cjs/index.js +var require_dist_cjs11 = __commonJS({ + "node_modules/@smithy/config-resolver/dist-cjs/index.js"(exports2, module2) { + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); + }; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + } + return to; + }; + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + CONFIG_USE_DUALSTACK_ENDPOINT: () => CONFIG_USE_DUALSTACK_ENDPOINT, + CONFIG_USE_FIPS_ENDPOINT: () => CONFIG_USE_FIPS_ENDPOINT, + DEFAULT_USE_DUALSTACK_ENDPOINT: () => DEFAULT_USE_DUALSTACK_ENDPOINT, + DEFAULT_USE_FIPS_ENDPOINT: () => DEFAULT_USE_FIPS_ENDPOINT, + ENV_USE_DUALSTACK_ENDPOINT: () => ENV_USE_DUALSTACK_ENDPOINT, + ENV_USE_FIPS_ENDPOINT: () => ENV_USE_FIPS_ENDPOINT, + NODE_REGION_CONFIG_FILE_OPTIONS: () => NODE_REGION_CONFIG_FILE_OPTIONS, + NODE_REGION_CONFIG_OPTIONS: () => NODE_REGION_CONFIG_OPTIONS, + NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS: () => NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS, + NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS: () => NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS, + REGION_ENV_NAME: () => REGION_ENV_NAME, + REGION_INI_NAME: () => REGION_INI_NAME, + getRegionInfo: () => getRegionInfo, + resolveCustomEndpointsConfig: () => resolveCustomEndpointsConfig, + resolveEndpointsConfig: () => resolveEndpointsConfig, + resolveRegionConfig: () => resolveRegionConfig + }); + module2.exports = __toCommonJS2(src_exports); + var import_util_config_provider = require_dist_cjs9(); + var ENV_USE_DUALSTACK_ENDPOINT = "AWS_USE_DUALSTACK_ENDPOINT"; + var CONFIG_USE_DUALSTACK_ENDPOINT = "use_dualstack_endpoint"; + var DEFAULT_USE_DUALSTACK_ENDPOINT = false; + var NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS = { + environmentVariableSelector: (env) => (0, import_util_config_provider.booleanSelector)(env, ENV_USE_DUALSTACK_ENDPOINT, import_util_config_provider.SelectorType.ENV), + configFileSelector: (profile) => (0, import_util_config_provider.booleanSelector)(profile, CONFIG_USE_DUALSTACK_ENDPOINT, import_util_config_provider.SelectorType.CONFIG), + default: false + }; + var ENV_USE_FIPS_ENDPOINT = "AWS_USE_FIPS_ENDPOINT"; + var CONFIG_USE_FIPS_ENDPOINT = "use_fips_endpoint"; + var DEFAULT_USE_FIPS_ENDPOINT = false; + var NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS = { + environmentVariableSelector: (env) => (0, import_util_config_provider.booleanSelector)(env, ENV_USE_FIPS_ENDPOINT, import_util_config_provider.SelectorType.ENV), + configFileSelector: (profile) => (0, import_util_config_provider.booleanSelector)(profile, CONFIG_USE_FIPS_ENDPOINT, import_util_config_provider.SelectorType.CONFIG), + default: false + }; + var import_util_middleware3 = require_dist_cjs10(); + var resolveCustomEndpointsConfig = /* @__PURE__ */ __name((input) => { + const { endpoint: endpoint2, urlParser } = input; + return { + ...input, + tls: input.tls ?? true, + endpoint: (0, import_util_middleware3.normalizeProvider)(typeof endpoint2 === "string" ? urlParser(endpoint2) : endpoint2), + isCustomEndpoint: true, + useDualstackEndpoint: (0, import_util_middleware3.normalizeProvider)(input.useDualstackEndpoint ?? false) + }; + }, "resolveCustomEndpointsConfig"); + var getEndpointFromRegion = /* @__PURE__ */ __name(async (input) => { + const { tls = true } = input; + const region = await input.region(); + const dnsHostRegex = new RegExp(/^([a-zA-Z0-9]|[a-zA-Z0-9][a-zA-Z0-9-]{0,61}[a-zA-Z0-9])$/); + if (!dnsHostRegex.test(region)) { + throw new Error("Invalid region in client config"); + } + const useDualstackEndpoint = await input.useDualstackEndpoint(); + const useFipsEndpoint = await input.useFipsEndpoint(); + const { hostname } = await input.regionInfoProvider(region, { useDualstackEndpoint, useFipsEndpoint }) ?? {}; + if (!hostname) { + throw new Error("Cannot resolve hostname from client config"); + } + return input.urlParser(`${tls ? "https:" : "http:"}//${hostname}`); + }, "getEndpointFromRegion"); + var resolveEndpointsConfig = /* @__PURE__ */ __name((input) => { + const useDualstackEndpoint = (0, import_util_middleware3.normalizeProvider)(input.useDualstackEndpoint ?? false); + const { endpoint: endpoint2, useFipsEndpoint, urlParser } = input; + return { + ...input, + tls: input.tls ?? true, + endpoint: endpoint2 ? (0, import_util_middleware3.normalizeProvider)(typeof endpoint2 === "string" ? urlParser(endpoint2) : endpoint2) : () => getEndpointFromRegion({ ...input, useDualstackEndpoint, useFipsEndpoint }), + isCustomEndpoint: !!endpoint2, + useDualstackEndpoint + }; + }, "resolveEndpointsConfig"); + var REGION_ENV_NAME = "AWS_REGION"; + var REGION_INI_NAME = "region"; + var NODE_REGION_CONFIG_OPTIONS = { + environmentVariableSelector: (env) => env[REGION_ENV_NAME], + configFileSelector: (profile) => profile[REGION_INI_NAME], + default: () => { + throw new Error("Region is missing"); + } + }; + var NODE_REGION_CONFIG_FILE_OPTIONS = { + preferredFile: "credentials" + }; + var isFipsRegion = /* @__PURE__ */ __name((region) => typeof region === "string" && (region.startsWith("fips-") || region.endsWith("-fips")), "isFipsRegion"); + var getRealRegion = /* @__PURE__ */ __name((region) => isFipsRegion(region) ? ["fips-aws-global", "aws-fips"].includes(region) ? "us-east-1" : region.replace(/fips-(dkr-|prod-)?|-fips/, "") : region, "getRealRegion"); + var resolveRegionConfig = /* @__PURE__ */ __name((input) => { + const { region, useFipsEndpoint } = input; + if (!region) { + throw new Error("Region is missing"); + } + return { + ...input, + region: async () => { + if (typeof region === "string") { + return getRealRegion(region); + } + const providedRegion = await region(); + return getRealRegion(providedRegion); + }, + useFipsEndpoint: async () => { + const providedRegion = typeof region === "string" ? region : await region(); + if (isFipsRegion(providedRegion)) { + return true; + } + return typeof useFipsEndpoint !== "function" ? Promise.resolve(!!useFipsEndpoint) : useFipsEndpoint(); } - const code = this.code = key.charCodeAt(index); - if (code > 127) { - throw new TypeError("key must be ascii string"); + }; + }, "resolveRegionConfig"); + var getHostnameFromVariants = /* @__PURE__ */ __name((variants = [], { useFipsEndpoint, useDualstackEndpoint }) => { + var _a; + return (_a = variants.find( + ({ tags }) => useFipsEndpoint === tags.includes("fips") && useDualstackEndpoint === tags.includes("dualstack") + )) == null ? void 0 : _a.hostname; + }, "getHostnameFromVariants"); + var getResolvedHostname = /* @__PURE__ */ __name((resolvedRegion, { regionHostname, partitionHostname }) => regionHostname ? regionHostname : partitionHostname ? partitionHostname.replace("{region}", resolvedRegion) : void 0, "getResolvedHostname"); + var getResolvedPartition = /* @__PURE__ */ __name((region, { partitionHash }) => Object.keys(partitionHash || {}).find((key) => partitionHash[key].regions.includes(region)) ?? "aws", "getResolvedPartition"); + var getResolvedSigningRegion = /* @__PURE__ */ __name((hostname, { signingRegion, regionRegex, useFipsEndpoint }) => { + if (signingRegion) { + return signingRegion; + } else if (useFipsEndpoint) { + const regionRegexJs = regionRegex.replace("\\\\", "\\").replace(/^\^/g, "\\.").replace(/\$$/g, "\\."); + const regionRegexmatchArray = hostname.match(regionRegexJs); + if (regionRegexmatchArray) { + return regionRegexmatchArray[0].slice(1, -1); + } + } + }, "getResolvedSigningRegion"); + var getRegionInfo = /* @__PURE__ */ __name((region, { + useFipsEndpoint = false, + useDualstackEndpoint = false, + signingService, + regionHash, + partitionHash + }) => { + var _a, _b, _c, _d, _e; + const partition = getResolvedPartition(region, { partitionHash }); + const resolvedRegion = region in regionHash ? region : ((_a = partitionHash[partition]) == null ? void 0 : _a.endpoint) ?? region; + const hostnameOptions = { useFipsEndpoint, useDualstackEndpoint }; + const regionHostname = getHostnameFromVariants((_b = regionHash[resolvedRegion]) == null ? void 0 : _b.variants, hostnameOptions); + const partitionHostname = getHostnameFromVariants((_c = partitionHash[partition]) == null ? void 0 : _c.variants, hostnameOptions); + const hostname = getResolvedHostname(resolvedRegion, { regionHostname, partitionHostname }); + if (hostname === void 0) { + throw new Error(`Endpoint resolution failed for: ${{ resolvedRegion, useFipsEndpoint, useDualstackEndpoint }}`); + } + const signingRegion = getResolvedSigningRegion(hostname, { + signingRegion: (_d = regionHash[resolvedRegion]) == null ? void 0 : _d.signingRegion, + regionRegex: partitionHash[partition].regionRegex, + useFipsEndpoint + }); + return { + partition, + signingService, + hostname, + ...signingRegion && { signingRegion }, + ...((_e = regionHash[resolvedRegion]) == null ? void 0 : _e.signingService) && { + signingService: regionHash[resolvedRegion].signingService } - if (key.length !== ++index) { - this.middle = new _TstNode(key, value, index); - } else { - this.value = value; + }; + }, "getRegionInfo"); + } +}); + +// node_modules/@smithy/core/dist-es/middleware-http-auth-scheme/httpAuthSchemeMiddleware.js +function convertHttpAuthSchemesToMap(httpAuthSchemes) { + const map = /* @__PURE__ */ new Map(); + for (const scheme of httpAuthSchemes) { + map.set(scheme.schemeId, scheme); + } + return map; +} +var import_types, import_util_middleware, httpAuthSchemeMiddleware; +var init_httpAuthSchemeMiddleware = __esm({ + "node_modules/@smithy/core/dist-es/middleware-http-auth-scheme/httpAuthSchemeMiddleware.js"() { + import_types = __toESM(require_dist_cjs()); + import_util_middleware = __toESM(require_dist_cjs10()); + httpAuthSchemeMiddleware = (config, mwOptions) => (next, context) => async (args) => { + const options = config.httpAuthSchemeProvider(await mwOptions.httpAuthSchemeParametersProvider(config, context, args.input)); + const authSchemes = convertHttpAuthSchemesToMap(config.httpAuthSchemes); + const smithyContext = (0, import_util_middleware.getSmithyContext)(context); + const failureReasons = []; + for (const option of options) { + const scheme = authSchemes.get(option.schemeId); + if (!scheme) { + failureReasons.push(`HttpAuthScheme \`${option.schemeId}\` was not enabled for this service.`); + continue; } - } - /** - * @param {string} key - * @param {any} value - */ - add(key, value) { - const length = key.length; - if (length === 0) { - throw new TypeError("Unreachable"); + const identityProvider = scheme.identityProvider(await mwOptions.identityProviderConfigProvider(config)); + if (!identityProvider) { + failureReasons.push(`HttpAuthScheme \`${option.schemeId}\` did not have an IdentityProvider configured.`); + continue; } - let index = 0; - let node = this; - while (true) { - const code = key.charCodeAt(index); - if (code > 127) { - throw new TypeError("key must be ascii string"); - } - if (node.code === code) { - if (length === ++index) { - node.value = value; - break; - } else if (node.middle !== null) { - node = node.middle; - } else { - node.middle = new _TstNode(key, value, index); - break; - } - } else if (node.code < code) { - if (node.left !== null) { - node = node.left; - } else { - node.left = new _TstNode(key, value, index); - break; - } - } else if (node.right !== null) { - node = node.right; - } else { - node.right = new _TstNode(key, value, index); - break; - } + const { identityProperties = {}, signingProperties = {} } = option.propertiesExtractor?.(config, context) || {}; + option.identityProperties = Object.assign(option.identityProperties || {}, identityProperties); + option.signingProperties = Object.assign(option.signingProperties || {}, signingProperties); + smithyContext.selectedHttpAuthScheme = { + httpAuthOption: option, + identity: await identityProvider(option.identityProperties), + signer: scheme.signer + }; + break; + } + if (!smithyContext.selectedHttpAuthScheme) { + throw new Error(failureReasons.join("\n")); + } + return next(args); + }; + } +}); + +// node_modules/@smithy/property-provider/dist-cjs/index.js +var require_dist_cjs12 = __commonJS({ + "node_modules/@smithy/property-provider/dist-cjs/index.js"(exports2, module2) { + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); + }; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + } + return to; + }; + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + CredentialsProviderError: () => CredentialsProviderError, + ProviderError: () => ProviderError2, + TokenProviderError: () => TokenProviderError, + chain: () => chain, + fromStatic: () => fromStatic, + memoize: () => memoize + }); + module2.exports = __toCommonJS2(src_exports); + var _ProviderError = class _ProviderError2 extends Error { + constructor(message, options = true) { + var _a; + let logger; + let tryNextLink = true; + if (typeof options === "boolean") { + logger = void 0; + tryNextLink = options; + } else if (options != null && typeof options === "object") { + logger = options.logger; + tryNextLink = options.tryNextLink ?? true; } + super(message); + this.name = "ProviderError"; + this.tryNextLink = tryNextLink; + Object.setPrototypeOf(this, _ProviderError2.prototype); + (_a = logger == null ? void 0 : logger.debug) == null ? void 0 : _a.call(logger, `@smithy/property-provider ${tryNextLink ? "->" : "(!)"} ${message}`); } /** - * @param {Uint8Array} key - * @return {TstNode | null} + * @deprecated use new operator. */ - search(key) { - const keylength = key.length; - let index = 0; - let node = this; - while (node !== null && index < keylength) { - let code = key[index]; - if (code <= 90 && code >= 65) { - code |= 32; - } - while (node !== null) { - if (code === node.code) { - if (keylength === ++index) { - return node; - } - node = node.middle; - break; - } - node = node.code < code ? node.left : node.right; - } - } - return null; + static from(error, options = true) { + return Object.assign(new this(error.message, options), error); } }; - var TernarySearchTree = class { - /** @type {TstNode | null} */ - node = null; + __name(_ProviderError, "ProviderError"); + var ProviderError2 = _ProviderError; + var _CredentialsProviderError = class _CredentialsProviderError2 extends ProviderError2 { /** - * @param {string} key - * @param {any} value - * */ - insert(key, value) { - if (this.node === null) { - this.node = new TstNode(key, value, 0); - } else { - this.node.add(key, value); - } + * @override + */ + constructor(message, options = true) { + super(message, options); + this.name = "CredentialsProviderError"; + Object.setPrototypeOf(this, _CredentialsProviderError2.prototype); } + }; + __name(_CredentialsProviderError, "CredentialsProviderError"); + var CredentialsProviderError = _CredentialsProviderError; + var _TokenProviderError = class _TokenProviderError2 extends ProviderError2 { /** - * @param {Uint8Array} key - * @return {any} + * @override */ - lookup(key) { - return this.node?.search(key)?.value ?? null; + constructor(message, options = true) { + super(message, options); + this.name = "TokenProviderError"; + Object.setPrototypeOf(this, _TokenProviderError2.prototype); } }; - var tree = new TernarySearchTree(); - for (let i = 0; i < wellknownHeaderNames.length; ++i) { - const key = headerNameLowerCasedRecord[wellknownHeaderNames[i]]; - tree.insert(key, key); - } - module2.exports = { - TernarySearchTree, - tree + __name(_TokenProviderError, "TokenProviderError"); + var TokenProviderError = _TokenProviderError; + var chain = /* @__PURE__ */ __name((...providers) => async () => { + if (providers.length === 0) { + throw new ProviderError2("No providers in chain"); + } + let lastProviderError; + for (const provider of providers) { + try { + const credentials = await provider(); + return credentials; + } catch (err) { + lastProviderError = err; + if (err == null ? void 0 : err.tryNextLink) { + continue; + } + throw err; + } + } + throw lastProviderError; + }, "chain"); + var fromStatic = /* @__PURE__ */ __name((staticValue) => () => Promise.resolve(staticValue), "fromStatic"); + var memoize = /* @__PURE__ */ __name((provider, isExpired, requiresRefresh) => { + let resolved; + let pending; + let hasResult; + let isConstant = false; + const coalesceProvider = /* @__PURE__ */ __name(async () => { + if (!pending) { + pending = provider(); + } + try { + resolved = await pending; + hasResult = true; + isConstant = false; + } finally { + pending = void 0; + } + return resolved; + }, "coalesceProvider"); + if (isExpired === void 0) { + return async (options) => { + if (!hasResult || (options == null ? void 0 : options.forceRefresh)) { + resolved = await coalesceProvider(); + } + return resolved; + }; + } + return async (options) => { + if (!hasResult || (options == null ? void 0 : options.forceRefresh)) { + resolved = await coalesceProvider(); + } + if (isConstant) { + return resolved; + } + if (requiresRefresh && !requiresRefresh(resolved)) { + isConstant = true; + return resolved; + } + if (isExpired(resolved)) { + await coalesceProvider(); + return resolved; + } + return resolved; + }; + }, "memoize"); + } +}); + +// node_modules/@smithy/shared-ini-file-loader/dist-cjs/getHomeDir.js +var require_getHomeDir = __commonJS({ + "node_modules/@smithy/shared-ini-file-loader/dist-cjs/getHomeDir.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.getHomeDir = void 0; + var os_1 = require("os"); + var path_1 = require("path"); + var homeDirCache = {}; + var getHomeDirCacheKey = () => { + if (process && process.geteuid) { + return `${process.geteuid()}`; + } + return "DEFAULT"; + }; + var getHomeDir2 = () => { + const { HOME, USERPROFILE, HOMEPATH, HOMEDRIVE = `C:${path_1.sep}` } = process.env; + if (HOME) + return HOME; + if (USERPROFILE) + return USERPROFILE; + if (HOMEPATH) + return `${HOMEDRIVE}${HOMEPATH}`; + const homeDirCacheKey = getHomeDirCacheKey(); + if (!homeDirCache[homeDirCacheKey]) + homeDirCache[homeDirCacheKey] = (0, os_1.homedir)(); + return homeDirCache[homeDirCacheKey]; + }; + exports2.getHomeDir = getHomeDir2; + } +}); + +// node_modules/@smithy/shared-ini-file-loader/dist-cjs/getSSOTokenFilepath.js +var require_getSSOTokenFilepath = __commonJS({ + "node_modules/@smithy/shared-ini-file-loader/dist-cjs/getSSOTokenFilepath.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.getSSOTokenFilepath = void 0; + var crypto_1 = require("crypto"); + var path_1 = require("path"); + var getHomeDir_1 = require_getHomeDir(); + var getSSOTokenFilepath2 = (id) => { + const hasher = (0, crypto_1.createHash)("sha1"); + const cacheName = hasher.update(id).digest("hex"); + return (0, path_1.join)((0, getHomeDir_1.getHomeDir)(), ".aws", "sso", "cache", `${cacheName}.json`); }; + exports2.getSSOTokenFilepath = getSSOTokenFilepath2; } }); -// node_modules/undici/lib/core/util.js -var require_util8 = __commonJS({ - "node_modules/undici/lib/core/util.js"(exports2, module2) { +// node_modules/@smithy/shared-ini-file-loader/dist-cjs/getSSOTokenFromFile.js +var require_getSSOTokenFromFile = __commonJS({ + "node_modules/@smithy/shared-ini-file-loader/dist-cjs/getSSOTokenFromFile.js"(exports2) { "use strict"; - var assert = require("node:assert"); - var { kDestroyed, kBodyUsed, kListeners, kBody } = require_symbols6(); - var { IncomingMessage } = require("node:http"); - var stream = require("node:stream"); - var net = require("node:net"); - var { Blob: Blob2 } = require("node:buffer"); - var nodeUtil = require("node:util"); - var { stringify: stringify2 } = require("node:querystring"); - var { EventEmitter: EE } = require("node:events"); - var { InvalidArgumentError } = require_errors2(); - var { headerNameLowerCasedRecord } = require_constants6(); - var { tree } = require_tree(); - var [nodeMajor, nodeMinor] = process.versions.node.split(".").map((v) => Number(v)); - var BodyAsyncIterable = class { - constructor(body) { - this[kBody] = body; - this[kBodyUsed] = false; - } - async *[Symbol.asyncIterator]() { - assert(!this[kBodyUsed], "disturbed"); - this[kBodyUsed] = true; - yield* this[kBody]; - } + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.getSSOTokenFromFile = void 0; + var fs_1 = require("fs"); + var getSSOTokenFilepath_1 = require_getSSOTokenFilepath(); + var { readFile } = fs_1.promises; + var getSSOTokenFromFile2 = async (id) => { + const ssoTokenFilepath = (0, getSSOTokenFilepath_1.getSSOTokenFilepath)(id); + const ssoTokenText = await readFile(ssoTokenFilepath, "utf8"); + return JSON.parse(ssoTokenText); }; - function wrapRequestBody(body) { - if (isStream(body)) { - if (bodyLength(body) === 0) { - body.on("data", function() { - assert(false); - }); - } - if (typeof body.readableDidRead !== "boolean") { - body[kBodyUsed] = false; - EE.prototype.on.call(body, "data", function() { - this[kBodyUsed] = true; - }); - } - return body; - } else if (body && typeof body.pipeTo === "function") { - return new BodyAsyncIterable(body); - } else if (body && typeof body !== "string" && !ArrayBuffer.isView(body) && isIterable(body)) { - return new BodyAsyncIterable(body); - } else { - return body; + exports2.getSSOTokenFromFile = getSSOTokenFromFile2; + } +}); + +// node_modules/@smithy/shared-ini-file-loader/dist-cjs/slurpFile.js +var require_slurpFile = __commonJS({ + "node_modules/@smithy/shared-ini-file-loader/dist-cjs/slurpFile.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.slurpFile = void 0; + var fs_1 = require("fs"); + var { readFile } = fs_1.promises; + var filePromisesHash = {}; + var slurpFile = (path, options) => { + if (!filePromisesHash[path] || (options === null || options === void 0 ? void 0 : options.ignoreCache)) { + filePromisesHash[path] = readFile(path, "utf8"); } - } - function nop() { - } - function isStream(obj) { - return obj && typeof obj === "object" && typeof obj.pipe === "function" && typeof obj.on === "function"; - } - function isBlobLike(object) { - if (object === null) { - return false; - } else if (object instanceof Blob2) { - return true; - } else if (typeof object !== "object") { + return filePromisesHash[path]; + }; + exports2.slurpFile = slurpFile; + } +}); + +// node_modules/@smithy/shared-ini-file-loader/dist-cjs/index.js +var require_dist_cjs13 = __commonJS({ + "node_modules/@smithy/shared-ini-file-loader/dist-cjs/index.js"(exports2, module2) { + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); + }; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + } + return to; + }; + var __reExport = (target, mod, secondTarget) => (__copyProps2(target, mod, "default"), secondTarget && __copyProps2(secondTarget, mod, "default")); + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + CONFIG_PREFIX_SEPARATOR: () => CONFIG_PREFIX_SEPARATOR, + DEFAULT_PROFILE: () => DEFAULT_PROFILE, + ENV_PROFILE: () => ENV_PROFILE, + getProfileName: () => getProfileName, + loadSharedConfigFiles: () => loadSharedConfigFiles, + loadSsoSessionData: () => loadSsoSessionData, + parseKnownFiles: () => parseKnownFiles + }); + module2.exports = __toCommonJS2(src_exports); + __reExport(src_exports, require_getHomeDir(), module2.exports); + var ENV_PROFILE = "AWS_PROFILE"; + var DEFAULT_PROFILE = "default"; + var getProfileName = /* @__PURE__ */ __name((init) => init.profile || process.env[ENV_PROFILE] || DEFAULT_PROFILE, "getProfileName"); + __reExport(src_exports, require_getSSOTokenFilepath(), module2.exports); + __reExport(src_exports, require_getSSOTokenFromFile(), module2.exports); + var import_types5 = require_dist_cjs(); + var getConfigData = /* @__PURE__ */ __name((data) => Object.entries(data).filter(([key]) => { + const indexOfSeparator = key.indexOf(CONFIG_PREFIX_SEPARATOR); + if (indexOfSeparator === -1) { return false; - } else { - const sTag = object[Symbol.toStringTag]; - return (sTag === "Blob" || sTag === "File") && ("stream" in object && typeof object.stream === "function" || "arrayBuffer" in object && typeof object.arrayBuffer === "function"); } - } - function buildURL(url, queryParams) { - if (url.includes("?") || url.includes("#")) { - throw new Error('Query params cannot be passed when url already contains "?" or "#".'); + return Object.values(import_types5.IniSectionType).includes(key.substring(0, indexOfSeparator)); + }).reduce( + (acc, [key, value]) => { + const indexOfSeparator = key.indexOf(CONFIG_PREFIX_SEPARATOR); + const updatedKey = key.substring(0, indexOfSeparator) === import_types5.IniSectionType.PROFILE ? key.substring(indexOfSeparator + 1) : key; + acc[updatedKey] = value; + return acc; + }, + { + // Populate default profile, if present. + ...data.default && { default: data.default } + } + ), "getConfigData"); + var import_path = require("path"); + var import_getHomeDir = require_getHomeDir(); + var ENV_CONFIG_PATH = "AWS_CONFIG_FILE"; + var getConfigFilepath = /* @__PURE__ */ __name(() => process.env[ENV_CONFIG_PATH] || (0, import_path.join)((0, import_getHomeDir.getHomeDir)(), ".aws", "config"), "getConfigFilepath"); + var import_getHomeDir2 = require_getHomeDir(); + var ENV_CREDENTIALS_PATH = "AWS_SHARED_CREDENTIALS_FILE"; + var getCredentialsFilepath = /* @__PURE__ */ __name(() => process.env[ENV_CREDENTIALS_PATH] || (0, import_path.join)((0, import_getHomeDir2.getHomeDir)(), ".aws", "credentials"), "getCredentialsFilepath"); + var import_getHomeDir3 = require_getHomeDir(); + var prefixKeyRegex = /^([\w-]+)\s(["'])?([\w-@\+\.%:/]+)\2$/; + var profileNameBlockList = ["__proto__", "profile __proto__"]; + var parseIni = /* @__PURE__ */ __name((iniData) => { + const map = {}; + let currentSection; + let currentSubSection; + for (const iniLine of iniData.split(/\r?\n/)) { + const trimmedLine = iniLine.split(/(^|\s)[;#]/)[0].trim(); + const isSection = trimmedLine[0] === "[" && trimmedLine[trimmedLine.length - 1] === "]"; + if (isSection) { + currentSection = void 0; + currentSubSection = void 0; + const sectionName = trimmedLine.substring(1, trimmedLine.length - 1); + const matches = prefixKeyRegex.exec(sectionName); + if (matches) { + const [, prefix, , name] = matches; + if (Object.values(import_types5.IniSectionType).includes(prefix)) { + currentSection = [prefix, name].join(CONFIG_PREFIX_SEPARATOR); + } + } else { + currentSection = sectionName; + } + if (profileNameBlockList.includes(sectionName)) { + throw new Error(`Found invalid profile name "${sectionName}"`); + } + } else if (currentSection) { + const indexOfEqualsSign = trimmedLine.indexOf("="); + if (![0, -1].includes(indexOfEqualsSign)) { + const [name, value] = [ + trimmedLine.substring(0, indexOfEqualsSign).trim(), + trimmedLine.substring(indexOfEqualsSign + 1).trim() + ]; + if (value === "") { + currentSubSection = name; + } else { + if (currentSubSection && iniLine.trimStart() === iniLine) { + currentSubSection = void 0; + } + map[currentSection] = map[currentSection] || {}; + const key = currentSubSection ? [currentSubSection, name].join(CONFIG_PREFIX_SEPARATOR) : name; + map[currentSection][key] = value; + } + } + } + } + return map; + }, "parseIni"); + var import_slurpFile = require_slurpFile(); + var swallowError = /* @__PURE__ */ __name(() => ({}), "swallowError"); + var CONFIG_PREFIX_SEPARATOR = "."; + var loadSharedConfigFiles = /* @__PURE__ */ __name(async (init = {}) => { + const { filepath = getCredentialsFilepath(), configFilepath = getConfigFilepath() } = init; + const homeDir = (0, import_getHomeDir3.getHomeDir)(); + const relativeHomeDirPrefix = "~/"; + let resolvedFilepath = filepath; + if (filepath.startsWith(relativeHomeDirPrefix)) { + resolvedFilepath = (0, import_path.join)(homeDir, filepath.slice(2)); + } + let resolvedConfigFilepath = configFilepath; + if (configFilepath.startsWith(relativeHomeDirPrefix)) { + resolvedConfigFilepath = (0, import_path.join)(homeDir, configFilepath.slice(2)); + } + const parsedFiles = await Promise.all([ + (0, import_slurpFile.slurpFile)(resolvedConfigFilepath, { + ignoreCache: init.ignoreCache + }).then(parseIni).then(getConfigData).catch(swallowError), + (0, import_slurpFile.slurpFile)(resolvedFilepath, { + ignoreCache: init.ignoreCache + }).then(parseIni).catch(swallowError) + ]); + return { + configFile: parsedFiles[0], + credentialsFile: parsedFiles[1] + }; + }, "loadSharedConfigFiles"); + var getSsoSessionData = /* @__PURE__ */ __name((data) => Object.entries(data).filter(([key]) => key.startsWith(import_types5.IniSectionType.SSO_SESSION + CONFIG_PREFIX_SEPARATOR)).reduce((acc, [key, value]) => ({ ...acc, [key.substring(key.indexOf(CONFIG_PREFIX_SEPARATOR) + 1)]: value }), {}), "getSsoSessionData"); + var import_slurpFile2 = require_slurpFile(); + var swallowError2 = /* @__PURE__ */ __name(() => ({}), "swallowError"); + var loadSsoSessionData = /* @__PURE__ */ __name(async (init = {}) => (0, import_slurpFile2.slurpFile)(init.configFilepath ?? getConfigFilepath()).then(parseIni).then(getSsoSessionData).catch(swallowError2), "loadSsoSessionData"); + var mergeConfigFiles = /* @__PURE__ */ __name((...files) => { + const merged = {}; + for (const file of files) { + for (const [key, values] of Object.entries(file)) { + if (merged[key] !== void 0) { + Object.assign(merged[key], values); + } else { + merged[key] = values; + } + } } - const stringified = stringify2(queryParams); - if (stringified) { - url += "?" + stringified; + return merged; + }, "mergeConfigFiles"); + var parseKnownFiles = /* @__PURE__ */ __name(async (init) => { + const parsedFiles = await loadSharedConfigFiles(init); + return mergeConfigFiles(parsedFiles.configFile, parsedFiles.credentialsFile); + }, "parseKnownFiles"); + } +}); + +// node_modules/@smithy/node-config-provider/dist-cjs/index.js +var require_dist_cjs14 = __commonJS({ + "node_modules/@smithy/node-config-provider/dist-cjs/index.js"(exports2, module2) { + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); + }; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + } + return to; + }; + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + loadConfig: () => loadConfig + }); + module2.exports = __toCommonJS2(src_exports); + var import_property_provider2 = require_dist_cjs12(); + function getSelectorName(functionString) { + try { + const constants = new Set(Array.from(functionString.match(/([A-Z_]){3,}/g) ?? [])); + constants.delete("CONFIG"); + constants.delete("CONFIG_PREFIX_SEPARATOR"); + constants.delete("ENV"); + return [...constants].join(", "); + } catch (e) { + return functionString; } - return url; - } - function isValidPort(port) { - const value = parseInt(port, 10); - return value === Number(port) && value >= 0 && value <= 65535; - } - function isHttpOrHttpsPrefixed(value) { - return value != null && value[0] === "h" && value[1] === "t" && value[2] === "t" && value[3] === "p" && (value[4] === ":" || value[4] === "s" && value[5] === ":"); } - function parseURL(url) { - if (typeof url === "string") { - url = new URL(url); - if (!isHttpOrHttpsPrefixed(url.origin || url.protocol)) { - throw new InvalidArgumentError("Invalid URL protocol: the URL must start with `http:` or `https:`."); + __name(getSelectorName, "getSelectorName"); + var fromEnv = /* @__PURE__ */ __name((envVarSelector, logger) => async () => { + try { + const config = envVarSelector(process.env); + if (config === void 0) { + throw new Error(); } - return url; - } - if (!url || typeof url !== "object") { - throw new InvalidArgumentError("Invalid URL: The URL argument must be a non-null object."); + return config; + } catch (e) { + throw new import_property_provider2.CredentialsProviderError( + e.message || `Not found in ENV: ${getSelectorName(envVarSelector.toString())}`, + { logger } + ); } - if (!(url instanceof URL)) { - if (url.port != null && url.port !== "" && isValidPort(url.port) === false) { - throw new InvalidArgumentError("Invalid URL: port must be a valid integer or a string representation of an integer."); - } - if (url.path != null && typeof url.path !== "string") { - throw new InvalidArgumentError("Invalid URL path: the path must be a string or null/undefined."); - } - if (url.pathname != null && typeof url.pathname !== "string") { - throw new InvalidArgumentError("Invalid URL pathname: the pathname must be a string or null/undefined."); - } - if (url.hostname != null && typeof url.hostname !== "string") { - throw new InvalidArgumentError("Invalid URL hostname: the hostname must be a string or null/undefined."); - } - if (url.origin != null && typeof url.origin !== "string") { - throw new InvalidArgumentError("Invalid URL origin: the origin must be a string or null/undefined."); - } - if (!isHttpOrHttpsPrefixed(url.origin || url.protocol)) { - throw new InvalidArgumentError("Invalid URL protocol: the URL must start with `http:` or `https:`."); - } - const port = url.port != null ? url.port : url.protocol === "https:" ? 443 : 80; - let origin = url.origin != null ? url.origin : `${url.protocol || ""}//${url.hostname || ""}:${port}`; - let path = url.path != null ? url.path : `${url.pathname || ""}${url.search || ""}`; - if (origin[origin.length - 1] === "/") { - origin = origin.slice(0, origin.length - 1); - } - if (path && path[0] !== "/") { - path = `/${path}`; + }, "fromEnv"); + var import_shared_ini_file_loader = require_dist_cjs13(); + var fromSharedConfigFiles = /* @__PURE__ */ __name((configSelector, { preferredFile = "config", ...init } = {}) => async () => { + const profile = (0, import_shared_ini_file_loader.getProfileName)(init); + const { configFile, credentialsFile } = await (0, import_shared_ini_file_loader.loadSharedConfigFiles)(init); + const profileFromCredentials = credentialsFile[profile] || {}; + const profileFromConfig = configFile[profile] || {}; + const mergedProfile = preferredFile === "config" ? { ...profileFromCredentials, ...profileFromConfig } : { ...profileFromConfig, ...profileFromCredentials }; + try { + const cfgFile = preferredFile === "config" ? configFile : credentialsFile; + const configValue = configSelector(mergedProfile, cfgFile); + if (configValue === void 0) { + throw new Error(); } - return new URL(`${origin}${path}`); + return configValue; + } catch (e) { + throw new import_property_provider2.CredentialsProviderError( + e.message || `Not found in config files w/ profile [${profile}]: ${getSelectorName(configSelector.toString())}`, + { logger: init.logger } + ); } - if (!isHttpOrHttpsPrefixed(url.origin || url.protocol)) { - throw new InvalidArgumentError("Invalid URL protocol: the URL must start with `http:` or `https:`."); + }, "fromSharedConfigFiles"); + var isFunction = /* @__PURE__ */ __name((func) => typeof func === "function", "isFunction"); + var fromStatic = /* @__PURE__ */ __name((defaultValue) => isFunction(defaultValue) ? async () => await defaultValue() : (0, import_property_provider2.fromStatic)(defaultValue), "fromStatic"); + var loadConfig = /* @__PURE__ */ __name(({ environmentVariableSelector, configFileSelector, default: defaultValue }, configuration = {}) => (0, import_property_provider2.memoize)( + (0, import_property_provider2.chain)( + fromEnv(environmentVariableSelector), + fromSharedConfigFiles(configFileSelector, configuration), + fromStatic(defaultValue) + ) + ), "loadConfig"); + } +}); + +// node_modules/@smithy/middleware-endpoint/dist-cjs/adaptors/getEndpointUrlConfig.js +var require_getEndpointUrlConfig = __commonJS({ + "node_modules/@smithy/middleware-endpoint/dist-cjs/adaptors/getEndpointUrlConfig.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.getEndpointUrlConfig = void 0; + var shared_ini_file_loader_1 = require_dist_cjs13(); + var ENV_ENDPOINT_URL = "AWS_ENDPOINT_URL"; + var CONFIG_ENDPOINT_URL = "endpoint_url"; + var getEndpointUrlConfig = (serviceId) => ({ + environmentVariableSelector: (env) => { + const serviceSuffixParts = serviceId.split(" ").map((w) => w.toUpperCase()); + const serviceEndpointUrl = env[[ENV_ENDPOINT_URL, ...serviceSuffixParts].join("_")]; + if (serviceEndpointUrl) + return serviceEndpointUrl; + const endpointUrl = env[ENV_ENDPOINT_URL]; + if (endpointUrl) + return endpointUrl; + return void 0; + }, + configFileSelector: (profile, config) => { + if (config && profile.services) { + const servicesSection = config[["services", profile.services].join(shared_ini_file_loader_1.CONFIG_PREFIX_SEPARATOR)]; + if (servicesSection) { + const servicePrefixParts = serviceId.split(" ").map((w) => w.toLowerCase()); + const endpointUrl2 = servicesSection[[servicePrefixParts.join("_"), CONFIG_ENDPOINT_URL].join(shared_ini_file_loader_1.CONFIG_PREFIX_SEPARATOR)]; + if (endpointUrl2) + return endpointUrl2; + } + } + const endpointUrl = profile[CONFIG_ENDPOINT_URL]; + if (endpointUrl) + return endpointUrl; + return void 0; + }, + default: void 0 + }); + exports2.getEndpointUrlConfig = getEndpointUrlConfig; + } +}); + +// node_modules/@smithy/middleware-endpoint/dist-cjs/adaptors/getEndpointFromConfig.js +var require_getEndpointFromConfig = __commonJS({ + "node_modules/@smithy/middleware-endpoint/dist-cjs/adaptors/getEndpointFromConfig.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.getEndpointFromConfig = void 0; + var node_config_provider_1 = require_dist_cjs14(); + var getEndpointUrlConfig_1 = require_getEndpointUrlConfig(); + var getEndpointFromConfig = async (serviceId) => (0, node_config_provider_1.loadConfig)((0, getEndpointUrlConfig_1.getEndpointUrlConfig)(serviceId))(); + exports2.getEndpointFromConfig = getEndpointFromConfig; + } +}); + +// node_modules/@smithy/querystring-parser/dist-cjs/index.js +var require_dist_cjs15 = __commonJS({ + "node_modules/@smithy/querystring-parser/dist-cjs/index.js"(exports2, module2) { + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); + }; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + } + return to; + }; + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + parseQueryString: () => parseQueryString + }); + module2.exports = __toCommonJS2(src_exports); + function parseQueryString(querystring) { + const query = {}; + querystring = querystring.replace(/^\?/, ""); + if (querystring) { + for (const pair of querystring.split("&")) { + let [key, value = null] = pair.split("="); + key = decodeURIComponent(key); + if (value) { + value = decodeURIComponent(value); + } + if (!(key in query)) { + query[key] = value; + } else if (Array.isArray(query[key])) { + query[key].push(value); + } else { + query[key] = [query[key], value]; + } + } } - return url; + return query; } - function parseOrigin(url) { - url = parseURL(url); - if (url.pathname !== "/" || url.search || url.hash) { - throw new InvalidArgumentError("invalid url"); + __name(parseQueryString, "parseQueryString"); + } +}); + +// node_modules/@smithy/url-parser/dist-cjs/index.js +var require_dist_cjs16 = __commonJS({ + "node_modules/@smithy/url-parser/dist-cjs/index.js"(exports2, module2) { + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); + }; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + } + return to; + }; + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + parseUrl: () => parseUrl2 + }); + module2.exports = __toCommonJS2(src_exports); + var import_querystring_parser = require_dist_cjs15(); + var parseUrl2 = /* @__PURE__ */ __name((url) => { + if (typeof url === "string") { + return parseUrl2(new URL(url)); } - return url; - } - function getHostname(host) { - if (host[0] === "[") { - const idx2 = host.indexOf("]"); - assert(idx2 !== -1); - return host.substring(1, idx2); + const { hostname, pathname, port, protocol, search } = url; + let query; + if (search) { + query = (0, import_querystring_parser.parseQueryString)(search); } - const idx = host.indexOf(":"); - if (idx === -1) return host; - return host.substring(0, idx); - } - function getServerName(host) { - if (!host) { - return null; + return { + hostname, + port: port ? parseInt(port) : void 0, + protocol, + path: pathname, + query + }; + }, "parseUrl"); + } +}); + +// node_modules/@smithy/middleware-serde/dist-cjs/index.js +var require_dist_cjs17 = __commonJS({ + "node_modules/@smithy/middleware-serde/dist-cjs/index.js"(exports2, module2) { + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); + }; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + } + return to; + }; + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + deserializerMiddleware: () => deserializerMiddleware, + deserializerMiddlewareOption: () => deserializerMiddlewareOption, + getSerdePlugin: () => getSerdePlugin, + serializerMiddleware: () => serializerMiddleware, + serializerMiddlewareOption: () => serializerMiddlewareOption2 + }); + module2.exports = __toCommonJS2(src_exports); + var deserializerMiddleware = /* @__PURE__ */ __name((options, deserializer) => (next) => async (args) => { + const { response } = await next(args); + try { + const parsed = await deserializer(response, options); + return { + response, + output: parsed + }; + } catch (error) { + Object.defineProperty(error, "$response", { + value: response + }); + if (!("$metadata" in error)) { + const hint = `Deserialization error: to see the raw response, inspect the hidden field {error}.$response on this object.`; + error.message += "\n " + hint; + if (typeof error.$responseBodyText !== "undefined") { + if (error.$response) { + error.$response.body = error.$responseBodyText; + } + } + } + throw error; } - assert.strictEqual(typeof host, "string"); - const servername = getHostname(host); - if (net.isIP(servername)) { - return ""; + }, "deserializerMiddleware"); + var serializerMiddleware = /* @__PURE__ */ __name((options, serializer) => (next, context) => async (args) => { + var _a; + const endpoint2 = ((_a = context.endpointV2) == null ? void 0 : _a.url) && options.urlParser ? async () => options.urlParser(context.endpointV2.url) : options.endpoint; + if (!endpoint2) { + throw new Error("No valid endpoint provider available."); } - return servername; - } - function deepClone(obj) { - return JSON.parse(JSON.stringify(obj)); - } - function isAsyncIterable(obj) { - return !!(obj != null && typeof obj[Symbol.asyncIterator] === "function"); - } - function isIterable(obj) { - return !!(obj != null && (typeof obj[Symbol.iterator] === "function" || typeof obj[Symbol.asyncIterator] === "function")); + const request2 = await serializer(args.input, { ...options, endpoint: endpoint2 }); + return next({ + ...args, + request: request2 + }); + }, "serializerMiddleware"); + var deserializerMiddlewareOption = { + name: "deserializerMiddleware", + step: "deserialize", + tags: ["DESERIALIZER"], + override: true + }; + var serializerMiddlewareOption2 = { + name: "serializerMiddleware", + step: "serialize", + tags: ["SERIALIZER"], + override: true + }; + function getSerdePlugin(config, serializer, deserializer) { + return { + applyToStack: (commandStack) => { + commandStack.add(deserializerMiddleware(config, deserializer), deserializerMiddlewareOption); + commandStack.add(serializerMiddleware(config, serializer), serializerMiddlewareOption2); + } + }; } - function bodyLength(body) { - if (body == null) { - return 0; - } else if (isStream(body)) { - const state = body._readableState; - return state && state.objectMode === false && state.ended === true && Number.isFinite(state.length) ? state.length : null; - } else if (isBlobLike(body)) { - return body.size != null ? body.size : null; - } else if (isBuffer(body)) { - return body.byteLength; + __name(getSerdePlugin, "getSerdePlugin"); + } +}); + +// node_modules/@smithy/middleware-endpoint/dist-cjs/index.js +var require_dist_cjs18 = __commonJS({ + "node_modules/@smithy/middleware-endpoint/dist-cjs/index.js"(exports2, module2) { + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); + }; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + } + return to; + }; + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + endpointMiddleware: () => endpointMiddleware, + endpointMiddlewareOptions: () => endpointMiddlewareOptions2, + getEndpointFromInstructions: () => getEndpointFromInstructions, + getEndpointPlugin: () => getEndpointPlugin, + resolveEndpointConfig: () => resolveEndpointConfig, + resolveParams: () => resolveParams, + toEndpointV1: () => toEndpointV1 + }); + module2.exports = __toCommonJS2(src_exports); + var resolveParamsForS3 = /* @__PURE__ */ __name(async (endpointParams) => { + const bucket = (endpointParams == null ? void 0 : endpointParams.Bucket) || ""; + if (typeof endpointParams.Bucket === "string") { + endpointParams.Bucket = bucket.replace(/#/g, encodeURIComponent("#")).replace(/\?/g, encodeURIComponent("?")); + } + if (isArnBucketName(bucket)) { + if (endpointParams.ForcePathStyle === true) { + throw new Error("Path-style addressing cannot be used with ARN buckets"); + } + } else if (!isDnsCompatibleBucketName(bucket) || bucket.indexOf(".") !== -1 && !String(endpointParams.Endpoint).startsWith("http:") || bucket.toLowerCase() !== bucket || bucket.length < 3) { + endpointParams.ForcePathStyle = true; + } + if (endpointParams.DisableMultiRegionAccessPoints) { + endpointParams.disableMultiRegionAccessPoints = true; + endpointParams.DisableMRAP = true; + } + return endpointParams; + }, "resolveParamsForS3"); + var DOMAIN_PATTERN = /^[a-z0-9][a-z0-9\.\-]{1,61}[a-z0-9]$/; + var IP_ADDRESS_PATTERN = /(\d+\.){3}\d+/; + var DOTS_PATTERN = /\.\./; + var isDnsCompatibleBucketName = /* @__PURE__ */ __name((bucketName) => DOMAIN_PATTERN.test(bucketName) && !IP_ADDRESS_PATTERN.test(bucketName) && !DOTS_PATTERN.test(bucketName), "isDnsCompatibleBucketName"); + var isArnBucketName = /* @__PURE__ */ __name((bucketName) => { + const [arn, partition, service, , , bucket] = bucketName.split(":"); + const isArn = arn === "arn" && bucketName.split(":").length >= 6; + const isValidArn = Boolean(isArn && partition && service && bucket); + if (isArn && !isValidArn) { + throw new Error(`Invalid ARN: ${bucketName} was an invalid ARN.`); + } + return isValidArn; + }, "isArnBucketName"); + var createConfigValueProvider = /* @__PURE__ */ __name((configKey, canonicalEndpointParamKey, config) => { + const configProvider = /* @__PURE__ */ __name(async () => { + const configValue = config[configKey] ?? config[canonicalEndpointParamKey]; + if (typeof configValue === "function") { + return configValue(); + } + return configValue; + }, "configProvider"); + if (configKey === "credentialScope" || canonicalEndpointParamKey === "CredentialScope") { + return async () => { + const credentials = typeof config.credentials === "function" ? await config.credentials() : config.credentials; + const configValue = (credentials == null ? void 0 : credentials.credentialScope) ?? (credentials == null ? void 0 : credentials.CredentialScope); + return configValue; + }; } - return null; - } - function isDestroyed(body) { - return body && !!(body.destroyed || body[kDestroyed] || stream.isDestroyed?.(body)); - } - function destroy(stream2, err) { - if (stream2 == null || !isStream(stream2) || isDestroyed(stream2)) { - return; + if (configKey === "accountId" || canonicalEndpointParamKey === "AccountId") { + return async () => { + const credentials = typeof config.credentials === "function" ? await config.credentials() : config.credentials; + const configValue = (credentials == null ? void 0 : credentials.accountId) ?? (credentials == null ? void 0 : credentials.AccountId); + return configValue; + }; } - if (typeof stream2.destroy === "function") { - if (Object.getPrototypeOf(stream2).constructor === IncomingMessage) { - stream2.socket = null; + if (configKey === "endpoint" || canonicalEndpointParamKey === "endpoint") { + return async () => { + const endpoint2 = await configProvider(); + if (endpoint2 && typeof endpoint2 === "object") { + if ("url" in endpoint2) { + return endpoint2.url.href; + } + if ("hostname" in endpoint2) { + const { protocol, hostname, port, path } = endpoint2; + return `${protocol}//${hostname}${port ? ":" + port : ""}${path}`; + } + } + return endpoint2; + }; + } + return configProvider; + }, "createConfigValueProvider"); + var import_getEndpointFromConfig = require_getEndpointFromConfig(); + var import_url_parser = require_dist_cjs16(); + var toEndpointV1 = /* @__PURE__ */ __name((endpoint2) => { + if (typeof endpoint2 === "object") { + if ("url" in endpoint2) { + return (0, import_url_parser.parseUrl)(endpoint2.url); + } + return endpoint2; + } + return (0, import_url_parser.parseUrl)(endpoint2); + }, "toEndpointV1"); + var getEndpointFromInstructions = /* @__PURE__ */ __name(async (commandInput, instructionsSupplier, clientConfig, context) => { + if (!clientConfig.endpoint) { + const endpointFromConfig = await (0, import_getEndpointFromConfig.getEndpointFromConfig)(clientConfig.serviceId || ""); + if (endpointFromConfig) { + clientConfig.endpoint = () => Promise.resolve(toEndpointV1(endpointFromConfig)); + } + } + const endpointParams = await resolveParams(commandInput, instructionsSupplier, clientConfig); + if (typeof clientConfig.endpointProvider !== "function") { + throw new Error("config.endpointProvider is not set."); + } + const endpoint2 = clientConfig.endpointProvider(endpointParams, context); + return endpoint2; + }, "getEndpointFromInstructions"); + var resolveParams = /* @__PURE__ */ __name(async (commandInput, instructionsSupplier, clientConfig) => { + var _a; + const endpointParams = {}; + const instructions = ((_a = instructionsSupplier == null ? void 0 : instructionsSupplier.getEndpointParameterInstructions) == null ? void 0 : _a.call(instructionsSupplier)) || {}; + for (const [name, instruction] of Object.entries(instructions)) { + switch (instruction.type) { + case "staticContextParams": + endpointParams[name] = instruction.value; + break; + case "contextParams": + endpointParams[name] = commandInput[instruction.name]; + break; + case "clientContextParams": + case "builtInParams": + endpointParams[name] = await createConfigValueProvider(instruction.name, name, clientConfig)(); + break; + default: + throw new Error("Unrecognized endpoint parameter instruction: " + JSON.stringify(instruction)); + } + } + if (Object.keys(instructions).length === 0) { + Object.assign(endpointParams, clientConfig); + } + if (String(clientConfig.serviceId).toLowerCase() === "s3") { + await resolveParamsForS3(endpointParams); + } + return endpointParams; + }, "resolveParams"); + var import_util_middleware3 = require_dist_cjs10(); + var endpointMiddleware = /* @__PURE__ */ __name(({ + config, + instructions + }) => { + return (next, context) => async (args) => { + var _a, _b, _c; + const endpoint2 = await getEndpointFromInstructions( + args.input, + { + getEndpointParameterInstructions() { + return instructions; + } + }, + { ...config }, + context + ); + context.endpointV2 = endpoint2; + context.authSchemes = (_a = endpoint2.properties) == null ? void 0 : _a.authSchemes; + const authScheme = (_b = context.authSchemes) == null ? void 0 : _b[0]; + if (authScheme) { + context["signing_region"] = authScheme.signingRegion; + context["signing_service"] = authScheme.signingName; + const smithyContext = (0, import_util_middleware3.getSmithyContext)(context); + const httpAuthOption = (_c = smithyContext == null ? void 0 : smithyContext.selectedHttpAuthScheme) == null ? void 0 : _c.httpAuthOption; + if (httpAuthOption) { + httpAuthOption.signingProperties = Object.assign( + httpAuthOption.signingProperties || {}, + { + signing_region: authScheme.signingRegion, + signingRegion: authScheme.signingRegion, + signing_service: authScheme.signingName, + signingName: authScheme.signingName, + signingRegionSet: authScheme.signingRegionSet + }, + authScheme.properties + ); + } } - stream2.destroy(err); - } else if (err) { - queueMicrotask(() => { - stream2.emit("error", err); + return next({ + ...args }); + }; + }, "endpointMiddleware"); + var import_middleware_serde2 = require_dist_cjs17(); + var endpointMiddlewareOptions2 = { + step: "serialize", + tags: ["ENDPOINT_PARAMETERS", "ENDPOINT_V2", "ENDPOINT"], + name: "endpointV2Middleware", + override: true, + relation: "before", + toMiddleware: import_middleware_serde2.serializerMiddlewareOption.name + }; + var getEndpointPlugin = /* @__PURE__ */ __name((config, instructions) => ({ + applyToStack: (clientStack) => { + clientStack.addRelativeTo( + endpointMiddleware({ + config, + instructions + }), + endpointMiddlewareOptions2 + ); } - if (stream2.destroyed !== true) { - stream2[kDestroyed] = true; + }), "getEndpointPlugin"); + var resolveEndpointConfig = /* @__PURE__ */ __name((input) => { + const tls = input.tls ?? true; + const { endpoint: endpoint2 } = input; + const customEndpointProvider = endpoint2 != null ? async () => toEndpointV1(await (0, import_util_middleware3.normalizeProvider)(endpoint2)()) : void 0; + const isCustomEndpoint = !!endpoint2; + return { + ...input, + endpoint: customEndpointProvider, + tls, + isCustomEndpoint, + useDualstackEndpoint: (0, import_util_middleware3.normalizeProvider)(input.useDualstackEndpoint ?? false), + useFipsEndpoint: (0, import_util_middleware3.normalizeProvider)(input.useFipsEndpoint ?? false) + }; + }, "resolveEndpointConfig"); + } +}); + +// node_modules/@smithy/core/dist-es/middleware-http-auth-scheme/getHttpAuthSchemeEndpointRuleSetPlugin.js +var import_middleware_endpoint, httpAuthSchemeEndpointRuleSetMiddlewareOptions, getHttpAuthSchemeEndpointRuleSetPlugin; +var init_getHttpAuthSchemeEndpointRuleSetPlugin = __esm({ + "node_modules/@smithy/core/dist-es/middleware-http-auth-scheme/getHttpAuthSchemeEndpointRuleSetPlugin.js"() { + import_middleware_endpoint = __toESM(require_dist_cjs18()); + init_httpAuthSchemeMiddleware(); + httpAuthSchemeEndpointRuleSetMiddlewareOptions = { + step: "serialize", + tags: ["HTTP_AUTH_SCHEME"], + name: "httpAuthSchemeMiddleware", + override: true, + relation: "before", + toMiddleware: import_middleware_endpoint.endpointMiddlewareOptions.name + }; + getHttpAuthSchemeEndpointRuleSetPlugin = (config, { httpAuthSchemeParametersProvider, identityProviderConfigProvider }) => ({ + applyToStack: (clientStack) => { + clientStack.addRelativeTo(httpAuthSchemeMiddleware(config, { + httpAuthSchemeParametersProvider, + identityProviderConfigProvider + }), httpAuthSchemeEndpointRuleSetMiddlewareOptions); } + }); + } +}); + +// node_modules/@smithy/core/dist-es/middleware-http-auth-scheme/getHttpAuthSchemePlugin.js +var import_middleware_serde, httpAuthSchemeMiddlewareOptions, getHttpAuthSchemePlugin; +var init_getHttpAuthSchemePlugin = __esm({ + "node_modules/@smithy/core/dist-es/middleware-http-auth-scheme/getHttpAuthSchemePlugin.js"() { + import_middleware_serde = __toESM(require_dist_cjs17()); + init_httpAuthSchemeMiddleware(); + httpAuthSchemeMiddlewareOptions = { + step: "serialize", + tags: ["HTTP_AUTH_SCHEME"], + name: "httpAuthSchemeMiddleware", + override: true, + relation: "before", + toMiddleware: import_middleware_serde.serializerMiddlewareOption.name + }; + getHttpAuthSchemePlugin = (config, { httpAuthSchemeParametersProvider, identityProviderConfigProvider }) => ({ + applyToStack: (clientStack) => { + clientStack.addRelativeTo(httpAuthSchemeMiddleware(config, { + httpAuthSchemeParametersProvider, + identityProviderConfigProvider + }), httpAuthSchemeMiddlewareOptions); + } + }); + } +}); + +// node_modules/@smithy/core/dist-es/middleware-http-auth-scheme/index.js +var init_middleware_http_auth_scheme = __esm({ + "node_modules/@smithy/core/dist-es/middleware-http-auth-scheme/index.js"() { + init_httpAuthSchemeMiddleware(); + init_getHttpAuthSchemeEndpointRuleSetPlugin(); + init_getHttpAuthSchemePlugin(); + } +}); + +// node_modules/@smithy/core/dist-es/middleware-http-signing/httpSigningMiddleware.js +var import_protocol_http, import_types2, import_util_middleware2, defaultErrorHandler, defaultSuccessHandler, httpSigningMiddleware; +var init_httpSigningMiddleware = __esm({ + "node_modules/@smithy/core/dist-es/middleware-http-signing/httpSigningMiddleware.js"() { + import_protocol_http = __toESM(require_dist_cjs2()); + import_types2 = __toESM(require_dist_cjs()); + import_util_middleware2 = __toESM(require_dist_cjs10()); + defaultErrorHandler = (signingProperties) => (error) => { + throw error; + }; + defaultSuccessHandler = (httpResponse, signingProperties) => { + }; + httpSigningMiddleware = (config) => (next, context) => async (args) => { + if (!import_protocol_http.HttpRequest.isInstance(args.request)) { + return next(args); + } + const smithyContext = (0, import_util_middleware2.getSmithyContext)(context); + const scheme = smithyContext.selectedHttpAuthScheme; + if (!scheme) { + throw new Error(`No HttpAuthScheme was selected: unable to sign request`); + } + const { httpAuthOption: { signingProperties = {} }, identity, signer } = scheme; + const output = await next({ + ...args, + request: await signer.sign(args.request, identity, signingProperties) + }).catch((signer.errorHandler || defaultErrorHandler)(signingProperties)); + (signer.successHandler || defaultSuccessHandler)(output.response, signingProperties); + return output; + }; + } +}); + +// node_modules/@smithy/middleware-retry/node_modules/uuid/dist/esm-node/rng.js +function rng2() { + if (poolPtr2 > rnds8Pool2.length - 16) { + import_crypto4.default.randomFillSync(rnds8Pool2); + poolPtr2 = 0; + } + return rnds8Pool2.slice(poolPtr2, poolPtr2 += 16); +} +var import_crypto4, rnds8Pool2, poolPtr2; +var init_rng2 = __esm({ + "node_modules/@smithy/middleware-retry/node_modules/uuid/dist/esm-node/rng.js"() { + import_crypto4 = __toESM(require("crypto")); + rnds8Pool2 = new Uint8Array(256); + poolPtr2 = rnds8Pool2.length; + } +}); + +// node_modules/@smithy/middleware-retry/node_modules/uuid/dist/esm-node/regex.js +var regex_default2; +var init_regex2 = __esm({ + "node_modules/@smithy/middleware-retry/node_modules/uuid/dist/esm-node/regex.js"() { + regex_default2 = /^(?:[0-9a-f]{8}-[0-9a-f]{4}-[1-5][0-9a-f]{3}-[89ab][0-9a-f]{3}-[0-9a-f]{12}|00000000-0000-0000-0000-000000000000)$/i; + } +}); + +// node_modules/@smithy/middleware-retry/node_modules/uuid/dist/esm-node/validate.js +function validate2(uuid) { + return typeof uuid === "string" && regex_default2.test(uuid); +} +var validate_default2; +var init_validate2 = __esm({ + "node_modules/@smithy/middleware-retry/node_modules/uuid/dist/esm-node/validate.js"() { + init_regex2(); + validate_default2 = validate2; + } +}); + +// node_modules/@smithy/middleware-retry/node_modules/uuid/dist/esm-node/stringify.js +function unsafeStringify(arr, offset = 0) { + return byteToHex2[arr[offset + 0]] + byteToHex2[arr[offset + 1]] + byteToHex2[arr[offset + 2]] + byteToHex2[arr[offset + 3]] + "-" + byteToHex2[arr[offset + 4]] + byteToHex2[arr[offset + 5]] + "-" + byteToHex2[arr[offset + 6]] + byteToHex2[arr[offset + 7]] + "-" + byteToHex2[arr[offset + 8]] + byteToHex2[arr[offset + 9]] + "-" + byteToHex2[arr[offset + 10]] + byteToHex2[arr[offset + 11]] + byteToHex2[arr[offset + 12]] + byteToHex2[arr[offset + 13]] + byteToHex2[arr[offset + 14]] + byteToHex2[arr[offset + 15]]; +} +function stringify2(arr, offset = 0) { + const uuid = unsafeStringify(arr, offset); + if (!validate_default2(uuid)) { + throw TypeError("Stringified UUID is invalid"); + } + return uuid; +} +var byteToHex2, stringify_default2; +var init_stringify2 = __esm({ + "node_modules/@smithy/middleware-retry/node_modules/uuid/dist/esm-node/stringify.js"() { + init_validate2(); + byteToHex2 = []; + for (let i = 0; i < 256; ++i) { + byteToHex2.push((i + 256).toString(16).slice(1)); } - var KEEPALIVE_TIMEOUT_EXPR = /timeout=(\d+)/; - function parseKeepAliveTimeout(val) { - const m = val.toString().match(KEEPALIVE_TIMEOUT_EXPR); - return m ? parseInt(m[1], 10) * 1e3 : null; + stringify_default2 = stringify2; + } +}); + +// node_modules/@smithy/middleware-retry/node_modules/uuid/dist/esm-node/v1.js +function v12(options, buf, offset) { + let i = buf && offset || 0; + const b = buf || new Array(16); + options = options || {}; + let node = options.node || _nodeId2; + let clockseq = options.clockseq !== void 0 ? options.clockseq : _clockseq2; + if (node == null || clockseq == null) { + const seedBytes = options.random || (options.rng || rng2)(); + if (node == null) { + node = _nodeId2 = [seedBytes[0] | 1, seedBytes[1], seedBytes[2], seedBytes[3], seedBytes[4], seedBytes[5]]; } - function headerNameToString(value) { - return typeof value === "string" ? headerNameLowerCasedRecord[value] ?? value.toLowerCase() : tree.lookup(value) ?? value.toString("latin1").toLowerCase(); + if (clockseq == null) { + clockseq = _clockseq2 = (seedBytes[6] << 8 | seedBytes[7]) & 16383; } - function bufferToLowerCasedHeaderName(value) { - return tree.lookup(value) ?? value.toString("latin1").toLowerCase(); + } + let msecs = options.msecs !== void 0 ? options.msecs : Date.now(); + let nsecs = options.nsecs !== void 0 ? options.nsecs : _lastNSecs2 + 1; + const dt = msecs - _lastMSecs2 + (nsecs - _lastNSecs2) / 1e4; + if (dt < 0 && options.clockseq === void 0) { + clockseq = clockseq + 1 & 16383; + } + if ((dt < 0 || msecs > _lastMSecs2) && options.nsecs === void 0) { + nsecs = 0; + } + if (nsecs >= 1e4) { + throw new Error("uuid.v1(): Can't create more than 10M uuids/sec"); + } + _lastMSecs2 = msecs; + _lastNSecs2 = nsecs; + _clockseq2 = clockseq; + msecs += 122192928e5; + const tl = ((msecs & 268435455) * 1e4 + nsecs) % 4294967296; + b[i++] = tl >>> 24 & 255; + b[i++] = tl >>> 16 & 255; + b[i++] = tl >>> 8 & 255; + b[i++] = tl & 255; + const tmh = msecs / 4294967296 * 1e4 & 268435455; + b[i++] = tmh >>> 8 & 255; + b[i++] = tmh & 255; + b[i++] = tmh >>> 24 & 15 | 16; + b[i++] = tmh >>> 16 & 255; + b[i++] = clockseq >>> 8 | 128; + b[i++] = clockseq & 255; + for (let n = 0; n < 6; ++n) { + b[i + n] = node[n]; + } + return buf || unsafeStringify(b); +} +var _nodeId2, _clockseq2, _lastMSecs2, _lastNSecs2, v1_default2; +var init_v12 = __esm({ + "node_modules/@smithy/middleware-retry/node_modules/uuid/dist/esm-node/v1.js"() { + init_rng2(); + init_stringify2(); + _lastMSecs2 = 0; + _lastNSecs2 = 0; + v1_default2 = v12; + } +}); + +// node_modules/@smithy/middleware-retry/node_modules/uuid/dist/esm-node/parse.js +function parse2(uuid) { + if (!validate_default2(uuid)) { + throw TypeError("Invalid UUID"); + } + let v; + const arr = new Uint8Array(16); + arr[0] = (v = parseInt(uuid.slice(0, 8), 16)) >>> 24; + arr[1] = v >>> 16 & 255; + arr[2] = v >>> 8 & 255; + arr[3] = v & 255; + arr[4] = (v = parseInt(uuid.slice(9, 13), 16)) >>> 8; + arr[5] = v & 255; + arr[6] = (v = parseInt(uuid.slice(14, 18), 16)) >>> 8; + arr[7] = v & 255; + arr[8] = (v = parseInt(uuid.slice(19, 23), 16)) >>> 8; + arr[9] = v & 255; + arr[10] = (v = parseInt(uuid.slice(24, 36), 16)) / 1099511627776 & 255; + arr[11] = v / 4294967296 & 255; + arr[12] = v >>> 24 & 255; + arr[13] = v >>> 16 & 255; + arr[14] = v >>> 8 & 255; + arr[15] = v & 255; + return arr; +} +var parse_default2; +var init_parse2 = __esm({ + "node_modules/@smithy/middleware-retry/node_modules/uuid/dist/esm-node/parse.js"() { + init_validate2(); + parse_default2 = parse2; + } +}); + +// node_modules/@smithy/middleware-retry/node_modules/uuid/dist/esm-node/v35.js +function stringToBytes2(str) { + str = unescape(encodeURIComponent(str)); + const bytes = []; + for (let i = 0; i < str.length; ++i) { + bytes.push(str.charCodeAt(i)); + } + return bytes; +} +function v35(name, version3, hashfunc) { + function generateUUID(value, namespace, buf, offset) { + var _namespace; + if (typeof value === "string") { + value = stringToBytes2(value); } - function parseHeaders(headers, obj) { - if (obj === void 0) obj = {}; - for (let i = 0; i < headers.length; i += 2) { - const key = headerNameToString(headers[i]); - let val = obj[key]; - if (val) { - if (typeof val === "string") { - val = [val]; - obj[key] = val; - } - val.push(headers[i + 1].toString("utf8")); - } else { - const headersValue = headers[i + 1]; - if (typeof headersValue === "string") { - obj[key] = headersValue; - } else { - obj[key] = Array.isArray(headersValue) ? headersValue.map((x) => x.toString("utf8")) : headersValue.toString("utf8"); - } - } - } - if ("content-length" in obj && "content-disposition" in obj) { - obj["content-disposition"] = Buffer.from(obj["content-disposition"]).toString("latin1"); - } - return obj; + if (typeof namespace === "string") { + namespace = parse_default2(namespace); } - function parseRawHeaders(headers) { - const len = headers.length; - const ret = new Array(len); - let hasContentLength = false; - let contentDispositionIdx = -1; - let key; - let val; - let kLen = 0; - for (let n = 0; n < headers.length; n += 2) { - key = headers[n]; - val = headers[n + 1]; - typeof key !== "string" && (key = key.toString()); - typeof val !== "string" && (val = val.toString("utf8")); - kLen = key.length; - if (kLen === 14 && key[7] === "-" && (key === "content-length" || key.toLowerCase() === "content-length")) { - hasContentLength = true; - } else if (kLen === 19 && key[7] === "-" && (key === "content-disposition" || key.toLowerCase() === "content-disposition")) { - contentDispositionIdx = n + 1; - } - ret[n] = key; - ret[n + 1] = val; - } - if (hasContentLength && contentDispositionIdx !== -1) { - ret[contentDispositionIdx] = Buffer.from(ret[contentDispositionIdx]).toString("latin1"); + if (((_namespace = namespace) === null || _namespace === void 0 ? void 0 : _namespace.length) !== 16) { + throw TypeError("Namespace must be array-like (16 iterable integer values, 0-255)"); + } + let bytes = new Uint8Array(16 + value.length); + bytes.set(namespace); + bytes.set(value, namespace.length); + bytes = hashfunc(bytes); + bytes[6] = bytes[6] & 15 | version3; + bytes[8] = bytes[8] & 63 | 128; + if (buf) { + offset = offset || 0; + for (let i = 0; i < 16; ++i) { + buf[offset + i] = bytes[i]; } - return ret; + return buf; } - function isBuffer(buffer) { - return buffer instanceof Uint8Array || Buffer.isBuffer(buffer); + return unsafeStringify(bytes); + } + try { + generateUUID.name = name; + } catch (err) { + } + generateUUID.DNS = DNS2; + generateUUID.URL = URL3; + return generateUUID; +} +var DNS2, URL3; +var init_v352 = __esm({ + "node_modules/@smithy/middleware-retry/node_modules/uuid/dist/esm-node/v35.js"() { + init_stringify2(); + init_parse2(); + DNS2 = "6ba7b810-9dad-11d1-80b4-00c04fd430c8"; + URL3 = "6ba7b811-9dad-11d1-80b4-00c04fd430c8"; + } +}); + +// node_modules/@smithy/middleware-retry/node_modules/uuid/dist/esm-node/md5.js +function md52(bytes) { + if (Array.isArray(bytes)) { + bytes = Buffer.from(bytes); + } else if (typeof bytes === "string") { + bytes = Buffer.from(bytes, "utf8"); + } + return import_crypto5.default.createHash("md5").update(bytes).digest(); +} +var import_crypto5, md5_default2; +var init_md52 = __esm({ + "node_modules/@smithy/middleware-retry/node_modules/uuid/dist/esm-node/md5.js"() { + import_crypto5 = __toESM(require("crypto")); + md5_default2 = md52; + } +}); + +// node_modules/@smithy/middleware-retry/node_modules/uuid/dist/esm-node/v3.js +var v32, v3_default2; +var init_v32 = __esm({ + "node_modules/@smithy/middleware-retry/node_modules/uuid/dist/esm-node/v3.js"() { + init_v352(); + init_md52(); + v32 = v35("v3", 48, md5_default2); + v3_default2 = v32; + } +}); + +// node_modules/@smithy/middleware-retry/node_modules/uuid/dist/esm-node/native.js +var import_crypto6, native_default; +var init_native = __esm({ + "node_modules/@smithy/middleware-retry/node_modules/uuid/dist/esm-node/native.js"() { + import_crypto6 = __toESM(require("crypto")); + native_default = { + randomUUID: import_crypto6.default.randomUUID + }; + } +}); + +// node_modules/@smithy/middleware-retry/node_modules/uuid/dist/esm-node/v4.js +function v42(options, buf, offset) { + if (native_default.randomUUID && !buf && !options) { + return native_default.randomUUID(); + } + options = options || {}; + const rnds = options.random || (options.rng || rng2)(); + rnds[6] = rnds[6] & 15 | 64; + rnds[8] = rnds[8] & 63 | 128; + if (buf) { + offset = offset || 0; + for (let i = 0; i < 16; ++i) { + buf[offset + i] = rnds[i]; } - function validateHandler(handler, method, upgrade) { - if (!handler || typeof handler !== "object") { - throw new InvalidArgumentError("handler must be an object"); - } - if (typeof handler.onConnect !== "function") { - throw new InvalidArgumentError("invalid onConnect method"); - } - if (typeof handler.onError !== "function") { - throw new InvalidArgumentError("invalid onError method"); - } - if (typeof handler.onBodySent !== "function" && handler.onBodySent !== void 0) { - throw new InvalidArgumentError("invalid onBodySent method"); + return buf; + } + return unsafeStringify(rnds); +} +var v4_default2; +var init_v42 = __esm({ + "node_modules/@smithy/middleware-retry/node_modules/uuid/dist/esm-node/v4.js"() { + init_native(); + init_rng2(); + init_stringify2(); + v4_default2 = v42; + } +}); + +// node_modules/@smithy/middleware-retry/node_modules/uuid/dist/esm-node/sha1.js +function sha12(bytes) { + if (Array.isArray(bytes)) { + bytes = Buffer.from(bytes); + } else if (typeof bytes === "string") { + bytes = Buffer.from(bytes, "utf8"); + } + return import_crypto7.default.createHash("sha1").update(bytes).digest(); +} +var import_crypto7, sha1_default2; +var init_sha12 = __esm({ + "node_modules/@smithy/middleware-retry/node_modules/uuid/dist/esm-node/sha1.js"() { + import_crypto7 = __toESM(require("crypto")); + sha1_default2 = sha12; + } +}); + +// node_modules/@smithy/middleware-retry/node_modules/uuid/dist/esm-node/v5.js +var v52, v5_default2; +var init_v52 = __esm({ + "node_modules/@smithy/middleware-retry/node_modules/uuid/dist/esm-node/v5.js"() { + init_v352(); + init_sha12(); + v52 = v35("v5", 80, sha1_default2); + v5_default2 = v52; + } +}); + +// node_modules/@smithy/middleware-retry/node_modules/uuid/dist/esm-node/nil.js +var nil_default2; +var init_nil2 = __esm({ + "node_modules/@smithy/middleware-retry/node_modules/uuid/dist/esm-node/nil.js"() { + nil_default2 = "00000000-0000-0000-0000-000000000000"; + } +}); + +// node_modules/@smithy/middleware-retry/node_modules/uuid/dist/esm-node/version.js +function version2(uuid) { + if (!validate_default2(uuid)) { + throw TypeError("Invalid UUID"); + } + return parseInt(uuid.slice(14, 15), 16); +} +var version_default2; +var init_version2 = __esm({ + "node_modules/@smithy/middleware-retry/node_modules/uuid/dist/esm-node/version.js"() { + init_validate2(); + version_default2 = version2; + } +}); + +// node_modules/@smithy/middleware-retry/node_modules/uuid/dist/esm-node/index.js +var esm_node_exports2 = {}; +__export(esm_node_exports2, { + NIL: () => nil_default2, + parse: () => parse_default2, + stringify: () => stringify_default2, + v1: () => v1_default2, + v3: () => v3_default2, + v4: () => v4_default2, + v5: () => v5_default2, + validate: () => validate_default2, + version: () => version_default2 +}); +var init_esm_node2 = __esm({ + "node_modules/@smithy/middleware-retry/node_modules/uuid/dist/esm-node/index.js"() { + init_v12(); + init_v32(); + init_v42(); + init_v52(); + init_nil2(); + init_version2(); + init_validate2(); + init_stringify2(); + init_parse2(); + } +}); + +// node_modules/@smithy/service-error-classification/dist-cjs/index.js +var require_dist_cjs19 = __commonJS({ + "node_modules/@smithy/service-error-classification/dist-cjs/index.js"(exports2, module2) { + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); + }; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + } + return to; + }; + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + isClockSkewCorrectedError: () => isClockSkewCorrectedError, + isClockSkewError: () => isClockSkewError, + isRetryableByTrait: () => isRetryableByTrait, + isServerError: () => isServerError, + isThrottlingError: () => isThrottlingError, + isTransientError: () => isTransientError + }); + module2.exports = __toCommonJS2(src_exports); + var CLOCK_SKEW_ERROR_CODES = [ + "AuthFailure", + "InvalidSignatureException", + "RequestExpired", + "RequestInTheFuture", + "RequestTimeTooSkewed", + "SignatureDoesNotMatch" + ]; + var THROTTLING_ERROR_CODES = [ + "BandwidthLimitExceeded", + "EC2ThrottledException", + "LimitExceededException", + "PriorRequestNotComplete", + "ProvisionedThroughputExceededException", + "RequestLimitExceeded", + "RequestThrottled", + "RequestThrottledException", + "SlowDown", + "ThrottledException", + "Throttling", + "ThrottlingException", + "TooManyRequestsException", + "TransactionInProgressException" + // DynamoDB + ]; + var TRANSIENT_ERROR_CODES = ["TimeoutError", "RequestTimeout", "RequestTimeoutException"]; + var TRANSIENT_ERROR_STATUS_CODES = [500, 502, 503, 504]; + var NODEJS_TIMEOUT_ERROR_CODES = ["ECONNRESET", "ECONNREFUSED", "EPIPE", "ETIMEDOUT"]; + var isRetryableByTrait = /* @__PURE__ */ __name((error) => error.$retryable !== void 0, "isRetryableByTrait"); + var isClockSkewError = /* @__PURE__ */ __name((error) => CLOCK_SKEW_ERROR_CODES.includes(error.name), "isClockSkewError"); + var isClockSkewCorrectedError = /* @__PURE__ */ __name((error) => { + var _a; + return (_a = error.$metadata) == null ? void 0 : _a.clockSkewCorrected; + }, "isClockSkewCorrectedError"); + var isThrottlingError = /* @__PURE__ */ __name((error) => { + var _a, _b; + return ((_a = error.$metadata) == null ? void 0 : _a.httpStatusCode) === 429 || THROTTLING_ERROR_CODES.includes(error.name) || ((_b = error.$retryable) == null ? void 0 : _b.throttling) == true; + }, "isThrottlingError"); + var isTransientError = /* @__PURE__ */ __name((error) => { + var _a; + return isClockSkewCorrectedError(error) || TRANSIENT_ERROR_CODES.includes(error.name) || NODEJS_TIMEOUT_ERROR_CODES.includes((error == null ? void 0 : error.code) || "") || TRANSIENT_ERROR_STATUS_CODES.includes(((_a = error.$metadata) == null ? void 0 : _a.httpStatusCode) || 0); + }, "isTransientError"); + var isServerError = /* @__PURE__ */ __name((error) => { + var _a; + if (((_a = error.$metadata) == null ? void 0 : _a.httpStatusCode) !== void 0) { + const statusCode = error.$metadata.httpStatusCode; + if (500 <= statusCode && statusCode <= 599 && !isTransientError(error)) { + return true; + } + return false; } - if (upgrade || method === "CONNECT") { - if (typeof handler.onUpgrade !== "function") { - throw new InvalidArgumentError("invalid onUpgrade method"); + return false; + }, "isServerError"); + } +}); + +// node_modules/@smithy/util-retry/dist-cjs/index.js +var require_dist_cjs20 = __commonJS({ + "node_modules/@smithy/util-retry/dist-cjs/index.js"(exports2, module2) { + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); + }; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + } + return to; + }; + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + AdaptiveRetryStrategy: () => AdaptiveRetryStrategy, + ConfiguredRetryStrategy: () => ConfiguredRetryStrategy, + DEFAULT_MAX_ATTEMPTS: () => DEFAULT_MAX_ATTEMPTS, + DEFAULT_RETRY_DELAY_BASE: () => DEFAULT_RETRY_DELAY_BASE, + DEFAULT_RETRY_MODE: () => DEFAULT_RETRY_MODE, + DefaultRateLimiter: () => DefaultRateLimiter, + INITIAL_RETRY_TOKENS: () => INITIAL_RETRY_TOKENS, + INVOCATION_ID_HEADER: () => INVOCATION_ID_HEADER, + MAXIMUM_RETRY_DELAY: () => MAXIMUM_RETRY_DELAY, + NO_RETRY_INCREMENT: () => NO_RETRY_INCREMENT, + REQUEST_HEADER: () => REQUEST_HEADER, + RETRY_COST: () => RETRY_COST, + RETRY_MODES: () => RETRY_MODES, + StandardRetryStrategy: () => StandardRetryStrategy, + THROTTLING_RETRY_DELAY_BASE: () => THROTTLING_RETRY_DELAY_BASE, + TIMEOUT_RETRY_COST: () => TIMEOUT_RETRY_COST + }); + module2.exports = __toCommonJS2(src_exports); + var RETRY_MODES = /* @__PURE__ */ ((RETRY_MODES2) => { + RETRY_MODES2["STANDARD"] = "standard"; + RETRY_MODES2["ADAPTIVE"] = "adaptive"; + return RETRY_MODES2; + })(RETRY_MODES || {}); + var DEFAULT_MAX_ATTEMPTS = 3; + var DEFAULT_RETRY_MODE = "standard"; + var import_service_error_classification = require_dist_cjs19(); + var _DefaultRateLimiter = class _DefaultRateLimiter { + constructor(options) { + this.currentCapacity = 0; + this.enabled = false; + this.lastMaxRate = 0; + this.measuredTxRate = 0; + this.requestCount = 0; + this.lastTimestamp = 0; + this.timeWindow = 0; + this.beta = (options == null ? void 0 : options.beta) ?? 0.7; + this.minCapacity = (options == null ? void 0 : options.minCapacity) ?? 1; + this.minFillRate = (options == null ? void 0 : options.minFillRate) ?? 0.5; + this.scaleConstant = (options == null ? void 0 : options.scaleConstant) ?? 0.4; + this.smooth = (options == null ? void 0 : options.smooth) ?? 0.8; + const currentTimeInSeconds = this.getCurrentTimeInSeconds(); + this.lastThrottleTime = currentTimeInSeconds; + this.lastTxRateBucket = Math.floor(this.getCurrentTimeInSeconds()); + this.fillRate = this.minFillRate; + this.maxCapacity = this.minCapacity; + } + getCurrentTimeInSeconds() { + return Date.now() / 1e3; + } + async getSendToken() { + return this.acquireTokenBucket(1); + } + async acquireTokenBucket(amount) { + if (!this.enabled) { + return; } - } else { - if (typeof handler.onHeaders !== "function") { - throw new InvalidArgumentError("invalid onHeaders method"); + this.refillTokenBucket(); + if (amount > this.currentCapacity) { + const delay = (amount - this.currentCapacity) / this.fillRate * 1e3; + await new Promise((resolve) => setTimeout(resolve, delay)); } - if (typeof handler.onData !== "function") { - throw new InvalidArgumentError("invalid onData method"); + this.currentCapacity = this.currentCapacity - amount; + } + refillTokenBucket() { + const timestamp = this.getCurrentTimeInSeconds(); + if (!this.lastTimestamp) { + this.lastTimestamp = timestamp; + return; } - if (typeof handler.onComplete !== "function") { - throw new InvalidArgumentError("invalid onComplete method"); + const fillAmount = (timestamp - this.lastTimestamp) * this.fillRate; + this.currentCapacity = Math.min(this.maxCapacity, this.currentCapacity + fillAmount); + this.lastTimestamp = timestamp; + } + updateClientSendingRate(response) { + let calculatedRate; + this.updateMeasuredRate(); + if ((0, import_service_error_classification.isThrottlingError)(response)) { + const rateToUse = !this.enabled ? this.measuredTxRate : Math.min(this.measuredTxRate, this.fillRate); + this.lastMaxRate = rateToUse; + this.calculateTimeWindow(); + this.lastThrottleTime = this.getCurrentTimeInSeconds(); + calculatedRate = this.cubicThrottle(rateToUse); + this.enableTokenBucket(); + } else { + this.calculateTimeWindow(); + calculatedRate = this.cubicSuccess(this.getCurrentTimeInSeconds()); } + const newRate = Math.min(calculatedRate, 2 * this.measuredTxRate); + this.updateTokenBucketRate(newRate); } - } - function isDisturbed(body) { - return !!(body && (stream.isDisturbed(body) || body[kBodyUsed])); - } - function isErrored(body) { - return !!(body && stream.isErrored(body)); - } - function isReadable(body) { - return !!(body && stream.isReadable(body)); - } - function getSocketInfo(socket) { + calculateTimeWindow() { + this.timeWindow = this.getPrecise(Math.pow(this.lastMaxRate * (1 - this.beta) / this.scaleConstant, 1 / 3)); + } + cubicThrottle(rateToUse) { + return this.getPrecise(rateToUse * this.beta); + } + cubicSuccess(timestamp) { + return this.getPrecise( + this.scaleConstant * Math.pow(timestamp - this.lastThrottleTime - this.timeWindow, 3) + this.lastMaxRate + ); + } + enableTokenBucket() { + this.enabled = true; + } + updateTokenBucketRate(newRate) { + this.refillTokenBucket(); + this.fillRate = Math.max(newRate, this.minFillRate); + this.maxCapacity = Math.max(newRate, this.minCapacity); + this.currentCapacity = Math.min(this.currentCapacity, this.maxCapacity); + } + updateMeasuredRate() { + const t = this.getCurrentTimeInSeconds(); + const timeBucket = Math.floor(t * 2) / 2; + this.requestCount++; + if (timeBucket > this.lastTxRateBucket) { + const currentRate = this.requestCount / (timeBucket - this.lastTxRateBucket); + this.measuredTxRate = this.getPrecise(currentRate * this.smooth + this.measuredTxRate * (1 - this.smooth)); + this.requestCount = 0; + this.lastTxRateBucket = timeBucket; + } + } + getPrecise(num) { + return parseFloat(num.toFixed(8)); + } + }; + __name(_DefaultRateLimiter, "DefaultRateLimiter"); + var DefaultRateLimiter = _DefaultRateLimiter; + var DEFAULT_RETRY_DELAY_BASE = 100; + var MAXIMUM_RETRY_DELAY = 20 * 1e3; + var THROTTLING_RETRY_DELAY_BASE = 500; + var INITIAL_RETRY_TOKENS = 500; + var RETRY_COST = 5; + var TIMEOUT_RETRY_COST = 10; + var NO_RETRY_INCREMENT = 1; + var INVOCATION_ID_HEADER = "amz-sdk-invocation-id"; + var REQUEST_HEADER = "amz-sdk-request"; + var getDefaultRetryBackoffStrategy = /* @__PURE__ */ __name(() => { + let delayBase = DEFAULT_RETRY_DELAY_BASE; + const computeNextBackoffDelay = /* @__PURE__ */ __name((attempts) => { + return Math.floor(Math.min(MAXIMUM_RETRY_DELAY, Math.random() * 2 ** attempts * delayBase)); + }, "computeNextBackoffDelay"); + const setDelayBase = /* @__PURE__ */ __name((delay) => { + delayBase = delay; + }, "setDelayBase"); return { - localAddress: socket.localAddress, - localPort: socket.localPort, - remoteAddress: socket.remoteAddress, - remotePort: socket.remotePort, - remoteFamily: socket.remoteFamily, - timeout: socket.timeout, - bytesWritten: socket.bytesWritten, - bytesRead: socket.bytesRead + computeNextBackoffDelay, + setDelayBase }; - } - function ReadableStreamFrom(iterable) { - let iterator; - return new ReadableStream( - { - async start() { - iterator = iterable[Symbol.asyncIterator](); - }, - async pull(controller) { - const { done, value } = await iterator.next(); - if (done) { - queueMicrotask(() => { - controller.close(); - controller.byobRequest?.respond(0); - }); - } else { - const buf = Buffer.isBuffer(value) ? value : Buffer.from(value); - if (buf.byteLength) { - controller.enqueue(new Uint8Array(buf)); - } - } - return controller.desiredSize > 0; - }, - async cancel(reason) { - await iterator.return(); - }, - type: "bytes" + }, "getDefaultRetryBackoffStrategy"); + var createDefaultRetryToken = /* @__PURE__ */ __name(({ + retryDelay, + retryCount, + retryCost + }) => { + const getRetryCount = /* @__PURE__ */ __name(() => retryCount, "getRetryCount"); + const getRetryDelay = /* @__PURE__ */ __name(() => Math.min(MAXIMUM_RETRY_DELAY, retryDelay), "getRetryDelay"); + const getRetryCost = /* @__PURE__ */ __name(() => retryCost, "getRetryCost"); + return { + getRetryCount, + getRetryDelay, + getRetryCost + }; + }, "createDefaultRetryToken"); + var _StandardRetryStrategy = class _StandardRetryStrategy { + constructor(maxAttempts) { + this.maxAttempts = maxAttempts; + this.mode = "standard"; + this.capacity = INITIAL_RETRY_TOKENS; + this.retryBackoffStrategy = getDefaultRetryBackoffStrategy(); + this.maxAttemptsProvider = typeof maxAttempts === "function" ? maxAttempts : async () => maxAttempts; + } + // eslint-disable-next-line @typescript-eslint/no-unused-vars + async acquireInitialRetryToken(retryTokenScope) { + return createDefaultRetryToken({ + retryDelay: DEFAULT_RETRY_DELAY_BASE, + retryCount: 0 + }); + } + async refreshRetryTokenForRetry(token, errorInfo) { + const maxAttempts = await this.getMaxAttempts(); + if (this.shouldRetry(token, errorInfo, maxAttempts)) { + const errorType = errorInfo.errorType; + this.retryBackoffStrategy.setDelayBase( + errorType === "THROTTLING" ? THROTTLING_RETRY_DELAY_BASE : DEFAULT_RETRY_DELAY_BASE + ); + const delayFromErrorType = this.retryBackoffStrategy.computeNextBackoffDelay(token.getRetryCount()); + const retryDelay = errorInfo.retryAfterHint ? Math.max(errorInfo.retryAfterHint.getTime() - Date.now() || 0, delayFromErrorType) : delayFromErrorType; + const capacityCost = this.getCapacityCost(errorType); + this.capacity -= capacityCost; + return createDefaultRetryToken({ + retryDelay, + retryCount: token.getRetryCount() + 1, + retryCost: capacityCost + }); } - ); - } - function isFormDataLike(object) { - return object && typeof object === "object" && typeof object.append === "function" && typeof object.delete === "function" && typeof object.get === "function" && typeof object.getAll === "function" && typeof object.has === "function" && typeof object.set === "function" && object[Symbol.toStringTag] === "FormData"; - } - function addAbortListener(signal, listener) { - if ("addEventListener" in signal) { - signal.addEventListener("abort", listener, { once: true }); - return () => signal.removeEventListener("abort", listener); + throw new Error("No retry token available"); } - signal.addListener("abort", listener); - return () => signal.removeListener("abort", listener); - } - var hasToWellFormed = typeof String.prototype.toWellFormed === "function"; - var hasIsWellFormed = typeof String.prototype.isWellFormed === "function"; - function toUSVString(val) { - return hasToWellFormed ? `${val}`.toWellFormed() : nodeUtil.toUSVString(val); - } - function isUSVString(val) { - return hasIsWellFormed ? `${val}`.isWellFormed() : toUSVString(val) === `${val}`; - } - function isTokenCharCode(c) { - switch (c) { - case 34: - case 40: - case 41: - case 44: - case 47: - case 58: - case 59: - case 60: - case 61: - case 62: - case 63: - case 64: - case 91: - case 92: - case 93: - case 123: - case 125: - return false; - default: - return c >= 33 && c <= 126; + recordSuccess(token) { + this.capacity = Math.max(INITIAL_RETRY_TOKENS, this.capacity + (token.getRetryCost() ?? NO_RETRY_INCREMENT)); } - } - function isValidHTTPToken(characters) { - if (characters.length === 0) { - return false; + /** + * @returns the current available retry capacity. + * + * This number decreases when retries are executed and refills when requests or retries succeed. + */ + getCapacity() { + return this.capacity; } - for (let i = 0; i < characters.length; ++i) { - if (!isTokenCharCode(characters.charCodeAt(i))) { - return false; + async getMaxAttempts() { + try { + return await this.maxAttemptsProvider(); + } catch (error) { + console.warn(`Max attempts provider could not resolve. Using default of ${DEFAULT_MAX_ATTEMPTS}`); + return DEFAULT_MAX_ATTEMPTS; } } - return true; - } - var headerCharRegex = /[^\t\x20-\x7e\x80-\xff]/; - function isValidHeaderValue(characters) { - return !headerCharRegex.test(characters); - } - function parseRangeHeader(range) { - if (range == null || range === "") return { start: 0, end: null, size: null }; - const m = range ? range.match(/^bytes (\d+)-(\d+)\/(\d+)?$/) : null; - return m ? { - start: parseInt(m[1]), - end: m[2] ? parseInt(m[2]) : null, - size: m[3] ? parseInt(m[3]) : null - } : null; - } - function addListener(obj, name, listener) { - const listeners = obj[kListeners] ??= []; - listeners.push([name, listener]); - obj.on(name, listener); - return obj; - } - function removeAllListeners(obj) { - for (const [name, listener] of obj[kListeners] ?? []) { - obj.removeListener(name, listener); + shouldRetry(tokenToRenew, errorInfo, maxAttempts) { + const attempts = tokenToRenew.getRetryCount() + 1; + return attempts < maxAttempts && this.capacity >= this.getCapacityCost(errorInfo.errorType) && this.isRetryableError(errorInfo.errorType); } - obj[kListeners] = null; - } - function errorRequest(client, request2, err) { - try { - request2.onError(err); - assert(request2.aborted); - } catch (err2) { - client.emit("error", err2); + getCapacityCost(errorType) { + return errorType === "TRANSIENT" ? TIMEOUT_RETRY_COST : RETRY_COST; + } + isRetryableError(errorType) { + return errorType === "THROTTLING" || errorType === "TRANSIENT"; + } + }; + __name(_StandardRetryStrategy, "StandardRetryStrategy"); + var StandardRetryStrategy = _StandardRetryStrategy; + var _AdaptiveRetryStrategy = class _AdaptiveRetryStrategy { + constructor(maxAttemptsProvider, options) { + this.maxAttemptsProvider = maxAttemptsProvider; + this.mode = "adaptive"; + const { rateLimiter } = options ?? {}; + this.rateLimiter = rateLimiter ?? new DefaultRateLimiter(); + this.standardRetryStrategy = new StandardRetryStrategy(maxAttemptsProvider); + } + async acquireInitialRetryToken(retryTokenScope) { + await this.rateLimiter.getSendToken(); + return this.standardRetryStrategy.acquireInitialRetryToken(retryTokenScope); + } + async refreshRetryTokenForRetry(tokenToRenew, errorInfo) { + this.rateLimiter.updateClientSendingRate(errorInfo); + return this.standardRetryStrategy.refreshRetryTokenForRetry(tokenToRenew, errorInfo); + } + recordSuccess(token) { + this.rateLimiter.updateClientSendingRate({}); + this.standardRetryStrategy.recordSuccess(token); + } + }; + __name(_AdaptiveRetryStrategy, "AdaptiveRetryStrategy"); + var AdaptiveRetryStrategy = _AdaptiveRetryStrategy; + var _ConfiguredRetryStrategy = class _ConfiguredRetryStrategy extends StandardRetryStrategy { + /** + * @param maxAttempts - the maximum number of retry attempts allowed. + * e.g., if set to 3, then 4 total requests are possible. + * @param computeNextBackoffDelay - a millisecond delay for each retry or a function that takes the retry attempt + * and returns the delay. + * + * @example exponential backoff. + * ```js + * new Client({ + * retryStrategy: new ConfiguredRetryStrategy(3, (attempt) => attempt ** 2) + * }); + * ``` + * @example constant delay. + * ```js + * new Client({ + * retryStrategy: new ConfiguredRetryStrategy(3, 2000) + * }); + * ``` + */ + constructor(maxAttempts, computeNextBackoffDelay = DEFAULT_RETRY_DELAY_BASE) { + super(typeof maxAttempts === "function" ? maxAttempts : async () => maxAttempts); + if (typeof computeNextBackoffDelay === "number") { + this.computeNextBackoffDelay = () => computeNextBackoffDelay; + } else { + this.computeNextBackoffDelay = computeNextBackoffDelay; + } + } + async refreshRetryTokenForRetry(tokenToRenew, errorInfo) { + const token = await super.refreshRetryTokenForRetry(tokenToRenew, errorInfo); + token.getRetryDelay = () => this.computeNextBackoffDelay(token.getRetryCount()); + return token; } - } - var kEnumerableProperty = /* @__PURE__ */ Object.create(null); - kEnumerableProperty.enumerable = true; - module2.exports = { - kEnumerableProperty, - nop, - isDisturbed, - isErrored, - isReadable, - toUSVString, - isUSVString, - isBlobLike, - parseOrigin, - parseURL, - getServerName, - isStream, - isIterable, - isAsyncIterable, - isDestroyed, - headerNameToString, - bufferToLowerCasedHeaderName, - addListener, - removeAllListeners, - errorRequest, - parseRawHeaders, - parseHeaders, - parseKeepAliveTimeout, - destroy, - bodyLength, - deepClone, - ReadableStreamFrom, - isBuffer, - validateHandler, - getSocketInfo, - isFormDataLike, - buildURL, - addAbortListener, - isValidHTTPToken, - isValidHeaderValue, - isTokenCharCode, - parseRangeHeader, - isValidPort, - isHttpOrHttpsPrefixed, - nodeMajor, - nodeMinor, - safeHTTPMethods: ["GET", "HEAD", "OPTIONS", "TRACE"], - wrapRequestBody }; + __name(_ConfiguredRetryStrategy, "ConfiguredRetryStrategy"); + var ConfiguredRetryStrategy = _ConfiguredRetryStrategy; } }); -// node_modules/undici/lib/core/diagnostics.js -var require_diagnostics = __commonJS({ - "node_modules/undici/lib/core/diagnostics.js"(exports2, module2) { - "use strict"; - var diagnosticsChannel = require("node:diagnostics_channel"); - var util = require("node:util"); - var undiciDebugLog = util.debuglog("undici"); - var fetchDebuglog = util.debuglog("fetch"); - var websocketDebuglog = util.debuglog("websocket"); - var isClientSet = false; - var channels = { - // Client - beforeConnect: diagnosticsChannel.channel("undici:client:beforeConnect"), - connected: diagnosticsChannel.channel("undici:client:connected"), - connectError: diagnosticsChannel.channel("undici:client:connectError"), - sendHeaders: diagnosticsChannel.channel("undici:client:sendHeaders"), - // Request - create: diagnosticsChannel.channel("undici:request:create"), - bodySent: diagnosticsChannel.channel("undici:request:bodySent"), - headers: diagnosticsChannel.channel("undici:request:headers"), - trailers: diagnosticsChannel.channel("undici:request:trailers"), - error: diagnosticsChannel.channel("undici:request:error"), - // WebSocket - open: diagnosticsChannel.channel("undici:websocket:open"), - close: diagnosticsChannel.channel("undici:websocket:close"), - socketError: diagnosticsChannel.channel("undici:websocket:socket_error"), - ping: diagnosticsChannel.channel("undici:websocket:ping"), - pong: diagnosticsChannel.channel("undici:websocket:pong") - }; - if (undiciDebugLog.enabled || fetchDebuglog.enabled) { - const debuglog = fetchDebuglog.enabled ? fetchDebuglog : undiciDebugLog; - diagnosticsChannel.channel("undici:client:beforeConnect").subscribe((evt) => { - const { - connectParams: { version: version2, protocol, port, host } - } = evt; - debuglog( - "connecting to %s using %s%s", - `${host}${port ? `:${port}` : ""}`, - protocol, - version2 - ); - }); - diagnosticsChannel.channel("undici:client:connected").subscribe((evt) => { - const { - connectParams: { version: version2, protocol, port, host } - } = evt; - debuglog( - "connected to %s using %s%s", - `${host}${port ? `:${port}` : ""}`, - protocol, - version2 - ); - }); - diagnosticsChannel.channel("undici:client:connectError").subscribe((evt) => { - const { - connectParams: { version: version2, protocol, port, host }, - error - } = evt; - debuglog( - "connection to %s using %s%s errored - %s", - `${host}${port ? `:${port}` : ""}`, - protocol, - version2, - error.message - ); - }); - diagnosticsChannel.channel("undici:client:sendHeaders").subscribe((evt) => { - const { - request: { method, path, origin } - } = evt; - debuglog("sending request to %s %s/%s", method, origin, path); - }); - diagnosticsChannel.channel("undici:request:headers").subscribe((evt) => { - const { - request: { method, path, origin }, - response: { statusCode } - } = evt; - debuglog( - "received response to %s %s/%s - HTTP %d", - method, - origin, - path, - statusCode - ); - }); - diagnosticsChannel.channel("undici:request:trailers").subscribe((evt) => { - const { - request: { method, path, origin } - } = evt; - debuglog("trailers received from %s %s/%s", method, origin, path); - }); - diagnosticsChannel.channel("undici:request:error").subscribe((evt) => { - const { - request: { method, path, origin }, - error - } = evt; - debuglog( - "request to %s %s/%s errored - %s", - method, - origin, - path, - error.message - ); - }); - isClientSet = true; - } - if (websocketDebuglog.enabled) { - if (!isClientSet) { - const debuglog = undiciDebugLog.enabled ? undiciDebugLog : websocketDebuglog; - diagnosticsChannel.channel("undici:client:beforeConnect").subscribe((evt) => { - const { - connectParams: { version: version2, protocol, port, host } - } = evt; - debuglog( - "connecting to %s%s using %s%s", - host, - port ? `:${port}` : "", - protocol, - version2 - ); +// node_modules/@smithy/middleware-stack/dist-cjs/index.js +var require_dist_cjs21 = __commonJS({ + "node_modules/@smithy/middleware-stack/dist-cjs/index.js"(exports2, module2) { + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); + }; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + } + return to; + }; + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + constructStack: () => constructStack + }); + module2.exports = __toCommonJS2(src_exports); + var getAllAliases = /* @__PURE__ */ __name((name, aliases) => { + const _aliases = []; + if (name) { + _aliases.push(name); + } + if (aliases) { + for (const alias of aliases) { + _aliases.push(alias); + } + } + return _aliases; + }, "getAllAliases"); + var getMiddlewareNameWithAliases = /* @__PURE__ */ __name((name, aliases) => { + return `${name || "anonymous"}${aliases && aliases.length > 0 ? ` (a.k.a. ${aliases.join(",")})` : ""}`; + }, "getMiddlewareNameWithAliases"); + var constructStack = /* @__PURE__ */ __name(() => { + let absoluteEntries = []; + let relativeEntries = []; + let identifyOnResolve = false; + const entriesNameSet = /* @__PURE__ */ new Set(); + const sort = /* @__PURE__ */ __name((entries) => entries.sort( + (a, b) => stepWeights[b.step] - stepWeights[a.step] || priorityWeights[b.priority || "normal"] - priorityWeights[a.priority || "normal"] + ), "sort"); + const removeByName = /* @__PURE__ */ __name((toRemove) => { + let isRemoved = false; + const filterCb = /* @__PURE__ */ __name((entry) => { + const aliases = getAllAliases(entry.name, entry.aliases); + if (aliases.includes(toRemove)) { + isRemoved = true; + for (const alias of aliases) { + entriesNameSet.delete(alias); + } + return false; + } + return true; + }, "filterCb"); + absoluteEntries = absoluteEntries.filter(filterCb); + relativeEntries = relativeEntries.filter(filterCb); + return isRemoved; + }, "removeByName"); + const removeByReference = /* @__PURE__ */ __name((toRemove) => { + let isRemoved = false; + const filterCb = /* @__PURE__ */ __name((entry) => { + if (entry.middleware === toRemove) { + isRemoved = true; + for (const alias of getAllAliases(entry.name, entry.aliases)) { + entriesNameSet.delete(alias); + } + return false; + } + return true; + }, "filterCb"); + absoluteEntries = absoluteEntries.filter(filterCb); + relativeEntries = relativeEntries.filter(filterCb); + return isRemoved; + }, "removeByReference"); + const cloneTo = /* @__PURE__ */ __name((toStack) => { + var _a; + absoluteEntries.forEach((entry) => { + toStack.add(entry.middleware, { ...entry }); }); - diagnosticsChannel.channel("undici:client:connected").subscribe((evt) => { - const { - connectParams: { version: version2, protocol, port, host } - } = evt; - debuglog( - "connected to %s%s using %s%s", - host, - port ? `:${port}` : "", - protocol, - version2 - ); + relativeEntries.forEach((entry) => { + toStack.addRelativeTo(entry.middleware, { ...entry }); }); - diagnosticsChannel.channel("undici:client:connectError").subscribe((evt) => { - const { - connectParams: { version: version2, protocol, port, host }, - error - } = evt; - debuglog( - "connection to %s%s using %s%s errored - %s", - host, - port ? `:${port}` : "", - protocol, - version2, - error.message - ); + (_a = toStack.identifyOnResolve) == null ? void 0 : _a.call(toStack, stack.identifyOnResolve()); + return toStack; + }, "cloneTo"); + const expandRelativeMiddlewareList = /* @__PURE__ */ __name((from) => { + const expandedMiddlewareList = []; + from.before.forEach((entry) => { + if (entry.before.length === 0 && entry.after.length === 0) { + expandedMiddlewareList.push(entry); + } else { + expandedMiddlewareList.push(...expandRelativeMiddlewareList(entry)); + } }); - diagnosticsChannel.channel("undici:client:sendHeaders").subscribe((evt) => { - const { - request: { method, path, origin } - } = evt; - debuglog("sending request to %s %s/%s", method, origin, path); + expandedMiddlewareList.push(from); + from.after.reverse().forEach((entry) => { + if (entry.before.length === 0 && entry.after.length === 0) { + expandedMiddlewareList.push(entry); + } else { + expandedMiddlewareList.push(...expandRelativeMiddlewareList(entry)); + } }); - } - diagnosticsChannel.channel("undici:websocket:open").subscribe((evt) => { - const { - address: { address, port } - } = evt; - websocketDebuglog("connection opened %s%s", address, port ? `:${port}` : ""); - }); - diagnosticsChannel.channel("undici:websocket:close").subscribe((evt) => { - const { websocket, code, reason } = evt; - websocketDebuglog( - "closed connection to %s - %s %s", - websocket.url, - code, - reason + return expandedMiddlewareList; + }, "expandRelativeMiddlewareList"); + const getMiddlewareList = /* @__PURE__ */ __name((debug = false) => { + const normalizedAbsoluteEntries = []; + const normalizedRelativeEntries = []; + const normalizedEntriesNameMap = {}; + absoluteEntries.forEach((entry) => { + const normalizedEntry = { + ...entry, + before: [], + after: [] + }; + for (const alias of getAllAliases(normalizedEntry.name, normalizedEntry.aliases)) { + normalizedEntriesNameMap[alias] = normalizedEntry; + } + normalizedAbsoluteEntries.push(normalizedEntry); + }); + relativeEntries.forEach((entry) => { + const normalizedEntry = { + ...entry, + before: [], + after: [] + }; + for (const alias of getAllAliases(normalizedEntry.name, normalizedEntry.aliases)) { + normalizedEntriesNameMap[alias] = normalizedEntry; + } + normalizedRelativeEntries.push(normalizedEntry); + }); + normalizedRelativeEntries.forEach((entry) => { + if (entry.toMiddleware) { + const toMiddleware = normalizedEntriesNameMap[entry.toMiddleware]; + if (toMiddleware === void 0) { + if (debug) { + return; + } + throw new Error( + `${entry.toMiddleware} is not found when adding ${getMiddlewareNameWithAliases(entry.name, entry.aliases)} middleware ${entry.relation} ${entry.toMiddleware}` + ); + } + if (entry.relation === "after") { + toMiddleware.after.push(entry); + } + if (entry.relation === "before") { + toMiddleware.before.push(entry); + } + } + }); + const mainChain = sort(normalizedAbsoluteEntries).map(expandRelativeMiddlewareList).reduce( + (wholeList, expandedMiddlewareList) => { + wholeList.push(...expandedMiddlewareList); + return wholeList; + }, + [] ); - }); - diagnosticsChannel.channel("undici:websocket:socket_error").subscribe((err) => { - websocketDebuglog("connection errored - %s", err.message); - }); - diagnosticsChannel.channel("undici:websocket:ping").subscribe((evt) => { - websocketDebuglog("ping received"); - }); - diagnosticsChannel.channel("undici:websocket:pong").subscribe((evt) => { - websocketDebuglog("pong received"); - }); - } - module2.exports = { - channels + return mainChain; + }, "getMiddlewareList"); + const stack = { + add: (middleware, options = {}) => { + const { name, override, aliases: _aliases } = options; + const entry = { + step: "initialize", + priority: "normal", + middleware, + ...options + }; + const aliases = getAllAliases(name, _aliases); + if (aliases.length > 0) { + if (aliases.some((alias) => entriesNameSet.has(alias))) { + if (!override) + throw new Error(`Duplicate middleware name '${getMiddlewareNameWithAliases(name, _aliases)}'`); + for (const alias of aliases) { + const toOverrideIndex = absoluteEntries.findIndex( + (entry2) => { + var _a; + return entry2.name === alias || ((_a = entry2.aliases) == null ? void 0 : _a.some((a) => a === alias)); + } + ); + if (toOverrideIndex === -1) { + continue; + } + const toOverride = absoluteEntries[toOverrideIndex]; + if (toOverride.step !== entry.step || entry.priority !== toOverride.priority) { + throw new Error( + `"${getMiddlewareNameWithAliases(toOverride.name, toOverride.aliases)}" middleware with ${toOverride.priority} priority in ${toOverride.step} step cannot be overridden by "${getMiddlewareNameWithAliases(name, _aliases)}" middleware with ${entry.priority} priority in ${entry.step} step.` + ); + } + absoluteEntries.splice(toOverrideIndex, 1); + } + } + for (const alias of aliases) { + entriesNameSet.add(alias); + } + } + absoluteEntries.push(entry); + }, + addRelativeTo: (middleware, options) => { + const { name, override, aliases: _aliases } = options; + const entry = { + middleware, + ...options + }; + const aliases = getAllAliases(name, _aliases); + if (aliases.length > 0) { + if (aliases.some((alias) => entriesNameSet.has(alias))) { + if (!override) + throw new Error(`Duplicate middleware name '${getMiddlewareNameWithAliases(name, _aliases)}'`); + for (const alias of aliases) { + const toOverrideIndex = relativeEntries.findIndex( + (entry2) => { + var _a; + return entry2.name === alias || ((_a = entry2.aliases) == null ? void 0 : _a.some((a) => a === alias)); + } + ); + if (toOverrideIndex === -1) { + continue; + } + const toOverride = relativeEntries[toOverrideIndex]; + if (toOverride.toMiddleware !== entry.toMiddleware || toOverride.relation !== entry.relation) { + throw new Error( + `"${getMiddlewareNameWithAliases(toOverride.name, toOverride.aliases)}" middleware ${toOverride.relation} "${toOverride.toMiddleware}" middleware cannot be overridden by "${getMiddlewareNameWithAliases(name, _aliases)}" middleware ${entry.relation} "${entry.toMiddleware}" middleware.` + ); + } + relativeEntries.splice(toOverrideIndex, 1); + } + } + for (const alias of aliases) { + entriesNameSet.add(alias); + } + } + relativeEntries.push(entry); + }, + clone: () => cloneTo(constructStack()), + use: (plugin) => { + plugin.applyToStack(stack); + }, + remove: (toRemove) => { + if (typeof toRemove === "string") + return removeByName(toRemove); + else + return removeByReference(toRemove); + }, + removeByTag: (toRemove) => { + let isRemoved = false; + const filterCb = /* @__PURE__ */ __name((entry) => { + const { tags, name, aliases: _aliases } = entry; + if (tags && tags.includes(toRemove)) { + const aliases = getAllAliases(name, _aliases); + for (const alias of aliases) { + entriesNameSet.delete(alias); + } + isRemoved = true; + return false; + } + return true; + }, "filterCb"); + absoluteEntries = absoluteEntries.filter(filterCb); + relativeEntries = relativeEntries.filter(filterCb); + return isRemoved; + }, + concat: (from) => { + var _a; + const cloned = cloneTo(constructStack()); + cloned.use(from); + cloned.identifyOnResolve( + identifyOnResolve || cloned.identifyOnResolve() || (((_a = from.identifyOnResolve) == null ? void 0 : _a.call(from)) ?? false) + ); + return cloned; + }, + applyToStack: cloneTo, + identify: () => { + return getMiddlewareList(true).map((mw) => { + const step = mw.step ?? mw.relation + " " + mw.toMiddleware; + return getMiddlewareNameWithAliases(mw.name, mw.aliases) + " - " + step; + }); + }, + identifyOnResolve(toggle) { + if (typeof toggle === "boolean") + identifyOnResolve = toggle; + return identifyOnResolve; + }, + resolve: (handler, context) => { + for (const middleware of getMiddlewareList().map((entry) => entry.middleware).reverse()) { + handler = middleware(handler, context); + } + if (identifyOnResolve) { + console.log(stack.identify()); + } + return handler; + } + }; + return stack; + }, "constructStack"); + var stepWeights = { + initialize: 5, + serialize: 4, + build: 3, + finalizeRequest: 2, + deserialize: 1 + }; + var priorityWeights = { + high: 3, + normal: 2, + low: 1 }; } }); -// node_modules/undici/lib/core/request.js -var require_request3 = __commonJS({ - "node_modules/undici/lib/core/request.js"(exports2, module2) { +// node_modules/@smithy/is-array-buffer/dist-cjs/index.js +var require_dist_cjs22 = __commonJS({ + "node_modules/@smithy/is-array-buffer/dist-cjs/index.js"(exports2, module2) { + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); + }; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + } + return to; + }; + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + isArrayBuffer: () => isArrayBuffer + }); + module2.exports = __toCommonJS2(src_exports); + var isArrayBuffer = /* @__PURE__ */ __name((arg) => typeof ArrayBuffer === "function" && arg instanceof ArrayBuffer || Object.prototype.toString.call(arg) === "[object ArrayBuffer]", "isArrayBuffer"); + } +}); + +// node_modules/@smithy/util-buffer-from/dist-cjs/index.js +var require_dist_cjs23 = __commonJS({ + "node_modules/@smithy/util-buffer-from/dist-cjs/index.js"(exports2, module2) { + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); + }; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + } + return to; + }; + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + fromArrayBuffer: () => fromArrayBuffer, + fromString: () => fromString + }); + module2.exports = __toCommonJS2(src_exports); + var import_is_array_buffer = require_dist_cjs22(); + var import_buffer = require("buffer"); + var fromArrayBuffer = /* @__PURE__ */ __name((input, offset = 0, length = input.byteLength - offset) => { + if (!(0, import_is_array_buffer.isArrayBuffer)(input)) { + throw new TypeError(`The "input" argument must be ArrayBuffer. Received type ${typeof input} (${input})`); + } + return import_buffer.Buffer.from(input, offset, length); + }, "fromArrayBuffer"); + var fromString = /* @__PURE__ */ __name((input, encoding) => { + if (typeof input !== "string") { + throw new TypeError(`The "input" argument must be of type string. Received type ${typeof input} (${input})`); + } + return encoding ? import_buffer.Buffer.from(input, encoding) : import_buffer.Buffer.from(input); + }, "fromString"); + } +}); + +// node_modules/@smithy/util-base64/dist-cjs/fromBase64.js +var require_fromBase64 = __commonJS({ + "node_modules/@smithy/util-base64/dist-cjs/fromBase64.js"(exports2) { "use strict"; - var { - InvalidArgumentError, - NotSupportedError - } = require_errors2(); - var assert = require("node:assert"); - var { - isValidHTTPToken, - isValidHeaderValue, - isStream, - destroy, - isBuffer, - isFormDataLike, - isIterable, - isBlobLike, - buildURL, - validateHandler, - getServerName - } = require_util8(); - var { channels } = require_diagnostics(); - var { headerNameLowerCasedRecord } = require_constants6(); - var invalidPathRegex = /[^\u0021-\u00ff]/; - var kHandler = Symbol("handler"); - var Request = class { - constructor(origin, { - path, - method, - body, - headers, - query, - idempotent, - blocking, - upgrade, - headersTimeout, - bodyTimeout, - reset, - throwOnError, - expectContinue, - servername - }, handler) { - if (typeof path !== "string") { - throw new InvalidArgumentError("path must be a string"); - } else if (path[0] !== "/" && !(path.startsWith("http://") || path.startsWith("https://")) && method !== "CONNECT") { - throw new InvalidArgumentError("path must be an absolute URL or start with a slash"); - } else if (invalidPathRegex.exec(path) !== null) { - throw new InvalidArgumentError("invalid request path"); + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.fromBase64 = void 0; + var util_buffer_from_1 = require_dist_cjs23(); + var BASE64_REGEX = /^[A-Za-z0-9+/]*={0,2}$/; + var fromBase642 = (input) => { + if (input.length * 3 % 4 !== 0) { + throw new TypeError(`Incorrect padding on base64 string.`); + } + if (!BASE64_REGEX.exec(input)) { + throw new TypeError(`Invalid base64 string.`); + } + const buffer = (0, util_buffer_from_1.fromString)(input, "base64"); + return new Uint8Array(buffer.buffer, buffer.byteOffset, buffer.byteLength); + }; + exports2.fromBase64 = fromBase642; + } +}); + +// node_modules/@smithy/util-utf8/dist-cjs/index.js +var require_dist_cjs24 = __commonJS({ + "node_modules/@smithy/util-utf8/dist-cjs/index.js"(exports2, module2) { + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); + }; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + } + return to; + }; + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + fromUtf8: () => fromUtf8, + toUint8Array: () => toUint8Array, + toUtf8: () => toUtf8 + }); + module2.exports = __toCommonJS2(src_exports); + var import_util_buffer_from = require_dist_cjs23(); + var fromUtf8 = /* @__PURE__ */ __name((input) => { + const buf = (0, import_util_buffer_from.fromString)(input, "utf8"); + return new Uint8Array(buf.buffer, buf.byteOffset, buf.byteLength / Uint8Array.BYTES_PER_ELEMENT); + }, "fromUtf8"); + var toUint8Array = /* @__PURE__ */ __name((data) => { + if (typeof data === "string") { + return fromUtf8(data); + } + if (ArrayBuffer.isView(data)) { + return new Uint8Array(data.buffer, data.byteOffset, data.byteLength / Uint8Array.BYTES_PER_ELEMENT); + } + return new Uint8Array(data); + }, "toUint8Array"); + var toUtf8 = /* @__PURE__ */ __name((input) => { + if (typeof input === "string") { + return input; + } + if (typeof input !== "object" || typeof input.byteOffset !== "number" || typeof input.byteLength !== "number") { + throw new Error("@smithy/util-utf8: toUtf8 encoder function only accepts string | Uint8Array."); + } + return (0, import_util_buffer_from.fromArrayBuffer)(input.buffer, input.byteOffset, input.byteLength).toString("utf8"); + }, "toUtf8"); + } +}); + +// node_modules/@smithy/util-base64/dist-cjs/toBase64.js +var require_toBase64 = __commonJS({ + "node_modules/@smithy/util-base64/dist-cjs/toBase64.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.toBase64 = void 0; + var util_buffer_from_1 = require_dist_cjs23(); + var util_utf8_1 = require_dist_cjs24(); + var toBase642 = (_input) => { + let input; + if (typeof _input === "string") { + input = (0, util_utf8_1.fromUtf8)(_input); + } else { + input = _input; + } + if (typeof input !== "object" || typeof input.byteOffset !== "number" || typeof input.byteLength !== "number") { + throw new Error("@smithy/util-base64: toBase64 encoder function only accepts string | Uint8Array."); + } + return (0, util_buffer_from_1.fromArrayBuffer)(input.buffer, input.byteOffset, input.byteLength).toString("base64"); + }; + exports2.toBase64 = toBase642; + } +}); + +// node_modules/@smithy/util-base64/dist-cjs/index.js +var require_dist_cjs25 = __commonJS({ + "node_modules/@smithy/util-base64/dist-cjs/index.js"(exports2, module2) { + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + } + return to; + }; + var __reExport = (target, mod, secondTarget) => (__copyProps2(target, mod, "default"), secondTarget && __copyProps2(secondTarget, mod, "default")); + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + module2.exports = __toCommonJS2(src_exports); + __reExport(src_exports, require_fromBase64(), module2.exports); + __reExport(src_exports, require_toBase64(), module2.exports); + } +}); + +// node_modules/@smithy/util-stream/dist-cjs/getAwsChunkedEncodingStream.js +var require_getAwsChunkedEncodingStream = __commonJS({ + "node_modules/@smithy/util-stream/dist-cjs/getAwsChunkedEncodingStream.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.getAwsChunkedEncodingStream = void 0; + var stream_1 = require("stream"); + var getAwsChunkedEncodingStream2 = (readableStream, options) => { + const { base64Encoder, bodyLengthChecker, checksumAlgorithmFn, checksumLocationName, streamHasher } = options; + const checksumRequired = base64Encoder !== void 0 && checksumAlgorithmFn !== void 0 && checksumLocationName !== void 0 && streamHasher !== void 0; + const digest = checksumRequired ? streamHasher(checksumAlgorithmFn, readableStream) : void 0; + const awsChunkedEncodingStream = new stream_1.Readable({ read: () => { + } }); + readableStream.on("data", (data) => { + const length = bodyLengthChecker(data) || 0; + awsChunkedEncodingStream.push(`${length.toString(16)}\r +`); + awsChunkedEncodingStream.push(data); + awsChunkedEncodingStream.push("\r\n"); + }); + readableStream.on("end", async () => { + awsChunkedEncodingStream.push(`0\r +`); + if (checksumRequired) { + const checksum = base64Encoder(await digest); + awsChunkedEncodingStream.push(`${checksumLocationName}:${checksum}\r +`); + awsChunkedEncodingStream.push(`\r +`); } - if (typeof method !== "string") { - throw new InvalidArgumentError("method must be a string"); - } else if (!isValidHTTPToken(method)) { - throw new InvalidArgumentError("invalid request method"); + awsChunkedEncodingStream.push(null); + }); + return awsChunkedEncodingStream; + }; + exports2.getAwsChunkedEncodingStream = getAwsChunkedEncodingStream2; + } +}); + +// node_modules/@smithy/util-uri-escape/dist-cjs/index.js +var require_dist_cjs26 = __commonJS({ + "node_modules/@smithy/util-uri-escape/dist-cjs/index.js"(exports2, module2) { + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); + }; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + } + return to; + }; + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + escapeUri: () => escapeUri, + escapeUriPath: () => escapeUriPath + }); + module2.exports = __toCommonJS2(src_exports); + var escapeUri = /* @__PURE__ */ __name((uri) => ( + // AWS percent-encodes some extra non-standard characters in a URI + encodeURIComponent(uri).replace(/[!'()*]/g, hexEncode) + ), "escapeUri"); + var hexEncode = /* @__PURE__ */ __name((c) => `%${c.charCodeAt(0).toString(16).toUpperCase()}`, "hexEncode"); + var escapeUriPath = /* @__PURE__ */ __name((uri) => uri.split("/").map(escapeUri).join("/"), "escapeUriPath"); + } +}); + +// node_modules/@smithy/querystring-builder/dist-cjs/index.js +var require_dist_cjs27 = __commonJS({ + "node_modules/@smithy/querystring-builder/dist-cjs/index.js"(exports2, module2) { + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); + }; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + } + return to; + }; + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + buildQueryString: () => buildQueryString + }); + module2.exports = __toCommonJS2(src_exports); + var import_util_uri_escape = require_dist_cjs26(); + function buildQueryString(query) { + const parts = []; + for (let key of Object.keys(query).sort()) { + const value = query[key]; + key = (0, import_util_uri_escape.escapeUri)(key); + if (Array.isArray(value)) { + for (let i = 0, iLen = value.length; i < iLen; i++) { + parts.push(`${key}=${(0, import_util_uri_escape.escapeUri)(value[i])}`); + } + } else { + let qsEntry = key; + if (value || typeof value === "string") { + qsEntry += `=${(0, import_util_uri_escape.escapeUri)(value)}`; + } + parts.push(qsEntry); } - if (upgrade && typeof upgrade !== "string") { - throw new InvalidArgumentError("upgrade must be a string"); + } + return parts.join("&"); + } + __name(buildQueryString, "buildQueryString"); + } +}); + +// node_modules/@smithy/node-http-handler/dist-cjs/index.js +var require_dist_cjs28 = __commonJS({ + "node_modules/@smithy/node-http-handler/dist-cjs/index.js"(exports2, module2) { + var __create2 = Object.create; + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __getProtoOf2 = Object.getPrototypeOf; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); + }; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + } + return to; + }; + var __toESM2 = (mod, isNodeMode, target) => (target = mod != null ? __create2(__getProtoOf2(mod)) : {}, __copyProps2( + // If the importer is in node compatibility mode or this is not an ESM + // file that has been converted to a CommonJS file using a Babel- + // compatible transform (i.e. "__esModule" has not been set), then set + // "default" to the CommonJS "module.exports" for node compatibility. + isNodeMode || !mod || !mod.__esModule ? __defProp2(target, "default", { value: mod, enumerable: true }) : target, + mod + )); + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + DEFAULT_REQUEST_TIMEOUT: () => DEFAULT_REQUEST_TIMEOUT, + NodeHttp2Handler: () => NodeHttp2Handler, + NodeHttpHandler: () => NodeHttpHandler, + streamCollector: () => streamCollector + }); + module2.exports = __toCommonJS2(src_exports); + var import_protocol_http8 = require_dist_cjs2(); + var import_querystring_builder = require_dist_cjs27(); + var import_http = require("http"); + var import_https = require("https"); + var NODEJS_TIMEOUT_ERROR_CODES = ["ECONNRESET", "EPIPE", "ETIMEDOUT"]; + var getTransformedHeaders = /* @__PURE__ */ __name((headers) => { + const transformedHeaders = {}; + for (const name of Object.keys(headers)) { + const headerValues = headers[name]; + transformedHeaders[name] = Array.isArray(headerValues) ? headerValues.join(",") : headerValues; + } + return transformedHeaders; + }, "getTransformedHeaders"); + var setConnectionTimeout = /* @__PURE__ */ __name((request2, reject, timeoutInMs = 0) => { + if (!timeoutInMs) { + return; + } + const timeoutId = setTimeout(() => { + request2.destroy(); + reject( + Object.assign(new Error(`Socket timed out without establishing a connection within ${timeoutInMs} ms`), { + name: "TimeoutError" + }) + ); + }, timeoutInMs); + request2.on("socket", (socket) => { + if (socket.connecting) { + socket.on("connect", () => { + clearTimeout(timeoutId); + }); + } else { + clearTimeout(timeoutId); } - if (headersTimeout != null && (!Number.isFinite(headersTimeout) || headersTimeout < 0)) { - throw new InvalidArgumentError("invalid headersTimeout"); + }); + }, "setConnectionTimeout"); + var setSocketKeepAlive = /* @__PURE__ */ __name((request2, { keepAlive, keepAliveMsecs }) => { + if (keepAlive !== true) { + return; + } + request2.on("socket", (socket) => { + socket.setKeepAlive(keepAlive, keepAliveMsecs || 0); + }); + }, "setSocketKeepAlive"); + var setSocketTimeout = /* @__PURE__ */ __name((request2, reject, timeoutInMs = 0) => { + request2.setTimeout(timeoutInMs, () => { + request2.destroy(); + reject(Object.assign(new Error(`Connection timed out after ${timeoutInMs} ms`), { name: "TimeoutError" })); + }); + }, "setSocketTimeout"); + var import_stream = require("stream"); + var MIN_WAIT_TIME = 1e3; + async function writeRequestBody(httpRequest, request2, maxContinueTimeoutMs = MIN_WAIT_TIME) { + const headers = request2.headers ?? {}; + const expect = headers["Expect"] || headers["expect"]; + let timeoutId = -1; + let hasError = false; + if (expect === "100-continue") { + await Promise.race([ + new Promise((resolve) => { + timeoutId = Number(setTimeout(resolve, Math.max(MIN_WAIT_TIME, maxContinueTimeoutMs))); + }), + new Promise((resolve) => { + httpRequest.on("continue", () => { + clearTimeout(timeoutId); + resolve(); + }); + httpRequest.on("error", () => { + hasError = true; + clearTimeout(timeoutId); + resolve(); + }); + }) + ]); + } + if (!hasError) { + writeBody(httpRequest, request2.body); + } + } + __name(writeRequestBody, "writeRequestBody"); + function writeBody(httpRequest, body) { + if (body instanceof import_stream.Readable) { + body.pipe(httpRequest); + return; + } + if (body) { + if (Buffer.isBuffer(body) || typeof body === "string") { + httpRequest.end(body); + return; } - if (bodyTimeout != null && (!Number.isFinite(bodyTimeout) || bodyTimeout < 0)) { - throw new InvalidArgumentError("invalid bodyTimeout"); + const uint8 = body; + if (typeof uint8 === "object" && uint8.buffer && typeof uint8.byteOffset === "number" && typeof uint8.byteLength === "number") { + httpRequest.end(Buffer.from(uint8.buffer, uint8.byteOffset, uint8.byteLength)); + return; } - if (reset != null && typeof reset !== "boolean") { - throw new InvalidArgumentError("invalid reset"); + httpRequest.end(Buffer.from(body)); + return; + } + httpRequest.end(); + } + __name(writeBody, "writeBody"); + var DEFAULT_REQUEST_TIMEOUT = 0; + var _NodeHttpHandler = class _NodeHttpHandler2 { + constructor(options) { + this.socketWarningTimestamp = 0; + this.metadata = { handlerProtocol: "http/1.1" }; + this.configProvider = new Promise((resolve, reject) => { + if (typeof options === "function") { + options().then((_options) => { + resolve(this.resolveDefaultConfig(_options)); + }).catch(reject); + } else { + resolve(this.resolveDefaultConfig(options)); + } + }); + } + /** + * @returns the input if it is an HttpHandler of any class, + * or instantiates a new instance of this handler. + */ + static create(instanceOrOptions) { + if (typeof (instanceOrOptions == null ? void 0 : instanceOrOptions.handle) === "function") { + return instanceOrOptions; } - if (expectContinue != null && typeof expectContinue !== "boolean") { - throw new InvalidArgumentError("invalid expectContinue"); + return new _NodeHttpHandler2(instanceOrOptions); + } + /** + * @internal + * + * @param agent - http(s) agent in use by the NodeHttpHandler instance. + * @param socketWarningTimestamp - last socket usage check timestamp. + * @param logger - channel for the warning. + * @returns timestamp of last emitted warning. + */ + static checkSocketUsage(agent, socketWarningTimestamp, logger = console) { + var _a, _b, _c; + const { sockets, requests, maxSockets } = agent; + if (typeof maxSockets !== "number" || maxSockets === Infinity) { + return socketWarningTimestamp; + } + const interval = 15e3; + if (Date.now() - interval < socketWarningTimestamp) { + return socketWarningTimestamp; + } + if (sockets && requests) { + for (const origin in sockets) { + const socketsInUse = ((_a = sockets[origin]) == null ? void 0 : _a.length) ?? 0; + const requestsEnqueued = ((_b = requests[origin]) == null ? void 0 : _b.length) ?? 0; + if (socketsInUse >= maxSockets && requestsEnqueued >= 2 * maxSockets) { + (_c = logger == null ? void 0 : logger.warn) == null ? void 0 : _c.call( + logger, + `@smithy/node-http-handler:WARN - socket usage at capacity=${socketsInUse} and ${requestsEnqueued} additional requests are enqueued. +See https://docs.aws.amazon.com/sdk-for-javascript/v3/developer-guide/node-configuring-maxsockets.html +or increase socketAcquisitionWarningTimeout=(millis) in the NodeHttpHandler config.` + ); + return Date.now(); + } + } } - this.headersTimeout = headersTimeout; - this.bodyTimeout = bodyTimeout; - this.throwOnError = throwOnError === true; - this.method = method; - this.abort = null; - if (body == null) { - this.body = null; - } else if (isStream(body)) { - this.body = body; - const rState = this.body._readableState; - if (!rState || !rState.autoDestroy) { - this.endHandler = function autoDestroy() { - destroy(this); - }; - this.body.on("end", this.endHandler); + return socketWarningTimestamp; + } + resolveDefaultConfig(options) { + const { requestTimeout, connectionTimeout, socketTimeout, httpAgent, httpsAgent } = options || {}; + const keepAlive = true; + const maxSockets = 50; + return { + connectionTimeout, + requestTimeout: requestTimeout ?? socketTimeout, + httpAgent: (() => { + if (httpAgent instanceof import_http.Agent || typeof (httpAgent == null ? void 0 : httpAgent.destroy) === "function") { + return httpAgent; + } + return new import_http.Agent({ keepAlive, maxSockets, ...httpAgent }); + })(), + httpsAgent: (() => { + if (httpsAgent instanceof import_https.Agent || typeof (httpsAgent == null ? void 0 : httpsAgent.destroy) === "function") { + return httpsAgent; + } + return new import_https.Agent({ keepAlive, maxSockets, ...httpsAgent }); + })(), + logger: console + }; + } + destroy() { + var _a, _b, _c, _d; + (_b = (_a = this.config) == null ? void 0 : _a.httpAgent) == null ? void 0 : _b.destroy(); + (_d = (_c = this.config) == null ? void 0 : _c.httpsAgent) == null ? void 0 : _d.destroy(); + } + async handle(request2, { abortSignal } = {}) { + if (!this.config) { + this.config = await this.configProvider; + } + let socketCheckTimeoutId; + return new Promise((_resolve, _reject) => { + let writeRequestBodyPromise = void 0; + const resolve = /* @__PURE__ */ __name(async (arg) => { + await writeRequestBodyPromise; + clearTimeout(socketCheckTimeoutId); + _resolve(arg); + }, "resolve"); + const reject = /* @__PURE__ */ __name(async (arg) => { + await writeRequestBodyPromise; + clearTimeout(socketCheckTimeoutId); + _reject(arg); + }, "reject"); + if (!this.config) { + throw new Error("Node HTTP request handler config is not resolved"); + } + if (abortSignal == null ? void 0 : abortSignal.aborted) { + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + reject(abortError); + return; } - this.errorHandler = (err) => { - if (this.abort) { - this.abort(err); + const isSSL = request2.protocol === "https:"; + const agent = isSSL ? this.config.httpsAgent : this.config.httpAgent; + socketCheckTimeoutId = setTimeout( + () => { + this.socketWarningTimestamp = _NodeHttpHandler2.checkSocketUsage( + agent, + this.socketWarningTimestamp, + this.config.logger + ); + }, + this.config.socketAcquisitionWarningTimeout ?? (this.config.requestTimeout ?? 2e3) + (this.config.connectionTimeout ?? 1e3) + ); + const queryString = (0, import_querystring_builder.buildQueryString)(request2.query || {}); + let auth = void 0; + if (request2.username != null || request2.password != null) { + const username = request2.username ?? ""; + const password = request2.password ?? ""; + auth = `${username}:${password}`; + } + let path = request2.path; + if (queryString) { + path += `?${queryString}`; + } + if (request2.fragment) { + path += `#${request2.fragment}`; + } + const nodeHttpsOptions = { + headers: request2.headers, + host: request2.hostname, + method: request2.method, + path, + port: request2.port, + agent, + auth + }; + const requestFunc = isSSL ? import_https.request : import_http.request; + const req = requestFunc(nodeHttpsOptions, (res) => { + const httpResponse = new import_protocol_http8.HttpResponse({ + statusCode: res.statusCode || -1, + reason: res.statusMessage, + headers: getTransformedHeaders(res.headers), + body: res + }); + resolve({ response: httpResponse }); + }); + req.on("error", (err) => { + if (NODEJS_TIMEOUT_ERROR_CODES.includes(err.code)) { + reject(Object.assign(err, { name: "TimeoutError" })); } else { - this.error = err; + reject(err); + } + }); + setConnectionTimeout(req, reject, this.config.connectionTimeout); + setSocketTimeout(req, reject, this.config.requestTimeout); + if (abortSignal) { + const onAbort = /* @__PURE__ */ __name(() => { + req.destroy(); + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + reject(abortError); + }, "onAbort"); + if (typeof abortSignal.addEventListener === "function") { + const signal = abortSignal; + signal.addEventListener("abort", onAbort, { once: true }); + req.once("close", () => signal.removeEventListener("abort", onAbort)); + } else { + abortSignal.onabort = onAbort; } + } + const httpAgent = nodeHttpsOptions.agent; + if (typeof httpAgent === "object" && "keepAlive" in httpAgent) { + setSocketKeepAlive(req, { + // @ts-expect-error keepAlive is not public on httpAgent. + keepAlive: httpAgent.keepAlive, + // @ts-expect-error keepAliveMsecs is not public on httpAgent. + keepAliveMsecs: httpAgent.keepAliveMsecs + }); + } + writeRequestBodyPromise = writeRequestBody(req, request2, this.config.requestTimeout).catch((e) => { + clearTimeout(socketCheckTimeoutId); + return _reject(e); + }); + }); + } + updateHttpClientConfig(key, value) { + this.config = void 0; + this.configProvider = this.configProvider.then((config) => { + return { + ...config, + [key]: value }; - this.body.on("error", this.errorHandler); - } else if (isBuffer(body)) { - this.body = body.byteLength ? body : null; - } else if (ArrayBuffer.isView(body)) { - this.body = body.buffer.byteLength ? Buffer.from(body.buffer, body.byteOffset, body.byteLength) : null; - } else if (body instanceof ArrayBuffer) { - this.body = body.byteLength ? Buffer.from(body) : null; - } else if (typeof body === "string") { - this.body = body.length ? Buffer.from(body) : null; - } else if (isFormDataLike(body) || isIterable(body) || isBlobLike(body)) { - this.body = body; - } else { - throw new InvalidArgumentError("body must be a string, a Buffer, a Readable stream, an iterable, or an async iterable"); + }); + } + httpHandlerConfigs() { + return this.config ?? {}; + } + }; + __name(_NodeHttpHandler, "NodeHttpHandler"); + var NodeHttpHandler = _NodeHttpHandler; + var import_http22 = require("http2"); + var import_http2 = __toESM2(require("http2")); + var _NodeHttp2ConnectionPool = class _NodeHttp2ConnectionPool { + constructor(sessions) { + this.sessions = []; + this.sessions = sessions ?? []; + } + poll() { + if (this.sessions.length > 0) { + return this.sessions.shift(); } - this.completed = false; - this.aborted = false; - this.upgrade = upgrade || null; - this.path = query ? buildURL(path, query) : path; - this.origin = origin; - this.idempotent = idempotent == null ? method === "HEAD" || method === "GET" : idempotent; - this.blocking = blocking == null ? false : blocking; - this.reset = reset == null ? null : reset; - this.host = null; - this.contentLength = null; - this.contentType = null; - this.headers = []; - this.expectContinue = expectContinue != null ? expectContinue : false; - if (Array.isArray(headers)) { - if (headers.length % 2 !== 0) { - throw new InvalidArgumentError("headers array must be even"); - } - for (let i = 0; i < headers.length; i += 2) { - processHeader(this, headers[i], headers[i + 1]); - } - } else if (headers && typeof headers === "object") { - if (headers[Symbol.iterator]) { - for (const header of headers) { - if (!Array.isArray(header) || header.length !== 2) { - throw new InvalidArgumentError("headers must be in key-value pair format"); - } - processHeader(this, header[0], header[1]); - } - } else { - const keys = Object.keys(headers); - for (let i = 0; i < keys.length; ++i) { - processHeader(this, keys[i], headers[keys[i]]); + } + offerLast(session) { + this.sessions.push(session); + } + contains(session) { + return this.sessions.includes(session); + } + remove(session) { + this.sessions = this.sessions.filter((s) => s !== session); + } + [Symbol.iterator]() { + return this.sessions[Symbol.iterator](); + } + destroy(connection) { + for (const session of this.sessions) { + if (session === connection) { + if (!session.destroyed) { + session.destroy(); } } - } else if (headers != null) { - throw new InvalidArgumentError("headers must be an object or an array"); } - validateHandler(handler, method, upgrade); - this.servername = servername || getServerName(this.host); - this[kHandler] = handler; - if (channels.create.hasSubscribers) { - channels.create.publish({ request: this }); + } + }; + __name(_NodeHttp2ConnectionPool, "NodeHttp2ConnectionPool"); + var NodeHttp2ConnectionPool = _NodeHttp2ConnectionPool; + var _NodeHttp2ConnectionManager = class _NodeHttp2ConnectionManager { + constructor(config) { + this.sessionCache = /* @__PURE__ */ new Map(); + this.config = config; + if (this.config.maxConcurrency && this.config.maxConcurrency <= 0) { + throw new RangeError("maxConcurrency must be greater than zero."); } } - onBodySent(chunk) { - if (this[kHandler].onBodySent) { - try { - return this[kHandler].onBodySent(chunk); - } catch (err) { - this.abort(err); + lease(requestContext, connectionConfiguration) { + const url = this.getUrlString(requestContext); + const existingPool = this.sessionCache.get(url); + if (existingPool) { + const existingSession = existingPool.poll(); + if (existingSession && !this.config.disableConcurrency) { + return existingSession; } } + const session = import_http2.default.connect(url); + if (this.config.maxConcurrency) { + session.settings({ maxConcurrentStreams: this.config.maxConcurrency }, (err) => { + if (err) { + throw new Error( + "Fail to set maxConcurrentStreams to " + this.config.maxConcurrency + "when creating new session for " + requestContext.destination.toString() + ); + } + }); + } + session.unref(); + const destroySessionCb = /* @__PURE__ */ __name(() => { + session.destroy(); + this.deleteSession(url, session); + }, "destroySessionCb"); + session.on("goaway", destroySessionCb); + session.on("error", destroySessionCb); + session.on("frameError", destroySessionCb); + session.on("close", () => this.deleteSession(url, session)); + if (connectionConfiguration.requestTimeout) { + session.setTimeout(connectionConfiguration.requestTimeout, destroySessionCb); + } + const connectionPool = this.sessionCache.get(url) || new NodeHttp2ConnectionPool(); + connectionPool.offerLast(session); + this.sessionCache.set(url, connectionPool); + return session; } - onRequestSent() { - if (channels.bodySent.hasSubscribers) { - channels.bodySent.publish({ request: this }); + /** + * Delete a session from the connection pool. + * @param authority The authority of the session to delete. + * @param session The session to delete. + */ + deleteSession(authority, session) { + const existingConnectionPool = this.sessionCache.get(authority); + if (!existingConnectionPool) { + return; } - if (this[kHandler].onRequestSent) { - try { - return this[kHandler].onRequestSent(); - } catch (err) { - this.abort(err); + if (!existingConnectionPool.contains(session)) { + return; + } + existingConnectionPool.remove(session); + this.sessionCache.set(authority, existingConnectionPool); + } + release(requestContext, session) { + var _a; + const cacheKey = this.getUrlString(requestContext); + (_a = this.sessionCache.get(cacheKey)) == null ? void 0 : _a.offerLast(session); + } + destroy() { + for (const [key, connectionPool] of this.sessionCache) { + for (const session of connectionPool) { + if (!session.destroyed) { + session.destroy(); + } + connectionPool.remove(session); } + this.sessionCache.delete(key); } } - onConnect(abort) { - assert(!this.aborted); - assert(!this.completed); - if (this.error) { - abort(this.error); - } else { - this.abort = abort; - return this[kHandler].onConnect(abort); + setMaxConcurrentStreams(maxConcurrentStreams) { + if (this.config.maxConcurrency && this.config.maxConcurrency <= 0) { + throw new RangeError("maxConcurrentStreams must be greater than zero."); } + this.config.maxConcurrency = maxConcurrentStreams; } - onResponseStarted() { - return this[kHandler].onResponseStarted?.(); + setDisableConcurrentStreams(disableConcurrentStreams) { + this.config.disableConcurrency = disableConcurrentStreams; } - onHeaders(statusCode, headers, resume, statusText) { - assert(!this.aborted); - assert(!this.completed); - if (channels.headers.hasSubscribers) { - channels.headers.publish({ request: this, response: { statusCode, headers, statusText } }); + getUrlString(request2) { + return request2.destination.toString(); + } + }; + __name(_NodeHttp2ConnectionManager, "NodeHttp2ConnectionManager"); + var NodeHttp2ConnectionManager = _NodeHttp2ConnectionManager; + var _NodeHttp2Handler = class _NodeHttp2Handler2 { + constructor(options) { + this.metadata = { handlerProtocol: "h2" }; + this.connectionManager = new NodeHttp2ConnectionManager({}); + this.configProvider = new Promise((resolve, reject) => { + if (typeof options === "function") { + options().then((opts) => { + resolve(opts || {}); + }).catch(reject); + } else { + resolve(options || {}); + } + }); + } + /** + * @returns the input if it is an HttpHandler of any class, + * or instantiates a new instance of this handler. + */ + static create(instanceOrOptions) { + if (typeof (instanceOrOptions == null ? void 0 : instanceOrOptions.handle) === "function") { + return instanceOrOptions; } - try { - return this[kHandler].onHeaders(statusCode, headers, resume, statusText); - } catch (err) { - this.abort(err); + return new _NodeHttp2Handler2(instanceOrOptions); + } + destroy() { + this.connectionManager.destroy(); + } + async handle(request2, { abortSignal } = {}) { + if (!this.config) { + this.config = await this.configProvider; + this.connectionManager.setDisableConcurrentStreams(this.config.disableConcurrentStreams || false); + if (this.config.maxConcurrentStreams) { + this.connectionManager.setMaxConcurrentStreams(this.config.maxConcurrentStreams); + } + } + const { requestTimeout, disableConcurrentStreams } = this.config; + return new Promise((_resolve, _reject) => { + var _a; + let fulfilled = false; + let writeRequestBodyPromise = void 0; + const resolve = /* @__PURE__ */ __name(async (arg) => { + await writeRequestBodyPromise; + _resolve(arg); + }, "resolve"); + const reject = /* @__PURE__ */ __name(async (arg) => { + await writeRequestBodyPromise; + _reject(arg); + }, "reject"); + if (abortSignal == null ? void 0 : abortSignal.aborted) { + fulfilled = true; + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + reject(abortError); + return; + } + const { hostname, method, port, protocol, query } = request2; + let auth = ""; + if (request2.username != null || request2.password != null) { + const username = request2.username ?? ""; + const password = request2.password ?? ""; + auth = `${username}:${password}@`; + } + const authority = `${protocol}//${auth}${hostname}${port ? `:${port}` : ""}`; + const requestContext = { destination: new URL(authority) }; + const session = this.connectionManager.lease(requestContext, { + requestTimeout: (_a = this.config) == null ? void 0 : _a.sessionTimeout, + disableConcurrentStreams: disableConcurrentStreams || false + }); + const rejectWithDestroy = /* @__PURE__ */ __name((err) => { + if (disableConcurrentStreams) { + this.destroySession(session); + } + fulfilled = true; + reject(err); + }, "rejectWithDestroy"); + const queryString = (0, import_querystring_builder.buildQueryString)(query || {}); + let path = request2.path; + if (queryString) { + path += `?${queryString}`; + } + if (request2.fragment) { + path += `#${request2.fragment}`; + } + const req = session.request({ + ...request2.headers, + [import_http22.constants.HTTP2_HEADER_PATH]: path, + [import_http22.constants.HTTP2_HEADER_METHOD]: method + }); + session.ref(); + req.on("response", (headers) => { + const httpResponse = new import_protocol_http8.HttpResponse({ + statusCode: headers[":status"] || -1, + headers: getTransformedHeaders(headers), + body: req + }); + fulfilled = true; + resolve({ response: httpResponse }); + if (disableConcurrentStreams) { + session.close(); + this.connectionManager.deleteSession(authority, session); + } + }); + if (requestTimeout) { + req.setTimeout(requestTimeout, () => { + req.close(); + const timeoutError = new Error(`Stream timed out because of no activity for ${requestTimeout} ms`); + timeoutError.name = "TimeoutError"; + rejectWithDestroy(timeoutError); + }); + } + if (abortSignal) { + const onAbort = /* @__PURE__ */ __name(() => { + req.close(); + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + rejectWithDestroy(abortError); + }, "onAbort"); + if (typeof abortSignal.addEventListener === "function") { + const signal = abortSignal; + signal.addEventListener("abort", onAbort, { once: true }); + req.once("close", () => signal.removeEventListener("abort", onAbort)); + } else { + abortSignal.onabort = onAbort; + } + } + req.on("frameError", (type, code, id) => { + rejectWithDestroy(new Error(`Frame type id ${type} in stream id ${id} has failed with code ${code}.`)); + }); + req.on("error", rejectWithDestroy); + req.on("aborted", () => { + rejectWithDestroy( + new Error(`HTTP/2 stream is abnormally aborted in mid-communication with result code ${req.rstCode}.`) + ); + }); + req.on("close", () => { + session.unref(); + if (disableConcurrentStreams) { + session.destroy(); + } + if (!fulfilled) { + rejectWithDestroy(new Error("Unexpected error: http2 request did not get a response")); + } + }); + writeRequestBodyPromise = writeRequestBody(req, request2, requestTimeout); + }); + } + updateHttpClientConfig(key, value) { + this.config = void 0; + this.configProvider = this.configProvider.then((config) => { + return { + ...config, + [key]: value + }; + }); + } + httpHandlerConfigs() { + return this.config ?? {}; + } + /** + * Destroys a session. + * @param session The session to destroy. + */ + destroySession(session) { + if (!session.destroyed) { + session.destroy(); } } - onData(chunk) { - assert(!this.aborted); - assert(!this.completed); - try { - return this[kHandler].onData(chunk); - } catch (err) { - this.abort(err); - return false; + }; + __name(_NodeHttp2Handler, "NodeHttp2Handler"); + var NodeHttp2Handler = _NodeHttp2Handler; + var _Collector = class _Collector extends import_stream.Writable { + constructor() { + super(...arguments); + this.bufferedBytes = []; + } + _write(chunk, encoding, callback) { + this.bufferedBytes.push(chunk); + callback(); + } + }; + __name(_Collector, "Collector"); + var Collector = _Collector; + var streamCollector = /* @__PURE__ */ __name((stream) => { + if (isReadableStreamInstance(stream)) { + return collectReadableStream(stream); + } + return new Promise((resolve, reject) => { + const collector = new Collector(); + stream.pipe(collector); + stream.on("error", (err) => { + collector.end(); + reject(err); + }); + collector.on("error", reject); + collector.on("finish", function() { + const bytes = new Uint8Array(Buffer.concat(this.bufferedBytes)); + resolve(bytes); + }); + }); + }, "streamCollector"); + var isReadableStreamInstance = /* @__PURE__ */ __name((stream) => typeof ReadableStream === "function" && stream instanceof ReadableStream, "isReadableStreamInstance"); + async function collectReadableStream(stream) { + const chunks = []; + const reader = stream.getReader(); + let isDone = false; + let length = 0; + while (!isDone) { + const { done, value } = await reader.read(); + if (value) { + chunks.push(value); + length += value.length; } + isDone = done; } - onUpgrade(statusCode, headers, socket) { - assert(!this.aborted); - assert(!this.completed); - return this[kHandler].onUpgrade(statusCode, headers, socket); + const collected = new Uint8Array(length); + let offset = 0; + for (const chunk of chunks) { + collected.set(chunk, offset); + offset += chunk.length; } - onComplete(trailers) { - this.onFinally(); - assert(!this.aborted); - this.completed = true; - if (channels.trailers.hasSubscribers) { - channels.trailers.publish({ request: this, trailers }); + return collected; + } + __name(collectReadableStream, "collectReadableStream"); + } +}); + +// node_modules/@smithy/fetch-http-handler/dist-cjs/index.js +var require_dist_cjs29 = __commonJS({ + "node_modules/@smithy/fetch-http-handler/dist-cjs/index.js"(exports2, module2) { + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); + }; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + } + return to; + }; + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + FetchHttpHandler: () => FetchHttpHandler, + keepAliveSupport: () => keepAliveSupport, + streamCollector: () => streamCollector + }); + module2.exports = __toCommonJS2(src_exports); + var import_protocol_http8 = require_dist_cjs2(); + var import_querystring_builder = require_dist_cjs27(); + function requestTimeout(timeoutInMs = 0) { + return new Promise((resolve, reject) => { + if (timeoutInMs) { + setTimeout(() => { + const timeoutError = new Error(`Request did not complete within ${timeoutInMs} ms`); + timeoutError.name = "TimeoutError"; + reject(timeoutError); + }, timeoutInMs); } - try { - return this[kHandler].onComplete(trailers); - } catch (err) { - this.onError(err); + }); + } + __name(requestTimeout, "requestTimeout"); + var keepAliveSupport = { + supported: void 0 + }; + var _FetchHttpHandler = class _FetchHttpHandler2 { + /** + * @returns the input if it is an HttpHandler of any class, + * or instantiates a new instance of this handler. + */ + static create(instanceOrOptions) { + if (typeof (instanceOrOptions == null ? void 0 : instanceOrOptions.handle) === "function") { + return instanceOrOptions; } + return new _FetchHttpHandler2(instanceOrOptions); } - onError(error) { - this.onFinally(); - if (channels.error.hasSubscribers) { - channels.error.publish({ request: this, error }); + constructor(options) { + if (typeof options === "function") { + this.configProvider = options().then((opts) => opts || {}); + } else { + this.config = options ?? {}; + this.configProvider = Promise.resolve(this.config); } - if (this.aborted) { - return; + if (keepAliveSupport.supported === void 0) { + keepAliveSupport.supported = Boolean( + typeof Request !== "undefined" && "keepalive" in new Request("https://[::1]") + ); } - this.aborted = true; - return this[kHandler].onError(error); } - onFinally() { - if (this.errorHandler) { - this.body.off("error", this.errorHandler); - this.errorHandler = null; - } - if (this.endHandler) { - this.body.off("end", this.endHandler); - this.endHandler = null; + destroy() { + } + async handle(request2, { abortSignal } = {}) { + if (!this.config) { + this.config = await this.configProvider; + } + const requestTimeoutInMs = this.config.requestTimeout; + const keepAlive = this.config.keepAlive === true; + const credentials = this.config.credentials; + if (abortSignal == null ? void 0 : abortSignal.aborted) { + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + return Promise.reject(abortError); + } + let path = request2.path; + const queryString = (0, import_querystring_builder.buildQueryString)(request2.query || {}); + if (queryString) { + path += `?${queryString}`; + } + if (request2.fragment) { + path += `#${request2.fragment}`; + } + let auth = ""; + if (request2.username != null || request2.password != null) { + const username = request2.username ?? ""; + const password = request2.password ?? ""; + auth = `${username}:${password}@`; + } + const { port, method } = request2; + const url = `${request2.protocol}//${auth}${request2.hostname}${port ? `:${port}` : ""}${path}`; + const body = method === "GET" || method === "HEAD" ? void 0 : request2.body; + const requestOptions = { + body, + headers: new Headers(request2.headers), + method, + credentials + }; + if (body) { + requestOptions.duplex = "half"; + } + if (typeof AbortController !== "undefined") { + requestOptions.signal = abortSignal; + } + if (keepAliveSupport.supported) { + requestOptions.keepalive = keepAlive; + } + let removeSignalEventListener = /* @__PURE__ */ __name(() => { + }, "removeSignalEventListener"); + const fetchRequest = new Request(url, requestOptions); + const raceOfPromises = [ + fetch(fetchRequest).then((response) => { + const fetchHeaders = response.headers; + const transformedHeaders = {}; + for (const pair of fetchHeaders.entries()) { + transformedHeaders[pair[0]] = pair[1]; + } + const hasReadableStream = response.body != void 0; + if (!hasReadableStream) { + return response.blob().then((body2) => ({ + response: new import_protocol_http8.HttpResponse({ + headers: transformedHeaders, + reason: response.statusText, + statusCode: response.status, + body: body2 + }) + })); + } + return { + response: new import_protocol_http8.HttpResponse({ + headers: transformedHeaders, + reason: response.statusText, + statusCode: response.status, + body: response.body + }) + }; + }), + requestTimeout(requestTimeoutInMs) + ]; + if (abortSignal) { + raceOfPromises.push( + new Promise((resolve, reject) => { + const onAbort = /* @__PURE__ */ __name(() => { + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + reject(abortError); + }, "onAbort"); + if (typeof abortSignal.addEventListener === "function") { + const signal = abortSignal; + signal.addEventListener("abort", onAbort, { once: true }); + removeSignalEventListener = /* @__PURE__ */ __name(() => signal.removeEventListener("abort", onAbort), "removeSignalEventListener"); + } else { + abortSignal.onabort = onAbort; + } + }) + ); } + return Promise.race(raceOfPromises).finally(removeSignalEventListener); } - addHeader(key, value) { - processHeader(this, key, value); - return this; + updateHttpClientConfig(key, value) { + this.config = void 0; + this.configProvider = this.configProvider.then((config) => { + config[key] = value; + return config; + }); + } + httpHandlerConfigs() { + return this.config ?? {}; } }; - function processHeader(request2, key, val) { - if (val && (typeof val === "object" && !Array.isArray(val))) { - throw new InvalidArgumentError(`invalid ${key} header`); - } else if (val === void 0) { - return; + __name(_FetchHttpHandler, "FetchHttpHandler"); + var FetchHttpHandler = _FetchHttpHandler; + var import_util_base64 = require_dist_cjs25(); + var streamCollector = /* @__PURE__ */ __name((stream) => { + if (typeof Blob === "function" && stream instanceof Blob) { + return collectBlob(stream); } - let headerName = headerNameLowerCasedRecord[key]; - if (headerName === void 0) { - headerName = key.toLowerCase(); - if (headerNameLowerCasedRecord[headerName] === void 0 && !isValidHTTPToken(headerName)) { - throw new InvalidArgumentError("invalid header key"); + return collectStream(stream); + }, "streamCollector"); + async function collectBlob(blob) { + const base64 = await readToBase64(blob); + const arrayBuffer = (0, import_util_base64.fromBase64)(base64); + return new Uint8Array(arrayBuffer); + } + __name(collectBlob, "collectBlob"); + async function collectStream(stream) { + const chunks = []; + const reader = stream.getReader(); + let isDone = false; + let length = 0; + while (!isDone) { + const { done, value } = await reader.read(); + if (value) { + chunks.push(value); + length += value.length; } + isDone = done; } - if (Array.isArray(val)) { - const arr = []; - for (let i = 0; i < val.length; i++) { - if (typeof val[i] === "string") { - if (!isValidHeaderValue(val[i])) { - throw new InvalidArgumentError(`invalid ${key} header`); - } - arr.push(val[i]); - } else if (val[i] === null) { - arr.push(""); - } else if (typeof val[i] === "object") { - throw new InvalidArgumentError(`invalid ${key} header`); + const collected = new Uint8Array(length); + let offset = 0; + for (const chunk of chunks) { + collected.set(chunk, offset); + offset += chunk.length; + } + return collected; + } + __name(collectStream, "collectStream"); + function readToBase64(blob) { + return new Promise((resolve, reject) => { + const reader = new FileReader(); + reader.onloadend = () => { + if (reader.readyState !== 2) { + return reject(new Error("Reader aborted too early")); + } + const result = reader.result ?? ""; + const commaIndex = result.indexOf(","); + const dataOffset = commaIndex > -1 ? commaIndex + 1 : result.length; + resolve(result.substring(dataOffset)); + }; + reader.onabort = () => reject(new Error("Read aborted")); + reader.onerror = () => reject(reader.error); + reader.readAsDataURL(blob); + }); + } + __name(readToBase64, "readToBase64"); + } +}); + +// node_modules/@smithy/util-hex-encoding/dist-cjs/index.js +var require_dist_cjs30 = __commonJS({ + "node_modules/@smithy/util-hex-encoding/dist-cjs/index.js"(exports2, module2) { + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); + }; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + } + return to; + }; + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + fromHex: () => fromHex, + toHex: () => toHex + }); + module2.exports = __toCommonJS2(src_exports); + var SHORT_TO_HEX = {}; + var HEX_TO_SHORT = {}; + for (let i = 0; i < 256; i++) { + let encodedByte = i.toString(16).toLowerCase(); + if (encodedByte.length === 1) { + encodedByte = `0${encodedByte}`; + } + SHORT_TO_HEX[i] = encodedByte; + HEX_TO_SHORT[encodedByte] = i; + } + function fromHex(encoded) { + if (encoded.length % 2 !== 0) { + throw new Error("Hex encoded strings must have an even number length"); + } + const out = new Uint8Array(encoded.length / 2); + for (let i = 0; i < encoded.length; i += 2) { + const encodedByte = encoded.slice(i, i + 2).toLowerCase(); + if (encodedByte in HEX_TO_SHORT) { + out[i / 2] = HEX_TO_SHORT[encodedByte]; + } else { + throw new Error(`Cannot decode unrecognized sequence ${encodedByte} as hexadecimal`); + } + } + return out; + } + __name(fromHex, "fromHex"); + function toHex(bytes) { + let out = ""; + for (let i = 0; i < bytes.byteLength; i++) { + out += SHORT_TO_HEX[bytes[i]]; + } + return out; + } + __name(toHex, "toHex"); + } +}); + +// node_modules/@smithy/util-stream/dist-cjs/stream-type-check.js +var require_stream_type_check = __commonJS({ + "node_modules/@smithy/util-stream/dist-cjs/stream-type-check.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.isReadableStream = void 0; + var isReadableStream2 = (stream) => { + var _a; + return typeof ReadableStream === "function" && (((_a = stream === null || stream === void 0 ? void 0 : stream.constructor) === null || _a === void 0 ? void 0 : _a.name) === ReadableStream.name || stream instanceof ReadableStream); + }; + exports2.isReadableStream = isReadableStream2; + } +}); + +// node_modules/@smithy/util-stream/dist-cjs/sdk-stream-mixin.browser.js +var require_sdk_stream_mixin_browser = __commonJS({ + "node_modules/@smithy/util-stream/dist-cjs/sdk-stream-mixin.browser.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.sdkStreamMixin = void 0; + var fetch_http_handler_1 = require_dist_cjs29(); + var util_base64_1 = require_dist_cjs25(); + var util_hex_encoding_1 = require_dist_cjs30(); + var util_utf8_1 = require_dist_cjs24(); + var stream_type_check_1 = require_stream_type_check(); + var ERR_MSG_STREAM_HAS_BEEN_TRANSFORMED = "The stream has already been transformed."; + var sdkStreamMixin2 = (stream) => { + var _a, _b; + if (!isBlobInstance(stream) && !(0, stream_type_check_1.isReadableStream)(stream)) { + const name = ((_b = (_a = stream === null || stream === void 0 ? void 0 : stream.__proto__) === null || _a === void 0 ? void 0 : _a.constructor) === null || _b === void 0 ? void 0 : _b.name) || stream; + throw new Error(`Unexpected stream implementation, expect Blob or ReadableStream, got ${name}`); + } + let transformed = false; + const transformToByteArray = async () => { + if (transformed) { + throw new Error(ERR_MSG_STREAM_HAS_BEEN_TRANSFORMED); + } + transformed = true; + return await (0, fetch_http_handler_1.streamCollector)(stream); + }; + const blobToWebStream = (blob) => { + if (typeof blob.stream !== "function") { + throw new Error("Cannot transform payload Blob to web stream. Please make sure the Blob.stream() is polyfilled.\nIf you are using React Native, this API is not yet supported, see: https://react-native.canny.io/feature-requests/p/fetch-streaming-body"); + } + return blob.stream(); + }; + return Object.assign(stream, { + transformToByteArray, + transformToString: async (encoding) => { + const buf = await transformToByteArray(); + if (encoding === "base64") { + return (0, util_base64_1.toBase64)(buf); + } else if (encoding === "hex") { + return (0, util_hex_encoding_1.toHex)(buf); + } else if (encoding === void 0 || encoding === "utf8" || encoding === "utf-8") { + return (0, util_utf8_1.toUtf8)(buf); + } else if (typeof TextDecoder === "function") { + return new TextDecoder(encoding).decode(buf); + } else { + throw new Error("TextDecoder is not available, please make sure polyfill is provided."); + } + }, + transformToWebStream: () => { + if (transformed) { + throw new Error(ERR_MSG_STREAM_HAS_BEEN_TRANSFORMED); + } + transformed = true; + if (isBlobInstance(stream)) { + return blobToWebStream(stream); + } else if ((0, stream_type_check_1.isReadableStream)(stream)) { + return stream; } else { - arr.push(`${val[i]}`); + throw new Error(`Cannot transform payload to web stream, got ${stream}`); } } - val = arr; - } else if (typeof val === "string") { - if (!isValidHeaderValue(val)) { - throw new InvalidArgumentError(`invalid ${key} header`); + }); + }; + exports2.sdkStreamMixin = sdkStreamMixin2; + var isBlobInstance = (stream) => typeof Blob === "function" && stream instanceof Blob; + } +}); + +// node_modules/@smithy/util-stream/dist-cjs/sdk-stream-mixin.js +var require_sdk_stream_mixin = __commonJS({ + "node_modules/@smithy/util-stream/dist-cjs/sdk-stream-mixin.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.sdkStreamMixin = void 0; + var node_http_handler_1 = require_dist_cjs28(); + var util_buffer_from_1 = require_dist_cjs23(); + var stream_1 = require("stream"); + var util_1 = require("util"); + var sdk_stream_mixin_browser_1 = require_sdk_stream_mixin_browser(); + var ERR_MSG_STREAM_HAS_BEEN_TRANSFORMED = "The stream has already been transformed."; + var sdkStreamMixin2 = (stream) => { + var _a, _b; + if (!(stream instanceof stream_1.Readable)) { + try { + return (0, sdk_stream_mixin_browser_1.sdkStreamMixin)(stream); + } catch (e) { + const name = ((_b = (_a = stream === null || stream === void 0 ? void 0 : stream.__proto__) === null || _a === void 0 ? void 0 : _a.constructor) === null || _b === void 0 ? void 0 : _b.name) || stream; + throw new Error(`Unexpected stream implementation, expect Stream.Readable instance, got ${name}`); } - } else if (val === null) { - val = ""; - } else { - val = `${val}`; } - if (request2.host === null && headerName === "host") { - if (typeof val !== "string") { - throw new InvalidArgumentError("invalid host header"); + let transformed = false; + const transformToByteArray = async () => { + if (transformed) { + throw new Error(ERR_MSG_STREAM_HAS_BEEN_TRANSFORMED); } - request2.host = val; - } else if (request2.contentLength === null && headerName === "content-length") { - request2.contentLength = parseInt(val, 10); - if (!Number.isFinite(request2.contentLength)) { - throw new InvalidArgumentError("invalid content-length header"); + transformed = true; + return await (0, node_http_handler_1.streamCollector)(stream); + }; + return Object.assign(stream, { + transformToByteArray, + transformToString: async (encoding) => { + const buf = await transformToByteArray(); + if (encoding === void 0 || Buffer.isEncoding(encoding)) { + return (0, util_buffer_from_1.fromArrayBuffer)(buf.buffer, buf.byteOffset, buf.byteLength).toString(encoding); + } else { + const decoder = new util_1.TextDecoder(encoding); + return decoder.decode(buf); + } + }, + transformToWebStream: () => { + if (transformed) { + throw new Error(ERR_MSG_STREAM_HAS_BEEN_TRANSFORMED); + } + if (stream.readableFlowing !== null) { + throw new Error("The stream has been consumed by other callbacks."); + } + if (typeof stream_1.Readable.toWeb !== "function") { + throw new Error("Readable.toWeb() is not supported. Please make sure you are using Node.js >= 17.0.0, or polyfill is available."); + } + transformed = true; + return stream_1.Readable.toWeb(stream); } - } else if (request2.contentType === null && headerName === "content-type") { - request2.contentType = val; - request2.headers.push(key, val); - } else if (headerName === "transfer-encoding" || headerName === "keep-alive" || headerName === "upgrade") { - throw new InvalidArgumentError(`invalid ${headerName} header`); - } else if (headerName === "connection") { - const value = typeof val === "string" ? val.toLowerCase() : null; - if (value !== "close" && value !== "keep-alive") { - throw new InvalidArgumentError("invalid connection header"); + }); + }; + exports2.sdkStreamMixin = sdkStreamMixin2; + } +}); + +// node_modules/@smithy/util-stream/dist-cjs/splitStream.browser.js +var require_splitStream_browser = __commonJS({ + "node_modules/@smithy/util-stream/dist-cjs/splitStream.browser.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.splitStream = void 0; + async function splitStream2(stream) { + if (typeof stream.stream === "function") { + stream = stream.stream(); + } + const readableStream = stream; + return readableStream.tee(); + } + exports2.splitStream = splitStream2; + } +}); + +// node_modules/@smithy/util-stream/dist-cjs/splitStream.js +var require_splitStream = __commonJS({ + "node_modules/@smithy/util-stream/dist-cjs/splitStream.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.splitStream = void 0; + var stream_1 = require("stream"); + var splitStream_browser_1 = require_splitStream_browser(); + var stream_type_check_1 = require_stream_type_check(); + async function splitStream2(stream) { + if ((0, stream_type_check_1.isReadableStream)(stream)) { + return (0, splitStream_browser_1.splitStream)(stream); + } + const stream1 = new stream_1.PassThrough(); + const stream2 = new stream_1.PassThrough(); + stream.pipe(stream1); + stream.pipe(stream2); + return [stream1, stream2]; + } + exports2.splitStream = splitStream2; + } +}); + +// node_modules/@smithy/util-stream/dist-cjs/headStream.browser.js +var require_headStream_browser = __commonJS({ + "node_modules/@smithy/util-stream/dist-cjs/headStream.browser.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.headStream = void 0; + async function headStream2(stream, bytes) { + var _a; + let byteLengthCounter = 0; + const chunks = []; + const reader = stream.getReader(); + let isDone = false; + while (!isDone) { + const { done, value } = await reader.read(); + if (value) { + chunks.push(value); + byteLengthCounter += (_a = value === null || value === void 0 ? void 0 : value.byteLength) !== null && _a !== void 0 ? _a : 0; + } + if (byteLengthCounter >= bytes) { + break; } - if (value === "close") { - request2.reset = true; + isDone = done; + } + reader.releaseLock(); + const collected = new Uint8Array(Math.min(bytes, byteLengthCounter)); + let offset = 0; + for (const chunk of chunks) { + if (chunk.byteLength > collected.byteLength - offset) { + collected.set(chunk.subarray(0, collected.byteLength - offset), offset); + break; + } else { + collected.set(chunk, offset); } - } else if (headerName === "expect") { - throw new NotSupportedError("expect header not supported"); - } else { - request2.headers.push(key, val); + offset += chunk.length; } + return collected; } - module2.exports = Request; + exports2.headStream = headStream2; } }); -// node_modules/undici/lib/dispatcher/dispatcher.js -var require_dispatcher2 = __commonJS({ - "node_modules/undici/lib/dispatcher/dispatcher.js"(exports2, module2) { +// node_modules/@smithy/util-stream/dist-cjs/headStream.js +var require_headStream = __commonJS({ + "node_modules/@smithy/util-stream/dist-cjs/headStream.js"(exports2) { "use strict"; - var EventEmitter = require("node:events"); - var Dispatcher = class extends EventEmitter { - dispatch() { - throw new Error("not implemented"); - } - close() { - throw new Error("not implemented"); + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.headStream = void 0; + var stream_1 = require("stream"); + var headStream_browser_1 = require_headStream_browser(); + var stream_type_check_1 = require_stream_type_check(); + var headStream2 = (stream, bytes) => { + if ((0, stream_type_check_1.isReadableStream)(stream)) { + return (0, headStream_browser_1.headStream)(stream, bytes); } - destroy() { - throw new Error("not implemented"); + return new Promise((resolve, reject) => { + const collector = new Collector(); + collector.limit = bytes; + stream.pipe(collector); + stream.on("error", (err) => { + collector.end(); + reject(err); + }); + collector.on("error", reject); + collector.on("finish", function() { + const bytes2 = new Uint8Array(Buffer.concat(this.buffers)); + resolve(bytes2); + }); + }); + }; + exports2.headStream = headStream2; + var Collector = class extends stream_1.Writable { + constructor() { + super(...arguments); + this.buffers = []; + this.limit = Infinity; + this.bytesBuffered = 0; } - compose(...args) { - const interceptors = Array.isArray(args[0]) ? args[0] : args; - let dispatch = this.dispatch.bind(this); - for (const interceptor of interceptors) { - if (interceptor == null) { - continue; - } - if (typeof interceptor !== "function") { - throw new TypeError(`invalid interceptor, expected function received ${typeof interceptor}`); - } - dispatch = interceptor(dispatch); - if (dispatch == null || typeof dispatch !== "function" || dispatch.length !== 2) { - throw new TypeError("invalid interceptor"); - } + _write(chunk, encoding, callback) { + var _a; + this.buffers.push(chunk); + this.bytesBuffered += (_a = chunk.byteLength) !== null && _a !== void 0 ? _a : 0; + if (this.bytesBuffered >= this.limit) { + const excess = this.bytesBuffered - this.limit; + const tailBuffer = this.buffers[this.buffers.length - 1]; + this.buffers[this.buffers.length - 1] = tailBuffer.subarray(0, tailBuffer.byteLength - excess); + this.emit("finish"); } - return new ComposedDispatcher(this, dispatch); + callback(); } }; - var ComposedDispatcher = class extends Dispatcher { - #dispatcher = null; - #dispatch = null; - constructor(dispatcher, dispatch) { - super(); - this.#dispatcher = dispatcher; - this.#dispatch = dispatch; + } +}); + +// node_modules/@smithy/util-stream/dist-cjs/index.js +var require_dist_cjs31 = __commonJS({ + "node_modules/@smithy/util-stream/dist-cjs/index.js"(exports2, module2) { + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); + }; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + } + return to; + }; + var __reExport = (target, mod, secondTarget) => (__copyProps2(target, mod, "default"), secondTarget && __copyProps2(secondTarget, mod, "default")); + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + Uint8ArrayBlobAdapter: () => Uint8ArrayBlobAdapter + }); + module2.exports = __toCommonJS2(src_exports); + var import_util_base64 = require_dist_cjs25(); + var import_util_utf8 = require_dist_cjs24(); + function transformToString(payload, encoding = "utf-8") { + if (encoding === "base64") { + return (0, import_util_base64.toBase64)(payload); } - dispatch(...args) { - this.#dispatch(...args); + return (0, import_util_utf8.toUtf8)(payload); + } + __name(transformToString, "transformToString"); + function transformFromString(str, encoding) { + if (encoding === "base64") { + return Uint8ArrayBlobAdapter.mutate((0, import_util_base64.fromBase64)(str)); } - close(...args) { - return this.#dispatcher.close(...args); + return Uint8ArrayBlobAdapter.mutate((0, import_util_utf8.fromUtf8)(str)); + } + __name(transformFromString, "transformFromString"); + var _Uint8ArrayBlobAdapter = class _Uint8ArrayBlobAdapter2 extends Uint8Array { + /** + * @param source - such as a string or Stream. + * @returns a new Uint8ArrayBlobAdapter extending Uint8Array. + */ + static fromString(source, encoding = "utf-8") { + switch (typeof source) { + case "string": + return transformFromString(source, encoding); + default: + throw new Error(`Unsupported conversion from ${typeof source} to Uint8ArrayBlobAdapter.`); + } } - destroy(...args) { - return this.#dispatcher.destroy(...args); + /** + * @param source - Uint8Array to be mutated. + * @returns the same Uint8Array but with prototype switched to Uint8ArrayBlobAdapter. + */ + static mutate(source) { + Object.setPrototypeOf(source, _Uint8ArrayBlobAdapter2.prototype); + return source; + } + /** + * @param encoding - default 'utf-8'. + * @returns the blob as string. + */ + transformToString(encoding = "utf-8") { + return transformToString(this, encoding); } }; - module2.exports = Dispatcher; + __name(_Uint8ArrayBlobAdapter, "Uint8ArrayBlobAdapter"); + var Uint8ArrayBlobAdapter = _Uint8ArrayBlobAdapter; + __reExport(src_exports, require_getAwsChunkedEncodingStream(), module2.exports); + __reExport(src_exports, require_sdk_stream_mixin(), module2.exports); + __reExport(src_exports, require_splitStream(), module2.exports); + __reExport(src_exports, require_headStream(), module2.exports); + __reExport(src_exports, require_stream_type_check(), module2.exports); } }); -// node_modules/undici/lib/dispatcher/dispatcher-base.js -var require_dispatcher_base2 = __commonJS({ - "node_modules/undici/lib/dispatcher/dispatcher-base.js"(exports2, module2) { - "use strict"; - var Dispatcher = require_dispatcher2(); - var { - ClientDestroyedError, - ClientClosedError, - InvalidArgumentError - } = require_errors2(); - var { kDestroy, kClose, kClosed, kDestroyed, kDispatch, kInterceptors } = require_symbols6(); - var kOnDestroyed = Symbol("onDestroyed"); - var kOnClosed = Symbol("onClosed"); - var kInterceptedDispatch = Symbol("Intercepted Dispatch"); - var DispatcherBase = class extends Dispatcher { - constructor() { - super(); - this[kDestroyed] = false; - this[kOnDestroyed] = null; - this[kClosed] = false; - this[kOnClosed] = []; +// node_modules/@smithy/smithy-client/dist-cjs/index.js +var require_dist_cjs32 = __commonJS({ + "node_modules/@smithy/smithy-client/dist-cjs/index.js"(exports2, module2) { + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); + }; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + } + return to; + }; + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + Client: () => Client, + Command: () => Command, + LazyJsonString: () => LazyJsonString, + NoOpLogger: () => NoOpLogger, + SENSITIVE_STRING: () => SENSITIVE_STRING, + ServiceException: () => ServiceException, + StringWrapper: () => StringWrapper, + _json: () => _json, + collectBody: () => collectBody2, + convertMap: () => convertMap, + createAggregatedClient: () => createAggregatedClient, + dateToUtcString: () => dateToUtcString, + decorateServiceException: () => decorateServiceException, + emitWarningIfUnsupportedVersion: () => emitWarningIfUnsupportedVersion2, + expectBoolean: () => expectBoolean, + expectByte: () => expectByte, + expectFloat32: () => expectFloat32, + expectInt: () => expectInt, + expectInt32: () => expectInt32, + expectLong: () => expectLong, + expectNonNull: () => expectNonNull, + expectNumber: () => expectNumber, + expectObject: () => expectObject, + expectShort: () => expectShort, + expectString: () => expectString, + expectUnion: () => expectUnion2, + extendedEncodeURIComponent: () => extendedEncodeURIComponent, + getArrayIfSingleItem: () => getArrayIfSingleItem, + getDefaultClientConfiguration: () => getDefaultClientConfiguration, + getDefaultExtensionConfiguration: () => getDefaultExtensionConfiguration, + getValueFromTextNode: () => getValueFromTextNode2, + handleFloat: () => handleFloat, + limitedParseDouble: () => limitedParseDouble, + limitedParseFloat: () => limitedParseFloat, + limitedParseFloat32: () => limitedParseFloat32, + loadConfigsForDefaultMode: () => loadConfigsForDefaultMode, + logger: () => logger, + map: () => map, + parseBoolean: () => parseBoolean, + parseEpochTimestamp: () => parseEpochTimestamp, + parseRfc3339DateTime: () => parseRfc3339DateTime, + parseRfc3339DateTimeWithOffset: () => parseRfc3339DateTimeWithOffset, + parseRfc7231DateTime: () => parseRfc7231DateTime, + resolveDefaultRuntimeConfig: () => resolveDefaultRuntimeConfig, + resolvedPath: () => resolvedPath2, + serializeDateTime: () => serializeDateTime, + serializeFloat: () => serializeFloat, + splitEvery: () => splitEvery, + strictParseByte: () => strictParseByte, + strictParseDouble: () => strictParseDouble, + strictParseFloat: () => strictParseFloat, + strictParseFloat32: () => strictParseFloat32, + strictParseInt: () => strictParseInt, + strictParseInt32: () => strictParseInt32, + strictParseLong: () => strictParseLong, + strictParseShort: () => strictParseShort, + take: () => take, + throwDefaultError: () => throwDefaultError, + withBaseException: () => withBaseException + }); + module2.exports = __toCommonJS2(src_exports); + var _NoOpLogger = class _NoOpLogger { + trace() { } - get destroyed() { - return this[kDestroyed]; + debug() { } - get closed() { - return this[kClosed]; + info() { } - get interceptors() { - return this[kInterceptors]; + warn() { } - set interceptors(newInterceptors) { - if (newInterceptors) { - for (let i = newInterceptors.length - 1; i >= 0; i--) { - const interceptor = this[kInterceptors][i]; - if (typeof interceptor !== "function") { - throw new InvalidArgumentError("interceptor must be an function"); + error() { + } + }; + __name(_NoOpLogger, "NoOpLogger"); + var NoOpLogger = _NoOpLogger; + var import_middleware_stack = require_dist_cjs21(); + var _Client = class _Client { + constructor(config) { + this.middlewareStack = (0, import_middleware_stack.constructStack)(); + this.config = config; + } + send(command, optionsOrCb, cb) { + const options = typeof optionsOrCb !== "function" ? optionsOrCb : void 0; + const callback = typeof optionsOrCb === "function" ? optionsOrCb : cb; + const handler = command.resolveMiddleware(this.middlewareStack, this.config, options); + if (callback) { + handler(command).then( + (result) => callback(null, result.output), + (err) => callback(err) + ).catch( + // prevent any errors thrown in the callback from triggering an + // unhandled promise rejection + () => { } - } + ); + } else { + return handler(command).then((result) => result.output); } - this[kInterceptors] = newInterceptors; } - close(callback) { - if (callback === void 0) { - return new Promise((resolve, reject) => { - this.close((err, data) => { - return err ? reject(err) : resolve(data); - }); - }); - } - if (typeof callback !== "function") { - throw new InvalidArgumentError("invalid callback"); - } - if (this[kDestroyed]) { - queueMicrotask(() => callback(new ClientDestroyedError(), null)); - return; - } - if (this[kClosed]) { - if (this[kOnClosed]) { - this[kOnClosed].push(callback); - } else { - queueMicrotask(() => callback(null, null)); - } - return; - } - this[kClosed] = true; - this[kOnClosed].push(callback); - const onClosed = () => { - const callbacks = this[kOnClosed]; - this[kOnClosed] = null; - for (let i = 0; i < callbacks.length; i++) { - callbacks[i](null, null); - } + destroy() { + if (this.config.requestHandler.destroy) + this.config.requestHandler.destroy(); + } + }; + __name(_Client, "Client"); + var Client = _Client; + var import_util_stream = require_dist_cjs31(); + var collectBody2 = /* @__PURE__ */ __name(async (streamBody = new Uint8Array(), context) => { + if (streamBody instanceof Uint8Array) { + return import_util_stream.Uint8ArrayBlobAdapter.mutate(streamBody); + } + if (!streamBody) { + return import_util_stream.Uint8ArrayBlobAdapter.mutate(new Uint8Array()); + } + const fromContext = context.streamCollector(streamBody); + return import_util_stream.Uint8ArrayBlobAdapter.mutate(await fromContext); + }, "collectBody"); + var import_types5 = require_dist_cjs(); + var _Command = class _Command { + constructor() { + this.middlewareStack = (0, import_middleware_stack.constructStack)(); + } + /** + * Factory for Command ClassBuilder. + * @internal + */ + static classBuilder() { + return new ClassBuilder(); + } + /** + * @internal + */ + resolveMiddlewareWithContext(clientStack, configuration, options, { + middlewareFn, + clientName, + commandName, + inputFilterSensitiveLog, + outputFilterSensitiveLog, + smithyContext, + additionalContext, + CommandCtor + }) { + for (const mw of middlewareFn.bind(this)(CommandCtor, clientStack, configuration, options)) { + this.middlewareStack.use(mw); + } + const stack = clientStack.concat(this.middlewareStack); + const { logger: logger2 } = configuration; + const handlerExecutionContext = { + logger: logger2, + clientName, + commandName, + inputFilterSensitiveLog, + outputFilterSensitiveLog, + [import_types5.SMITHY_CONTEXT_KEY]: { + commandInstance: this, + ...smithyContext + }, + ...additionalContext }; - this[kClose]().then(() => this.destroy()).then(() => { - queueMicrotask(onClosed); - }); + const { requestHandler } = configuration; + return stack.resolve( + (request2) => requestHandler.handle(request2.request, options || {}), + handlerExecutionContext + ); } - destroy(err, callback) { - if (typeof err === "function") { - callback = err; - err = null; - } - if (callback === void 0) { - return new Promise((resolve, reject) => { - this.destroy(err, (err2, data) => { - return err2 ? ( - /* istanbul ignore next: should never error */ - reject(err2) - ) : resolve(data); - }); - }); - } - if (typeof callback !== "function") { - throw new InvalidArgumentError("invalid callback"); - } - if (this[kDestroyed]) { - if (this[kOnDestroyed]) { - this[kOnDestroyed].push(callback); - } else { - queueMicrotask(() => callback(null, null)); - } - return; - } - if (!err) { - err = new ClientDestroyedError(); - } - this[kDestroyed] = true; - this[kOnDestroyed] = this[kOnDestroyed] || []; - this[kOnDestroyed].push(callback); - const onDestroyed = () => { - const callbacks = this[kOnDestroyed]; - this[kOnDestroyed] = null; - for (let i = 0; i < callbacks.length; i++) { - callbacks[i](null, null); - } + }; + __name(_Command, "Command"); + var Command = _Command; + var _ClassBuilder = class _ClassBuilder { + constructor() { + this._init = () => { }; - this[kDestroy](err).then(() => { - queueMicrotask(onDestroyed); - }); + this._ep = {}; + this._middlewareFn = () => []; + this._commandName = ""; + this._clientName = ""; + this._additionalContext = {}; + this._smithyContext = {}; + this._inputFilterSensitiveLog = (_) => _; + this._outputFilterSensitiveLog = (_) => _; + this._serializer = null; + this._deserializer = null; } - [kInterceptedDispatch](opts, handler) { - if (!this[kInterceptors] || this[kInterceptors].length === 0) { - this[kInterceptedDispatch] = this[kDispatch]; - return this[kDispatch](opts, handler); - } - let dispatch = this[kDispatch].bind(this); - for (let i = this[kInterceptors].length - 1; i >= 0; i--) { - dispatch = this[kInterceptors][i](dispatch); - } - this[kInterceptedDispatch] = dispatch; - return dispatch(opts, handler); + /** + * Optional init callback. + */ + init(cb) { + this._init = cb; } - dispatch(opts, handler) { - if (!handler || typeof handler !== "object") { - throw new InvalidArgumentError("handler must be an object"); - } - try { - if (!opts || typeof opts !== "object") { - throw new InvalidArgumentError("opts must be an object."); - } - if (this[kDestroyed] || this[kOnDestroyed]) { - throw new ClientDestroyedError(); - } - if (this[kClosed]) { - throw new ClientClosedError(); + /** + * Set the endpoint parameter instructions. + */ + ep(endpointParameterInstructions) { + this._ep = endpointParameterInstructions; + return this; + } + /** + * Add any number of middleware. + */ + m(middlewareSupplier) { + this._middlewareFn = middlewareSupplier; + return this; + } + /** + * Set the initial handler execution context Smithy field. + */ + s(service, operation, smithyContext = {}) { + this._smithyContext = { + service, + operation, + ...smithyContext + }; + return this; + } + /** + * Set the initial handler execution context. + */ + c(additionalContext = {}) { + this._additionalContext = additionalContext; + return this; + } + /** + * Set constant string identifiers for the operation. + */ + n(clientName, commandName) { + this._clientName = clientName; + this._commandName = commandName; + return this; + } + /** + * Set the input and output sensistive log filters. + */ + f(inputFilter = (_) => _, outputFilter = (_) => _) { + this._inputFilterSensitiveLog = inputFilter; + this._outputFilterSensitiveLog = outputFilter; + return this; + } + /** + * Sets the serializer. + */ + ser(serializer) { + this._serializer = serializer; + return this; + } + /** + * Sets the deserializer. + */ + de(deserializer) { + this._deserializer = deserializer; + return this; + } + /** + * @returns a Command class with the classBuilder properties. + */ + build() { + var _a; + const closure = this; + let CommandRef; + return CommandRef = (_a = class extends Command { + /** + * @public + */ + constructor(...[input]) { + super(); + this.serialize = closure._serializer; + this.deserialize = closure._deserializer; + this.input = input ?? {}; + closure._init(this); + } + /** + * @public + */ + static getEndpointParameterInstructions() { + return closure._ep; + } + /** + * @internal + */ + resolveMiddleware(stack, configuration, options) { + return this.resolveMiddlewareWithContext(stack, configuration, options, { + CommandCtor: CommandRef, + middlewareFn: closure._middlewareFn, + clientName: closure._clientName, + commandName: closure._commandName, + inputFilterSensitiveLog: closure._inputFilterSensitiveLog, + outputFilterSensitiveLog: closure._outputFilterSensitiveLog, + smithyContext: closure._smithyContext, + additionalContext: closure._additionalContext + }); } - return this[kInterceptedDispatch](opts, handler); - } catch (err) { - if (typeof handler.onError !== "function") { - throw new InvalidArgumentError("invalid onError method"); + }, __name(_a, "CommandRef"), _a); + } + }; + __name(_ClassBuilder, "ClassBuilder"); + var ClassBuilder = _ClassBuilder; + var SENSITIVE_STRING = "***SensitiveInformation***"; + var createAggregatedClient = /* @__PURE__ */ __name((commands, Client2) => { + for (const command of Object.keys(commands)) { + const CommandCtor = commands[command]; + const methodImpl = /* @__PURE__ */ __name(async function(args, optionsOrCb, cb) { + const command2 = new CommandCtor(args); + if (typeof optionsOrCb === "function") { + this.send(command2, optionsOrCb); + } else if (typeof cb === "function") { + if (typeof optionsOrCb !== "object") + throw new Error(`Expected http options but got ${typeof optionsOrCb}`); + this.send(command2, optionsOrCb || {}, cb); + } else { + return this.send(command2, optionsOrCb); } - handler.onError(err); + }, "methodImpl"); + const methodName = (command[0].toLowerCase() + command.slice(1)).replace(/Command$/, ""); + Client2.prototype[methodName] = methodImpl; + } + }, "createAggregatedClient"); + var parseBoolean = /* @__PURE__ */ __name((value) => { + switch (value) { + case "true": + return true; + case "false": + return false; + default: + throw new Error(`Unable to parse boolean value "${value}"`); + } + }, "parseBoolean"); + var expectBoolean = /* @__PURE__ */ __name((value) => { + if (value === null || value === void 0) { + return void 0; + } + if (typeof value === "number") { + if (value === 0 || value === 1) { + logger.warn(stackTraceWarning(`Expected boolean, got ${typeof value}: ${value}`)); + } + if (value === 0) { return false; } + if (value === 1) { + return true; + } } - }; - module2.exports = DispatcherBase; - } -}); - -// node_modules/undici/lib/core/connect.js -var require_connect2 = __commonJS({ - "node_modules/undici/lib/core/connect.js"(exports2, module2) { - "use strict"; - var net = require("node:net"); - var assert = require("node:assert"); - var util = require_util8(); - var { InvalidArgumentError, ConnectTimeoutError } = require_errors2(); - var tls; - var SessionCache; - if (global.FinalizationRegistry && !(process.env.NODE_V8_COVERAGE || process.env.UNDICI_NO_FG)) { - SessionCache = class WeakSessionCache { - constructor(maxCachedSessions) { - this._maxCachedSessions = maxCachedSessions; - this._sessionCache = /* @__PURE__ */ new Map(); - this._sessionRegistry = new global.FinalizationRegistry((key) => { - if (this._sessionCache.size < this._maxCachedSessions) { - return; - } - const ref = this._sessionCache.get(key); - if (ref !== void 0 && ref.deref() === void 0) { - this._sessionCache.delete(key); - } - }); + if (typeof value === "string") { + const lower = value.toLowerCase(); + if (lower === "false" || lower === "true") { + logger.warn(stackTraceWarning(`Expected boolean, got ${typeof value}: ${value}`)); } - get(sessionKey) { - const ref = this._sessionCache.get(sessionKey); - return ref ? ref.deref() : null; + if (lower === "false") { + return false; } - set(sessionKey, session) { - if (this._maxCachedSessions === 0) { - return; + if (lower === "true") { + return true; + } + } + if (typeof value === "boolean") { + return value; + } + throw new TypeError(`Expected boolean, got ${typeof value}: ${value}`); + }, "expectBoolean"); + var expectNumber = /* @__PURE__ */ __name((value) => { + if (value === null || value === void 0) { + return void 0; + } + if (typeof value === "string") { + const parsed = parseFloat(value); + if (!Number.isNaN(parsed)) { + if (String(parsed) !== String(value)) { + logger.warn(stackTraceWarning(`Expected number but observed string: ${value}`)); } - this._sessionCache.set(sessionKey, new WeakRef(session)); - this._sessionRegistry.register(session, sessionKey); + return parsed; + } + } + if (typeof value === "number") { + return value; + } + throw new TypeError(`Expected number, got ${typeof value}: ${value}`); + }, "expectNumber"); + var MAX_FLOAT = Math.ceil(2 ** 127 * (2 - 2 ** -23)); + var expectFloat32 = /* @__PURE__ */ __name((value) => { + const expected = expectNumber(value); + if (expected !== void 0 && !Number.isNaN(expected) && expected !== Infinity && expected !== -Infinity) { + if (Math.abs(expected) > MAX_FLOAT) { + throw new TypeError(`Expected 32-bit float, got ${value}`); + } + } + return expected; + }, "expectFloat32"); + var expectLong = /* @__PURE__ */ __name((value) => { + if (value === null || value === void 0) { + return void 0; + } + if (Number.isInteger(value) && !Number.isNaN(value)) { + return value; + } + throw new TypeError(`Expected integer, got ${typeof value}: ${value}`); + }, "expectLong"); + var expectInt = expectLong; + var expectInt32 = /* @__PURE__ */ __name((value) => expectSizedInt(value, 32), "expectInt32"); + var expectShort = /* @__PURE__ */ __name((value) => expectSizedInt(value, 16), "expectShort"); + var expectByte = /* @__PURE__ */ __name((value) => expectSizedInt(value, 8), "expectByte"); + var expectSizedInt = /* @__PURE__ */ __name((value, size) => { + const expected = expectLong(value); + if (expected !== void 0 && castInt(expected, size) !== expected) { + throw new TypeError(`Expected ${size}-bit integer, got ${value}`); + } + return expected; + }, "expectSizedInt"); + var castInt = /* @__PURE__ */ __name((value, size) => { + switch (size) { + case 32: + return Int32Array.of(value)[0]; + case 16: + return Int16Array.of(value)[0]; + case 8: + return Int8Array.of(value)[0]; + } + }, "castInt"); + var expectNonNull = /* @__PURE__ */ __name((value, location) => { + if (value === null || value === void 0) { + if (location) { + throw new TypeError(`Expected a non-null value for ${location}`); + } + throw new TypeError("Expected a non-null value"); + } + return value; + }, "expectNonNull"); + var expectObject = /* @__PURE__ */ __name((value) => { + if (value === null || value === void 0) { + return void 0; + } + if (typeof value === "object" && !Array.isArray(value)) { + return value; + } + const receivedType = Array.isArray(value) ? "array" : typeof value; + throw new TypeError(`Expected object, got ${receivedType}: ${value}`); + }, "expectObject"); + var expectString = /* @__PURE__ */ __name((value) => { + if (value === null || value === void 0) { + return void 0; + } + if (typeof value === "string") { + return value; + } + if (["boolean", "number", "bigint"].includes(typeof value)) { + logger.warn(stackTraceWarning(`Expected string, got ${typeof value}: ${value}`)); + return String(value); + } + throw new TypeError(`Expected string, got ${typeof value}: ${value}`); + }, "expectString"); + var expectUnion2 = /* @__PURE__ */ __name((value) => { + if (value === null || value === void 0) { + return void 0; + } + const asObject = expectObject(value); + const setKeys = Object.entries(asObject).filter(([, v]) => v != null).map(([k]) => k); + if (setKeys.length === 0) { + throw new TypeError(`Unions must have exactly one non-null member. None were found.`); + } + if (setKeys.length > 1) { + throw new TypeError(`Unions must have exactly one non-null member. Keys ${setKeys} were not null.`); + } + return asObject; + }, "expectUnion"); + var strictParseDouble = /* @__PURE__ */ __name((value) => { + if (typeof value == "string") { + return expectNumber(parseNumber(value)); + } + return expectNumber(value); + }, "strictParseDouble"); + var strictParseFloat = strictParseDouble; + var strictParseFloat32 = /* @__PURE__ */ __name((value) => { + if (typeof value == "string") { + return expectFloat32(parseNumber(value)); + } + return expectFloat32(value); + }, "strictParseFloat32"); + var NUMBER_REGEX = /(-?(?:0|[1-9]\d*)(?:\.\d+)?(?:[eE][+-]?\d+)?)|(-?Infinity)|(NaN)/g; + var parseNumber = /* @__PURE__ */ __name((value) => { + const matches = value.match(NUMBER_REGEX); + if (matches === null || matches[0].length !== value.length) { + throw new TypeError(`Expected real number, got implicit NaN`); + } + return parseFloat(value); + }, "parseNumber"); + var limitedParseDouble = /* @__PURE__ */ __name((value) => { + if (typeof value == "string") { + return parseFloatString(value); + } + return expectNumber(value); + }, "limitedParseDouble"); + var handleFloat = limitedParseDouble; + var limitedParseFloat = limitedParseDouble; + var limitedParseFloat32 = /* @__PURE__ */ __name((value) => { + if (typeof value == "string") { + return parseFloatString(value); + } + return expectFloat32(value); + }, "limitedParseFloat32"); + var parseFloatString = /* @__PURE__ */ __name((value) => { + switch (value) { + case "NaN": + return NaN; + case "Infinity": + return Infinity; + case "-Infinity": + return -Infinity; + default: + throw new Error(`Unable to parse float value: ${value}`); + } + }, "parseFloatString"); + var strictParseLong = /* @__PURE__ */ __name((value) => { + if (typeof value === "string") { + return expectLong(parseNumber(value)); + } + return expectLong(value); + }, "strictParseLong"); + var strictParseInt = strictParseLong; + var strictParseInt32 = /* @__PURE__ */ __name((value) => { + if (typeof value === "string") { + return expectInt32(parseNumber(value)); + } + return expectInt32(value); + }, "strictParseInt32"); + var strictParseShort = /* @__PURE__ */ __name((value) => { + if (typeof value === "string") { + return expectShort(parseNumber(value)); + } + return expectShort(value); + }, "strictParseShort"); + var strictParseByte = /* @__PURE__ */ __name((value) => { + if (typeof value === "string") { + return expectByte(parseNumber(value)); + } + return expectByte(value); + }, "strictParseByte"); + var stackTraceWarning = /* @__PURE__ */ __name((message) => { + return String(new TypeError(message).stack || message).split("\n").slice(0, 5).filter((s) => !s.includes("stackTraceWarning")).join("\n"); + }, "stackTraceWarning"); + var logger = { + warn: console.warn + }; + var DAYS = ["Sun", "Mon", "Tue", "Wed", "Thu", "Fri", "Sat"]; + var MONTHS = ["Jan", "Feb", "Mar", "Apr", "May", "Jun", "Jul", "Aug", "Sep", "Oct", "Nov", "Dec"]; + function dateToUtcString(date) { + const year = date.getUTCFullYear(); + const month = date.getUTCMonth(); + const dayOfWeek = date.getUTCDay(); + const dayOfMonthInt = date.getUTCDate(); + const hoursInt = date.getUTCHours(); + const minutesInt = date.getUTCMinutes(); + const secondsInt = date.getUTCSeconds(); + const dayOfMonthString = dayOfMonthInt < 10 ? `0${dayOfMonthInt}` : `${dayOfMonthInt}`; + const hoursString = hoursInt < 10 ? `0${hoursInt}` : `${hoursInt}`; + const minutesString = minutesInt < 10 ? `0${minutesInt}` : `${minutesInt}`; + const secondsString = secondsInt < 10 ? `0${secondsInt}` : `${secondsInt}`; + return `${DAYS[dayOfWeek]}, ${dayOfMonthString} ${MONTHS[month]} ${year} ${hoursString}:${minutesString}:${secondsString} GMT`; + } + __name(dateToUtcString, "dateToUtcString"); + var RFC3339 = new RegExp(/^(\d{4})-(\d{2})-(\d{2})[tT](\d{2}):(\d{2}):(\d{2})(?:\.(\d+))?[zZ]$/); + var parseRfc3339DateTime = /* @__PURE__ */ __name((value) => { + if (value === null || value === void 0) { + return void 0; + } + if (typeof value !== "string") { + throw new TypeError("RFC-3339 date-times must be expressed as strings"); + } + const match = RFC3339.exec(value); + if (!match) { + throw new TypeError("Invalid RFC-3339 date-time value"); + } + const [_, yearStr, monthStr, dayStr, hours, minutes, seconds, fractionalMilliseconds] = match; + const year = strictParseShort(stripLeadingZeroes(yearStr)); + const month = parseDateValue(monthStr, "month", 1, 12); + const day = parseDateValue(dayStr, "day", 1, 31); + return buildDate(year, month, day, { hours, minutes, seconds, fractionalMilliseconds }); + }, "parseRfc3339DateTime"); + var RFC3339_WITH_OFFSET = new RegExp( + /^(\d{4})-(\d{2})-(\d{2})[tT](\d{2}):(\d{2}):(\d{2})(?:\.(\d+))?(([-+]\d{2}\:\d{2})|[zZ])$/ + ); + var parseRfc3339DateTimeWithOffset = /* @__PURE__ */ __name((value) => { + if (value === null || value === void 0) { + return void 0; + } + if (typeof value !== "string") { + throw new TypeError("RFC-3339 date-times must be expressed as strings"); + } + const match = RFC3339_WITH_OFFSET.exec(value); + if (!match) { + throw new TypeError("Invalid RFC-3339 date-time value"); + } + const [_, yearStr, monthStr, dayStr, hours, minutes, seconds, fractionalMilliseconds, offsetStr] = match; + const year = strictParseShort(stripLeadingZeroes(yearStr)); + const month = parseDateValue(monthStr, "month", 1, 12); + const day = parseDateValue(dayStr, "day", 1, 31); + const date = buildDate(year, month, day, { hours, minutes, seconds, fractionalMilliseconds }); + if (offsetStr.toUpperCase() != "Z") { + date.setTime(date.getTime() - parseOffsetToMilliseconds(offsetStr)); + } + return date; + }, "parseRfc3339DateTimeWithOffset"); + var IMF_FIXDATE = new RegExp( + /^(?:Mon|Tue|Wed|Thu|Fri|Sat|Sun), (\d{2}) (Jan|Feb|Mar|Apr|May|Jun|Jul|Aug|Sep|Oct|Nov|Dec) (\d{4}) (\d{1,2}):(\d{2}):(\d{2})(?:\.(\d+))? GMT$/ + ); + var RFC_850_DATE = new RegExp( + /^(?:Monday|Tuesday|Wednesday|Thursday|Friday|Saturday|Sunday), (\d{2})-(Jan|Feb|Mar|Apr|May|Jun|Jul|Aug|Sep|Oct|Nov|Dec)-(\d{2}) (\d{1,2}):(\d{2}):(\d{2})(?:\.(\d+))? GMT$/ + ); + var ASC_TIME = new RegExp( + /^(?:Mon|Tue|Wed|Thu|Fri|Sat|Sun) (Jan|Feb|Mar|Apr|May|Jun|Jul|Aug|Sep|Oct|Nov|Dec) ( [1-9]|\d{2}) (\d{1,2}):(\d{2}):(\d{2})(?:\.(\d+))? (\d{4})$/ + ); + var parseRfc7231DateTime = /* @__PURE__ */ __name((value) => { + if (value === null || value === void 0) { + return void 0; + } + if (typeof value !== "string") { + throw new TypeError("RFC-7231 date-times must be expressed as strings"); + } + let match = IMF_FIXDATE.exec(value); + if (match) { + const [_, dayStr, monthStr, yearStr, hours, minutes, seconds, fractionalMilliseconds] = match; + return buildDate( + strictParseShort(stripLeadingZeroes(yearStr)), + parseMonthByShortName(monthStr), + parseDateValue(dayStr, "day", 1, 31), + { hours, minutes, seconds, fractionalMilliseconds } + ); + } + match = RFC_850_DATE.exec(value); + if (match) { + const [_, dayStr, monthStr, yearStr, hours, minutes, seconds, fractionalMilliseconds] = match; + return adjustRfc850Year( + buildDate(parseTwoDigitYear(yearStr), parseMonthByShortName(monthStr), parseDateValue(dayStr, "day", 1, 31), { + hours, + minutes, + seconds, + fractionalMilliseconds + }) + ); + } + match = ASC_TIME.exec(value); + if (match) { + const [_, monthStr, dayStr, hours, minutes, seconds, fractionalMilliseconds, yearStr] = match; + return buildDate( + strictParseShort(stripLeadingZeroes(yearStr)), + parseMonthByShortName(monthStr), + parseDateValue(dayStr.trimLeft(), "day", 1, 31), + { hours, minutes, seconds, fractionalMilliseconds } + ); + } + throw new TypeError("Invalid RFC-7231 date-time value"); + }, "parseRfc7231DateTime"); + var parseEpochTimestamp = /* @__PURE__ */ __name((value) => { + if (value === null || value === void 0) { + return void 0; + } + let valueAsDouble; + if (typeof value === "number") { + valueAsDouble = value; + } else if (typeof value === "string") { + valueAsDouble = strictParseDouble(value); + } else if (typeof value === "object" && value.tag === 1) { + valueAsDouble = value.value; + } else { + throw new TypeError("Epoch timestamps must be expressed as floating point numbers or their string representation"); + } + if (Number.isNaN(valueAsDouble) || valueAsDouble === Infinity || valueAsDouble === -Infinity) { + throw new TypeError("Epoch timestamps must be valid, non-Infinite, non-NaN numerics"); + } + return new Date(Math.round(valueAsDouble * 1e3)); + }, "parseEpochTimestamp"); + var buildDate = /* @__PURE__ */ __name((year, month, day, time) => { + const adjustedMonth = month - 1; + validateDayOfMonth(year, adjustedMonth, day); + return new Date( + Date.UTC( + year, + adjustedMonth, + day, + parseDateValue(time.hours, "hour", 0, 23), + parseDateValue(time.minutes, "minute", 0, 59), + // seconds can go up to 60 for leap seconds + parseDateValue(time.seconds, "seconds", 0, 60), + parseMilliseconds(time.fractionalMilliseconds) + ) + ); + }, "buildDate"); + var parseTwoDigitYear = /* @__PURE__ */ __name((value) => { + const thisYear = (/* @__PURE__ */ new Date()).getUTCFullYear(); + const valueInThisCentury = Math.floor(thisYear / 100) * 100 + strictParseShort(stripLeadingZeroes(value)); + if (valueInThisCentury < thisYear) { + return valueInThisCentury + 100; + } + return valueInThisCentury; + }, "parseTwoDigitYear"); + var FIFTY_YEARS_IN_MILLIS = 50 * 365 * 24 * 60 * 60 * 1e3; + var adjustRfc850Year = /* @__PURE__ */ __name((input) => { + if (input.getTime() - (/* @__PURE__ */ new Date()).getTime() > FIFTY_YEARS_IN_MILLIS) { + return new Date( + Date.UTC( + input.getUTCFullYear() - 100, + input.getUTCMonth(), + input.getUTCDate(), + input.getUTCHours(), + input.getUTCMinutes(), + input.getUTCSeconds(), + input.getUTCMilliseconds() + ) + ); + } + return input; + }, "adjustRfc850Year"); + var parseMonthByShortName = /* @__PURE__ */ __name((value) => { + const monthIdx = MONTHS.indexOf(value); + if (monthIdx < 0) { + throw new TypeError(`Invalid month: ${value}`); + } + return monthIdx + 1; + }, "parseMonthByShortName"); + var DAYS_IN_MONTH = [31, 28, 31, 30, 31, 30, 31, 31, 30, 31, 30, 31]; + var validateDayOfMonth = /* @__PURE__ */ __name((year, month, day) => { + let maxDays = DAYS_IN_MONTH[month]; + if (month === 1 && isLeapYear(year)) { + maxDays = 29; + } + if (day > maxDays) { + throw new TypeError(`Invalid day for ${MONTHS[month]} in ${year}: ${day}`); + } + }, "validateDayOfMonth"); + var isLeapYear = /* @__PURE__ */ __name((year) => { + return year % 4 === 0 && (year % 100 !== 0 || year % 400 === 0); + }, "isLeapYear"); + var parseDateValue = /* @__PURE__ */ __name((value, type, lower, upper) => { + const dateVal = strictParseByte(stripLeadingZeroes(value)); + if (dateVal < lower || dateVal > upper) { + throw new TypeError(`${type} must be between ${lower} and ${upper}, inclusive`); + } + return dateVal; + }, "parseDateValue"); + var parseMilliseconds = /* @__PURE__ */ __name((value) => { + if (value === null || value === void 0) { + return 0; + } + return strictParseFloat32("0." + value) * 1e3; + }, "parseMilliseconds"); + var parseOffsetToMilliseconds = /* @__PURE__ */ __name((value) => { + const directionStr = value[0]; + let direction = 1; + if (directionStr == "+") { + direction = 1; + } else if (directionStr == "-") { + direction = -1; + } else { + throw new TypeError(`Offset direction, ${directionStr}, must be "+" or "-"`); + } + const hour = Number(value.substring(1, 3)); + const minute = Number(value.substring(4, 6)); + return direction * (hour * 60 + minute) * 60 * 1e3; + }, "parseOffsetToMilliseconds"); + var stripLeadingZeroes = /* @__PURE__ */ __name((value) => { + let idx = 0; + while (idx < value.length - 1 && value.charAt(idx) === "0") { + idx++; + } + if (idx === 0) { + return value; + } + return value.slice(idx); + }, "stripLeadingZeroes"); + var _ServiceException = class _ServiceException2 extends Error { + constructor(options) { + super(options.message); + Object.setPrototypeOf(this, _ServiceException2.prototype); + this.name = options.name; + this.$fault = options.$fault; + this.$metadata = options.$metadata; + } + }; + __name(_ServiceException, "ServiceException"); + var ServiceException = _ServiceException; + var decorateServiceException = /* @__PURE__ */ __name((exception, additions = {}) => { + Object.entries(additions).filter(([, v]) => v !== void 0).forEach(([k, v]) => { + if (exception[k] == void 0 || exception[k] === "") { + exception[k] = v; } + }); + const message = exception.message || exception.Message || "UnknownError"; + exception.message = message; + delete exception.Message; + return exception; + }, "decorateServiceException"); + var throwDefaultError = /* @__PURE__ */ __name(({ output, parsedBody, exceptionCtor, errorCode }) => { + const $metadata = deserializeMetadata(output); + const statusCode = $metadata.httpStatusCode ? $metadata.httpStatusCode + "" : void 0; + const response = new exceptionCtor({ + name: (parsedBody == null ? void 0 : parsedBody.code) || (parsedBody == null ? void 0 : parsedBody.Code) || errorCode || statusCode || "UnknownError", + $fault: "client", + $metadata + }); + throw decorateServiceException(response, parsedBody); + }, "throwDefaultError"); + var withBaseException = /* @__PURE__ */ __name((ExceptionCtor) => { + return ({ output, parsedBody, errorCode }) => { + throwDefaultError({ output, parsedBody, exceptionCtor: ExceptionCtor, errorCode }); }; - } else { - SessionCache = class SimpleSessionCache { - constructor(maxCachedSessions) { - this._maxCachedSessions = maxCachedSessions; - this._sessionCache = /* @__PURE__ */ new Map(); + }, "withBaseException"); + var deserializeMetadata = /* @__PURE__ */ __name((output) => ({ + httpStatusCode: output.statusCode, + requestId: output.headers["x-amzn-requestid"] ?? output.headers["x-amzn-request-id"] ?? output.headers["x-amz-request-id"], + extendedRequestId: output.headers["x-amz-id-2"], + cfId: output.headers["x-amz-cf-id"] + }), "deserializeMetadata"); + var loadConfigsForDefaultMode = /* @__PURE__ */ __name((mode) => { + switch (mode) { + case "standard": + return { + retryMode: "standard", + connectionTimeout: 3100 + }; + case "in-region": + return { + retryMode: "standard", + connectionTimeout: 1100 + }; + case "cross-region": + return { + retryMode: "standard", + connectionTimeout: 3100 + }; + case "mobile": + return { + retryMode: "standard", + connectionTimeout: 3e4 + }; + default: + return {}; + } + }, "loadConfigsForDefaultMode"); + var warningEmitted2 = false; + var emitWarningIfUnsupportedVersion2 = /* @__PURE__ */ __name((version3) => { + if (version3 && !warningEmitted2 && parseInt(version3.substring(1, version3.indexOf("."))) < 16) { + warningEmitted2 = true; + } + }, "emitWarningIfUnsupportedVersion"); + var getChecksumConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { + const checksumAlgorithms = []; + for (const id in import_types5.AlgorithmId) { + const algorithmId = import_types5.AlgorithmId[id]; + if (runtimeConfig[algorithmId] === void 0) { + continue; } - get(sessionKey) { - return this._sessionCache.get(sessionKey); + checksumAlgorithms.push({ + algorithmId: () => algorithmId, + checksumConstructor: () => runtimeConfig[algorithmId] + }); + } + return { + _checksumAlgorithms: checksumAlgorithms, + addChecksumAlgorithm(algo) { + this._checksumAlgorithms.push(algo); + }, + checksumAlgorithms() { + return this._checksumAlgorithms; } - set(sessionKey, session) { - if (this._maxCachedSessions === 0) { - return; - } - if (this._sessionCache.size >= this._maxCachedSessions) { - const { value: oldestKey } = this._sessionCache.keys().next(); - this._sessionCache.delete(oldestKey); - } - this._sessionCache.set(sessionKey, session); + }; + }, "getChecksumConfiguration"); + var resolveChecksumRuntimeConfig = /* @__PURE__ */ __name((clientConfig) => { + const runtimeConfig = {}; + clientConfig.checksumAlgorithms().forEach((checksumAlgorithm) => { + runtimeConfig[checksumAlgorithm.algorithmId()] = checksumAlgorithm.checksumConstructor(); + }); + return runtimeConfig; + }, "resolveChecksumRuntimeConfig"); + var getRetryConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { + let _retryStrategy = runtimeConfig.retryStrategy; + return { + setRetryStrategy(retryStrategy) { + _retryStrategy = retryStrategy; + }, + retryStrategy() { + return _retryStrategy; } }; + }, "getRetryConfiguration"); + var resolveRetryRuntimeConfig = /* @__PURE__ */ __name((retryStrategyConfiguration) => { + const runtimeConfig = {}; + runtimeConfig.retryStrategy = retryStrategyConfiguration.retryStrategy(); + return runtimeConfig; + }, "resolveRetryRuntimeConfig"); + var getDefaultExtensionConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { + return { + ...getChecksumConfiguration(runtimeConfig), + ...getRetryConfiguration(runtimeConfig) + }; + }, "getDefaultExtensionConfiguration"); + var getDefaultClientConfiguration = getDefaultExtensionConfiguration; + var resolveDefaultRuntimeConfig = /* @__PURE__ */ __name((config) => { + return { + ...resolveChecksumRuntimeConfig(config), + ...resolveRetryRuntimeConfig(config) + }; + }, "resolveDefaultRuntimeConfig"); + function extendedEncodeURIComponent(str) { + return encodeURIComponent(str).replace(/[!'()*]/g, function(c) { + return "%" + c.charCodeAt(0).toString(16).toUpperCase(); + }); } - function buildConnector({ allowH2, maxCachedSessions, socketPath, timeout, ...opts }) { - if (maxCachedSessions != null && (!Number.isInteger(maxCachedSessions) || maxCachedSessions < 0)) { - throw new InvalidArgumentError("maxCachedSessions must be a positive integer or zero"); + __name(extendedEncodeURIComponent, "extendedEncodeURIComponent"); + var getArrayIfSingleItem = /* @__PURE__ */ __name((mayBeArray) => Array.isArray(mayBeArray) ? mayBeArray : [mayBeArray], "getArrayIfSingleItem"); + var getValueFromTextNode2 = /* @__PURE__ */ __name((obj) => { + const textNodeName = "#text"; + for (const key in obj) { + if (obj.hasOwnProperty(key) && obj[key][textNodeName] !== void 0) { + obj[key] = obj[key][textNodeName]; + } else if (typeof obj[key] === "object" && obj[key] !== null) { + obj[key] = getValueFromTextNode2(obj[key]); + } } - const options = { path: socketPath, ...opts }; - const sessionCache = new SessionCache(maxCachedSessions == null ? 100 : maxCachedSessions); - timeout = timeout == null ? 1e4 : timeout; - allowH2 = allowH2 != null ? allowH2 : false; - return function connect({ hostname, host, protocol, port, servername, localAddress, httpSocket }, callback) { - let socket; - if (protocol === "https:") { - if (!tls) { - tls = require("node:tls"); - } - servername = servername || options.servername || util.getServerName(host) || null; - const sessionKey = servername || hostname; - const session = sessionCache.get(sessionKey) || null; - assert(sessionKey); - socket = tls.connect({ - highWaterMark: 16384, - // TLS in node can't have bigger HWM anyway... - ...options, - servername, - session, - localAddress, - // TODO(HTTP/2): Add support for h2c - ALPNProtocols: allowH2 ? ["http/1.1", "h2"] : ["http/1.1"], - socket: httpSocket, - // upgrade socket connection - port: port || 443, - host: hostname - }); - socket.on("session", function(session2) { - sessionCache.set(sessionKey, session2); - }); + return obj; + }, "getValueFromTextNode"); + var StringWrapper = /* @__PURE__ */ __name(function() { + const Class = Object.getPrototypeOf(this).constructor; + const Constructor = Function.bind.apply(String, [null, ...arguments]); + const instance = new Constructor(); + Object.setPrototypeOf(instance, Class.prototype); + return instance; + }, "StringWrapper"); + StringWrapper.prototype = Object.create(String.prototype, { + constructor: { + value: StringWrapper, + enumerable: false, + writable: true, + configurable: true + } + }); + Object.setPrototypeOf(StringWrapper, String); + var _LazyJsonString = class _LazyJsonString2 extends StringWrapper { + deserializeJSON() { + return JSON.parse(super.toString()); + } + toJSON() { + return super.toString(); + } + static fromObject(object) { + if (object instanceof _LazyJsonString2) { + return object; + } else if (object instanceof String || typeof object === "string") { + return new _LazyJsonString2(object); + } + return new _LazyJsonString2(JSON.stringify(object)); + } + }; + __name(_LazyJsonString, "LazyJsonString"); + var LazyJsonString = _LazyJsonString; + function map(arg0, arg1, arg2) { + let target; + let filter; + let instructions; + if (typeof arg1 === "undefined" && typeof arg2 === "undefined") { + target = {}; + instructions = arg0; + } else { + target = arg0; + if (typeof arg1 === "function") { + filter = arg1; + instructions = arg2; + return mapWithFilter(target, filter, instructions); } else { - assert(!httpSocket, "httpSocket can only be sent on TLS update"); - socket = net.connect({ - highWaterMark: 64 * 1024, - // Same as nodejs fs streams. - ...options, - localAddress, - port: port || 80, - host: hostname - }); + instructions = arg1; } - if (options.keepAlive == null || options.keepAlive) { - const keepAliveInitialDelay = options.keepAliveInitialDelay === void 0 ? 6e4 : options.keepAliveInitialDelay; - socket.setKeepAlive(true, keepAliveInitialDelay); + } + for (const key of Object.keys(instructions)) { + if (!Array.isArray(instructions[key])) { + target[key] = instructions[key]; + continue; } - const cancelTimeout = setupTimeout(() => onConnectTimeout(socket), timeout); - socket.setNoDelay(true).once(protocol === "https:" ? "secureConnect" : "connect", function() { - cancelTimeout(); - if (callback) { - const cb = callback; - callback = null; - cb(null, this); - } - }).on("error", function(err) { - cancelTimeout(); - if (callback) { - const cb = callback; - callback = null; - cb(err); - } - }); - return socket; - }; - } - function setupTimeout(onConnectTimeout2, timeout) { - if (!timeout) { - return () => { - }; + applyInstruction(target, null, instructions, key); } - let s1 = null; - let s2 = null; - const timeoutId = setTimeout(() => { - s1 = setImmediate(() => { - if (process.platform === "win32") { - s2 = setImmediate(() => onConnectTimeout2()); - } else { - onConnectTimeout2(); - } - }); - }, timeout); - return () => { - clearTimeout(timeoutId); - clearImmediate(s1); - clearImmediate(s2); - }; + return target; } - function onConnectTimeout(socket) { - let message = "Connect Timeout Error"; - if (Array.isArray(socket.autoSelectFamilyAttemptedAddresses)) { - message += ` (attempted addresses: ${socket.autoSelectFamilyAttemptedAddresses.join(", ")})`; + __name(map, "map"); + var convertMap = /* @__PURE__ */ __name((target) => { + const output = {}; + for (const [k, v] of Object.entries(target || {})) { + output[k] = [, v]; } - util.destroy(socket, new ConnectTimeoutError(message)); - } - module2.exports = buildConnector; - } -}); - -// node_modules/undici/lib/util/timers.js -var require_timers2 = __commonJS({ - "node_modules/undici/lib/util/timers.js"(exports2, module2) { - "use strict"; - var TICK_MS = 499; - var fastNow = Date.now(); - var fastNowTimeout; - var fastTimers = []; - function onTimeout() { - fastNow = Date.now(); - let len = fastTimers.length; - let idx = 0; - while (idx < len) { - const timer = fastTimers[idx]; - if (timer.state === 0) { - timer.state = fastNow + timer.delay - TICK_MS; - } else if (timer.state > 0 && fastNow >= timer.state) { - timer.state = -1; - timer.callback(timer.opaque); + return output; + }, "convertMap"); + var take = /* @__PURE__ */ __name((source, instructions) => { + const out = {}; + for (const key in instructions) { + applyInstruction(out, source, instructions, key); + } + return out; + }, "take"); + var mapWithFilter = /* @__PURE__ */ __name((target, filter, instructions) => { + return map( + target, + Object.entries(instructions).reduce( + (_instructions, [key, value]) => { + if (Array.isArray(value)) { + _instructions[key] = value; + } else { + if (typeof value === "function") { + _instructions[key] = [filter, value()]; + } else { + _instructions[key] = [filter, value]; + } + } + return _instructions; + }, + {} + ) + ); + }, "mapWithFilter"); + var applyInstruction = /* @__PURE__ */ __name((target, source, instructions, targetKey) => { + if (source !== null) { + let instruction = instructions[targetKey]; + if (typeof instruction === "function") { + instruction = [, instruction]; } - if (timer.state === -1) { - timer.state = -2; - if (idx !== len - 1) { - fastTimers[idx] = fastTimers.pop(); - } else { - fastTimers.pop(); - } - len -= 1; - } else { - idx += 1; + const [filter2 = nonNullish, valueFn = pass, sourceKey = targetKey] = instruction; + if (typeof filter2 === "function" && filter2(source[sourceKey]) || typeof filter2 !== "function" && !!filter2) { + target[targetKey] = valueFn(source[sourceKey]); } + return; } - if (fastTimers.length > 0) { - refreshTimeout(); - } - } - function refreshTimeout() { - if (fastNowTimeout?.refresh) { - fastNowTimeout.refresh(); - } else { - clearTimeout(fastNowTimeout); - fastNowTimeout = setTimeout(onTimeout, TICK_MS); - if (fastNowTimeout.unref) { - fastNowTimeout.unref(); + let [filter, value] = instructions[targetKey]; + if (typeof value === "function") { + let _value; + const defaultFilterPassed = filter === void 0 && (_value = value()) != null; + const customFilterPassed = typeof filter === "function" && !!filter(void 0) || typeof filter !== "function" && !!filter; + if (defaultFilterPassed) { + target[targetKey] = _value; + } else if (customFilterPassed) { + target[targetKey] = value(); } + } else { + const defaultFilterPassed = filter === void 0 && value != null; + const customFilterPassed = typeof filter === "function" && !!filter(value) || typeof filter !== "function" && !!filter; + if (defaultFilterPassed || customFilterPassed) { + target[targetKey] = value; + } + } + }, "applyInstruction"); + var nonNullish = /* @__PURE__ */ __name((_) => _ != null, "nonNullish"); + var pass = /* @__PURE__ */ __name((_) => _, "pass"); + var resolvedPath2 = /* @__PURE__ */ __name((resolvedPath22, input, memberName, labelValueProvider, uriLabel, isGreedyLabel) => { + if (input != null && input[memberName] !== void 0) { + const labelValue = labelValueProvider(); + if (labelValue.length <= 0) { + throw new Error("Empty value provided for input HTTP label: " + memberName + "."); + } + resolvedPath22 = resolvedPath22.replace( + uriLabel, + isGreedyLabel ? labelValue.split("/").map((segment) => extendedEncodeURIComponent(segment)).join("/") : extendedEncodeURIComponent(labelValue) + ); + } else { + throw new Error("No value provided for input HTTP label: " + memberName + "."); + } + return resolvedPath22; + }, "resolvedPath"); + var serializeFloat = /* @__PURE__ */ __name((value) => { + if (value !== value) { + return "NaN"; + } + switch (value) { + case Infinity: + return "Infinity"; + case -Infinity: + return "-Infinity"; + default: + return value; } - } - var Timeout = class { - constructor(callback, delay, opaque) { - this.callback = callback; - this.delay = delay; - this.opaque = opaque; - this.state = -2; - this.refresh(); + }, "serializeFloat"); + var serializeDateTime = /* @__PURE__ */ __name((date) => date.toISOString().replace(".000Z", "Z"), "serializeDateTime"); + var _json = /* @__PURE__ */ __name((obj) => { + if (obj == null) { + return {}; } - refresh() { - if (this.state === -2) { - fastTimers.push(this); - if (!fastNowTimeout || fastTimers.length === 1) { - refreshTimeout(); + if (Array.isArray(obj)) { + return obj.filter((_) => _ != null).map(_json); + } + if (typeof obj === "object") { + const target = {}; + for (const key of Object.keys(obj)) { + if (obj[key] == null) { + continue; } + target[key] = _json(obj[key]); } - this.state = 0; - } - clear() { - this.state = -1; + return target; } - }; - module2.exports = { - setTimeout(callback, delay, opaque) { - return delay <= 1e3 ? setTimeout(callback, delay, opaque) : new Timeout(callback, delay, opaque); - }, - clearTimeout(timeout) { - if (timeout instanceof Timeout) { - timeout.clear(); + return obj; + }, "_json"); + function splitEvery(value, delimiter, numDelimiters) { + if (numDelimiters <= 0 || !Number.isInteger(numDelimiters)) { + throw new Error("Invalid number of delimiters (" + numDelimiters + ") for splitEvery."); + } + const segments = value.split(delimiter); + if (numDelimiters === 1) { + return segments; + } + const compoundSegments = []; + let currentSegment = ""; + for (let i = 0; i < segments.length; i++) { + if (currentSegment === "") { + currentSegment = segments[i]; } else { - clearTimeout(timeout); + currentSegment += delimiter + segments[i]; + } + if ((i + 1) % numDelimiters === 0) { + compoundSegments.push(currentSegment); + currentSegment = ""; } } - }; + if (currentSegment !== "") { + compoundSegments.push(currentSegment); + } + return compoundSegments; + } + __name(splitEvery, "splitEvery"); } }); -// node_modules/undici/lib/llhttp/utils.js -var require_utils3 = __commonJS({ - "node_modules/undici/lib/llhttp/utils.js"(exports2) { +// node_modules/@smithy/middleware-retry/dist-cjs/isStreamingPayload/isStreamingPayload.js +var require_isStreamingPayload = __commonJS({ + "node_modules/@smithy/middleware-retry/dist-cjs/isStreamingPayload/isStreamingPayload.js"(exports2) { "use strict"; Object.defineProperty(exports2, "__esModule", { value: true }); - exports2.enumToMap = void 0; - function enumToMap(obj) { - const res = {}; - Object.keys(obj).forEach((key) => { - const value = obj[key]; - if (typeof value === "number") { - res[key] = value; - } - }); - return res; - } - exports2.enumToMap = enumToMap; + exports2.isStreamingPayload = void 0; + var stream_1 = require("stream"); + var isStreamingPayload = (request2) => (request2 === null || request2 === void 0 ? void 0 : request2.body) instanceof stream_1.Readable || typeof ReadableStream !== "undefined" && (request2 === null || request2 === void 0 ? void 0 : request2.body) instanceof ReadableStream; + exports2.isStreamingPayload = isStreamingPayload; } }); -// node_modules/undici/lib/llhttp/constants.js -var require_constants7 = __commonJS({ - "node_modules/undici/lib/llhttp/constants.js"(exports2) { - "use strict"; - Object.defineProperty(exports2, "__esModule", { value: true }); - exports2.SPECIAL_HEADERS = exports2.HEADER_STATE = exports2.MINOR = exports2.MAJOR = exports2.CONNECTION_TOKEN_CHARS = exports2.HEADER_CHARS = exports2.TOKEN = exports2.STRICT_TOKEN = exports2.HEX = exports2.URL_CHAR = exports2.STRICT_URL_CHAR = exports2.USERINFO_CHARS = exports2.MARK = exports2.ALPHANUM = exports2.NUM = exports2.HEX_MAP = exports2.NUM_MAP = exports2.ALPHA = exports2.FINISH = exports2.H_METHOD_MAP = exports2.METHOD_MAP = exports2.METHODS_RTSP = exports2.METHODS_ICE = exports2.METHODS_HTTP = exports2.METHODS = exports2.LENIENT_FLAGS = exports2.FLAGS = exports2.TYPE = exports2.ERROR = void 0; - var utils_1 = require_utils3(); - var ERROR; - (function(ERROR2) { - ERROR2[ERROR2["OK"] = 0] = "OK"; - ERROR2[ERROR2["INTERNAL"] = 1] = "INTERNAL"; - ERROR2[ERROR2["STRICT"] = 2] = "STRICT"; - ERROR2[ERROR2["LF_EXPECTED"] = 3] = "LF_EXPECTED"; - ERROR2[ERROR2["UNEXPECTED_CONTENT_LENGTH"] = 4] = "UNEXPECTED_CONTENT_LENGTH"; - ERROR2[ERROR2["CLOSED_CONNECTION"] = 5] = "CLOSED_CONNECTION"; - ERROR2[ERROR2["INVALID_METHOD"] = 6] = "INVALID_METHOD"; - ERROR2[ERROR2["INVALID_URL"] = 7] = "INVALID_URL"; - ERROR2[ERROR2["INVALID_CONSTANT"] = 8] = "INVALID_CONSTANT"; - ERROR2[ERROR2["INVALID_VERSION"] = 9] = "INVALID_VERSION"; - ERROR2[ERROR2["INVALID_HEADER_TOKEN"] = 10] = "INVALID_HEADER_TOKEN"; - ERROR2[ERROR2["INVALID_CONTENT_LENGTH"] = 11] = "INVALID_CONTENT_LENGTH"; - ERROR2[ERROR2["INVALID_CHUNK_SIZE"] = 12] = "INVALID_CHUNK_SIZE"; - ERROR2[ERROR2["INVALID_STATUS"] = 13] = "INVALID_STATUS"; - ERROR2[ERROR2["INVALID_EOF_STATE"] = 14] = "INVALID_EOF_STATE"; - ERROR2[ERROR2["INVALID_TRANSFER_ENCODING"] = 15] = "INVALID_TRANSFER_ENCODING"; - ERROR2[ERROR2["CB_MESSAGE_BEGIN"] = 16] = "CB_MESSAGE_BEGIN"; - ERROR2[ERROR2["CB_HEADERS_COMPLETE"] = 17] = "CB_HEADERS_COMPLETE"; - ERROR2[ERROR2["CB_MESSAGE_COMPLETE"] = 18] = "CB_MESSAGE_COMPLETE"; - ERROR2[ERROR2["CB_CHUNK_HEADER"] = 19] = "CB_CHUNK_HEADER"; - ERROR2[ERROR2["CB_CHUNK_COMPLETE"] = 20] = "CB_CHUNK_COMPLETE"; - ERROR2[ERROR2["PAUSED"] = 21] = "PAUSED"; - ERROR2[ERROR2["PAUSED_UPGRADE"] = 22] = "PAUSED_UPGRADE"; - ERROR2[ERROR2["PAUSED_H2_UPGRADE"] = 23] = "PAUSED_H2_UPGRADE"; - ERROR2[ERROR2["USER"] = 24] = "USER"; - })(ERROR = exports2.ERROR || (exports2.ERROR = {})); - var TYPE2; - (function(TYPE3) { - TYPE3[TYPE3["BOTH"] = 0] = "BOTH"; - TYPE3[TYPE3["REQUEST"] = 1] = "REQUEST"; - TYPE3[TYPE3["RESPONSE"] = 2] = "RESPONSE"; - })(TYPE2 = exports2.TYPE || (exports2.TYPE = {})); - var FLAGS; - (function(FLAGS2) { - FLAGS2[FLAGS2["CONNECTION_KEEP_ALIVE"] = 1] = "CONNECTION_KEEP_ALIVE"; - FLAGS2[FLAGS2["CONNECTION_CLOSE"] = 2] = "CONNECTION_CLOSE"; - FLAGS2[FLAGS2["CONNECTION_UPGRADE"] = 4] = "CONNECTION_UPGRADE"; - FLAGS2[FLAGS2["CHUNKED"] = 8] = "CHUNKED"; - FLAGS2[FLAGS2["UPGRADE"] = 16] = "UPGRADE"; - FLAGS2[FLAGS2["CONTENT_LENGTH"] = 32] = "CONTENT_LENGTH"; - FLAGS2[FLAGS2["SKIPBODY"] = 64] = "SKIPBODY"; - FLAGS2[FLAGS2["TRAILING"] = 128] = "TRAILING"; - FLAGS2[FLAGS2["TRANSFER_ENCODING"] = 512] = "TRANSFER_ENCODING"; - })(FLAGS = exports2.FLAGS || (exports2.FLAGS = {})); - var LENIENT_FLAGS; - (function(LENIENT_FLAGS2) { - LENIENT_FLAGS2[LENIENT_FLAGS2["HEADERS"] = 1] = "HEADERS"; - LENIENT_FLAGS2[LENIENT_FLAGS2["CHUNKED_LENGTH"] = 2] = "CHUNKED_LENGTH"; - LENIENT_FLAGS2[LENIENT_FLAGS2["KEEP_ALIVE"] = 4] = "KEEP_ALIVE"; - })(LENIENT_FLAGS = exports2.LENIENT_FLAGS || (exports2.LENIENT_FLAGS = {})); - var METHODS; - (function(METHODS2) { - METHODS2[METHODS2["DELETE"] = 0] = "DELETE"; - METHODS2[METHODS2["GET"] = 1] = "GET"; - METHODS2[METHODS2["HEAD"] = 2] = "HEAD"; - METHODS2[METHODS2["POST"] = 3] = "POST"; - METHODS2[METHODS2["PUT"] = 4] = "PUT"; - METHODS2[METHODS2["CONNECT"] = 5] = "CONNECT"; - METHODS2[METHODS2["OPTIONS"] = 6] = "OPTIONS"; - METHODS2[METHODS2["TRACE"] = 7] = "TRACE"; - METHODS2[METHODS2["COPY"] = 8] = "COPY"; - METHODS2[METHODS2["LOCK"] = 9] = "LOCK"; - METHODS2[METHODS2["MKCOL"] = 10] = "MKCOL"; - METHODS2[METHODS2["MOVE"] = 11] = "MOVE"; - METHODS2[METHODS2["PROPFIND"] = 12] = "PROPFIND"; - METHODS2[METHODS2["PROPPATCH"] = 13] = "PROPPATCH"; - METHODS2[METHODS2["SEARCH"] = 14] = "SEARCH"; - METHODS2[METHODS2["UNLOCK"] = 15] = "UNLOCK"; - METHODS2[METHODS2["BIND"] = 16] = "BIND"; - METHODS2[METHODS2["REBIND"] = 17] = "REBIND"; - METHODS2[METHODS2["UNBIND"] = 18] = "UNBIND"; - METHODS2[METHODS2["ACL"] = 19] = "ACL"; - METHODS2[METHODS2["REPORT"] = 20] = "REPORT"; - METHODS2[METHODS2["MKACTIVITY"] = 21] = "MKACTIVITY"; - METHODS2[METHODS2["CHECKOUT"] = 22] = "CHECKOUT"; - METHODS2[METHODS2["MERGE"] = 23] = "MERGE"; - METHODS2[METHODS2["M-SEARCH"] = 24] = "M-SEARCH"; - METHODS2[METHODS2["NOTIFY"] = 25] = "NOTIFY"; - METHODS2[METHODS2["SUBSCRIBE"] = 26] = "SUBSCRIBE"; - METHODS2[METHODS2["UNSUBSCRIBE"] = 27] = "UNSUBSCRIBE"; - METHODS2[METHODS2["PATCH"] = 28] = "PATCH"; - METHODS2[METHODS2["PURGE"] = 29] = "PURGE"; - METHODS2[METHODS2["MKCALENDAR"] = 30] = "MKCALENDAR"; - METHODS2[METHODS2["LINK"] = 31] = "LINK"; - METHODS2[METHODS2["UNLINK"] = 32] = "UNLINK"; - METHODS2[METHODS2["SOURCE"] = 33] = "SOURCE"; - METHODS2[METHODS2["PRI"] = 34] = "PRI"; - METHODS2[METHODS2["DESCRIBE"] = 35] = "DESCRIBE"; - METHODS2[METHODS2["ANNOUNCE"] = 36] = "ANNOUNCE"; - METHODS2[METHODS2["SETUP"] = 37] = "SETUP"; - METHODS2[METHODS2["PLAY"] = 38] = "PLAY"; - METHODS2[METHODS2["PAUSE"] = 39] = "PAUSE"; - METHODS2[METHODS2["TEARDOWN"] = 40] = "TEARDOWN"; - METHODS2[METHODS2["GET_PARAMETER"] = 41] = "GET_PARAMETER"; - METHODS2[METHODS2["SET_PARAMETER"] = 42] = "SET_PARAMETER"; - METHODS2[METHODS2["REDIRECT"] = 43] = "REDIRECT"; - METHODS2[METHODS2["RECORD"] = 44] = "RECORD"; - METHODS2[METHODS2["FLUSH"] = 45] = "FLUSH"; - })(METHODS = exports2.METHODS || (exports2.METHODS = {})); - exports2.METHODS_HTTP = [ - METHODS.DELETE, - METHODS.GET, - METHODS.HEAD, - METHODS.POST, - METHODS.PUT, - METHODS.CONNECT, - METHODS.OPTIONS, - METHODS.TRACE, - METHODS.COPY, - METHODS.LOCK, - METHODS.MKCOL, - METHODS.MOVE, - METHODS.PROPFIND, - METHODS.PROPPATCH, - METHODS.SEARCH, - METHODS.UNLOCK, - METHODS.BIND, - METHODS.REBIND, - METHODS.UNBIND, - METHODS.ACL, - METHODS.REPORT, - METHODS.MKACTIVITY, - METHODS.CHECKOUT, - METHODS.MERGE, - METHODS["M-SEARCH"], - METHODS.NOTIFY, - METHODS.SUBSCRIBE, - METHODS.UNSUBSCRIBE, - METHODS.PATCH, - METHODS.PURGE, - METHODS.MKCALENDAR, - METHODS.LINK, - METHODS.UNLINK, - METHODS.PRI, - // TODO(indutny): should we allow it with HTTP? - METHODS.SOURCE - ]; - exports2.METHODS_ICE = [ - METHODS.SOURCE - ]; - exports2.METHODS_RTSP = [ - METHODS.OPTIONS, - METHODS.DESCRIBE, - METHODS.ANNOUNCE, - METHODS.SETUP, - METHODS.PLAY, - METHODS.PAUSE, - METHODS.TEARDOWN, - METHODS.GET_PARAMETER, - METHODS.SET_PARAMETER, - METHODS.REDIRECT, - METHODS.RECORD, - METHODS.FLUSH, - // For AirPlay - METHODS.GET, - METHODS.POST - ]; - exports2.METHOD_MAP = utils_1.enumToMap(METHODS); - exports2.H_METHOD_MAP = {}; - Object.keys(exports2.METHOD_MAP).forEach((key) => { - if (/^H/.test(key)) { - exports2.H_METHOD_MAP[key] = exports2.METHOD_MAP[key]; - } +// node_modules/@smithy/middleware-retry/dist-cjs/index.js +var require_dist_cjs33 = __commonJS({ + "node_modules/@smithy/middleware-retry/dist-cjs/index.js"(exports2, module2) { + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); + }; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + } + return to; + }; + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + AdaptiveRetryStrategy: () => AdaptiveRetryStrategy, + CONFIG_MAX_ATTEMPTS: () => CONFIG_MAX_ATTEMPTS, + CONFIG_RETRY_MODE: () => CONFIG_RETRY_MODE, + ENV_MAX_ATTEMPTS: () => ENV_MAX_ATTEMPTS, + ENV_RETRY_MODE: () => ENV_RETRY_MODE, + NODE_MAX_ATTEMPT_CONFIG_OPTIONS: () => NODE_MAX_ATTEMPT_CONFIG_OPTIONS, + NODE_RETRY_MODE_CONFIG_OPTIONS: () => NODE_RETRY_MODE_CONFIG_OPTIONS, + StandardRetryStrategy: () => StandardRetryStrategy, + defaultDelayDecider: () => defaultDelayDecider, + defaultRetryDecider: () => defaultRetryDecider, + getOmitRetryHeadersPlugin: () => getOmitRetryHeadersPlugin, + getRetryAfterHint: () => getRetryAfterHint, + getRetryPlugin: () => getRetryPlugin, + omitRetryHeadersMiddleware: () => omitRetryHeadersMiddleware, + omitRetryHeadersMiddlewareOptions: () => omitRetryHeadersMiddlewareOptions, + resolveRetryConfig: () => resolveRetryConfig, + retryMiddleware: () => retryMiddleware, + retryMiddlewareOptions: () => retryMiddlewareOptions2 }); - var FINISH; - (function(FINISH2) { - FINISH2[FINISH2["SAFE"] = 0] = "SAFE"; - FINISH2[FINISH2["SAFE_WITH_CB"] = 1] = "SAFE_WITH_CB"; - FINISH2[FINISH2["UNSAFE"] = 2] = "UNSAFE"; - })(FINISH = exports2.FINISH || (exports2.FINISH = {})); - exports2.ALPHA = []; - for (let i = "A".charCodeAt(0); i <= "Z".charCodeAt(0); i++) { - exports2.ALPHA.push(String.fromCharCode(i)); - exports2.ALPHA.push(String.fromCharCode(i + 32)); - } - exports2.NUM_MAP = { - 0: 0, - 1: 1, - 2: 2, - 3: 3, - 4: 4, - 5: 5, - 6: 6, - 7: 7, - 8: 8, - 9: 9 - }; - exports2.HEX_MAP = { - 0: 0, - 1: 1, - 2: 2, - 3: 3, - 4: 4, - 5: 5, - 6: 6, - 7: 7, - 8: 8, - 9: 9, - A: 10, - B: 11, - C: 12, - D: 13, - E: 14, - F: 15, - a: 10, - b: 11, - c: 12, - d: 13, - e: 14, - f: 15 + module2.exports = __toCommonJS2(src_exports); + var import_protocol_http8 = require_dist_cjs2(); + var import_uuid = (init_esm_node2(), __toCommonJS(esm_node_exports2)); + var import_util_retry = require_dist_cjs20(); + var getDefaultRetryQuota = /* @__PURE__ */ __name((initialRetryTokens, options) => { + const MAX_CAPACITY = initialRetryTokens; + const noRetryIncrement = (options == null ? void 0 : options.noRetryIncrement) ?? import_util_retry.NO_RETRY_INCREMENT; + const retryCost = (options == null ? void 0 : options.retryCost) ?? import_util_retry.RETRY_COST; + const timeoutRetryCost = (options == null ? void 0 : options.timeoutRetryCost) ?? import_util_retry.TIMEOUT_RETRY_COST; + let availableCapacity = initialRetryTokens; + const getCapacityAmount = /* @__PURE__ */ __name((error) => error.name === "TimeoutError" ? timeoutRetryCost : retryCost, "getCapacityAmount"); + const hasRetryTokens = /* @__PURE__ */ __name((error) => getCapacityAmount(error) <= availableCapacity, "hasRetryTokens"); + const retrieveRetryTokens = /* @__PURE__ */ __name((error) => { + if (!hasRetryTokens(error)) { + throw new Error("No retry token available"); + } + const capacityAmount = getCapacityAmount(error); + availableCapacity -= capacityAmount; + return capacityAmount; + }, "retrieveRetryTokens"); + const releaseRetryTokens = /* @__PURE__ */ __name((capacityReleaseAmount) => { + availableCapacity += capacityReleaseAmount ?? noRetryIncrement; + availableCapacity = Math.min(availableCapacity, MAX_CAPACITY); + }, "releaseRetryTokens"); + return Object.freeze({ + hasRetryTokens, + retrieveRetryTokens, + releaseRetryTokens + }); + }, "getDefaultRetryQuota"); + var defaultDelayDecider = /* @__PURE__ */ __name((delayBase, attempts) => Math.floor(Math.min(import_util_retry.MAXIMUM_RETRY_DELAY, Math.random() * 2 ** attempts * delayBase)), "defaultDelayDecider"); + var import_service_error_classification = require_dist_cjs19(); + var defaultRetryDecider = /* @__PURE__ */ __name((error) => { + if (!error) { + return false; + } + return (0, import_service_error_classification.isRetryableByTrait)(error) || (0, import_service_error_classification.isClockSkewError)(error) || (0, import_service_error_classification.isThrottlingError)(error) || (0, import_service_error_classification.isTransientError)(error); + }, "defaultRetryDecider"); + var asSdkError = /* @__PURE__ */ __name((error) => { + if (error instanceof Error) + return error; + if (error instanceof Object) + return Object.assign(new Error(), error); + if (typeof error === "string") + return new Error(error); + return new Error(`AWS SDK error wrapper for ${error}`); + }, "asSdkError"); + var _StandardRetryStrategy = class _StandardRetryStrategy { + constructor(maxAttemptsProvider, options) { + this.maxAttemptsProvider = maxAttemptsProvider; + this.mode = import_util_retry.RETRY_MODES.STANDARD; + this.retryDecider = (options == null ? void 0 : options.retryDecider) ?? defaultRetryDecider; + this.delayDecider = (options == null ? void 0 : options.delayDecider) ?? defaultDelayDecider; + this.retryQuota = (options == null ? void 0 : options.retryQuota) ?? getDefaultRetryQuota(import_util_retry.INITIAL_RETRY_TOKENS); + } + shouldRetry(error, attempts, maxAttempts) { + return attempts < maxAttempts && this.retryDecider(error) && this.retryQuota.hasRetryTokens(error); + } + async getMaxAttempts() { + let maxAttempts; + try { + maxAttempts = await this.maxAttemptsProvider(); + } catch (error) { + maxAttempts = import_util_retry.DEFAULT_MAX_ATTEMPTS; + } + return maxAttempts; + } + async retry(next, args, options) { + let retryTokenAmount; + let attempts = 0; + let totalDelay = 0; + const maxAttempts = await this.getMaxAttempts(); + const { request: request2 } = args; + if (import_protocol_http8.HttpRequest.isInstance(request2)) { + request2.headers[import_util_retry.INVOCATION_ID_HEADER] = (0, import_uuid.v4)(); + } + while (true) { + try { + if (import_protocol_http8.HttpRequest.isInstance(request2)) { + request2.headers[import_util_retry.REQUEST_HEADER] = `attempt=${attempts + 1}; max=${maxAttempts}`; + } + if (options == null ? void 0 : options.beforeRequest) { + await options.beforeRequest(); + } + const { response, output } = await next(args); + if (options == null ? void 0 : options.afterRequest) { + options.afterRequest(response); + } + this.retryQuota.releaseRetryTokens(retryTokenAmount); + output.$metadata.attempts = attempts + 1; + output.$metadata.totalRetryDelay = totalDelay; + return { response, output }; + } catch (e) { + const err = asSdkError(e); + attempts++; + if (this.shouldRetry(err, attempts, maxAttempts)) { + retryTokenAmount = this.retryQuota.retrieveRetryTokens(err); + const delayFromDecider = this.delayDecider( + (0, import_service_error_classification.isThrottlingError)(err) ? import_util_retry.THROTTLING_RETRY_DELAY_BASE : import_util_retry.DEFAULT_RETRY_DELAY_BASE, + attempts + ); + const delayFromResponse = getDelayFromRetryAfterHeader(err.$response); + const delay = Math.max(delayFromResponse || 0, delayFromDecider); + totalDelay += delay; + await new Promise((resolve) => setTimeout(resolve, delay)); + continue; + } + if (!err.$metadata) { + err.$metadata = {}; + } + err.$metadata.attempts = attempts; + err.$metadata.totalRetryDelay = totalDelay; + throw err; + } + } + } }; - exports2.NUM = [ - "0", - "1", - "2", - "3", - "4", - "5", - "6", - "7", - "8", - "9" - ]; - exports2.ALPHANUM = exports2.ALPHA.concat(exports2.NUM); - exports2.MARK = ["-", "_", ".", "!", "~", "*", "'", "(", ")"]; - exports2.USERINFO_CHARS = exports2.ALPHANUM.concat(exports2.MARK).concat(["%", ";", ":", "&", "=", "+", "$", ","]); - exports2.STRICT_URL_CHAR = [ - "!", - '"', - "$", - "%", - "&", - "'", - "(", - ")", - "*", - "+", - ",", - "-", - ".", - "/", - ":", - ";", - "<", - "=", - ">", - "@", - "[", - "\\", - "]", - "^", - "_", - "`", - "{", - "|", - "}", - "~" - ].concat(exports2.ALPHANUM); - exports2.URL_CHAR = exports2.STRICT_URL_CHAR.concat([" ", "\f"]); - for (let i = 128; i <= 255; i++) { - exports2.URL_CHAR.push(i); - } - exports2.HEX = exports2.NUM.concat(["a", "b", "c", "d", "e", "f", "A", "B", "C", "D", "E", "F"]); - exports2.STRICT_TOKEN = [ - "!", - "#", - "$", - "%", - "&", - "'", - "*", - "+", - "-", - ".", - "^", - "_", - "`", - "|", - "~" - ].concat(exports2.ALPHANUM); - exports2.TOKEN = exports2.STRICT_TOKEN.concat([" "]); - exports2.HEADER_CHARS = [" "]; - for (let i = 32; i <= 255; i++) { - if (i !== 127) { - exports2.HEADER_CHARS.push(i); + __name(_StandardRetryStrategy, "StandardRetryStrategy"); + var StandardRetryStrategy = _StandardRetryStrategy; + var getDelayFromRetryAfterHeader = /* @__PURE__ */ __name((response) => { + if (!import_protocol_http8.HttpResponse.isInstance(response)) + return; + const retryAfterHeaderName = Object.keys(response.headers).find((key) => key.toLowerCase() === "retry-after"); + if (!retryAfterHeaderName) + return; + const retryAfter = response.headers[retryAfterHeaderName]; + const retryAfterSeconds = Number(retryAfter); + if (!Number.isNaN(retryAfterSeconds)) + return retryAfterSeconds * 1e3; + const retryAfterDate = new Date(retryAfter); + return retryAfterDate.getTime() - Date.now(); + }, "getDelayFromRetryAfterHeader"); + var _AdaptiveRetryStrategy = class _AdaptiveRetryStrategy extends StandardRetryStrategy { + constructor(maxAttemptsProvider, options) { + const { rateLimiter, ...superOptions } = options ?? {}; + super(maxAttemptsProvider, superOptions); + this.rateLimiter = rateLimiter ?? new import_util_retry.DefaultRateLimiter(); + this.mode = import_util_retry.RETRY_MODES.ADAPTIVE; + } + async retry(next, args) { + return super.retry(next, args, { + beforeRequest: async () => { + return this.rateLimiter.getSendToken(); + }, + afterRequest: (response) => { + this.rateLimiter.updateClientSendingRate(response); + } + }); } - } - exports2.CONNECTION_TOKEN_CHARS = exports2.HEADER_CHARS.filter((c) => c !== 44); - exports2.MAJOR = exports2.NUM_MAP; - exports2.MINOR = exports2.MAJOR; - var HEADER_STATE; - (function(HEADER_STATE2) { - HEADER_STATE2[HEADER_STATE2["GENERAL"] = 0] = "GENERAL"; - HEADER_STATE2[HEADER_STATE2["CONNECTION"] = 1] = "CONNECTION"; - HEADER_STATE2[HEADER_STATE2["CONTENT_LENGTH"] = 2] = "CONTENT_LENGTH"; - HEADER_STATE2[HEADER_STATE2["TRANSFER_ENCODING"] = 3] = "TRANSFER_ENCODING"; - HEADER_STATE2[HEADER_STATE2["UPGRADE"] = 4] = "UPGRADE"; - HEADER_STATE2[HEADER_STATE2["CONNECTION_KEEP_ALIVE"] = 5] = "CONNECTION_KEEP_ALIVE"; - HEADER_STATE2[HEADER_STATE2["CONNECTION_CLOSE"] = 6] = "CONNECTION_CLOSE"; - HEADER_STATE2[HEADER_STATE2["CONNECTION_UPGRADE"] = 7] = "CONNECTION_UPGRADE"; - HEADER_STATE2[HEADER_STATE2["TRANSFER_ENCODING_CHUNKED"] = 8] = "TRANSFER_ENCODING_CHUNKED"; - })(HEADER_STATE = exports2.HEADER_STATE || (exports2.HEADER_STATE = {})); - exports2.SPECIAL_HEADERS = { - "connection": HEADER_STATE.CONNECTION, - "content-length": HEADER_STATE.CONTENT_LENGTH, - "proxy-connection": HEADER_STATE.CONNECTION, - "transfer-encoding": HEADER_STATE.TRANSFER_ENCODING, - "upgrade": HEADER_STATE.UPGRADE }; + __name(_AdaptiveRetryStrategy, "AdaptiveRetryStrategy"); + var AdaptiveRetryStrategy = _AdaptiveRetryStrategy; + var import_util_middleware3 = require_dist_cjs10(); + var ENV_MAX_ATTEMPTS = "AWS_MAX_ATTEMPTS"; + var CONFIG_MAX_ATTEMPTS = "max_attempts"; + var NODE_MAX_ATTEMPT_CONFIG_OPTIONS = { + environmentVariableSelector: (env) => { + const value = env[ENV_MAX_ATTEMPTS]; + if (!value) + return void 0; + const maxAttempt = parseInt(value); + if (Number.isNaN(maxAttempt)) { + throw new Error(`Environment variable ${ENV_MAX_ATTEMPTS} mast be a number, got "${value}"`); + } + return maxAttempt; + }, + configFileSelector: (profile) => { + const value = profile[CONFIG_MAX_ATTEMPTS]; + if (!value) + return void 0; + const maxAttempt = parseInt(value); + if (Number.isNaN(maxAttempt)) { + throw new Error(`Shared config file entry ${CONFIG_MAX_ATTEMPTS} mast be a number, got "${value}"`); + } + return maxAttempt; + }, + default: import_util_retry.DEFAULT_MAX_ATTEMPTS + }; + var resolveRetryConfig = /* @__PURE__ */ __name((input) => { + const { retryStrategy } = input; + const maxAttempts = (0, import_util_middleware3.normalizeProvider)(input.maxAttempts ?? import_util_retry.DEFAULT_MAX_ATTEMPTS); + return { + ...input, + maxAttempts, + retryStrategy: async () => { + if (retryStrategy) { + return retryStrategy; + } + const retryMode = await (0, import_util_middleware3.normalizeProvider)(input.retryMode)(); + if (retryMode === import_util_retry.RETRY_MODES.ADAPTIVE) { + return new import_util_retry.AdaptiveRetryStrategy(maxAttempts); + } + return new import_util_retry.StandardRetryStrategy(maxAttempts); + } + }; + }, "resolveRetryConfig"); + var ENV_RETRY_MODE = "AWS_RETRY_MODE"; + var CONFIG_RETRY_MODE = "retry_mode"; + var NODE_RETRY_MODE_CONFIG_OPTIONS = { + environmentVariableSelector: (env) => env[ENV_RETRY_MODE], + configFileSelector: (profile) => profile[CONFIG_RETRY_MODE], + default: import_util_retry.DEFAULT_RETRY_MODE + }; + var omitRetryHeadersMiddleware = /* @__PURE__ */ __name(() => (next) => async (args) => { + const { request: request2 } = args; + if (import_protocol_http8.HttpRequest.isInstance(request2)) { + delete request2.headers[import_util_retry.INVOCATION_ID_HEADER]; + delete request2.headers[import_util_retry.REQUEST_HEADER]; + } + return next(args); + }, "omitRetryHeadersMiddleware"); + var omitRetryHeadersMiddlewareOptions = { + name: "omitRetryHeadersMiddleware", + tags: ["RETRY", "HEADERS", "OMIT_RETRY_HEADERS"], + relation: "before", + toMiddleware: "awsAuthMiddleware", + override: true + }; + var getOmitRetryHeadersPlugin = /* @__PURE__ */ __name((options) => ({ + applyToStack: (clientStack) => { + clientStack.addRelativeTo(omitRetryHeadersMiddleware(), omitRetryHeadersMiddlewareOptions); + } + }), "getOmitRetryHeadersPlugin"); + var import_smithy_client5 = require_dist_cjs32(); + var import_isStreamingPayload = require_isStreamingPayload(); + var retryMiddleware = /* @__PURE__ */ __name((options) => (next, context) => async (args) => { + var _a; + let retryStrategy = await options.retryStrategy(); + const maxAttempts = await options.maxAttempts(); + if (isRetryStrategyV2(retryStrategy)) { + retryStrategy = retryStrategy; + let retryToken = await retryStrategy.acquireInitialRetryToken(context["partition_id"]); + let lastError = new Error(); + let attempts = 0; + let totalRetryDelay = 0; + const { request: request2 } = args; + const isRequest = import_protocol_http8.HttpRequest.isInstance(request2); + if (isRequest) { + request2.headers[import_util_retry.INVOCATION_ID_HEADER] = (0, import_uuid.v4)(); + } + while (true) { + try { + if (isRequest) { + request2.headers[import_util_retry.REQUEST_HEADER] = `attempt=${attempts + 1}; max=${maxAttempts}`; + } + const { response, output } = await next(args); + retryStrategy.recordSuccess(retryToken); + output.$metadata.attempts = attempts + 1; + output.$metadata.totalRetryDelay = totalRetryDelay; + return { response, output }; + } catch (e) { + const retryErrorInfo = getRetryErrorInfo(e); + lastError = asSdkError(e); + if (isRequest && (0, import_isStreamingPayload.isStreamingPayload)(request2)) { + (_a = context.logger instanceof import_smithy_client5.NoOpLogger ? console : context.logger) == null ? void 0 : _a.warn( + "An error was encountered in a non-retryable streaming request." + ); + throw lastError; + } + try { + retryToken = await retryStrategy.refreshRetryTokenForRetry(retryToken, retryErrorInfo); + } catch (refreshError) { + if (!lastError.$metadata) { + lastError.$metadata = {}; + } + lastError.$metadata.attempts = attempts + 1; + lastError.$metadata.totalRetryDelay = totalRetryDelay; + throw lastError; + } + attempts = retryToken.getRetryCount(); + const delay = retryToken.getRetryDelay(); + totalRetryDelay += delay; + await new Promise((resolve) => setTimeout(resolve, delay)); + } + } + } else { + retryStrategy = retryStrategy; + if (retryStrategy == null ? void 0 : retryStrategy.mode) + context.userAgent = [...context.userAgent || [], ["cfg/retry-mode", retryStrategy.mode]]; + return retryStrategy.retry(next, args); + } + }, "retryMiddleware"); + var isRetryStrategyV2 = /* @__PURE__ */ __name((retryStrategy) => typeof retryStrategy.acquireInitialRetryToken !== "undefined" && typeof retryStrategy.refreshRetryTokenForRetry !== "undefined" && typeof retryStrategy.recordSuccess !== "undefined", "isRetryStrategyV2"); + var getRetryErrorInfo = /* @__PURE__ */ __name((error) => { + const errorInfo = { + error, + errorType: getRetryErrorType(error) + }; + const retryAfterHint = getRetryAfterHint(error.$response); + if (retryAfterHint) { + errorInfo.retryAfterHint = retryAfterHint; + } + return errorInfo; + }, "getRetryErrorInfo"); + var getRetryErrorType = /* @__PURE__ */ __name((error) => { + if ((0, import_service_error_classification.isThrottlingError)(error)) + return "THROTTLING"; + if ((0, import_service_error_classification.isTransientError)(error)) + return "TRANSIENT"; + if ((0, import_service_error_classification.isServerError)(error)) + return "SERVER_ERROR"; + return "CLIENT_ERROR"; + }, "getRetryErrorType"); + var retryMiddlewareOptions2 = { + name: "retryMiddleware", + tags: ["RETRY"], + step: "finalizeRequest", + priority: "high", + override: true + }; + var getRetryPlugin = /* @__PURE__ */ __name((options) => ({ + applyToStack: (clientStack) => { + clientStack.add(retryMiddleware(options), retryMiddlewareOptions2); + } + }), "getRetryPlugin"); + var getRetryAfterHint = /* @__PURE__ */ __name((response) => { + if (!import_protocol_http8.HttpResponse.isInstance(response)) + return; + const retryAfterHeaderName = Object.keys(response.headers).find((key) => key.toLowerCase() === "retry-after"); + if (!retryAfterHeaderName) + return; + const retryAfter = response.headers[retryAfterHeaderName]; + const retryAfterSeconds = Number(retryAfter); + if (!Number.isNaN(retryAfterSeconds)) + return new Date(retryAfterSeconds * 1e3); + const retryAfterDate = new Date(retryAfter); + return retryAfterDate; + }, "getRetryAfterHint"); } }); -// node_modules/undici/lib/llhttp/llhttp-wasm.js -var require_llhttp_wasm2 = __commonJS({ - "node_modules/undici/lib/llhttp/llhttp-wasm.js"(exports2, module2) { - "use strict"; - var { Buffer: Buffer2 } = require("node:buffer"); - module2.exports = Buffer2.from("AGFzbQEAAAABJwdgAX8Bf2ADf39/AX9gAX8AYAJ/fwBgBH9/f38Bf2AAAGADf39/AALLAQgDZW52GHdhc21fb25faGVhZGVyc19jb21wbGV0ZQAEA2VudhV3YXNtX29uX21lc3NhZ2VfYmVnaW4AAANlbnYLd2FzbV9vbl91cmwAAQNlbnYOd2FzbV9vbl9zdGF0dXMAAQNlbnYUd2FzbV9vbl9oZWFkZXJfZmllbGQAAQNlbnYUd2FzbV9vbl9oZWFkZXJfdmFsdWUAAQNlbnYMd2FzbV9vbl9ib2R5AAEDZW52GHdhc21fb25fbWVzc2FnZV9jb21wbGV0ZQAAAy0sBQYAAAIAAAAAAAACAQIAAgICAAADAAAAAAMDAwMBAQEBAQEBAQEAAAIAAAAEBQFwARISBQMBAAIGCAF/AUGA1AQLB9EFIgZtZW1vcnkCAAtfaW5pdGlhbGl6ZQAIGV9faW5kaXJlY3RfZnVuY3Rpb25fdGFibGUBAAtsbGh0dHBfaW5pdAAJGGxsaHR0cF9zaG91bGRfa2VlcF9hbGl2ZQAvDGxsaHR0cF9hbGxvYwALBm1hbGxvYwAxC2xsaHR0cF9mcmVlAAwEZnJlZQAMD2xsaHR0cF9nZXRfdHlwZQANFWxsaHR0cF9nZXRfaHR0cF9tYWpvcgAOFWxsaHR0cF9nZXRfaHR0cF9taW5vcgAPEWxsaHR0cF9nZXRfbWV0aG9kABAWbGxodHRwX2dldF9zdGF0dXNfY29kZQAREmxsaHR0cF9nZXRfdXBncmFkZQASDGxsaHR0cF9yZXNldAATDmxsaHR0cF9leGVjdXRlABQUbGxodHRwX3NldHRpbmdzX2luaXQAFQ1sbGh0dHBfZmluaXNoABYMbGxodHRwX3BhdXNlABcNbGxodHRwX3Jlc3VtZQAYG2xsaHR0cF9yZXN1bWVfYWZ0ZXJfdXBncmFkZQAZEGxsaHR0cF9nZXRfZXJybm8AGhdsbGh0dHBfZ2V0X2Vycm9yX3JlYXNvbgAbF2xsaHR0cF9zZXRfZXJyb3JfcmVhc29uABwUbGxodHRwX2dldF9lcnJvcl9wb3MAHRFsbGh0dHBfZXJybm9fbmFtZQAeEmxsaHR0cF9tZXRob2RfbmFtZQAfEmxsaHR0cF9zdGF0dXNfbmFtZQAgGmxsaHR0cF9zZXRfbGVuaWVudF9oZWFkZXJzACEhbGxodHRwX3NldF9sZW5pZW50X2NodW5rZWRfbGVuZ3RoACIdbGxodHRwX3NldF9sZW5pZW50X2tlZXBfYWxpdmUAIyRsbGh0dHBfc2V0X2xlbmllbnRfdHJhbnNmZXJfZW5jb2RpbmcAJBhsbGh0dHBfbWVzc2FnZV9uZWVkc19lb2YALgkXAQBBAQsRAQIDBAUKBgcrLSwqKSglJyYK07MCLBYAQYjQACgCAARAAAtBiNAAQQE2AgALFAAgABAwIAAgAjYCOCAAIAE6ACgLFAAgACAALwEyIAAtAC4gABAvEAALHgEBf0HAABAyIgEQMCABQYAINgI4IAEgADoAKCABC48MAQd/AkAgAEUNACAAQQhrIgEgAEEEaygCACIAQXhxIgRqIQUCQCAAQQFxDQAgAEEDcUUNASABIAEoAgAiAGsiAUGc0AAoAgBJDQEgACAEaiEEAkACQEGg0AAoAgAgAUcEQCAAQf8BTQRAIABBA3YhAyABKAIIIgAgASgCDCICRgRAQYzQAEGM0AAoAgBBfiADd3E2AgAMBQsgAiAANgIIIAAgAjYCDAwECyABKAIYIQYgASABKAIMIgBHBEAgACABKAIIIgI2AgggAiAANgIMDAMLIAFBFGoiAygCACICRQRAIAEoAhAiAkUNAiABQRBqIQMLA0AgAyEHIAIiAEEUaiIDKAIAIgINACAAQRBqIQMgACgCECICDQALIAdBADYCAAwCCyAFKAIEIgBBA3FBA0cNAiAFIABBfnE2AgRBlNAAIAQ2AgAgBSAENgIAIAEgBEEBcjYCBAwDC0EAIQALIAZFDQACQCABKAIcIgJBAnRBvNIAaiIDKAIAIAFGBEAgAyAANgIAIAANAUGQ0ABBkNAAKAIAQX4gAndxNgIADAILIAZBEEEUIAYoAhAgAUYbaiAANgIAIABFDQELIAAgBjYCGCABKAIQIgIEQCAAIAI2AhAgAiAANgIYCyABQRRqKAIAIgJFDQAgAEEUaiACNgIAIAIgADYCGAsgASAFTw0AIAUoAgQiAEEBcUUNAAJAAkACQAJAIABBAnFFBEBBpNAAKAIAIAVGBEBBpNAAIAE2AgBBmNAAQZjQACgCACAEaiIANgIAIAEgAEEBcjYCBCABQaDQACgCAEcNBkGU0ABBADYCAEGg0ABBADYCAAwGC0Gg0AAoAgAgBUYEQEGg0AAgATYCAEGU0ABBlNAAKAIAIARqIgA2AgAgASAAQQFyNgIEIAAgAWogADYCAAwGCyAAQXhxIARqIQQgAEH/AU0EQCAAQQN2IQMgBSgCCCIAIAUoAgwiAkYEQEGM0ABBjNAAKAIAQX4gA3dxNgIADAULIAIgADYCCCAAIAI2AgwMBAsgBSgCGCEGIAUgBSgCDCIARwRAQZzQACgCABogACAFKAIIIgI2AgggAiAANgIMDAMLIAVBFGoiAygCACICRQRAIAUoAhAiAkUNAiAFQRBqIQMLA0AgAyEHIAIiAEEUaiIDKAIAIgINACAAQRBqIQMgACgCECICDQALIAdBADYCAAwCCyAFIABBfnE2AgQgASAEaiAENgIAIAEgBEEBcjYCBAwDC0EAIQALIAZFDQACQCAFKAIcIgJBAnRBvNIAaiIDKAIAIAVGBEAgAyAANgIAIAANAUGQ0ABBkNAAKAIAQX4gAndxNgIADAILIAZBEEEUIAYoAhAgBUYbaiAANgIAIABFDQELIAAgBjYCGCAFKAIQIgIEQCAAIAI2AhAgAiAANgIYCyAFQRRqKAIAIgJFDQAgAEEUaiACNgIAIAIgADYCGAsgASAEaiAENgIAIAEgBEEBcjYCBCABQaDQACgCAEcNAEGU0AAgBDYCAAwBCyAEQf8BTQRAIARBeHFBtNAAaiEAAn9BjNAAKAIAIgJBASAEQQN2dCIDcUUEQEGM0AAgAiADcjYCACAADAELIAAoAggLIgIgATYCDCAAIAE2AgggASAANgIMIAEgAjYCCAwBC0EfIQIgBEH///8HTQRAIARBJiAEQQh2ZyIAa3ZBAXEgAEEBdGtBPmohAgsgASACNgIcIAFCADcCECACQQJ0QbzSAGohAAJAQZDQACgCACIDQQEgAnQiB3FFBEAgACABNgIAQZDQACADIAdyNgIAIAEgADYCGCABIAE2AgggASABNgIMDAELIARBGSACQQF2a0EAIAJBH0cbdCECIAAoAgAhAAJAA0AgACIDKAIEQXhxIARGDQEgAkEddiEAIAJBAXQhAiADIABBBHFqQRBqIgcoAgAiAA0ACyAHIAE2AgAgASADNgIYIAEgATYCDCABIAE2AggMAQsgAygCCCIAIAE2AgwgAyABNgIIIAFBADYCGCABIAM2AgwgASAANgIIC0Gs0ABBrNAAKAIAQQFrIgBBfyAAGzYCAAsLBwAgAC0AKAsHACAALQAqCwcAIAAtACsLBwAgAC0AKQsHACAALwEyCwcAIAAtAC4LQAEEfyAAKAIYIQEgAC0ALSECIAAtACghAyAAKAI4IQQgABAwIAAgBDYCOCAAIAM6ACggACACOgAtIAAgATYCGAu74gECB38DfiABIAJqIQQCQCAAIgIoAgwiAA0AIAIoAgQEQCACIAE2AgQLIwBBEGsiCCQAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACfwJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAIAIoAhwiA0EBaw7dAdoBAdkBAgMEBQYHCAkKCwwNDtgBDxDXARES1gETFBUWFxgZGhvgAd8BHB0e1QEfICEiIyQl1AEmJygpKiss0wHSAS0u0QHQAS8wMTIzNDU2Nzg5Ojs8PT4/QEFCQ0RFRtsBR0hJSs8BzgFLzQFMzAFNTk9QUVJTVFVWV1hZWltcXV5fYGFiY2RlZmdoaWprbG1ub3BxcnN0dXZ3eHl6e3x9fn+AAYEBggGDAYQBhQGGAYcBiAGJAYoBiwGMAY0BjgGPAZABkQGSAZMBlAGVAZYBlwGYAZkBmgGbAZwBnQGeAZ8BoAGhAaIBowGkAaUBpgGnAagBqQGqAasBrAGtAa4BrwGwAbEBsgGzAbQBtQG2AbcBywHKAbgByQG5AcgBugG7AbwBvQG+Ab8BwAHBAcIBwwHEAcUBxgEA3AELQQAMxgELQQ4MxQELQQ0MxAELQQ8MwwELQRAMwgELQRMMwQELQRQMwAELQRUMvwELQRYMvgELQRgMvQELQRkMvAELQRoMuwELQRsMugELQRwMuQELQR0MuAELQQgMtwELQR4MtgELQSAMtQELQR8MtAELQQcMswELQSEMsgELQSIMsQELQSMMsAELQSQMrwELQRIMrgELQREMrQELQSUMrAELQSYMqwELQScMqgELQSgMqQELQcMBDKgBC0EqDKcBC0ErDKYBC0EsDKUBC0EtDKQBC0EuDKMBC0EvDKIBC0HEAQyhAQtBMAygAQtBNAyfAQtBDAyeAQtBMQydAQtBMgycAQtBMwybAQtBOQyaAQtBNQyZAQtBxQEMmAELQQsMlwELQToMlgELQTYMlQELQQoMlAELQTcMkwELQTgMkgELQTwMkQELQTsMkAELQT0MjwELQQkMjgELQSkMjQELQT4MjAELQT8MiwELQcAADIoBC0HBAAyJAQtBwgAMiAELQcMADIcBC0HEAAyGAQtBxQAMhQELQcYADIQBC0EXDIMBC0HHAAyCAQtByAAMgQELQckADIABC0HKAAx/C0HLAAx+C0HNAAx9C0HMAAx8C0HOAAx7C0HPAAx6C0HQAAx5C0HRAAx4C0HSAAx3C0HTAAx2C0HUAAx1C0HWAAx0C0HVAAxzC0EGDHILQdcADHELQQUMcAtB2AAMbwtBBAxuC0HZAAxtC0HaAAxsC0HbAAxrC0HcAAxqC0EDDGkLQd0ADGgLQd4ADGcLQd8ADGYLQeEADGULQeAADGQLQeIADGMLQeMADGILQQIMYQtB5AAMYAtB5QAMXwtB5gAMXgtB5wAMXQtB6AAMXAtB6QAMWwtB6gAMWgtB6wAMWQtB7AAMWAtB7QAMVwtB7gAMVgtB7wAMVQtB8AAMVAtB8QAMUwtB8gAMUgtB8wAMUQtB9AAMUAtB9QAMTwtB9gAMTgtB9wAMTQtB+AAMTAtB+QAMSwtB+gAMSgtB+wAMSQtB/AAMSAtB/QAMRwtB/gAMRgtB/wAMRQtBgAEMRAtBgQEMQwtBggEMQgtBgwEMQQtBhAEMQAtBhQEMPwtBhgEMPgtBhwEMPQtBiAEMPAtBiQEMOwtBigEMOgtBiwEMOQtBjAEMOAtBjQEMNwtBjgEMNgtBjwEMNQtBkAEMNAtBkQEMMwtBkgEMMgtBkwEMMQtBlAEMMAtBlQEMLwtBlgEMLgtBlwEMLQtBmAEMLAtBmQEMKwtBmgEMKgtBmwEMKQtBnAEMKAtBnQEMJwtBngEMJgtBnwEMJQtBoAEMJAtBoQEMIwtBogEMIgtBowEMIQtBpAEMIAtBpQEMHwtBpgEMHgtBpwEMHQtBqAEMHAtBqQEMGwtBqgEMGgtBqwEMGQtBrAEMGAtBrQEMFwtBrgEMFgtBAQwVC0GvAQwUC0GwAQwTC0GxAQwSC0GzAQwRC0GyAQwQC0G0AQwPC0G1AQwOC0G2AQwNC0G3AQwMC0G4AQwLC0G5AQwKC0G6AQwJC0G7AQwIC0HGAQwHC0G8AQwGC0G9AQwFC0G+AQwEC0G/AQwDC0HAAQwCC0HCAQwBC0HBAQshAwNAAkACQAJAAkACQAJAAkACQAJAIAICfwJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJ/AkACQAJAAkACQAJAAkACQAJAAkACQAJAAkAgAgJ/AkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACfwJAAkACfwJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACfwJAAkACQAJAAn8CQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQCADDsYBAAECAwQFBgcICQoLDA0ODxAREhMUFRYXGBkaGxwdHyAhIyUmKCorLC8wMTIzNDU2Nzk6Ozw9lANAQkRFRklLTk9QUVJTVFVWWFpbXF1eX2BhYmNkZWZnaGpsb3Bxc3V2eHl6e3x/gAGBAYIBgwGEAYUBhgGHAYgBiQGKAYsBjAGNAY4BjwGQAZEBkgGTAZQBlQGWAZcBmAGZAZoBmwGcAZ0BngGfAaABoQGiAaMBpAGlAaYBpwGoAakBqgGrAawBrQGuAa8BsAGxAbIBswG0AbUBtgG3AbgBuQG6AbsBvAG9Ab4BvwHAAcEBwgHDAcQBxQHGAccByAHJAcsBzAHNAc4BzwGKA4kDiAOHA4QDgwOAA/sC+gL5AvgC9wL0AvMC8gLLAsECsALZAQsgASAERw3wAkHdASEDDLMDCyABIARHDcgBQcMBIQMMsgMLIAEgBEcNe0H3ACEDDLEDCyABIARHDXBB7wAhAwywAwsgASAERw1pQeoAIQMMrwMLIAEgBEcNZUHoACEDDK4DCyABIARHDWJB5gAhAwytAwsgASAERw0aQRghAwysAwsgASAERw0VQRIhAwyrAwsgASAERw1CQcUAIQMMqgMLIAEgBEcNNEE/IQMMqQMLIAEgBEcNMkE8IQMMqAMLIAEgBEcNK0ExIQMMpwMLIAItAC5BAUYNnwMMwQILQQAhAAJAAkACQCACLQAqRQ0AIAItACtFDQAgAi8BMCIDQQJxRQ0BDAILIAIvATAiA0EBcUUNAQtBASEAIAItAChBAUYNACACLwEyIgVB5ABrQeQASQ0AIAVBzAFGDQAgBUGwAkYNACADQcAAcQ0AQQAhACADQYgEcUGABEYNACADQShxQQBHIQALIAJBADsBMCACQQA6AC8gAEUN3wIgAkIANwMgDOACC0EAIQACQCACKAI4IgNFDQAgAygCLCIDRQ0AIAIgAxEAACEACyAARQ3MASAAQRVHDd0CIAJBBDYCHCACIAE2AhQgAkGwGDYCECACQRU2AgxBACEDDKQDCyABIARGBEBBBiEDDKQDCyABQQFqIQFBACEAAkAgAigCOCIDRQ0AIAMoAlQiA0UNACACIAMRAAAhAAsgAA3ZAgwcCyACQgA3AyBBEiEDDIkDCyABIARHDRZBHSEDDKEDCyABIARHBEAgAUEBaiEBQRAhAwyIAwtBByEDDKADCyACIAIpAyAiCiAEIAFrrSILfSIMQgAgCiAMWhs3AyAgCiALWA3UAkEIIQMMnwMLIAEgBEcEQCACQQk2AgggAiABNgIEQRQhAwyGAwtBCSEDDJ4DCyACKQMgQgBSDccBIAIgAi8BMEGAAXI7ATAMQgsgASAERw0/QdAAIQMMnAMLIAEgBEYEQEELIQMMnAMLIAFBAWohAUEAIQACQCACKAI4IgNFDQAgAygCUCIDRQ0AIAIgAxEAACEACyAADc8CDMYBC0EAIQACQCACKAI4IgNFDQAgAygCSCIDRQ0AIAIgAxEAACEACyAARQ3GASAAQRVHDc0CIAJBCzYCHCACIAE2AhQgAkGCGTYCECACQRU2AgxBACEDDJoDC0EAIQACQCACKAI4IgNFDQAgAygCSCIDRQ0AIAIgAxEAACEACyAARQ0MIABBFUcNygIgAkEaNgIcIAIgATYCFCACQYIZNgIQIAJBFTYCDEEAIQMMmQMLQQAhAAJAIAIoAjgiA0UNACADKAJMIgNFDQAgAiADEQAAIQALIABFDcQBIABBFUcNxwIgAkELNgIcIAIgATYCFCACQZEXNgIQIAJBFTYCDEEAIQMMmAMLIAEgBEYEQEEPIQMMmAMLIAEtAAAiAEE7Rg0HIABBDUcNxAIgAUEBaiEBDMMBC0EAIQACQCACKAI4IgNFDQAgAygCTCIDRQ0AIAIgAxEAACEACyAARQ3DASAAQRVHDcICIAJBDzYCHCACIAE2AhQgAkGRFzYCECACQRU2AgxBACEDDJYDCwNAIAEtAABB8DVqLQAAIgBBAUcEQCAAQQJHDcECIAIoAgQhAEEAIQMgAkEANgIEIAIgACABQQFqIgEQLSIADcICDMUBCyAEIAFBAWoiAUcNAAtBEiEDDJUDC0EAIQACQCACKAI4IgNFDQAgAygCTCIDRQ0AIAIgAxEAACEACyAARQ3FASAAQRVHDb0CIAJBGzYCHCACIAE2AhQgAkGRFzYCECACQRU2AgxBACEDDJQDCyABIARGBEBBFiEDDJQDCyACQQo2AgggAiABNgIEQQAhAAJAIAIoAjgiA0UNACADKAJIIgNFDQAgAiADEQAAIQALIABFDcIBIABBFUcNuQIgAkEVNgIcIAIgATYCFCACQYIZNgIQIAJBFTYCDEEAIQMMkwMLIAEgBEcEQANAIAEtAABB8DdqLQAAIgBBAkcEQAJAIABBAWsOBMQCvQIAvgK9AgsgAUEBaiEBQQghAwz8AgsgBCABQQFqIgFHDQALQRUhAwyTAwtBFSEDDJIDCwNAIAEtAABB8DlqLQAAIgBBAkcEQCAAQQFrDgTFArcCwwK4ArcCCyAEIAFBAWoiAUcNAAtBGCEDDJEDCyABIARHBEAgAkELNgIIIAIgATYCBEEHIQMM+AILQRkhAwyQAwsgAUEBaiEBDAILIAEgBEYEQEEaIQMMjwMLAkAgAS0AAEENaw4UtQG/Ab8BvwG/Ab8BvwG/Ab8BvwG/Ab8BvwG/Ab8BvwG/Ab8BvwEAvwELQQAhAyACQQA2AhwgAkGvCzYCECACQQI2AgwgAiABQQFqNgIUDI4DCyABIARGBEBBGyEDDI4DCyABLQAAIgBBO0cEQCAAQQ1HDbECIAFBAWohAQy6AQsgAUEBaiEBC0EiIQMM8wILIAEgBEYEQEEcIQMMjAMLQgAhCgJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkAgAS0AAEEwaw43wQLAAgABAgMEBQYH0AHQAdAB0AHQAdAB0AEICQoLDA3QAdAB0AHQAdAB0AHQAdAB0AHQAdAB0AHQAdAB0AHQAdAB0AHQAdAB0AHQAdAB0AHQAdABDg8QERIT0AELQgIhCgzAAgtCAyEKDL8CC0IEIQoMvgILQgUhCgy9AgtCBiEKDLwCC0IHIQoMuwILQgghCgy6AgtCCSEKDLkCC0IKIQoMuAILQgshCgy3AgtCDCEKDLYCC0INIQoMtQILQg4hCgy0AgtCDyEKDLMCC0IKIQoMsgILQgshCgyxAgtCDCEKDLACC0INIQoMrwILQg4hCgyuAgtCDyEKDK0CC0IAIQoCQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAIAEtAABBMGsON8ACvwIAAQIDBAUGB74CvgK+Ar4CvgK+Ar4CCAkKCwwNvgK+Ar4CvgK+Ar4CvgK+Ar4CvgK+Ar4CvgK+Ar4CvgK+Ar4CvgK+Ar4CvgK+Ar4CvgK+Ag4PEBESE74CC0ICIQoMvwILQgMhCgy+AgtCBCEKDL0CC0IFIQoMvAILQgYhCgy7AgtCByEKDLoCC0IIIQoMuQILQgkhCgy4AgtCCiEKDLcCC0ILIQoMtgILQgwhCgy1AgtCDSEKDLQCC0IOIQoMswILQg8hCgyyAgtCCiEKDLECC0ILIQoMsAILQgwhCgyvAgtCDSEKDK4CC0IOIQoMrQILQg8hCgysAgsgAiACKQMgIgogBCABa60iC30iDEIAIAogDFobNwMgIAogC1gNpwJBHyEDDIkDCyABIARHBEAgAkEJNgIIIAIgATYCBEElIQMM8AILQSAhAwyIAwtBASEFIAIvATAiA0EIcUUEQCACKQMgQgBSIQULAkAgAi0ALgRAQQEhACACLQApQQVGDQEgA0HAAHFFIAVxRQ0BC0EAIQAgA0HAAHENAEECIQAgA0EIcQ0AIANBgARxBEACQCACLQAoQQFHDQAgAi0ALUEKcQ0AQQUhAAwCC0EEIQAMAQsgA0EgcUUEQAJAIAItAChBAUYNACACLwEyIgBB5ABrQeQASQ0AIABBzAFGDQAgAEGwAkYNAEEEIQAgA0EocUUNAiADQYgEcUGABEYNAgtBACEADAELQQBBAyACKQMgUBshAAsgAEEBaw4FvgIAsAEBpAKhAgtBESEDDO0CCyACQQE6AC8MhAMLIAEgBEcNnQJBJCEDDIQDCyABIARHDRxBxgAhAwyDAwtBACEAAkAgAigCOCIDRQ0AIAMoAkQiA0UNACACIAMRAAAhAAsgAEUNJyAAQRVHDZgCIAJB0AA2AhwgAiABNgIUIAJBkRg2AhAgAkEVNgIMQQAhAwyCAwsgASAERgRAQSghAwyCAwtBACEDIAJBADYCBCACQQw2AgggAiABIAEQKiIARQ2UAiACQSc2AhwgAiABNgIUIAIgADYCDAyBAwsgASAERgRAQSkhAwyBAwsgAS0AACIAQSBGDRMgAEEJRw2VAiABQQFqIQEMFAsgASAERwRAIAFBAWohAQwWC0EqIQMM/wILIAEgBEYEQEErIQMM/wILIAEtAAAiAEEJRyAAQSBHcQ2QAiACLQAsQQhHDd0CIAJBADoALAzdAgsgASAERgRAQSwhAwz+AgsgAS0AAEEKRw2OAiABQQFqIQEMsAELIAEgBEcNigJBLyEDDPwCCwNAIAEtAAAiAEEgRwRAIABBCmsOBIQCiAKIAoQChgILIAQgAUEBaiIBRw0AC0ExIQMM+wILQTIhAyABIARGDfoCIAIoAgAiACAEIAFraiEHIAEgAGtBA2ohBgJAA0AgAEHwO2otAAAgAS0AACIFQSByIAUgBUHBAGtB/wFxQRpJG0H/AXFHDQEgAEEDRgRAQQYhAQziAgsgAEEBaiEAIAQgAUEBaiIBRw0ACyACIAc2AgAM+wILIAJBADYCAAyGAgtBMyEDIAQgASIARg35AiAEIAFrIAIoAgAiAWohByAAIAFrQQhqIQYCQANAIAFB9DtqLQAAIAAtAAAiBUEgciAFIAVBwQBrQf8BcUEaSRtB/wFxRw0BIAFBCEYEQEEFIQEM4QILIAFBAWohASAEIABBAWoiAEcNAAsgAiAHNgIADPoCCyACQQA2AgAgACEBDIUCC0E0IQMgBCABIgBGDfgCIAQgAWsgAigCACIBaiEHIAAgAWtBBWohBgJAA0AgAUHQwgBqLQAAIAAtAAAiBUEgciAFIAVBwQBrQf8BcUEaSRtB/wFxRw0BIAFBBUYEQEEHIQEM4AILIAFBAWohASAEIABBAWoiAEcNAAsgAiAHNgIADPkCCyACQQA2AgAgACEBDIQCCyABIARHBEADQCABLQAAQYA+ai0AACIAQQFHBEAgAEECRg0JDIECCyAEIAFBAWoiAUcNAAtBMCEDDPgCC0EwIQMM9wILIAEgBEcEQANAIAEtAAAiAEEgRwRAIABBCmsOBP8B/gH+Af8B/gELIAQgAUEBaiIBRw0AC0E4IQMM9wILQTghAwz2AgsDQCABLQAAIgBBIEcgAEEJR3EN9gEgBCABQQFqIgFHDQALQTwhAwz1AgsDQCABLQAAIgBBIEcEQAJAIABBCmsOBPkBBAT5AQALIABBLEYN9QEMAwsgBCABQQFqIgFHDQALQT8hAwz0AgtBwAAhAyABIARGDfMCIAIoAgAiACAEIAFraiEFIAEgAGtBBmohBgJAA0AgAEGAQGstAAAgAS0AAEEgckcNASAAQQZGDdsCIABBAWohACAEIAFBAWoiAUcNAAsgAiAFNgIADPQCCyACQQA2AgALQTYhAwzZAgsgASAERgRAQcEAIQMM8gILIAJBDDYCCCACIAE2AgQgAi0ALEEBaw4E+wHuAewB6wHUAgsgAUEBaiEBDPoBCyABIARHBEADQAJAIAEtAAAiAEEgciAAIABBwQBrQf8BcUEaSRtB/wFxIgBBCUYNACAAQSBGDQACQAJAAkACQCAAQeMAaw4TAAMDAwMDAwMBAwMDAwMDAwMDAgMLIAFBAWohAUExIQMM3AILIAFBAWohAUEyIQMM2wILIAFBAWohAUEzIQMM2gILDP4BCyAEIAFBAWoiAUcNAAtBNSEDDPACC0E1IQMM7wILIAEgBEcEQANAIAEtAABBgDxqLQAAQQFHDfcBIAQgAUEBaiIBRw0AC0E9IQMM7wILQT0hAwzuAgtBACEAAkAgAigCOCIDRQ0AIAMoAkAiA0UNACACIAMRAAAhAAsgAEUNASAAQRVHDeYBIAJBwgA2AhwgAiABNgIUIAJB4xg2AhAgAkEVNgIMQQAhAwztAgsgAUEBaiEBC0E8IQMM0gILIAEgBEYEQEHCACEDDOsCCwJAA0ACQCABLQAAQQlrDhgAAswCzALRAswCzALMAswCzALMAswCzALMAswCzALMAswCzALMAswCzALMAgDMAgsgBCABQQFqIgFHDQALQcIAIQMM6wILIAFBAWohASACLQAtQQFxRQ3+AQtBLCEDDNACCyABIARHDd4BQcQAIQMM6AILA0AgAS0AAEGQwABqLQAAQQFHDZwBIAQgAUEBaiIBRw0AC0HFACEDDOcCCyABLQAAIgBBIEYN/gEgAEE6Rw3AAiACKAIEIQBBACEDIAJBADYCBCACIAAgARApIgAN3gEM3QELQccAIQMgBCABIgBGDeUCIAQgAWsgAigCACIBaiEHIAAgAWtBBWohBgNAIAFBkMIAai0AACAALQAAIgVBIHIgBSAFQcEAa0H/AXFBGkkbQf8BcUcNvwIgAUEFRg3CAiABQQFqIQEgBCAAQQFqIgBHDQALIAIgBzYCAAzlAgtByAAhAyAEIAEiAEYN5AIgBCABayACKAIAIgFqIQcgACABa0EJaiEGA0AgAUGWwgBqLQAAIAAtAAAiBUEgciAFIAVBwQBrQf8BcUEaSRtB/wFxRw2+AkECIAFBCUYNwgIaIAFBAWohASAEIABBAWoiAEcNAAsgAiAHNgIADOQCCyABIARGBEBByQAhAwzkAgsCQAJAIAEtAAAiAEEgciAAIABBwQBrQf8BcUEaSRtB/wFxQe4Aaw4HAL8CvwK/Ar8CvwIBvwILIAFBAWohAUE+IQMMywILIAFBAWohAUE/IQMMygILQcoAIQMgBCABIgBGDeICIAQgAWsgAigCACIBaiEGIAAgAWtBAWohBwNAIAFBoMIAai0AACAALQAAIgVBIHIgBSAFQcEAa0H/AXFBGkkbQf8BcUcNvAIgAUEBRg2+AiABQQFqIQEgBCAAQQFqIgBHDQALIAIgBjYCAAziAgtBywAhAyAEIAEiAEYN4QIgBCABayACKAIAIgFqIQcgACABa0EOaiEGA0AgAUGiwgBqLQAAIAAtAAAiBUEgciAFIAVBwQBrQf8BcUEaSRtB/wFxRw27AiABQQ5GDb4CIAFBAWohASAEIABBAWoiAEcNAAsgAiAHNgIADOECC0HMACEDIAQgASIARg3gAiAEIAFrIAIoAgAiAWohByAAIAFrQQ9qIQYDQCABQcDCAGotAAAgAC0AACIFQSByIAUgBUHBAGtB/wFxQRpJG0H/AXFHDboCQQMgAUEPRg2+AhogAUEBaiEBIAQgAEEBaiIARw0ACyACIAc2AgAM4AILQc0AIQMgBCABIgBGDd8CIAQgAWsgAigCACIBaiEHIAAgAWtBBWohBgNAIAFB0MIAai0AACAALQAAIgVBIHIgBSAFQcEAa0H/AXFBGkkbQf8BcUcNuQJBBCABQQVGDb0CGiABQQFqIQEgBCAAQQFqIgBHDQALIAIgBzYCAAzfAgsgASAERgRAQc4AIQMM3wILAkACQAJAAkAgAS0AACIAQSByIAAgAEHBAGtB/wFxQRpJG0H/AXFB4wBrDhMAvAK8ArwCvAK8ArwCvAK8ArwCvAK8ArwCAbwCvAK8AgIDvAILIAFBAWohAUHBACEDDMgCCyABQQFqIQFBwgAhAwzHAgsgAUEBaiEBQcMAIQMMxgILIAFBAWohAUHEACEDDMUCCyABIARHBEAgAkENNgIIIAIgATYCBEHFACEDDMUCC0HPACEDDN0CCwJAAkAgAS0AAEEKaw4EAZABkAEAkAELIAFBAWohAQtBKCEDDMMCCyABIARGBEBB0QAhAwzcAgsgAS0AAEEgRw0AIAFBAWohASACLQAtQQFxRQ3QAQtBFyEDDMECCyABIARHDcsBQdIAIQMM2QILQdMAIQMgASAERg3YAiACKAIAIgAgBCABa2ohBiABIABrQQFqIQUDQCABLQAAIABB1sIAai0AAEcNxwEgAEEBRg3KASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBjYCAAzYAgsgASAERgRAQdUAIQMM2AILIAEtAABBCkcNwgEgAUEBaiEBDMoBCyABIARGBEBB1gAhAwzXAgsCQAJAIAEtAABBCmsOBADDAcMBAcMBCyABQQFqIQEMygELIAFBAWohAUHKACEDDL0CC0EAIQACQCACKAI4IgNFDQAgAygCPCIDRQ0AIAIgAxEAACEACyAADb8BQc0AIQMMvAILIAItAClBIkYNzwIMiQELIAQgASIFRgRAQdsAIQMM1AILQQAhAEEBIQFBASEGQQAhAwJAAn8CQAJAAkACQAJAAkACQCAFLQAAQTBrDgrFAcQBAAECAwQFBgjDAQtBAgwGC0EDDAULQQQMBAtBBQwDC0EGDAILQQcMAQtBCAshA0EAIQFBACEGDL0BC0EJIQNBASEAQQAhAUEAIQYMvAELIAEgBEYEQEHdACEDDNMCCyABLQAAQS5HDbgBIAFBAWohAQyIAQsgASAERw22AUHfACEDDNECCyABIARHBEAgAkEONgIIIAIgATYCBEHQACEDDLgCC0HgACEDDNACC0HhACEDIAEgBEYNzwIgAigCACIAIAQgAWtqIQUgASAAa0EDaiEGA0AgAS0AACAAQeLCAGotAABHDbEBIABBA0YNswEgAEEBaiEAIAQgAUEBaiIBRw0ACyACIAU2AgAMzwILQeIAIQMgASAERg3OAiACKAIAIgAgBCABa2ohBSABIABrQQJqIQYDQCABLQAAIABB5sIAai0AAEcNsAEgAEECRg2vASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAzOAgtB4wAhAyABIARGDc0CIAIoAgAiACAEIAFraiEFIAEgAGtBA2ohBgNAIAEtAAAgAEHpwgBqLQAARw2vASAAQQNGDa0BIABBAWohACAEIAFBAWoiAUcNAAsgAiAFNgIADM0CCyABIARGBEBB5QAhAwzNAgsgAUEBaiEBQQAhAAJAIAIoAjgiA0UNACADKAIwIgNFDQAgAiADEQAAIQALIAANqgFB1gAhAwyzAgsgASAERwRAA0AgAS0AACIAQSBHBEACQAJAAkAgAEHIAGsOCwABswGzAbMBswGzAbMBswGzAQKzAQsgAUEBaiEBQdIAIQMMtwILIAFBAWohAUHTACEDDLYCCyABQQFqIQFB1AAhAwy1AgsgBCABQQFqIgFHDQALQeQAIQMMzAILQeQAIQMMywILA0AgAS0AAEHwwgBqLQAAIgBBAUcEQCAAQQJrDgOnAaYBpQGkAQsgBCABQQFqIgFHDQALQeYAIQMMygILIAFBAWogASAERw0CGkHnACEDDMkCCwNAIAEtAABB8MQAai0AACIAQQFHBEACQCAAQQJrDgSiAaEBoAEAnwELQdcAIQMMsQILIAQgAUEBaiIBRw0AC0HoACEDDMgCCyABIARGBEBB6QAhAwzIAgsCQCABLQAAIgBBCmsOGrcBmwGbAbQBmwGbAZsBmwGbAZsBmwGbAZsBmwGbAZsBmwGbAZsBmwGbAZsBpAGbAZsBAJkBCyABQQFqCyEBQQYhAwytAgsDQCABLQAAQfDGAGotAABBAUcNfSAEIAFBAWoiAUcNAAtB6gAhAwzFAgsgAUEBaiABIARHDQIaQesAIQMMxAILIAEgBEYEQEHsACEDDMQCCyABQQFqDAELIAEgBEYEQEHtACEDDMMCCyABQQFqCyEBQQQhAwyoAgsgASAERgRAQe4AIQMMwQILAkACQAJAIAEtAABB8MgAai0AAEEBaw4HkAGPAY4BAHwBAo0BCyABQQFqIQEMCwsgAUEBagyTAQtBACEDIAJBADYCHCACQZsSNgIQIAJBBzYCDCACIAFBAWo2AhQMwAILAkADQCABLQAAQfDIAGotAAAiAEEERwRAAkACQCAAQQFrDgeUAZMBkgGNAQAEAY0BC0HaACEDDKoCCyABQQFqIQFB3AAhAwypAgsgBCABQQFqIgFHDQALQe8AIQMMwAILIAFBAWoMkQELIAQgASIARgRAQfAAIQMMvwILIAAtAABBL0cNASAAQQFqIQEMBwsgBCABIgBGBEBB8QAhAwy+AgsgAC0AACIBQS9GBEAgAEEBaiEBQd0AIQMMpQILIAFBCmsiA0EWSw0AIAAhAUEBIAN0QYmAgAJxDfkBC0EAIQMgAkEANgIcIAIgADYCFCACQYwcNgIQIAJBBzYCDAy8AgsgASAERwRAIAFBAWohAUHeACEDDKMCC0HyACEDDLsCCyABIARGBEBB9AAhAwy7AgsCQCABLQAAQfDMAGotAABBAWsOA/cBcwCCAQtB4QAhAwyhAgsgASAERwRAA0AgAS0AAEHwygBqLQAAIgBBA0cEQAJAIABBAWsOAvkBAIUBC0HfACEDDKMCCyAEIAFBAWoiAUcNAAtB8wAhAwy6AgtB8wAhAwy5AgsgASAERwRAIAJBDzYCCCACIAE2AgRB4AAhAwygAgtB9QAhAwy4AgsgASAERgRAQfYAIQMMuAILIAJBDzYCCCACIAE2AgQLQQMhAwydAgsDQCABLQAAQSBHDY4CIAQgAUEBaiIBRw0AC0H3ACEDDLUCCyABIARGBEBB+AAhAwy1AgsgAS0AAEEgRw16IAFBAWohAQxbC0EAIQACQCACKAI4IgNFDQAgAygCOCIDRQ0AIAIgAxEAACEACyAADXgMgAILIAEgBEYEQEH6ACEDDLMCCyABLQAAQcwARw10IAFBAWohAUETDHYLQfsAIQMgASAERg2xAiACKAIAIgAgBCABa2ohBSABIABrQQVqIQYDQCABLQAAIABB8M4Aai0AAEcNcyAAQQVGDXUgAEEBaiEAIAQgAUEBaiIBRw0ACyACIAU2AgAMsQILIAEgBEYEQEH8ACEDDLECCwJAAkAgAS0AAEHDAGsODAB0dHR0dHR0dHR0AXQLIAFBAWohAUHmACEDDJgCCyABQQFqIQFB5wAhAwyXAgtB/QAhAyABIARGDa8CIAIoAgAiACAEIAFraiEFIAEgAGtBAmohBgJAA0AgAS0AACAAQe3PAGotAABHDXIgAEECRg0BIABBAWohACAEIAFBAWoiAUcNAAsgAiAFNgIADLACCyACQQA2AgAgBkEBaiEBQRAMcwtB/gAhAyABIARGDa4CIAIoAgAiACAEIAFraiEFIAEgAGtBBWohBgJAA0AgAS0AACAAQfbOAGotAABHDXEgAEEFRg0BIABBAWohACAEIAFBAWoiAUcNAAsgAiAFNgIADK8CCyACQQA2AgAgBkEBaiEBQRYMcgtB/wAhAyABIARGDa0CIAIoAgAiACAEIAFraiEFIAEgAGtBA2ohBgJAA0AgAS0AACAAQfzOAGotAABHDXAgAEEDRg0BIABBAWohACAEIAFBAWoiAUcNAAsgAiAFNgIADK4CCyACQQA2AgAgBkEBaiEBQQUMcQsgASAERgRAQYABIQMMrQILIAEtAABB2QBHDW4gAUEBaiEBQQgMcAsgASAERgRAQYEBIQMMrAILAkACQCABLQAAQc4Aaw4DAG8BbwsgAUEBaiEBQesAIQMMkwILIAFBAWohAUHsACEDDJICCyABIARGBEBBggEhAwyrAgsCQAJAIAEtAABByABrDggAbm5ubm5uAW4LIAFBAWohAUHqACEDDJICCyABQQFqIQFB7QAhAwyRAgtBgwEhAyABIARGDakCIAIoAgAiACAEIAFraiEFIAEgAGtBAmohBgJAA0AgAS0AACAAQYDPAGotAABHDWwgAEECRg0BIABBAWohACAEIAFBAWoiAUcNAAsgAiAFNgIADKoCCyACQQA2AgAgBkEBaiEBQQAMbQtBhAEhAyABIARGDagCIAIoAgAiACAEIAFraiEFIAEgAGtBBGohBgJAA0AgAS0AACAAQYPPAGotAABHDWsgAEEERg0BIABBAWohACAEIAFBAWoiAUcNAAsgAiAFNgIADKkCCyACQQA2AgAgBkEBaiEBQSMMbAsgASAERgRAQYUBIQMMqAILAkACQCABLQAAQcwAaw4IAGtra2trawFrCyABQQFqIQFB7wAhAwyPAgsgAUEBaiEBQfAAIQMMjgILIAEgBEYEQEGGASEDDKcCCyABLQAAQcUARw1oIAFBAWohAQxgC0GHASEDIAEgBEYNpQIgAigCACIAIAQgAWtqIQUgASAAa0EDaiEGAkADQCABLQAAIABBiM8Aai0AAEcNaCAAQQNGDQEgAEEBaiEAIAQgAUEBaiIBRw0ACyACIAU2AgAMpgILIAJBADYCACAGQQFqIQFBLQxpC0GIASEDIAEgBEYNpAIgAigCACIAIAQgAWtqIQUgASAAa0EIaiEGAkADQCABLQAAIABB0M8Aai0AAEcNZyAAQQhGDQEgAEEBaiEAIAQgAUEBaiIBRw0ACyACIAU2AgAMpQILIAJBADYCACAGQQFqIQFBKQxoCyABIARGBEBBiQEhAwykAgtBASABLQAAQd8ARw1nGiABQQFqIQEMXgtBigEhAyABIARGDaICIAIoAgAiACAEIAFraiEFIAEgAGtBAWohBgNAIAEtAAAgAEGMzwBqLQAARw1kIABBAUYN+gEgAEEBaiEAIAQgAUEBaiIBRw0ACyACIAU2AgAMogILQYsBIQMgASAERg2hAiACKAIAIgAgBCABa2ohBSABIABrQQJqIQYCQANAIAEtAAAgAEGOzwBqLQAARw1kIABBAkYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAyiAgsgAkEANgIAIAZBAWohAUECDGULQYwBIQMgASAERg2gAiACKAIAIgAgBCABa2ohBSABIABrQQFqIQYCQANAIAEtAAAgAEHwzwBqLQAARw1jIABBAUYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAyhAgsgAkEANgIAIAZBAWohAUEfDGQLQY0BIQMgASAERg2fAiACKAIAIgAgBCABa2ohBSABIABrQQFqIQYCQANAIAEtAAAgAEHyzwBqLQAARw1iIABBAUYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAygAgsgAkEANgIAIAZBAWohAUEJDGMLIAEgBEYEQEGOASEDDJ8CCwJAAkAgAS0AAEHJAGsOBwBiYmJiYgFiCyABQQFqIQFB+AAhAwyGAgsgAUEBaiEBQfkAIQMMhQILQY8BIQMgASAERg2dAiACKAIAIgAgBCABa2ohBSABIABrQQVqIQYCQANAIAEtAAAgAEGRzwBqLQAARw1gIABBBUYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAyeAgsgAkEANgIAIAZBAWohAUEYDGELQZABIQMgASAERg2cAiACKAIAIgAgBCABa2ohBSABIABrQQJqIQYCQANAIAEtAAAgAEGXzwBqLQAARw1fIABBAkYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAydAgsgAkEANgIAIAZBAWohAUEXDGALQZEBIQMgASAERg2bAiACKAIAIgAgBCABa2ohBSABIABrQQZqIQYCQANAIAEtAAAgAEGazwBqLQAARw1eIABBBkYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAycAgsgAkEANgIAIAZBAWohAUEVDF8LQZIBIQMgASAERg2aAiACKAIAIgAgBCABa2ohBSABIABrQQVqIQYCQANAIAEtAAAgAEGhzwBqLQAARw1dIABBBUYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAybAgsgAkEANgIAIAZBAWohAUEeDF4LIAEgBEYEQEGTASEDDJoCCyABLQAAQcwARw1bIAFBAWohAUEKDF0LIAEgBEYEQEGUASEDDJkCCwJAAkAgAS0AAEHBAGsODwBcXFxcXFxcXFxcXFxcAVwLIAFBAWohAUH+ACEDDIACCyABQQFqIQFB/wAhAwz/AQsgASAERgRAQZUBIQMMmAILAkACQCABLQAAQcEAaw4DAFsBWwsgAUEBaiEBQf0AIQMM/wELIAFBAWohAUGAASEDDP4BC0GWASEDIAEgBEYNlgIgAigCACIAIAQgAWtqIQUgASAAa0EBaiEGAkADQCABLQAAIABBp88Aai0AAEcNWSAAQQFGDQEgAEEBaiEAIAQgAUEBaiIBRw0ACyACIAU2AgAMlwILIAJBADYCACAGQQFqIQFBCwxaCyABIARGBEBBlwEhAwyWAgsCQAJAAkACQCABLQAAQS1rDiMAW1tbW1tbW1tbW1tbW1tbW1tbW1tbW1sBW1tbW1sCW1tbA1sLIAFBAWohAUH7ACEDDP8BCyABQQFqIQFB/AAhAwz+AQsgAUEBaiEBQYEBIQMM/QELIAFBAWohAUGCASEDDPwBC0GYASEDIAEgBEYNlAIgAigCACIAIAQgAWtqIQUgASAAa0EEaiEGAkADQCABLQAAIABBqc8Aai0AAEcNVyAAQQRGDQEgAEEBaiEAIAQgAUEBaiIBRw0ACyACIAU2AgAMlQILIAJBADYCACAGQQFqIQFBGQxYC0GZASEDIAEgBEYNkwIgAigCACIAIAQgAWtqIQUgASAAa0EFaiEGAkADQCABLQAAIABBrs8Aai0AAEcNViAAQQVGDQEgAEEBaiEAIAQgAUEBaiIBRw0ACyACIAU2AgAMlAILIAJBADYCACAGQQFqIQFBBgxXC0GaASEDIAEgBEYNkgIgAigCACIAIAQgAWtqIQUgASAAa0EBaiEGAkADQCABLQAAIABBtM8Aai0AAEcNVSAAQQFGDQEgAEEBaiEAIAQgAUEBaiIBRw0ACyACIAU2AgAMkwILIAJBADYCACAGQQFqIQFBHAxWC0GbASEDIAEgBEYNkQIgAigCACIAIAQgAWtqIQUgASAAa0EBaiEGAkADQCABLQAAIABBts8Aai0AAEcNVCAAQQFGDQEgAEEBaiEAIAQgAUEBaiIBRw0ACyACIAU2AgAMkgILIAJBADYCACAGQQFqIQFBJwxVCyABIARGBEBBnAEhAwyRAgsCQAJAIAEtAABB1ABrDgIAAVQLIAFBAWohAUGGASEDDPgBCyABQQFqIQFBhwEhAwz3AQtBnQEhAyABIARGDY8CIAIoAgAiACAEIAFraiEFIAEgAGtBAWohBgJAA0AgAS0AACAAQbjPAGotAABHDVIgAEEBRg0BIABBAWohACAEIAFBAWoiAUcNAAsgAiAFNgIADJACCyACQQA2AgAgBkEBaiEBQSYMUwtBngEhAyABIARGDY4CIAIoAgAiACAEIAFraiEFIAEgAGtBAWohBgJAA0AgAS0AACAAQbrPAGotAABHDVEgAEEBRg0BIABBAWohACAEIAFBAWoiAUcNAAsgAiAFNgIADI8CCyACQQA2AgAgBkEBaiEBQQMMUgtBnwEhAyABIARGDY0CIAIoAgAiACAEIAFraiEFIAEgAGtBAmohBgJAA0AgAS0AACAAQe3PAGotAABHDVAgAEECRg0BIABBAWohACAEIAFBAWoiAUcNAAsgAiAFNgIADI4CCyACQQA2AgAgBkEBaiEBQQwMUQtBoAEhAyABIARGDYwCIAIoAgAiACAEIAFraiEFIAEgAGtBA2ohBgJAA0AgAS0AACAAQbzPAGotAABHDU8gAEEDRg0BIABBAWohACAEIAFBAWoiAUcNAAsgAiAFNgIADI0CCyACQQA2AgAgBkEBaiEBQQ0MUAsgASAERgRAQaEBIQMMjAILAkACQCABLQAAQcYAaw4LAE9PT09PT09PTwFPCyABQQFqIQFBiwEhAwzzAQsgAUEBaiEBQYwBIQMM8gELIAEgBEYEQEGiASEDDIsCCyABLQAAQdAARw1MIAFBAWohAQxGCyABIARGBEBBowEhAwyKAgsCQAJAIAEtAABByQBrDgcBTU1NTU0ATQsgAUEBaiEBQY4BIQMM8QELIAFBAWohAUEiDE0LQaQBIQMgASAERg2IAiACKAIAIgAgBCABa2ohBSABIABrQQFqIQYCQANAIAEtAAAgAEHAzwBqLQAARw1LIABBAUYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAyJAgsgAkEANgIAIAZBAWohAUEdDEwLIAEgBEYEQEGlASEDDIgCCwJAAkAgAS0AAEHSAGsOAwBLAUsLIAFBAWohAUGQASEDDO8BCyABQQFqIQFBBAxLCyABIARGBEBBpgEhAwyHAgsCQAJAAkACQAJAIAEtAABBwQBrDhUATU1NTU1NTU1NTQFNTQJNTQNNTQRNCyABQQFqIQFBiAEhAwzxAQsgAUEBaiEBQYkBIQMM8AELIAFBAWohAUGKASEDDO8BCyABQQFqIQFBjwEhAwzuAQsgAUEBaiEBQZEBIQMM7QELQacBIQMgASAERg2FAiACKAIAIgAgBCABa2ohBSABIABrQQJqIQYCQANAIAEtAAAgAEHtzwBqLQAARw1IIABBAkYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAyGAgsgAkEANgIAIAZBAWohAUERDEkLQagBIQMgASAERg2EAiACKAIAIgAgBCABa2ohBSABIABrQQJqIQYCQANAIAEtAAAgAEHCzwBqLQAARw1HIABBAkYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAyFAgsgAkEANgIAIAZBAWohAUEsDEgLQakBIQMgASAERg2DAiACKAIAIgAgBCABa2ohBSABIABrQQRqIQYCQANAIAEtAAAgAEHFzwBqLQAARw1GIABBBEYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAyEAgsgAkEANgIAIAZBAWohAUErDEcLQaoBIQMgASAERg2CAiACKAIAIgAgBCABa2ohBSABIABrQQJqIQYCQANAIAEtAAAgAEHKzwBqLQAARw1FIABBAkYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAyDAgsgAkEANgIAIAZBAWohAUEUDEYLIAEgBEYEQEGrASEDDIICCwJAAkACQAJAIAEtAABBwgBrDg8AAQJHR0dHR0dHR0dHRwNHCyABQQFqIQFBkwEhAwzrAQsgAUEBaiEBQZQBIQMM6gELIAFBAWohAUGVASEDDOkBCyABQQFqIQFBlgEhAwzoAQsgASAERgRAQawBIQMMgQILIAEtAABBxQBHDUIgAUEBaiEBDD0LQa0BIQMgASAERg3/ASACKAIAIgAgBCABa2ohBSABIABrQQJqIQYCQANAIAEtAAAgAEHNzwBqLQAARw1CIABBAkYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAyAAgsgAkEANgIAIAZBAWohAUEODEMLIAEgBEYEQEGuASEDDP8BCyABLQAAQdAARw1AIAFBAWohAUElDEILQa8BIQMgASAERg39ASACKAIAIgAgBCABa2ohBSABIABrQQhqIQYCQANAIAEtAAAgAEHQzwBqLQAARw1AIABBCEYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAz+AQsgAkEANgIAIAZBAWohAUEqDEELIAEgBEYEQEGwASEDDP0BCwJAAkAgAS0AAEHVAGsOCwBAQEBAQEBAQEABQAsgAUEBaiEBQZoBIQMM5AELIAFBAWohAUGbASEDDOMBCyABIARGBEBBsQEhAwz8AQsCQAJAIAEtAABBwQBrDhQAPz8/Pz8/Pz8/Pz8/Pz8/Pz8/AT8LIAFBAWohAUGZASEDDOMBCyABQQFqIQFBnAEhAwziAQtBsgEhAyABIARGDfoBIAIoAgAiACAEIAFraiEFIAEgAGtBA2ohBgJAA0AgAS0AACAAQdnPAGotAABHDT0gAEEDRg0BIABBAWohACAEIAFBAWoiAUcNAAsgAiAFNgIADPsBCyACQQA2AgAgBkEBaiEBQSEMPgtBswEhAyABIARGDfkBIAIoAgAiACAEIAFraiEFIAEgAGtBBmohBgJAA0AgAS0AACAAQd3PAGotAABHDTwgAEEGRg0BIABBAWohACAEIAFBAWoiAUcNAAsgAiAFNgIADPoBCyACQQA2AgAgBkEBaiEBQRoMPQsgASAERgRAQbQBIQMM+QELAkACQAJAIAEtAABBxQBrDhEAPT09PT09PT09AT09PT09Aj0LIAFBAWohAUGdASEDDOEBCyABQQFqIQFBngEhAwzgAQsgAUEBaiEBQZ8BIQMM3wELQbUBIQMgASAERg33ASACKAIAIgAgBCABa2ohBSABIABrQQVqIQYCQANAIAEtAAAgAEHkzwBqLQAARw06IABBBUYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAz4AQsgAkEANgIAIAZBAWohAUEoDDsLQbYBIQMgASAERg32ASACKAIAIgAgBCABa2ohBSABIABrQQJqIQYCQANAIAEtAAAgAEHqzwBqLQAARw05IABBAkYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAz3AQsgAkEANgIAIAZBAWohAUEHDDoLIAEgBEYEQEG3ASEDDPYBCwJAAkAgAS0AAEHFAGsODgA5OTk5OTk5OTk5OTkBOQsgAUEBaiEBQaEBIQMM3QELIAFBAWohAUGiASEDDNwBC0G4ASEDIAEgBEYN9AEgAigCACIAIAQgAWtqIQUgASAAa0ECaiEGAkADQCABLQAAIABB7c8Aai0AAEcNNyAAQQJGDQEgAEEBaiEAIAQgAUEBaiIBRw0ACyACIAU2AgAM9QELIAJBADYCACAGQQFqIQFBEgw4C0G5ASEDIAEgBEYN8wEgAigCACIAIAQgAWtqIQUgASAAa0EBaiEGAkADQCABLQAAIABB8M8Aai0AAEcNNiAAQQFGDQEgAEEBaiEAIAQgAUEBaiIBRw0ACyACIAU2AgAM9AELIAJBADYCACAGQQFqIQFBIAw3C0G6ASEDIAEgBEYN8gEgAigCACIAIAQgAWtqIQUgASAAa0EBaiEGAkADQCABLQAAIABB8s8Aai0AAEcNNSAAQQFGDQEgAEEBaiEAIAQgAUEBaiIBRw0ACyACIAU2AgAM8wELIAJBADYCACAGQQFqIQFBDww2CyABIARGBEBBuwEhAwzyAQsCQAJAIAEtAABByQBrDgcANTU1NTUBNQsgAUEBaiEBQaUBIQMM2QELIAFBAWohAUGmASEDDNgBC0G8ASEDIAEgBEYN8AEgAigCACIAIAQgAWtqIQUgASAAa0EHaiEGAkADQCABLQAAIABB9M8Aai0AAEcNMyAAQQdGDQEgAEEBaiEAIAQgAUEBaiIBRw0ACyACIAU2AgAM8QELIAJBADYCACAGQQFqIQFBGww0CyABIARGBEBBvQEhAwzwAQsCQAJAAkAgAS0AAEHCAGsOEgA0NDQ0NDQ0NDQBNDQ0NDQ0AjQLIAFBAWohAUGkASEDDNgBCyABQQFqIQFBpwEhAwzXAQsgAUEBaiEBQagBIQMM1gELIAEgBEYEQEG+ASEDDO8BCyABLQAAQc4ARw0wIAFBAWohAQwsCyABIARGBEBBvwEhAwzuAQsCQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQCABLQAAQcEAaw4VAAECAz8EBQY/Pz8HCAkKCz8MDQ4PPwsgAUEBaiEBQegAIQMM4wELIAFBAWohAUHpACEDDOIBCyABQQFqIQFB7gAhAwzhAQsgAUEBaiEBQfIAIQMM4AELIAFBAWohAUHzACEDDN8BCyABQQFqIQFB9gAhAwzeAQsgAUEBaiEBQfcAIQMM3QELIAFBAWohAUH6ACEDDNwBCyABQQFqIQFBgwEhAwzbAQsgAUEBaiEBQYQBIQMM2gELIAFBAWohAUGFASEDDNkBCyABQQFqIQFBkgEhAwzYAQsgAUEBaiEBQZgBIQMM1wELIAFBAWohAUGgASEDDNYBCyABQQFqIQFBowEhAwzVAQsgAUEBaiEBQaoBIQMM1AELIAEgBEcEQCACQRA2AgggAiABNgIEQasBIQMM1AELQcABIQMM7AELQQAhAAJAIAIoAjgiA0UNACADKAI0IgNFDQAgAiADEQAAIQALIABFDV4gAEEVRw0HIAJB0QA2AhwgAiABNgIUIAJBsBc2AhAgAkEVNgIMQQAhAwzrAQsgAUEBaiABIARHDQgaQcIBIQMM6gELA0ACQCABLQAAQQprDgQIAAALAAsgBCABQQFqIgFHDQALQcMBIQMM6QELIAEgBEcEQCACQRE2AgggAiABNgIEQQEhAwzQAQtBxAEhAwzoAQsgASAERgRAQcUBIQMM6AELAkACQCABLQAAQQprDgQBKCgAKAsgAUEBagwJCyABQQFqDAULIAEgBEYEQEHGASEDDOcBCwJAAkAgAS0AAEEKaw4XAQsLAQsLCwsLCwsLCwsLCwsLCwsLCwALCyABQQFqIQELQbABIQMMzQELIAEgBEYEQEHIASEDDOYBCyABLQAAQSBHDQkgAkEAOwEyIAFBAWohAUGzASEDDMwBCwNAIAEhAAJAIAEgBEcEQCABLQAAQTBrQf8BcSIDQQpJDQEMJwtBxwEhAwzmAQsCQCACLwEyIgFBmTNLDQAgAiABQQpsIgU7ATIgBUH+/wNxIANB//8Dc0sNACAAQQFqIQEgAiADIAVqIgM7ATIgA0H//wNxQegHSQ0BCwtBACEDIAJBADYCHCACQcEJNgIQIAJBDTYCDCACIABBAWo2AhQM5AELIAJBADYCHCACIAE2AhQgAkHwDDYCECACQRs2AgxBACEDDOMBCyACKAIEIQAgAkEANgIEIAIgACABECYiAA0BIAFBAWoLIQFBrQEhAwzIAQsgAkHBATYCHCACIAA2AgwgAiABQQFqNgIUQQAhAwzgAQsgAigCBCEAIAJBADYCBCACIAAgARAmIgANASABQQFqCyEBQa4BIQMMxQELIAJBwgE2AhwgAiAANgIMIAIgAUEBajYCFEEAIQMM3QELIAJBADYCHCACIAE2AhQgAkGXCzYCECACQQ02AgxBACEDDNwBCyACQQA2AhwgAiABNgIUIAJB4xA2AhAgAkEJNgIMQQAhAwzbAQsgAkECOgAoDKwBC0EAIQMgAkEANgIcIAJBrws2AhAgAkECNgIMIAIgAUEBajYCFAzZAQtBAiEDDL8BC0ENIQMMvgELQSYhAwy9AQtBFSEDDLwBC0EWIQMMuwELQRghAwy6AQtBHCEDDLkBC0EdIQMMuAELQSAhAwy3AQtBISEDDLYBC0EjIQMMtQELQcYAIQMMtAELQS4hAwyzAQtBPSEDDLIBC0HLACEDDLEBC0HOACEDDLABC0HYACEDDK8BC0HZACEDDK4BC0HbACEDDK0BC0HxACEDDKwBC0H0ACEDDKsBC0GNASEDDKoBC0GXASEDDKkBC0GpASEDDKgBC0GvASEDDKcBC0GxASEDDKYBCyACQQA2AgALQQAhAyACQQA2AhwgAiABNgIUIAJB8Rs2AhAgAkEGNgIMDL0BCyACQQA2AgAgBkEBaiEBQSQLOgApIAIoAgQhACACQQA2AgQgAiAAIAEQJyIARQRAQeUAIQMMowELIAJB+QA2AhwgAiABNgIUIAIgADYCDEEAIQMMuwELIABBFUcEQCACQQA2AhwgAiABNgIUIAJBzA42AhAgAkEgNgIMQQAhAwy7AQsgAkH4ADYCHCACIAE2AhQgAkHKGDYCECACQRU2AgxBACEDDLoBCyACQQA2AhwgAiABNgIUIAJBjhs2AhAgAkEGNgIMQQAhAwy5AQsgAkEANgIcIAIgATYCFCACQf4RNgIQIAJBBzYCDEEAIQMMuAELIAJBADYCHCACIAE2AhQgAkGMHDYCECACQQc2AgxBACEDDLcBCyACQQA2AhwgAiABNgIUIAJBww82AhAgAkEHNgIMQQAhAwy2AQsgAkEANgIcIAIgATYCFCACQcMPNgIQIAJBBzYCDEEAIQMMtQELIAIoAgQhACACQQA2AgQgAiAAIAEQJSIARQ0RIAJB5QA2AhwgAiABNgIUIAIgADYCDEEAIQMMtAELIAIoAgQhACACQQA2AgQgAiAAIAEQJSIARQ0gIAJB0wA2AhwgAiABNgIUIAIgADYCDEEAIQMMswELIAIoAgQhACACQQA2AgQgAiAAIAEQJSIARQ0iIAJB0gA2AhwgAiABNgIUIAIgADYCDEEAIQMMsgELIAIoAgQhACACQQA2AgQgAiAAIAEQJSIARQ0OIAJB5QA2AhwgAiABNgIUIAIgADYCDEEAIQMMsQELIAIoAgQhACACQQA2AgQgAiAAIAEQJSIARQ0dIAJB0wA2AhwgAiABNgIUIAIgADYCDEEAIQMMsAELIAIoAgQhACACQQA2AgQgAiAAIAEQJSIARQ0fIAJB0gA2AhwgAiABNgIUIAIgADYCDEEAIQMMrwELIABBP0cNASABQQFqCyEBQQUhAwyUAQtBACEDIAJBADYCHCACIAE2AhQgAkH9EjYCECACQQc2AgwMrAELIAJBADYCHCACIAE2AhQgAkHcCDYCECACQQc2AgxBACEDDKsBCyACKAIEIQAgAkEANgIEIAIgACABECUiAEUNByACQeUANgIcIAIgATYCFCACIAA2AgxBACEDDKoBCyACKAIEIQAgAkEANgIEIAIgACABECUiAEUNFiACQdMANgIcIAIgATYCFCACIAA2AgxBACEDDKkBCyACKAIEIQAgAkEANgIEIAIgACABECUiAEUNGCACQdIANgIcIAIgATYCFCACIAA2AgxBACEDDKgBCyACQQA2AhwgAiABNgIUIAJBxgo2AhAgAkEHNgIMQQAhAwynAQsgAigCBCEAIAJBADYCBCACIAAgARAlIgBFDQMgAkHlADYCHCACIAE2AhQgAiAANgIMQQAhAwymAQsgAigCBCEAIAJBADYCBCACIAAgARAlIgBFDRIgAkHTADYCHCACIAE2AhQgAiAANgIMQQAhAwylAQsgAigCBCEAIAJBADYCBCACIAAgARAlIgBFDRQgAkHSADYCHCACIAE2AhQgAiAANgIMQQAhAwykAQsgAigCBCEAIAJBADYCBCACIAAgARAlIgBFDQAgAkHlADYCHCACIAE2AhQgAiAANgIMQQAhAwyjAQtB1QAhAwyJAQsgAEEVRwRAIAJBADYCHCACIAE2AhQgAkG5DTYCECACQRo2AgxBACEDDKIBCyACQeQANgIcIAIgATYCFCACQeMXNgIQIAJBFTYCDEEAIQMMoQELIAJBADYCACAGQQFqIQEgAi0AKSIAQSNrQQtJDQQCQCAAQQZLDQBBASAAdEHKAHFFDQAMBQtBACEDIAJBADYCHCACIAE2AhQgAkH3CTYCECACQQg2AgwMoAELIAJBADYCACAGQQFqIQEgAi0AKUEhRg0DIAJBADYCHCACIAE2AhQgAkGbCjYCECACQQg2AgxBACEDDJ8BCyACQQA2AgALQQAhAyACQQA2AhwgAiABNgIUIAJBkDM2AhAgAkEINgIMDJ0BCyACQQA2AgAgBkEBaiEBIAItAClBI0kNACACQQA2AhwgAiABNgIUIAJB0wk2AhAgAkEINgIMQQAhAwycAQtB0QAhAwyCAQsgAS0AAEEwayIAQf8BcUEKSQRAIAIgADoAKiABQQFqIQFBzwAhAwyCAQsgAigCBCEAIAJBADYCBCACIAAgARAoIgBFDYYBIAJB3gA2AhwgAiABNgIUIAIgADYCDEEAIQMMmgELIAIoAgQhACACQQA2AgQgAiAAIAEQKCIARQ2GASACQdwANgIcIAIgATYCFCACIAA2AgxBACEDDJkBCyACKAIEIQAgAkEANgIEIAIgACAFECgiAEUEQCAFIQEMhwELIAJB2gA2AhwgAiAFNgIUIAIgADYCDAyYAQtBACEBQQEhAwsgAiADOgArIAVBAWohAwJAAkACQCACLQAtQRBxDQACQAJAAkAgAi0AKg4DAQACBAsgBkUNAwwCCyAADQEMAgsgAUUNAQsgAigCBCEAIAJBADYCBCACIAAgAxAoIgBFBEAgAyEBDAILIAJB2AA2AhwgAiADNgIUIAIgADYCDEEAIQMMmAELIAIoAgQhACACQQA2AgQgAiAAIAMQKCIARQRAIAMhAQyHAQsgAkHZADYCHCACIAM2AhQgAiAANgIMQQAhAwyXAQtBzAAhAwx9CyAAQRVHBEAgAkEANgIcIAIgATYCFCACQZQNNgIQIAJBITYCDEEAIQMMlgELIAJB1wA2AhwgAiABNgIUIAJByRc2AhAgAkEVNgIMQQAhAwyVAQtBACEDIAJBADYCHCACIAE2AhQgAkGAETYCECACQQk2AgwMlAELIAIoAgQhACACQQA2AgQgAiAAIAEQJSIARQ0AIAJB0wA2AhwgAiABNgIUIAIgADYCDEEAIQMMkwELQckAIQMMeQsgAkEANgIcIAIgATYCFCACQcEoNgIQIAJBBzYCDCACQQA2AgBBACEDDJEBCyACKAIEIQBBACEDIAJBADYCBCACIAAgARAlIgBFDQAgAkHSADYCHCACIAE2AhQgAiAANgIMDJABC0HIACEDDHYLIAJBADYCACAFIQELIAJBgBI7ASogAUEBaiEBQQAhAAJAIAIoAjgiA0UNACADKAIwIgNFDQAgAiADEQAAIQALIAANAQtBxwAhAwxzCyAAQRVGBEAgAkHRADYCHCACIAE2AhQgAkHjFzYCECACQRU2AgxBACEDDIwBC0EAIQMgAkEANgIcIAIgATYCFCACQbkNNgIQIAJBGjYCDAyLAQtBACEDIAJBADYCHCACIAE2AhQgAkGgGTYCECACQR42AgwMigELIAEtAABBOkYEQCACKAIEIQBBACEDIAJBADYCBCACIAAgARApIgBFDQEgAkHDADYCHCACIAA2AgwgAiABQQFqNgIUDIoBC0EAIQMgAkEANgIcIAIgATYCFCACQbERNgIQIAJBCjYCDAyJAQsgAUEBaiEBQTshAwxvCyACQcMANgIcIAIgADYCDCACIAFBAWo2AhQMhwELQQAhAyACQQA2AhwgAiABNgIUIAJB8A42AhAgAkEcNgIMDIYBCyACIAIvATBBEHI7ATAMZgsCQCACLwEwIgBBCHFFDQAgAi0AKEEBRw0AIAItAC1BCHFFDQMLIAIgAEH3+wNxQYAEcjsBMAwECyABIARHBEACQANAIAEtAABBMGsiAEH/AXFBCk8EQEE1IQMMbgsgAikDICIKQpmz5syZs+bMGVYNASACIApCCn4iCjcDICAKIACtQv8BgyILQn+FVg0BIAIgCiALfDcDICAEIAFBAWoiAUcNAAtBOSEDDIUBCyACKAIEIQBBACEDIAJBADYCBCACIAAgAUEBaiIBECoiAA0MDHcLQTkhAwyDAQsgAi0AMEEgcQ0GQcUBIQMMaQtBACEDIAJBADYCBCACIAEgARAqIgBFDQQgAkE6NgIcIAIgADYCDCACIAFBAWo2AhQMgQELIAItAChBAUcNACACLQAtQQhxRQ0BC0E3IQMMZgsgAigCBCEAQQAhAyACQQA2AgQgAiAAIAEQKiIABEAgAkE7NgIcIAIgADYCDCACIAFBAWo2AhQMfwsgAUEBaiEBDG4LIAJBCDoALAwECyABQQFqIQEMbQtBACEDIAJBADYCHCACIAE2AhQgAkHkEjYCECACQQQ2AgwMewsgAigCBCEAQQAhAyACQQA2AgQgAiAAIAEQKiIARQ1sIAJBNzYCHCACIAE2AhQgAiAANgIMDHoLIAIgAi8BMEEgcjsBMAtBMCEDDF8LIAJBNjYCHCACIAE2AhQgAiAANgIMDHcLIABBLEcNASABQQFqIQBBASEBAkACQAJAAkACQCACLQAsQQVrDgQDAQIEAAsgACEBDAQLQQIhAQwBC0EEIQELIAJBAToALCACIAIvATAgAXI7ATAgACEBDAELIAIgAi8BMEEIcjsBMCAAIQELQTkhAwxcCyACQQA6ACwLQTQhAwxaCyABIARGBEBBLSEDDHMLAkACQANAAkAgAS0AAEEKaw4EAgAAAwALIAQgAUEBaiIBRw0AC0EtIQMMdAsgAigCBCEAQQAhAyACQQA2AgQgAiAAIAEQKiIARQ0CIAJBLDYCHCACIAE2AhQgAiAANgIMDHMLIAIoAgQhAEEAIQMgAkEANgIEIAIgACABECoiAEUEQCABQQFqIQEMAgsgAkEsNgIcIAIgADYCDCACIAFBAWo2AhQMcgsgAS0AAEENRgRAIAIoAgQhAEEAIQMgAkEANgIEIAIgACABECoiAEUEQCABQQFqIQEMAgsgAkEsNgIcIAIgADYCDCACIAFBAWo2AhQMcgsgAi0ALUEBcQRAQcQBIQMMWQsgAigCBCEAQQAhAyACQQA2AgQgAiAAIAEQKiIADQEMZQtBLyEDDFcLIAJBLjYCHCACIAE2AhQgAiAANgIMDG8LQQAhAyACQQA2AhwgAiABNgIUIAJB8BQ2AhAgAkEDNgIMDG4LQQEhAwJAAkACQAJAIAItACxBBWsOBAMBAgAECyACIAIvATBBCHI7ATAMAwtBAiEDDAELQQQhAwsgAkEBOgAsIAIgAi8BMCADcjsBMAtBKiEDDFMLQQAhAyACQQA2AhwgAiABNgIUIAJB4Q82AhAgAkEKNgIMDGsLQQEhAwJAAkACQAJAAkACQCACLQAsQQJrDgcFBAQDAQIABAsgAiACLwEwQQhyOwEwDAMLQQIhAwwBC0EEIQMLIAJBAToALCACIAIvATAgA3I7ATALQSshAwxSC0EAIQMgAkEANgIcIAIgATYCFCACQasSNgIQIAJBCzYCDAxqC0EAIQMgAkEANgIcIAIgATYCFCACQf0NNgIQIAJBHTYCDAxpCyABIARHBEADQCABLQAAQSBHDUggBCABQQFqIgFHDQALQSUhAwxpC0ElIQMMaAsgAi0ALUEBcQRAQcMBIQMMTwsgAigCBCEAQQAhAyACQQA2AgQgAiAAIAEQKSIABEAgAkEmNgIcIAIgADYCDCACIAFBAWo2AhQMaAsgAUEBaiEBDFwLIAFBAWohASACLwEwIgBBgAFxBEBBACEAAkAgAigCOCIDRQ0AIAMoAlQiA0UNACACIAMRAAAhAAsgAEUNBiAAQRVHDR8gAkEFNgIcIAIgATYCFCACQfkXNgIQIAJBFTYCDEEAIQMMZwsCQCAAQaAEcUGgBEcNACACLQAtQQJxDQBBACEDIAJBADYCHCACIAE2AhQgAkGWEzYCECACQQQ2AgwMZwsgAgJ/IAIvATBBFHFBFEYEQEEBIAItAChBAUYNARogAi8BMkHlAEYMAQsgAi0AKUEFRgs6AC5BACEAAkAgAigCOCIDRQ0AIAMoAiQiA0UNACACIAMRAAAhAAsCQAJAAkACQAJAIAAOFgIBAAQEBAQEBAQEBAQEBAQEBAQEBAMECyACQQE6AC4LIAIgAi8BMEHAAHI7ATALQSchAwxPCyACQSM2AhwgAiABNgIUIAJBpRY2AhAgAkEVNgIMQQAhAwxnC0EAIQMgAkEANgIcIAIgATYCFCACQdULNgIQIAJBETYCDAxmC0EAIQACQCACKAI4IgNFDQAgAygCLCIDRQ0AIAIgAxEAACEACyAADQELQQ4hAwxLCyAAQRVGBEAgAkECNgIcIAIgATYCFCACQbAYNgIQIAJBFTYCDEEAIQMMZAtBACEDIAJBADYCHCACIAE2AhQgAkGnDjYCECACQRI2AgwMYwtBACEDIAJBADYCHCACIAE2AhQgAkGqHDYCECACQQ82AgwMYgsgAigCBCEAQQAhAyACQQA2AgQgAiAAIAEgCqdqIgEQKyIARQ0AIAJBBTYCHCACIAE2AhQgAiAANgIMDGELQQ8hAwxHC0EAIQMgAkEANgIcIAIgATYCFCACQc0TNgIQIAJBDDYCDAxfC0IBIQoLIAFBAWohAQJAIAIpAyAiC0L//////////w9YBEAgAiALQgSGIAqENwMgDAELQQAhAyACQQA2AhwgAiABNgIUIAJBrQk2AhAgAkEMNgIMDF4LQSQhAwxEC0EAIQMgAkEANgIcIAIgATYCFCACQc0TNgIQIAJBDDYCDAxcCyACKAIEIQBBACEDIAJBADYCBCACIAAgARAsIgBFBEAgAUEBaiEBDFILIAJBFzYCHCACIAA2AgwgAiABQQFqNgIUDFsLIAIoAgQhAEEAIQMgAkEANgIEAkAgAiAAIAEQLCIARQRAIAFBAWohAQwBCyACQRY2AhwgAiAANgIMIAIgAUEBajYCFAxbC0EfIQMMQQtBACEDIAJBADYCHCACIAE2AhQgAkGaDzYCECACQSI2AgwMWQsgAigCBCEAQQAhAyACQQA2AgQgAiAAIAEQLSIARQRAIAFBAWohAQxQCyACQRQ2AhwgAiAANgIMIAIgAUEBajYCFAxYCyACKAIEIQBBACEDIAJBADYCBAJAIAIgACABEC0iAEUEQCABQQFqIQEMAQsgAkETNgIcIAIgADYCDCACIAFBAWo2AhQMWAtBHiEDDD4LQQAhAyACQQA2AhwgAiABNgIUIAJBxgw2AhAgAkEjNgIMDFYLIAIoAgQhAEEAIQMgAkEANgIEIAIgACABEC0iAEUEQCABQQFqIQEMTgsgAkERNgIcIAIgADYCDCACIAFBAWo2AhQMVQsgAkEQNgIcIAIgATYCFCACIAA2AgwMVAtBACEDIAJBADYCHCACIAE2AhQgAkHGDDYCECACQSM2AgwMUwtBACEDIAJBADYCHCACIAE2AhQgAkHAFTYCECACQQI2AgwMUgsgAigCBCEAQQAhAyACQQA2AgQCQCACIAAgARAtIgBFBEAgAUEBaiEBDAELIAJBDjYCHCACIAA2AgwgAiABQQFqNgIUDFILQRshAww4C0EAIQMgAkEANgIcIAIgATYCFCACQcYMNgIQIAJBIzYCDAxQCyACKAIEIQBBACEDIAJBADYCBAJAIAIgACABECwiAEUEQCABQQFqIQEMAQsgAkENNgIcIAIgADYCDCACIAFBAWo2AhQMUAtBGiEDDDYLQQAhAyACQQA2AhwgAiABNgIUIAJBmg82AhAgAkEiNgIMDE4LIAIoAgQhAEEAIQMgAkEANgIEAkAgAiAAIAEQLCIARQRAIAFBAWohAQwBCyACQQw2AhwgAiAANgIMIAIgAUEBajYCFAxOC0EZIQMMNAtBACEDIAJBADYCHCACIAE2AhQgAkGaDzYCECACQSI2AgwMTAsgAEEVRwRAQQAhAyACQQA2AhwgAiABNgIUIAJBgww2AhAgAkETNgIMDEwLIAJBCjYCHCACIAE2AhQgAkHkFjYCECACQRU2AgxBACEDDEsLIAIoAgQhAEEAIQMgAkEANgIEIAIgACABIAqnaiIBECsiAARAIAJBBzYCHCACIAE2AhQgAiAANgIMDEsLQRMhAwwxCyAAQRVHBEBBACEDIAJBADYCHCACIAE2AhQgAkHaDTYCECACQRQ2AgwMSgsgAkEeNgIcIAIgATYCFCACQfkXNgIQIAJBFTYCDEEAIQMMSQtBACEAAkAgAigCOCIDRQ0AIAMoAiwiA0UNACACIAMRAAAhAAsgAEUNQSAAQRVGBEAgAkEDNgIcIAIgATYCFCACQbAYNgIQIAJBFTYCDEEAIQMMSQtBACEDIAJBADYCHCACIAE2AhQgAkGnDjYCECACQRI2AgwMSAtBACEDIAJBADYCHCACIAE2AhQgAkHaDTYCECACQRQ2AgwMRwtBACEDIAJBADYCHCACIAE2AhQgAkGnDjYCECACQRI2AgwMRgsgAkEAOgAvIAItAC1BBHFFDT8LIAJBADoALyACQQE6ADRBACEDDCsLQQAhAyACQQA2AhwgAkHkETYCECACQQc2AgwgAiABQQFqNgIUDEMLAkADQAJAIAEtAABBCmsOBAACAgACCyAEIAFBAWoiAUcNAAtB3QEhAwxDCwJAAkAgAi0ANEEBRw0AQQAhAAJAIAIoAjgiA0UNACADKAJYIgNFDQAgAiADEQAAIQALIABFDQAgAEEVRw0BIAJB3AE2AhwgAiABNgIUIAJB1RY2AhAgAkEVNgIMQQAhAwxEC0HBASEDDCoLIAJBADYCHCACIAE2AhQgAkHpCzYCECACQR82AgxBACEDDEILAkACQCACLQAoQQFrDgIEAQALQcABIQMMKQtBuQEhAwwoCyACQQI6AC9BACEAAkAgAigCOCIDRQ0AIAMoAgAiA0UNACACIAMRAAAhAAsgAEUEQEHCASEDDCgLIABBFUcEQCACQQA2AhwgAiABNgIUIAJBpAw2AhAgAkEQNgIMQQAhAwxBCyACQdsBNgIcIAIgATYCFCACQfoWNgIQIAJBFTYCDEEAIQMMQAsgASAERgRAQdoBIQMMQAsgAS0AAEHIAEYNASACQQE6ACgLQawBIQMMJQtBvwEhAwwkCyABIARHBEAgAkEQNgIIIAIgATYCBEG+ASEDDCQLQdkBIQMMPAsgASAERgRAQdgBIQMMPAsgAS0AAEHIAEcNBCABQQFqIQFBvQEhAwwiCyABIARGBEBB1wEhAww7CwJAAkAgAS0AAEHFAGsOEAAFBQUFBQUFBQUFBQUFBQEFCyABQQFqIQFBuwEhAwwiCyABQQFqIQFBvAEhAwwhC0HWASEDIAEgBEYNOSACKAIAIgAgBCABa2ohBSABIABrQQJqIQYCQANAIAEtAAAgAEGD0ABqLQAARw0DIABBAkYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAw6CyACKAIEIQAgAkIANwMAIAIgACAGQQFqIgEQJyIARQRAQcYBIQMMIQsgAkHVATYCHCACIAE2AhQgAiAANgIMQQAhAww5C0HUASEDIAEgBEYNOCACKAIAIgAgBCABa2ohBSABIABrQQFqIQYCQANAIAEtAAAgAEGB0ABqLQAARw0CIABBAUYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAw5CyACQYEEOwEoIAIoAgQhACACQgA3AwAgAiAAIAZBAWoiARAnIgANAwwCCyACQQA2AgALQQAhAyACQQA2AhwgAiABNgIUIAJB2Bs2AhAgAkEINgIMDDYLQboBIQMMHAsgAkHTATYCHCACIAE2AhQgAiAANgIMQQAhAww0C0EAIQACQCACKAI4IgNFDQAgAygCOCIDRQ0AIAIgAxEAACEACyAARQ0AIABBFUYNASACQQA2AhwgAiABNgIUIAJBzA42AhAgAkEgNgIMQQAhAwwzC0HkACEDDBkLIAJB+AA2AhwgAiABNgIUIAJByhg2AhAgAkEVNgIMQQAhAwwxC0HSASEDIAQgASIARg0wIAQgAWsgAigCACIBaiEFIAAgAWtBBGohBgJAA0AgAC0AACABQfzPAGotAABHDQEgAUEERg0DIAFBAWohASAEIABBAWoiAEcNAAsgAiAFNgIADDELIAJBADYCHCACIAA2AhQgAkGQMzYCECACQQg2AgwgAkEANgIAQQAhAwwwCyABIARHBEAgAkEONgIIIAIgATYCBEG3ASEDDBcLQdEBIQMMLwsgAkEANgIAIAZBAWohAQtBuAEhAwwUCyABIARGBEBB0AEhAwwtCyABLQAAQTBrIgBB/wFxQQpJBEAgAiAAOgAqIAFBAWohAUG2ASEDDBQLIAIoAgQhACACQQA2AgQgAiAAIAEQKCIARQ0UIAJBzwE2AhwgAiABNgIUIAIgADYCDEEAIQMMLAsgASAERgRAQc4BIQMMLAsCQCABLQAAQS5GBEAgAUEBaiEBDAELIAIoAgQhACACQQA2AgQgAiAAIAEQKCIARQ0VIAJBzQE2AhwgAiABNgIUIAIgADYCDEEAIQMMLAtBtQEhAwwSCyAEIAEiBUYEQEHMASEDDCsLQQAhAEEBIQFBASEGQQAhAwJAAkACQAJAAkACfwJAAkACQAJAAkACQAJAIAUtAABBMGsOCgoJAAECAwQFBggLC0ECDAYLQQMMBQtBBAwEC0EFDAMLQQYMAgtBBwwBC0EICyEDQQAhAUEAIQYMAgtBCSEDQQEhAEEAIQFBACEGDAELQQAhAUEBIQMLIAIgAzoAKyAFQQFqIQMCQAJAIAItAC1BEHENAAJAAkACQCACLQAqDgMBAAIECyAGRQ0DDAILIAANAQwCCyABRQ0BCyACKAIEIQAgAkEANgIEIAIgACADECgiAEUEQCADIQEMAwsgAkHJATYCHCACIAM2AhQgAiAANgIMQQAhAwwtCyACKAIEIQAgAkEANgIEIAIgACADECgiAEUEQCADIQEMGAsgAkHKATYCHCACIAM2AhQgAiAANgIMQQAhAwwsCyACKAIEIQAgAkEANgIEIAIgACAFECgiAEUEQCAFIQEMFgsgAkHLATYCHCACIAU2AhQgAiAANgIMDCsLQbQBIQMMEQtBACEAAkAgAigCOCIDRQ0AIAMoAjwiA0UNACACIAMRAAAhAAsCQCAABEAgAEEVRg0BIAJBADYCHCACIAE2AhQgAkGUDTYCECACQSE2AgxBACEDDCsLQbIBIQMMEQsgAkHIATYCHCACIAE2AhQgAkHJFzYCECACQRU2AgxBACEDDCkLIAJBADYCACAGQQFqIQFB9QAhAwwPCyACLQApQQVGBEBB4wAhAwwPC0HiACEDDA4LIAAhASACQQA2AgALIAJBADoALEEJIQMMDAsgAkEANgIAIAdBAWohAUHAACEDDAsLQQELOgAsIAJBADYCACAGQQFqIQELQSkhAwwIC0E4IQMMBwsCQCABIARHBEADQCABLQAAQYA+ai0AACIAQQFHBEAgAEECRw0DIAFBAWohAQwFCyAEIAFBAWoiAUcNAAtBPiEDDCELQT4hAwwgCwsgAkEAOgAsDAELQQshAwwEC0E6IQMMAwsgAUEBaiEBQS0hAwwCCyACIAE6ACwgAkEANgIAIAZBAWohAUEMIQMMAQsgAkEANgIAIAZBAWohAUEKIQMMAAsAC0EAIQMgAkEANgIcIAIgATYCFCACQc0QNgIQIAJBCTYCDAwXC0EAIQMgAkEANgIcIAIgATYCFCACQekKNgIQIAJBCTYCDAwWC0EAIQMgAkEANgIcIAIgATYCFCACQbcQNgIQIAJBCTYCDAwVC0EAIQMgAkEANgIcIAIgATYCFCACQZwRNgIQIAJBCTYCDAwUC0EAIQMgAkEANgIcIAIgATYCFCACQc0QNgIQIAJBCTYCDAwTC0EAIQMgAkEANgIcIAIgATYCFCACQekKNgIQIAJBCTYCDAwSC0EAIQMgAkEANgIcIAIgATYCFCACQbcQNgIQIAJBCTYCDAwRC0EAIQMgAkEANgIcIAIgATYCFCACQZwRNgIQIAJBCTYCDAwQC0EAIQMgAkEANgIcIAIgATYCFCACQZcVNgIQIAJBDzYCDAwPC0EAIQMgAkEANgIcIAIgATYCFCACQZcVNgIQIAJBDzYCDAwOC0EAIQMgAkEANgIcIAIgATYCFCACQcASNgIQIAJBCzYCDAwNC0EAIQMgAkEANgIcIAIgATYCFCACQZUJNgIQIAJBCzYCDAwMC0EAIQMgAkEANgIcIAIgATYCFCACQeEPNgIQIAJBCjYCDAwLC0EAIQMgAkEANgIcIAIgATYCFCACQfsPNgIQIAJBCjYCDAwKC0EAIQMgAkEANgIcIAIgATYCFCACQfEZNgIQIAJBAjYCDAwJC0EAIQMgAkEANgIcIAIgATYCFCACQcQUNgIQIAJBAjYCDAwIC0EAIQMgAkEANgIcIAIgATYCFCACQfIVNgIQIAJBAjYCDAwHCyACQQI2AhwgAiABNgIUIAJBnBo2AhAgAkEWNgIMQQAhAwwGC0EBIQMMBQtB1AAhAyABIARGDQQgCEEIaiEJIAIoAgAhBQJAAkAgASAERwRAIAVB2MIAaiEHIAQgBWogAWshACAFQX9zQQpqIgUgAWohBgNAIAEtAAAgBy0AAEcEQEECIQcMAwsgBUUEQEEAIQcgBiEBDAMLIAVBAWshBSAHQQFqIQcgBCABQQFqIgFHDQALIAAhBSAEIQELIAlBATYCACACIAU2AgAMAQsgAkEANgIAIAkgBzYCAAsgCSABNgIEIAgoAgwhACAIKAIIDgMBBAIACwALIAJBADYCHCACQbUaNgIQIAJBFzYCDCACIABBAWo2AhRBACEDDAILIAJBADYCHCACIAA2AhQgAkHKGjYCECACQQk2AgxBACEDDAELIAEgBEYEQEEiIQMMAQsgAkEJNgIIIAIgATYCBEEhIQMLIAhBEGokACADRQRAIAIoAgwhAAwBCyACIAM2AhxBACEAIAIoAgQiAUUNACACIAEgBCACKAIIEQEAIgFFDQAgAiAENgIUIAIgATYCDCABIQALIAALvgIBAn8gAEEAOgAAIABB3ABqIgFBAWtBADoAACAAQQA6AAIgAEEAOgABIAFBA2tBADoAACABQQJrQQA6AAAgAEEAOgADIAFBBGtBADoAAEEAIABrQQNxIgEgAGoiAEEANgIAQdwAIAFrQXxxIgIgAGoiAUEEa0EANgIAAkAgAkEJSQ0AIABBADYCCCAAQQA2AgQgAUEIa0EANgIAIAFBDGtBADYCACACQRlJDQAgAEEANgIYIABBADYCFCAAQQA2AhAgAEEANgIMIAFBEGtBADYCACABQRRrQQA2AgAgAUEYa0EANgIAIAFBHGtBADYCACACIABBBHFBGHIiAmsiAUEgSQ0AIAAgAmohAANAIABCADcDGCAAQgA3AxAgAEIANwMIIABCADcDACAAQSBqIQAgAUEgayIBQR9LDQALCwtWAQF/AkAgACgCDA0AAkACQAJAAkAgAC0ALw4DAQADAgsgACgCOCIBRQ0AIAEoAiwiAUUNACAAIAERAAAiAQ0DC0EADwsACyAAQcMWNgIQQQ4hAQsgAQsaACAAKAIMRQRAIABB0Rs2AhAgAEEVNgIMCwsUACAAKAIMQRVGBEAgAEEANgIMCwsUACAAKAIMQRZGBEAgAEEANgIMCwsHACAAKAIMCwcAIAAoAhALCQAgACABNgIQCwcAIAAoAhQLFwAgAEEkTwRAAAsgAEECdEGgM2ooAgALFwAgAEEuTwRAAAsgAEECdEGwNGooAgALvwkBAX9B6yghAQJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAIABB5ABrDvQDY2IAAWFhYWFhYQIDBAVhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhBgcICQoLDA0OD2FhYWFhEGFhYWFhYWFhYWFhEWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYRITFBUWFxgZGhthYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhHB0eHyAhIiMkJSYnKCkqKywtLi8wMTIzNDU2YTc4OTphYWFhYWFhYTthYWE8YWFhYT0+P2FhYWFhYWFhQGFhQWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYUJDREVGR0hJSktMTU5PUFFSU2FhYWFhYWFhVFVWV1hZWlthXF1hYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFeYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhX2BhC0HhJw8LQaQhDwtByywPC0H+MQ8LQcAkDwtBqyQPC0GNKA8LQeImDwtBgDAPC0G5Lw8LQdckDwtB7x8PC0HhHw8LQfofDwtB8iAPC0GoLw8LQa4yDwtBiDAPC0HsJw8LQYIiDwtBjh0PC0HQLg8LQcojDwtBxTIPC0HfHA8LQdIcDwtBxCAPC0HXIA8LQaIfDwtB7S4PC0GrMA8LQdQlDwtBzC4PC0H6Lg8LQfwrDwtB0jAPC0HxHQ8LQbsgDwtB9ysPC0GQMQ8LQdcxDwtBoi0PC0HUJw8LQeArDwtBnywPC0HrMQ8LQdUfDwtByjEPC0HeJQ8LQdQeDwtB9BwPC0GnMg8LQbEdDwtBoB0PC0G5MQ8LQbwwDwtBkiEPC0GzJg8LQeksDwtBrB4PC0HUKw8LQfcmDwtBgCYPC0GwIQ8LQf4eDwtBjSMPC0GJLQ8LQfciDwtBoDEPC0GuHw8LQcYlDwtB6B4PC0GTIg8LQcIvDwtBwx0PC0GLLA8LQeEdDwtBjS8PC0HqIQ8LQbQtDwtB0i8PC0HfMg8LQdIyDwtB8DAPC0GpIg8LQfkjDwtBmR4PC0G1LA8LQZswDwtBkjIPC0G2Kw8LQcIiDwtB+DIPC0GeJQ8LQdAiDwtBuh4PC0GBHg8LAAtB1iEhAQsgAQsWACAAIAAtAC1B/gFxIAFBAEdyOgAtCxkAIAAgAC0ALUH9AXEgAUEAR0EBdHI6AC0LGQAgACAALQAtQfsBcSABQQBHQQJ0cjoALQsZACAAIAAtAC1B9wFxIAFBAEdBA3RyOgAtCz4BAn8CQCAAKAI4IgNFDQAgAygCBCIDRQ0AIAAgASACIAFrIAMRAQAiBEF/Rw0AIABBxhE2AhBBGCEECyAECz4BAn8CQCAAKAI4IgNFDQAgAygCCCIDRQ0AIAAgASACIAFrIAMRAQAiBEF/Rw0AIABB9go2AhBBGCEECyAECz4BAn8CQCAAKAI4IgNFDQAgAygCDCIDRQ0AIAAgASACIAFrIAMRAQAiBEF/Rw0AIABB7Ro2AhBBGCEECyAECz4BAn8CQCAAKAI4IgNFDQAgAygCECIDRQ0AIAAgASACIAFrIAMRAQAiBEF/Rw0AIABBlRA2AhBBGCEECyAECz4BAn8CQCAAKAI4IgNFDQAgAygCFCIDRQ0AIAAgASACIAFrIAMRAQAiBEF/Rw0AIABBqhs2AhBBGCEECyAECz4BAn8CQCAAKAI4IgNFDQAgAygCGCIDRQ0AIAAgASACIAFrIAMRAQAiBEF/Rw0AIABB7RM2AhBBGCEECyAECz4BAn8CQCAAKAI4IgNFDQAgAygCKCIDRQ0AIAAgASACIAFrIAMRAQAiBEF/Rw0AIABB9gg2AhBBGCEECyAECz4BAn8CQCAAKAI4IgNFDQAgAygCHCIDRQ0AIAAgASACIAFrIAMRAQAiBEF/Rw0AIABBwhk2AhBBGCEECyAECz4BAn8CQCAAKAI4IgNFDQAgAygCICIDRQ0AIAAgASACIAFrIAMRAQAiBEF/Rw0AIABBlBQ2AhBBGCEECyAEC1kBAn8CQCAALQAoQQFGDQAgAC8BMiIBQeQAa0HkAEkNACABQcwBRg0AIAFBsAJGDQAgAC8BMCIAQcAAcQ0AQQEhAiAAQYgEcUGABEYNACAAQShxRSECCyACC4wBAQJ/AkACQAJAIAAtACpFDQAgAC0AK0UNACAALwEwIgFBAnFFDQEMAgsgAC8BMCIBQQFxRQ0BC0EBIQIgAC0AKEEBRg0AIAAvATIiAEHkAGtB5ABJDQAgAEHMAUYNACAAQbACRg0AIAFBwABxDQBBACECIAFBiARxQYAERg0AIAFBKHFBAEchAgsgAgtXACAAQRhqQgA3AwAgAEIANwMAIABBOGpCADcDACAAQTBqQgA3AwAgAEEoakIANwMAIABBIGpCADcDACAAQRBqQgA3AwAgAEEIakIANwMAIABB3QE2AhwLBgAgABAyC5otAQt/IwBBEGsiCiQAQaTQACgCACIJRQRAQeTTACgCACIFRQRAQfDTAEJ/NwIAQejTAEKAgISAgIDAADcCAEHk0wAgCkEIakFwcUHYqtWqBXMiBTYCAEH40wBBADYCAEHI0wBBADYCAAtBzNMAQYDUBDYCAEGc0ABBgNQENgIAQbDQACAFNgIAQazQAEF/NgIAQdDTAEGArAM2AgADQCABQcjQAGogAUG80ABqIgI2AgAgAiABQbTQAGoiAzYCACABQcDQAGogAzYCACABQdDQAGogAUHE0ABqIgM2AgAgAyACNgIAIAFB2NAAaiABQczQAGoiAjYCACACIAM2AgAgAUHU0ABqIAI2AgAgAUEgaiIBQYACRw0AC0GM1ARBwasDNgIAQajQAEH00wAoAgA2AgBBmNAAQcCrAzYCAEGk0ABBiNQENgIAQcz/B0E4NgIAQYjUBCEJCwJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAIABB7AFNBEBBjNAAKAIAIgZBECAAQRNqQXBxIABBC0kbIgRBA3YiAHYiAUEDcQRAAkAgAUEBcSAAckEBcyICQQN0IgBBtNAAaiIBIABBvNAAaigCACIAKAIIIgNGBEBBjNAAIAZBfiACd3E2AgAMAQsgASADNgIIIAMgATYCDAsgAEEIaiEBIAAgAkEDdCICQQNyNgIEIAAgAmoiACAAKAIEQQFyNgIEDBELQZTQACgCACIIIARPDQEgAQRAAkBBAiAAdCICQQAgAmtyIAEgAHRxaCIAQQN0IgJBtNAAaiIBIAJBvNAAaigCACICKAIIIgNGBEBBjNAAIAZBfiAAd3EiBjYCAAwBCyABIAM2AgggAyABNgIMCyACIARBA3I2AgQgAEEDdCIAIARrIQUgACACaiAFNgIAIAIgBGoiBCAFQQFyNgIEIAgEQCAIQXhxQbTQAGohAEGg0AAoAgAhAwJ/QQEgCEEDdnQiASAGcUUEQEGM0AAgASAGcjYCACAADAELIAAoAggLIgEgAzYCDCAAIAM2AgggAyAANgIMIAMgATYCCAsgAkEIaiEBQaDQACAENgIAQZTQACAFNgIADBELQZDQACgCACILRQ0BIAtoQQJ0QbzSAGooAgAiACgCBEF4cSAEayEFIAAhAgNAAkAgAigCECIBRQRAIAJBFGooAgAiAUUNAQsgASgCBEF4cSAEayIDIAVJIQIgAyAFIAIbIQUgASAAIAIbIQAgASECDAELCyAAKAIYIQkgACgCDCIDIABHBEBBnNAAKAIAGiADIAAoAggiATYCCCABIAM2AgwMEAsgAEEUaiICKAIAIgFFBEAgACgCECIBRQ0DIABBEGohAgsDQCACIQcgASIDQRRqIgIoAgAiAQ0AIANBEGohAiADKAIQIgENAAsgB0EANgIADA8LQX8hBCAAQb9/Sw0AIABBE2oiAUFwcSEEQZDQACgCACIIRQ0AQQAgBGshBQJAAkACQAJ/QQAgBEGAAkkNABpBHyAEQf///wdLDQAaIARBJiABQQh2ZyIAa3ZBAXEgAEEBdGtBPmoLIgZBAnRBvNIAaigCACICRQRAQQAhAUEAIQMMAQtBACEBIARBGSAGQQF2a0EAIAZBH0cbdCEAQQAhAwNAAkAgAigCBEF4cSAEayIHIAVPDQAgAiEDIAciBQ0AQQAhBSACIQEMAwsgASACQRRqKAIAIgcgByACIABBHXZBBHFqQRBqKAIAIgJGGyABIAcbIQEgAEEBdCEAIAINAAsLIAEgA3JFBEBBACEDQQIgBnQiAEEAIABrciAIcSIARQ0DIABoQQJ0QbzSAGooAgAhAQsgAUUNAQsDQCABKAIEQXhxIARrIgIgBUkhACACIAUgABshBSABIAMgABshAyABKAIQIgAEfyAABSABQRRqKAIACyIBDQALCyADRQ0AIAVBlNAAKAIAIARrTw0AIAMoAhghByADIAMoAgwiAEcEQEGc0AAoAgAaIAAgAygCCCIBNgIIIAEgADYCDAwOCyADQRRqIgIoAgAiAUUEQCADKAIQIgFFDQMgA0EQaiECCwNAIAIhBiABIgBBFGoiAigCACIBDQAgAEEQaiECIAAoAhAiAQ0ACyAGQQA2AgAMDQtBlNAAKAIAIgMgBE8EQEGg0AAoAgAhAQJAIAMgBGsiAkEQTwRAIAEgBGoiACACQQFyNgIEIAEgA2ogAjYCACABIARBA3I2AgQMAQsgASADQQNyNgIEIAEgA2oiACAAKAIEQQFyNgIEQQAhAEEAIQILQZTQACACNgIAQaDQACAANgIAIAFBCGohAQwPC0GY0AAoAgAiAyAESwRAIAQgCWoiACADIARrIgFBAXI2AgRBpNAAIAA2AgBBmNAAIAE2AgAgCSAEQQNyNgIEIAlBCGohAQwPC0EAIQEgBAJ/QeTTACgCAARAQezTACgCAAwBC0Hw0wBCfzcCAEHo0wBCgICEgICAwAA3AgBB5NMAIApBDGpBcHFB2KrVqgVzNgIAQfjTAEEANgIAQcjTAEEANgIAQYCABAsiACAEQccAaiIFaiIGQQAgAGsiB3EiAk8EQEH80wBBMDYCAAwPCwJAQcTTACgCACIBRQ0AQbzTACgCACIIIAJqIQAgACABTSAAIAhLcQ0AQQAhAUH80wBBMDYCAAwPC0HI0wAtAABBBHENBAJAAkAgCQRAQczTACEBA0AgASgCACIAIAlNBEAgACABKAIEaiAJSw0DCyABKAIIIgENAAsLQQAQMyIAQX9GDQUgAiEGQejTACgCACIBQQFrIgMgAHEEQCACIABrIAAgA2pBACABa3FqIQYLIAQgBk8NBSAGQf7///8HSw0FQcTTACgCACIDBEBBvNMAKAIAIgcgBmohASABIAdNDQYgASADSw0GCyAGEDMiASAARw0BDAcLIAYgA2sgB3EiBkH+////B0sNBCAGEDMhACAAIAEoAgAgASgCBGpGDQMgACEBCwJAIAYgBEHIAGpPDQAgAUF/Rg0AQezTACgCACIAIAUgBmtqQQAgAGtxIgBB/v///wdLBEAgASEADAcLIAAQM0F/RwRAIAAgBmohBiABIQAMBwtBACAGaxAzGgwECyABIgBBf0cNBQwDC0EAIQMMDAtBACEADAoLIABBf0cNAgtByNMAQcjTACgCAEEEcjYCAAsgAkH+////B0sNASACEDMhAEEAEDMhASAAQX9GDQEgAUF/Rg0BIAAgAU8NASABIABrIgYgBEE4ak0NAQtBvNMAQbzTACgCACAGaiIBNgIAQcDTACgCACABSQRAQcDTACABNgIACwJAAkACQEGk0AAoAgAiAgRAQczTACEBA0AgACABKAIAIgMgASgCBCIFakYNAiABKAIIIgENAAsMAgtBnNAAKAIAIgFBAEcgACABT3FFBEBBnNAAIAA2AgALQQAhAUHQ0wAgBjYCAEHM0wAgADYCAEGs0ABBfzYCAEGw0ABB5NMAKAIANgIAQdjTAEEANgIAA0AgAUHI0ABqIAFBvNAAaiICNgIAIAIgAUG00ABqIgM2AgAgAUHA0ABqIAM2AgAgAUHQ0ABqIAFBxNAAaiIDNgIAIAMgAjYCACABQdjQAGogAUHM0ABqIgI2AgAgAiADNgIAIAFB1NAAaiACNgIAIAFBIGoiAUGAAkcNAAtBeCAAa0EPcSIBIABqIgIgBkE4ayIDIAFrIgFBAXI2AgRBqNAAQfTTACgCADYCAEGY0AAgATYCAEGk0AAgAjYCACAAIANqQTg2AgQMAgsgACACTQ0AIAIgA0kNACABKAIMQQhxDQBBeCACa0EPcSIAIAJqIgNBmNAAKAIAIAZqIgcgAGsiAEEBcjYCBCABIAUgBmo2AgRBqNAAQfTTACgCADYCAEGY0AAgADYCAEGk0AAgAzYCACACIAdqQTg2AgQMAQsgAEGc0AAoAgBJBEBBnNAAIAA2AgALIAAgBmohA0HM0wAhAQJAAkACQANAIAMgASgCAEcEQCABKAIIIgENAQwCCwsgAS0ADEEIcUUNAQtBzNMAIQEDQCABKAIAIgMgAk0EQCADIAEoAgRqIgUgAksNAwsgASgCCCEBDAALAAsgASAANgIAIAEgASgCBCAGajYCBCAAQXggAGtBD3FqIgkgBEEDcjYCBCADQXggA2tBD3FqIgYgBCAJaiIEayEBIAIgBkYEQEGk0AAgBDYCAEGY0ABBmNAAKAIAIAFqIgA2AgAgBCAAQQFyNgIEDAgLQaDQACgCACAGRgRAQaDQACAENgIAQZTQAEGU0AAoAgAgAWoiADYCACAEIABBAXI2AgQgACAEaiAANgIADAgLIAYoAgQiBUEDcUEBRw0GIAVBeHEhCCAFQf8BTQRAIAVBA3YhAyAGKAIIIgAgBigCDCICRgRAQYzQAEGM0AAoAgBBfiADd3E2AgAMBwsgAiAANgIIIAAgAjYCDAwGCyAGKAIYIQcgBiAGKAIMIgBHBEAgACAGKAIIIgI2AgggAiAANgIMDAULIAZBFGoiAigCACIFRQRAIAYoAhAiBUUNBCAGQRBqIQILA0AgAiEDIAUiAEEUaiICKAIAIgUNACAAQRBqIQIgACgCECIFDQALIANBADYCAAwEC0F4IABrQQ9xIgEgAGoiByAGQThrIgMgAWsiAUEBcjYCBCAAIANqQTg2AgQgAiAFQTcgBWtBD3FqQT9rIgMgAyACQRBqSRsiA0EjNgIEQajQAEH00wAoAgA2AgBBmNAAIAE2AgBBpNAAIAc2AgAgA0EQakHU0wApAgA3AgAgA0HM0wApAgA3AghB1NMAIANBCGo2AgBB0NMAIAY2AgBBzNMAIAA2AgBB2NMAQQA2AgAgA0EkaiEBA0AgAUEHNgIAIAUgAUEEaiIBSw0ACyACIANGDQAgAyADKAIEQX5xNgIEIAMgAyACayIFNgIAIAIgBUEBcjYCBCAFQf8BTQRAIAVBeHFBtNAAaiEAAn9BjNAAKAIAIgFBASAFQQN2dCIDcUUEQEGM0AAgASADcjYCACAADAELIAAoAggLIgEgAjYCDCAAIAI2AgggAiAANgIMIAIgATYCCAwBC0EfIQEgBUH///8HTQRAIAVBJiAFQQh2ZyIAa3ZBAXEgAEEBdGtBPmohAQsgAiABNgIcIAJCADcCECABQQJ0QbzSAGohAEGQ0AAoAgAiA0EBIAF0IgZxRQRAIAAgAjYCAEGQ0AAgAyAGcjYCACACIAA2AhggAiACNgIIIAIgAjYCDAwBCyAFQRkgAUEBdmtBACABQR9HG3QhASAAKAIAIQMCQANAIAMiACgCBEF4cSAFRg0BIAFBHXYhAyABQQF0IQEgACADQQRxakEQaiIGKAIAIgMNAAsgBiACNgIAIAIgADYCGCACIAI2AgwgAiACNgIIDAELIAAoAggiASACNgIMIAAgAjYCCCACQQA2AhggAiAANgIMIAIgATYCCAtBmNAAKAIAIgEgBE0NAEGk0AAoAgAiACAEaiICIAEgBGsiAUEBcjYCBEGY0AAgATYCAEGk0AAgAjYCACAAIARBA3I2AgQgAEEIaiEBDAgLQQAhAUH80wBBMDYCAAwHC0EAIQALIAdFDQACQCAGKAIcIgJBAnRBvNIAaiIDKAIAIAZGBEAgAyAANgIAIAANAUGQ0ABBkNAAKAIAQX4gAndxNgIADAILIAdBEEEUIAcoAhAgBkYbaiAANgIAIABFDQELIAAgBzYCGCAGKAIQIgIEQCAAIAI2AhAgAiAANgIYCyAGQRRqKAIAIgJFDQAgAEEUaiACNgIAIAIgADYCGAsgASAIaiEBIAYgCGoiBigCBCEFCyAGIAVBfnE2AgQgASAEaiABNgIAIAQgAUEBcjYCBCABQf8BTQRAIAFBeHFBtNAAaiEAAn9BjNAAKAIAIgJBASABQQN2dCIBcUUEQEGM0AAgASACcjYCACAADAELIAAoAggLIgEgBDYCDCAAIAQ2AgggBCAANgIMIAQgATYCCAwBC0EfIQUgAUH///8HTQRAIAFBJiABQQh2ZyIAa3ZBAXEgAEEBdGtBPmohBQsgBCAFNgIcIARCADcCECAFQQJ0QbzSAGohAEGQ0AAoAgAiAkEBIAV0IgNxRQRAIAAgBDYCAEGQ0AAgAiADcjYCACAEIAA2AhggBCAENgIIIAQgBDYCDAwBCyABQRkgBUEBdmtBACAFQR9HG3QhBSAAKAIAIQACQANAIAAiAigCBEF4cSABRg0BIAVBHXYhACAFQQF0IQUgAiAAQQRxakEQaiIDKAIAIgANAAsgAyAENgIAIAQgAjYCGCAEIAQ2AgwgBCAENgIIDAELIAIoAggiACAENgIMIAIgBDYCCCAEQQA2AhggBCACNgIMIAQgADYCCAsgCUEIaiEBDAILAkAgB0UNAAJAIAMoAhwiAUECdEG80gBqIgIoAgAgA0YEQCACIAA2AgAgAA0BQZDQACAIQX4gAXdxIgg2AgAMAgsgB0EQQRQgBygCECADRhtqIAA2AgAgAEUNAQsgACAHNgIYIAMoAhAiAQRAIAAgATYCECABIAA2AhgLIANBFGooAgAiAUUNACAAQRRqIAE2AgAgASAANgIYCwJAIAVBD00EQCADIAQgBWoiAEEDcjYCBCAAIANqIgAgACgCBEEBcjYCBAwBCyADIARqIgIgBUEBcjYCBCADIARBA3I2AgQgAiAFaiAFNgIAIAVB/wFNBEAgBUF4cUG00ABqIQACf0GM0AAoAgAiAUEBIAVBA3Z0IgVxRQRAQYzQACABIAVyNgIAIAAMAQsgACgCCAsiASACNgIMIAAgAjYCCCACIAA2AgwgAiABNgIIDAELQR8hASAFQf///wdNBEAgBUEmIAVBCHZnIgBrdkEBcSAAQQF0a0E+aiEBCyACIAE2AhwgAkIANwIQIAFBAnRBvNIAaiEAQQEgAXQiBCAIcUUEQCAAIAI2AgBBkNAAIAQgCHI2AgAgAiAANgIYIAIgAjYCCCACIAI2AgwMAQsgBUEZIAFBAXZrQQAgAUEfRxt0IQEgACgCACEEAkADQCAEIgAoAgRBeHEgBUYNASABQR12IQQgAUEBdCEBIAAgBEEEcWpBEGoiBigCACIEDQALIAYgAjYCACACIAA2AhggAiACNgIMIAIgAjYCCAwBCyAAKAIIIgEgAjYCDCAAIAI2AgggAkEANgIYIAIgADYCDCACIAE2AggLIANBCGohAQwBCwJAIAlFDQACQCAAKAIcIgFBAnRBvNIAaiICKAIAIABGBEAgAiADNgIAIAMNAUGQ0AAgC0F+IAF3cTYCAAwCCyAJQRBBFCAJKAIQIABGG2ogAzYCACADRQ0BCyADIAk2AhggACgCECIBBEAgAyABNgIQIAEgAzYCGAsgAEEUaigCACIBRQ0AIANBFGogATYCACABIAM2AhgLAkAgBUEPTQRAIAAgBCAFaiIBQQNyNgIEIAAgAWoiASABKAIEQQFyNgIEDAELIAAgBGoiByAFQQFyNgIEIAAgBEEDcjYCBCAFIAdqIAU2AgAgCARAIAhBeHFBtNAAaiEBQaDQACgCACEDAn9BASAIQQN2dCICIAZxRQRAQYzQACACIAZyNgIAIAEMAQsgASgCCAsiAiADNgIMIAEgAzYCCCADIAE2AgwgAyACNgIIC0Gg0AAgBzYCAEGU0AAgBTYCAAsgAEEIaiEBCyAKQRBqJAAgAQtDACAARQRAPwBBEHQPCwJAIABB//8DcQ0AIABBAEgNACAAQRB2QAAiAEF/RgRAQfzTAEEwNgIAQX8PCyAAQRB0DwsACwvcPyIAQYAICwkBAAAAAgAAAAMAQZQICwUEAAAABQBBpAgLCQYAAAAHAAAACABB3AgLii1JbnZhbGlkIGNoYXIgaW4gdXJsIHF1ZXJ5AFNwYW4gY2FsbGJhY2sgZXJyb3IgaW4gb25fYm9keQBDb250ZW50LUxlbmd0aCBvdmVyZmxvdwBDaHVuayBzaXplIG92ZXJmbG93AFJlc3BvbnNlIG92ZXJmbG93AEludmFsaWQgbWV0aG9kIGZvciBIVFRQL3gueCByZXF1ZXN0AEludmFsaWQgbWV0aG9kIGZvciBSVFNQL3gueCByZXF1ZXN0AEV4cGVjdGVkIFNPVVJDRSBtZXRob2QgZm9yIElDRS94LnggcmVxdWVzdABJbnZhbGlkIGNoYXIgaW4gdXJsIGZyYWdtZW50IHN0YXJ0AEV4cGVjdGVkIGRvdABTcGFuIGNhbGxiYWNrIGVycm9yIGluIG9uX3N0YXR1cwBJbnZhbGlkIHJlc3BvbnNlIHN0YXR1cwBJbnZhbGlkIGNoYXJhY3RlciBpbiBjaHVuayBleHRlbnNpb25zAFVzZXIgY2FsbGJhY2sgZXJyb3IAYG9uX3Jlc2V0YCBjYWxsYmFjayBlcnJvcgBgb25fY2h1bmtfaGVhZGVyYCBjYWxsYmFjayBlcnJvcgBgb25fbWVzc2FnZV9iZWdpbmAgY2FsbGJhY2sgZXJyb3IAYG9uX2NodW5rX2V4dGVuc2lvbl92YWx1ZWAgY2FsbGJhY2sgZXJyb3IAYG9uX3N0YXR1c19jb21wbGV0ZWAgY2FsbGJhY2sgZXJyb3IAYG9uX3ZlcnNpb25fY29tcGxldGVgIGNhbGxiYWNrIGVycm9yAGBvbl91cmxfY29tcGxldGVgIGNhbGxiYWNrIGVycm9yAGBvbl9jaHVua19jb21wbGV0ZWAgY2FsbGJhY2sgZXJyb3IAYG9uX2hlYWRlcl92YWx1ZV9jb21wbGV0ZWAgY2FsbGJhY2sgZXJyb3IAYG9uX21lc3NhZ2VfY29tcGxldGVgIGNhbGxiYWNrIGVycm9yAGBvbl9tZXRob2RfY29tcGxldGVgIGNhbGxiYWNrIGVycm9yAGBvbl9oZWFkZXJfZmllbGRfY29tcGxldGVgIGNhbGxiYWNrIGVycm9yAGBvbl9jaHVua19leHRlbnNpb25fbmFtZWAgY2FsbGJhY2sgZXJyb3IAVW5leHBlY3RlZCBjaGFyIGluIHVybCBzZXJ2ZXIASW52YWxpZCBoZWFkZXIgdmFsdWUgY2hhcgBJbnZhbGlkIGhlYWRlciBmaWVsZCBjaGFyAFNwYW4gY2FsbGJhY2sgZXJyb3IgaW4gb25fdmVyc2lvbgBJbnZhbGlkIG1pbm9yIHZlcnNpb24ASW52YWxpZCBtYWpvciB2ZXJzaW9uAEV4cGVjdGVkIHNwYWNlIGFmdGVyIHZlcnNpb24ARXhwZWN0ZWQgQ1JMRiBhZnRlciB2ZXJzaW9uAEludmFsaWQgSFRUUCB2ZXJzaW9uAEludmFsaWQgaGVhZGVyIHRva2VuAFNwYW4gY2FsbGJhY2sgZXJyb3IgaW4gb25fdXJsAEludmFsaWQgY2hhcmFjdGVycyBpbiB1cmwAVW5leHBlY3RlZCBzdGFydCBjaGFyIGluIHVybABEb3VibGUgQCBpbiB1cmwARW1wdHkgQ29udGVudC1MZW5ndGgASW52YWxpZCBjaGFyYWN0ZXIgaW4gQ29udGVudC1MZW5ndGgARHVwbGljYXRlIENvbnRlbnQtTGVuZ3RoAEludmFsaWQgY2hhciBpbiB1cmwgcGF0aABDb250ZW50LUxlbmd0aCBjYW4ndCBiZSBwcmVzZW50IHdpdGggVHJhbnNmZXItRW5jb2RpbmcASW52YWxpZCBjaGFyYWN0ZXIgaW4gY2h1bmsgc2l6ZQBTcGFuIGNhbGxiYWNrIGVycm9yIGluIG9uX2hlYWRlcl92YWx1ZQBTcGFuIGNhbGxiYWNrIGVycm9yIGluIG9uX2NodW5rX2V4dGVuc2lvbl92YWx1ZQBJbnZhbGlkIGNoYXJhY3RlciBpbiBjaHVuayBleHRlbnNpb25zIHZhbHVlAE1pc3NpbmcgZXhwZWN0ZWQgTEYgYWZ0ZXIgaGVhZGVyIHZhbHVlAEludmFsaWQgYFRyYW5zZmVyLUVuY29kaW5nYCBoZWFkZXIgdmFsdWUASW52YWxpZCBjaGFyYWN0ZXIgaW4gY2h1bmsgZXh0ZW5zaW9ucyBxdW90ZSB2YWx1ZQBJbnZhbGlkIGNoYXJhY3RlciBpbiBjaHVuayBleHRlbnNpb25zIHF1b3RlZCB2YWx1ZQBQYXVzZWQgYnkgb25faGVhZGVyc19jb21wbGV0ZQBJbnZhbGlkIEVPRiBzdGF0ZQBvbl9yZXNldCBwYXVzZQBvbl9jaHVua19oZWFkZXIgcGF1c2UAb25fbWVzc2FnZV9iZWdpbiBwYXVzZQBvbl9jaHVua19leHRlbnNpb25fdmFsdWUgcGF1c2UAb25fc3RhdHVzX2NvbXBsZXRlIHBhdXNlAG9uX3ZlcnNpb25fY29tcGxldGUgcGF1c2UAb25fdXJsX2NvbXBsZXRlIHBhdXNlAG9uX2NodW5rX2NvbXBsZXRlIHBhdXNlAG9uX2hlYWRlcl92YWx1ZV9jb21wbGV0ZSBwYXVzZQBvbl9tZXNzYWdlX2NvbXBsZXRlIHBhdXNlAG9uX21ldGhvZF9jb21wbGV0ZSBwYXVzZQBvbl9oZWFkZXJfZmllbGRfY29tcGxldGUgcGF1c2UAb25fY2h1bmtfZXh0ZW5zaW9uX25hbWUgcGF1c2UAVW5leHBlY3RlZCBzcGFjZSBhZnRlciBzdGFydCBsaW5lAFNwYW4gY2FsbGJhY2sgZXJyb3IgaW4gb25fY2h1bmtfZXh0ZW5zaW9uX25hbWUASW52YWxpZCBjaGFyYWN0ZXIgaW4gY2h1bmsgZXh0ZW5zaW9ucyBuYW1lAFBhdXNlIG9uIENPTk5FQ1QvVXBncmFkZQBQYXVzZSBvbiBQUkkvVXBncmFkZQBFeHBlY3RlZCBIVFRQLzIgQ29ubmVjdGlvbiBQcmVmYWNlAFNwYW4gY2FsbGJhY2sgZXJyb3IgaW4gb25fbWV0aG9kAEV4cGVjdGVkIHNwYWNlIGFmdGVyIG1ldGhvZABTcGFuIGNhbGxiYWNrIGVycm9yIGluIG9uX2hlYWRlcl9maWVsZABQYXVzZWQASW52YWxpZCB3b3JkIGVuY291bnRlcmVkAEludmFsaWQgbWV0aG9kIGVuY291bnRlcmVkAFVuZXhwZWN0ZWQgY2hhciBpbiB1cmwgc2NoZW1hAFJlcXVlc3QgaGFzIGludmFsaWQgYFRyYW5zZmVyLUVuY29kaW5nYABTV0lUQ0hfUFJPWFkAVVNFX1BST1hZAE1LQUNUSVZJVFkAVU5QUk9DRVNTQUJMRV9FTlRJVFkAQ09QWQBNT1ZFRF9QRVJNQU5FTlRMWQBUT09fRUFSTFkATk9USUZZAEZBSUxFRF9ERVBFTkRFTkNZAEJBRF9HQVRFV0FZAFBMQVkAUFVUAENIRUNLT1VUAEdBVEVXQVlfVElNRU9VVABSRVFVRVNUX1RJTUVPVVQATkVUV09SS19DT05ORUNUX1RJTUVPVVQAQ09OTkVDVElPTl9USU1FT1VUAExPR0lOX1RJTUVPVVQATkVUV09SS19SRUFEX1RJTUVPVVQAUE9TVABNSVNESVJFQ1RFRF9SRVFVRVNUAENMSUVOVF9DTE9TRURfUkVRVUVTVABDTElFTlRfQ0xPU0VEX0xPQURfQkFMQU5DRURfUkVRVUVTVABCQURfUkVRVUVTVABIVFRQX1JFUVVFU1RfU0VOVF9UT19IVFRQU19QT1JUAFJFUE9SVABJTV9BX1RFQVBPVABSRVNFVF9DT05URU5UAE5PX0NPTlRFTlQAUEFSVElBTF9DT05URU5UAEhQRV9JTlZBTElEX0NPTlNUQU5UAEhQRV9DQl9SRVNFVABHRVQASFBFX1NUUklDVABDT05GTElDVABURU1QT1JBUllfUkVESVJFQ1QAUEVSTUFORU5UX1JFRElSRUNUAENPTk5FQ1QATVVMVElfU1RBVFVTAEhQRV9JTlZBTElEX1NUQVRVUwBUT09fTUFOWV9SRVFVRVNUUwBFQVJMWV9ISU5UUwBVTkFWQUlMQUJMRV9GT1JfTEVHQUxfUkVBU09OUwBPUFRJT05TAFNXSVRDSElOR19QUk9UT0NPTFMAVkFSSUFOVF9BTFNPX05FR09USUFURVMATVVMVElQTEVfQ0hPSUNFUwBJTlRFUk5BTF9TRVJWRVJfRVJST1IAV0VCX1NFUlZFUl9VTktOT1dOX0VSUk9SAFJBSUxHVU5fRVJST1IASURFTlRJVFlfUFJPVklERVJfQVVUSEVOVElDQVRJT05fRVJST1IAU1NMX0NFUlRJRklDQVRFX0VSUk9SAElOVkFMSURfWF9GT1JXQVJERURfRk9SAFNFVF9QQVJBTUVURVIAR0VUX1BBUkFNRVRFUgBIUEVfVVNFUgBTRUVfT1RIRVIASFBFX0NCX0NIVU5LX0hFQURFUgBNS0NBTEVOREFSAFNFVFVQAFdFQl9TRVJWRVJfSVNfRE9XTgBURUFSRE9XTgBIUEVfQ0xPU0VEX0NPTk5FQ1RJT04ASEVVUklTVElDX0VYUElSQVRJT04ARElTQ09OTkVDVEVEX09QRVJBVElPTgBOT05fQVVUSE9SSVRBVElWRV9JTkZPUk1BVElPTgBIUEVfSU5WQUxJRF9WRVJTSU9OAEhQRV9DQl9NRVNTQUdFX0JFR0lOAFNJVEVfSVNfRlJPWkVOAEhQRV9JTlZBTElEX0hFQURFUl9UT0tFTgBJTlZBTElEX1RPS0VOAEZPUkJJRERFTgBFTkhBTkNFX1lPVVJfQ0FMTQBIUEVfSU5WQUxJRF9VUkwAQkxPQ0tFRF9CWV9QQVJFTlRBTF9DT05UUk9MAE1LQ09MAEFDTABIUEVfSU5URVJOQUwAUkVRVUVTVF9IRUFERVJfRklFTERTX1RPT19MQVJHRV9VTk9GRklDSUFMAEhQRV9PSwBVTkxJTksAVU5MT0NLAFBSSQBSRVRSWV9XSVRIAEhQRV9JTlZBTElEX0NPTlRFTlRfTEVOR1RIAEhQRV9VTkVYUEVDVEVEX0NPTlRFTlRfTEVOR1RIAEZMVVNIAFBST1BQQVRDSABNLVNFQVJDSABVUklfVE9PX0xPTkcAUFJPQ0VTU0lORwBNSVNDRUxMQU5FT1VTX1BFUlNJU1RFTlRfV0FSTklORwBNSVNDRUxMQU5FT1VTX1dBUk5JTkcASFBFX0lOVkFMSURfVFJBTlNGRVJfRU5DT0RJTkcARXhwZWN0ZWQgQ1JMRgBIUEVfSU5WQUxJRF9DSFVOS19TSVpFAE1PVkUAQ09OVElOVUUASFBFX0NCX1NUQVRVU19DT01QTEVURQBIUEVfQ0JfSEVBREVSU19DT01QTEVURQBIUEVfQ0JfVkVSU0lPTl9DT01QTEVURQBIUEVfQ0JfVVJMX0NPTVBMRVRFAEhQRV9DQl9DSFVOS19DT01QTEVURQBIUEVfQ0JfSEVBREVSX1ZBTFVFX0NPTVBMRVRFAEhQRV9DQl9DSFVOS19FWFRFTlNJT05fVkFMVUVfQ09NUExFVEUASFBFX0NCX0NIVU5LX0VYVEVOU0lPTl9OQU1FX0NPTVBMRVRFAEhQRV9DQl9NRVNTQUdFX0NPTVBMRVRFAEhQRV9DQl9NRVRIT0RfQ09NUExFVEUASFBFX0NCX0hFQURFUl9GSUVMRF9DT01QTEVURQBERUxFVEUASFBFX0lOVkFMSURfRU9GX1NUQVRFAElOVkFMSURfU1NMX0NFUlRJRklDQVRFAFBBVVNFAE5PX1JFU1BPTlNFAFVOU1VQUE9SVEVEX01FRElBX1RZUEUAR09ORQBOT1RfQUNDRVBUQUJMRQBTRVJWSUNFX1VOQVZBSUxBQkxFAFJBTkdFX05PVF9TQVRJU0ZJQUJMRQBPUklHSU5fSVNfVU5SRUFDSEFCTEUAUkVTUE9OU0VfSVNfU1RBTEUAUFVSR0UATUVSR0UAUkVRVUVTVF9IRUFERVJfRklFTERTX1RPT19MQVJHRQBSRVFVRVNUX0hFQURFUl9UT09fTEFSR0UAUEFZTE9BRF9UT09fTEFSR0UASU5TVUZGSUNJRU5UX1NUT1JBR0UASFBFX1BBVVNFRF9VUEdSQURFAEhQRV9QQVVTRURfSDJfVVBHUkFERQBTT1VSQ0UAQU5OT1VOQ0UAVFJBQ0UASFBFX1VORVhQRUNURURfU1BBQ0UAREVTQ1JJQkUAVU5TVUJTQ1JJQkUAUkVDT1JEAEhQRV9JTlZBTElEX01FVEhPRABOT1RfRk9VTkQAUFJPUEZJTkQAVU5CSU5EAFJFQklORABVTkFVVEhPUklaRUQATUVUSE9EX05PVF9BTExPV0VEAEhUVFBfVkVSU0lPTl9OT1RfU1VQUE9SVEVEAEFMUkVBRFlfUkVQT1JURUQAQUNDRVBURUQATk9UX0lNUExFTUVOVEVEAExPT1BfREVURUNURUQASFBFX0NSX0VYUEVDVEVEAEhQRV9MRl9FWFBFQ1RFRABDUkVBVEVEAElNX1VTRUQASFBFX1BBVVNFRABUSU1FT1VUX09DQ1VSRUQAUEFZTUVOVF9SRVFVSVJFRABQUkVDT05ESVRJT05fUkVRVUlSRUQAUFJPWFlfQVVUSEVOVElDQVRJT05fUkVRVUlSRUQATkVUV09SS19BVVRIRU5USUNBVElPTl9SRVFVSVJFRABMRU5HVEhfUkVRVUlSRUQAU1NMX0NFUlRJRklDQVRFX1JFUVVJUkVEAFVQR1JBREVfUkVRVUlSRUQAUEFHRV9FWFBJUkVEAFBSRUNPTkRJVElPTl9GQUlMRUQARVhQRUNUQVRJT05fRkFJTEVEAFJFVkFMSURBVElPTl9GQUlMRUQAU1NMX0hBTkRTSEFLRV9GQUlMRUQATE9DS0VEAFRSQU5TRk9STUFUSU9OX0FQUExJRUQATk9UX01PRElGSUVEAE5PVF9FWFRFTkRFRABCQU5EV0lEVEhfTElNSVRfRVhDRUVERUQAU0lURV9JU19PVkVSTE9BREVEAEhFQUQARXhwZWN0ZWQgSFRUUC8AAF4TAAAmEwAAMBAAAPAXAACdEwAAFRIAADkXAADwEgAAChAAAHUSAACtEgAAghMAAE8UAAB/EAAAoBUAACMUAACJEgAAixQAAE0VAADUEQAAzxQAABAYAADJFgAA3BYAAMERAADgFwAAuxQAAHQUAAB8FQAA5RQAAAgXAAAfEAAAZRUAAKMUAAAoFQAAAhUAAJkVAAAsEAAAixkAAE8PAADUDgAAahAAAM4QAAACFwAAiQ4AAG4TAAAcEwAAZhQAAFYXAADBEwAAzRMAAGwTAABoFwAAZhcAAF8XAAAiEwAAzg8AAGkOAADYDgAAYxYAAMsTAACqDgAAKBcAACYXAADFEwAAXRYAAOgRAABnEwAAZRMAAPIWAABzEwAAHRcAAPkWAADzEQAAzw4AAM4VAAAMEgAAsxEAAKURAABhEAAAMhcAALsTAEH5NQsBAQBBkDYL4AEBAQIBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEAAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQBB/TcLAQEAQZE4C14CAwICAgICAAACAgACAgACAgICAgICAgICAAQAAAAAAAICAgICAgICAgICAgICAgICAgICAgICAgICAAAAAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAAgACAEH9OQsBAQBBkToLXgIAAgICAgIAAAICAAICAAICAgICAgICAgIAAwAEAAAAAgICAgICAgICAgICAgICAgICAgICAgICAgIAAAACAgICAgICAgICAgICAgICAgICAgICAgICAgICAgACAAIAQfA7Cw1sb3NlZWVwLWFsaXZlAEGJPAsBAQBBoDwL4AEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQABAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQBBiT4LAQEAQaA+C+cBAQEBAQEBAQEBAQEBAgEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEAAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQFjaHVua2VkAEGwwAALXwEBAAEBAQEBAAABAQABAQABAQEBAQEBAQEBAAAAAAAAAAEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAAAAAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEAAQABAEGQwgALIWVjdGlvbmVudC1sZW5ndGhvbnJveHktY29ubmVjdGlvbgBBwMIACy1yYW5zZmVyLWVuY29kaW5ncGdyYWRlDQoNCg0KU00NCg0KVFRQL0NFL1RTUC8AQfnCAAsFAQIAAQMAQZDDAAvgAQQBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAAEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAEH5xAALBQECAAEDAEGQxQAL4AEEAQEFAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQABAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQBB+cYACwQBAAABAEGRxwAL3wEBAQABAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEAAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAAEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAEH6yAALBAEAAAIAQZDJAAtfAwQAAAQEBAQEBAQEBAQEBQQEBAQEBAQEBAQEBAAEAAYHBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEAAQABAAEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAAAAAQAQfrKAAsEAQAAAQBBkMsACwEBAEGqywALQQIAAAAAAAADAwMDAwMDAwMDAwMDAwMDAwMDAwMDAwMDAwAAAAAAAAMDAwMDAwMDAwMDAwMDAwMDAwMDAwMDAwMDAEH6zAALBAEAAAEAQZDNAAsBAQBBms0ACwYCAAAAAAIAQbHNAAs6AwMDAwMDAwMDAwMDAwMDAwMDAwMDAwMDAwMAAAAAAAADAwMDAwMDAwMDAwMDAwMDAwMDAwMDAwMDAwBB8M4AC5YBTk9VTkNFRUNLT1VUTkVDVEVURUNSSUJFTFVTSEVURUFEU0VBUkNIUkdFQ1RJVklUWUxFTkRBUlZFT1RJRllQVElPTlNDSFNFQVlTVEFUQ0hHRU9SRElSRUNUT1JUUkNIUEFSQU1FVEVSVVJDRUJTQ1JJQkVBUkRPV05BQ0VJTkROS0NLVUJTQ1JJQkVIVFRQL0FEVFAv", "base64"); +// node_modules/@smithy/core/dist-es/middleware-http-signing/getHttpSigningMiddleware.js +var import_middleware_retry, httpSigningMiddlewareOptions, getHttpSigningPlugin; +var init_getHttpSigningMiddleware = __esm({ + "node_modules/@smithy/core/dist-es/middleware-http-signing/getHttpSigningMiddleware.js"() { + import_middleware_retry = __toESM(require_dist_cjs33()); + init_httpSigningMiddleware(); + httpSigningMiddlewareOptions = { + step: "finalizeRequest", + tags: ["HTTP_SIGNING"], + name: "httpSigningMiddleware", + aliases: ["apiKeyMiddleware", "tokenMiddleware", "awsAuthMiddleware"], + override: true, + relation: "after", + toMiddleware: import_middleware_retry.retryMiddlewareOptions.name + }; + getHttpSigningPlugin = (config) => ({ + applyToStack: (clientStack) => { + clientStack.addRelativeTo(httpSigningMiddleware(config), httpSigningMiddlewareOptions); + } + }); } }); -// node_modules/undici/lib/llhttp/llhttp_simd-wasm.js -var require_llhttp_simd_wasm2 = __commonJS({ - "node_modules/undici/lib/llhttp/llhttp_simd-wasm.js"(exports2, module2) { - "use strict"; - var { Buffer: Buffer2 } = require("node:buffer"); - module2.exports = Buffer2.from("AGFzbQEAAAABJwdgAX8Bf2ADf39/AX9gAX8AYAJ/fwBgBH9/f38Bf2AAAGADf39/AALLAQgDZW52GHdhc21fb25faGVhZGVyc19jb21wbGV0ZQAEA2VudhV3YXNtX29uX21lc3NhZ2VfYmVnaW4AAANlbnYLd2FzbV9vbl91cmwAAQNlbnYOd2FzbV9vbl9zdGF0dXMAAQNlbnYUd2FzbV9vbl9oZWFkZXJfZmllbGQAAQNlbnYUd2FzbV9vbl9oZWFkZXJfdmFsdWUAAQNlbnYMd2FzbV9vbl9ib2R5AAEDZW52GHdhc21fb25fbWVzc2FnZV9jb21wbGV0ZQAAAy0sBQYAAAIAAAAAAAACAQIAAgICAAADAAAAAAMDAwMBAQEBAQEBAQEAAAIAAAAEBQFwARISBQMBAAIGCAF/AUGA1AQLB9EFIgZtZW1vcnkCAAtfaW5pdGlhbGl6ZQAIGV9faW5kaXJlY3RfZnVuY3Rpb25fdGFibGUBAAtsbGh0dHBfaW5pdAAJGGxsaHR0cF9zaG91bGRfa2VlcF9hbGl2ZQAvDGxsaHR0cF9hbGxvYwALBm1hbGxvYwAxC2xsaHR0cF9mcmVlAAwEZnJlZQAMD2xsaHR0cF9nZXRfdHlwZQANFWxsaHR0cF9nZXRfaHR0cF9tYWpvcgAOFWxsaHR0cF9nZXRfaHR0cF9taW5vcgAPEWxsaHR0cF9nZXRfbWV0aG9kABAWbGxodHRwX2dldF9zdGF0dXNfY29kZQAREmxsaHR0cF9nZXRfdXBncmFkZQASDGxsaHR0cF9yZXNldAATDmxsaHR0cF9leGVjdXRlABQUbGxodHRwX3NldHRpbmdzX2luaXQAFQ1sbGh0dHBfZmluaXNoABYMbGxodHRwX3BhdXNlABcNbGxodHRwX3Jlc3VtZQAYG2xsaHR0cF9yZXN1bWVfYWZ0ZXJfdXBncmFkZQAZEGxsaHR0cF9nZXRfZXJybm8AGhdsbGh0dHBfZ2V0X2Vycm9yX3JlYXNvbgAbF2xsaHR0cF9zZXRfZXJyb3JfcmVhc29uABwUbGxodHRwX2dldF9lcnJvcl9wb3MAHRFsbGh0dHBfZXJybm9fbmFtZQAeEmxsaHR0cF9tZXRob2RfbmFtZQAfEmxsaHR0cF9zdGF0dXNfbmFtZQAgGmxsaHR0cF9zZXRfbGVuaWVudF9oZWFkZXJzACEhbGxodHRwX3NldF9sZW5pZW50X2NodW5rZWRfbGVuZ3RoACIdbGxodHRwX3NldF9sZW5pZW50X2tlZXBfYWxpdmUAIyRsbGh0dHBfc2V0X2xlbmllbnRfdHJhbnNmZXJfZW5jb2RpbmcAJBhsbGh0dHBfbWVzc2FnZV9uZWVkc19lb2YALgkXAQBBAQsRAQIDBAUKBgcrLSwqKSglJyYK77MCLBYAQYjQACgCAARAAAtBiNAAQQE2AgALFAAgABAwIAAgAjYCOCAAIAE6ACgLFAAgACAALwEyIAAtAC4gABAvEAALHgEBf0HAABAyIgEQMCABQYAINgI4IAEgADoAKCABC48MAQd/AkAgAEUNACAAQQhrIgEgAEEEaygCACIAQXhxIgRqIQUCQCAAQQFxDQAgAEEDcUUNASABIAEoAgAiAGsiAUGc0AAoAgBJDQEgACAEaiEEAkACQEGg0AAoAgAgAUcEQCAAQf8BTQRAIABBA3YhAyABKAIIIgAgASgCDCICRgRAQYzQAEGM0AAoAgBBfiADd3E2AgAMBQsgAiAANgIIIAAgAjYCDAwECyABKAIYIQYgASABKAIMIgBHBEAgACABKAIIIgI2AgggAiAANgIMDAMLIAFBFGoiAygCACICRQRAIAEoAhAiAkUNAiABQRBqIQMLA0AgAyEHIAIiAEEUaiIDKAIAIgINACAAQRBqIQMgACgCECICDQALIAdBADYCAAwCCyAFKAIEIgBBA3FBA0cNAiAFIABBfnE2AgRBlNAAIAQ2AgAgBSAENgIAIAEgBEEBcjYCBAwDC0EAIQALIAZFDQACQCABKAIcIgJBAnRBvNIAaiIDKAIAIAFGBEAgAyAANgIAIAANAUGQ0ABBkNAAKAIAQX4gAndxNgIADAILIAZBEEEUIAYoAhAgAUYbaiAANgIAIABFDQELIAAgBjYCGCABKAIQIgIEQCAAIAI2AhAgAiAANgIYCyABQRRqKAIAIgJFDQAgAEEUaiACNgIAIAIgADYCGAsgASAFTw0AIAUoAgQiAEEBcUUNAAJAAkACQAJAIABBAnFFBEBBpNAAKAIAIAVGBEBBpNAAIAE2AgBBmNAAQZjQACgCACAEaiIANgIAIAEgAEEBcjYCBCABQaDQACgCAEcNBkGU0ABBADYCAEGg0ABBADYCAAwGC0Gg0AAoAgAgBUYEQEGg0AAgATYCAEGU0ABBlNAAKAIAIARqIgA2AgAgASAAQQFyNgIEIAAgAWogADYCAAwGCyAAQXhxIARqIQQgAEH/AU0EQCAAQQN2IQMgBSgCCCIAIAUoAgwiAkYEQEGM0ABBjNAAKAIAQX4gA3dxNgIADAULIAIgADYCCCAAIAI2AgwMBAsgBSgCGCEGIAUgBSgCDCIARwRAQZzQACgCABogACAFKAIIIgI2AgggAiAANgIMDAMLIAVBFGoiAygCACICRQRAIAUoAhAiAkUNAiAFQRBqIQMLA0AgAyEHIAIiAEEUaiIDKAIAIgINACAAQRBqIQMgACgCECICDQALIAdBADYCAAwCCyAFIABBfnE2AgQgASAEaiAENgIAIAEgBEEBcjYCBAwDC0EAIQALIAZFDQACQCAFKAIcIgJBAnRBvNIAaiIDKAIAIAVGBEAgAyAANgIAIAANAUGQ0ABBkNAAKAIAQX4gAndxNgIADAILIAZBEEEUIAYoAhAgBUYbaiAANgIAIABFDQELIAAgBjYCGCAFKAIQIgIEQCAAIAI2AhAgAiAANgIYCyAFQRRqKAIAIgJFDQAgAEEUaiACNgIAIAIgADYCGAsgASAEaiAENgIAIAEgBEEBcjYCBCABQaDQACgCAEcNAEGU0AAgBDYCAAwBCyAEQf8BTQRAIARBeHFBtNAAaiEAAn9BjNAAKAIAIgJBASAEQQN2dCIDcUUEQEGM0AAgAiADcjYCACAADAELIAAoAggLIgIgATYCDCAAIAE2AgggASAANgIMIAEgAjYCCAwBC0EfIQIgBEH///8HTQRAIARBJiAEQQh2ZyIAa3ZBAXEgAEEBdGtBPmohAgsgASACNgIcIAFCADcCECACQQJ0QbzSAGohAAJAQZDQACgCACIDQQEgAnQiB3FFBEAgACABNgIAQZDQACADIAdyNgIAIAEgADYCGCABIAE2AgggASABNgIMDAELIARBGSACQQF2a0EAIAJBH0cbdCECIAAoAgAhAAJAA0AgACIDKAIEQXhxIARGDQEgAkEddiEAIAJBAXQhAiADIABBBHFqQRBqIgcoAgAiAA0ACyAHIAE2AgAgASADNgIYIAEgATYCDCABIAE2AggMAQsgAygCCCIAIAE2AgwgAyABNgIIIAFBADYCGCABIAM2AgwgASAANgIIC0Gs0ABBrNAAKAIAQQFrIgBBfyAAGzYCAAsLBwAgAC0AKAsHACAALQAqCwcAIAAtACsLBwAgAC0AKQsHACAALwEyCwcAIAAtAC4LQAEEfyAAKAIYIQEgAC0ALSECIAAtACghAyAAKAI4IQQgABAwIAAgBDYCOCAAIAM6ACggACACOgAtIAAgATYCGAu74gECB38DfiABIAJqIQQCQCAAIgIoAgwiAA0AIAIoAgQEQCACIAE2AgQLIwBBEGsiCCQAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACfwJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAIAIoAhwiA0EBaw7dAdoBAdkBAgMEBQYHCAkKCwwNDtgBDxDXARES1gETFBUWFxgZGhvgAd8BHB0e1QEfICEiIyQl1AEmJygpKiss0wHSAS0u0QHQAS8wMTIzNDU2Nzg5Ojs8PT4/QEFCQ0RFRtsBR0hJSs8BzgFLzQFMzAFNTk9QUVJTVFVWV1hZWltcXV5fYGFiY2RlZmdoaWprbG1ub3BxcnN0dXZ3eHl6e3x9fn+AAYEBggGDAYQBhQGGAYcBiAGJAYoBiwGMAY0BjgGPAZABkQGSAZMBlAGVAZYBlwGYAZkBmgGbAZwBnQGeAZ8BoAGhAaIBowGkAaUBpgGnAagBqQGqAasBrAGtAa4BrwGwAbEBsgGzAbQBtQG2AbcBywHKAbgByQG5AcgBugG7AbwBvQG+Ab8BwAHBAcIBwwHEAcUBxgEA3AELQQAMxgELQQ4MxQELQQ0MxAELQQ8MwwELQRAMwgELQRMMwQELQRQMwAELQRUMvwELQRYMvgELQRgMvQELQRkMvAELQRoMuwELQRsMugELQRwMuQELQR0MuAELQQgMtwELQR4MtgELQSAMtQELQR8MtAELQQcMswELQSEMsgELQSIMsQELQSMMsAELQSQMrwELQRIMrgELQREMrQELQSUMrAELQSYMqwELQScMqgELQSgMqQELQcMBDKgBC0EqDKcBC0ErDKYBC0EsDKUBC0EtDKQBC0EuDKMBC0EvDKIBC0HEAQyhAQtBMAygAQtBNAyfAQtBDAyeAQtBMQydAQtBMgycAQtBMwybAQtBOQyaAQtBNQyZAQtBxQEMmAELQQsMlwELQToMlgELQTYMlQELQQoMlAELQTcMkwELQTgMkgELQTwMkQELQTsMkAELQT0MjwELQQkMjgELQSkMjQELQT4MjAELQT8MiwELQcAADIoBC0HBAAyJAQtBwgAMiAELQcMADIcBC0HEAAyGAQtBxQAMhQELQcYADIQBC0EXDIMBC0HHAAyCAQtByAAMgQELQckADIABC0HKAAx/C0HLAAx+C0HNAAx9C0HMAAx8C0HOAAx7C0HPAAx6C0HQAAx5C0HRAAx4C0HSAAx3C0HTAAx2C0HUAAx1C0HWAAx0C0HVAAxzC0EGDHILQdcADHELQQUMcAtB2AAMbwtBBAxuC0HZAAxtC0HaAAxsC0HbAAxrC0HcAAxqC0EDDGkLQd0ADGgLQd4ADGcLQd8ADGYLQeEADGULQeAADGQLQeIADGMLQeMADGILQQIMYQtB5AAMYAtB5QAMXwtB5gAMXgtB5wAMXQtB6AAMXAtB6QAMWwtB6gAMWgtB6wAMWQtB7AAMWAtB7QAMVwtB7gAMVgtB7wAMVQtB8AAMVAtB8QAMUwtB8gAMUgtB8wAMUQtB9AAMUAtB9QAMTwtB9gAMTgtB9wAMTQtB+AAMTAtB+QAMSwtB+gAMSgtB+wAMSQtB/AAMSAtB/QAMRwtB/gAMRgtB/wAMRQtBgAEMRAtBgQEMQwtBggEMQgtBgwEMQQtBhAEMQAtBhQEMPwtBhgEMPgtBhwEMPQtBiAEMPAtBiQEMOwtBigEMOgtBiwEMOQtBjAEMOAtBjQEMNwtBjgEMNgtBjwEMNQtBkAEMNAtBkQEMMwtBkgEMMgtBkwEMMQtBlAEMMAtBlQEMLwtBlgEMLgtBlwEMLQtBmAEMLAtBmQEMKwtBmgEMKgtBmwEMKQtBnAEMKAtBnQEMJwtBngEMJgtBnwEMJQtBoAEMJAtBoQEMIwtBogEMIgtBowEMIQtBpAEMIAtBpQEMHwtBpgEMHgtBpwEMHQtBqAEMHAtBqQEMGwtBqgEMGgtBqwEMGQtBrAEMGAtBrQEMFwtBrgEMFgtBAQwVC0GvAQwUC0GwAQwTC0GxAQwSC0GzAQwRC0GyAQwQC0G0AQwPC0G1AQwOC0G2AQwNC0G3AQwMC0G4AQwLC0G5AQwKC0G6AQwJC0G7AQwIC0HGAQwHC0G8AQwGC0G9AQwFC0G+AQwEC0G/AQwDC0HAAQwCC0HCAQwBC0HBAQshAwNAAkACQAJAAkACQAJAAkACQAJAIAICfwJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJ/AkACQAJAAkACQAJAAkACQAJAAkACQAJAAkAgAgJ/AkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACfwJAAkACfwJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACfwJAAkACQAJAAn8CQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQCADDsYBAAECAwQFBgcICQoLDA0ODxAREhMUFRYXGBkaGxwdHyAhIyUmKCorLC8wMTIzNDU2Nzk6Ozw9lANAQkRFRklLTk9QUVJTVFVWWFpbXF1eX2BhYmNkZWZnaGpsb3Bxc3V2eHl6e3x/gAGBAYIBgwGEAYUBhgGHAYgBiQGKAYsBjAGNAY4BjwGQAZEBkgGTAZQBlQGWAZcBmAGZAZoBmwGcAZ0BngGfAaABoQGiAaMBpAGlAaYBpwGoAakBqgGrAawBrQGuAa8BsAGxAbIBswG0AbUBtgG3AbgBuQG6AbsBvAG9Ab4BvwHAAcEBwgHDAcQBxQHGAccByAHJAcsBzAHNAc4BzwGKA4kDiAOHA4QDgwOAA/sC+gL5AvgC9wL0AvMC8gLLAsECsALZAQsgASAERw3wAkHdASEDDLMDCyABIARHDcgBQcMBIQMMsgMLIAEgBEcNe0H3ACEDDLEDCyABIARHDXBB7wAhAwywAwsgASAERw1pQeoAIQMMrwMLIAEgBEcNZUHoACEDDK4DCyABIARHDWJB5gAhAwytAwsgASAERw0aQRghAwysAwsgASAERw0VQRIhAwyrAwsgASAERw1CQcUAIQMMqgMLIAEgBEcNNEE/IQMMqQMLIAEgBEcNMkE8IQMMqAMLIAEgBEcNK0ExIQMMpwMLIAItAC5BAUYNnwMMwQILQQAhAAJAAkACQCACLQAqRQ0AIAItACtFDQAgAi8BMCIDQQJxRQ0BDAILIAIvATAiA0EBcUUNAQtBASEAIAItAChBAUYNACACLwEyIgVB5ABrQeQASQ0AIAVBzAFGDQAgBUGwAkYNACADQcAAcQ0AQQAhACADQYgEcUGABEYNACADQShxQQBHIQALIAJBADsBMCACQQA6AC8gAEUN3wIgAkIANwMgDOACC0EAIQACQCACKAI4IgNFDQAgAygCLCIDRQ0AIAIgAxEAACEACyAARQ3MASAAQRVHDd0CIAJBBDYCHCACIAE2AhQgAkGwGDYCECACQRU2AgxBACEDDKQDCyABIARGBEBBBiEDDKQDCyABQQFqIQFBACEAAkAgAigCOCIDRQ0AIAMoAlQiA0UNACACIAMRAAAhAAsgAA3ZAgwcCyACQgA3AyBBEiEDDIkDCyABIARHDRZBHSEDDKEDCyABIARHBEAgAUEBaiEBQRAhAwyIAwtBByEDDKADCyACIAIpAyAiCiAEIAFrrSILfSIMQgAgCiAMWhs3AyAgCiALWA3UAkEIIQMMnwMLIAEgBEcEQCACQQk2AgggAiABNgIEQRQhAwyGAwtBCSEDDJ4DCyACKQMgQgBSDccBIAIgAi8BMEGAAXI7ATAMQgsgASAERw0/QdAAIQMMnAMLIAEgBEYEQEELIQMMnAMLIAFBAWohAUEAIQACQCACKAI4IgNFDQAgAygCUCIDRQ0AIAIgAxEAACEACyAADc8CDMYBC0EAIQACQCACKAI4IgNFDQAgAygCSCIDRQ0AIAIgAxEAACEACyAARQ3GASAAQRVHDc0CIAJBCzYCHCACIAE2AhQgAkGCGTYCECACQRU2AgxBACEDDJoDC0EAIQACQCACKAI4IgNFDQAgAygCSCIDRQ0AIAIgAxEAACEACyAARQ0MIABBFUcNygIgAkEaNgIcIAIgATYCFCACQYIZNgIQIAJBFTYCDEEAIQMMmQMLQQAhAAJAIAIoAjgiA0UNACADKAJMIgNFDQAgAiADEQAAIQALIABFDcQBIABBFUcNxwIgAkELNgIcIAIgATYCFCACQZEXNgIQIAJBFTYCDEEAIQMMmAMLIAEgBEYEQEEPIQMMmAMLIAEtAAAiAEE7Rg0HIABBDUcNxAIgAUEBaiEBDMMBC0EAIQACQCACKAI4IgNFDQAgAygCTCIDRQ0AIAIgAxEAACEACyAARQ3DASAAQRVHDcICIAJBDzYCHCACIAE2AhQgAkGRFzYCECACQRU2AgxBACEDDJYDCwNAIAEtAABB8DVqLQAAIgBBAUcEQCAAQQJHDcECIAIoAgQhAEEAIQMgAkEANgIEIAIgACABQQFqIgEQLSIADcICDMUBCyAEIAFBAWoiAUcNAAtBEiEDDJUDC0EAIQACQCACKAI4IgNFDQAgAygCTCIDRQ0AIAIgAxEAACEACyAARQ3FASAAQRVHDb0CIAJBGzYCHCACIAE2AhQgAkGRFzYCECACQRU2AgxBACEDDJQDCyABIARGBEBBFiEDDJQDCyACQQo2AgggAiABNgIEQQAhAAJAIAIoAjgiA0UNACADKAJIIgNFDQAgAiADEQAAIQALIABFDcIBIABBFUcNuQIgAkEVNgIcIAIgATYCFCACQYIZNgIQIAJBFTYCDEEAIQMMkwMLIAEgBEcEQANAIAEtAABB8DdqLQAAIgBBAkcEQAJAIABBAWsOBMQCvQIAvgK9AgsgAUEBaiEBQQghAwz8AgsgBCABQQFqIgFHDQALQRUhAwyTAwtBFSEDDJIDCwNAIAEtAABB8DlqLQAAIgBBAkcEQCAAQQFrDgTFArcCwwK4ArcCCyAEIAFBAWoiAUcNAAtBGCEDDJEDCyABIARHBEAgAkELNgIIIAIgATYCBEEHIQMM+AILQRkhAwyQAwsgAUEBaiEBDAILIAEgBEYEQEEaIQMMjwMLAkAgAS0AAEENaw4UtQG/Ab8BvwG/Ab8BvwG/Ab8BvwG/Ab8BvwG/Ab8BvwG/Ab8BvwEAvwELQQAhAyACQQA2AhwgAkGvCzYCECACQQI2AgwgAiABQQFqNgIUDI4DCyABIARGBEBBGyEDDI4DCyABLQAAIgBBO0cEQCAAQQ1HDbECIAFBAWohAQy6AQsgAUEBaiEBC0EiIQMM8wILIAEgBEYEQEEcIQMMjAMLQgAhCgJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkAgAS0AAEEwaw43wQLAAgABAgMEBQYH0AHQAdAB0AHQAdAB0AEICQoLDA3QAdAB0AHQAdAB0AHQAdAB0AHQAdAB0AHQAdAB0AHQAdAB0AHQAdAB0AHQAdAB0AHQAdABDg8QERIT0AELQgIhCgzAAgtCAyEKDL8CC0IEIQoMvgILQgUhCgy9AgtCBiEKDLwCC0IHIQoMuwILQgghCgy6AgtCCSEKDLkCC0IKIQoMuAILQgshCgy3AgtCDCEKDLYCC0INIQoMtQILQg4hCgy0AgtCDyEKDLMCC0IKIQoMsgILQgshCgyxAgtCDCEKDLACC0INIQoMrwILQg4hCgyuAgtCDyEKDK0CC0IAIQoCQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAIAEtAABBMGsON8ACvwIAAQIDBAUGB74CvgK+Ar4CvgK+Ar4CCAkKCwwNvgK+Ar4CvgK+Ar4CvgK+Ar4CvgK+Ar4CvgK+Ar4CvgK+Ar4CvgK+Ar4CvgK+Ar4CvgK+Ag4PEBESE74CC0ICIQoMvwILQgMhCgy+AgtCBCEKDL0CC0IFIQoMvAILQgYhCgy7AgtCByEKDLoCC0IIIQoMuQILQgkhCgy4AgtCCiEKDLcCC0ILIQoMtgILQgwhCgy1AgtCDSEKDLQCC0IOIQoMswILQg8hCgyyAgtCCiEKDLECC0ILIQoMsAILQgwhCgyvAgtCDSEKDK4CC0IOIQoMrQILQg8hCgysAgsgAiACKQMgIgogBCABa60iC30iDEIAIAogDFobNwMgIAogC1gNpwJBHyEDDIkDCyABIARHBEAgAkEJNgIIIAIgATYCBEElIQMM8AILQSAhAwyIAwtBASEFIAIvATAiA0EIcUUEQCACKQMgQgBSIQULAkAgAi0ALgRAQQEhACACLQApQQVGDQEgA0HAAHFFIAVxRQ0BC0EAIQAgA0HAAHENAEECIQAgA0EIcQ0AIANBgARxBEACQCACLQAoQQFHDQAgAi0ALUEKcQ0AQQUhAAwCC0EEIQAMAQsgA0EgcUUEQAJAIAItAChBAUYNACACLwEyIgBB5ABrQeQASQ0AIABBzAFGDQAgAEGwAkYNAEEEIQAgA0EocUUNAiADQYgEcUGABEYNAgtBACEADAELQQBBAyACKQMgUBshAAsgAEEBaw4FvgIAsAEBpAKhAgtBESEDDO0CCyACQQE6AC8MhAMLIAEgBEcNnQJBJCEDDIQDCyABIARHDRxBxgAhAwyDAwtBACEAAkAgAigCOCIDRQ0AIAMoAkQiA0UNACACIAMRAAAhAAsgAEUNJyAAQRVHDZgCIAJB0AA2AhwgAiABNgIUIAJBkRg2AhAgAkEVNgIMQQAhAwyCAwsgASAERgRAQSghAwyCAwtBACEDIAJBADYCBCACQQw2AgggAiABIAEQKiIARQ2UAiACQSc2AhwgAiABNgIUIAIgADYCDAyBAwsgASAERgRAQSkhAwyBAwsgAS0AACIAQSBGDRMgAEEJRw2VAiABQQFqIQEMFAsgASAERwRAIAFBAWohAQwWC0EqIQMM/wILIAEgBEYEQEErIQMM/wILIAEtAAAiAEEJRyAAQSBHcQ2QAiACLQAsQQhHDd0CIAJBADoALAzdAgsgASAERgRAQSwhAwz+AgsgAS0AAEEKRw2OAiABQQFqIQEMsAELIAEgBEcNigJBLyEDDPwCCwNAIAEtAAAiAEEgRwRAIABBCmsOBIQCiAKIAoQChgILIAQgAUEBaiIBRw0AC0ExIQMM+wILQTIhAyABIARGDfoCIAIoAgAiACAEIAFraiEHIAEgAGtBA2ohBgJAA0AgAEHwO2otAAAgAS0AACIFQSByIAUgBUHBAGtB/wFxQRpJG0H/AXFHDQEgAEEDRgRAQQYhAQziAgsgAEEBaiEAIAQgAUEBaiIBRw0ACyACIAc2AgAM+wILIAJBADYCAAyGAgtBMyEDIAQgASIARg35AiAEIAFrIAIoAgAiAWohByAAIAFrQQhqIQYCQANAIAFB9DtqLQAAIAAtAAAiBUEgciAFIAVBwQBrQf8BcUEaSRtB/wFxRw0BIAFBCEYEQEEFIQEM4QILIAFBAWohASAEIABBAWoiAEcNAAsgAiAHNgIADPoCCyACQQA2AgAgACEBDIUCC0E0IQMgBCABIgBGDfgCIAQgAWsgAigCACIBaiEHIAAgAWtBBWohBgJAA0AgAUHQwgBqLQAAIAAtAAAiBUEgciAFIAVBwQBrQf8BcUEaSRtB/wFxRw0BIAFBBUYEQEEHIQEM4AILIAFBAWohASAEIABBAWoiAEcNAAsgAiAHNgIADPkCCyACQQA2AgAgACEBDIQCCyABIARHBEADQCABLQAAQYA+ai0AACIAQQFHBEAgAEECRg0JDIECCyAEIAFBAWoiAUcNAAtBMCEDDPgCC0EwIQMM9wILIAEgBEcEQANAIAEtAAAiAEEgRwRAIABBCmsOBP8B/gH+Af8B/gELIAQgAUEBaiIBRw0AC0E4IQMM9wILQTghAwz2AgsDQCABLQAAIgBBIEcgAEEJR3EN9gEgBCABQQFqIgFHDQALQTwhAwz1AgsDQCABLQAAIgBBIEcEQAJAIABBCmsOBPkBBAT5AQALIABBLEYN9QEMAwsgBCABQQFqIgFHDQALQT8hAwz0AgtBwAAhAyABIARGDfMCIAIoAgAiACAEIAFraiEFIAEgAGtBBmohBgJAA0AgAEGAQGstAAAgAS0AAEEgckcNASAAQQZGDdsCIABBAWohACAEIAFBAWoiAUcNAAsgAiAFNgIADPQCCyACQQA2AgALQTYhAwzZAgsgASAERgRAQcEAIQMM8gILIAJBDDYCCCACIAE2AgQgAi0ALEEBaw4E+wHuAewB6wHUAgsgAUEBaiEBDPoBCyABIARHBEADQAJAIAEtAAAiAEEgciAAIABBwQBrQf8BcUEaSRtB/wFxIgBBCUYNACAAQSBGDQACQAJAAkACQCAAQeMAaw4TAAMDAwMDAwMBAwMDAwMDAwMDAgMLIAFBAWohAUExIQMM3AILIAFBAWohAUEyIQMM2wILIAFBAWohAUEzIQMM2gILDP4BCyAEIAFBAWoiAUcNAAtBNSEDDPACC0E1IQMM7wILIAEgBEcEQANAIAEtAABBgDxqLQAAQQFHDfcBIAQgAUEBaiIBRw0AC0E9IQMM7wILQT0hAwzuAgtBACEAAkAgAigCOCIDRQ0AIAMoAkAiA0UNACACIAMRAAAhAAsgAEUNASAAQRVHDeYBIAJBwgA2AhwgAiABNgIUIAJB4xg2AhAgAkEVNgIMQQAhAwztAgsgAUEBaiEBC0E8IQMM0gILIAEgBEYEQEHCACEDDOsCCwJAA0ACQCABLQAAQQlrDhgAAswCzALRAswCzALMAswCzALMAswCzALMAswCzALMAswCzALMAswCzALMAgDMAgsgBCABQQFqIgFHDQALQcIAIQMM6wILIAFBAWohASACLQAtQQFxRQ3+AQtBLCEDDNACCyABIARHDd4BQcQAIQMM6AILA0AgAS0AAEGQwABqLQAAQQFHDZwBIAQgAUEBaiIBRw0AC0HFACEDDOcCCyABLQAAIgBBIEYN/gEgAEE6Rw3AAiACKAIEIQBBACEDIAJBADYCBCACIAAgARApIgAN3gEM3QELQccAIQMgBCABIgBGDeUCIAQgAWsgAigCACIBaiEHIAAgAWtBBWohBgNAIAFBkMIAai0AACAALQAAIgVBIHIgBSAFQcEAa0H/AXFBGkkbQf8BcUcNvwIgAUEFRg3CAiABQQFqIQEgBCAAQQFqIgBHDQALIAIgBzYCAAzlAgtByAAhAyAEIAEiAEYN5AIgBCABayACKAIAIgFqIQcgACABa0EJaiEGA0AgAUGWwgBqLQAAIAAtAAAiBUEgciAFIAVBwQBrQf8BcUEaSRtB/wFxRw2+AkECIAFBCUYNwgIaIAFBAWohASAEIABBAWoiAEcNAAsgAiAHNgIADOQCCyABIARGBEBByQAhAwzkAgsCQAJAIAEtAAAiAEEgciAAIABBwQBrQf8BcUEaSRtB/wFxQe4Aaw4HAL8CvwK/Ar8CvwIBvwILIAFBAWohAUE+IQMMywILIAFBAWohAUE/IQMMygILQcoAIQMgBCABIgBGDeICIAQgAWsgAigCACIBaiEGIAAgAWtBAWohBwNAIAFBoMIAai0AACAALQAAIgVBIHIgBSAFQcEAa0H/AXFBGkkbQf8BcUcNvAIgAUEBRg2+AiABQQFqIQEgBCAAQQFqIgBHDQALIAIgBjYCAAziAgtBywAhAyAEIAEiAEYN4QIgBCABayACKAIAIgFqIQcgACABa0EOaiEGA0AgAUGiwgBqLQAAIAAtAAAiBUEgciAFIAVBwQBrQf8BcUEaSRtB/wFxRw27AiABQQ5GDb4CIAFBAWohASAEIABBAWoiAEcNAAsgAiAHNgIADOECC0HMACEDIAQgASIARg3gAiAEIAFrIAIoAgAiAWohByAAIAFrQQ9qIQYDQCABQcDCAGotAAAgAC0AACIFQSByIAUgBUHBAGtB/wFxQRpJG0H/AXFHDboCQQMgAUEPRg2+AhogAUEBaiEBIAQgAEEBaiIARw0ACyACIAc2AgAM4AILQc0AIQMgBCABIgBGDd8CIAQgAWsgAigCACIBaiEHIAAgAWtBBWohBgNAIAFB0MIAai0AACAALQAAIgVBIHIgBSAFQcEAa0H/AXFBGkkbQf8BcUcNuQJBBCABQQVGDb0CGiABQQFqIQEgBCAAQQFqIgBHDQALIAIgBzYCAAzfAgsgASAERgRAQc4AIQMM3wILAkACQAJAAkAgAS0AACIAQSByIAAgAEHBAGtB/wFxQRpJG0H/AXFB4wBrDhMAvAK8ArwCvAK8ArwCvAK8ArwCvAK8ArwCAbwCvAK8AgIDvAILIAFBAWohAUHBACEDDMgCCyABQQFqIQFBwgAhAwzHAgsgAUEBaiEBQcMAIQMMxgILIAFBAWohAUHEACEDDMUCCyABIARHBEAgAkENNgIIIAIgATYCBEHFACEDDMUCC0HPACEDDN0CCwJAAkAgAS0AAEEKaw4EAZABkAEAkAELIAFBAWohAQtBKCEDDMMCCyABIARGBEBB0QAhAwzcAgsgAS0AAEEgRw0AIAFBAWohASACLQAtQQFxRQ3QAQtBFyEDDMECCyABIARHDcsBQdIAIQMM2QILQdMAIQMgASAERg3YAiACKAIAIgAgBCABa2ohBiABIABrQQFqIQUDQCABLQAAIABB1sIAai0AAEcNxwEgAEEBRg3KASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBjYCAAzYAgsgASAERgRAQdUAIQMM2AILIAEtAABBCkcNwgEgAUEBaiEBDMoBCyABIARGBEBB1gAhAwzXAgsCQAJAIAEtAABBCmsOBADDAcMBAcMBCyABQQFqIQEMygELIAFBAWohAUHKACEDDL0CC0EAIQACQCACKAI4IgNFDQAgAygCPCIDRQ0AIAIgAxEAACEACyAADb8BQc0AIQMMvAILIAItAClBIkYNzwIMiQELIAQgASIFRgRAQdsAIQMM1AILQQAhAEEBIQFBASEGQQAhAwJAAn8CQAJAAkACQAJAAkACQCAFLQAAQTBrDgrFAcQBAAECAwQFBgjDAQtBAgwGC0EDDAULQQQMBAtBBQwDC0EGDAILQQcMAQtBCAshA0EAIQFBACEGDL0BC0EJIQNBASEAQQAhAUEAIQYMvAELIAEgBEYEQEHdACEDDNMCCyABLQAAQS5HDbgBIAFBAWohAQyIAQsgASAERw22AUHfACEDDNECCyABIARHBEAgAkEONgIIIAIgATYCBEHQACEDDLgCC0HgACEDDNACC0HhACEDIAEgBEYNzwIgAigCACIAIAQgAWtqIQUgASAAa0EDaiEGA0AgAS0AACAAQeLCAGotAABHDbEBIABBA0YNswEgAEEBaiEAIAQgAUEBaiIBRw0ACyACIAU2AgAMzwILQeIAIQMgASAERg3OAiACKAIAIgAgBCABa2ohBSABIABrQQJqIQYDQCABLQAAIABB5sIAai0AAEcNsAEgAEECRg2vASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAzOAgtB4wAhAyABIARGDc0CIAIoAgAiACAEIAFraiEFIAEgAGtBA2ohBgNAIAEtAAAgAEHpwgBqLQAARw2vASAAQQNGDa0BIABBAWohACAEIAFBAWoiAUcNAAsgAiAFNgIADM0CCyABIARGBEBB5QAhAwzNAgsgAUEBaiEBQQAhAAJAIAIoAjgiA0UNACADKAIwIgNFDQAgAiADEQAAIQALIAANqgFB1gAhAwyzAgsgASAERwRAA0AgAS0AACIAQSBHBEACQAJAAkAgAEHIAGsOCwABswGzAbMBswGzAbMBswGzAQKzAQsgAUEBaiEBQdIAIQMMtwILIAFBAWohAUHTACEDDLYCCyABQQFqIQFB1AAhAwy1AgsgBCABQQFqIgFHDQALQeQAIQMMzAILQeQAIQMMywILA0AgAS0AAEHwwgBqLQAAIgBBAUcEQCAAQQJrDgOnAaYBpQGkAQsgBCABQQFqIgFHDQALQeYAIQMMygILIAFBAWogASAERw0CGkHnACEDDMkCCwNAIAEtAABB8MQAai0AACIAQQFHBEACQCAAQQJrDgSiAaEBoAEAnwELQdcAIQMMsQILIAQgAUEBaiIBRw0AC0HoACEDDMgCCyABIARGBEBB6QAhAwzIAgsCQCABLQAAIgBBCmsOGrcBmwGbAbQBmwGbAZsBmwGbAZsBmwGbAZsBmwGbAZsBmwGbAZsBmwGbAZsBpAGbAZsBAJkBCyABQQFqCyEBQQYhAwytAgsDQCABLQAAQfDGAGotAABBAUcNfSAEIAFBAWoiAUcNAAtB6gAhAwzFAgsgAUEBaiABIARHDQIaQesAIQMMxAILIAEgBEYEQEHsACEDDMQCCyABQQFqDAELIAEgBEYEQEHtACEDDMMCCyABQQFqCyEBQQQhAwyoAgsgASAERgRAQe4AIQMMwQILAkACQAJAIAEtAABB8MgAai0AAEEBaw4HkAGPAY4BAHwBAo0BCyABQQFqIQEMCwsgAUEBagyTAQtBACEDIAJBADYCHCACQZsSNgIQIAJBBzYCDCACIAFBAWo2AhQMwAILAkADQCABLQAAQfDIAGotAAAiAEEERwRAAkACQCAAQQFrDgeUAZMBkgGNAQAEAY0BC0HaACEDDKoCCyABQQFqIQFB3AAhAwypAgsgBCABQQFqIgFHDQALQe8AIQMMwAILIAFBAWoMkQELIAQgASIARgRAQfAAIQMMvwILIAAtAABBL0cNASAAQQFqIQEMBwsgBCABIgBGBEBB8QAhAwy+AgsgAC0AACIBQS9GBEAgAEEBaiEBQd0AIQMMpQILIAFBCmsiA0EWSw0AIAAhAUEBIAN0QYmAgAJxDfkBC0EAIQMgAkEANgIcIAIgADYCFCACQYwcNgIQIAJBBzYCDAy8AgsgASAERwRAIAFBAWohAUHeACEDDKMCC0HyACEDDLsCCyABIARGBEBB9AAhAwy7AgsCQCABLQAAQfDMAGotAABBAWsOA/cBcwCCAQtB4QAhAwyhAgsgASAERwRAA0AgAS0AAEHwygBqLQAAIgBBA0cEQAJAIABBAWsOAvkBAIUBC0HfACEDDKMCCyAEIAFBAWoiAUcNAAtB8wAhAwy6AgtB8wAhAwy5AgsgASAERwRAIAJBDzYCCCACIAE2AgRB4AAhAwygAgtB9QAhAwy4AgsgASAERgRAQfYAIQMMuAILIAJBDzYCCCACIAE2AgQLQQMhAwydAgsDQCABLQAAQSBHDY4CIAQgAUEBaiIBRw0AC0H3ACEDDLUCCyABIARGBEBB+AAhAwy1AgsgAS0AAEEgRw16IAFBAWohAQxbC0EAIQACQCACKAI4IgNFDQAgAygCOCIDRQ0AIAIgAxEAACEACyAADXgMgAILIAEgBEYEQEH6ACEDDLMCCyABLQAAQcwARw10IAFBAWohAUETDHYLQfsAIQMgASAERg2xAiACKAIAIgAgBCABa2ohBSABIABrQQVqIQYDQCABLQAAIABB8M4Aai0AAEcNcyAAQQVGDXUgAEEBaiEAIAQgAUEBaiIBRw0ACyACIAU2AgAMsQILIAEgBEYEQEH8ACEDDLECCwJAAkAgAS0AAEHDAGsODAB0dHR0dHR0dHR0AXQLIAFBAWohAUHmACEDDJgCCyABQQFqIQFB5wAhAwyXAgtB/QAhAyABIARGDa8CIAIoAgAiACAEIAFraiEFIAEgAGtBAmohBgJAA0AgAS0AACAAQe3PAGotAABHDXIgAEECRg0BIABBAWohACAEIAFBAWoiAUcNAAsgAiAFNgIADLACCyACQQA2AgAgBkEBaiEBQRAMcwtB/gAhAyABIARGDa4CIAIoAgAiACAEIAFraiEFIAEgAGtBBWohBgJAA0AgAS0AACAAQfbOAGotAABHDXEgAEEFRg0BIABBAWohACAEIAFBAWoiAUcNAAsgAiAFNgIADK8CCyACQQA2AgAgBkEBaiEBQRYMcgtB/wAhAyABIARGDa0CIAIoAgAiACAEIAFraiEFIAEgAGtBA2ohBgJAA0AgAS0AACAAQfzOAGotAABHDXAgAEEDRg0BIABBAWohACAEIAFBAWoiAUcNAAsgAiAFNgIADK4CCyACQQA2AgAgBkEBaiEBQQUMcQsgASAERgRAQYABIQMMrQILIAEtAABB2QBHDW4gAUEBaiEBQQgMcAsgASAERgRAQYEBIQMMrAILAkACQCABLQAAQc4Aaw4DAG8BbwsgAUEBaiEBQesAIQMMkwILIAFBAWohAUHsACEDDJICCyABIARGBEBBggEhAwyrAgsCQAJAIAEtAABByABrDggAbm5ubm5uAW4LIAFBAWohAUHqACEDDJICCyABQQFqIQFB7QAhAwyRAgtBgwEhAyABIARGDakCIAIoAgAiACAEIAFraiEFIAEgAGtBAmohBgJAA0AgAS0AACAAQYDPAGotAABHDWwgAEECRg0BIABBAWohACAEIAFBAWoiAUcNAAsgAiAFNgIADKoCCyACQQA2AgAgBkEBaiEBQQAMbQtBhAEhAyABIARGDagCIAIoAgAiACAEIAFraiEFIAEgAGtBBGohBgJAA0AgAS0AACAAQYPPAGotAABHDWsgAEEERg0BIABBAWohACAEIAFBAWoiAUcNAAsgAiAFNgIADKkCCyACQQA2AgAgBkEBaiEBQSMMbAsgASAERgRAQYUBIQMMqAILAkACQCABLQAAQcwAaw4IAGtra2trawFrCyABQQFqIQFB7wAhAwyPAgsgAUEBaiEBQfAAIQMMjgILIAEgBEYEQEGGASEDDKcCCyABLQAAQcUARw1oIAFBAWohAQxgC0GHASEDIAEgBEYNpQIgAigCACIAIAQgAWtqIQUgASAAa0EDaiEGAkADQCABLQAAIABBiM8Aai0AAEcNaCAAQQNGDQEgAEEBaiEAIAQgAUEBaiIBRw0ACyACIAU2AgAMpgILIAJBADYCACAGQQFqIQFBLQxpC0GIASEDIAEgBEYNpAIgAigCACIAIAQgAWtqIQUgASAAa0EIaiEGAkADQCABLQAAIABB0M8Aai0AAEcNZyAAQQhGDQEgAEEBaiEAIAQgAUEBaiIBRw0ACyACIAU2AgAMpQILIAJBADYCACAGQQFqIQFBKQxoCyABIARGBEBBiQEhAwykAgtBASABLQAAQd8ARw1nGiABQQFqIQEMXgtBigEhAyABIARGDaICIAIoAgAiACAEIAFraiEFIAEgAGtBAWohBgNAIAEtAAAgAEGMzwBqLQAARw1kIABBAUYN+gEgAEEBaiEAIAQgAUEBaiIBRw0ACyACIAU2AgAMogILQYsBIQMgASAERg2hAiACKAIAIgAgBCABa2ohBSABIABrQQJqIQYCQANAIAEtAAAgAEGOzwBqLQAARw1kIABBAkYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAyiAgsgAkEANgIAIAZBAWohAUECDGULQYwBIQMgASAERg2gAiACKAIAIgAgBCABa2ohBSABIABrQQFqIQYCQANAIAEtAAAgAEHwzwBqLQAARw1jIABBAUYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAyhAgsgAkEANgIAIAZBAWohAUEfDGQLQY0BIQMgASAERg2fAiACKAIAIgAgBCABa2ohBSABIABrQQFqIQYCQANAIAEtAAAgAEHyzwBqLQAARw1iIABBAUYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAygAgsgAkEANgIAIAZBAWohAUEJDGMLIAEgBEYEQEGOASEDDJ8CCwJAAkAgAS0AAEHJAGsOBwBiYmJiYgFiCyABQQFqIQFB+AAhAwyGAgsgAUEBaiEBQfkAIQMMhQILQY8BIQMgASAERg2dAiACKAIAIgAgBCABa2ohBSABIABrQQVqIQYCQANAIAEtAAAgAEGRzwBqLQAARw1gIABBBUYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAyeAgsgAkEANgIAIAZBAWohAUEYDGELQZABIQMgASAERg2cAiACKAIAIgAgBCABa2ohBSABIABrQQJqIQYCQANAIAEtAAAgAEGXzwBqLQAARw1fIABBAkYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAydAgsgAkEANgIAIAZBAWohAUEXDGALQZEBIQMgASAERg2bAiACKAIAIgAgBCABa2ohBSABIABrQQZqIQYCQANAIAEtAAAgAEGazwBqLQAARw1eIABBBkYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAycAgsgAkEANgIAIAZBAWohAUEVDF8LQZIBIQMgASAERg2aAiACKAIAIgAgBCABa2ohBSABIABrQQVqIQYCQANAIAEtAAAgAEGhzwBqLQAARw1dIABBBUYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAybAgsgAkEANgIAIAZBAWohAUEeDF4LIAEgBEYEQEGTASEDDJoCCyABLQAAQcwARw1bIAFBAWohAUEKDF0LIAEgBEYEQEGUASEDDJkCCwJAAkAgAS0AAEHBAGsODwBcXFxcXFxcXFxcXFxcAVwLIAFBAWohAUH+ACEDDIACCyABQQFqIQFB/wAhAwz/AQsgASAERgRAQZUBIQMMmAILAkACQCABLQAAQcEAaw4DAFsBWwsgAUEBaiEBQf0AIQMM/wELIAFBAWohAUGAASEDDP4BC0GWASEDIAEgBEYNlgIgAigCACIAIAQgAWtqIQUgASAAa0EBaiEGAkADQCABLQAAIABBp88Aai0AAEcNWSAAQQFGDQEgAEEBaiEAIAQgAUEBaiIBRw0ACyACIAU2AgAMlwILIAJBADYCACAGQQFqIQFBCwxaCyABIARGBEBBlwEhAwyWAgsCQAJAAkACQCABLQAAQS1rDiMAW1tbW1tbW1tbW1tbW1tbW1tbW1tbW1sBW1tbW1sCW1tbA1sLIAFBAWohAUH7ACEDDP8BCyABQQFqIQFB/AAhAwz+AQsgAUEBaiEBQYEBIQMM/QELIAFBAWohAUGCASEDDPwBC0GYASEDIAEgBEYNlAIgAigCACIAIAQgAWtqIQUgASAAa0EEaiEGAkADQCABLQAAIABBqc8Aai0AAEcNVyAAQQRGDQEgAEEBaiEAIAQgAUEBaiIBRw0ACyACIAU2AgAMlQILIAJBADYCACAGQQFqIQFBGQxYC0GZASEDIAEgBEYNkwIgAigCACIAIAQgAWtqIQUgASAAa0EFaiEGAkADQCABLQAAIABBrs8Aai0AAEcNViAAQQVGDQEgAEEBaiEAIAQgAUEBaiIBRw0ACyACIAU2AgAMlAILIAJBADYCACAGQQFqIQFBBgxXC0GaASEDIAEgBEYNkgIgAigCACIAIAQgAWtqIQUgASAAa0EBaiEGAkADQCABLQAAIABBtM8Aai0AAEcNVSAAQQFGDQEgAEEBaiEAIAQgAUEBaiIBRw0ACyACIAU2AgAMkwILIAJBADYCACAGQQFqIQFBHAxWC0GbASEDIAEgBEYNkQIgAigCACIAIAQgAWtqIQUgASAAa0EBaiEGAkADQCABLQAAIABBts8Aai0AAEcNVCAAQQFGDQEgAEEBaiEAIAQgAUEBaiIBRw0ACyACIAU2AgAMkgILIAJBADYCACAGQQFqIQFBJwxVCyABIARGBEBBnAEhAwyRAgsCQAJAIAEtAABB1ABrDgIAAVQLIAFBAWohAUGGASEDDPgBCyABQQFqIQFBhwEhAwz3AQtBnQEhAyABIARGDY8CIAIoAgAiACAEIAFraiEFIAEgAGtBAWohBgJAA0AgAS0AACAAQbjPAGotAABHDVIgAEEBRg0BIABBAWohACAEIAFBAWoiAUcNAAsgAiAFNgIADJACCyACQQA2AgAgBkEBaiEBQSYMUwtBngEhAyABIARGDY4CIAIoAgAiACAEIAFraiEFIAEgAGtBAWohBgJAA0AgAS0AACAAQbrPAGotAABHDVEgAEEBRg0BIABBAWohACAEIAFBAWoiAUcNAAsgAiAFNgIADI8CCyACQQA2AgAgBkEBaiEBQQMMUgtBnwEhAyABIARGDY0CIAIoAgAiACAEIAFraiEFIAEgAGtBAmohBgJAA0AgAS0AACAAQe3PAGotAABHDVAgAEECRg0BIABBAWohACAEIAFBAWoiAUcNAAsgAiAFNgIADI4CCyACQQA2AgAgBkEBaiEBQQwMUQtBoAEhAyABIARGDYwCIAIoAgAiACAEIAFraiEFIAEgAGtBA2ohBgJAA0AgAS0AACAAQbzPAGotAABHDU8gAEEDRg0BIABBAWohACAEIAFBAWoiAUcNAAsgAiAFNgIADI0CCyACQQA2AgAgBkEBaiEBQQ0MUAsgASAERgRAQaEBIQMMjAILAkACQCABLQAAQcYAaw4LAE9PT09PT09PTwFPCyABQQFqIQFBiwEhAwzzAQsgAUEBaiEBQYwBIQMM8gELIAEgBEYEQEGiASEDDIsCCyABLQAAQdAARw1MIAFBAWohAQxGCyABIARGBEBBowEhAwyKAgsCQAJAIAEtAABByQBrDgcBTU1NTU0ATQsgAUEBaiEBQY4BIQMM8QELIAFBAWohAUEiDE0LQaQBIQMgASAERg2IAiACKAIAIgAgBCABa2ohBSABIABrQQFqIQYCQANAIAEtAAAgAEHAzwBqLQAARw1LIABBAUYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAyJAgsgAkEANgIAIAZBAWohAUEdDEwLIAEgBEYEQEGlASEDDIgCCwJAAkAgAS0AAEHSAGsOAwBLAUsLIAFBAWohAUGQASEDDO8BCyABQQFqIQFBBAxLCyABIARGBEBBpgEhAwyHAgsCQAJAAkACQAJAIAEtAABBwQBrDhUATU1NTU1NTU1NTQFNTQJNTQNNTQRNCyABQQFqIQFBiAEhAwzxAQsgAUEBaiEBQYkBIQMM8AELIAFBAWohAUGKASEDDO8BCyABQQFqIQFBjwEhAwzuAQsgAUEBaiEBQZEBIQMM7QELQacBIQMgASAERg2FAiACKAIAIgAgBCABa2ohBSABIABrQQJqIQYCQANAIAEtAAAgAEHtzwBqLQAARw1IIABBAkYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAyGAgsgAkEANgIAIAZBAWohAUERDEkLQagBIQMgASAERg2EAiACKAIAIgAgBCABa2ohBSABIABrQQJqIQYCQANAIAEtAAAgAEHCzwBqLQAARw1HIABBAkYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAyFAgsgAkEANgIAIAZBAWohAUEsDEgLQakBIQMgASAERg2DAiACKAIAIgAgBCABa2ohBSABIABrQQRqIQYCQANAIAEtAAAgAEHFzwBqLQAARw1GIABBBEYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAyEAgsgAkEANgIAIAZBAWohAUErDEcLQaoBIQMgASAERg2CAiACKAIAIgAgBCABa2ohBSABIABrQQJqIQYCQANAIAEtAAAgAEHKzwBqLQAARw1FIABBAkYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAyDAgsgAkEANgIAIAZBAWohAUEUDEYLIAEgBEYEQEGrASEDDIICCwJAAkACQAJAIAEtAABBwgBrDg8AAQJHR0dHR0dHR0dHRwNHCyABQQFqIQFBkwEhAwzrAQsgAUEBaiEBQZQBIQMM6gELIAFBAWohAUGVASEDDOkBCyABQQFqIQFBlgEhAwzoAQsgASAERgRAQawBIQMMgQILIAEtAABBxQBHDUIgAUEBaiEBDD0LQa0BIQMgASAERg3/ASACKAIAIgAgBCABa2ohBSABIABrQQJqIQYCQANAIAEtAAAgAEHNzwBqLQAARw1CIABBAkYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAyAAgsgAkEANgIAIAZBAWohAUEODEMLIAEgBEYEQEGuASEDDP8BCyABLQAAQdAARw1AIAFBAWohAUElDEILQa8BIQMgASAERg39ASACKAIAIgAgBCABa2ohBSABIABrQQhqIQYCQANAIAEtAAAgAEHQzwBqLQAARw1AIABBCEYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAz+AQsgAkEANgIAIAZBAWohAUEqDEELIAEgBEYEQEGwASEDDP0BCwJAAkAgAS0AAEHVAGsOCwBAQEBAQEBAQEABQAsgAUEBaiEBQZoBIQMM5AELIAFBAWohAUGbASEDDOMBCyABIARGBEBBsQEhAwz8AQsCQAJAIAEtAABBwQBrDhQAPz8/Pz8/Pz8/Pz8/Pz8/Pz8/AT8LIAFBAWohAUGZASEDDOMBCyABQQFqIQFBnAEhAwziAQtBsgEhAyABIARGDfoBIAIoAgAiACAEIAFraiEFIAEgAGtBA2ohBgJAA0AgAS0AACAAQdnPAGotAABHDT0gAEEDRg0BIABBAWohACAEIAFBAWoiAUcNAAsgAiAFNgIADPsBCyACQQA2AgAgBkEBaiEBQSEMPgtBswEhAyABIARGDfkBIAIoAgAiACAEIAFraiEFIAEgAGtBBmohBgJAA0AgAS0AACAAQd3PAGotAABHDTwgAEEGRg0BIABBAWohACAEIAFBAWoiAUcNAAsgAiAFNgIADPoBCyACQQA2AgAgBkEBaiEBQRoMPQsgASAERgRAQbQBIQMM+QELAkACQAJAIAEtAABBxQBrDhEAPT09PT09PT09AT09PT09Aj0LIAFBAWohAUGdASEDDOEBCyABQQFqIQFBngEhAwzgAQsgAUEBaiEBQZ8BIQMM3wELQbUBIQMgASAERg33ASACKAIAIgAgBCABa2ohBSABIABrQQVqIQYCQANAIAEtAAAgAEHkzwBqLQAARw06IABBBUYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAz4AQsgAkEANgIAIAZBAWohAUEoDDsLQbYBIQMgASAERg32ASACKAIAIgAgBCABa2ohBSABIABrQQJqIQYCQANAIAEtAAAgAEHqzwBqLQAARw05IABBAkYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAz3AQsgAkEANgIAIAZBAWohAUEHDDoLIAEgBEYEQEG3ASEDDPYBCwJAAkAgAS0AAEHFAGsODgA5OTk5OTk5OTk5OTkBOQsgAUEBaiEBQaEBIQMM3QELIAFBAWohAUGiASEDDNwBC0G4ASEDIAEgBEYN9AEgAigCACIAIAQgAWtqIQUgASAAa0ECaiEGAkADQCABLQAAIABB7c8Aai0AAEcNNyAAQQJGDQEgAEEBaiEAIAQgAUEBaiIBRw0ACyACIAU2AgAM9QELIAJBADYCACAGQQFqIQFBEgw4C0G5ASEDIAEgBEYN8wEgAigCACIAIAQgAWtqIQUgASAAa0EBaiEGAkADQCABLQAAIABB8M8Aai0AAEcNNiAAQQFGDQEgAEEBaiEAIAQgAUEBaiIBRw0ACyACIAU2AgAM9AELIAJBADYCACAGQQFqIQFBIAw3C0G6ASEDIAEgBEYN8gEgAigCACIAIAQgAWtqIQUgASAAa0EBaiEGAkADQCABLQAAIABB8s8Aai0AAEcNNSAAQQFGDQEgAEEBaiEAIAQgAUEBaiIBRw0ACyACIAU2AgAM8wELIAJBADYCACAGQQFqIQFBDww2CyABIARGBEBBuwEhAwzyAQsCQAJAIAEtAABByQBrDgcANTU1NTUBNQsgAUEBaiEBQaUBIQMM2QELIAFBAWohAUGmASEDDNgBC0G8ASEDIAEgBEYN8AEgAigCACIAIAQgAWtqIQUgASAAa0EHaiEGAkADQCABLQAAIABB9M8Aai0AAEcNMyAAQQdGDQEgAEEBaiEAIAQgAUEBaiIBRw0ACyACIAU2AgAM8QELIAJBADYCACAGQQFqIQFBGww0CyABIARGBEBBvQEhAwzwAQsCQAJAAkAgAS0AAEHCAGsOEgA0NDQ0NDQ0NDQBNDQ0NDQ0AjQLIAFBAWohAUGkASEDDNgBCyABQQFqIQFBpwEhAwzXAQsgAUEBaiEBQagBIQMM1gELIAEgBEYEQEG+ASEDDO8BCyABLQAAQc4ARw0wIAFBAWohAQwsCyABIARGBEBBvwEhAwzuAQsCQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQCABLQAAQcEAaw4VAAECAz8EBQY/Pz8HCAkKCz8MDQ4PPwsgAUEBaiEBQegAIQMM4wELIAFBAWohAUHpACEDDOIBCyABQQFqIQFB7gAhAwzhAQsgAUEBaiEBQfIAIQMM4AELIAFBAWohAUHzACEDDN8BCyABQQFqIQFB9gAhAwzeAQsgAUEBaiEBQfcAIQMM3QELIAFBAWohAUH6ACEDDNwBCyABQQFqIQFBgwEhAwzbAQsgAUEBaiEBQYQBIQMM2gELIAFBAWohAUGFASEDDNkBCyABQQFqIQFBkgEhAwzYAQsgAUEBaiEBQZgBIQMM1wELIAFBAWohAUGgASEDDNYBCyABQQFqIQFBowEhAwzVAQsgAUEBaiEBQaoBIQMM1AELIAEgBEcEQCACQRA2AgggAiABNgIEQasBIQMM1AELQcABIQMM7AELQQAhAAJAIAIoAjgiA0UNACADKAI0IgNFDQAgAiADEQAAIQALIABFDV4gAEEVRw0HIAJB0QA2AhwgAiABNgIUIAJBsBc2AhAgAkEVNgIMQQAhAwzrAQsgAUEBaiABIARHDQgaQcIBIQMM6gELA0ACQCABLQAAQQprDgQIAAALAAsgBCABQQFqIgFHDQALQcMBIQMM6QELIAEgBEcEQCACQRE2AgggAiABNgIEQQEhAwzQAQtBxAEhAwzoAQsgASAERgRAQcUBIQMM6AELAkACQCABLQAAQQprDgQBKCgAKAsgAUEBagwJCyABQQFqDAULIAEgBEYEQEHGASEDDOcBCwJAAkAgAS0AAEEKaw4XAQsLAQsLCwsLCwsLCwsLCwsLCwsLCwALCyABQQFqIQELQbABIQMMzQELIAEgBEYEQEHIASEDDOYBCyABLQAAQSBHDQkgAkEAOwEyIAFBAWohAUGzASEDDMwBCwNAIAEhAAJAIAEgBEcEQCABLQAAQTBrQf8BcSIDQQpJDQEMJwtBxwEhAwzmAQsCQCACLwEyIgFBmTNLDQAgAiABQQpsIgU7ATIgBUH+/wNxIANB//8Dc0sNACAAQQFqIQEgAiADIAVqIgM7ATIgA0H//wNxQegHSQ0BCwtBACEDIAJBADYCHCACQcEJNgIQIAJBDTYCDCACIABBAWo2AhQM5AELIAJBADYCHCACIAE2AhQgAkHwDDYCECACQRs2AgxBACEDDOMBCyACKAIEIQAgAkEANgIEIAIgACABECYiAA0BIAFBAWoLIQFBrQEhAwzIAQsgAkHBATYCHCACIAA2AgwgAiABQQFqNgIUQQAhAwzgAQsgAigCBCEAIAJBADYCBCACIAAgARAmIgANASABQQFqCyEBQa4BIQMMxQELIAJBwgE2AhwgAiAANgIMIAIgAUEBajYCFEEAIQMM3QELIAJBADYCHCACIAE2AhQgAkGXCzYCECACQQ02AgxBACEDDNwBCyACQQA2AhwgAiABNgIUIAJB4xA2AhAgAkEJNgIMQQAhAwzbAQsgAkECOgAoDKwBC0EAIQMgAkEANgIcIAJBrws2AhAgAkECNgIMIAIgAUEBajYCFAzZAQtBAiEDDL8BC0ENIQMMvgELQSYhAwy9AQtBFSEDDLwBC0EWIQMMuwELQRghAwy6AQtBHCEDDLkBC0EdIQMMuAELQSAhAwy3AQtBISEDDLYBC0EjIQMMtQELQcYAIQMMtAELQS4hAwyzAQtBPSEDDLIBC0HLACEDDLEBC0HOACEDDLABC0HYACEDDK8BC0HZACEDDK4BC0HbACEDDK0BC0HxACEDDKwBC0H0ACEDDKsBC0GNASEDDKoBC0GXASEDDKkBC0GpASEDDKgBC0GvASEDDKcBC0GxASEDDKYBCyACQQA2AgALQQAhAyACQQA2AhwgAiABNgIUIAJB8Rs2AhAgAkEGNgIMDL0BCyACQQA2AgAgBkEBaiEBQSQLOgApIAIoAgQhACACQQA2AgQgAiAAIAEQJyIARQRAQeUAIQMMowELIAJB+QA2AhwgAiABNgIUIAIgADYCDEEAIQMMuwELIABBFUcEQCACQQA2AhwgAiABNgIUIAJBzA42AhAgAkEgNgIMQQAhAwy7AQsgAkH4ADYCHCACIAE2AhQgAkHKGDYCECACQRU2AgxBACEDDLoBCyACQQA2AhwgAiABNgIUIAJBjhs2AhAgAkEGNgIMQQAhAwy5AQsgAkEANgIcIAIgATYCFCACQf4RNgIQIAJBBzYCDEEAIQMMuAELIAJBADYCHCACIAE2AhQgAkGMHDYCECACQQc2AgxBACEDDLcBCyACQQA2AhwgAiABNgIUIAJBww82AhAgAkEHNgIMQQAhAwy2AQsgAkEANgIcIAIgATYCFCACQcMPNgIQIAJBBzYCDEEAIQMMtQELIAIoAgQhACACQQA2AgQgAiAAIAEQJSIARQ0RIAJB5QA2AhwgAiABNgIUIAIgADYCDEEAIQMMtAELIAIoAgQhACACQQA2AgQgAiAAIAEQJSIARQ0gIAJB0wA2AhwgAiABNgIUIAIgADYCDEEAIQMMswELIAIoAgQhACACQQA2AgQgAiAAIAEQJSIARQ0iIAJB0gA2AhwgAiABNgIUIAIgADYCDEEAIQMMsgELIAIoAgQhACACQQA2AgQgAiAAIAEQJSIARQ0OIAJB5QA2AhwgAiABNgIUIAIgADYCDEEAIQMMsQELIAIoAgQhACACQQA2AgQgAiAAIAEQJSIARQ0dIAJB0wA2AhwgAiABNgIUIAIgADYCDEEAIQMMsAELIAIoAgQhACACQQA2AgQgAiAAIAEQJSIARQ0fIAJB0gA2AhwgAiABNgIUIAIgADYCDEEAIQMMrwELIABBP0cNASABQQFqCyEBQQUhAwyUAQtBACEDIAJBADYCHCACIAE2AhQgAkH9EjYCECACQQc2AgwMrAELIAJBADYCHCACIAE2AhQgAkHcCDYCECACQQc2AgxBACEDDKsBCyACKAIEIQAgAkEANgIEIAIgACABECUiAEUNByACQeUANgIcIAIgATYCFCACIAA2AgxBACEDDKoBCyACKAIEIQAgAkEANgIEIAIgACABECUiAEUNFiACQdMANgIcIAIgATYCFCACIAA2AgxBACEDDKkBCyACKAIEIQAgAkEANgIEIAIgACABECUiAEUNGCACQdIANgIcIAIgATYCFCACIAA2AgxBACEDDKgBCyACQQA2AhwgAiABNgIUIAJBxgo2AhAgAkEHNgIMQQAhAwynAQsgAigCBCEAIAJBADYCBCACIAAgARAlIgBFDQMgAkHlADYCHCACIAE2AhQgAiAANgIMQQAhAwymAQsgAigCBCEAIAJBADYCBCACIAAgARAlIgBFDRIgAkHTADYCHCACIAE2AhQgAiAANgIMQQAhAwylAQsgAigCBCEAIAJBADYCBCACIAAgARAlIgBFDRQgAkHSADYCHCACIAE2AhQgAiAANgIMQQAhAwykAQsgAigCBCEAIAJBADYCBCACIAAgARAlIgBFDQAgAkHlADYCHCACIAE2AhQgAiAANgIMQQAhAwyjAQtB1QAhAwyJAQsgAEEVRwRAIAJBADYCHCACIAE2AhQgAkG5DTYCECACQRo2AgxBACEDDKIBCyACQeQANgIcIAIgATYCFCACQeMXNgIQIAJBFTYCDEEAIQMMoQELIAJBADYCACAGQQFqIQEgAi0AKSIAQSNrQQtJDQQCQCAAQQZLDQBBASAAdEHKAHFFDQAMBQtBACEDIAJBADYCHCACIAE2AhQgAkH3CTYCECACQQg2AgwMoAELIAJBADYCACAGQQFqIQEgAi0AKUEhRg0DIAJBADYCHCACIAE2AhQgAkGbCjYCECACQQg2AgxBACEDDJ8BCyACQQA2AgALQQAhAyACQQA2AhwgAiABNgIUIAJBkDM2AhAgAkEINgIMDJ0BCyACQQA2AgAgBkEBaiEBIAItAClBI0kNACACQQA2AhwgAiABNgIUIAJB0wk2AhAgAkEINgIMQQAhAwycAQtB0QAhAwyCAQsgAS0AAEEwayIAQf8BcUEKSQRAIAIgADoAKiABQQFqIQFBzwAhAwyCAQsgAigCBCEAIAJBADYCBCACIAAgARAoIgBFDYYBIAJB3gA2AhwgAiABNgIUIAIgADYCDEEAIQMMmgELIAIoAgQhACACQQA2AgQgAiAAIAEQKCIARQ2GASACQdwANgIcIAIgATYCFCACIAA2AgxBACEDDJkBCyACKAIEIQAgAkEANgIEIAIgACAFECgiAEUEQCAFIQEMhwELIAJB2gA2AhwgAiAFNgIUIAIgADYCDAyYAQtBACEBQQEhAwsgAiADOgArIAVBAWohAwJAAkACQCACLQAtQRBxDQACQAJAAkAgAi0AKg4DAQACBAsgBkUNAwwCCyAADQEMAgsgAUUNAQsgAigCBCEAIAJBADYCBCACIAAgAxAoIgBFBEAgAyEBDAILIAJB2AA2AhwgAiADNgIUIAIgADYCDEEAIQMMmAELIAIoAgQhACACQQA2AgQgAiAAIAMQKCIARQRAIAMhAQyHAQsgAkHZADYCHCACIAM2AhQgAiAANgIMQQAhAwyXAQtBzAAhAwx9CyAAQRVHBEAgAkEANgIcIAIgATYCFCACQZQNNgIQIAJBITYCDEEAIQMMlgELIAJB1wA2AhwgAiABNgIUIAJByRc2AhAgAkEVNgIMQQAhAwyVAQtBACEDIAJBADYCHCACIAE2AhQgAkGAETYCECACQQk2AgwMlAELIAIoAgQhACACQQA2AgQgAiAAIAEQJSIARQ0AIAJB0wA2AhwgAiABNgIUIAIgADYCDEEAIQMMkwELQckAIQMMeQsgAkEANgIcIAIgATYCFCACQcEoNgIQIAJBBzYCDCACQQA2AgBBACEDDJEBCyACKAIEIQBBACEDIAJBADYCBCACIAAgARAlIgBFDQAgAkHSADYCHCACIAE2AhQgAiAANgIMDJABC0HIACEDDHYLIAJBADYCACAFIQELIAJBgBI7ASogAUEBaiEBQQAhAAJAIAIoAjgiA0UNACADKAIwIgNFDQAgAiADEQAAIQALIAANAQtBxwAhAwxzCyAAQRVGBEAgAkHRADYCHCACIAE2AhQgAkHjFzYCECACQRU2AgxBACEDDIwBC0EAIQMgAkEANgIcIAIgATYCFCACQbkNNgIQIAJBGjYCDAyLAQtBACEDIAJBADYCHCACIAE2AhQgAkGgGTYCECACQR42AgwMigELIAEtAABBOkYEQCACKAIEIQBBACEDIAJBADYCBCACIAAgARApIgBFDQEgAkHDADYCHCACIAA2AgwgAiABQQFqNgIUDIoBC0EAIQMgAkEANgIcIAIgATYCFCACQbERNgIQIAJBCjYCDAyJAQsgAUEBaiEBQTshAwxvCyACQcMANgIcIAIgADYCDCACIAFBAWo2AhQMhwELQQAhAyACQQA2AhwgAiABNgIUIAJB8A42AhAgAkEcNgIMDIYBCyACIAIvATBBEHI7ATAMZgsCQCACLwEwIgBBCHFFDQAgAi0AKEEBRw0AIAItAC1BCHFFDQMLIAIgAEH3+wNxQYAEcjsBMAwECyABIARHBEACQANAIAEtAABBMGsiAEH/AXFBCk8EQEE1IQMMbgsgAikDICIKQpmz5syZs+bMGVYNASACIApCCn4iCjcDICAKIACtQv8BgyILQn+FVg0BIAIgCiALfDcDICAEIAFBAWoiAUcNAAtBOSEDDIUBCyACKAIEIQBBACEDIAJBADYCBCACIAAgAUEBaiIBECoiAA0MDHcLQTkhAwyDAQsgAi0AMEEgcQ0GQcUBIQMMaQtBACEDIAJBADYCBCACIAEgARAqIgBFDQQgAkE6NgIcIAIgADYCDCACIAFBAWo2AhQMgQELIAItAChBAUcNACACLQAtQQhxRQ0BC0E3IQMMZgsgAigCBCEAQQAhAyACQQA2AgQgAiAAIAEQKiIABEAgAkE7NgIcIAIgADYCDCACIAFBAWo2AhQMfwsgAUEBaiEBDG4LIAJBCDoALAwECyABQQFqIQEMbQtBACEDIAJBADYCHCACIAE2AhQgAkHkEjYCECACQQQ2AgwMewsgAigCBCEAQQAhAyACQQA2AgQgAiAAIAEQKiIARQ1sIAJBNzYCHCACIAE2AhQgAiAANgIMDHoLIAIgAi8BMEEgcjsBMAtBMCEDDF8LIAJBNjYCHCACIAE2AhQgAiAANgIMDHcLIABBLEcNASABQQFqIQBBASEBAkACQAJAAkACQCACLQAsQQVrDgQDAQIEAAsgACEBDAQLQQIhAQwBC0EEIQELIAJBAToALCACIAIvATAgAXI7ATAgACEBDAELIAIgAi8BMEEIcjsBMCAAIQELQTkhAwxcCyACQQA6ACwLQTQhAwxaCyABIARGBEBBLSEDDHMLAkACQANAAkAgAS0AAEEKaw4EAgAAAwALIAQgAUEBaiIBRw0AC0EtIQMMdAsgAigCBCEAQQAhAyACQQA2AgQgAiAAIAEQKiIARQ0CIAJBLDYCHCACIAE2AhQgAiAANgIMDHMLIAIoAgQhAEEAIQMgAkEANgIEIAIgACABECoiAEUEQCABQQFqIQEMAgsgAkEsNgIcIAIgADYCDCACIAFBAWo2AhQMcgsgAS0AAEENRgRAIAIoAgQhAEEAIQMgAkEANgIEIAIgACABECoiAEUEQCABQQFqIQEMAgsgAkEsNgIcIAIgADYCDCACIAFBAWo2AhQMcgsgAi0ALUEBcQRAQcQBIQMMWQsgAigCBCEAQQAhAyACQQA2AgQgAiAAIAEQKiIADQEMZQtBLyEDDFcLIAJBLjYCHCACIAE2AhQgAiAANgIMDG8LQQAhAyACQQA2AhwgAiABNgIUIAJB8BQ2AhAgAkEDNgIMDG4LQQEhAwJAAkACQAJAIAItACxBBWsOBAMBAgAECyACIAIvATBBCHI7ATAMAwtBAiEDDAELQQQhAwsgAkEBOgAsIAIgAi8BMCADcjsBMAtBKiEDDFMLQQAhAyACQQA2AhwgAiABNgIUIAJB4Q82AhAgAkEKNgIMDGsLQQEhAwJAAkACQAJAAkACQCACLQAsQQJrDgcFBAQDAQIABAsgAiACLwEwQQhyOwEwDAMLQQIhAwwBC0EEIQMLIAJBAToALCACIAIvATAgA3I7ATALQSshAwxSC0EAIQMgAkEANgIcIAIgATYCFCACQasSNgIQIAJBCzYCDAxqC0EAIQMgAkEANgIcIAIgATYCFCACQf0NNgIQIAJBHTYCDAxpCyABIARHBEADQCABLQAAQSBHDUggBCABQQFqIgFHDQALQSUhAwxpC0ElIQMMaAsgAi0ALUEBcQRAQcMBIQMMTwsgAigCBCEAQQAhAyACQQA2AgQgAiAAIAEQKSIABEAgAkEmNgIcIAIgADYCDCACIAFBAWo2AhQMaAsgAUEBaiEBDFwLIAFBAWohASACLwEwIgBBgAFxBEBBACEAAkAgAigCOCIDRQ0AIAMoAlQiA0UNACACIAMRAAAhAAsgAEUNBiAAQRVHDR8gAkEFNgIcIAIgATYCFCACQfkXNgIQIAJBFTYCDEEAIQMMZwsCQCAAQaAEcUGgBEcNACACLQAtQQJxDQBBACEDIAJBADYCHCACIAE2AhQgAkGWEzYCECACQQQ2AgwMZwsgAgJ/IAIvATBBFHFBFEYEQEEBIAItAChBAUYNARogAi8BMkHlAEYMAQsgAi0AKUEFRgs6AC5BACEAAkAgAigCOCIDRQ0AIAMoAiQiA0UNACACIAMRAAAhAAsCQAJAAkACQAJAIAAOFgIBAAQEBAQEBAQEBAQEBAQEBAQEBAMECyACQQE6AC4LIAIgAi8BMEHAAHI7ATALQSchAwxPCyACQSM2AhwgAiABNgIUIAJBpRY2AhAgAkEVNgIMQQAhAwxnC0EAIQMgAkEANgIcIAIgATYCFCACQdULNgIQIAJBETYCDAxmC0EAIQACQCACKAI4IgNFDQAgAygCLCIDRQ0AIAIgAxEAACEACyAADQELQQ4hAwxLCyAAQRVGBEAgAkECNgIcIAIgATYCFCACQbAYNgIQIAJBFTYCDEEAIQMMZAtBACEDIAJBADYCHCACIAE2AhQgAkGnDjYCECACQRI2AgwMYwtBACEDIAJBADYCHCACIAE2AhQgAkGqHDYCECACQQ82AgwMYgsgAigCBCEAQQAhAyACQQA2AgQgAiAAIAEgCqdqIgEQKyIARQ0AIAJBBTYCHCACIAE2AhQgAiAANgIMDGELQQ8hAwxHC0EAIQMgAkEANgIcIAIgATYCFCACQc0TNgIQIAJBDDYCDAxfC0IBIQoLIAFBAWohAQJAIAIpAyAiC0L//////////w9YBEAgAiALQgSGIAqENwMgDAELQQAhAyACQQA2AhwgAiABNgIUIAJBrQk2AhAgAkEMNgIMDF4LQSQhAwxEC0EAIQMgAkEANgIcIAIgATYCFCACQc0TNgIQIAJBDDYCDAxcCyACKAIEIQBBACEDIAJBADYCBCACIAAgARAsIgBFBEAgAUEBaiEBDFILIAJBFzYCHCACIAA2AgwgAiABQQFqNgIUDFsLIAIoAgQhAEEAIQMgAkEANgIEAkAgAiAAIAEQLCIARQRAIAFBAWohAQwBCyACQRY2AhwgAiAANgIMIAIgAUEBajYCFAxbC0EfIQMMQQtBACEDIAJBADYCHCACIAE2AhQgAkGaDzYCECACQSI2AgwMWQsgAigCBCEAQQAhAyACQQA2AgQgAiAAIAEQLSIARQRAIAFBAWohAQxQCyACQRQ2AhwgAiAANgIMIAIgAUEBajYCFAxYCyACKAIEIQBBACEDIAJBADYCBAJAIAIgACABEC0iAEUEQCABQQFqIQEMAQsgAkETNgIcIAIgADYCDCACIAFBAWo2AhQMWAtBHiEDDD4LQQAhAyACQQA2AhwgAiABNgIUIAJBxgw2AhAgAkEjNgIMDFYLIAIoAgQhAEEAIQMgAkEANgIEIAIgACABEC0iAEUEQCABQQFqIQEMTgsgAkERNgIcIAIgADYCDCACIAFBAWo2AhQMVQsgAkEQNgIcIAIgATYCFCACIAA2AgwMVAtBACEDIAJBADYCHCACIAE2AhQgAkHGDDYCECACQSM2AgwMUwtBACEDIAJBADYCHCACIAE2AhQgAkHAFTYCECACQQI2AgwMUgsgAigCBCEAQQAhAyACQQA2AgQCQCACIAAgARAtIgBFBEAgAUEBaiEBDAELIAJBDjYCHCACIAA2AgwgAiABQQFqNgIUDFILQRshAww4C0EAIQMgAkEANgIcIAIgATYCFCACQcYMNgIQIAJBIzYCDAxQCyACKAIEIQBBACEDIAJBADYCBAJAIAIgACABECwiAEUEQCABQQFqIQEMAQsgAkENNgIcIAIgADYCDCACIAFBAWo2AhQMUAtBGiEDDDYLQQAhAyACQQA2AhwgAiABNgIUIAJBmg82AhAgAkEiNgIMDE4LIAIoAgQhAEEAIQMgAkEANgIEAkAgAiAAIAEQLCIARQRAIAFBAWohAQwBCyACQQw2AhwgAiAANgIMIAIgAUEBajYCFAxOC0EZIQMMNAtBACEDIAJBADYCHCACIAE2AhQgAkGaDzYCECACQSI2AgwMTAsgAEEVRwRAQQAhAyACQQA2AhwgAiABNgIUIAJBgww2AhAgAkETNgIMDEwLIAJBCjYCHCACIAE2AhQgAkHkFjYCECACQRU2AgxBACEDDEsLIAIoAgQhAEEAIQMgAkEANgIEIAIgACABIAqnaiIBECsiAARAIAJBBzYCHCACIAE2AhQgAiAANgIMDEsLQRMhAwwxCyAAQRVHBEBBACEDIAJBADYCHCACIAE2AhQgAkHaDTYCECACQRQ2AgwMSgsgAkEeNgIcIAIgATYCFCACQfkXNgIQIAJBFTYCDEEAIQMMSQtBACEAAkAgAigCOCIDRQ0AIAMoAiwiA0UNACACIAMRAAAhAAsgAEUNQSAAQRVGBEAgAkEDNgIcIAIgATYCFCACQbAYNgIQIAJBFTYCDEEAIQMMSQtBACEDIAJBADYCHCACIAE2AhQgAkGnDjYCECACQRI2AgwMSAtBACEDIAJBADYCHCACIAE2AhQgAkHaDTYCECACQRQ2AgwMRwtBACEDIAJBADYCHCACIAE2AhQgAkGnDjYCECACQRI2AgwMRgsgAkEAOgAvIAItAC1BBHFFDT8LIAJBADoALyACQQE6ADRBACEDDCsLQQAhAyACQQA2AhwgAkHkETYCECACQQc2AgwgAiABQQFqNgIUDEMLAkADQAJAIAEtAABBCmsOBAACAgACCyAEIAFBAWoiAUcNAAtB3QEhAwxDCwJAAkAgAi0ANEEBRw0AQQAhAAJAIAIoAjgiA0UNACADKAJYIgNFDQAgAiADEQAAIQALIABFDQAgAEEVRw0BIAJB3AE2AhwgAiABNgIUIAJB1RY2AhAgAkEVNgIMQQAhAwxEC0HBASEDDCoLIAJBADYCHCACIAE2AhQgAkHpCzYCECACQR82AgxBACEDDEILAkACQCACLQAoQQFrDgIEAQALQcABIQMMKQtBuQEhAwwoCyACQQI6AC9BACEAAkAgAigCOCIDRQ0AIAMoAgAiA0UNACACIAMRAAAhAAsgAEUEQEHCASEDDCgLIABBFUcEQCACQQA2AhwgAiABNgIUIAJBpAw2AhAgAkEQNgIMQQAhAwxBCyACQdsBNgIcIAIgATYCFCACQfoWNgIQIAJBFTYCDEEAIQMMQAsgASAERgRAQdoBIQMMQAsgAS0AAEHIAEYNASACQQE6ACgLQawBIQMMJQtBvwEhAwwkCyABIARHBEAgAkEQNgIIIAIgATYCBEG+ASEDDCQLQdkBIQMMPAsgASAERgRAQdgBIQMMPAsgAS0AAEHIAEcNBCABQQFqIQFBvQEhAwwiCyABIARGBEBB1wEhAww7CwJAAkAgAS0AAEHFAGsOEAAFBQUFBQUFBQUFBQUFBQEFCyABQQFqIQFBuwEhAwwiCyABQQFqIQFBvAEhAwwhC0HWASEDIAEgBEYNOSACKAIAIgAgBCABa2ohBSABIABrQQJqIQYCQANAIAEtAAAgAEGD0ABqLQAARw0DIABBAkYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAw6CyACKAIEIQAgAkIANwMAIAIgACAGQQFqIgEQJyIARQRAQcYBIQMMIQsgAkHVATYCHCACIAE2AhQgAiAANgIMQQAhAww5C0HUASEDIAEgBEYNOCACKAIAIgAgBCABa2ohBSABIABrQQFqIQYCQANAIAEtAAAgAEGB0ABqLQAARw0CIABBAUYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAw5CyACQYEEOwEoIAIoAgQhACACQgA3AwAgAiAAIAZBAWoiARAnIgANAwwCCyACQQA2AgALQQAhAyACQQA2AhwgAiABNgIUIAJB2Bs2AhAgAkEINgIMDDYLQboBIQMMHAsgAkHTATYCHCACIAE2AhQgAiAANgIMQQAhAww0C0EAIQACQCACKAI4IgNFDQAgAygCOCIDRQ0AIAIgAxEAACEACyAARQ0AIABBFUYNASACQQA2AhwgAiABNgIUIAJBzA42AhAgAkEgNgIMQQAhAwwzC0HkACEDDBkLIAJB+AA2AhwgAiABNgIUIAJByhg2AhAgAkEVNgIMQQAhAwwxC0HSASEDIAQgASIARg0wIAQgAWsgAigCACIBaiEFIAAgAWtBBGohBgJAA0AgAC0AACABQfzPAGotAABHDQEgAUEERg0DIAFBAWohASAEIABBAWoiAEcNAAsgAiAFNgIADDELIAJBADYCHCACIAA2AhQgAkGQMzYCECACQQg2AgwgAkEANgIAQQAhAwwwCyABIARHBEAgAkEONgIIIAIgATYCBEG3ASEDDBcLQdEBIQMMLwsgAkEANgIAIAZBAWohAQtBuAEhAwwUCyABIARGBEBB0AEhAwwtCyABLQAAQTBrIgBB/wFxQQpJBEAgAiAAOgAqIAFBAWohAUG2ASEDDBQLIAIoAgQhACACQQA2AgQgAiAAIAEQKCIARQ0UIAJBzwE2AhwgAiABNgIUIAIgADYCDEEAIQMMLAsgASAERgRAQc4BIQMMLAsCQCABLQAAQS5GBEAgAUEBaiEBDAELIAIoAgQhACACQQA2AgQgAiAAIAEQKCIARQ0VIAJBzQE2AhwgAiABNgIUIAIgADYCDEEAIQMMLAtBtQEhAwwSCyAEIAEiBUYEQEHMASEDDCsLQQAhAEEBIQFBASEGQQAhAwJAAkACQAJAAkACfwJAAkACQAJAAkACQAJAIAUtAABBMGsOCgoJAAECAwQFBggLC0ECDAYLQQMMBQtBBAwEC0EFDAMLQQYMAgtBBwwBC0EICyEDQQAhAUEAIQYMAgtBCSEDQQEhAEEAIQFBACEGDAELQQAhAUEBIQMLIAIgAzoAKyAFQQFqIQMCQAJAIAItAC1BEHENAAJAAkACQCACLQAqDgMBAAIECyAGRQ0DDAILIAANAQwCCyABRQ0BCyACKAIEIQAgAkEANgIEIAIgACADECgiAEUEQCADIQEMAwsgAkHJATYCHCACIAM2AhQgAiAANgIMQQAhAwwtCyACKAIEIQAgAkEANgIEIAIgACADECgiAEUEQCADIQEMGAsgAkHKATYCHCACIAM2AhQgAiAANgIMQQAhAwwsCyACKAIEIQAgAkEANgIEIAIgACAFECgiAEUEQCAFIQEMFgsgAkHLATYCHCACIAU2AhQgAiAANgIMDCsLQbQBIQMMEQtBACEAAkAgAigCOCIDRQ0AIAMoAjwiA0UNACACIAMRAAAhAAsCQCAABEAgAEEVRg0BIAJBADYCHCACIAE2AhQgAkGUDTYCECACQSE2AgxBACEDDCsLQbIBIQMMEQsgAkHIATYCHCACIAE2AhQgAkHJFzYCECACQRU2AgxBACEDDCkLIAJBADYCACAGQQFqIQFB9QAhAwwPCyACLQApQQVGBEBB4wAhAwwPC0HiACEDDA4LIAAhASACQQA2AgALIAJBADoALEEJIQMMDAsgAkEANgIAIAdBAWohAUHAACEDDAsLQQELOgAsIAJBADYCACAGQQFqIQELQSkhAwwIC0E4IQMMBwsCQCABIARHBEADQCABLQAAQYA+ai0AACIAQQFHBEAgAEECRw0DIAFBAWohAQwFCyAEIAFBAWoiAUcNAAtBPiEDDCELQT4hAwwgCwsgAkEAOgAsDAELQQshAwwEC0E6IQMMAwsgAUEBaiEBQS0hAwwCCyACIAE6ACwgAkEANgIAIAZBAWohAUEMIQMMAQsgAkEANgIAIAZBAWohAUEKIQMMAAsAC0EAIQMgAkEANgIcIAIgATYCFCACQc0QNgIQIAJBCTYCDAwXC0EAIQMgAkEANgIcIAIgATYCFCACQekKNgIQIAJBCTYCDAwWC0EAIQMgAkEANgIcIAIgATYCFCACQbcQNgIQIAJBCTYCDAwVC0EAIQMgAkEANgIcIAIgATYCFCACQZwRNgIQIAJBCTYCDAwUC0EAIQMgAkEANgIcIAIgATYCFCACQc0QNgIQIAJBCTYCDAwTC0EAIQMgAkEANgIcIAIgATYCFCACQekKNgIQIAJBCTYCDAwSC0EAIQMgAkEANgIcIAIgATYCFCACQbcQNgIQIAJBCTYCDAwRC0EAIQMgAkEANgIcIAIgATYCFCACQZwRNgIQIAJBCTYCDAwQC0EAIQMgAkEANgIcIAIgATYCFCACQZcVNgIQIAJBDzYCDAwPC0EAIQMgAkEANgIcIAIgATYCFCACQZcVNgIQIAJBDzYCDAwOC0EAIQMgAkEANgIcIAIgATYCFCACQcASNgIQIAJBCzYCDAwNC0EAIQMgAkEANgIcIAIgATYCFCACQZUJNgIQIAJBCzYCDAwMC0EAIQMgAkEANgIcIAIgATYCFCACQeEPNgIQIAJBCjYCDAwLC0EAIQMgAkEANgIcIAIgATYCFCACQfsPNgIQIAJBCjYCDAwKC0EAIQMgAkEANgIcIAIgATYCFCACQfEZNgIQIAJBAjYCDAwJC0EAIQMgAkEANgIcIAIgATYCFCACQcQUNgIQIAJBAjYCDAwIC0EAIQMgAkEANgIcIAIgATYCFCACQfIVNgIQIAJBAjYCDAwHCyACQQI2AhwgAiABNgIUIAJBnBo2AhAgAkEWNgIMQQAhAwwGC0EBIQMMBQtB1AAhAyABIARGDQQgCEEIaiEJIAIoAgAhBQJAAkAgASAERwRAIAVB2MIAaiEHIAQgBWogAWshACAFQX9zQQpqIgUgAWohBgNAIAEtAAAgBy0AAEcEQEECIQcMAwsgBUUEQEEAIQcgBiEBDAMLIAVBAWshBSAHQQFqIQcgBCABQQFqIgFHDQALIAAhBSAEIQELIAlBATYCACACIAU2AgAMAQsgAkEANgIAIAkgBzYCAAsgCSABNgIEIAgoAgwhACAIKAIIDgMBBAIACwALIAJBADYCHCACQbUaNgIQIAJBFzYCDCACIABBAWo2AhRBACEDDAILIAJBADYCHCACIAA2AhQgAkHKGjYCECACQQk2AgxBACEDDAELIAEgBEYEQEEiIQMMAQsgAkEJNgIIIAIgATYCBEEhIQMLIAhBEGokACADRQRAIAIoAgwhAAwBCyACIAM2AhxBACEAIAIoAgQiAUUNACACIAEgBCACKAIIEQEAIgFFDQAgAiAENgIUIAIgATYCDCABIQALIAALvgIBAn8gAEEAOgAAIABB3ABqIgFBAWtBADoAACAAQQA6AAIgAEEAOgABIAFBA2tBADoAACABQQJrQQA6AAAgAEEAOgADIAFBBGtBADoAAEEAIABrQQNxIgEgAGoiAEEANgIAQdwAIAFrQXxxIgIgAGoiAUEEa0EANgIAAkAgAkEJSQ0AIABBADYCCCAAQQA2AgQgAUEIa0EANgIAIAFBDGtBADYCACACQRlJDQAgAEEANgIYIABBADYCFCAAQQA2AhAgAEEANgIMIAFBEGtBADYCACABQRRrQQA2AgAgAUEYa0EANgIAIAFBHGtBADYCACACIABBBHFBGHIiAmsiAUEgSQ0AIAAgAmohAANAIABCADcDGCAAQgA3AxAgAEIANwMIIABCADcDACAAQSBqIQAgAUEgayIBQR9LDQALCwtWAQF/AkAgACgCDA0AAkACQAJAAkAgAC0ALw4DAQADAgsgACgCOCIBRQ0AIAEoAiwiAUUNACAAIAERAAAiAQ0DC0EADwsACyAAQcMWNgIQQQ4hAQsgAQsaACAAKAIMRQRAIABB0Rs2AhAgAEEVNgIMCwsUACAAKAIMQRVGBEAgAEEANgIMCwsUACAAKAIMQRZGBEAgAEEANgIMCwsHACAAKAIMCwcAIAAoAhALCQAgACABNgIQCwcAIAAoAhQLFwAgAEEkTwRAAAsgAEECdEGgM2ooAgALFwAgAEEuTwRAAAsgAEECdEGwNGooAgALvwkBAX9B6yghAQJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAIABB5ABrDvQDY2IAAWFhYWFhYQIDBAVhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhBgcICQoLDA0OD2FhYWFhEGFhYWFhYWFhYWFhEWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYRITFBUWFxgZGhthYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhHB0eHyAhIiMkJSYnKCkqKywtLi8wMTIzNDU2YTc4OTphYWFhYWFhYTthYWE8YWFhYT0+P2FhYWFhYWFhQGFhQWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYUJDREVGR0hJSktMTU5PUFFSU2FhYWFhYWFhVFVWV1hZWlthXF1hYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFeYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhX2BhC0HhJw8LQaQhDwtByywPC0H+MQ8LQcAkDwtBqyQPC0GNKA8LQeImDwtBgDAPC0G5Lw8LQdckDwtB7x8PC0HhHw8LQfofDwtB8iAPC0GoLw8LQa4yDwtBiDAPC0HsJw8LQYIiDwtBjh0PC0HQLg8LQcojDwtBxTIPC0HfHA8LQdIcDwtBxCAPC0HXIA8LQaIfDwtB7S4PC0GrMA8LQdQlDwtBzC4PC0H6Lg8LQfwrDwtB0jAPC0HxHQ8LQbsgDwtB9ysPC0GQMQ8LQdcxDwtBoi0PC0HUJw8LQeArDwtBnywPC0HrMQ8LQdUfDwtByjEPC0HeJQ8LQdQeDwtB9BwPC0GnMg8LQbEdDwtBoB0PC0G5MQ8LQbwwDwtBkiEPC0GzJg8LQeksDwtBrB4PC0HUKw8LQfcmDwtBgCYPC0GwIQ8LQf4eDwtBjSMPC0GJLQ8LQfciDwtBoDEPC0GuHw8LQcYlDwtB6B4PC0GTIg8LQcIvDwtBwx0PC0GLLA8LQeEdDwtBjS8PC0HqIQ8LQbQtDwtB0i8PC0HfMg8LQdIyDwtB8DAPC0GpIg8LQfkjDwtBmR4PC0G1LA8LQZswDwtBkjIPC0G2Kw8LQcIiDwtB+DIPC0GeJQ8LQdAiDwtBuh4PC0GBHg8LAAtB1iEhAQsgAQsWACAAIAAtAC1B/gFxIAFBAEdyOgAtCxkAIAAgAC0ALUH9AXEgAUEAR0EBdHI6AC0LGQAgACAALQAtQfsBcSABQQBHQQJ0cjoALQsZACAAIAAtAC1B9wFxIAFBAEdBA3RyOgAtCz4BAn8CQCAAKAI4IgNFDQAgAygCBCIDRQ0AIAAgASACIAFrIAMRAQAiBEF/Rw0AIABBxhE2AhBBGCEECyAECz4BAn8CQCAAKAI4IgNFDQAgAygCCCIDRQ0AIAAgASACIAFrIAMRAQAiBEF/Rw0AIABB9go2AhBBGCEECyAECz4BAn8CQCAAKAI4IgNFDQAgAygCDCIDRQ0AIAAgASACIAFrIAMRAQAiBEF/Rw0AIABB7Ro2AhBBGCEECyAECz4BAn8CQCAAKAI4IgNFDQAgAygCECIDRQ0AIAAgASACIAFrIAMRAQAiBEF/Rw0AIABBlRA2AhBBGCEECyAECz4BAn8CQCAAKAI4IgNFDQAgAygCFCIDRQ0AIAAgASACIAFrIAMRAQAiBEF/Rw0AIABBqhs2AhBBGCEECyAECz4BAn8CQCAAKAI4IgNFDQAgAygCGCIDRQ0AIAAgASACIAFrIAMRAQAiBEF/Rw0AIABB7RM2AhBBGCEECyAECz4BAn8CQCAAKAI4IgNFDQAgAygCKCIDRQ0AIAAgASACIAFrIAMRAQAiBEF/Rw0AIABB9gg2AhBBGCEECyAECz4BAn8CQCAAKAI4IgNFDQAgAygCHCIDRQ0AIAAgASACIAFrIAMRAQAiBEF/Rw0AIABBwhk2AhBBGCEECyAECz4BAn8CQCAAKAI4IgNFDQAgAygCICIDRQ0AIAAgASACIAFrIAMRAQAiBEF/Rw0AIABBlBQ2AhBBGCEECyAEC1kBAn8CQCAALQAoQQFGDQAgAC8BMiIBQeQAa0HkAEkNACABQcwBRg0AIAFBsAJGDQAgAC8BMCIAQcAAcQ0AQQEhAiAAQYgEcUGABEYNACAAQShxRSECCyACC4wBAQJ/AkACQAJAIAAtACpFDQAgAC0AK0UNACAALwEwIgFBAnFFDQEMAgsgAC8BMCIBQQFxRQ0BC0EBIQIgAC0AKEEBRg0AIAAvATIiAEHkAGtB5ABJDQAgAEHMAUYNACAAQbACRg0AIAFBwABxDQBBACECIAFBiARxQYAERg0AIAFBKHFBAEchAgsgAgtzACAAQRBq/QwAAAAAAAAAAAAAAAAAAAAA/QsDACAA/QwAAAAAAAAAAAAAAAAAAAAA/QsDACAAQTBq/QwAAAAAAAAAAAAAAAAAAAAA/QsDACAAQSBq/QwAAAAAAAAAAAAAAAAAAAAA/QsDACAAQd0BNgIcCwYAIAAQMguaLQELfyMAQRBrIgokAEGk0AAoAgAiCUUEQEHk0wAoAgAiBUUEQEHw0wBCfzcCAEHo0wBCgICEgICAwAA3AgBB5NMAIApBCGpBcHFB2KrVqgVzIgU2AgBB+NMAQQA2AgBByNMAQQA2AgALQczTAEGA1AQ2AgBBnNAAQYDUBDYCAEGw0AAgBTYCAEGs0ABBfzYCAEHQ0wBBgKwDNgIAA0AgAUHI0ABqIAFBvNAAaiICNgIAIAIgAUG00ABqIgM2AgAgAUHA0ABqIAM2AgAgAUHQ0ABqIAFBxNAAaiIDNgIAIAMgAjYCACABQdjQAGogAUHM0ABqIgI2AgAgAiADNgIAIAFB1NAAaiACNgIAIAFBIGoiAUGAAkcNAAtBjNQEQcGrAzYCAEGo0ABB9NMAKAIANgIAQZjQAEHAqwM2AgBBpNAAQYjUBDYCAEHM/wdBODYCAEGI1AQhCQsCQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQCAAQewBTQRAQYzQACgCACIGQRAgAEETakFwcSAAQQtJGyIEQQN2IgB2IgFBA3EEQAJAIAFBAXEgAHJBAXMiAkEDdCIAQbTQAGoiASAAQbzQAGooAgAiACgCCCIDRgRAQYzQACAGQX4gAndxNgIADAELIAEgAzYCCCADIAE2AgwLIABBCGohASAAIAJBA3QiAkEDcjYCBCAAIAJqIgAgACgCBEEBcjYCBAwRC0GU0AAoAgAiCCAETw0BIAEEQAJAQQIgAHQiAkEAIAJrciABIAB0cWgiAEEDdCICQbTQAGoiASACQbzQAGooAgAiAigCCCIDRgRAQYzQACAGQX4gAHdxIgY2AgAMAQsgASADNgIIIAMgATYCDAsgAiAEQQNyNgIEIABBA3QiACAEayEFIAAgAmogBTYCACACIARqIgQgBUEBcjYCBCAIBEAgCEF4cUG00ABqIQBBoNAAKAIAIQMCf0EBIAhBA3Z0IgEgBnFFBEBBjNAAIAEgBnI2AgAgAAwBCyAAKAIICyIBIAM2AgwgACADNgIIIAMgADYCDCADIAE2AggLIAJBCGohAUGg0AAgBDYCAEGU0AAgBTYCAAwRC0GQ0AAoAgAiC0UNASALaEECdEG80gBqKAIAIgAoAgRBeHEgBGshBSAAIQIDQAJAIAIoAhAiAUUEQCACQRRqKAIAIgFFDQELIAEoAgRBeHEgBGsiAyAFSSECIAMgBSACGyEFIAEgACACGyEAIAEhAgwBCwsgACgCGCEJIAAoAgwiAyAARwRAQZzQACgCABogAyAAKAIIIgE2AgggASADNgIMDBALIABBFGoiAigCACIBRQRAIAAoAhAiAUUNAyAAQRBqIQILA0AgAiEHIAEiA0EUaiICKAIAIgENACADQRBqIQIgAygCECIBDQALIAdBADYCAAwPC0F/IQQgAEG/f0sNACAAQRNqIgFBcHEhBEGQ0AAoAgAiCEUNAEEAIARrIQUCQAJAAkACf0EAIARBgAJJDQAaQR8gBEH///8HSw0AGiAEQSYgAUEIdmciAGt2QQFxIABBAXRrQT5qCyIGQQJ0QbzSAGooAgAiAkUEQEEAIQFBACEDDAELQQAhASAEQRkgBkEBdmtBACAGQR9HG3QhAEEAIQMDQAJAIAIoAgRBeHEgBGsiByAFTw0AIAIhAyAHIgUNAEEAIQUgAiEBDAMLIAEgAkEUaigCACIHIAcgAiAAQR12QQRxakEQaigCACICRhsgASAHGyEBIABBAXQhACACDQALCyABIANyRQRAQQAhA0ECIAZ0IgBBACAAa3IgCHEiAEUNAyAAaEECdEG80gBqKAIAIQELIAFFDQELA0AgASgCBEF4cSAEayICIAVJIQAgAiAFIAAbIQUgASADIAAbIQMgASgCECIABH8gAAUgAUEUaigCAAsiAQ0ACwsgA0UNACAFQZTQACgCACAEa08NACADKAIYIQcgAyADKAIMIgBHBEBBnNAAKAIAGiAAIAMoAggiATYCCCABIAA2AgwMDgsgA0EUaiICKAIAIgFFBEAgAygCECIBRQ0DIANBEGohAgsDQCACIQYgASIAQRRqIgIoAgAiAQ0AIABBEGohAiAAKAIQIgENAAsgBkEANgIADA0LQZTQACgCACIDIARPBEBBoNAAKAIAIQECQCADIARrIgJBEE8EQCABIARqIgAgAkEBcjYCBCABIANqIAI2AgAgASAEQQNyNgIEDAELIAEgA0EDcjYCBCABIANqIgAgACgCBEEBcjYCBEEAIQBBACECC0GU0AAgAjYCAEGg0AAgADYCACABQQhqIQEMDwtBmNAAKAIAIgMgBEsEQCAEIAlqIgAgAyAEayIBQQFyNgIEQaTQACAANgIAQZjQACABNgIAIAkgBEEDcjYCBCAJQQhqIQEMDwtBACEBIAQCf0Hk0wAoAgAEQEHs0wAoAgAMAQtB8NMAQn83AgBB6NMAQoCAhICAgMAANwIAQeTTACAKQQxqQXBxQdiq1aoFczYCAEH40wBBADYCAEHI0wBBADYCAEGAgAQLIgAgBEHHAGoiBWoiBkEAIABrIgdxIgJPBEBB/NMAQTA2AgAMDwsCQEHE0wAoAgAiAUUNAEG80wAoAgAiCCACaiEAIAAgAU0gACAIS3ENAEEAIQFB/NMAQTA2AgAMDwtByNMALQAAQQRxDQQCQAJAIAkEQEHM0wAhAQNAIAEoAgAiACAJTQRAIAAgASgCBGogCUsNAwsgASgCCCIBDQALC0EAEDMiAEF/Rg0FIAIhBkHo0wAoAgAiAUEBayIDIABxBEAgAiAAayAAIANqQQAgAWtxaiEGCyAEIAZPDQUgBkH+////B0sNBUHE0wAoAgAiAwRAQbzTACgCACIHIAZqIQEgASAHTQ0GIAEgA0sNBgsgBhAzIgEgAEcNAQwHCyAGIANrIAdxIgZB/v///wdLDQQgBhAzIQAgACABKAIAIAEoAgRqRg0DIAAhAQsCQCAGIARByABqTw0AIAFBf0YNAEHs0wAoAgAiACAFIAZrakEAIABrcSIAQf7///8HSwRAIAEhAAwHCyAAEDNBf0cEQCAAIAZqIQYgASEADAcLQQAgBmsQMxoMBAsgASIAQX9HDQUMAwtBACEDDAwLQQAhAAwKCyAAQX9HDQILQcjTAEHI0wAoAgBBBHI2AgALIAJB/v///wdLDQEgAhAzIQBBABAzIQEgAEF/Rg0BIAFBf0YNASAAIAFPDQEgASAAayIGIARBOGpNDQELQbzTAEG80wAoAgAgBmoiATYCAEHA0wAoAgAgAUkEQEHA0wAgATYCAAsCQAJAAkBBpNAAKAIAIgIEQEHM0wAhAQNAIAAgASgCACIDIAEoAgQiBWpGDQIgASgCCCIBDQALDAILQZzQACgCACIBQQBHIAAgAU9xRQRAQZzQACAANgIAC0EAIQFB0NMAIAY2AgBBzNMAIAA2AgBBrNAAQX82AgBBsNAAQeTTACgCADYCAEHY0wBBADYCAANAIAFByNAAaiABQbzQAGoiAjYCACACIAFBtNAAaiIDNgIAIAFBwNAAaiADNgIAIAFB0NAAaiABQcTQAGoiAzYCACADIAI2AgAgAUHY0ABqIAFBzNAAaiICNgIAIAIgAzYCACABQdTQAGogAjYCACABQSBqIgFBgAJHDQALQXggAGtBD3EiASAAaiICIAZBOGsiAyABayIBQQFyNgIEQajQAEH00wAoAgA2AgBBmNAAIAE2AgBBpNAAIAI2AgAgACADakE4NgIEDAILIAAgAk0NACACIANJDQAgASgCDEEIcQ0AQXggAmtBD3EiACACaiIDQZjQACgCACAGaiIHIABrIgBBAXI2AgQgASAFIAZqNgIEQajQAEH00wAoAgA2AgBBmNAAIAA2AgBBpNAAIAM2AgAgAiAHakE4NgIEDAELIABBnNAAKAIASQRAQZzQACAANgIACyAAIAZqIQNBzNMAIQECQAJAAkADQCADIAEoAgBHBEAgASgCCCIBDQEMAgsLIAEtAAxBCHFFDQELQczTACEBA0AgASgCACIDIAJNBEAgAyABKAIEaiIFIAJLDQMLIAEoAgghAQwACwALIAEgADYCACABIAEoAgQgBmo2AgQgAEF4IABrQQ9xaiIJIARBA3I2AgQgA0F4IANrQQ9xaiIGIAQgCWoiBGshASACIAZGBEBBpNAAIAQ2AgBBmNAAQZjQACgCACABaiIANgIAIAQgAEEBcjYCBAwIC0Gg0AAoAgAgBkYEQEGg0AAgBDYCAEGU0ABBlNAAKAIAIAFqIgA2AgAgBCAAQQFyNgIEIAAgBGogADYCAAwICyAGKAIEIgVBA3FBAUcNBiAFQXhxIQggBUH/AU0EQCAFQQN2IQMgBigCCCIAIAYoAgwiAkYEQEGM0ABBjNAAKAIAQX4gA3dxNgIADAcLIAIgADYCCCAAIAI2AgwMBgsgBigCGCEHIAYgBigCDCIARwRAIAAgBigCCCICNgIIIAIgADYCDAwFCyAGQRRqIgIoAgAiBUUEQCAGKAIQIgVFDQQgBkEQaiECCwNAIAIhAyAFIgBBFGoiAigCACIFDQAgAEEQaiECIAAoAhAiBQ0ACyADQQA2AgAMBAtBeCAAa0EPcSIBIABqIgcgBkE4ayIDIAFrIgFBAXI2AgQgACADakE4NgIEIAIgBUE3IAVrQQ9xakE/ayIDIAMgAkEQakkbIgNBIzYCBEGo0ABB9NMAKAIANgIAQZjQACABNgIAQaTQACAHNgIAIANBEGpB1NMAKQIANwIAIANBzNMAKQIANwIIQdTTACADQQhqNgIAQdDTACAGNgIAQczTACAANgIAQdjTAEEANgIAIANBJGohAQNAIAFBBzYCACAFIAFBBGoiAUsNAAsgAiADRg0AIAMgAygCBEF+cTYCBCADIAMgAmsiBTYCACACIAVBAXI2AgQgBUH/AU0EQCAFQXhxQbTQAGohAAJ/QYzQACgCACIBQQEgBUEDdnQiA3FFBEBBjNAAIAEgA3I2AgAgAAwBCyAAKAIICyIBIAI2AgwgACACNgIIIAIgADYCDCACIAE2AggMAQtBHyEBIAVB////B00EQCAFQSYgBUEIdmciAGt2QQFxIABBAXRrQT5qIQELIAIgATYCHCACQgA3AhAgAUECdEG80gBqIQBBkNAAKAIAIgNBASABdCIGcUUEQCAAIAI2AgBBkNAAIAMgBnI2AgAgAiAANgIYIAIgAjYCCCACIAI2AgwMAQsgBUEZIAFBAXZrQQAgAUEfRxt0IQEgACgCACEDAkADQCADIgAoAgRBeHEgBUYNASABQR12IQMgAUEBdCEBIAAgA0EEcWpBEGoiBigCACIDDQALIAYgAjYCACACIAA2AhggAiACNgIMIAIgAjYCCAwBCyAAKAIIIgEgAjYCDCAAIAI2AgggAkEANgIYIAIgADYCDCACIAE2AggLQZjQACgCACIBIARNDQBBpNAAKAIAIgAgBGoiAiABIARrIgFBAXI2AgRBmNAAIAE2AgBBpNAAIAI2AgAgACAEQQNyNgIEIABBCGohAQwIC0EAIQFB/NMAQTA2AgAMBwtBACEACyAHRQ0AAkAgBigCHCICQQJ0QbzSAGoiAygCACAGRgRAIAMgADYCACAADQFBkNAAQZDQACgCAEF+IAJ3cTYCAAwCCyAHQRBBFCAHKAIQIAZGG2ogADYCACAARQ0BCyAAIAc2AhggBigCECICBEAgACACNgIQIAIgADYCGAsgBkEUaigCACICRQ0AIABBFGogAjYCACACIAA2AhgLIAEgCGohASAGIAhqIgYoAgQhBQsgBiAFQX5xNgIEIAEgBGogATYCACAEIAFBAXI2AgQgAUH/AU0EQCABQXhxQbTQAGohAAJ/QYzQACgCACICQQEgAUEDdnQiAXFFBEBBjNAAIAEgAnI2AgAgAAwBCyAAKAIICyIBIAQ2AgwgACAENgIIIAQgADYCDCAEIAE2AggMAQtBHyEFIAFB////B00EQCABQSYgAUEIdmciAGt2QQFxIABBAXRrQT5qIQULIAQgBTYCHCAEQgA3AhAgBUECdEG80gBqIQBBkNAAKAIAIgJBASAFdCIDcUUEQCAAIAQ2AgBBkNAAIAIgA3I2AgAgBCAANgIYIAQgBDYCCCAEIAQ2AgwMAQsgAUEZIAVBAXZrQQAgBUEfRxt0IQUgACgCACEAAkADQCAAIgIoAgRBeHEgAUYNASAFQR12IQAgBUEBdCEFIAIgAEEEcWpBEGoiAygCACIADQALIAMgBDYCACAEIAI2AhggBCAENgIMIAQgBDYCCAwBCyACKAIIIgAgBDYCDCACIAQ2AgggBEEANgIYIAQgAjYCDCAEIAA2AggLIAlBCGohAQwCCwJAIAdFDQACQCADKAIcIgFBAnRBvNIAaiICKAIAIANGBEAgAiAANgIAIAANAUGQ0AAgCEF+IAF3cSIINgIADAILIAdBEEEUIAcoAhAgA0YbaiAANgIAIABFDQELIAAgBzYCGCADKAIQIgEEQCAAIAE2AhAgASAANgIYCyADQRRqKAIAIgFFDQAgAEEUaiABNgIAIAEgADYCGAsCQCAFQQ9NBEAgAyAEIAVqIgBBA3I2AgQgACADaiIAIAAoAgRBAXI2AgQMAQsgAyAEaiICIAVBAXI2AgQgAyAEQQNyNgIEIAIgBWogBTYCACAFQf8BTQRAIAVBeHFBtNAAaiEAAn9BjNAAKAIAIgFBASAFQQN2dCIFcUUEQEGM0AAgASAFcjYCACAADAELIAAoAggLIgEgAjYCDCAAIAI2AgggAiAANgIMIAIgATYCCAwBC0EfIQEgBUH///8HTQRAIAVBJiAFQQh2ZyIAa3ZBAXEgAEEBdGtBPmohAQsgAiABNgIcIAJCADcCECABQQJ0QbzSAGohAEEBIAF0IgQgCHFFBEAgACACNgIAQZDQACAEIAhyNgIAIAIgADYCGCACIAI2AgggAiACNgIMDAELIAVBGSABQQF2a0EAIAFBH0cbdCEBIAAoAgAhBAJAA0AgBCIAKAIEQXhxIAVGDQEgAUEddiEEIAFBAXQhASAAIARBBHFqQRBqIgYoAgAiBA0ACyAGIAI2AgAgAiAANgIYIAIgAjYCDCACIAI2AggMAQsgACgCCCIBIAI2AgwgACACNgIIIAJBADYCGCACIAA2AgwgAiABNgIICyADQQhqIQEMAQsCQCAJRQ0AAkAgACgCHCIBQQJ0QbzSAGoiAigCACAARgRAIAIgAzYCACADDQFBkNAAIAtBfiABd3E2AgAMAgsgCUEQQRQgCSgCECAARhtqIAM2AgAgA0UNAQsgAyAJNgIYIAAoAhAiAQRAIAMgATYCECABIAM2AhgLIABBFGooAgAiAUUNACADQRRqIAE2AgAgASADNgIYCwJAIAVBD00EQCAAIAQgBWoiAUEDcjYCBCAAIAFqIgEgASgCBEEBcjYCBAwBCyAAIARqIgcgBUEBcjYCBCAAIARBA3I2AgQgBSAHaiAFNgIAIAgEQCAIQXhxQbTQAGohAUGg0AAoAgAhAwJ/QQEgCEEDdnQiAiAGcUUEQEGM0AAgAiAGcjYCACABDAELIAEoAggLIgIgAzYCDCABIAM2AgggAyABNgIMIAMgAjYCCAtBoNAAIAc2AgBBlNAAIAU2AgALIABBCGohAQsgCkEQaiQAIAELQwAgAEUEQD8AQRB0DwsCQCAAQf//A3ENACAAQQBIDQAgAEEQdkAAIgBBf0YEQEH80wBBMDYCAEF/DwsgAEEQdA8LAAsL3D8iAEGACAsJAQAAAAIAAAADAEGUCAsFBAAAAAUAQaQICwkGAAAABwAAAAgAQdwIC4otSW52YWxpZCBjaGFyIGluIHVybCBxdWVyeQBTcGFuIGNhbGxiYWNrIGVycm9yIGluIG9uX2JvZHkAQ29udGVudC1MZW5ndGggb3ZlcmZsb3cAQ2h1bmsgc2l6ZSBvdmVyZmxvdwBSZXNwb25zZSBvdmVyZmxvdwBJbnZhbGlkIG1ldGhvZCBmb3IgSFRUUC94LnggcmVxdWVzdABJbnZhbGlkIG1ldGhvZCBmb3IgUlRTUC94LnggcmVxdWVzdABFeHBlY3RlZCBTT1VSQ0UgbWV0aG9kIGZvciBJQ0UveC54IHJlcXVlc3QASW52YWxpZCBjaGFyIGluIHVybCBmcmFnbWVudCBzdGFydABFeHBlY3RlZCBkb3QAU3BhbiBjYWxsYmFjayBlcnJvciBpbiBvbl9zdGF0dXMASW52YWxpZCByZXNwb25zZSBzdGF0dXMASW52YWxpZCBjaGFyYWN0ZXIgaW4gY2h1bmsgZXh0ZW5zaW9ucwBVc2VyIGNhbGxiYWNrIGVycm9yAGBvbl9yZXNldGAgY2FsbGJhY2sgZXJyb3IAYG9uX2NodW5rX2hlYWRlcmAgY2FsbGJhY2sgZXJyb3IAYG9uX21lc3NhZ2VfYmVnaW5gIGNhbGxiYWNrIGVycm9yAGBvbl9jaHVua19leHRlbnNpb25fdmFsdWVgIGNhbGxiYWNrIGVycm9yAGBvbl9zdGF0dXNfY29tcGxldGVgIGNhbGxiYWNrIGVycm9yAGBvbl92ZXJzaW9uX2NvbXBsZXRlYCBjYWxsYmFjayBlcnJvcgBgb25fdXJsX2NvbXBsZXRlYCBjYWxsYmFjayBlcnJvcgBgb25fY2h1bmtfY29tcGxldGVgIGNhbGxiYWNrIGVycm9yAGBvbl9oZWFkZXJfdmFsdWVfY29tcGxldGVgIGNhbGxiYWNrIGVycm9yAGBvbl9tZXNzYWdlX2NvbXBsZXRlYCBjYWxsYmFjayBlcnJvcgBgb25fbWV0aG9kX2NvbXBsZXRlYCBjYWxsYmFjayBlcnJvcgBgb25faGVhZGVyX2ZpZWxkX2NvbXBsZXRlYCBjYWxsYmFjayBlcnJvcgBgb25fY2h1bmtfZXh0ZW5zaW9uX25hbWVgIGNhbGxiYWNrIGVycm9yAFVuZXhwZWN0ZWQgY2hhciBpbiB1cmwgc2VydmVyAEludmFsaWQgaGVhZGVyIHZhbHVlIGNoYXIASW52YWxpZCBoZWFkZXIgZmllbGQgY2hhcgBTcGFuIGNhbGxiYWNrIGVycm9yIGluIG9uX3ZlcnNpb24ASW52YWxpZCBtaW5vciB2ZXJzaW9uAEludmFsaWQgbWFqb3IgdmVyc2lvbgBFeHBlY3RlZCBzcGFjZSBhZnRlciB2ZXJzaW9uAEV4cGVjdGVkIENSTEYgYWZ0ZXIgdmVyc2lvbgBJbnZhbGlkIEhUVFAgdmVyc2lvbgBJbnZhbGlkIGhlYWRlciB0b2tlbgBTcGFuIGNhbGxiYWNrIGVycm9yIGluIG9uX3VybABJbnZhbGlkIGNoYXJhY3RlcnMgaW4gdXJsAFVuZXhwZWN0ZWQgc3RhcnQgY2hhciBpbiB1cmwARG91YmxlIEAgaW4gdXJsAEVtcHR5IENvbnRlbnQtTGVuZ3RoAEludmFsaWQgY2hhcmFjdGVyIGluIENvbnRlbnQtTGVuZ3RoAER1cGxpY2F0ZSBDb250ZW50LUxlbmd0aABJbnZhbGlkIGNoYXIgaW4gdXJsIHBhdGgAQ29udGVudC1MZW5ndGggY2FuJ3QgYmUgcHJlc2VudCB3aXRoIFRyYW5zZmVyLUVuY29kaW5nAEludmFsaWQgY2hhcmFjdGVyIGluIGNodW5rIHNpemUAU3BhbiBjYWxsYmFjayBlcnJvciBpbiBvbl9oZWFkZXJfdmFsdWUAU3BhbiBjYWxsYmFjayBlcnJvciBpbiBvbl9jaHVua19leHRlbnNpb25fdmFsdWUASW52YWxpZCBjaGFyYWN0ZXIgaW4gY2h1bmsgZXh0ZW5zaW9ucyB2YWx1ZQBNaXNzaW5nIGV4cGVjdGVkIExGIGFmdGVyIGhlYWRlciB2YWx1ZQBJbnZhbGlkIGBUcmFuc2Zlci1FbmNvZGluZ2AgaGVhZGVyIHZhbHVlAEludmFsaWQgY2hhcmFjdGVyIGluIGNodW5rIGV4dGVuc2lvbnMgcXVvdGUgdmFsdWUASW52YWxpZCBjaGFyYWN0ZXIgaW4gY2h1bmsgZXh0ZW5zaW9ucyBxdW90ZWQgdmFsdWUAUGF1c2VkIGJ5IG9uX2hlYWRlcnNfY29tcGxldGUASW52YWxpZCBFT0Ygc3RhdGUAb25fcmVzZXQgcGF1c2UAb25fY2h1bmtfaGVhZGVyIHBhdXNlAG9uX21lc3NhZ2VfYmVnaW4gcGF1c2UAb25fY2h1bmtfZXh0ZW5zaW9uX3ZhbHVlIHBhdXNlAG9uX3N0YXR1c19jb21wbGV0ZSBwYXVzZQBvbl92ZXJzaW9uX2NvbXBsZXRlIHBhdXNlAG9uX3VybF9jb21wbGV0ZSBwYXVzZQBvbl9jaHVua19jb21wbGV0ZSBwYXVzZQBvbl9oZWFkZXJfdmFsdWVfY29tcGxldGUgcGF1c2UAb25fbWVzc2FnZV9jb21wbGV0ZSBwYXVzZQBvbl9tZXRob2RfY29tcGxldGUgcGF1c2UAb25faGVhZGVyX2ZpZWxkX2NvbXBsZXRlIHBhdXNlAG9uX2NodW5rX2V4dGVuc2lvbl9uYW1lIHBhdXNlAFVuZXhwZWN0ZWQgc3BhY2UgYWZ0ZXIgc3RhcnQgbGluZQBTcGFuIGNhbGxiYWNrIGVycm9yIGluIG9uX2NodW5rX2V4dGVuc2lvbl9uYW1lAEludmFsaWQgY2hhcmFjdGVyIGluIGNodW5rIGV4dGVuc2lvbnMgbmFtZQBQYXVzZSBvbiBDT05ORUNUL1VwZ3JhZGUAUGF1c2Ugb24gUFJJL1VwZ3JhZGUARXhwZWN0ZWQgSFRUUC8yIENvbm5lY3Rpb24gUHJlZmFjZQBTcGFuIGNhbGxiYWNrIGVycm9yIGluIG9uX21ldGhvZABFeHBlY3RlZCBzcGFjZSBhZnRlciBtZXRob2QAU3BhbiBjYWxsYmFjayBlcnJvciBpbiBvbl9oZWFkZXJfZmllbGQAUGF1c2VkAEludmFsaWQgd29yZCBlbmNvdW50ZXJlZABJbnZhbGlkIG1ldGhvZCBlbmNvdW50ZXJlZABVbmV4cGVjdGVkIGNoYXIgaW4gdXJsIHNjaGVtYQBSZXF1ZXN0IGhhcyBpbnZhbGlkIGBUcmFuc2Zlci1FbmNvZGluZ2AAU1dJVENIX1BST1hZAFVTRV9QUk9YWQBNS0FDVElWSVRZAFVOUFJPQ0VTU0FCTEVfRU5USVRZAENPUFkATU9WRURfUEVSTUFORU5UTFkAVE9PX0VBUkxZAE5PVElGWQBGQUlMRURfREVQRU5ERU5DWQBCQURfR0FURVdBWQBQTEFZAFBVVABDSEVDS09VVABHQVRFV0FZX1RJTUVPVVQAUkVRVUVTVF9USU1FT1VUAE5FVFdPUktfQ09OTkVDVF9USU1FT1VUAENPTk5FQ1RJT05fVElNRU9VVABMT0dJTl9USU1FT1VUAE5FVFdPUktfUkVBRF9USU1FT1VUAFBPU1QATUlTRElSRUNURURfUkVRVUVTVABDTElFTlRfQ0xPU0VEX1JFUVVFU1QAQ0xJRU5UX0NMT1NFRF9MT0FEX0JBTEFOQ0VEX1JFUVVFU1QAQkFEX1JFUVVFU1QASFRUUF9SRVFVRVNUX1NFTlRfVE9fSFRUUFNfUE9SVABSRVBPUlQASU1fQV9URUFQT1QAUkVTRVRfQ09OVEVOVABOT19DT05URU5UAFBBUlRJQUxfQ09OVEVOVABIUEVfSU5WQUxJRF9DT05TVEFOVABIUEVfQ0JfUkVTRVQAR0VUAEhQRV9TVFJJQ1QAQ09ORkxJQ1QAVEVNUE9SQVJZX1JFRElSRUNUAFBFUk1BTkVOVF9SRURJUkVDVABDT05ORUNUAE1VTFRJX1NUQVRVUwBIUEVfSU5WQUxJRF9TVEFUVVMAVE9PX01BTllfUkVRVUVTVFMARUFSTFlfSElOVFMAVU5BVkFJTEFCTEVfRk9SX0xFR0FMX1JFQVNPTlMAT1BUSU9OUwBTV0lUQ0hJTkdfUFJPVE9DT0xTAFZBUklBTlRfQUxTT19ORUdPVElBVEVTAE1VTFRJUExFX0NIT0lDRVMASU5URVJOQUxfU0VSVkVSX0VSUk9SAFdFQl9TRVJWRVJfVU5LTk9XTl9FUlJPUgBSQUlMR1VOX0VSUk9SAElERU5USVRZX1BST1ZJREVSX0FVVEhFTlRJQ0FUSU9OX0VSUk9SAFNTTF9DRVJUSUZJQ0FURV9FUlJPUgBJTlZBTElEX1hfRk9SV0FSREVEX0ZPUgBTRVRfUEFSQU1FVEVSAEdFVF9QQVJBTUVURVIASFBFX1VTRVIAU0VFX09USEVSAEhQRV9DQl9DSFVOS19IRUFERVIATUtDQUxFTkRBUgBTRVRVUABXRUJfU0VSVkVSX0lTX0RPV04AVEVBUkRPV04ASFBFX0NMT1NFRF9DT05ORUNUSU9OAEhFVVJJU1RJQ19FWFBJUkFUSU9OAERJU0NPTk5FQ1RFRF9PUEVSQVRJT04ATk9OX0FVVEhPUklUQVRJVkVfSU5GT1JNQVRJT04ASFBFX0lOVkFMSURfVkVSU0lPTgBIUEVfQ0JfTUVTU0FHRV9CRUdJTgBTSVRFX0lTX0ZST1pFTgBIUEVfSU5WQUxJRF9IRUFERVJfVE9LRU4ASU5WQUxJRF9UT0tFTgBGT1JCSURERU4ARU5IQU5DRV9ZT1VSX0NBTE0ASFBFX0lOVkFMSURfVVJMAEJMT0NLRURfQllfUEFSRU5UQUxfQ09OVFJPTABNS0NPTABBQ0wASFBFX0lOVEVSTkFMAFJFUVVFU1RfSEVBREVSX0ZJRUxEU19UT09fTEFSR0VfVU5PRkZJQ0lBTABIUEVfT0sAVU5MSU5LAFVOTE9DSwBQUkkAUkVUUllfV0lUSABIUEVfSU5WQUxJRF9DT05URU5UX0xFTkdUSABIUEVfVU5FWFBFQ1RFRF9DT05URU5UX0xFTkdUSABGTFVTSABQUk9QUEFUQ0gATS1TRUFSQ0gAVVJJX1RPT19MT05HAFBST0NFU1NJTkcATUlTQ0VMTEFORU9VU19QRVJTSVNURU5UX1dBUk5JTkcATUlTQ0VMTEFORU9VU19XQVJOSU5HAEhQRV9JTlZBTElEX1RSQU5TRkVSX0VOQ09ESU5HAEV4cGVjdGVkIENSTEYASFBFX0lOVkFMSURfQ0hVTktfU0laRQBNT1ZFAENPTlRJTlVFAEhQRV9DQl9TVEFUVVNfQ09NUExFVEUASFBFX0NCX0hFQURFUlNfQ09NUExFVEUASFBFX0NCX1ZFUlNJT05fQ09NUExFVEUASFBFX0NCX1VSTF9DT01QTEVURQBIUEVfQ0JfQ0hVTktfQ09NUExFVEUASFBFX0NCX0hFQURFUl9WQUxVRV9DT01QTEVURQBIUEVfQ0JfQ0hVTktfRVhURU5TSU9OX1ZBTFVFX0NPTVBMRVRFAEhQRV9DQl9DSFVOS19FWFRFTlNJT05fTkFNRV9DT01QTEVURQBIUEVfQ0JfTUVTU0FHRV9DT01QTEVURQBIUEVfQ0JfTUVUSE9EX0NPTVBMRVRFAEhQRV9DQl9IRUFERVJfRklFTERfQ09NUExFVEUAREVMRVRFAEhQRV9JTlZBTElEX0VPRl9TVEFURQBJTlZBTElEX1NTTF9DRVJUSUZJQ0FURQBQQVVTRQBOT19SRVNQT05TRQBVTlNVUFBPUlRFRF9NRURJQV9UWVBFAEdPTkUATk9UX0FDQ0VQVEFCTEUAU0VSVklDRV9VTkFWQUlMQUJMRQBSQU5HRV9OT1RfU0FUSVNGSUFCTEUAT1JJR0lOX0lTX1VOUkVBQ0hBQkxFAFJFU1BPTlNFX0lTX1NUQUxFAFBVUkdFAE1FUkdFAFJFUVVFU1RfSEVBREVSX0ZJRUxEU19UT09fTEFSR0UAUkVRVUVTVF9IRUFERVJfVE9PX0xBUkdFAFBBWUxPQURfVE9PX0xBUkdFAElOU1VGRklDSUVOVF9TVE9SQUdFAEhQRV9QQVVTRURfVVBHUkFERQBIUEVfUEFVU0VEX0gyX1VQR1JBREUAU09VUkNFAEFOTk9VTkNFAFRSQUNFAEhQRV9VTkVYUEVDVEVEX1NQQUNFAERFU0NSSUJFAFVOU1VCU0NSSUJFAFJFQ09SRABIUEVfSU5WQUxJRF9NRVRIT0QATk9UX0ZPVU5EAFBST1BGSU5EAFVOQklORABSRUJJTkQAVU5BVVRIT1JJWkVEAE1FVEhPRF9OT1RfQUxMT1dFRABIVFRQX1ZFUlNJT05fTk9UX1NVUFBPUlRFRABBTFJFQURZX1JFUE9SVEVEAEFDQ0VQVEVEAE5PVF9JTVBMRU1FTlRFRABMT09QX0RFVEVDVEVEAEhQRV9DUl9FWFBFQ1RFRABIUEVfTEZfRVhQRUNURUQAQ1JFQVRFRABJTV9VU0VEAEhQRV9QQVVTRUQAVElNRU9VVF9PQ0NVUkVEAFBBWU1FTlRfUkVRVUlSRUQAUFJFQ09ORElUSU9OX1JFUVVJUkVEAFBST1hZX0FVVEhFTlRJQ0FUSU9OX1JFUVVJUkVEAE5FVFdPUktfQVVUSEVOVElDQVRJT05fUkVRVUlSRUQATEVOR1RIX1JFUVVJUkVEAFNTTF9DRVJUSUZJQ0FURV9SRVFVSVJFRABVUEdSQURFX1JFUVVJUkVEAFBBR0VfRVhQSVJFRABQUkVDT05ESVRJT05fRkFJTEVEAEVYUEVDVEFUSU9OX0ZBSUxFRABSRVZBTElEQVRJT05fRkFJTEVEAFNTTF9IQU5EU0hBS0VfRkFJTEVEAExPQ0tFRABUUkFOU0ZPUk1BVElPTl9BUFBMSUVEAE5PVF9NT0RJRklFRABOT1RfRVhURU5ERUQAQkFORFdJRFRIX0xJTUlUX0VYQ0VFREVEAFNJVEVfSVNfT1ZFUkxPQURFRABIRUFEAEV4cGVjdGVkIEhUVFAvAABeEwAAJhMAADAQAADwFwAAnRMAABUSAAA5FwAA8BIAAAoQAAB1EgAArRIAAIITAABPFAAAfxAAAKAVAAAjFAAAiRIAAIsUAABNFQAA1BEAAM8UAAAQGAAAyRYAANwWAADBEQAA4BcAALsUAAB0FAAAfBUAAOUUAAAIFwAAHxAAAGUVAACjFAAAKBUAAAIVAACZFQAALBAAAIsZAABPDwAA1A4AAGoQAADOEAAAAhcAAIkOAABuEwAAHBMAAGYUAABWFwAAwRMAAM0TAABsEwAAaBcAAGYXAABfFwAAIhMAAM4PAABpDgAA2A4AAGMWAADLEwAAqg4AACgXAAAmFwAAxRMAAF0WAADoEQAAZxMAAGUTAADyFgAAcxMAAB0XAAD5FgAA8xEAAM8OAADOFQAADBIAALMRAAClEQAAYRAAADIXAAC7EwBB+TULAQEAQZA2C+ABAQECAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAAEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEAQf03CwEBAEGROAteAgMCAgICAgAAAgIAAgIAAgICAgICAgICAgAEAAAAAAACAgICAgICAgICAgICAgICAgICAgICAgICAgAAAAICAgICAgICAgICAgICAgICAgICAgICAgICAgICAAIAAgBB/TkLAQEAQZE6C14CAAICAgICAAACAgACAgACAgICAgICAgICAAMABAAAAAICAgICAgICAgICAgICAgICAgICAgICAgICAAAAAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAAgACAEHwOwsNbG9zZWVlcC1hbGl2ZQBBiTwLAQEAQaA8C+ABAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEAAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEAQYk+CwEBAEGgPgvnAQEBAQEBAQEBAQEBAQIBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAAEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBY2h1bmtlZABBsMAAC18BAQABAQEBAQAAAQEAAQEAAQEBAQEBAQEBAQAAAAAAAAABAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQAAAAEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAAEAAQBBkMIACyFlY3Rpb25lbnQtbGVuZ3Rob25yb3h5LWNvbm5lY3Rpb24AQcDCAAstcmFuc2Zlci1lbmNvZGluZ3BncmFkZQ0KDQoNClNNDQoNClRUUC9DRS9UU1AvAEH5wgALBQECAAEDAEGQwwAL4AEEAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQABAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQBB+cQACwUBAgABAwBBkMUAC+ABBAEBBQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEAAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEAQfnGAAsEAQAAAQBBkccAC98BAQEAAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAAEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQABAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQBB+sgACwQBAAACAEGQyQALXwMEAAAEBAQEBAQEBAQEBAUEBAQEBAQEBAQEBAQABAAGBwQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAAEAAQABAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQAAAAEAEH6ygALBAEAAAEAQZDLAAsBAQBBqssAC0ECAAAAAAAAAwMDAwMDAwMDAwMDAwMDAwMDAwMDAwMDAwMAAAAAAAADAwMDAwMDAwMDAwMDAwMDAwMDAwMDAwMDAwBB+swACwQBAAABAEGQzQALAQEAQZrNAAsGAgAAAAACAEGxzQALOgMDAwMDAwMDAwMDAwMDAwMDAwMDAwMDAwMDAAAAAAAAAwMDAwMDAwMDAwMDAwMDAwMDAwMDAwMDAwMAQfDOAAuWAU5PVU5DRUVDS09VVE5FQ1RFVEVDUklCRUxVU0hFVEVBRFNFQVJDSFJHRUNUSVZJVFlMRU5EQVJWRU9USUZZUFRJT05TQ0hTRUFZU1RBVENIR0VPUkRJUkVDVE9SVFJDSFBBUkFNRVRFUlVSQ0VCU0NSSUJFQVJET1dOQUNFSU5ETktDS1VCU0NSSUJFSFRUUC9BRFRQLw==", "base64"); +// node_modules/@smithy/core/dist-es/middleware-http-signing/index.js +var init_middleware_http_signing = __esm({ + "node_modules/@smithy/core/dist-es/middleware-http-signing/index.js"() { + init_httpSigningMiddleware(); + init_getHttpSigningMiddleware(); } }); -// node_modules/undici/lib/web/fetch/constants.js -var require_constants8 = __commonJS({ - "node_modules/undici/lib/web/fetch/constants.js"(exports2, module2) { - "use strict"; - var corsSafeListedMethods = ["GET", "HEAD", "POST"]; - var corsSafeListedMethodsSet = new Set(corsSafeListedMethods); - var nullBodyStatus = [101, 204, 205, 304]; - var redirectStatus = [301, 302, 303, 307, 308]; - var redirectStatusSet = new Set(redirectStatus); - var badPorts = [ - "1", - "7", - "9", - "11", - "13", - "15", - "17", - "19", - "20", - "21", - "22", - "23", - "25", - "37", - "42", - "43", - "53", - "69", - "77", - "79", - "87", - "95", - "101", - "102", - "103", - "104", - "109", - "110", - "111", - "113", - "115", - "117", - "119", - "123", - "135", - "137", - "139", - "143", - "161", - "179", - "389", - "427", - "465", - "512", - "513", - "514", - "515", - "526", - "530", - "531", - "532", - "540", - "548", - "554", - "556", - "563", - "587", - "601", - "636", - "989", - "990", - "993", - "995", - "1719", - "1720", - "1723", - "2049", - "3659", - "4045", - "4190", - "5060", - "5061", - "6000", - "6566", - "6665", - "6666", - "6667", - "6668", - "6669", - "6679", - "6697", - "10080" - ]; - var badPortsSet = new Set(badPorts); - var referrerPolicy = [ - "", - "no-referrer", - "no-referrer-when-downgrade", - "same-origin", - "origin", - "strict-origin", - "origin-when-cross-origin", - "strict-origin-when-cross-origin", - "unsafe-url" - ]; - var referrerPolicySet = new Set(referrerPolicy); - var requestRedirect = ["follow", "manual", "error"]; - var safeMethods = ["GET", "HEAD", "OPTIONS", "TRACE"]; - var safeMethodsSet = new Set(safeMethods); - var requestMode = ["navigate", "same-origin", "no-cors", "cors"]; - var requestCredentials = ["omit", "same-origin", "include"]; - var requestCache = [ - "default", - "no-store", - "reload", - "no-cache", - "force-cache", - "only-if-cached" - ]; - var requestBodyHeader = [ - "content-encoding", - "content-language", - "content-location", - "content-type", - // See https://github.com/nodejs/undici/issues/2021 - // 'Content-Length' is a forbidden header name, which is typically - // removed in the Headers implementation. However, undici doesn't - // filter out headers, so we add it here. - "content-length" - ]; - var requestDuplex = [ - "half" - ]; - var forbiddenMethods = ["CONNECT", "TRACE", "TRACK"]; - var forbiddenMethodsSet = new Set(forbiddenMethods); - var subresource = [ - "audio", - "audioworklet", - "font", - "image", - "manifest", - "paintworklet", - "script", - "style", - "track", - "video", - "xslt", - "" - ]; - var subresourceSet = new Set(subresource); - module2.exports = { - subresource, - forbiddenMethods, - requestBodyHeader, - referrerPolicy, - requestRedirect, - requestMode, - requestCredentials, - requestCache, - redirectStatus, - corsSafeListedMethods, - nullBodyStatus, - safeMethods, - badPorts, - requestDuplex, - subresourceSet, - badPortsSet, - redirectStatusSet, - corsSafeListedMethodsSet, - safeMethodsSet, - forbiddenMethodsSet, - referrerPolicySet +// node_modules/@smithy/core/dist-es/util-identity-and-auth/DefaultIdentityProviderConfig.js +var DefaultIdentityProviderConfig; +var init_DefaultIdentityProviderConfig = __esm({ + "node_modules/@smithy/core/dist-es/util-identity-and-auth/DefaultIdentityProviderConfig.js"() { + DefaultIdentityProviderConfig = class { + constructor(config) { + this.authSchemes = /* @__PURE__ */ new Map(); + for (const [key, value] of Object.entries(config)) { + if (value !== void 0) { + this.authSchemes.set(key, value); + } + } + } + getIdentityProvider(schemeId) { + return this.authSchemes.get(schemeId); + } }; } }); -// node_modules/undici/lib/web/fetch/global.js -var require_global3 = __commonJS({ - "node_modules/undici/lib/web/fetch/global.js"(exports2, module2) { - "use strict"; - var globalOrigin = Symbol.for("undici.globalOrigin.1"); - function getGlobalOrigin() { - return globalThis[globalOrigin]; - } - function setGlobalOrigin(newOrigin) { - if (newOrigin === void 0) { - Object.defineProperty(globalThis, globalOrigin, { - value: void 0, - writable: true, - enumerable: false, - configurable: false - }); - return; +// node_modules/@smithy/core/dist-es/util-identity-and-auth/httpAuthSchemes/httpApiKeyAuth.js +var import_protocol_http2, import_types3, HttpApiKeyAuthSigner; +var init_httpApiKeyAuth = __esm({ + "node_modules/@smithy/core/dist-es/util-identity-and-auth/httpAuthSchemes/httpApiKeyAuth.js"() { + import_protocol_http2 = __toESM(require_dist_cjs2()); + import_types3 = __toESM(require_dist_cjs()); + HttpApiKeyAuthSigner = class { + async sign(httpRequest, identity, signingProperties) { + if (!signingProperties) { + throw new Error("request could not be signed with `apiKey` since the `name` and `in` signer properties are missing"); + } + if (!signingProperties.name) { + throw new Error("request could not be signed with `apiKey` since the `name` signer property is missing"); + } + if (!signingProperties.in) { + throw new Error("request could not be signed with `apiKey` since the `in` signer property is missing"); + } + if (!identity.apiKey) { + throw new Error("request could not be signed with `apiKey` since the `apiKey` is not defined"); + } + const clonedRequest = import_protocol_http2.HttpRequest.clone(httpRequest); + if (signingProperties.in === import_types3.HttpApiKeyAuthLocation.QUERY) { + clonedRequest.query[signingProperties.name] = identity.apiKey; + } else if (signingProperties.in === import_types3.HttpApiKeyAuthLocation.HEADER) { + clonedRequest.headers[signingProperties.name] = signingProperties.scheme ? `${signingProperties.scheme} ${identity.apiKey}` : identity.apiKey; + } else { + throw new Error("request can only be signed with `apiKey` locations `query` or `header`, but found: `" + signingProperties.in + "`"); + } + return clonedRequest; } - const parsedURL = new URL(newOrigin); - if (parsedURL.protocol !== "http:" && parsedURL.protocol !== "https:") { - throw new TypeError(`Only http & https urls are allowed, received ${parsedURL.protocol}`); + }; + } +}); + +// node_modules/@smithy/core/dist-es/util-identity-and-auth/httpAuthSchemes/httpBearerAuth.js +var import_protocol_http3, HttpBearerAuthSigner; +var init_httpBearerAuth = __esm({ + "node_modules/@smithy/core/dist-es/util-identity-and-auth/httpAuthSchemes/httpBearerAuth.js"() { + import_protocol_http3 = __toESM(require_dist_cjs2()); + HttpBearerAuthSigner = class { + async sign(httpRequest, identity, signingProperties) { + const clonedRequest = import_protocol_http3.HttpRequest.clone(httpRequest); + if (!identity.token) { + throw new Error("request could not be signed with `token` since the `token` is not defined"); + } + clonedRequest.headers["Authorization"] = `Bearer ${identity.token}`; + return clonedRequest; } - Object.defineProperty(globalThis, globalOrigin, { - value: parsedURL, - writable: true, - enumerable: false, - configurable: false - }); - } - module2.exports = { - getGlobalOrigin, - setGlobalOrigin }; } }); -// node_modules/undici/lib/web/fetch/data-url.js -var require_data_url = __commonJS({ - "node_modules/undici/lib/web/fetch/data-url.js"(exports2, module2) { - "use strict"; - var assert = require("node:assert"); - var encoder = new TextEncoder(); - var HTTP_TOKEN_CODEPOINTS = /^[!#$%&'*+\-.^_|~A-Za-z0-9]+$/; - var HTTP_WHITESPACE_REGEX = /[\u000A\u000D\u0009\u0020]/; - var ASCII_WHITESPACE_REPLACE_REGEX = /[\u0009\u000A\u000C\u000D\u0020]/g; - var HTTP_QUOTED_STRING_TOKENS = /^[\u0009\u0020-\u007E\u0080-\u00FF]+$/; - function dataURLProcessor(dataURL) { - assert(dataURL.protocol === "data:"); - let input = URLSerializer(dataURL, true); - input = input.slice(5); - const position = { position: 0 }; - let mimeType = collectASequenceOfCodePointsFast( - ",", - input, - position - ); - const mimeTypeLength = mimeType.length; - mimeType = removeASCIIWhitespace(mimeType, true, true); - if (position.position >= input.length) { - return "failure"; +// node_modules/@smithy/core/dist-es/util-identity-and-auth/httpAuthSchemes/noAuth.js +var NoAuthSigner; +var init_noAuth = __esm({ + "node_modules/@smithy/core/dist-es/util-identity-and-auth/httpAuthSchemes/noAuth.js"() { + NoAuthSigner = class { + async sign(httpRequest, identity, signingProperties) { + return httpRequest; } - position.position++; - const encodedBody = input.slice(mimeTypeLength + 1); - let body = stringPercentDecode(encodedBody); - if (/;(\u0020){0,}base64$/i.test(mimeType)) { - const stringBody = isomorphicDecode(body); - body = forgivingBase64(stringBody); - if (body === "failure") { - return "failure"; + }; + } +}); + +// node_modules/@smithy/core/dist-es/util-identity-and-auth/httpAuthSchemes/index.js +var init_httpAuthSchemes = __esm({ + "node_modules/@smithy/core/dist-es/util-identity-and-auth/httpAuthSchemes/index.js"() { + init_httpApiKeyAuth(); + init_httpBearerAuth(); + init_noAuth(); + } +}); + +// node_modules/@smithy/core/dist-es/util-identity-and-auth/memoizeIdentityProvider.js +var createIsIdentityExpiredFunction, EXPIRATION_MS, isIdentityExpired, doesIdentityRequireRefresh, memoizeIdentityProvider; +var init_memoizeIdentityProvider = __esm({ + "node_modules/@smithy/core/dist-es/util-identity-and-auth/memoizeIdentityProvider.js"() { + createIsIdentityExpiredFunction = (expirationMs) => (identity) => doesIdentityRequireRefresh(identity) && identity.expiration.getTime() - Date.now() < expirationMs; + EXPIRATION_MS = 3e5; + isIdentityExpired = createIsIdentityExpiredFunction(EXPIRATION_MS); + doesIdentityRequireRefresh = (identity) => identity.expiration !== void 0; + memoizeIdentityProvider = (provider, isExpired, requiresRefresh) => { + if (provider === void 0) { + return void 0; + } + const normalizedProvider = typeof provider !== "function" ? async () => Promise.resolve(provider) : provider; + let resolved; + let pending; + let hasResult; + let isConstant = false; + const coalesceProvider = async (options) => { + if (!pending) { + pending = normalizedProvider(options); } - mimeType = mimeType.slice(0, -6); - mimeType = mimeType.replace(/(\u0020)+$/, ""); - mimeType = mimeType.slice(0, -1); + try { + resolved = await pending; + hasResult = true; + isConstant = false; + } finally { + pending = void 0; + } + return resolved; + }; + if (isExpired === void 0) { + return async (options) => { + if (!hasResult || options?.forceRefresh) { + resolved = await coalesceProvider(options); + } + return resolved; + }; } - if (mimeType.startsWith(";")) { - mimeType = "text/plain" + mimeType; + return async (options) => { + if (!hasResult || options?.forceRefresh) { + resolved = await coalesceProvider(options); + } + if (isConstant) { + return resolved; + } + if (!requiresRefresh(resolved)) { + isConstant = true; + return resolved; + } + if (isExpired(resolved)) { + await coalesceProvider(options); + return resolved; + } + return resolved; + }; + }; + } +}); + +// node_modules/@smithy/core/dist-es/util-identity-and-auth/index.js +var init_util_identity_and_auth = __esm({ + "node_modules/@smithy/core/dist-es/util-identity-and-auth/index.js"() { + init_DefaultIdentityProviderConfig(); + init_httpAuthSchemes(); + init_memoizeIdentityProvider(); + } +}); + +// node_modules/@smithy/core/dist-es/getSmithyContext.js +var import_types4, getSmithyContext3; +var init_getSmithyContext = __esm({ + "node_modules/@smithy/core/dist-es/getSmithyContext.js"() { + import_types4 = __toESM(require_dist_cjs()); + getSmithyContext3 = (context) => context[import_types4.SMITHY_CONTEXT_KEY] || (context[import_types4.SMITHY_CONTEXT_KEY] = {}); + } +}); + +// node_modules/@smithy/core/dist-es/normalizeProvider.js +var normalizeProvider; +var init_normalizeProvider = __esm({ + "node_modules/@smithy/core/dist-es/normalizeProvider.js"() { + normalizeProvider = (input) => { + if (typeof input === "function") + return input; + const promisified = Promise.resolve(input); + return () => promisified; + }; + } +}); + +// node_modules/@smithy/core/dist-es/protocols/requestBuilder.js +function requestBuilder(input, context) { + return new RequestBuilder(input, context); +} +var import_protocol_http4, import_smithy_client, RequestBuilder; +var init_requestBuilder = __esm({ + "node_modules/@smithy/core/dist-es/protocols/requestBuilder.js"() { + import_protocol_http4 = __toESM(require_dist_cjs2()); + import_smithy_client = __toESM(require_dist_cjs32()); + RequestBuilder = class { + constructor(input, context) { + this.input = input; + this.context = context; + this.query = {}; + this.method = ""; + this.headers = {}; + this.path = ""; + this.body = null; + this.hostname = ""; + this.resolvePathStack = []; + } + async build() { + const { hostname, protocol = "https", port, path: basePath } = await this.context.endpoint(); + this.path = basePath; + for (const resolvePath of this.resolvePathStack) { + resolvePath(this.path); + } + return new import_protocol_http4.HttpRequest({ + protocol, + hostname: this.hostname || hostname, + port, + method: this.method, + path: this.path, + query: this.query, + body: this.body, + headers: this.headers + }); } - let mimeTypeRecord = parseMIMEType(mimeType); - if (mimeTypeRecord === "failure") { - mimeTypeRecord = parseMIMEType("text/plain;charset=US-ASCII"); + hn(hostname) { + this.hostname = hostname; + return this; } - return { mimeType: mimeTypeRecord, body }; - } - function URLSerializer(url, excludeFragment = false) { - if (!excludeFragment) { - return url.href; + bp(uriLabel) { + this.resolvePathStack.push((basePath) => { + this.path = `${basePath?.endsWith("/") ? basePath.slice(0, -1) : basePath || ""}` + uriLabel; + }); + return this; } - const href = url.href; - const hashLength = url.hash.length; - const serialized = hashLength === 0 ? href : href.substring(0, href.length - hashLength); - if (!hashLength && href.endsWith("#")) { - return serialized.slice(0, -1); + p(memberName, labelValueProvider, uriLabel, isGreedyLabel) { + this.resolvePathStack.push((path) => { + this.path = (0, import_smithy_client.resolvedPath)(path, this.input, memberName, labelValueProvider, uriLabel, isGreedyLabel); + }); + return this; } - return serialized; - } - function collectASequenceOfCodePoints(condition, input, position) { - let result = ""; - while (position.position < input.length && condition(input[position.position])) { - result += input[position.position]; - position.position++; + h(headers) { + this.headers = headers; + return this; } - return result; - } - function collectASequenceOfCodePointsFast(char, input, position) { - const idx = input.indexOf(char, position.position); - const start = position.position; - if (idx === -1) { - position.position = input.length; - return input.slice(start); + q(query) { + this.query = query; + return this; } - position.position = idx; - return input.slice(start, position.position); - } - function stringPercentDecode(input) { - const bytes = encoder.encode(input); - return percentDecode(bytes); - } - function isHexCharByte(byte) { - return byte >= 48 && byte <= 57 || byte >= 65 && byte <= 70 || byte >= 97 && byte <= 102; - } - function hexByteToNumber(byte) { - return ( - // 0-9 - byte >= 48 && byte <= 57 ? byte - 48 : (byte & 223) - 55 - ); + b(body) { + this.body = body; + return this; + } + m(method) { + this.method = method; + return this; + } + }; + } +}); + +// node_modules/@smithy/core/dist-es/pagination/createPaginator.js +function createPaginator(ClientCtor, CommandCtor, inputTokenName, outputTokenName, pageSizeTokenName) { + return async function* paginateOperation(config, input, ...additionalArguments) { + let token = config.startingToken || void 0; + let hasNext = true; + let page; + while (hasNext) { + input[inputTokenName] = token; + if (pageSizeTokenName) { + input[pageSizeTokenName] = input[pageSizeTokenName] ?? config.pageSize; + } + if (config.client instanceof ClientCtor) { + page = await makePagedClientRequest(CommandCtor, config.client, input, ...additionalArguments); + } else { + throw new Error(`Invalid client, expected instance of ${ClientCtor.name}`); + } + yield page; + const prevToken = token; + token = get(page, outputTokenName); + hasNext = !!(token && (!config.stopOnSameToken || token !== prevToken)); } - function percentDecode(input) { - const length = input.length; - const output = new Uint8Array(length); - let j = 0; - for (let i = 0; i < length; ++i) { - const byte = input[i]; - if (byte !== 37) { - output[j++] = byte; - } else if (byte === 37 && !(isHexCharByte(input[i + 1]) && isHexCharByte(input[i + 2]))) { - output[j++] = 37; - } else { - output[j++] = hexByteToNumber(input[i + 1]) << 4 | hexByteToNumber(input[i + 2]); - i += 2; + return void 0; + }; +} +var makePagedClientRequest, get; +var init_createPaginator = __esm({ + "node_modules/@smithy/core/dist-es/pagination/createPaginator.js"() { + makePagedClientRequest = async (CommandCtor, client, input, ...args) => { + return await client.send(new CommandCtor(input), ...args); + }; + get = (fromObject, path) => { + let cursor = fromObject; + const pathComponents = path.split("."); + for (const step of pathComponents) { + if (!cursor || typeof cursor !== "object") { + return void 0; } + cursor = cursor[step]; } - return length === j ? output : output.subarray(0, j); + return cursor; + }; + } +}); + +// node_modules/@smithy/core/dist-es/index.js +var dist_es_exports = {}; +__export(dist_es_exports, { + DefaultIdentityProviderConfig: () => DefaultIdentityProviderConfig, + EXPIRATION_MS: () => EXPIRATION_MS, + HttpApiKeyAuthSigner: () => HttpApiKeyAuthSigner, + HttpBearerAuthSigner: () => HttpBearerAuthSigner, + NoAuthSigner: () => NoAuthSigner, + RequestBuilder: () => RequestBuilder, + createIsIdentityExpiredFunction: () => createIsIdentityExpiredFunction, + createPaginator: () => createPaginator, + doesIdentityRequireRefresh: () => doesIdentityRequireRefresh, + getHttpAuthSchemeEndpointRuleSetPlugin: () => getHttpAuthSchemeEndpointRuleSetPlugin, + getHttpAuthSchemePlugin: () => getHttpAuthSchemePlugin, + getHttpSigningPlugin: () => getHttpSigningPlugin, + getSmithyContext: () => getSmithyContext3, + httpAuthSchemeEndpointRuleSetMiddlewareOptions: () => httpAuthSchemeEndpointRuleSetMiddlewareOptions, + httpAuthSchemeMiddleware: () => httpAuthSchemeMiddleware, + httpAuthSchemeMiddlewareOptions: () => httpAuthSchemeMiddlewareOptions, + httpSigningMiddleware: () => httpSigningMiddleware, + httpSigningMiddlewareOptions: () => httpSigningMiddlewareOptions, + isIdentityExpired: () => isIdentityExpired, + memoizeIdentityProvider: () => memoizeIdentityProvider, + normalizeProvider: () => normalizeProvider, + requestBuilder: () => requestBuilder +}); +var init_dist_es = __esm({ + "node_modules/@smithy/core/dist-es/index.js"() { + init_middleware_http_auth_scheme(); + init_middleware_http_signing(); + init_util_identity_and_auth(); + init_getSmithyContext(); + init_normalizeProvider(); + init_requestBuilder(); + init_createPaginator(); + } +}); + +// node_modules/@smithy/middleware-content-length/dist-cjs/index.js +var require_dist_cjs34 = __commonJS({ + "node_modules/@smithy/middleware-content-length/dist-cjs/index.js"(exports2, module2) { + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); + }; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + } + return to; + }; + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + contentLengthMiddleware: () => contentLengthMiddleware, + contentLengthMiddlewareOptions: () => contentLengthMiddlewareOptions, + getContentLengthPlugin: () => getContentLengthPlugin + }); + module2.exports = __toCommonJS2(src_exports); + var import_protocol_http8 = require_dist_cjs2(); + var CONTENT_LENGTH_HEADER = "content-length"; + function contentLengthMiddleware(bodyLengthChecker) { + return (next) => async (args) => { + const request2 = args.request; + if (import_protocol_http8.HttpRequest.isInstance(request2)) { + const { body, headers } = request2; + if (body && Object.keys(headers).map((str) => str.toLowerCase()).indexOf(CONTENT_LENGTH_HEADER) === -1) { + try { + const length = bodyLengthChecker(body); + request2.headers = { + ...request2.headers, + [CONTENT_LENGTH_HEADER]: String(length) + }; + } catch (error) { + } + } + } + return next({ + ...args, + request: request2 + }); + }; } - function parseMIMEType(input) { - input = removeHTTPWhitespace(input, true, true); - const position = { position: 0 }; - const type = collectASequenceOfCodePointsFast( - "/", - input, - position - ); - if (type.length === 0 || !HTTP_TOKEN_CODEPOINTS.test(type)) { - return "failure"; + __name(contentLengthMiddleware, "contentLengthMiddleware"); + var contentLengthMiddlewareOptions = { + step: "build", + tags: ["SET_CONTENT_LENGTH", "CONTENT_LENGTH"], + name: "contentLengthMiddleware", + override: true + }; + var getContentLengthPlugin = /* @__PURE__ */ __name((options) => ({ + applyToStack: (clientStack) => { + clientStack.add(contentLengthMiddleware(options.bodyLengthChecker), contentLengthMiddlewareOptions); } - if (position.position > input.length) { - return "failure"; + }), "getContentLengthPlugin"); + } +}); + +// node_modules/@aws-sdk/core/dist-es/submodules/client/emitWarningIfUnsupportedVersion.js +var warningEmitted, emitWarningIfUnsupportedVersion; +var init_emitWarningIfUnsupportedVersion = __esm({ + "node_modules/@aws-sdk/core/dist-es/submodules/client/emitWarningIfUnsupportedVersion.js"() { + warningEmitted = false; + emitWarningIfUnsupportedVersion = (version3) => { + if (version3 && !warningEmitted && parseInt(version3.substring(1, version3.indexOf("."))) < 18) { + warningEmitted = true; + process.emitWarning(`NodeDeprecationWarning: The AWS SDK for JavaScript (v3) will +no longer support Node.js 16.x on January 6, 2025. + +To continue receiving updates to AWS services, bug fixes, and security +updates please upgrade to a supported Node.js LTS version. + +More information can be found at: https://a.co/74kJMmI`); } - position.position++; - let subtype = collectASequenceOfCodePointsFast( - ";", - input, - position - ); - subtype = removeHTTPWhitespace(subtype, false, true); - if (subtype.length === 0 || !HTTP_TOKEN_CODEPOINTS.test(subtype)) { - return "failure"; + }; + } +}); + +// node_modules/@aws-sdk/core/dist-es/submodules/client/index.js +var init_client = __esm({ + "node_modules/@aws-sdk/core/dist-es/submodules/client/index.js"() { + init_emitWarningIfUnsupportedVersion(); + } +}); + +// node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/utils/getDateHeader.js +var import_protocol_http5, getDateHeader; +var init_getDateHeader = __esm({ + "node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/utils/getDateHeader.js"() { + import_protocol_http5 = __toESM(require_dist_cjs2()); + getDateHeader = (response) => import_protocol_http5.HttpResponse.isInstance(response) ? response.headers?.date ?? response.headers?.Date : void 0; + } +}); + +// node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/utils/getSkewCorrectedDate.js +var getSkewCorrectedDate; +var init_getSkewCorrectedDate = __esm({ + "node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/utils/getSkewCorrectedDate.js"() { + getSkewCorrectedDate = (systemClockOffset) => new Date(Date.now() + systemClockOffset); + } +}); + +// node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/utils/isClockSkewed.js +var isClockSkewed; +var init_isClockSkewed = __esm({ + "node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/utils/isClockSkewed.js"() { + init_getSkewCorrectedDate(); + isClockSkewed = (clockTime, systemClockOffset) => Math.abs(getSkewCorrectedDate(systemClockOffset).getTime() - clockTime) >= 3e5; + } +}); + +// node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/utils/getUpdatedSystemClockOffset.js +var getUpdatedSystemClockOffset; +var init_getUpdatedSystemClockOffset = __esm({ + "node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/utils/getUpdatedSystemClockOffset.js"() { + init_isClockSkewed(); + getUpdatedSystemClockOffset = (clockTime, currentSystemClockOffset) => { + const clockTimeInMs = Date.parse(clockTime); + if (isClockSkewed(clockTimeInMs, currentSystemClockOffset)) { + return clockTimeInMs - Date.now(); } - const typeLowercase = type.toLowerCase(); - const subtypeLowercase = subtype.toLowerCase(); - const mimeType = { - type: typeLowercase, - subtype: subtypeLowercase, - /** @type {Map} */ - parameters: /* @__PURE__ */ new Map(), - // https://mimesniff.spec.whatwg.org/#mime-type-essence - essence: `${typeLowercase}/${subtypeLowercase}` + return currentSystemClockOffset; + }; + } +}); + +// node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/utils/index.js +var init_utils = __esm({ + "node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/utils/index.js"() { + init_getDateHeader(); + init_getSkewCorrectedDate(); + init_getUpdatedSystemClockOffset(); + } +}); + +// node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/aws_sdk/AwsSdkSigV4Signer.js +var import_protocol_http6, throwSigningPropertyError, validateSigningProperties, AwsSdkSigV4Signer, AWSSDKSigV4Signer; +var init_AwsSdkSigV4Signer = __esm({ + "node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/aws_sdk/AwsSdkSigV4Signer.js"() { + import_protocol_http6 = __toESM(require_dist_cjs2()); + init_utils(); + throwSigningPropertyError = (name, property) => { + if (!property) { + throw new Error(`Property \`${name}\` is not resolved for AWS SDK SigV4Auth`); + } + return property; + }; + validateSigningProperties = async (signingProperties) => { + const context = throwSigningPropertyError("context", signingProperties.context); + const config = throwSigningPropertyError("config", signingProperties.config); + const authScheme = context.endpointV2?.properties?.authSchemes?.[0]; + const signerFunction = throwSigningPropertyError("signer", config.signer); + const signer = await signerFunction(authScheme); + const signingRegion = signingProperties?.signingRegion; + const signingRegionSet = signingProperties?.signingRegionSet; + const signingName = signingProperties?.signingName; + return { + config, + signer, + signingRegion, + signingRegionSet, + signingName }; - while (position.position < input.length) { - position.position++; - collectASequenceOfCodePoints( - // https://fetch.spec.whatwg.org/#http-whitespace - (char) => HTTP_WHITESPACE_REGEX.test(char), - input, - position - ); - let parameterName = collectASequenceOfCodePoints( - (char) => char !== ";" && char !== "=", - input, - position - ); - parameterName = parameterName.toLowerCase(); - if (position.position < input.length) { - if (input[position.position] === ";") { - continue; + }; + AwsSdkSigV4Signer = class { + async sign(httpRequest, identity, signingProperties) { + if (!import_protocol_http6.HttpRequest.isInstance(httpRequest)) { + throw new Error("The request is not an instance of `HttpRequest` and cannot be signed"); + } + const validatedProps = await validateSigningProperties(signingProperties); + const { config, signer } = validatedProps; + let { signingRegion, signingName } = validatedProps; + const handlerExecutionContext = signingProperties.context; + if (handlerExecutionContext?.authSchemes?.length ?? 0 > 1) { + const [first, second] = handlerExecutionContext.authSchemes; + if (first?.name === "sigv4a" && second?.name === "sigv4") { + signingRegion = second?.signingRegion ?? signingRegion; + signingName = second?.signingName ?? signingName; + } + } + const signedRequest = await signer.sign(httpRequest, { + signingDate: getSkewCorrectedDate(config.systemClockOffset), + signingRegion, + signingService: signingName + }); + return signedRequest; + } + errorHandler(signingProperties) { + return (error) => { + const serverTime = error.ServerTime ?? getDateHeader(error.$response); + if (serverTime) { + const config = throwSigningPropertyError("config", signingProperties.config); + const initialSystemClockOffset = config.systemClockOffset; + config.systemClockOffset = getUpdatedSystemClockOffset(serverTime, config.systemClockOffset); + const clockSkewCorrected = config.systemClockOffset !== initialSystemClockOffset; + if (clockSkewCorrected && error.$metadata) { + error.$metadata.clockSkewCorrected = true; + } } - position.position++; + throw error; + }; + } + successHandler(httpResponse, signingProperties) { + const dateHeader = getDateHeader(httpResponse); + if (dateHeader) { + const config = throwSigningPropertyError("config", signingProperties.config); + config.systemClockOffset = getUpdatedSystemClockOffset(dateHeader, config.systemClockOffset); } - if (position.position > input.length) { - break; + } + }; + AWSSDKSigV4Signer = AwsSdkSigV4Signer; + } +}); + +// node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/aws_sdk/AwsSdkSigV4ASigner.js +var import_protocol_http7, AwsSdkSigV4ASigner; +var init_AwsSdkSigV4ASigner = __esm({ + "node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/aws_sdk/AwsSdkSigV4ASigner.js"() { + import_protocol_http7 = __toESM(require_dist_cjs2()); + init_utils(); + init_AwsSdkSigV4Signer(); + AwsSdkSigV4ASigner = class extends AwsSdkSigV4Signer { + async sign(httpRequest, identity, signingProperties) { + if (!import_protocol_http7.HttpRequest.isInstance(httpRequest)) { + throw new Error("The request is not an instance of `HttpRequest` and cannot be signed"); + } + const { config, signer, signingRegion, signingRegionSet, signingName } = await validateSigningProperties(signingProperties); + const configResolvedSigningRegionSet = await config.sigv4aSigningRegionSet?.(); + const multiRegionOverride = (configResolvedSigningRegionSet ?? signingRegionSet ?? [signingRegion]).join(","); + const signedRequest = await signer.sign(httpRequest, { + signingDate: getSkewCorrectedDate(config.systemClockOffset), + signingRegion: multiRegionOverride, + signingService: signingName + }); + return signedRequest; + } + }; + } +}); + +// node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/aws_sdk/resolveAwsSdkSigV4AConfig.js +var import_property_provider, resolveAwsSdkSigV4AConfig, NODE_SIGV4A_CONFIG_OPTIONS; +var init_resolveAwsSdkSigV4AConfig = __esm({ + "node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/aws_sdk/resolveAwsSdkSigV4AConfig.js"() { + init_dist_es(); + import_property_provider = __toESM(require_dist_cjs12()); + resolveAwsSdkSigV4AConfig = (config) => { + config.sigv4aSigningRegionSet = normalizeProvider(config.sigv4aSigningRegionSet); + return config; + }; + NODE_SIGV4A_CONFIG_OPTIONS = { + environmentVariableSelector(env) { + if (env.AWS_SIGV4A_SIGNING_REGION_SET) { + return env.AWS_SIGV4A_SIGNING_REGION_SET.split(",").map((_) => _.trim()); + } + throw new import_property_provider.ProviderError("AWS_SIGV4A_SIGNING_REGION_SET not set in env.", { + tryNextLink: true + }); + }, + configFileSelector(profile) { + if (profile.sigv4a_signing_region_set) { + return (profile.sigv4a_signing_region_set ?? "").split(",").map((_) => _.trim()); } - let parameterValue = null; - if (input[position.position] === '"') { - parameterValue = collectAnHTTPQuotedString(input, position, true); - collectASequenceOfCodePointsFast( - ";", - input, - position - ); - } else { - parameterValue = collectASequenceOfCodePointsFast( - ";", - input, - position - ); - parameterValue = removeHTTPWhitespace(parameterValue, false, true); - if (parameterValue.length === 0) { + throw new import_property_provider.ProviderError("sigv4a_signing_region_set not set in profile.", { + tryNextLink: true + }); + }, + default: void 0 + }; + } +}); + +// node_modules/@smithy/signature-v4/dist-cjs/index.js +var require_dist_cjs35 = __commonJS({ + "node_modules/@smithy/signature-v4/dist-cjs/index.js"(exports2, module2) { + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); + }; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + } + return to; + }; + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + SignatureV4: () => SignatureV42, + clearCredentialCache: () => clearCredentialCache, + createScope: () => createScope, + getCanonicalHeaders: () => getCanonicalHeaders, + getCanonicalQuery: () => getCanonicalQuery, + getPayloadHash: () => getPayloadHash, + getSigningKey: () => getSigningKey, + moveHeadersToQuery: () => moveHeadersToQuery, + prepareRequest: () => prepareRequest + }); + module2.exports = __toCommonJS2(src_exports); + var import_util_middleware3 = require_dist_cjs10(); + var import_util_utf84 = require_dist_cjs24(); + var ALGORITHM_QUERY_PARAM = "X-Amz-Algorithm"; + var CREDENTIAL_QUERY_PARAM = "X-Amz-Credential"; + var AMZ_DATE_QUERY_PARAM = "X-Amz-Date"; + var SIGNED_HEADERS_QUERY_PARAM = "X-Amz-SignedHeaders"; + var EXPIRES_QUERY_PARAM = "X-Amz-Expires"; + var SIGNATURE_QUERY_PARAM = "X-Amz-Signature"; + var TOKEN_QUERY_PARAM = "X-Amz-Security-Token"; + var AUTH_HEADER = "authorization"; + var AMZ_DATE_HEADER = AMZ_DATE_QUERY_PARAM.toLowerCase(); + var DATE_HEADER = "date"; + var GENERATED_HEADERS = [AUTH_HEADER, AMZ_DATE_HEADER, DATE_HEADER]; + var SIGNATURE_HEADER = SIGNATURE_QUERY_PARAM.toLowerCase(); + var SHA256_HEADER = "x-amz-content-sha256"; + var TOKEN_HEADER = TOKEN_QUERY_PARAM.toLowerCase(); + var ALWAYS_UNSIGNABLE_HEADERS = { + authorization: true, + "cache-control": true, + connection: true, + expect: true, + from: true, + "keep-alive": true, + "max-forwards": true, + pragma: true, + referer: true, + te: true, + trailer: true, + "transfer-encoding": true, + upgrade: true, + "user-agent": true, + "x-amzn-trace-id": true + }; + var PROXY_HEADER_PATTERN = /^proxy-/; + var SEC_HEADER_PATTERN = /^sec-/; + var ALGORITHM_IDENTIFIER = "AWS4-HMAC-SHA256"; + var EVENT_ALGORITHM_IDENTIFIER = "AWS4-HMAC-SHA256-PAYLOAD"; + var UNSIGNED_PAYLOAD = "UNSIGNED-PAYLOAD"; + var MAX_CACHE_SIZE = 50; + var KEY_TYPE_IDENTIFIER = "aws4_request"; + var MAX_PRESIGNED_TTL = 60 * 60 * 24 * 7; + var import_util_hex_encoding = require_dist_cjs30(); + var import_util_utf8 = require_dist_cjs24(); + var signingKeyCache = {}; + var cacheQueue = []; + var createScope = /* @__PURE__ */ __name((shortDate, region, service) => `${shortDate}/${region}/${service}/${KEY_TYPE_IDENTIFIER}`, "createScope"); + var getSigningKey = /* @__PURE__ */ __name(async (sha256Constructor, credentials, shortDate, region, service) => { + const credsHash = await hmac(sha256Constructor, credentials.secretAccessKey, credentials.accessKeyId); + const cacheKey = `${shortDate}:${region}:${service}:${(0, import_util_hex_encoding.toHex)(credsHash)}:${credentials.sessionToken}`; + if (cacheKey in signingKeyCache) { + return signingKeyCache[cacheKey]; + } + cacheQueue.push(cacheKey); + while (cacheQueue.length > MAX_CACHE_SIZE) { + delete signingKeyCache[cacheQueue.shift()]; + } + let key = `AWS4${credentials.secretAccessKey}`; + for (const signable of [shortDate, region, service, KEY_TYPE_IDENTIFIER]) { + key = await hmac(sha256Constructor, key, signable); + } + return signingKeyCache[cacheKey] = key; + }, "getSigningKey"); + var clearCredentialCache = /* @__PURE__ */ __name(() => { + cacheQueue.length = 0; + Object.keys(signingKeyCache).forEach((cacheKey) => { + delete signingKeyCache[cacheKey]; + }); + }, "clearCredentialCache"); + var hmac = /* @__PURE__ */ __name((ctor, secret, data) => { + const hash = new ctor(secret); + hash.update((0, import_util_utf8.toUint8Array)(data)); + return hash.digest(); + }, "hmac"); + var getCanonicalHeaders = /* @__PURE__ */ __name(({ headers }, unsignableHeaders, signableHeaders) => { + const canonical = {}; + for (const headerName of Object.keys(headers).sort()) { + if (headers[headerName] == void 0) { + continue; + } + const canonicalHeaderName = headerName.toLowerCase(); + if (canonicalHeaderName in ALWAYS_UNSIGNABLE_HEADERS || (unsignableHeaders == null ? void 0 : unsignableHeaders.has(canonicalHeaderName)) || PROXY_HEADER_PATTERN.test(canonicalHeaderName) || SEC_HEADER_PATTERN.test(canonicalHeaderName)) { + if (!signableHeaders || signableHeaders && !signableHeaders.has(canonicalHeaderName)) { continue; } } - if (parameterName.length !== 0 && HTTP_TOKEN_CODEPOINTS.test(parameterName) && (parameterValue.length === 0 || HTTP_QUOTED_STRING_TOKENS.test(parameterValue)) && !mimeType.parameters.has(parameterName)) { - mimeType.parameters.set(parameterName, parameterValue); + canonical[canonicalHeaderName] = headers[headerName].trim().replace(/\s+/g, " "); + } + return canonical; + }, "getCanonicalHeaders"); + var import_util_uri_escape = require_dist_cjs26(); + var getCanonicalQuery = /* @__PURE__ */ __name(({ query = {} }) => { + const keys = []; + const serialized = {}; + for (const key of Object.keys(query).sort()) { + if (key.toLowerCase() === SIGNATURE_HEADER) { + continue; + } + keys.push(key); + const value = query[key]; + if (typeof value === "string") { + serialized[key] = `${(0, import_util_uri_escape.escapeUri)(key)}=${(0, import_util_uri_escape.escapeUri)(value)}`; + } else if (Array.isArray(value)) { + serialized[key] = value.slice(0).reduce( + (encoded, value2) => encoded.concat([`${(0, import_util_uri_escape.escapeUri)(key)}=${(0, import_util_uri_escape.escapeUri)(value2)}`]), + [] + ).sort().join("&"); + } + } + return keys.map((key) => serialized[key]).filter((serialized2) => serialized2).join("&"); + }, "getCanonicalQuery"); + var import_is_array_buffer = require_dist_cjs22(); + var import_util_utf82 = require_dist_cjs24(); + var getPayloadHash = /* @__PURE__ */ __name(async ({ headers, body }, hashConstructor) => { + for (const headerName of Object.keys(headers)) { + if (headerName.toLowerCase() === SHA256_HEADER) { + return headers[headerName]; + } + } + if (body == void 0) { + return "e3b0c44298fc1c149afbf4c8996fb92427ae41e4649b934ca495991b7852b855"; + } else if (typeof body === "string" || ArrayBuffer.isView(body) || (0, import_is_array_buffer.isArrayBuffer)(body)) { + const hashCtor = new hashConstructor(); + hashCtor.update((0, import_util_utf82.toUint8Array)(body)); + return (0, import_util_hex_encoding.toHex)(await hashCtor.digest()); + } + return UNSIGNED_PAYLOAD; + }, "getPayloadHash"); + var import_util_utf83 = require_dist_cjs24(); + var _HeaderFormatter = class _HeaderFormatter { + format(headers) { + const chunks = []; + for (const headerName of Object.keys(headers)) { + const bytes = (0, import_util_utf83.fromUtf8)(headerName); + chunks.push(Uint8Array.from([bytes.byteLength]), bytes, this.formatHeaderValue(headers[headerName])); + } + const out = new Uint8Array(chunks.reduce((carry, bytes) => carry + bytes.byteLength, 0)); + let position = 0; + for (const chunk of chunks) { + out.set(chunk, position); + position += chunk.byteLength; } + return out; } - return mimeType; - } - function forgivingBase64(data) { - data = data.replace(ASCII_WHITESPACE_REPLACE_REGEX, ""); - let dataLength = data.length; - if (dataLength % 4 === 0) { - if (data.charCodeAt(dataLength - 1) === 61) { - --dataLength; - if (data.charCodeAt(dataLength - 1) === 61) { - --dataLength; - } + formatHeaderValue(header) { + switch (header.type) { + case "boolean": + return Uint8Array.from([ + header.value ? 0 : 1 + /* boolFalse */ + ]); + case "byte": + return Uint8Array.from([2, header.value]); + case "short": + const shortView = new DataView(new ArrayBuffer(3)); + shortView.setUint8( + 0, + 3 + /* short */ + ); + shortView.setInt16(1, header.value, false); + return new Uint8Array(shortView.buffer); + case "integer": + const intView = new DataView(new ArrayBuffer(5)); + intView.setUint8( + 0, + 4 + /* integer */ + ); + intView.setInt32(1, header.value, false); + return new Uint8Array(intView.buffer); + case "long": + const longBytes = new Uint8Array(9); + longBytes[0] = 5; + longBytes.set(header.value.bytes, 1); + return longBytes; + case "binary": + const binView = new DataView(new ArrayBuffer(3 + header.value.byteLength)); + binView.setUint8( + 0, + 6 + /* byteArray */ + ); + binView.setUint16(1, header.value.byteLength, false); + const binBytes = new Uint8Array(binView.buffer); + binBytes.set(header.value, 3); + return binBytes; + case "string": + const utf8Bytes = (0, import_util_utf83.fromUtf8)(header.value); + const strView = new DataView(new ArrayBuffer(3 + utf8Bytes.byteLength)); + strView.setUint8( + 0, + 7 + /* string */ + ); + strView.setUint16(1, utf8Bytes.byteLength, false); + const strBytes = new Uint8Array(strView.buffer); + strBytes.set(utf8Bytes, 3); + return strBytes; + case "timestamp": + const tsBytes = new Uint8Array(9); + tsBytes[0] = 8; + tsBytes.set(Int64.fromNumber(header.value.valueOf()).bytes, 1); + return tsBytes; + case "uuid": + if (!UUID_PATTERN.test(header.value)) { + throw new Error(`Invalid UUID received: ${header.value}`); + } + const uuidBytes = new Uint8Array(17); + uuidBytes[0] = 9; + uuidBytes.set((0, import_util_hex_encoding.fromHex)(header.value.replace(/\-/g, "")), 1); + return uuidBytes; } } - if (dataLength % 4 === 1) { - return "failure"; + }; + __name(_HeaderFormatter, "HeaderFormatter"); + var HeaderFormatter = _HeaderFormatter; + var UUID_PATTERN = /^[a-f0-9]{8}-[a-f0-9]{4}-[a-f0-9]{4}-[a-f0-9]{4}-[a-f0-9]{12}$/; + var _Int64 = class _Int642 { + constructor(bytes) { + this.bytes = bytes; + if (bytes.byteLength !== 8) { + throw new Error("Int64 buffers must be exactly 8 bytes"); + } } - if (/[^+/0-9A-Za-z]/.test(data.length === dataLength ? data : data.substring(0, dataLength))) { - return "failure"; + static fromNumber(number) { + if (number > 9223372036854776e3 || number < -9223372036854776e3) { + throw new Error(`${number} is too large (or, if negative, too small) to represent as an Int64`); + } + const bytes = new Uint8Array(8); + for (let i = 7, remaining = Math.abs(Math.round(number)); i > -1 && remaining > 0; i--, remaining /= 256) { + bytes[i] = remaining; + } + if (number < 0) { + negate(bytes); + } + return new _Int642(bytes); } - const buffer = Buffer.from(data, "base64"); - return new Uint8Array(buffer.buffer, buffer.byteOffset, buffer.byteLength); - } - function collectAnHTTPQuotedString(input, position, extractValue) { - const positionStart = position.position; - let value = ""; - assert(input[position.position] === '"'); - position.position++; - while (true) { - value += collectASequenceOfCodePoints( - (char) => char !== '"' && char !== "\\", - input, - position - ); - if (position.position >= input.length) { - break; + /** + * Called implicitly by infix arithmetic operators. + */ + valueOf() { + const bytes = this.bytes.slice(0); + const negative = bytes[0] & 128; + if (negative) { + negate(bytes); } - const quoteOrBackslash = input[position.position]; - position.position++; - if (quoteOrBackslash === "\\") { - if (position.position >= input.length) { - value += "\\"; - break; - } - value += input[position.position]; - position.position++; - } else { - assert(quoteOrBackslash === '"'); + return parseInt((0, import_util_hex_encoding.toHex)(bytes), 16) * (negative ? -1 : 1); + } + toString() { + return String(this.valueOf()); + } + }; + __name(_Int64, "Int64"); + var Int64 = _Int64; + function negate(bytes) { + for (let i = 0; i < 8; i++) { + bytes[i] ^= 255; + } + for (let i = 7; i > -1; i--) { + bytes[i]++; + if (bytes[i] !== 0) break; + } + } + __name(negate, "negate"); + var hasHeader = /* @__PURE__ */ __name((soughtHeader, headers) => { + soughtHeader = soughtHeader.toLowerCase(); + for (const headerName of Object.keys(headers)) { + if (soughtHeader === headerName.toLowerCase()) { + return true; } } - if (extractValue) { - return value; + return false; + }, "hasHeader"); + var import_protocol_http8 = require_dist_cjs2(); + var moveHeadersToQuery = /* @__PURE__ */ __name((request2, options = {}) => { + var _a; + const { headers, query = {} } = import_protocol_http8.HttpRequest.clone(request2); + for (const name of Object.keys(headers)) { + const lname = name.toLowerCase(); + if (lname.slice(0, 6) === "x-amz-" && !((_a = options.unhoistableHeaders) == null ? void 0 : _a.has(lname))) { + query[name] = headers[name]; + delete headers[name]; + } } - return input.slice(positionStart, position.position); - } - function serializeAMimeType(mimeType) { - assert(mimeType !== "failure"); - const { parameters, essence } = mimeType; - let serialization = essence; - for (let [name, value] of parameters.entries()) { - serialization += ";"; - serialization += name; - serialization += "="; - if (!HTTP_TOKEN_CODEPOINTS.test(value)) { - value = value.replace(/(\\|")/g, "\\$1"); - value = '"' + value; - value += '"'; + return { + ...request2, + headers, + query + }; + }, "moveHeadersToQuery"); + var prepareRequest = /* @__PURE__ */ __name((request2) => { + request2 = import_protocol_http8.HttpRequest.clone(request2); + for (const headerName of Object.keys(request2.headers)) { + if (GENERATED_HEADERS.indexOf(headerName.toLowerCase()) > -1) { + delete request2.headers[headerName]; } - serialization += value; } - return serialization; - } - function isHTTPWhiteSpace(char) { - return char === 13 || char === 10 || char === 9 || char === 32; - } - function removeHTTPWhitespace(str, leading = true, trailing = true) { - return removeChars(str, leading, trailing, isHTTPWhiteSpace); - } - function isASCIIWhitespace(char) { - return char === 13 || char === 10 || char === 9 || char === 12 || char === 32; - } - function removeASCIIWhitespace(str, leading = true, trailing = true) { - return removeChars(str, leading, trailing, isASCIIWhitespace); - } - function removeChars(str, leading, trailing, predicate) { - let lead = 0; - let trail = str.length - 1; - if (leading) { - while (lead < str.length && predicate(str.charCodeAt(lead))) lead++; + return request2; + }, "prepareRequest"); + var iso8601 = /* @__PURE__ */ __name((time) => toDate(time).toISOString().replace(/\.\d{3}Z$/, "Z"), "iso8601"); + var toDate = /* @__PURE__ */ __name((time) => { + if (typeof time === "number") { + return new Date(time * 1e3); } - if (trailing) { - while (trail > 0 && predicate(str.charCodeAt(trail))) trail--; + if (typeof time === "string") { + if (Number(time)) { + return new Date(Number(time) * 1e3); + } + return new Date(time); } - return lead === 0 && trail === str.length - 1 ? str : str.slice(lead, trail + 1); - } - function isomorphicDecode(input) { - const length = input.length; - if ((2 << 15) - 1 > length) { - return String.fromCharCode.apply(null, input); + return time; + }, "toDate"); + var _SignatureV4 = class _SignatureV4 { + constructor({ + applyChecksum, + credentials, + region, + service, + sha256, + uriEscapePath = true + }) { + this.headerFormatter = new HeaderFormatter(); + this.service = service; + this.sha256 = sha256; + this.uriEscapePath = uriEscapePath; + this.applyChecksum = typeof applyChecksum === "boolean" ? applyChecksum : true; + this.regionProvider = (0, import_util_middleware3.normalizeProvider)(region); + this.credentialProvider = (0, import_util_middleware3.normalizeProvider)(credentials); + } + async presign(originalRequest, options = {}) { + const { + signingDate = /* @__PURE__ */ new Date(), + expiresIn = 3600, + unsignableHeaders, + unhoistableHeaders, + signableHeaders, + signingRegion, + signingService + } = options; + const credentials = await this.credentialProvider(); + this.validateResolvedCredentials(credentials); + const region = signingRegion ?? await this.regionProvider(); + const { longDate, shortDate } = formatDate(signingDate); + if (expiresIn > MAX_PRESIGNED_TTL) { + return Promise.reject( + "Signature version 4 presigned URLs must have an expiration date less than one week in the future" + ); + } + const scope = createScope(shortDate, region, signingService ?? this.service); + const request2 = moveHeadersToQuery(prepareRequest(originalRequest), { unhoistableHeaders }); + if (credentials.sessionToken) { + request2.query[TOKEN_QUERY_PARAM] = credentials.sessionToken; + } + request2.query[ALGORITHM_QUERY_PARAM] = ALGORITHM_IDENTIFIER; + request2.query[CREDENTIAL_QUERY_PARAM] = `${credentials.accessKeyId}/${scope}`; + request2.query[AMZ_DATE_QUERY_PARAM] = longDate; + request2.query[EXPIRES_QUERY_PARAM] = expiresIn.toString(10); + const canonicalHeaders = getCanonicalHeaders(request2, unsignableHeaders, signableHeaders); + request2.query[SIGNED_HEADERS_QUERY_PARAM] = getCanonicalHeaderList(canonicalHeaders); + request2.query[SIGNATURE_QUERY_PARAM] = await this.getSignature( + longDate, + scope, + this.getSigningKey(credentials, region, shortDate, signingService), + this.createCanonicalRequest(request2, canonicalHeaders, await getPayloadHash(originalRequest, this.sha256)) + ); + return request2; } - let result = ""; - let i = 0; - let addition = (2 << 15) - 1; - while (i < length) { - if (i + addition > length) { - addition = length - i; + async sign(toSign, options) { + if (typeof toSign === "string") { + return this.signString(toSign, options); + } else if (toSign.headers && toSign.payload) { + return this.signEvent(toSign, options); + } else if (toSign.message) { + return this.signMessage(toSign, options); + } else { + return this.signRequest(toSign, options); + } + } + async signEvent({ headers, payload }, { signingDate = /* @__PURE__ */ new Date(), priorSignature, signingRegion, signingService }) { + const region = signingRegion ?? await this.regionProvider(); + const { shortDate, longDate } = formatDate(signingDate); + const scope = createScope(shortDate, region, signingService ?? this.service); + const hashedPayload = await getPayloadHash({ headers: {}, body: payload }, this.sha256); + const hash = new this.sha256(); + hash.update(headers); + const hashedHeaders = (0, import_util_hex_encoding.toHex)(await hash.digest()); + const stringToSign = [ + EVENT_ALGORITHM_IDENTIFIER, + longDate, + scope, + priorSignature, + hashedHeaders, + hashedPayload + ].join("\n"); + return this.signString(stringToSign, { signingDate, signingRegion: region, signingService }); + } + async signMessage(signableMessage, { signingDate = /* @__PURE__ */ new Date(), signingRegion, signingService }) { + const promise = this.signEvent( + { + headers: this.headerFormatter.format(signableMessage.message.headers), + payload: signableMessage.message.body + }, + { + signingDate, + signingRegion, + signingService, + priorSignature: signableMessage.priorSignature + } + ); + return promise.then((signature) => { + return { message: signableMessage.message, signature }; + }); + } + async signString(stringToSign, { signingDate = /* @__PURE__ */ new Date(), signingRegion, signingService } = {}) { + const credentials = await this.credentialProvider(); + this.validateResolvedCredentials(credentials); + const region = signingRegion ?? await this.regionProvider(); + const { shortDate } = formatDate(signingDate); + const hash = new this.sha256(await this.getSigningKey(credentials, region, shortDate, signingService)); + hash.update((0, import_util_utf84.toUint8Array)(stringToSign)); + return (0, import_util_hex_encoding.toHex)(await hash.digest()); + } + async signRequest(requestToSign, { + signingDate = /* @__PURE__ */ new Date(), + signableHeaders, + unsignableHeaders, + signingRegion, + signingService + } = {}) { + const credentials = await this.credentialProvider(); + this.validateResolvedCredentials(credentials); + const region = signingRegion ?? await this.regionProvider(); + const request2 = prepareRequest(requestToSign); + const { longDate, shortDate } = formatDate(signingDate); + const scope = createScope(shortDate, region, signingService ?? this.service); + request2.headers[AMZ_DATE_HEADER] = longDate; + if (credentials.sessionToken) { + request2.headers[TOKEN_HEADER] = credentials.sessionToken; + } + const payloadHash = await getPayloadHash(request2, this.sha256); + if (!hasHeader(SHA256_HEADER, request2.headers) && this.applyChecksum) { + request2.headers[SHA256_HEADER] = payloadHash; + } + const canonicalHeaders = getCanonicalHeaders(request2, unsignableHeaders, signableHeaders); + const signature = await this.getSignature( + longDate, + scope, + this.getSigningKey(credentials, region, shortDate, signingService), + this.createCanonicalRequest(request2, canonicalHeaders, payloadHash) + ); + request2.headers[AUTH_HEADER] = `${ALGORITHM_IDENTIFIER} Credential=${credentials.accessKeyId}/${scope}, SignedHeaders=${getCanonicalHeaderList(canonicalHeaders)}, Signature=${signature}`; + return request2; + } + createCanonicalRequest(request2, canonicalHeaders, payloadHash) { + const sortedHeaders = Object.keys(canonicalHeaders).sort(); + return `${request2.method} +${this.getCanonicalPath(request2)} +${getCanonicalQuery(request2)} +${sortedHeaders.map((name) => `${name}:${canonicalHeaders[name]}`).join("\n")} + +${sortedHeaders.join(";")} +${payloadHash}`; + } + async createStringToSign(longDate, credentialScope, canonicalRequest) { + const hash = new this.sha256(); + hash.update((0, import_util_utf84.toUint8Array)(canonicalRequest)); + const hashedRequest = await hash.digest(); + return `${ALGORITHM_IDENTIFIER} +${longDate} +${credentialScope} +${(0, import_util_hex_encoding.toHex)(hashedRequest)}`; + } + getCanonicalPath({ path }) { + if (this.uriEscapePath) { + const normalizedPathSegments = []; + for (const pathSegment of path.split("/")) { + if ((pathSegment == null ? void 0 : pathSegment.length) === 0) + continue; + if (pathSegment === ".") + continue; + if (pathSegment === "..") { + normalizedPathSegments.pop(); + } else { + normalizedPathSegments.push(pathSegment); + } + } + const normalizedPath = `${(path == null ? void 0 : path.startsWith("/")) ? "/" : ""}${normalizedPathSegments.join("/")}${normalizedPathSegments.length > 0 && (path == null ? void 0 : path.endsWith("/")) ? "/" : ""}`; + const doubleEncoded = (0, import_util_uri_escape.escapeUri)(normalizedPath); + return doubleEncoded.replace(/%2F/g, "/"); } - result += String.fromCharCode.apply(null, input.subarray(i, i += addition)); + return path; } - return result; - } - function minimizeSupportedMimeType(mimeType) { - switch (mimeType.essence) { - case "application/ecmascript": - case "application/javascript": - case "application/x-ecmascript": - case "application/x-javascript": - case "text/ecmascript": - case "text/javascript": - case "text/javascript1.0": - case "text/javascript1.1": - case "text/javascript1.2": - case "text/javascript1.3": - case "text/javascript1.4": - case "text/javascript1.5": - case "text/jscript": - case "text/livescript": - case "text/x-ecmascript": - case "text/x-javascript": - return "text/javascript"; - case "application/json": - case "text/json": - return "application/json"; - case "image/svg+xml": - return "image/svg+xml"; - case "text/xml": - case "application/xml": - return "application/xml"; + async getSignature(longDate, credentialScope, keyPromise, canonicalRequest) { + const stringToSign = await this.createStringToSign(longDate, credentialScope, canonicalRequest); + const hash = new this.sha256(await keyPromise); + hash.update((0, import_util_utf84.toUint8Array)(stringToSign)); + return (0, import_util_hex_encoding.toHex)(await hash.digest()); } - if (mimeType.subtype.endsWith("+json")) { - return "application/json"; + getSigningKey(credentials, region, shortDate, service) { + return getSigningKey(this.sha256, credentials, shortDate, region, service || this.service); } - if (mimeType.subtype.endsWith("+xml")) { - return "application/xml"; + validateResolvedCredentials(credentials) { + if (typeof credentials !== "object" || // @ts-expect-error: Property 'accessKeyId' does not exist on type 'object'.ts(2339) + typeof credentials.accessKeyId !== "string" || // @ts-expect-error: Property 'secretAccessKey' does not exist on type 'object'.ts(2339) + typeof credentials.secretAccessKey !== "string") { + throw new Error("Resolved credential object is not valid"); + } } - return ""; - } - module2.exports = { - dataURLProcessor, - URLSerializer, - collectASequenceOfCodePoints, - collectASequenceOfCodePointsFast, - stringPercentDecode, - parseMIMEType, - collectAnHTTPQuotedString, - serializeAMimeType, - removeChars, - removeHTTPWhitespace, - minimizeSupportedMimeType, - HTTP_TOKEN_CODEPOINTS, - isomorphicDecode }; + __name(_SignatureV4, "SignatureV4"); + var SignatureV42 = _SignatureV4; + var formatDate = /* @__PURE__ */ __name((now) => { + const longDate = iso8601(now).replace(/[\-:]/g, ""); + return { + longDate, + shortDate: longDate.slice(0, 8) + }; + }, "formatDate"); + var getCanonicalHeaderList = /* @__PURE__ */ __name((headers) => Object.keys(headers).sort().join(";"), "getCanonicalHeaderList"); } }); -// node_modules/undici/lib/web/fetch/webidl.js -var require_webidl2 = __commonJS({ - "node_modules/undici/lib/web/fetch/webidl.js"(exports2, module2) { - "use strict"; - var { types, inspect } = require("node:util"); - var { toUSVString } = require_util8(); - var webidl = {}; - webidl.converters = {}; - webidl.util = {}; - webidl.errors = {}; - webidl.errors.exception = function(message) { - return new TypeError(`${message.header}: ${message.message}`); - }; - webidl.errors.conversionFailed = function(context) { - const plural = context.types.length === 1 ? "" : " one of"; - const message = `${context.argument} could not be converted to${plural}: ${context.types.join(", ")}.`; - return webidl.errors.exception({ - header: context.prefix, - message - }); - }; - webidl.errors.invalidArgument = function(context) { - return webidl.errors.exception({ - header: context.prefix, - message: `"${context.value}" is an invalid ${context.type}.` - }); - }; - webidl.brandCheck = function(V, I, opts) { - if (opts?.strict !== false) { - if (!(V instanceof I)) { - const err = new TypeError("Illegal invocation"); - err.code = "ERR_INVALID_THIS"; - throw err; +// node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/aws_sdk/resolveAwsSdkSigV4Config.js +var import_signature_v4, resolveAwsSdkSigV4Config, resolveAWSSDKSigV4Config; +var init_resolveAwsSdkSigV4Config = __esm({ + "node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/aws_sdk/resolveAwsSdkSigV4Config.js"() { + init_dist_es(); + import_signature_v4 = __toESM(require_dist_cjs35()); + resolveAwsSdkSigV4Config = (config) => { + let normalizedCreds; + if (config.credentials) { + normalizedCreds = memoizeIdentityProvider(config.credentials, isIdentityExpired, doesIdentityRequireRefresh); + } + if (!normalizedCreds) { + if (config.credentialDefaultProvider) { + normalizedCreds = normalizeProvider(config.credentialDefaultProvider(Object.assign({}, config, { + parentClientConfig: config + }))); + } else { + normalizedCreds = async () => { + throw new Error("`credentials` is missing"); + }; } + } + const { signingEscapePath = true, systemClockOffset = config.systemClockOffset || 0, sha256 } = config; + let signer; + if (config.signer) { + signer = normalizeProvider(config.signer); + } else if (config.regionInfoProvider) { + signer = () => normalizeProvider(config.region)().then(async (region) => [ + await config.regionInfoProvider(region, { + useFipsEndpoint: await config.useFipsEndpoint(), + useDualstackEndpoint: await config.useDualstackEndpoint() + }) || {}, + region + ]).then(([regionInfo, region]) => { + const { signingRegion, signingService } = regionInfo; + config.signingRegion = config.signingRegion || signingRegion || region; + config.signingName = config.signingName || signingService || config.serviceId; + const params = { + ...config, + credentials: normalizedCreds, + region: config.signingRegion, + service: config.signingName, + sha256, + uriEscapePath: signingEscapePath + }; + const SignerCtor = config.signerConstructor || import_signature_v4.SignatureV4; + return new SignerCtor(params); + }); } else { - if (V?.[Symbol.toStringTag] !== I.prototype[Symbol.toStringTag]) { - const err = new TypeError("Illegal invocation"); - err.code = "ERR_INVALID_THIS"; - throw err; + signer = async (authScheme) => { + authScheme = Object.assign({}, { + name: "sigv4", + signingName: config.signingName || config.defaultSigningName, + signingRegion: await normalizeProvider(config.region)(), + properties: {} + }, authScheme); + const signingRegion = authScheme.signingRegion; + const signingService = authScheme.signingName; + config.signingRegion = config.signingRegion || signingRegion; + config.signingName = config.signingName || signingService || config.serviceId; + const params = { + ...config, + credentials: normalizedCreds, + region: config.signingRegion, + service: config.signingName, + sha256, + uriEscapePath: signingEscapePath + }; + const SignerCtor = config.signerConstructor || import_signature_v4.SignatureV4; + return new SignerCtor(params); + }; + } + return { + ...config, + systemClockOffset, + signingEscapePath, + credentials: normalizedCreds, + signer + }; + }; + resolveAWSSDKSigV4Config = resolveAwsSdkSigV4Config; + } +}); + +// node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/aws_sdk/index.js +var init_aws_sdk = __esm({ + "node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/aws_sdk/index.js"() { + init_AwsSdkSigV4Signer(); + init_AwsSdkSigV4ASigner(); + init_resolveAwsSdkSigV4AConfig(); + init_resolveAwsSdkSigV4Config(); + } +}); + +// node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/index.js +var init_httpAuthSchemes2 = __esm({ + "node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/index.js"() { + init_aws_sdk(); + } +}); + +// node_modules/@aws-sdk/core/dist-es/submodules/protocols/coercing-serializers.js +var _toStr, _toBool, _toNum; +var init_coercing_serializers = __esm({ + "node_modules/@aws-sdk/core/dist-es/submodules/protocols/coercing-serializers.js"() { + _toStr = (val2) => { + if (val2 == null) { + return val2; + } + if (typeof val2 === "number" || typeof val2 === "bigint") { + const warning = new Error(`Received number ${val2} where a string was expected.`); + warning.name = "Warning"; + console.warn(warning); + return String(val2); + } + if (typeof val2 === "boolean") { + const warning = new Error(`Received boolean ${val2} where a string was expected.`); + warning.name = "Warning"; + console.warn(warning); + return String(val2); + } + return val2; + }; + _toBool = (val2) => { + if (val2 == null) { + return val2; + } + if (typeof val2 === "number") { + } + if (typeof val2 === "string") { + const lowercase = val2.toLowerCase(); + if (val2 !== "" && lowercase !== "false" && lowercase !== "true") { + const warning = new Error(`Received string "${val2}" where a boolean was expected.`); + warning.name = "Warning"; + console.warn(warning); } + return val2 !== "" && lowercase !== "false"; } + return val2; }; - webidl.argumentLengthCheck = function({ length }, min, ctx) { - if (length < min) { - throw webidl.errors.exception({ - message: `${min} argument${min !== 1 ? "s" : ""} required, but${length ? " only" : ""} ${length} found.`, - header: ctx - }); + _toNum = (val2) => { + if (val2 == null) { + return val2; } + if (typeof val2 === "boolean") { + } + if (typeof val2 === "string") { + const num = Number(val2); + if (num.toString() !== val2) { + const warning = new Error(`Received string "${val2}" where a number was expected.`); + warning.name = "Warning"; + console.warn(warning); + return val2; + } + return num; + } + return val2; }; - webidl.illegalConstructor = function() { - throw webidl.errors.exception({ - header: "TypeError", - message: "Illegal constructor" - }); + } +}); + +// node_modules/@aws-sdk/core/dist-es/submodules/protocols/json/awsExpectUnion.js +var import_smithy_client2, awsExpectUnion; +var init_awsExpectUnion = __esm({ + "node_modules/@aws-sdk/core/dist-es/submodules/protocols/json/awsExpectUnion.js"() { + import_smithy_client2 = __toESM(require_dist_cjs32()); + awsExpectUnion = (value) => { + if (value == null) { + return void 0; + } + if (typeof value === "object" && "__type" in value) { + delete value.__type; + } + return (0, import_smithy_client2.expectUnion)(value); }; - webidl.util.Type = function(V) { - switch (typeof V) { - case "undefined": - return "Undefined"; - case "boolean": - return "Boolean"; - case "string": - return "String"; - case "symbol": - return "Symbol"; - case "number": - return "Number"; - case "bigint": - return "BigInt"; - case "function": - case "object": { - if (V === null) { - return "Null"; + } +}); + +// node_modules/@aws-sdk/core/dist-es/submodules/protocols/common.js +var import_smithy_client3, collectBodyString; +var init_common = __esm({ + "node_modules/@aws-sdk/core/dist-es/submodules/protocols/common.js"() { + import_smithy_client3 = __toESM(require_dist_cjs32()); + collectBodyString = (streamBody, context) => (0, import_smithy_client3.collectBody)(streamBody, context).then((body) => context.utf8Encoder(body)); + } +}); + +// node_modules/@aws-sdk/core/dist-es/submodules/protocols/json/parseJsonBody.js +var parseJsonBody, parseJsonErrorBody, loadRestJsonErrorCode; +var init_parseJsonBody = __esm({ + "node_modules/@aws-sdk/core/dist-es/submodules/protocols/json/parseJsonBody.js"() { + init_common(); + parseJsonBody = (streamBody, context) => collectBodyString(streamBody, context).then((encoded) => { + if (encoded.length) { + try { + return JSON.parse(encoded); + } catch (e) { + if (e?.name === "SyntaxError") { + Object.defineProperty(e, "$responseBodyText", { + value: encoded + }); } - return "Object"; + throw e; } } + return {}; + }); + parseJsonErrorBody = async (errorBody, context) => { + const value = await parseJsonBody(errorBody, context); + value.message = value.message ?? value.Message; + return value; }; - webidl.util.ConvertToInt = function(V, bitLength, signedness, opts) { - let upperBound; - let lowerBound; - if (bitLength === 64) { - upperBound = Math.pow(2, 53) - 1; - if (signedness === "unsigned") { - lowerBound = 0; - } else { - lowerBound = Math.pow(-2, 53) + 1; + loadRestJsonErrorCode = (output, data) => { + const findKey = (object, key) => Object.keys(object).find((k) => k.toLowerCase() === key.toLowerCase()); + const sanitizeErrorCode = (rawValue) => { + let cleanValue = rawValue; + if (typeof cleanValue === "number") { + cleanValue = cleanValue.toString(); } - } else if (signedness === "unsigned") { - lowerBound = 0; - upperBound = Math.pow(2, bitLength) - 1; - } else { - lowerBound = Math.pow(-2, bitLength) - 1; - upperBound = Math.pow(2, bitLength - 1) - 1; - } - let x = Number(V); - if (x === 0) { - x = 0; - } - if (opts?.enforceRange === true) { - if (Number.isNaN(x) || x === Number.POSITIVE_INFINITY || x === Number.NEGATIVE_INFINITY) { - throw webidl.errors.exception({ - header: "Integer conversion", - message: `Could not convert ${webidl.util.Stringify(V)} to an integer.` - }); + if (cleanValue.indexOf(",") >= 0) { + cleanValue = cleanValue.split(",")[0]; } - x = webidl.util.IntegerPart(x); - if (x < lowerBound || x > upperBound) { - throw webidl.errors.exception({ - header: "Integer conversion", - message: `Value must be between ${lowerBound}-${upperBound}, got ${x}.` - }); + if (cleanValue.indexOf(":") >= 0) { + cleanValue = cleanValue.split(":")[0]; } - return x; - } - if (!Number.isNaN(x) && opts?.clamp === true) { - x = Math.min(Math.max(x, lowerBound), upperBound); - if (Math.floor(x) % 2 === 0) { - x = Math.floor(x); - } else { - x = Math.ceil(x); + if (cleanValue.indexOf("#") >= 0) { + cleanValue = cleanValue.split("#")[1]; } - return x; + return cleanValue; + }; + const headerKey = findKey(output.headers, "x-amzn-errortype"); + if (headerKey !== void 0) { + return sanitizeErrorCode(output.headers[headerKey]); } - if (Number.isNaN(x) || x === 0 && Object.is(0, x) || x === Number.POSITIVE_INFINITY || x === Number.NEGATIVE_INFINITY) { - return 0; + if (data.code !== void 0) { + return sanitizeErrorCode(data.code); } - x = webidl.util.IntegerPart(x); - x = x % Math.pow(2, bitLength); - if (signedness === "signed" && x >= Math.pow(2, bitLength) - 1) { - return x - Math.pow(2, bitLength); + if (data["__type"] !== void 0) { + return sanitizeErrorCode(data["__type"]); } - return x; }; - webidl.util.IntegerPart = function(n) { - const r = Math.floor(Math.abs(n)); - if (n < 0) { - return -1 * r; + } +}); + +// node_modules/fast-xml-parser/src/util.js +var require_util8 = __commonJS({ + "node_modules/fast-xml-parser/src/util.js"(exports2) { + "use strict"; + var nameStartChar = ":A-Za-z_\\u00C0-\\u00D6\\u00D8-\\u00F6\\u00F8-\\u02FF\\u0370-\\u037D\\u037F-\\u1FFF\\u200C-\\u200D\\u2070-\\u218F\\u2C00-\\u2FEF\\u3001-\\uD7FF\\uF900-\\uFDCF\\uFDF0-\\uFFFD"; + var nameChar = nameStartChar + "\\-.\\d\\u00B7\\u0300-\\u036F\\u203F-\\u2040"; + var nameRegexp = "[" + nameStartChar + "][" + nameChar + "]*"; + var regexName = new RegExp("^" + nameRegexp + "$"); + var getAllMatches = function(string, regex) { + const matches = []; + let match = regex.exec(string); + while (match) { + const allmatches = []; + allmatches.startIndex = regex.lastIndex - match[0].length; + const len = match.length; + for (let index = 0; index < len; index++) { + allmatches.push(match[index]); + } + matches.push(allmatches); + match = regex.exec(string); + } + return matches; + }; + var isName = function(string) { + const match = regexName.exec(string); + return !(match === null || typeof match === "undefined"); + }; + exports2.isExist = function(v) { + return typeof v !== "undefined"; + }; + exports2.isEmptyObject = function(obj) { + return Object.keys(obj).length === 0; + }; + exports2.merge = function(target, a, arrayMode) { + if (a) { + const keys = Object.keys(a); + const len = keys.length; + for (let i = 0; i < len; i++) { + if (arrayMode === "strict") { + target[keys[i]] = [a[keys[i]]]; + } else { + target[keys[i]] = a[keys[i]]; + } + } } - return r; }; - webidl.util.Stringify = function(V) { - const type = webidl.util.Type(V); - switch (type) { - case "Symbol": - return `Symbol(${V.description})`; - case "Object": - return inspect(V); - case "String": - return `"${V}"`; - default: - return `${V}`; + exports2.getValue = function(v) { + if (exports2.isExist(v)) { + return v; + } else { + return ""; } }; - webidl.sequenceConverter = function(converter) { - return (V, prefix, argument, Iterable) => { - if (webidl.util.Type(V) !== "Object") { - throw webidl.errors.exception({ - header: prefix, - message: `${argument} (${webidl.util.Stringify(V)}) is not iterable.` - }); + exports2.isName = isName; + exports2.getAllMatches = getAllMatches; + exports2.nameRegexp = nameRegexp; + } +}); + +// node_modules/fast-xml-parser/src/validator.js +var require_validator = __commonJS({ + "node_modules/fast-xml-parser/src/validator.js"(exports2) { + "use strict"; + var util = require_util8(); + var defaultOptions = { + allowBooleanAttributes: false, + //A tag can have attributes without any value + unpairedTags: [] + }; + exports2.validate = function(xmlData, options) { + options = Object.assign({}, defaultOptions, options); + const tags = []; + let tagFound = false; + let reachedRoot = false; + if (xmlData[0] === "\uFEFF") { + xmlData = xmlData.substr(1); + } + for (let i = 0; i < xmlData.length; i++) { + if (xmlData[i] === "<" && xmlData[i + 1] === "?") { + i += 2; + i = readPI(xmlData, i); + if (i.err) return i; + } else if (xmlData[i] === "<") { + let tagStartPos = i; + i++; + if (xmlData[i] === "!") { + i = readCommentAndCDATA(xmlData, i); + continue; + } else { + let closingTag = false; + if (xmlData[i] === "/") { + closingTag = true; + i++; + } + let tagName = ""; + for (; i < xmlData.length && xmlData[i] !== ">" && xmlData[i] !== " " && xmlData[i] !== " " && xmlData[i] !== "\n" && xmlData[i] !== "\r"; i++) { + tagName += xmlData[i]; + } + tagName = tagName.trim(); + if (tagName[tagName.length - 1] === "/") { + tagName = tagName.substring(0, tagName.length - 1); + i--; + } + if (!validateTagName(tagName)) { + let msg; + if (tagName.trim().length === 0) { + msg = "Invalid space after '<'."; + } else { + msg = "Tag '" + tagName + "' is an invalid name."; + } + return getErrorObject("InvalidTag", msg, getLineNumberForPosition(xmlData, i)); + } + const result = readAttributeStr(xmlData, i); + if (result === false) { + return getErrorObject("InvalidAttr", "Attributes for '" + tagName + "' have open quote.", getLineNumberForPosition(xmlData, i)); + } + let attrStr = result.value; + i = result.index; + if (attrStr[attrStr.length - 1] === "/") { + const attrStrStart = i - attrStr.length; + attrStr = attrStr.substring(0, attrStr.length - 1); + const isValid = validateAttributeString(attrStr, options); + if (isValid === true) { + tagFound = true; + } else { + return getErrorObject(isValid.err.code, isValid.err.msg, getLineNumberForPosition(xmlData, attrStrStart + isValid.err.line)); + } + } else if (closingTag) { + if (!result.tagClosed) { + return getErrorObject("InvalidTag", "Closing tag '" + tagName + "' doesn't have proper closing.", getLineNumberForPosition(xmlData, i)); + } else if (attrStr.trim().length > 0) { + return getErrorObject("InvalidTag", "Closing tag '" + tagName + "' can't have attributes or invalid starting.", getLineNumberForPosition(xmlData, tagStartPos)); + } else if (tags.length === 0) { + return getErrorObject("InvalidTag", "Closing tag '" + tagName + "' has not been opened.", getLineNumberForPosition(xmlData, tagStartPos)); + } else { + const otg = tags.pop(); + if (tagName !== otg.tagName) { + let openPos = getLineNumberForPosition(xmlData, otg.tagStartPos); + return getErrorObject( + "InvalidTag", + "Expected closing tag '" + otg.tagName + "' (opened in line " + openPos.line + ", col " + openPos.col + ") instead of closing tag '" + tagName + "'.", + getLineNumberForPosition(xmlData, tagStartPos) + ); + } + if (tags.length == 0) { + reachedRoot = true; + } + } + } else { + const isValid = validateAttributeString(attrStr, options); + if (isValid !== true) { + return getErrorObject(isValid.err.code, isValid.err.msg, getLineNumberForPosition(xmlData, i - attrStr.length + isValid.err.line)); + } + if (reachedRoot === true) { + return getErrorObject("InvalidXml", "Multiple possible root nodes found.", getLineNumberForPosition(xmlData, i)); + } else if (options.unpairedTags.indexOf(tagName) !== -1) { + } else { + tags.push({ tagName, tagStartPos }); + } + tagFound = true; + } + for (i++; i < xmlData.length; i++) { + if (xmlData[i] === "<") { + if (xmlData[i + 1] === "!") { + i++; + i = readCommentAndCDATA(xmlData, i); + continue; + } else if (xmlData[i + 1] === "?") { + i = readPI(xmlData, ++i); + if (i.err) return i; + } else { + break; + } + } else if (xmlData[i] === "&") { + const afterAmp = validateAmpersand(xmlData, i); + if (afterAmp == -1) + return getErrorObject("InvalidChar", "char '&' is not expected.", getLineNumberForPosition(xmlData, i)); + i = afterAmp; + } else { + if (reachedRoot === true && !isWhiteSpace(xmlData[i])) { + return getErrorObject("InvalidXml", "Extra text at the end", getLineNumberForPosition(xmlData, i)); + } + } + } + if (xmlData[i] === "<") { + i--; + } + } + } else { + if (isWhiteSpace(xmlData[i])) { + continue; + } + return getErrorObject("InvalidChar", "char '" + xmlData[i] + "' is not expected.", getLineNumberForPosition(xmlData, i)); } - const method = typeof Iterable === "function" ? Iterable() : V?.[Symbol.iterator]?.(); - const seq = []; - let index = 0; - if (method === void 0 || typeof method.next !== "function") { - throw webidl.errors.exception({ - header: prefix, - message: `${argument} is not iterable.` - }); + } + if (!tagFound) { + return getErrorObject("InvalidXml", "Start tag expected.", 1); + } else if (tags.length == 1) { + return getErrorObject("InvalidTag", "Unclosed tag '" + tags[0].tagName + "'.", getLineNumberForPosition(xmlData, tags[0].tagStartPos)); + } else if (tags.length > 0) { + return getErrorObject("InvalidXml", "Invalid '" + JSON.stringify(tags.map((t) => t.tagName), null, 4).replace(/\r?\n/g, "") + "' found.", { line: 1, col: 1 }); + } + return true; + }; + function isWhiteSpace(char) { + return char === " " || char === " " || char === "\n" || char === "\r"; + } + function readPI(xmlData, i) { + const start = i; + for (; i < xmlData.length; i++) { + if (xmlData[i] == "?" || xmlData[i] == " ") { + const tagname = xmlData.substr(start, i - start); + if (i > 5 && tagname === "xml") { + return getErrorObject("InvalidXml", "XML declaration allowed only at the start of the document.", getLineNumberForPosition(xmlData, i)); + } else if (xmlData[i] == "?" && xmlData[i + 1] == ">") { + i++; + break; + } else { + continue; + } } - while (true) { - const { done, value } = method.next(); - if (done) { + } + return i; + } + function readCommentAndCDATA(xmlData, i) { + if (xmlData.length > i + 5 && xmlData[i + 1] === "-" && xmlData[i + 2] === "-") { + for (i += 3; i < xmlData.length; i++) { + if (xmlData[i] === "-" && xmlData[i + 1] === "-" && xmlData[i + 2] === ">") { + i += 2; break; } - seq.push(converter(value, prefix, `${argument}[${index++}]`)); } - return seq; - }; - }; - webidl.recordConverter = function(keyConverter, valueConverter) { - return (O, prefix, argument) => { - if (webidl.util.Type(O) !== "Object") { - throw webidl.errors.exception({ - header: prefix, - message: `${argument} ("${webidl.util.Type(O)}") is not an Object.` - }); + } else if (xmlData.length > i + 8 && xmlData[i + 1] === "D" && xmlData[i + 2] === "O" && xmlData[i + 3] === "C" && xmlData[i + 4] === "T" && xmlData[i + 5] === "Y" && xmlData[i + 6] === "P" && xmlData[i + 7] === "E") { + let angleBracketsCount = 1; + for (i += 8; i < xmlData.length; i++) { + if (xmlData[i] === "<") { + angleBracketsCount++; + } else if (xmlData[i] === ">") { + angleBracketsCount--; + if (angleBracketsCount === 0) { + break; + } + } } - const result = {}; - if (!types.isProxy(O)) { - const keys2 = [...Object.getOwnPropertyNames(O), ...Object.getOwnPropertySymbols(O)]; - for (const key of keys2) { - const typedKey = keyConverter(key, prefix, argument); - const typedValue = valueConverter(O[key], prefix, argument); - result[typedKey] = typedValue; + } else if (xmlData.length > i + 9 && xmlData[i + 1] === "[" && xmlData[i + 2] === "C" && xmlData[i + 3] === "D" && xmlData[i + 4] === "A" && xmlData[i + 5] === "T" && xmlData[i + 6] === "A" && xmlData[i + 7] === "[") { + for (i += 8; i < xmlData.length; i++) { + if (xmlData[i] === "]" && xmlData[i + 1] === "]" && xmlData[i + 2] === ">") { + i += 2; + break; } - return result; } - const keys = Reflect.ownKeys(O); - for (const key of keys) { - const desc = Reflect.getOwnPropertyDescriptor(O, key); - if (desc?.enumerable) { - const typedKey = keyConverter(key, prefix, argument); - const typedValue = valueConverter(O[key], prefix, argument); - result[typedKey] = typedValue; + } + return i; + } + var doubleQuote = '"'; + var singleQuote = "'"; + function readAttributeStr(xmlData, i) { + let attrStr = ""; + let startChar = ""; + let tagClosed = false; + for (; i < xmlData.length; i++) { + if (xmlData[i] === doubleQuote || xmlData[i] === singleQuote) { + if (startChar === "") { + startChar = xmlData[i]; + } else if (startChar !== xmlData[i]) { + } else { + startChar = ""; + } + } else if (xmlData[i] === ">") { + if (startChar === "") { + tagClosed = true; + break; } } - return result; + attrStr += xmlData[i]; + } + if (startChar !== "") { + return false; + } + return { + value: attrStr, + index: i, + tagClosed }; - }; - webidl.interfaceConverter = function(i) { - return (V, prefix, argument, opts) => { - if (opts?.strict !== false && !(V instanceof i)) { - throw webidl.errors.exception({ - header: prefix, - message: `Expected ${argument} ("${webidl.util.Stringify(V)}") to be an instance of ${i.name}.` - }); + } + var validAttrStrRegxp = new RegExp(`(\\s*)([^\\s=]+)(\\s*=)?(\\s*(['"])(([\\s\\S])*?)\\5)?`, "g"); + function validateAttributeString(attrStr, options) { + const matches = util.getAllMatches(attrStr, validAttrStrRegxp); + const attrNames = {}; + for (let i = 0; i < matches.length; i++) { + if (matches[i][1].length === 0) { + return getErrorObject("InvalidAttr", "Attribute '" + matches[i][2] + "' has no space in starting.", getPositionFromMatch(matches[i])); + } else if (matches[i][3] !== void 0 && matches[i][4] === void 0) { + return getErrorObject("InvalidAttr", "Attribute '" + matches[i][2] + "' is without value.", getPositionFromMatch(matches[i])); + } else if (matches[i][3] === void 0 && !options.allowBooleanAttributes) { + return getErrorObject("InvalidAttr", "boolean attribute '" + matches[i][2] + "' is not allowed.", getPositionFromMatch(matches[i])); + } + const attrName = matches[i][2]; + if (!validateAttrName(attrName)) { + return getErrorObject("InvalidAttr", "Attribute '" + attrName + "' is an invalid name.", getPositionFromMatch(matches[i])); + } + if (!attrNames.hasOwnProperty(attrName)) { + attrNames[attrName] = 1; + } else { + return getErrorObject("InvalidAttr", "Attribute '" + attrName + "' is repeated.", getPositionFromMatch(matches[i])); + } + } + return true; + } + function validateNumberAmpersand(xmlData, i) { + let re = /\d/; + if (xmlData[i] === "x") { + i++; + re = /[\da-fA-F]/; + } + for (; i < xmlData.length; i++) { + if (xmlData[i] === ";") + return i; + if (!xmlData[i].match(re)) + break; + } + return -1; + } + function validateAmpersand(xmlData, i) { + i++; + if (xmlData[i] === ";") + return -1; + if (xmlData[i] === "#") { + i++; + return validateNumberAmpersand(xmlData, i); + } + let count = 0; + for (; i < xmlData.length; i++, count++) { + if (xmlData[i].match(/\w/) && count < 20) + continue; + if (xmlData[i] === ";") + break; + return -1; + } + return i; + } + function getErrorObject(code, message, lineNumber) { + return { + err: { + code, + msg: message, + line: lineNumber.line || lineNumber, + col: lineNumber.col } - return V; }; - }; - webidl.dictionaryConverter = function(converters) { - return (dictionary, prefix, argument) => { - const type = webidl.util.Type(dictionary); - const dict = {}; - if (type === "Null" || type === "Undefined") { - return dict; - } else if (type !== "Object") { - throw webidl.errors.exception({ - header: prefix, - message: `Expected ${dictionary} to be one of: Null, Undefined, Object.` - }); + } + function validateAttrName(attrName) { + return util.isName(attrName); + } + function validateTagName(tagname) { + return util.isName(tagname); + } + function getLineNumberForPosition(xmlData, index) { + const lines = xmlData.substring(0, index).split(/\r?\n/); + return { + line: lines.length, + // column number is last line's length + 1, because column numbering starts at 1: + col: lines[lines.length - 1].length + 1 + }; + } + function getPositionFromMatch(match) { + return match.startIndex + match[1].length; + } + } +}); + +// node_modules/fast-xml-parser/src/xmlparser/OptionsBuilder.js +var require_OptionsBuilder = __commonJS({ + "node_modules/fast-xml-parser/src/xmlparser/OptionsBuilder.js"(exports2) { + var defaultOptions = { + preserveOrder: false, + attributeNamePrefix: "@_", + attributesGroupName: false, + textNodeName: "#text", + ignoreAttributes: true, + removeNSPrefix: false, + // remove NS from tag name or attribute name if true + allowBooleanAttributes: false, + //a tag can have attributes without any value + //ignoreRootElement : false, + parseTagValue: true, + parseAttributeValue: false, + trimValues: true, + //Trim string values of tag and attributes + cdataPropName: false, + numberParseOptions: { + hex: true, + leadingZeros: true, + eNotation: true + }, + tagValueProcessor: function(tagName, val2) { + return val2; + }, + attributeValueProcessor: function(attrName, val2) { + return val2; + }, + stopNodes: [], + //nested tags will not be parsed even for errors + alwaysCreateTextNode: false, + isArray: () => false, + commentPropName: false, + unpairedTags: [], + processEntities: true, + htmlEntities: false, + ignoreDeclaration: false, + ignorePiTags: false, + transformTagName: false, + transformAttributeName: false, + updateTag: function(tagName, jPath, attrs) { + return tagName; + } + // skipEmptyListItem: false + }; + var buildOptions = function(options) { + return Object.assign({}, defaultOptions, options); + }; + exports2.buildOptions = buildOptions; + exports2.defaultOptions = defaultOptions; + } +}); + +// node_modules/fast-xml-parser/src/xmlparser/xmlNode.js +var require_xmlNode = __commonJS({ + "node_modules/fast-xml-parser/src/xmlparser/xmlNode.js"(exports2, module2) { + "use strict"; + var XmlNode = class { + constructor(tagname) { + this.tagname = tagname; + this.child = []; + this[":@"] = {}; + } + add(key, val2) { + if (key === "__proto__") key = "#__proto__"; + this.child.push({ [key]: val2 }); + } + addChild(node) { + if (node.tagname === "__proto__") node.tagname = "#__proto__"; + if (node[":@"] && Object.keys(node[":@"]).length > 0) { + this.child.push({ [node.tagname]: node.child, [":@"]: node[":@"] }); + } else { + this.child.push({ [node.tagname]: node.child }); } - for (const options of converters) { - const { key, defaultValue, required, converter } = options; - if (required === true) { - if (!Object.hasOwn(dictionary, key)) { - throw webidl.errors.exception({ - header: prefix, - message: `Missing required key "${key}".` - }); + } + }; + module2.exports = XmlNode; + } +}); + +// node_modules/fast-xml-parser/src/xmlparser/DocTypeReader.js +var require_DocTypeReader = __commonJS({ + "node_modules/fast-xml-parser/src/xmlparser/DocTypeReader.js"(exports2, module2) { + var util = require_util8(); + function readDocType(xmlData, i) { + const entities = {}; + if (xmlData[i + 3] === "O" && xmlData[i + 4] === "C" && xmlData[i + 5] === "T" && xmlData[i + 6] === "Y" && xmlData[i + 7] === "P" && xmlData[i + 8] === "E") { + i = i + 9; + let angleBracketsCount = 1; + let hasBody = false, comment = false; + let exp = ""; + for (; i < xmlData.length; i++) { + if (xmlData[i] === "<" && !comment) { + if (hasBody && isEntity(xmlData, i)) { + i += 7; + [entityName, val, i] = readEntityExp(xmlData, i + 1); + if (val.indexOf("&") === -1) + entities[validateEntityName(entityName)] = { + regx: RegExp(`&${entityName};`, "g"), + val + }; + } else if (hasBody && isElement(xmlData, i)) i += 8; + else if (hasBody && isAttlist(xmlData, i)) i += 8; + else if (hasBody && isNotation(xmlData, i)) i += 9; + else if (isComment) comment = true; + else throw new Error("Invalid DOCTYPE"); + angleBracketsCount++; + exp = ""; + } else if (xmlData[i] === ">") { + if (comment) { + if (xmlData[i - 1] === "-" && xmlData[i - 2] === "-") { + comment = false; + angleBracketsCount--; + } + } else { + angleBracketsCount--; } - } - let value = dictionary[key]; - const hasDefault = Object.hasOwn(options, "defaultValue"); - if (hasDefault && value !== null) { - value ??= defaultValue(); - } - if (required || hasDefault || value !== void 0) { - value = converter(value, prefix, `${argument}.${key}`); - if (options.allowedValues && !options.allowedValues.includes(value)) { - throw webidl.errors.exception({ - header: prefix, - message: `${value} is not an accepted type. Expected one of ${options.allowedValues.join(", ")}.` - }); + if (angleBracketsCount === 0) { + break; } - dict[key] = value; + } else if (xmlData[i] === "[") { + hasBody = true; + } else { + exp += xmlData[i]; } } - return dict; - }; - }; - webidl.nullableConverter = function(converter) { - return (V, prefix, argument) => { - if (V === null) { - return V; + if (angleBracketsCount !== 0) { + throw new Error(`Unclosed DOCTYPE`); } - return converter(V, prefix, argument); - }; - }; - webidl.converters.DOMString = function(V, prefix, argument, opts) { - if (V === null && opts?.legacyNullToEmptyString) { - return ""; + } else { + throw new Error(`Invalid Tag instead of DOCTYPE`); } - if (typeof V === "symbol") { - throw webidl.errors.exception({ - header: prefix, - message: `${argument} is a symbol, which cannot be converted to a DOMString.` - }); + return { entities, i }; + } + function readEntityExp(xmlData, i) { + let entityName2 = ""; + for (; i < xmlData.length && (xmlData[i] !== "'" && xmlData[i] !== '"'); i++) { + entityName2 += xmlData[i]; } - return String(V); - }; - webidl.converters.ByteString = function(V, prefix, argument) { - const x = webidl.converters.DOMString(V, prefix, argument); - for (let index = 0; index < x.length; index++) { - if (x.charCodeAt(index) > 255) { - throw new TypeError( - `Cannot convert argument to a ByteString because the character at index ${index} has a value of ${x.charCodeAt(index)} which is greater than 255.` - ); + entityName2 = entityName2.trim(); + if (entityName2.indexOf(" ") !== -1) throw new Error("External entites are not supported"); + const startChar = xmlData[i++]; + let val2 = ""; + for (; i < xmlData.length && xmlData[i] !== startChar; i++) { + val2 += xmlData[i]; + } + return [entityName2, val2, i]; + } + function isComment(xmlData, i) { + if (xmlData[i + 1] === "!" && xmlData[i + 2] === "-" && xmlData[i + 3] === "-") return true; + return false; + } + function isEntity(xmlData, i) { + if (xmlData[i + 1] === "!" && xmlData[i + 2] === "E" && xmlData[i + 3] === "N" && xmlData[i + 4] === "T" && xmlData[i + 5] === "I" && xmlData[i + 6] === "T" && xmlData[i + 7] === "Y") return true; + return false; + } + function isElement(xmlData, i) { + if (xmlData[i + 1] === "!" && xmlData[i + 2] === "E" && xmlData[i + 3] === "L" && xmlData[i + 4] === "E" && xmlData[i + 5] === "M" && xmlData[i + 6] === "E" && xmlData[i + 7] === "N" && xmlData[i + 8] === "T") return true; + return false; + } + function isAttlist(xmlData, i) { + if (xmlData[i + 1] === "!" && xmlData[i + 2] === "A" && xmlData[i + 3] === "T" && xmlData[i + 4] === "T" && xmlData[i + 5] === "L" && xmlData[i + 6] === "I" && xmlData[i + 7] === "S" && xmlData[i + 8] === "T") return true; + return false; + } + function isNotation(xmlData, i) { + if (xmlData[i + 1] === "!" && xmlData[i + 2] === "N" && xmlData[i + 3] === "O" && xmlData[i + 4] === "T" && xmlData[i + 5] === "A" && xmlData[i + 6] === "T" && xmlData[i + 7] === "I" && xmlData[i + 8] === "O" && xmlData[i + 9] === "N") return true; + return false; + } + function validateEntityName(name) { + if (util.isName(name)) + return name; + else + throw new Error(`Invalid entity name ${name}`); + } + module2.exports = readDocType; + } +}); + +// node_modules/strnum/strnum.js +var require_strnum = __commonJS({ + "node_modules/strnum/strnum.js"(exports2, module2) { + var hexRegex = /^[-+]?0x[a-fA-F0-9]+$/; + var numRegex = /^([\-\+])?(0*)(\.[0-9]+([eE]\-?[0-9]+)?|[0-9]+(\.[0-9]+([eE]\-?[0-9]+)?)?)$/; + if (!Number.parseInt && window.parseInt) { + Number.parseInt = window.parseInt; + } + if (!Number.parseFloat && window.parseFloat) { + Number.parseFloat = window.parseFloat; + } + var consider = { + hex: true, + leadingZeros: true, + decimalPoint: ".", + eNotation: true + //skipLike: /regex/ + }; + function toNumber(str, options = {}) { + options = Object.assign({}, consider, options); + if (!str || typeof str !== "string") return str; + let trimmedStr = str.trim(); + if (options.skipLike !== void 0 && options.skipLike.test(trimmedStr)) return str; + else if (options.hex && hexRegex.test(trimmedStr)) { + return Number.parseInt(trimmedStr, 16); + } else { + const match = numRegex.exec(trimmedStr); + if (match) { + const sign = match[1]; + const leadingZeros = match[2]; + let numTrimmedByZeros = trimZeros(match[3]); + const eNotation = match[4] || match[6]; + if (!options.leadingZeros && leadingZeros.length > 0 && sign && trimmedStr[2] !== ".") return str; + else if (!options.leadingZeros && leadingZeros.length > 0 && !sign && trimmedStr[1] !== ".") return str; + else { + const num = Number(trimmedStr); + const numStr = "" + num; + if (numStr.search(/[eE]/) !== -1) { + if (options.eNotation) return num; + else return str; + } else if (eNotation) { + if (options.eNotation) return num; + else return str; + } else if (trimmedStr.indexOf(".") !== -1) { + if (numStr === "0" && numTrimmedByZeros === "") return num; + else if (numStr === numTrimmedByZeros) return num; + else if (sign && numStr === "-" + numTrimmedByZeros) return num; + else return str; + } + if (leadingZeros) { + if (numTrimmedByZeros === numStr) return num; + else if (sign + numTrimmedByZeros === numStr) return num; + else return str; + } + if (trimmedStr === numStr) return num; + else if (trimmedStr === sign + numStr) return num; + return str; + } + } else { + return str; } } - return x; - }; - webidl.converters.USVString = toUSVString; - webidl.converters.boolean = function(V) { - const x = Boolean(V); - return x; - }; - webidl.converters.any = function(V) { - return V; - }; - webidl.converters["long long"] = function(V, prefix, argument) { - const x = webidl.util.ConvertToInt(V, 64, "signed", void 0, prefix, argument); - return x; - }; - webidl.converters["unsigned long long"] = function(V, prefix, argument) { - const x = webidl.util.ConvertToInt(V, 64, "unsigned", void 0, prefix, argument); - return x; - }; - webidl.converters["unsigned long"] = function(V, prefix, argument) { - const x = webidl.util.ConvertToInt(V, 32, "unsigned", void 0, prefix, argument); - return x; - }; - webidl.converters["unsigned short"] = function(V, prefix, argument, opts) { - const x = webidl.util.ConvertToInt(V, 16, "unsigned", opts, prefix, argument); - return x; - }; - webidl.converters.ArrayBuffer = function(V, prefix, argument, opts) { - if (webidl.util.Type(V) !== "Object" || !types.isAnyArrayBuffer(V)) { - throw webidl.errors.conversionFailed({ - prefix, - argument: `${argument} ("${webidl.util.Stringify(V)}")`, - types: ["ArrayBuffer"] - }); + } + function trimZeros(numStr) { + if (numStr && numStr.indexOf(".") !== -1) { + numStr = numStr.replace(/0+$/, ""); + if (numStr === ".") numStr = "0"; + else if (numStr[0] === ".") numStr = "0" + numStr; + else if (numStr[numStr.length - 1] === ".") numStr = numStr.substr(0, numStr.length - 1); + return numStr; } - if (opts?.allowShared === false && types.isSharedArrayBuffer(V)) { - throw webidl.errors.exception({ - header: "ArrayBuffer", - message: "SharedArrayBuffer is not allowed." - }); + return numStr; + } + module2.exports = toNumber; + } +}); + +// node_modules/fast-xml-parser/src/xmlparser/OrderedObjParser.js +var require_OrderedObjParser = __commonJS({ + "node_modules/fast-xml-parser/src/xmlparser/OrderedObjParser.js"(exports2, module2) { + "use strict"; + var util = require_util8(); + var xmlNode = require_xmlNode(); + var readDocType = require_DocTypeReader(); + var toNumber = require_strnum(); + var OrderedObjParser = class { + constructor(options) { + this.options = options; + this.currentNode = null; + this.tagsNodeStack = []; + this.docTypeEntities = {}; + this.lastEntities = { + "apos": { regex: /&(apos|#39|#x27);/g, val: "'" }, + "gt": { regex: /&(gt|#62|#x3E);/g, val: ">" }, + "lt": { regex: /&(lt|#60|#x3C);/g, val: "<" }, + "quot": { regex: /&(quot|#34|#x22);/g, val: '"' } + }; + this.ampEntity = { regex: /&(amp|#38|#x26);/g, val: "&" }; + this.htmlEntities = { + "space": { regex: /&(nbsp|#160);/g, val: " " }, + // "lt" : { regex: /&(lt|#60);/g, val: "<" }, + // "gt" : { regex: /&(gt|#62);/g, val: ">" }, + // "amp" : { regex: /&(amp|#38);/g, val: "&" }, + // "quot" : { regex: /&(quot|#34);/g, val: "\"" }, + // "apos" : { regex: /&(apos|#39);/g, val: "'" }, + "cent": { regex: /&(cent|#162);/g, val: "\xA2" }, + "pound": { regex: /&(pound|#163);/g, val: "\xA3" }, + "yen": { regex: /&(yen|#165);/g, val: "\xA5" }, + "euro": { regex: /&(euro|#8364);/g, val: "\u20AC" }, + "copyright": { regex: /&(copy|#169);/g, val: "\xA9" }, + "reg": { regex: /&(reg|#174);/g, val: "\xAE" }, + "inr": { regex: /&(inr|#8377);/g, val: "\u20B9" }, + "num_dec": { regex: /&#([0-9]{1,7});/g, val: (_, str) => String.fromCharCode(Number.parseInt(str, 10)) }, + "num_hex": { regex: /&#x([0-9a-fA-F]{1,6});/g, val: (_, str) => String.fromCharCode(Number.parseInt(str, 16)) } + }; + this.addExternalEntities = addExternalEntities; + this.parseXml = parseXml; + this.parseTextData = parseTextData; + this.resolveNameSpace = resolveNameSpace; + this.buildAttributesMap = buildAttributesMap; + this.isItStopNode = isItStopNode; + this.replaceEntitiesValue = replaceEntitiesValue; + this.readStopNodeData = readStopNodeData; + this.saveTextToParentTag = saveTextToParentTag; + this.addChild = addChild; + } + }; + function addExternalEntities(externalEntities) { + const entKeys = Object.keys(externalEntities); + for (let i = 0; i < entKeys.length; i++) { + const ent = entKeys[i]; + this.lastEntities[ent] = { + regex: new RegExp("&" + ent + ";", "g"), + val: externalEntities[ent] + }; } - if (V.resizable || V.growable) { - throw webidl.errors.exception({ - header: "ArrayBuffer", - message: "Received a resizable ArrayBuffer." - }); + } + function parseTextData(val2, tagName, jPath, dontTrim, hasAttributes, isLeafNode, escapeEntities) { + if (val2 !== void 0) { + if (this.options.trimValues && !dontTrim) { + val2 = val2.trim(); + } + if (val2.length > 0) { + if (!escapeEntities) val2 = this.replaceEntitiesValue(val2); + const newval = this.options.tagValueProcessor(tagName, val2, jPath, hasAttributes, isLeafNode); + if (newval === null || newval === void 0) { + return val2; + } else if (typeof newval !== typeof val2 || newval !== val2) { + return newval; + } else if (this.options.trimValues) { + return parseValue(val2, this.options.parseTagValue, this.options.numberParseOptions); + } else { + const trimmedVal = val2.trim(); + if (trimmedVal === val2) { + return parseValue(val2, this.options.parseTagValue, this.options.numberParseOptions); + } else { + return val2; + } + } + } } - return V; - }; - webidl.converters.TypedArray = function(V, T, prefix, name, opts) { - if (webidl.util.Type(V) !== "Object" || !types.isTypedArray(V) || V.constructor.name !== T.name) { - throw webidl.errors.conversionFailed({ - prefix, - argument: `${name} ("${webidl.util.Stringify(V)}")`, - types: [T.name] - }); - } - if (opts?.allowShared === false && types.isSharedArrayBuffer(V.buffer)) { - throw webidl.errors.exception({ - header: "ArrayBuffer", - message: "SharedArrayBuffer is not allowed." - }); - } - if (V.buffer.resizable || V.buffer.growable) { - throw webidl.errors.exception({ - header: "ArrayBuffer", - message: "Received a resizable ArrayBuffer." - }); + } + function resolveNameSpace(tagname) { + if (this.options.removeNSPrefix) { + const tags = tagname.split(":"); + const prefix = tagname.charAt(0) === "/" ? "/" : ""; + if (tags[0] === "xmlns") { + return ""; + } + if (tags.length === 2) { + tagname = prefix + tags[1]; + } + } + return tagname; + } + var attrsRegx = new RegExp(`([^\\s=]+)\\s*(=\\s*(['"])([\\s\\S]*?)\\3)?`, "gm"); + function buildAttributesMap(attrStr, jPath, tagName) { + if (!this.options.ignoreAttributes && typeof attrStr === "string") { + const matches = util.getAllMatches(attrStr, attrsRegx); + const len = matches.length; + const attrs = {}; + for (let i = 0; i < len; i++) { + const attrName = this.resolveNameSpace(matches[i][1]); + let oldVal = matches[i][4]; + let aName = this.options.attributeNamePrefix + attrName; + if (attrName.length) { + if (this.options.transformAttributeName) { + aName = this.options.transformAttributeName(aName); + } + if (aName === "__proto__") aName = "#__proto__"; + if (oldVal !== void 0) { + if (this.options.trimValues) { + oldVal = oldVal.trim(); + } + oldVal = this.replaceEntitiesValue(oldVal); + const newVal = this.options.attributeValueProcessor(attrName, oldVal, jPath); + if (newVal === null || newVal === void 0) { + attrs[aName] = oldVal; + } else if (typeof newVal !== typeof oldVal || newVal !== oldVal) { + attrs[aName] = newVal; + } else { + attrs[aName] = parseValue( + oldVal, + this.options.parseAttributeValue, + this.options.numberParseOptions + ); + } + } else if (this.options.allowBooleanAttributes) { + attrs[aName] = true; + } + } + } + if (!Object.keys(attrs).length) { + return; + } + if (this.options.attributesGroupName) { + const attrCollection = {}; + attrCollection[this.options.attributesGroupName] = attrs; + return attrCollection; + } + return attrs; + } + } + var parseXml = function(xmlData) { + xmlData = xmlData.replace(/\r\n?/g, "\n"); + const xmlObj = new xmlNode("!xml"); + let currentNode = xmlObj; + let textData = ""; + let jPath = ""; + for (let i = 0; i < xmlData.length; i++) { + const ch = xmlData[i]; + if (ch === "<") { + if (xmlData[i + 1] === "/") { + const closeIndex = findClosingIndex(xmlData, ">", i, "Closing Tag is not closed."); + let tagName = xmlData.substring(i + 2, closeIndex).trim(); + if (this.options.removeNSPrefix) { + const colonIndex = tagName.indexOf(":"); + if (colonIndex !== -1) { + tagName = tagName.substr(colonIndex + 1); + } + } + if (this.options.transformTagName) { + tagName = this.options.transformTagName(tagName); + } + if (currentNode) { + textData = this.saveTextToParentTag(textData, currentNode, jPath); + } + const lastTagName = jPath.substring(jPath.lastIndexOf(".") + 1); + if (tagName && this.options.unpairedTags.indexOf(tagName) !== -1) { + throw new Error(`Unpaired tag can not be used as closing tag: `); + } + let propIndex = 0; + if (lastTagName && this.options.unpairedTags.indexOf(lastTagName) !== -1) { + propIndex = jPath.lastIndexOf(".", jPath.lastIndexOf(".") - 1); + this.tagsNodeStack.pop(); + } else { + propIndex = jPath.lastIndexOf("."); + } + jPath = jPath.substring(0, propIndex); + currentNode = this.tagsNodeStack.pop(); + textData = ""; + i = closeIndex; + } else if (xmlData[i + 1] === "?") { + let tagData = readTagExp(xmlData, i, false, "?>"); + if (!tagData) throw new Error("Pi Tag is not closed."); + textData = this.saveTextToParentTag(textData, currentNode, jPath); + if (this.options.ignoreDeclaration && tagData.tagName === "?xml" || this.options.ignorePiTags) { + } else { + const childNode = new xmlNode(tagData.tagName); + childNode.add(this.options.textNodeName, ""); + if (tagData.tagName !== tagData.tagExp && tagData.attrExpPresent) { + childNode[":@"] = this.buildAttributesMap(tagData.tagExp, jPath, tagData.tagName); + } + this.addChild(currentNode, childNode, jPath); + } + i = tagData.closeIndex + 1; + } else if (xmlData.substr(i + 1, 3) === "!--") { + const endIndex = findClosingIndex(xmlData, "-->", i + 4, "Comment is not closed."); + if (this.options.commentPropName) { + const comment = xmlData.substring(i + 4, endIndex - 2); + textData = this.saveTextToParentTag(textData, currentNode, jPath); + currentNode.add(this.options.commentPropName, [{ [this.options.textNodeName]: comment }]); + } + i = endIndex; + } else if (xmlData.substr(i + 1, 2) === "!D") { + const result = readDocType(xmlData, i); + this.docTypeEntities = result.entities; + i = result.i; + } else if (xmlData.substr(i + 1, 2) === "![") { + const closeIndex = findClosingIndex(xmlData, "]]>", i, "CDATA is not closed.") - 2; + const tagExp = xmlData.substring(i + 9, closeIndex); + textData = this.saveTextToParentTag(textData, currentNode, jPath); + let val2 = this.parseTextData(tagExp, currentNode.tagname, jPath, true, false, true, true); + if (val2 == void 0) val2 = ""; + if (this.options.cdataPropName) { + currentNode.add(this.options.cdataPropName, [{ [this.options.textNodeName]: tagExp }]); + } else { + currentNode.add(this.options.textNodeName, val2); + } + i = closeIndex + 2; + } else { + let result = readTagExp(xmlData, i, this.options.removeNSPrefix); + let tagName = result.tagName; + const rawTagName = result.rawTagName; + let tagExp = result.tagExp; + let attrExpPresent = result.attrExpPresent; + let closeIndex = result.closeIndex; + if (this.options.transformTagName) { + tagName = this.options.transformTagName(tagName); + } + if (currentNode && textData) { + if (currentNode.tagname !== "!xml") { + textData = this.saveTextToParentTag(textData, currentNode, jPath, false); + } + } + const lastTag = currentNode; + if (lastTag && this.options.unpairedTags.indexOf(lastTag.tagname) !== -1) { + currentNode = this.tagsNodeStack.pop(); + jPath = jPath.substring(0, jPath.lastIndexOf(".")); + } + if (tagName !== xmlObj.tagname) { + jPath += jPath ? "." + tagName : tagName; + } + if (this.isItStopNode(this.options.stopNodes, jPath, tagName)) { + let tagContent = ""; + if (tagExp.length > 0 && tagExp.lastIndexOf("/") === tagExp.length - 1) { + if (tagName[tagName.length - 1] === "/") { + tagName = tagName.substr(0, tagName.length - 1); + jPath = jPath.substr(0, jPath.length - 1); + tagExp = tagName; + } else { + tagExp = tagExp.substr(0, tagExp.length - 1); + } + i = result.closeIndex; + } else if (this.options.unpairedTags.indexOf(tagName) !== -1) { + i = result.closeIndex; + } else { + const result2 = this.readStopNodeData(xmlData, rawTagName, closeIndex + 1); + if (!result2) throw new Error(`Unexpected end of ${rawTagName}`); + i = result2.i; + tagContent = result2.tagContent; + } + const childNode = new xmlNode(tagName); + if (tagName !== tagExp && attrExpPresent) { + childNode[":@"] = this.buildAttributesMap(tagExp, jPath, tagName); + } + if (tagContent) { + tagContent = this.parseTextData(tagContent, tagName, jPath, true, attrExpPresent, true, true); + } + jPath = jPath.substr(0, jPath.lastIndexOf(".")); + childNode.add(this.options.textNodeName, tagContent); + this.addChild(currentNode, childNode, jPath); + } else { + if (tagExp.length > 0 && tagExp.lastIndexOf("/") === tagExp.length - 1) { + if (tagName[tagName.length - 1] === "/") { + tagName = tagName.substr(0, tagName.length - 1); + jPath = jPath.substr(0, jPath.length - 1); + tagExp = tagName; + } else { + tagExp = tagExp.substr(0, tagExp.length - 1); + } + if (this.options.transformTagName) { + tagName = this.options.transformTagName(tagName); + } + const childNode = new xmlNode(tagName); + if (tagName !== tagExp && attrExpPresent) { + childNode[":@"] = this.buildAttributesMap(tagExp, jPath, tagName); + } + this.addChild(currentNode, childNode, jPath); + jPath = jPath.substr(0, jPath.lastIndexOf(".")); + } else { + const childNode = new xmlNode(tagName); + this.tagsNodeStack.push(currentNode); + if (tagName !== tagExp && attrExpPresent) { + childNode[":@"] = this.buildAttributesMap(tagExp, jPath, tagName); + } + this.addChild(currentNode, childNode, jPath); + currentNode = childNode; + } + textData = ""; + i = closeIndex; + } + } + } else { + textData += xmlData[i]; + } } - return V; + return xmlObj.child; }; - webidl.converters.DataView = function(V, prefix, name, opts) { - if (webidl.util.Type(V) !== "Object" || !types.isDataView(V)) { - throw webidl.errors.exception({ - header: prefix, - message: `${name} is not a DataView.` - }); - } - if (opts?.allowShared === false && types.isSharedArrayBuffer(V.buffer)) { - throw webidl.errors.exception({ - header: "ArrayBuffer", - message: "SharedArrayBuffer is not allowed." - }); + function addChild(currentNode, childNode, jPath) { + const result = this.options.updateTag(childNode.tagname, jPath, childNode[":@"]); + if (result === false) { + } else if (typeof result === "string") { + childNode.tagname = result; + currentNode.addChild(childNode); + } else { + currentNode.addChild(childNode); } - if (V.buffer.resizable || V.buffer.growable) { - throw webidl.errors.exception({ - header: "ArrayBuffer", - message: "Received a resizable ArrayBuffer." - }); + } + var replaceEntitiesValue = function(val2) { + if (this.options.processEntities) { + for (let entityName2 in this.docTypeEntities) { + const entity = this.docTypeEntities[entityName2]; + val2 = val2.replace(entity.regx, entity.val); + } + for (let entityName2 in this.lastEntities) { + const entity = this.lastEntities[entityName2]; + val2 = val2.replace(entity.regex, entity.val); + } + if (this.options.htmlEntities) { + for (let entityName2 in this.htmlEntities) { + const entity = this.htmlEntities[entityName2]; + val2 = val2.replace(entity.regex, entity.val); + } + } + val2 = val2.replace(this.ampEntity.regex, this.ampEntity.val); } - return V; + return val2; }; - webidl.converters.BufferSource = function(V, prefix, name, opts) { - if (types.isAnyArrayBuffer(V)) { - return webidl.converters.ArrayBuffer(V, prefix, name, { ...opts, allowShared: false }); + function saveTextToParentTag(textData, currentNode, jPath, isLeafNode) { + if (textData) { + if (isLeafNode === void 0) isLeafNode = Object.keys(currentNode.child).length === 0; + textData = this.parseTextData( + textData, + currentNode.tagname, + jPath, + false, + currentNode[":@"] ? Object.keys(currentNode[":@"]).length !== 0 : false, + isLeafNode + ); + if (textData !== void 0 && textData !== "") + currentNode.add(this.options.textNodeName, textData); + textData = ""; } - if (types.isTypedArray(V)) { - return webidl.converters.TypedArray(V, V.constructor, prefix, name, { ...opts, allowShared: false }); + return textData; + } + function isItStopNode(stopNodes, jPath, currentTagName) { + const allNodesExp = "*." + currentTagName; + for (const stopNodePath in stopNodes) { + const stopNodeExp = stopNodes[stopNodePath]; + if (allNodesExp === stopNodeExp || jPath === stopNodeExp) return true; } - if (types.isDataView(V)) { - return webidl.converters.DataView(V, prefix, name, { ...opts, allowShared: false }); + return false; + } + function tagExpWithClosingIndex(xmlData, i, closingChar = ">") { + let attrBoundary; + let tagExp = ""; + for (let index = i; index < xmlData.length; index++) { + let ch = xmlData[index]; + if (attrBoundary) { + if (ch === attrBoundary) attrBoundary = ""; + } else if (ch === '"' || ch === "'") { + attrBoundary = ch; + } else if (ch === closingChar[0]) { + if (closingChar[1]) { + if (xmlData[index + 1] === closingChar[1]) { + return { + data: tagExp, + index + }; + } + } else { + return { + data: tagExp, + index + }; + } + } else if (ch === " ") { + ch = " "; + } + tagExp += ch; } - throw webidl.errors.conversionFailed({ - prefix, - argument: `${name} ("${webidl.util.Stringify(V)}")`, - types: ["BufferSource"] - }); - }; - webidl.converters["sequence"] = webidl.sequenceConverter( - webidl.converters.ByteString - ); - webidl.converters["sequence>"] = webidl.sequenceConverter( - webidl.converters["sequence"] - ); - webidl.converters["record"] = webidl.recordConverter( - webidl.converters.ByteString, - webidl.converters.ByteString - ); - module2.exports = { - webidl - }; - } -}); - -// node_modules/undici/lib/web/fetch/util.js -var require_util9 = __commonJS({ - "node_modules/undici/lib/web/fetch/util.js"(exports2, module2) { - "use strict"; - var { Transform } = require("node:stream"); - var zlib = require("node:zlib"); - var { redirectStatusSet, referrerPolicySet: referrerPolicyTokens, badPortsSet } = require_constants8(); - var { getGlobalOrigin } = require_global3(); - var { collectASequenceOfCodePoints, collectAnHTTPQuotedString, removeChars, parseMIMEType } = require_data_url(); - var { performance: performance2 } = require("node:perf_hooks"); - var { isBlobLike, ReadableStreamFrom, isValidHTTPToken } = require_util8(); - var assert = require("node:assert"); - var { isUint8Array } = require("node:util/types"); - var { webidl } = require_webidl2(); - var supportedHashes = []; - var crypto4; - try { - crypto4 = require("node:crypto"); - const possibleRelevantHashes = ["sha256", "sha384", "sha512"]; - supportedHashes = crypto4.getHashes().filter((hash) => possibleRelevantHashes.includes(hash)); - } catch { } - function responseURL(response) { - const urlList = response.urlList; - const length = urlList.length; - return length === 0 ? null : urlList[length - 1].toString(); + function findClosingIndex(xmlData, str, i, errMsg) { + const closingIndex = xmlData.indexOf(str, i); + if (closingIndex === -1) { + throw new Error(errMsg); + } else { + return closingIndex + str.length - 1; + } } - function responseLocationURL(response, requestFragment) { - if (!redirectStatusSet.has(response.status)) { - return null; + function readTagExp(xmlData, i, removeNSPrefix, closingChar = ">") { + const result = tagExpWithClosingIndex(xmlData, i + 1, closingChar); + if (!result) return; + let tagExp = result.data; + const closeIndex = result.index; + const separatorIndex = tagExp.search(/\s/); + let tagName = tagExp; + let attrExpPresent = true; + if (separatorIndex !== -1) { + tagName = tagExp.substring(0, separatorIndex); + tagExp = tagExp.substring(separatorIndex + 1).trimStart(); } - let location = response.headersList.get("location", true); - if (location !== null && isValidHeaderValue(location)) { - if (!isValidEncodedURL(location)) { - location = normalizeBinaryStringToUtf8(location); + const rawTagName = tagName; + if (removeNSPrefix) { + const colonIndex = tagName.indexOf(":"); + if (colonIndex !== -1) { + tagName = tagName.substr(colonIndex + 1); + attrExpPresent = tagName !== result.data.substr(colonIndex + 1); } - location = new URL(location, responseURL(response)); - } - if (location && !location.hash) { - location.hash = requestFragment; } - return location; + return { + tagName, + tagExp, + closeIndex, + attrExpPresent, + rawTagName + }; } - function isValidEncodedURL(url) { - for (let i = 0; i < url.length; ++i) { - const code = url.charCodeAt(i); - if (code > 126 || // Non-US-ASCII + DEL - code < 32) { - return false; + function readStopNodeData(xmlData, tagName, i) { + const startIndex = i; + let openTagCount = 1; + for (; i < xmlData.length; i++) { + if (xmlData[i] === "<") { + if (xmlData[i + 1] === "/") { + const closeIndex = findClosingIndex(xmlData, ">", i, `${tagName} is not closed`); + let closeTagName = xmlData.substring(i + 2, closeIndex).trim(); + if (closeTagName === tagName) { + openTagCount--; + if (openTagCount === 0) { + return { + tagContent: xmlData.substring(startIndex, i), + i: closeIndex + }; + } + } + i = closeIndex; + } else if (xmlData[i + 1] === "?") { + const closeIndex = findClosingIndex(xmlData, "?>", i + 1, "StopNode is not closed."); + i = closeIndex; + } else if (xmlData.substr(i + 1, 3) === "!--") { + const closeIndex = findClosingIndex(xmlData, "-->", i + 3, "StopNode is not closed."); + i = closeIndex; + } else if (xmlData.substr(i + 1, 2) === "![") { + const closeIndex = findClosingIndex(xmlData, "]]>", i, "StopNode is not closed.") - 2; + i = closeIndex; + } else { + const tagData = readTagExp(xmlData, i, ">"); + if (tagData) { + const openTagName = tagData && tagData.tagName; + if (openTagName === tagName && tagData.tagExp[tagData.tagExp.length - 1] !== "/") { + openTagCount++; + } + i = tagData.closeIndex; + } + } } } - return true; - } - function normalizeBinaryStringToUtf8(value) { - return Buffer.from(value, "binary").toString("utf8"); - } - function requestCurrentURL(request2) { - return request2.urlList[request2.urlList.length - 1]; } - function requestBadPort(request2) { - const url = requestCurrentURL(request2); - if (urlIsHttpHttpsScheme(url) && badPortsSet.has(url.port)) { - return "blocked"; + function parseValue(val2, shouldParse, options) { + if (shouldParse && typeof val2 === "string") { + const newval = val2.trim(); + if (newval === "true") return true; + else if (newval === "false") return false; + else return toNumber(val2, options); + } else { + if (util.isExist(val2)) { + return val2; + } else { + return ""; + } } - return "allowed"; - } - function isErrorLike(object) { - return object instanceof Error || (object?.constructor?.name === "Error" || object?.constructor?.name === "DOMException"); } - function isValidReasonPhrase(statusText) { - for (let i = 0; i < statusText.length; ++i) { - const c = statusText.charCodeAt(i); - if (!(c === 9 || // HTAB - c >= 32 && c <= 126 || // SP / VCHAR - c >= 128 && c <= 255)) { - return false; + module2.exports = OrderedObjParser; + } +}); + +// node_modules/fast-xml-parser/src/xmlparser/node2json.js +var require_node2json = __commonJS({ + "node_modules/fast-xml-parser/src/xmlparser/node2json.js"(exports2) { + "use strict"; + function prettify(node, options) { + return compress(node, options); + } + function compress(arr, options, jPath) { + let text; + const compressedObj = {}; + for (let i = 0; i < arr.length; i++) { + const tagObj = arr[i]; + const property = propName(tagObj); + let newJpath = ""; + if (jPath === void 0) newJpath = property; + else newJpath = jPath + "." + property; + if (property === options.textNodeName) { + if (text === void 0) text = tagObj[property]; + else text += "" + tagObj[property]; + } else if (property === void 0) { + continue; + } else if (tagObj[property]) { + let val2 = compress(tagObj[property], options, newJpath); + const isLeaf = isLeafTag(val2, options); + if (tagObj[":@"]) { + assignAttributes(val2, tagObj[":@"], newJpath, options); + } else if (Object.keys(val2).length === 1 && val2[options.textNodeName] !== void 0 && !options.alwaysCreateTextNode) { + val2 = val2[options.textNodeName]; + } else if (Object.keys(val2).length === 0) { + if (options.alwaysCreateTextNode) val2[options.textNodeName] = ""; + else val2 = ""; + } + if (compressedObj[property] !== void 0 && compressedObj.hasOwnProperty(property)) { + if (!Array.isArray(compressedObj[property])) { + compressedObj[property] = [compressedObj[property]]; + } + compressedObj[property].push(val2); + } else { + if (options.isArray(property, newJpath, isLeaf)) { + compressedObj[property] = [val2]; + } else { + compressedObj[property] = val2; + } + } } } - return true; + if (typeof text === "string") { + if (text.length > 0) compressedObj[options.textNodeName] = text; + } else if (text !== void 0) compressedObj[options.textNodeName] = text; + return compressedObj; } - var isValidHeaderName = isValidHTTPToken; - function isValidHeaderValue(potentialValue) { - return (potentialValue[0] === " " || potentialValue[0] === " " || potentialValue[potentialValue.length - 1] === " " || potentialValue[potentialValue.length - 1] === " " || potentialValue.includes("\n") || potentialValue.includes("\r") || potentialValue.includes("\0")) === false; + function propName(obj) { + const keys = Object.keys(obj); + for (let i = 0; i < keys.length; i++) { + const key = keys[i]; + if (key !== ":@") return key; + } } - function setRequestReferrerPolicyOnRedirect(request2, actualResponse) { - const { headersList } = actualResponse; - const policyHeader = (headersList.get("referrer-policy", true) ?? "").split(","); - let policy = ""; - if (policyHeader.length > 0) { - for (let i = policyHeader.length; i !== 0; i--) { - const token = policyHeader[i - 1].trim(); - if (referrerPolicyTokens.has(token)) { - policy = token; - break; + function assignAttributes(obj, attrMap, jpath, options) { + if (attrMap) { + const keys = Object.keys(attrMap); + const len = keys.length; + for (let i = 0; i < len; i++) { + const atrrName = keys[i]; + if (options.isArray(atrrName, jpath + "." + atrrName, true, true)) { + obj[atrrName] = [attrMap[atrrName]]; + } else { + obj[atrrName] = attrMap[atrrName]; } } } - if (policy !== "") { - request2.referrerPolicy = policy; - } } - function crossOriginResourcePolicyCheck() { - return "allowed"; - } - function corsCheck() { - return "success"; - } - function TAOCheck() { - return "success"; - } - function appendFetchMetadata(httpRequest) { - let header = null; - header = httpRequest.mode; - httpRequest.headersList.set("sec-fetch-mode", header, true); - } - function appendRequestOriginHeader(request2) { - let serializedOrigin = request2.origin; - if (serializedOrigin === "client") { - return; + function isLeafTag(obj, options) { + const { textNodeName } = options; + const propCount = Object.keys(obj).length; + if (propCount === 0) { + return true; } - if (request2.responseTainting === "cors" || request2.mode === "websocket") { - request2.headersList.append("origin", serializedOrigin, true); - } else if (request2.method !== "GET" && request2.method !== "HEAD") { - switch (request2.referrerPolicy) { - case "no-referrer": - serializedOrigin = null; - break; - case "no-referrer-when-downgrade": - case "strict-origin": - case "strict-origin-when-cross-origin": - if (request2.origin && urlHasHttpsScheme(request2.origin) && !urlHasHttpsScheme(requestCurrentURL(request2))) { - serializedOrigin = null; - } - break; - case "same-origin": - if (!sameOrigin(request2, requestCurrentURL(request2))) { - serializedOrigin = null; - } - break; - default: - } - request2.headersList.append("origin", serializedOrigin, true); + if (propCount === 1 && (obj[textNodeName] || typeof obj[textNodeName] === "boolean" || obj[textNodeName] === 0)) { + return true; } + return false; } - function coarsenTime(timestamp, crossOriginIsolatedCapability) { - return timestamp; - } - function clampAndCoarsenConnectionTimingInfo(connectionTimingInfo, defaultStartTime, crossOriginIsolatedCapability) { - if (!connectionTimingInfo?.startTime || connectionTimingInfo.startTime < defaultStartTime) { - return { - domainLookupStartTime: defaultStartTime, - domainLookupEndTime: defaultStartTime, - connectionStartTime: defaultStartTime, - connectionEndTime: defaultStartTime, - secureConnectionStartTime: defaultStartTime, - ALPNNegotiatedProtocol: connectionTimingInfo?.ALPNNegotiatedProtocol - }; + exports2.prettify = prettify; + } +}); + +// node_modules/fast-xml-parser/src/xmlparser/XMLParser.js +var require_XMLParser = __commonJS({ + "node_modules/fast-xml-parser/src/xmlparser/XMLParser.js"(exports2, module2) { + var { buildOptions } = require_OptionsBuilder(); + var OrderedObjParser = require_OrderedObjParser(); + var { prettify } = require_node2json(); + var validator = require_validator(); + var XMLParser2 = class { + constructor(options) { + this.externalEntities = {}; + this.options = buildOptions(options); } - return { - domainLookupStartTime: coarsenTime(connectionTimingInfo.domainLookupStartTime, crossOriginIsolatedCapability), - domainLookupEndTime: coarsenTime(connectionTimingInfo.domainLookupEndTime, crossOriginIsolatedCapability), - connectionStartTime: coarsenTime(connectionTimingInfo.connectionStartTime, crossOriginIsolatedCapability), - connectionEndTime: coarsenTime(connectionTimingInfo.connectionEndTime, crossOriginIsolatedCapability), - secureConnectionStartTime: coarsenTime(connectionTimingInfo.secureConnectionStartTime, crossOriginIsolatedCapability), - ALPNNegotiatedProtocol: connectionTimingInfo.ALPNNegotiatedProtocol - }; - } - function coarsenedSharedCurrentTime(crossOriginIsolatedCapability) { - return coarsenTime(performance2.now(), crossOriginIsolatedCapability); - } - function createOpaqueTimingInfo(timingInfo) { - return { - startTime: timingInfo.startTime ?? 0, - redirectStartTime: 0, - redirectEndTime: 0, - postRedirectStartTime: timingInfo.startTime ?? 0, - finalServiceWorkerStartTime: 0, - finalNetworkResponseStartTime: 0, - finalNetworkRequestStartTime: 0, - endTime: 0, - encodedBodySize: 0, - decodedBodySize: 0, - finalConnectionTimingInfo: null - }; - } - function makePolicyContainer() { - return { - referrerPolicy: "strict-origin-when-cross-origin" - }; - } - function clonePolicyContainer(policyContainer) { - return { - referrerPolicy: policyContainer.referrerPolicy - }; - } - function determineRequestsReferrer(request2) { - const policy = request2.referrerPolicy; - assert(policy); - let referrerSource = null; - if (request2.referrer === "client") { - const globalOrigin = getGlobalOrigin(); - if (!globalOrigin || globalOrigin.origin === "null") { - return "no-referrer"; + /** + * Parse XML dats to JS object + * @param {string|Buffer} xmlData + * @param {boolean|Object} validationOption + */ + parse(xmlData, validationOption) { + if (typeof xmlData === "string") { + } else if (xmlData.toString) { + xmlData = xmlData.toString(); + } else { + throw new Error("XML data is accepted in String or Bytes[] form."); } - referrerSource = new URL(globalOrigin); - } else if (request2.referrer instanceof URL) { - referrerSource = request2.referrer; + if (validationOption) { + if (validationOption === true) validationOption = {}; + const result = validator.validate(xmlData, validationOption); + if (result !== true) { + throw Error(`${result.err.msg}:${result.err.line}:${result.err.col}`); + } + } + const orderedObjParser = new OrderedObjParser(this.options); + orderedObjParser.addExternalEntities(this.externalEntities); + const orderedResult = orderedObjParser.parseXml(xmlData); + if (this.options.preserveOrder || orderedResult === void 0) return orderedResult; + else return prettify(orderedResult, this.options); } - let referrerURL = stripURLForReferrer(referrerSource); - const referrerOrigin = stripURLForReferrer(referrerSource, true); - if (referrerURL.toString().length > 4096) { - referrerURL = referrerOrigin; + /** + * Add Entity which is not by default supported by this library + * @param {string} key + * @param {string} value + */ + addEntity(key, value) { + if (value.indexOf("&") !== -1) { + throw new Error("Entity value can't have '&'"); + } else if (key.indexOf("&") !== -1 || key.indexOf(";") !== -1) { + throw new Error("An entity must be set without '&' and ';'. Eg. use '#xD' for ' '"); + } else if (value === "&") { + throw new Error("An entity with value '&' is not permitted"); + } else { + this.externalEntities[key] = value; + } } - const areSameOrigin = sameOrigin(request2, referrerURL); - const isNonPotentiallyTrustWorthy = isURLPotentiallyTrustworthy(referrerURL) && !isURLPotentiallyTrustworthy(request2.url); - switch (policy) { - case "origin": - return referrerOrigin != null ? referrerOrigin : stripURLForReferrer(referrerSource, true); - case "unsafe-url": - return referrerURL; - case "same-origin": - return areSameOrigin ? referrerOrigin : "no-referrer"; - case "origin-when-cross-origin": - return areSameOrigin ? referrerURL : referrerOrigin; - case "strict-origin-when-cross-origin": { - const currentURL = requestCurrentURL(request2); - if (sameOrigin(referrerURL, currentURL)) { - return referrerURL; + }; + module2.exports = XMLParser2; + } +}); + +// node_modules/fast-xml-parser/src/xmlbuilder/orderedJs2Xml.js +var require_orderedJs2Xml = __commonJS({ + "node_modules/fast-xml-parser/src/xmlbuilder/orderedJs2Xml.js"(exports2, module2) { + var EOL = "\n"; + function toXml(jArray, options) { + let indentation = ""; + if (options.format && options.indentBy.length > 0) { + indentation = EOL; + } + return arrToStr(jArray, options, "", indentation); + } + function arrToStr(arr, options, jPath, indentation) { + let xmlStr = ""; + let isPreviousElementTag = false; + for (let i = 0; i < arr.length; i++) { + const tagObj = arr[i]; + const tagName = propName(tagObj); + if (tagName === void 0) continue; + let newJPath = ""; + if (jPath.length === 0) newJPath = tagName; + else newJPath = `${jPath}.${tagName}`; + if (tagName === options.textNodeName) { + let tagText = tagObj[tagName]; + if (!isStopNode(newJPath, options)) { + tagText = options.tagValueProcessor(tagName, tagText); + tagText = replaceEntitiesValue(tagText, options); + } + if (isPreviousElementTag) { + xmlStr += indentation; + } + xmlStr += tagText; + isPreviousElementTag = false; + continue; + } else if (tagName === options.cdataPropName) { + if (isPreviousElementTag) { + xmlStr += indentation; } - if (isURLPotentiallyTrustworthy(referrerURL) && !isURLPotentiallyTrustworthy(currentURL)) { - return "no-referrer"; + xmlStr += ``; + isPreviousElementTag = false; + continue; + } else if (tagName === options.commentPropName) { + xmlStr += indentation + ``; + isPreviousElementTag = true; + continue; + } else if (tagName[0] === "?") { + const attStr2 = attr_to_str(tagObj[":@"], options); + const tempInd = tagName === "?xml" ? "" : indentation; + let piTextNodeName = tagObj[tagName][0][options.textNodeName]; + piTextNodeName = piTextNodeName.length !== 0 ? " " + piTextNodeName : ""; + xmlStr += tempInd + `<${tagName}${piTextNodeName}${attStr2}?>`; + isPreviousElementTag = true; + continue; + } + let newIdentation = indentation; + if (newIdentation !== "") { + newIdentation += options.indentBy; + } + const attStr = attr_to_str(tagObj[":@"], options); + const tagStart = indentation + `<${tagName}${attStr}`; + const tagValue = arrToStr(tagObj[tagName], options, newJPath, newIdentation); + if (options.unpairedTags.indexOf(tagName) !== -1) { + if (options.suppressUnpairedNode) xmlStr += tagStart + ">"; + else xmlStr += tagStart + "/>"; + } else if ((!tagValue || tagValue.length === 0) && options.suppressEmptyNode) { + xmlStr += tagStart + "/>"; + } else if (tagValue && tagValue.endsWith(">")) { + xmlStr += tagStart + `>${tagValue}${indentation}`; + } else { + xmlStr += tagStart + ">"; + if (tagValue && indentation !== "" && (tagValue.includes("/>") || tagValue.includes("`; } - case "strict-origin": - case "no-referrer-when-downgrade": - default: - return isNonPotentiallyTrustWorthy ? "no-referrer" : referrerOrigin; + isPreviousElementTag = true; } + return xmlStr; } - function stripURLForReferrer(url, originOnly) { - assert(url instanceof URL); - url = new URL(url); - if (url.protocol === "file:" || url.protocol === "about:" || url.protocol === "blank:") { - return "no-referrer"; - } - url.username = ""; - url.password = ""; - url.hash = ""; - if (originOnly) { - url.pathname = ""; - url.search = ""; + function propName(obj) { + const keys = Object.keys(obj); + for (let i = 0; i < keys.length; i++) { + const key = keys[i]; + if (!obj.hasOwnProperty(key)) continue; + if (key !== ":@") return key; + } + } + function attr_to_str(attrMap, options) { + let attrStr = ""; + if (attrMap && !options.ignoreAttributes) { + for (let attr in attrMap) { + if (!attrMap.hasOwnProperty(attr)) continue; + let attrVal = options.attributeValueProcessor(attr, attrMap[attr]); + attrVal = replaceEntitiesValue(attrVal, options); + if (attrVal === true && options.suppressBooleanAttributes) { + attrStr += ` ${attr.substr(options.attributeNamePrefix.length)}`; + } else { + attrStr += ` ${attr.substr(options.attributeNamePrefix.length)}="${attrVal}"`; + } + } } - return url; + return attrStr; } - function isURLPotentiallyTrustworthy(url) { - if (!(url instanceof URL)) { - return false; + function isStopNode(jPath, options) { + jPath = jPath.substr(0, jPath.length - options.textNodeName.length - 1); + let tagName = jPath.substr(jPath.lastIndexOf(".") + 1); + for (let index in options.stopNodes) { + if (options.stopNodes[index] === jPath || options.stopNodes[index] === "*." + tagName) return true; } - if (url.href === "about:blank" || url.href === "about:srcdoc") { - return true; - } - if (url.protocol === "data:") return true; - if (url.protocol === "file:") return true; - return isOriginPotentiallyTrustworthy(url.origin); - function isOriginPotentiallyTrustworthy(origin) { - if (origin == null || origin === "null") return false; - const originAsURL = new URL(origin); - if (originAsURL.protocol === "https:" || originAsURL.protocol === "wss:") { - return true; - } - if (/^127(?:\.[0-9]+){0,2}\.[0-9]+$|^\[(?:0*:)*?:?0*1\]$/.test(originAsURL.hostname) || (originAsURL.hostname === "localhost" || originAsURL.hostname.includes("localhost.")) || originAsURL.hostname.endsWith(".localhost")) { - return true; + return false; + } + function replaceEntitiesValue(textValue, options) { + if (textValue && textValue.length > 0 && options.processEntities) { + for (let i = 0; i < options.entities.length; i++) { + const entity = options.entities[i]; + textValue = textValue.replace(entity.regex, entity.val); } - return false; } + return textValue; } - function bytesMatch(bytes, metadataList) { - if (crypto4 === void 0) { - return true; - } - const parsedMetadata = parseMetadata(metadataList); - if (parsedMetadata === "no metadata") { - return true; + module2.exports = toXml; + } +}); + +// node_modules/fast-xml-parser/src/xmlbuilder/json2xml.js +var require_json2xml = __commonJS({ + "node_modules/fast-xml-parser/src/xmlbuilder/json2xml.js"(exports2, module2) { + "use strict"; + var buildFromOrderedJs = require_orderedJs2Xml(); + var defaultOptions = { + attributeNamePrefix: "@_", + attributesGroupName: false, + textNodeName: "#text", + ignoreAttributes: true, + cdataPropName: false, + format: false, + indentBy: " ", + suppressEmptyNode: false, + suppressUnpairedNode: true, + suppressBooleanAttributes: true, + tagValueProcessor: function(key, a) { + return a; + }, + attributeValueProcessor: function(attrName, a) { + return a; + }, + preserveOrder: false, + commentPropName: false, + unpairedTags: [], + entities: [ + { regex: new RegExp("&", "g"), val: "&" }, + //it must be on top + { regex: new RegExp(">", "g"), val: ">" }, + { regex: new RegExp("<", "g"), val: "<" }, + { regex: new RegExp("'", "g"), val: "'" }, + { regex: new RegExp('"', "g"), val: """ } + ], + processEntities: true, + stopNodes: [], + // transformTagName: false, + // transformAttributeName: false, + oneListGroup: false + }; + function Builder(options) { + this.options = Object.assign({}, defaultOptions, options); + if (this.options.ignoreAttributes || this.options.attributesGroupName) { + this.isAttribute = function() { + return false; + }; + } else { + this.attrPrefixLen = this.options.attributeNamePrefix.length; + this.isAttribute = isAttribute; + } + this.processTextOrObjNode = processTextOrObjNode; + if (this.options.format) { + this.indentate = indentate; + this.tagEndChar = ">\n"; + this.newLine = "\n"; + } else { + this.indentate = function() { + return ""; + }; + this.tagEndChar = ">"; + this.newLine = ""; } - if (parsedMetadata.length === 0) { - return true; + } + Builder.prototype.build = function(jObj) { + if (this.options.preserveOrder) { + return buildFromOrderedJs(jObj, this.options); + } else { + if (Array.isArray(jObj) && this.options.arrayNodeName && this.options.arrayNodeName.length > 1) { + jObj = { + [this.options.arrayNodeName]: jObj + }; + } + return this.j2x(jObj, 0).val; } - const strongest = getStrongestMetadata(parsedMetadata); - const metadata = filterMetadataListByAlgorithm(parsedMetadata, strongest); - for (const item of metadata) { - const algorithm = item.algo; - const expectedValue = item.hash; - let actualValue = crypto4.createHash(algorithm).update(bytes).digest("base64"); - if (actualValue[actualValue.length - 1] === "=") { - if (actualValue[actualValue.length - 2] === "=") { - actualValue = actualValue.slice(0, -2); + }; + Builder.prototype.j2x = function(jObj, level) { + let attrStr = ""; + let val2 = ""; + for (let key in jObj) { + if (!Object.prototype.hasOwnProperty.call(jObj, key)) continue; + if (typeof jObj[key] === "undefined") { + if (this.isAttribute(key)) { + val2 += ""; + } + } else if (jObj[key] === null) { + if (this.isAttribute(key)) { + val2 += ""; + } else if (key[0] === "?") { + val2 += this.indentate(level) + "<" + key + "?" + this.tagEndChar; } else { - actualValue = actualValue.slice(0, -1); + val2 += this.indentate(level) + "<" + key + "/" + this.tagEndChar; + } + } else if (jObj[key] instanceof Date) { + val2 += this.buildTextValNode(jObj[key], key, "", level); + } else if (typeof jObj[key] !== "object") { + const attr = this.isAttribute(key); + if (attr) { + attrStr += this.buildAttrPairStr(attr, "" + jObj[key]); + } else { + if (key === this.options.textNodeName) { + let newval = this.options.tagValueProcessor(key, "" + jObj[key]); + val2 += this.replaceEntitiesValue(newval); + } else { + val2 += this.buildTextValNode(jObj[key], key, "", level); + } + } + } else if (Array.isArray(jObj[key])) { + const arrLen = jObj[key].length; + let listTagVal = ""; + let listTagAttr = ""; + for (let j = 0; j < arrLen; j++) { + const item = jObj[key][j]; + if (typeof item === "undefined") { + } else if (item === null) { + if (key[0] === "?") val2 += this.indentate(level) + "<" + key + "?" + this.tagEndChar; + else val2 += this.indentate(level) + "<" + key + "/" + this.tagEndChar; + } else if (typeof item === "object") { + if (this.options.oneListGroup) { + const result = this.j2x(item, level + 1); + listTagVal += result.val; + if (this.options.attributesGroupName && item.hasOwnProperty(this.options.attributesGroupName)) { + listTagAttr += result.attrStr; + } + } else { + listTagVal += this.processTextOrObjNode(item, key, level); + } + } else { + if (this.options.oneListGroup) { + let textValue = this.options.tagValueProcessor(key, item); + textValue = this.replaceEntitiesValue(textValue); + listTagVal += textValue; + } else { + listTagVal += this.buildTextValNode(item, key, "", level); + } + } + } + if (this.options.oneListGroup) { + listTagVal = this.buildObjectNode(listTagVal, key, listTagAttr, level); + } + val2 += listTagVal; + } else { + if (this.options.attributesGroupName && key === this.options.attributesGroupName) { + const Ks = Object.keys(jObj[key]); + const L = Ks.length; + for (let j = 0; j < L; j++) { + attrStr += this.buildAttrPairStr(Ks[j], "" + jObj[key][Ks[j]]); + } + } else { + val2 += this.processTextOrObjNode(jObj[key], key, level); } - } - if (compareBase64Mixed(actualValue, expectedValue)) { - return true; } } - return false; + return { attrStr, val: val2 }; + }; + Builder.prototype.buildAttrPairStr = function(attrName, val2) { + val2 = this.options.attributeValueProcessor(attrName, "" + val2); + val2 = this.replaceEntitiesValue(val2); + if (this.options.suppressBooleanAttributes && val2 === "true") { + return " " + attrName; + } else return " " + attrName + '="' + val2 + '"'; + }; + function processTextOrObjNode(object, key, level) { + const result = this.j2x(object, level + 1); + if (object[this.options.textNodeName] !== void 0 && Object.keys(object).length === 1) { + return this.buildTextValNode(object[this.options.textNodeName], key, result.attrStr, level); + } else { + return this.buildObjectNode(result.val, key, result.attrStr, level); + } } - var parseHashWithOptions = /(?sha256|sha384|sha512)-((?[A-Za-z0-9+/]+|[A-Za-z0-9_-]+)={0,2}(?:\s|$)( +[!-~]*)?)?/i; - function parseMetadata(metadata) { - const result = []; - let empty = true; - for (const token of metadata.split(" ")) { - empty = false; - const parsedToken = parseHashWithOptions.exec(token); - if (parsedToken === null || parsedToken.groups === void 0 || parsedToken.groups.algo === void 0) { - continue; + Builder.prototype.buildObjectNode = function(val2, key, attrStr, level) { + if (val2 === "") { + if (key[0] === "?") return this.indentate(level) + "<" + key + attrStr + "?" + this.tagEndChar; + else { + return this.indentate(level) + "<" + key + attrStr + this.closeTag(key) + this.tagEndChar; } - const algorithm = parsedToken.groups.algo.toLowerCase(); - if (supportedHashes.includes(algorithm)) { - result.push(parsedToken.groups); + } else { + let tagEndExp = "" + val2 + tagEndExp; + } else if (this.options.commentPropName !== false && key === this.options.commentPropName && piClosingChar.length === 0) { + return this.indentate(level) + `` + this.newLine; + } else { + return this.indentate(level) + "<" + key + attrStr + piClosingChar + this.tagEndChar + val2 + this.indentate(level) + tagEndExp; } } - if (empty === true) { - return "no metadata"; + }; + Builder.prototype.closeTag = function(key) { + let closeTag = ""; + if (this.options.unpairedTags.indexOf(key) !== -1) { + if (!this.options.suppressUnpairedNode) closeTag = "/"; + } else if (this.options.suppressEmptyNode) { + closeTag = "/"; + } else { + closeTag = `>` + this.newLine; + } else if (this.options.commentPropName !== false && key === this.options.commentPropName) { + return this.indentate(level) + `` + this.newLine; + } else if (key[0] === "?") { + return this.indentate(level) + "<" + key + attrStr + "?" + this.tagEndChar; + } else { + let textValue = this.options.tagValueProcessor(key, val2); + textValue = this.replaceEntitiesValue(textValue); + if (textValue === "") { + return this.indentate(level) + "<" + key + attrStr + this.closeTag(key) + this.tagEndChar; + } else { + return this.indentate(level) + "<" + key + attrStr + ">" + textValue + " 0 && this.options.processEntities) { + for (let i = 0; i < this.options.entities.length; i++) { + const entity = this.options.entities[i]; + textValue = textValue.replace(entity.regex, entity.val); } } - return algorithm; + return textValue; + }; + function indentate(level) { + return this.options.indentBy.repeat(level); } - function filterMetadataListByAlgorithm(metadataList, algorithm) { - if (metadataList.length === 1) { - return metadataList; + function isAttribute(name) { + if (name.startsWith(this.options.attributeNamePrefix) && name !== this.options.textNodeName) { + return name.substr(this.attrPrefixLen); + } else { + return false; } - let pos = 0; - for (let i = 0; i < metadataList.length; ++i) { - if (metadataList[i].algo === algorithm) { - metadataList[pos++] = metadataList[i]; + } + module2.exports = Builder; + } +}); + +// node_modules/fast-xml-parser/src/fxp.js +var require_fxp = __commonJS({ + "node_modules/fast-xml-parser/src/fxp.js"(exports2, module2) { + "use strict"; + var validator = require_validator(); + var XMLParser2 = require_XMLParser(); + var XMLBuilder = require_json2xml(); + module2.exports = { + XMLParser: XMLParser2, + XMLValidator: validator, + XMLBuilder + }; + } +}); + +// node_modules/@aws-sdk/core/dist-es/submodules/protocols/xml/parseXmlBody.js +var import_smithy_client4, import_fast_xml_parser, parseXmlBody, parseXmlErrorBody, loadRestXmlErrorCode; +var init_parseXmlBody = __esm({ + "node_modules/@aws-sdk/core/dist-es/submodules/protocols/xml/parseXmlBody.js"() { + import_smithy_client4 = __toESM(require_dist_cjs32()); + import_fast_xml_parser = __toESM(require_fxp()); + init_common(); + parseXmlBody = (streamBody, context) => collectBodyString(streamBody, context).then((encoded) => { + if (encoded.length) { + const parser = new import_fast_xml_parser.XMLParser({ + attributeNamePrefix: "", + htmlEntities: true, + ignoreAttributes: false, + ignoreDeclaration: true, + parseTagValue: false, + trimValues: false, + tagValueProcessor: (_, val2) => val2.trim() === "" && val2.includes("\n") ? "" : void 0 + }); + parser.addEntity("#xD", "\r"); + parser.addEntity("#10", "\n"); + let parsedObj; + try { + parsedObj = parser.parse(encoded, true); + } catch (e) { + if (e && typeof e === "object") { + Object.defineProperty(e, "$responseBodyText", { + value: encoded + }); + } + throw e; + } + const textNodeName = "#text"; + const key = Object.keys(parsedObj)[0]; + const parsedObjToReturn = parsedObj[key]; + if (parsedObjToReturn[textNodeName]) { + parsedObjToReturn[key] = parsedObjToReturn[textNodeName]; + delete parsedObjToReturn[textNodeName]; } + return (0, import_smithy_client4.getValueFromTextNode)(parsedObjToReturn); } - metadataList.length = pos; - return metadataList; - } - function compareBase64Mixed(actualValue, expectedValue) { - if (actualValue.length !== expectedValue.length) { - return false; + return {}; + }); + parseXmlErrorBody = async (errorBody, context) => { + const value = await parseXmlBody(errorBody, context); + if (value.Error) { + value.Error.message = value.Error.message ?? value.Error.Message; } - for (let i = 0; i < actualValue.length; ++i) { - if (actualValue[i] !== expectedValue[i]) { - if (actualValue[i] === "+" && expectedValue[i] === "-" || actualValue[i] === "/" && expectedValue[i] === "_") { - continue; + return value; + }; + loadRestXmlErrorCode = (output, data) => { + if (data?.Error?.Code !== void 0) { + return data.Error.Code; + } + if (data?.Code !== void 0) { + return data.Code; + } + if (output.statusCode == 404) { + return "NotFound"; + } + }; + } +}); + +// node_modules/@aws-sdk/core/dist-es/submodules/protocols/index.js +var init_protocols = __esm({ + "node_modules/@aws-sdk/core/dist-es/submodules/protocols/index.js"() { + init_coercing_serializers(); + init_awsExpectUnion(); + init_parseJsonBody(); + init_parseXmlBody(); + } +}); + +// node_modules/@aws-sdk/core/dist-es/index.js +var dist_es_exports2 = {}; +__export(dist_es_exports2, { + AWSSDKSigV4Signer: () => AWSSDKSigV4Signer, + AwsSdkSigV4ASigner: () => AwsSdkSigV4ASigner, + AwsSdkSigV4Signer: () => AwsSdkSigV4Signer, + NODE_SIGV4A_CONFIG_OPTIONS: () => NODE_SIGV4A_CONFIG_OPTIONS, + _toBool: () => _toBool, + _toNum: () => _toNum, + _toStr: () => _toStr, + awsExpectUnion: () => awsExpectUnion, + emitWarningIfUnsupportedVersion: () => emitWarningIfUnsupportedVersion, + loadRestJsonErrorCode: () => loadRestJsonErrorCode, + loadRestXmlErrorCode: () => loadRestXmlErrorCode, + parseJsonBody: () => parseJsonBody, + parseJsonErrorBody: () => parseJsonErrorBody, + parseXmlBody: () => parseXmlBody, + parseXmlErrorBody: () => parseXmlErrorBody, + resolveAWSSDKSigV4Config: () => resolveAWSSDKSigV4Config, + resolveAwsSdkSigV4AConfig: () => resolveAwsSdkSigV4AConfig, + resolveAwsSdkSigV4Config: () => resolveAwsSdkSigV4Config, + validateSigningProperties: () => validateSigningProperties +}); +var init_dist_es2 = __esm({ + "node_modules/@aws-sdk/core/dist-es/index.js"() { + init_client(); + init_httpAuthSchemes2(); + init_protocols(); + } +}); + +// node_modules/@aws-sdk/client-kms/dist-cjs/auth/httpAuthSchemeProvider.js +var require_httpAuthSchemeProvider = __commonJS({ + "node_modules/@aws-sdk/client-kms/dist-cjs/auth/httpAuthSchemeProvider.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.resolveHttpAuthSchemeConfig = exports2.defaultKMSHttpAuthSchemeProvider = exports2.defaultKMSHttpAuthSchemeParametersProvider = void 0; + var core_1 = (init_dist_es2(), __toCommonJS(dist_es_exports2)); + var util_middleware_1 = require_dist_cjs10(); + var defaultKMSHttpAuthSchemeParametersProvider = async (config, context, input) => { + return { + operation: (0, util_middleware_1.getSmithyContext)(context).operation, + region: await (0, util_middleware_1.normalizeProvider)(config.region)() || (() => { + throw new Error("expected `region` to be configured for `aws.auth#sigv4`"); + })() + }; + }; + exports2.defaultKMSHttpAuthSchemeParametersProvider = defaultKMSHttpAuthSchemeParametersProvider; + function createAwsAuthSigv4HttpAuthOption(authParameters) { + return { + schemeId: "aws.auth#sigv4", + signingProperties: { + name: "kms", + region: authParameters.region + }, + propertiesExtractor: (config, context) => ({ + signingProperties: { + config, + context } - return false; + }) + }; + } + var defaultKMSHttpAuthSchemeProvider = (authParameters) => { + const options = []; + switch (authParameters.operation) { + default: { + options.push(createAwsAuthSigv4HttpAuthOption(authParameters)); } } - return true; - } - function tryUpgradeRequestToAPotentiallyTrustworthyURL(request2) { + return options; + }; + exports2.defaultKMSHttpAuthSchemeProvider = defaultKMSHttpAuthSchemeProvider; + var resolveHttpAuthSchemeConfig = (config) => { + const config_0 = (0, core_1.resolveAwsSdkSigV4Config)(config); + return { + ...config_0 + }; + }; + exports2.resolveHttpAuthSchemeConfig = resolveHttpAuthSchemeConfig; + } +}); + +// node_modules/tslib/tslib.es6.mjs +var tslib_es6_exports = {}; +__export(tslib_es6_exports, { + __addDisposableResource: () => __addDisposableResource, + __assign: () => __assign, + __asyncDelegator: () => __asyncDelegator, + __asyncGenerator: () => __asyncGenerator, + __asyncValues: () => __asyncValues, + __await: () => __await, + __awaiter: () => __awaiter, + __classPrivateFieldGet: () => __classPrivateFieldGet, + __classPrivateFieldIn: () => __classPrivateFieldIn, + __classPrivateFieldSet: () => __classPrivateFieldSet, + __createBinding: () => __createBinding, + __decorate: () => __decorate, + __disposeResources: () => __disposeResources, + __esDecorate: () => __esDecorate, + __exportStar: () => __exportStar, + __extends: () => __extends, + __generator: () => __generator, + __importDefault: () => __importDefault, + __importStar: () => __importStar, + __makeTemplateObject: () => __makeTemplateObject, + __metadata: () => __metadata, + __param: () => __param, + __propKey: () => __propKey, + __read: () => __read, + __rest: () => __rest, + __runInitializers: () => __runInitializers, + __setFunctionName: () => __setFunctionName, + __spread: () => __spread, + __spreadArray: () => __spreadArray, + __spreadArrays: () => __spreadArrays, + __values: () => __values, + default: () => tslib_es6_default +}); +function __extends(d, b) { + if (typeof b !== "function" && b !== null) + throw new TypeError("Class extends value " + String(b) + " is not a constructor or null"); + extendStatics(d, b); + function __() { + this.constructor = d; + } + d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __()); +} +function __rest(s, e) { + var t = {}; + for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p) && e.indexOf(p) < 0) + t[p] = s[p]; + if (s != null && typeof Object.getOwnPropertySymbols === "function") + for (var i = 0, p = Object.getOwnPropertySymbols(s); i < p.length; i++) { + if (e.indexOf(p[i]) < 0 && Object.prototype.propertyIsEnumerable.call(s, p[i])) + t[p[i]] = s[p[i]]; + } + return t; +} +function __decorate(decorators, target, key, desc) { + var c = arguments.length, r = c < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d; + if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r = Reflect.decorate(decorators, target, key, desc); + else for (var i = decorators.length - 1; i >= 0; i--) if (d = decorators[i]) r = (c < 3 ? d(r) : c > 3 ? d(target, key, r) : d(target, key)) || r; + return c > 3 && r && Object.defineProperty(target, key, r), r; +} +function __param(paramIndex, decorator) { + return function(target, key) { + decorator(target, key, paramIndex); + }; +} +function __esDecorate(ctor, descriptorIn, decorators, contextIn, initializers, extraInitializers) { + function accept(f) { + if (f !== void 0 && typeof f !== "function") throw new TypeError("Function expected"); + return f; + } + var kind = contextIn.kind, key = kind === "getter" ? "get" : kind === "setter" ? "set" : "value"; + var target = !descriptorIn && ctor ? contextIn["static"] ? ctor : ctor.prototype : null; + var descriptor = descriptorIn || (target ? Object.getOwnPropertyDescriptor(target, contextIn.name) : {}); + var _, done = false; + for (var i = decorators.length - 1; i >= 0; i--) { + var context = {}; + for (var p in contextIn) context[p] = p === "access" ? {} : contextIn[p]; + for (var p in contextIn.access) context.access[p] = contextIn.access[p]; + context.addInitializer = function(f) { + if (done) throw new TypeError("Cannot add initializers after decoration has completed"); + extraInitializers.push(accept(f || null)); + }; + var result = (0, decorators[i])(kind === "accessor" ? { get: descriptor.get, set: descriptor.set } : descriptor[key], context); + if (kind === "accessor") { + if (result === void 0) continue; + if (result === null || typeof result !== "object") throw new TypeError("Object expected"); + if (_ = accept(result.get)) descriptor.get = _; + if (_ = accept(result.set)) descriptor.set = _; + if (_ = accept(result.init)) initializers.unshift(_); + } else if (_ = accept(result)) { + if (kind === "field") initializers.unshift(_); + else descriptor[key] = _; + } + } + if (target) Object.defineProperty(target, contextIn.name, descriptor); + done = true; +} +function __runInitializers(thisArg, initializers, value) { + var useValue = arguments.length > 2; + for (var i = 0; i < initializers.length; i++) { + value = useValue ? initializers[i].call(thisArg, value) : initializers[i].call(thisArg); + } + return useValue ? value : void 0; +} +function __propKey(x) { + return typeof x === "symbol" ? x : "".concat(x); +} +function __setFunctionName(f, name, prefix) { + if (typeof name === "symbol") name = name.description ? "[".concat(name.description, "]") : ""; + return Object.defineProperty(f, "name", { configurable: true, value: prefix ? "".concat(prefix, " ", name) : name }); +} +function __metadata(metadataKey, metadataValue) { + if (typeof Reflect === "object" && typeof Reflect.metadata === "function") return Reflect.metadata(metadataKey, metadataValue); +} +function __awaiter(thisArg, _arguments, P, generator) { + function adopt(value) { + return value instanceof P ? value : new P(function(resolve) { + resolve(value); + }); + } + return new (P || (P = Promise))(function(resolve, reject) { + function fulfilled(value) { + try { + step(generator.next(value)); + } catch (e) { + reject(e); + } } - function sameOrigin(A, B) { - if (A.origin === B.origin && A.origin === "null") { - return true; + function rejected(value) { + try { + step(generator["throw"](value)); + } catch (e) { + reject(e); } - if (A.protocol === B.protocol && A.hostname === B.hostname && A.port === B.port) { - return true; + } + function step(result) { + result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); + } + step((generator = generator.apply(thisArg, _arguments || [])).next()); + }); +} +function __generator(thisArg, body) { + var _ = { label: 0, sent: function() { + if (t[0] & 1) throw t[1]; + return t[1]; + }, trys: [], ops: [] }, f, y, t, g; + return g = { next: verb(0), "throw": verb(1), "return": verb(2) }, typeof Symbol === "function" && (g[Symbol.iterator] = function() { + return this; + }), g; + function verb(n) { + return function(v) { + return step([n, v]); + }; + } + function step(op) { + if (f) throw new TypeError("Generator is already executing."); + while (g && (g = 0, op[0] && (_ = 0)), _) try { + if (f = 1, y && (t = op[0] & 2 ? y["return"] : op[0] ? y["throw"] || ((t = y["return"]) && t.call(y), 0) : y.next) && !(t = t.call(y, op[1])).done) return t; + if (y = 0, t) op = [op[0] & 2, t.value]; + switch (op[0]) { + case 0: + case 1: + t = op; + break; + case 4: + _.label++; + return { value: op[1], done: false }; + case 5: + _.label++; + y = op[1]; + op = [0]; + continue; + case 7: + op = _.ops.pop(); + _.trys.pop(); + continue; + default: + if (!(t = _.trys, t = t.length > 0 && t[t.length - 1]) && (op[0] === 6 || op[0] === 2)) { + _ = 0; + continue; + } + if (op[0] === 3 && (!t || op[1] > t[0] && op[1] < t[3])) { + _.label = op[1]; + break; + } + if (op[0] === 6 && _.label < t[1]) { + _.label = t[1]; + t = op; + break; + } + if (t && _.label < t[2]) { + _.label = t[2]; + _.ops.push(op); + break; + } + if (t[2]) _.ops.pop(); + _.trys.pop(); + continue; } - return false; + op = body.call(thisArg, _); + } catch (e) { + op = [6, e]; + y = 0; + } finally { + f = t = 0; } - function createDeferredPromise() { - let res; - let rej; - const promise = new Promise((resolve, reject) => { - res = resolve; - rej = reject; - }); - return { promise, resolve: res, reject: rej }; + if (op[0] & 5) throw op[1]; + return { value: op[0] ? op[1] : void 0, done: true }; + } +} +function __exportStar(m, o) { + for (var p in m) if (p !== "default" && !Object.prototype.hasOwnProperty.call(o, p)) __createBinding(o, m, p); +} +function __values(o) { + var s = typeof Symbol === "function" && Symbol.iterator, m = s && o[s], i = 0; + if (m) return m.call(o); + if (o && typeof o.length === "number") return { + next: function() { + if (o && i >= o.length) o = void 0; + return { value: o && o[i++], done: !o }; } - function isAborted(fetchParams) { - return fetchParams.controller.state === "aborted"; + }; + throw new TypeError(s ? "Object is not iterable." : "Symbol.iterator is not defined."); +} +function __read(o, n) { + var m = typeof Symbol === "function" && o[Symbol.iterator]; + if (!m) return o; + var i = m.call(o), r, ar = [], e; + try { + while ((n === void 0 || n-- > 0) && !(r = i.next()).done) ar.push(r.value); + } catch (error) { + e = { error }; + } finally { + try { + if (r && !r.done && (m = i["return"])) m.call(i); + } finally { + if (e) throw e.error; } - function isCancelled(fetchParams) { - return fetchParams.controller.state === "aborted" || fetchParams.controller.state === "terminated"; + } + return ar; +} +function __spread() { + for (var ar = [], i = 0; i < arguments.length; i++) + ar = ar.concat(__read(arguments[i])); + return ar; +} +function __spreadArrays() { + for (var s = 0, i = 0, il = arguments.length; i < il; i++) s += arguments[i].length; + for (var r = Array(s), k = 0, i = 0; i < il; i++) + for (var a = arguments[i], j = 0, jl = a.length; j < jl; j++, k++) + r[k] = a[j]; + return r; +} +function __spreadArray(to, from, pack) { + if (pack || arguments.length === 2) for (var i = 0, l = from.length, ar; i < l; i++) { + if (ar || !(i in from)) { + if (!ar) ar = Array.prototype.slice.call(from, 0, i); + ar[i] = from[i]; } - var normalizeMethodRecordBase = { - delete: "DELETE", - DELETE: "DELETE", - get: "GET", - GET: "GET", - head: "HEAD", - HEAD: "HEAD", - options: "OPTIONS", - OPTIONS: "OPTIONS", - post: "POST", - POST: "POST", - put: "PUT", - PUT: "PUT" - }; - var normalizeMethodRecord = { - ...normalizeMethodRecordBase, - patch: "patch", - PATCH: "PATCH" + } + return to.concat(ar || Array.prototype.slice.call(from)); +} +function __await(v) { + return this instanceof __await ? (this.v = v, this) : new __await(v); +} +function __asyncGenerator(thisArg, _arguments, generator) { + if (!Symbol.asyncIterator) throw new TypeError("Symbol.asyncIterator is not defined."); + var g = generator.apply(thisArg, _arguments || []), i, q = []; + return i = {}, verb("next"), verb("throw"), verb("return", awaitReturn), i[Symbol.asyncIterator] = function() { + return this; + }, i; + function awaitReturn(f) { + return function(v) { + return Promise.resolve(v).then(f, reject); }; - Object.setPrototypeOf(normalizeMethodRecordBase, null); - Object.setPrototypeOf(normalizeMethodRecord, null); - function normalizeMethod(method) { - return normalizeMethodRecordBase[method.toLowerCase()] ?? method; + } + function verb(n, f) { + if (g[n]) { + i[n] = function(v) { + return new Promise(function(a, b) { + q.push([n, v, a, b]) > 1 || resume(n, v); + }); + }; + if (f) i[n] = f(i[n]); } - function serializeJavascriptValueToJSONString(value) { - const result = JSON.stringify(value); - if (result === void 0) { - throw new TypeError("Value is not JSON serializable"); + } + function resume(n, v) { + try { + step(g[n](v)); + } catch (e) { + settle(q[0][3], e); + } + } + function step(r) { + r.value instanceof __await ? Promise.resolve(r.value.v).then(fulfill, reject) : settle(q[0][2], r); + } + function fulfill(value) { + resume("next", value); + } + function reject(value) { + resume("throw", value); + } + function settle(f, v) { + if (f(v), q.shift(), q.length) resume(q[0][0], q[0][1]); + } +} +function __asyncDelegator(o) { + var i, p; + return i = {}, verb("next"), verb("throw", function(e) { + throw e; + }), verb("return"), i[Symbol.iterator] = function() { + return this; + }, i; + function verb(n, f) { + i[n] = o[n] ? function(v) { + return (p = !p) ? { value: __await(o[n](v)), done: false } : f ? f(v) : v; + } : f; + } +} +function __asyncValues(o) { + if (!Symbol.asyncIterator) throw new TypeError("Symbol.asyncIterator is not defined."); + var m = o[Symbol.asyncIterator], i; + return m ? m.call(o) : (o = typeof __values === "function" ? __values(o) : o[Symbol.iterator](), i = {}, verb("next"), verb("throw"), verb("return"), i[Symbol.asyncIterator] = function() { + return this; + }, i); + function verb(n) { + i[n] = o[n] && function(v) { + return new Promise(function(resolve, reject) { + v = o[n](v), settle(resolve, reject, v.done, v.value); + }); + }; + } + function settle(resolve, reject, d, v) { + Promise.resolve(v).then(function(v2) { + resolve({ value: v2, done: d }); + }, reject); + } +} +function __makeTemplateObject(cooked, raw) { + if (Object.defineProperty) { + Object.defineProperty(cooked, "raw", { value: raw }); + } else { + cooked.raw = raw; + } + return cooked; +} +function __importStar(mod) { + if (mod && mod.__esModule) return mod; + var result = {}; + if (mod != null) { + for (var k in mod) if (k !== "default" && Object.prototype.hasOwnProperty.call(mod, k)) __createBinding(result, mod, k); + } + __setModuleDefault(result, mod); + return result; +} +function __importDefault(mod) { + return mod && mod.__esModule ? mod : { default: mod }; +} +function __classPrivateFieldGet(receiver, state, kind, f) { + if (kind === "a" && !f) throw new TypeError("Private accessor was defined without a getter"); + if (typeof state === "function" ? receiver !== state || !f : !state.has(receiver)) throw new TypeError("Cannot read private member from an object whose class did not declare it"); + return kind === "m" ? f : kind === "a" ? f.call(receiver) : f ? f.value : state.get(receiver); +} +function __classPrivateFieldSet(receiver, state, value, kind, f) { + if (kind === "m") throw new TypeError("Private method is not writable"); + if (kind === "a" && !f) throw new TypeError("Private accessor was defined without a setter"); + if (typeof state === "function" ? receiver !== state || !f : !state.has(receiver)) throw new TypeError("Cannot write private member to an object whose class did not declare it"); + return kind === "a" ? f.call(receiver, value) : f ? f.value = value : state.set(receiver, value), value; +} +function __classPrivateFieldIn(state, receiver) { + if (receiver === null || typeof receiver !== "object" && typeof receiver !== "function") throw new TypeError("Cannot use 'in' operator on non-object"); + return typeof state === "function" ? receiver === state : state.has(receiver); +} +function __addDisposableResource(env, value, async) { + if (value !== null && value !== void 0) { + if (typeof value !== "object" && typeof value !== "function") throw new TypeError("Object expected."); + var dispose, inner; + if (async) { + if (!Symbol.asyncDispose) throw new TypeError("Symbol.asyncDispose is not defined."); + dispose = value[Symbol.asyncDispose]; + } + if (dispose === void 0) { + if (!Symbol.dispose) throw new TypeError("Symbol.dispose is not defined."); + dispose = value[Symbol.dispose]; + if (async) inner = dispose; + } + if (typeof dispose !== "function") throw new TypeError("Object not disposable."); + if (inner) dispose = function() { + try { + inner.call(this); + } catch (e) { + return Promise.reject(e); + } + }; + env.stack.push({ value, dispose, async }); + } else if (async) { + env.stack.push({ async: true }); + } + return value; +} +function __disposeResources(env) { + function fail(e) { + env.error = env.hasError ? new _SuppressedError(e, env.error, "An error was suppressed during disposal.") : e; + env.hasError = true; + } + function next() { + while (env.stack.length) { + var rec = env.stack.pop(); + try { + var result = rec.dispose && rec.dispose.call(rec.value); + if (rec.async) return Promise.resolve(result).then(next, function(e) { + fail(e); + return next(); + }); + } catch (e) { + fail(e); } - assert(typeof result === "string"); - return result; } - var esIteratorPrototype = Object.getPrototypeOf(Object.getPrototypeOf([][Symbol.iterator]())); - function createIterator(name, kInternalIterator, keyIndex = 0, valueIndex = 1) { - class FastIterableIterator { - /** @type {any} */ - #target; - /** @type {'key' | 'value' | 'key+value'} */ - #kind; - /** @type {number} */ - #index; - /** - * @see https://webidl.spec.whatwg.org/#dfn-default-iterator-object - * @param {unknown} target - * @param {'key' | 'value' | 'key+value'} kind - */ - constructor(target, kind) { - this.#target = target; - this.#kind = kind; - this.#index = 0; + if (env.hasError) throw env.error; + } + return next(); +} +var extendStatics, __assign, __createBinding, __setModuleDefault, _SuppressedError, tslib_es6_default; +var init_tslib_es6 = __esm({ + "node_modules/tslib/tslib.es6.mjs"() { + extendStatics = function(d, b) { + extendStatics = Object.setPrototypeOf || { __proto__: [] } instanceof Array && function(d2, b2) { + d2.__proto__ = b2; + } || function(d2, b2) { + for (var p in b2) if (Object.prototype.hasOwnProperty.call(b2, p)) d2[p] = b2[p]; + }; + return extendStatics(d, b); + }; + __assign = function() { + __assign = Object.assign || function __assign2(t) { + for (var s, i = 1, n = arguments.length; i < n; i++) { + s = arguments[i]; + for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p)) t[p] = s[p]; } - next() { - if (typeof this !== "object" || this === null || !(#target in this)) { - throw new TypeError( - `'next' called on an object that does not implement interface ${name} Iterator.` + return t; + }; + return __assign.apply(this, arguments); + }; + __createBinding = Object.create ? function(o, m, k, k2) { + if (k2 === void 0) k2 = k; + var desc = Object.getOwnPropertyDescriptor(m, k); + if (!desc || ("get" in desc ? !m.__esModule : desc.writable || desc.configurable)) { + desc = { enumerable: true, get: function() { + return m[k]; + } }; + } + Object.defineProperty(o, k2, desc); + } : function(o, m, k, k2) { + if (k2 === void 0) k2 = k; + o[k2] = m[k]; + }; + __setModuleDefault = Object.create ? function(o, v) { + Object.defineProperty(o, "default", { enumerable: true, value: v }); + } : function(o, v) { + o["default"] = v; + }; + _SuppressedError = typeof SuppressedError === "function" ? SuppressedError : function(error, suppressed, message) { + var e = new Error(message); + return e.name = "SuppressedError", e.error = error, e.suppressed = suppressed, e; + }; + tslib_es6_default = { + __extends, + __assign, + __rest, + __decorate, + __param, + __metadata, + __awaiter, + __generator, + __createBinding, + __exportStar, + __values, + __read, + __spread, + __spreadArrays, + __spreadArray, + __await, + __asyncGenerator, + __asyncDelegator, + __asyncValues, + __makeTemplateObject, + __importStar, + __importDefault, + __classPrivateFieldGet, + __classPrivateFieldSet, + __classPrivateFieldIn, + __addDisposableResource, + __disposeResources + }; + } +}); + +// node_modules/@aws-sdk/client-kms/package.json +var require_package = __commonJS({ + "node_modules/@aws-sdk/client-kms/package.json"(exports2, module2) { + module2.exports = { + name: "@aws-sdk/client-kms", + description: "AWS SDK for JavaScript Kms Client for Node.js, Browser and React Native", + version: "3.635.0", + scripts: { + build: "concurrently 'yarn:build:cjs' 'yarn:build:es' 'yarn:build:types'", + "build:cjs": "node ../../scripts/compilation/inline client-kms", + "build:es": "tsc -p tsconfig.es.json", + "build:include:deps": "lerna run --scope $npm_package_name --include-dependencies build", + "build:types": "tsc -p tsconfig.types.json", + "build:types:downlevel": "downlevel-dts dist-types dist-types/ts3.4", + clean: "rimraf ./dist-* && rimraf *.tsbuildinfo", + "extract:docs": "api-extractor run --local", + "generate:client": "node ../../scripts/generate-clients/single-service --solo kms" + }, + main: "./dist-cjs/index.js", + types: "./dist-types/index.d.ts", + module: "./dist-es/index.js", + sideEffects: false, + dependencies: { + "@aws-crypto/sha256-browser": "5.2.0", + "@aws-crypto/sha256-js": "5.2.0", + "@aws-sdk/client-sso-oidc": "3.635.0", + "@aws-sdk/client-sts": "3.635.0", + "@aws-sdk/core": "3.635.0", + "@aws-sdk/credential-provider-node": "3.635.0", + "@aws-sdk/middleware-host-header": "3.620.0", + "@aws-sdk/middleware-logger": "3.609.0", + "@aws-sdk/middleware-recursion-detection": "3.620.0", + "@aws-sdk/middleware-user-agent": "3.632.0", + "@aws-sdk/region-config-resolver": "3.614.0", + "@aws-sdk/types": "3.609.0", + "@aws-sdk/util-endpoints": "3.632.0", + "@aws-sdk/util-user-agent-browser": "3.609.0", + "@aws-sdk/util-user-agent-node": "3.614.0", + "@smithy/config-resolver": "^3.0.5", + "@smithy/core": "^2.4.0", + "@smithy/fetch-http-handler": "^3.2.4", + "@smithy/hash-node": "^3.0.3", + "@smithy/invalid-dependency": "^3.0.3", + "@smithy/middleware-content-length": "^3.0.5", + "@smithy/middleware-endpoint": "^3.1.0", + "@smithy/middleware-retry": "^3.0.15", + "@smithy/middleware-serde": "^3.0.3", + "@smithy/middleware-stack": "^3.0.3", + "@smithy/node-config-provider": "^3.1.4", + "@smithy/node-http-handler": "^3.1.4", + "@smithy/protocol-http": "^4.1.0", + "@smithy/smithy-client": "^3.2.0", + "@smithy/types": "^3.3.0", + "@smithy/url-parser": "^3.0.3", + "@smithy/util-base64": "^3.0.0", + "@smithy/util-body-length-browser": "^3.0.0", + "@smithy/util-body-length-node": "^3.0.0", + "@smithy/util-defaults-mode-browser": "^3.0.15", + "@smithy/util-defaults-mode-node": "^3.0.15", + "@smithy/util-endpoints": "^2.0.5", + "@smithy/util-middleware": "^3.0.3", + "@smithy/util-retry": "^3.0.3", + "@smithy/util-utf8": "^3.0.0", + tslib: "^2.6.2" + }, + devDependencies: { + "@tsconfig/node16": "16.1.3", + "@types/node": "^16.18.96", + concurrently: "7.0.0", + "downlevel-dts": "0.10.1", + rimraf: "3.0.2", + typescript: "~4.9.5" + }, + engines: { + node: ">=16.0.0" + }, + typesVersions: { + "<4.0": { + "dist-types/*": [ + "dist-types/ts3.4/*" + ] + } + }, + files: [ + "dist-*/**" + ], + author: { + name: "AWS SDK for JavaScript Team", + url: "https://aws.amazon.com/javascript/" + }, + license: "Apache-2.0", + browser: { + "./dist-es/runtimeConfig": "./dist-es/runtimeConfig.browser" + }, + "react-native": { + "./dist-es/runtimeConfig": "./dist-es/runtimeConfig.native" + }, + homepage: "https://github.com/aws/aws-sdk-js-v3/tree/main/clients/client-kms", + repository: { + type: "git", + url: "https://github.com/aws/aws-sdk-js-v3.git", + directory: "clients/client-kms" + } + }; + } +}); + +// node_modules/@aws-sdk/credential-provider-env/dist-cjs/index.js +var require_dist_cjs36 = __commonJS({ + "node_modules/@aws-sdk/credential-provider-env/dist-cjs/index.js"(exports2, module2) { + "use strict"; + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); + }; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + } + return to; + }; + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + ENV_ACCOUNT_ID: () => ENV_ACCOUNT_ID, + ENV_CREDENTIAL_SCOPE: () => ENV_CREDENTIAL_SCOPE, + ENV_EXPIRATION: () => ENV_EXPIRATION, + ENV_KEY: () => ENV_KEY, + ENV_SECRET: () => ENV_SECRET, + ENV_SESSION: () => ENV_SESSION, + fromEnv: () => fromEnv + }); + module2.exports = __toCommonJS2(src_exports); + var import_property_provider2 = require_dist_cjs12(); + var ENV_KEY = "AWS_ACCESS_KEY_ID"; + var ENV_SECRET = "AWS_SECRET_ACCESS_KEY"; + var ENV_SESSION = "AWS_SESSION_TOKEN"; + var ENV_EXPIRATION = "AWS_CREDENTIAL_EXPIRATION"; + var ENV_CREDENTIAL_SCOPE = "AWS_CREDENTIAL_SCOPE"; + var ENV_ACCOUNT_ID = "AWS_ACCOUNT_ID"; + var fromEnv = /* @__PURE__ */ __name((init) => async () => { + var _a; + (_a = init == null ? void 0 : init.logger) == null ? void 0 : _a.debug("@aws-sdk/credential-provider-env - fromEnv"); + const accessKeyId = process.env[ENV_KEY]; + const secretAccessKey = process.env[ENV_SECRET]; + const sessionToken = process.env[ENV_SESSION]; + const expiry = process.env[ENV_EXPIRATION]; + const credentialScope = process.env[ENV_CREDENTIAL_SCOPE]; + const accountId = process.env[ENV_ACCOUNT_ID]; + if (accessKeyId && secretAccessKey) { + return { + accessKeyId, + secretAccessKey, + ...sessionToken && { sessionToken }, + ...expiry && { expiration: new Date(expiry) }, + ...credentialScope && { credentialScope }, + ...accountId && { accountId } + }; + } + throw new import_property_provider2.CredentialsProviderError("Unable to find environment variable credentials.", { logger: init == null ? void 0 : init.logger }); + }, "fromEnv"); + } +}); + +// node_modules/@smithy/credential-provider-imds/dist-cjs/index.js +var require_dist_cjs37 = __commonJS({ + "node_modules/@smithy/credential-provider-imds/dist-cjs/index.js"(exports2, module2) { + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); + }; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + } + return to; + }; + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + DEFAULT_MAX_RETRIES: () => DEFAULT_MAX_RETRIES, + DEFAULT_TIMEOUT: () => DEFAULT_TIMEOUT, + ENV_CMDS_AUTH_TOKEN: () => ENV_CMDS_AUTH_TOKEN, + ENV_CMDS_FULL_URI: () => ENV_CMDS_FULL_URI, + ENV_CMDS_RELATIVE_URI: () => ENV_CMDS_RELATIVE_URI, + Endpoint: () => Endpoint, + fromContainerMetadata: () => fromContainerMetadata, + fromInstanceMetadata: () => fromInstanceMetadata, + getInstanceMetadataEndpoint: () => getInstanceMetadataEndpoint, + httpRequest: () => httpRequest, + providerConfigFromInit: () => providerConfigFromInit + }); + module2.exports = __toCommonJS2(src_exports); + var import_url = require("url"); + var import_property_provider2 = require_dist_cjs12(); + var import_buffer = require("buffer"); + var import_http = require("http"); + function httpRequest(options) { + return new Promise((resolve, reject) => { + var _a; + const req = (0, import_http.request)({ + method: "GET", + ...options, + // Node.js http module doesn't accept hostname with square brackets + // Refs: https://github.com/nodejs/node/issues/39738 + hostname: (_a = options.hostname) == null ? void 0 : _a.replace(/^\[(.+)\]$/, "$1") + }); + req.on("error", (err) => { + reject(Object.assign(new import_property_provider2.ProviderError("Unable to connect to instance metadata service"), err)); + req.destroy(); + }); + req.on("timeout", () => { + reject(new import_property_provider2.ProviderError("TimeoutError from instance metadata service")); + req.destroy(); + }); + req.on("response", (res) => { + const { statusCode = 400 } = res; + if (statusCode < 200 || 300 <= statusCode) { + reject( + Object.assign(new import_property_provider2.ProviderError("Error response received from instance metadata service"), { statusCode }) ); + req.destroy(); } - const index = this.#index; - const values = this.#target[kInternalIterator]; - const len = values.length; - if (index >= len) { - return { - value: void 0, - done: true - }; - } - const { [keyIndex]: key, [valueIndex]: value } = values[index]; - this.#index = index + 1; - let result; - switch (this.#kind) { - case "key": - result = key; - break; - case "value": - result = value; - break; - case "key+value": - result = [key, value]; - break; - } - return { - value: result, - done: false - }; + const chunks = []; + res.on("data", (chunk) => { + chunks.push(chunk); + }); + res.on("end", () => { + resolve(import_buffer.Buffer.concat(chunks)); + req.destroy(); + }); + }); + req.end(); + }); + } + __name(httpRequest, "httpRequest"); + var isImdsCredentials = /* @__PURE__ */ __name((arg) => Boolean(arg) && typeof arg === "object" && typeof arg.AccessKeyId === "string" && typeof arg.SecretAccessKey === "string" && typeof arg.Token === "string" && typeof arg.Expiration === "string", "isImdsCredentials"); + var fromImdsCredentials = /* @__PURE__ */ __name((creds) => ({ + accessKeyId: creds.AccessKeyId, + secretAccessKey: creds.SecretAccessKey, + sessionToken: creds.Token, + expiration: new Date(creds.Expiration), + ...creds.AccountId && { accountId: creds.AccountId } + }), "fromImdsCredentials"); + var DEFAULT_TIMEOUT = 1e3; + var DEFAULT_MAX_RETRIES = 0; + var providerConfigFromInit = /* @__PURE__ */ __name(({ + maxRetries = DEFAULT_MAX_RETRIES, + timeout = DEFAULT_TIMEOUT + }) => ({ maxRetries, timeout }), "providerConfigFromInit"); + var retry2 = /* @__PURE__ */ __name((toRetry, maxRetries) => { + let promise = toRetry(); + for (let i = 0; i < maxRetries; i++) { + promise = promise.catch(toRetry); + } + return promise; + }, "retry"); + var ENV_CMDS_FULL_URI = "AWS_CONTAINER_CREDENTIALS_FULL_URI"; + var ENV_CMDS_RELATIVE_URI = "AWS_CONTAINER_CREDENTIALS_RELATIVE_URI"; + var ENV_CMDS_AUTH_TOKEN = "AWS_CONTAINER_AUTHORIZATION_TOKEN"; + var fromContainerMetadata = /* @__PURE__ */ __name((init = {}) => { + const { timeout, maxRetries } = providerConfigFromInit(init); + return () => retry2(async () => { + const requestOptions = await getCmdsUri({ logger: init.logger }); + const credsResponse = JSON.parse(await requestFromEcsImds(timeout, requestOptions)); + if (!isImdsCredentials(credsResponse)) { + throw new import_property_provider2.CredentialsProviderError("Invalid response received from instance metadata service.", { + logger: init.logger + }); } + return fromImdsCredentials(credsResponse); + }, maxRetries); + }, "fromContainerMetadata"); + var requestFromEcsImds = /* @__PURE__ */ __name(async (timeout, options) => { + if (process.env[ENV_CMDS_AUTH_TOKEN]) { + options.headers = { + ...options.headers, + Authorization: process.env[ENV_CMDS_AUTH_TOKEN] + }; } - delete FastIterableIterator.prototype.constructor; - Object.setPrototypeOf(FastIterableIterator.prototype, esIteratorPrototype); - Object.defineProperties(FastIterableIterator.prototype, { - [Symbol.toStringTag]: { - writable: false, - enumerable: false, - configurable: true, - value: `${name} Iterator` - }, - next: { writable: true, enumerable: true, configurable: true } + const buffer = await httpRequest({ + ...options, + timeout }); - return function(target, kind) { - return new FastIterableIterator(target, kind); + return buffer.toString(); + }, "requestFromEcsImds"); + var CMDS_IP = "169.254.170.2"; + var GREENGRASS_HOSTS = { + localhost: true, + "127.0.0.1": true + }; + var GREENGRASS_PROTOCOLS = { + "http:": true, + "https:": true + }; + var getCmdsUri = /* @__PURE__ */ __name(async ({ logger }) => { + if (process.env[ENV_CMDS_RELATIVE_URI]) { + return { + hostname: CMDS_IP, + path: process.env[ENV_CMDS_RELATIVE_URI] + }; + } + if (process.env[ENV_CMDS_FULL_URI]) { + const parsed = (0, import_url.parse)(process.env[ENV_CMDS_FULL_URI]); + if (!parsed.hostname || !(parsed.hostname in GREENGRASS_HOSTS)) { + throw new import_property_provider2.CredentialsProviderError(`${parsed.hostname} is not a valid container metadata service hostname`, { + tryNextLink: false, + logger + }); + } + if (!parsed.protocol || !(parsed.protocol in GREENGRASS_PROTOCOLS)) { + throw new import_property_provider2.CredentialsProviderError(`${parsed.protocol} is not a valid container metadata service protocol`, { + tryNextLink: false, + logger + }); + } + return { + ...parsed, + port: parsed.port ? parseInt(parsed.port, 10) : void 0 + }; + } + throw new import_property_provider2.CredentialsProviderError( + `The container metadata credential provider cannot be used unless the ${ENV_CMDS_RELATIVE_URI} or ${ENV_CMDS_FULL_URI} environment variable is set`, + { + tryNextLink: false, + logger + } + ); + }, "getCmdsUri"); + var _InstanceMetadataV1FallbackError = class _InstanceMetadataV1FallbackError2 extends import_property_provider2.CredentialsProviderError { + constructor(message, tryNextLink = true) { + super(message, tryNextLink); + this.tryNextLink = tryNextLink; + this.name = "InstanceMetadataV1FallbackError"; + Object.setPrototypeOf(this, _InstanceMetadataV1FallbackError2.prototype); + } + }; + __name(_InstanceMetadataV1FallbackError, "InstanceMetadataV1FallbackError"); + var InstanceMetadataV1FallbackError = _InstanceMetadataV1FallbackError; + var import_node_config_provider = require_dist_cjs14(); + var import_url_parser = require_dist_cjs16(); + var Endpoint = /* @__PURE__ */ ((Endpoint2) => { + Endpoint2["IPv4"] = "http://169.254.169.254"; + Endpoint2["IPv6"] = "http://[fd00:ec2::254]"; + return Endpoint2; + })(Endpoint || {}); + var ENV_ENDPOINT_NAME = "AWS_EC2_METADATA_SERVICE_ENDPOINT"; + var CONFIG_ENDPOINT_NAME = "ec2_metadata_service_endpoint"; + var ENDPOINT_CONFIG_OPTIONS = { + environmentVariableSelector: (env) => env[ENV_ENDPOINT_NAME], + configFileSelector: (profile) => profile[CONFIG_ENDPOINT_NAME], + default: void 0 + }; + var EndpointMode = /* @__PURE__ */ ((EndpointMode2) => { + EndpointMode2["IPv4"] = "IPv4"; + EndpointMode2["IPv6"] = "IPv6"; + return EndpointMode2; + })(EndpointMode || {}); + var ENV_ENDPOINT_MODE_NAME = "AWS_EC2_METADATA_SERVICE_ENDPOINT_MODE"; + var CONFIG_ENDPOINT_MODE_NAME = "ec2_metadata_service_endpoint_mode"; + var ENDPOINT_MODE_CONFIG_OPTIONS = { + environmentVariableSelector: (env) => env[ENV_ENDPOINT_MODE_NAME], + configFileSelector: (profile) => profile[CONFIG_ENDPOINT_MODE_NAME], + default: "IPv4" + /* IPv4 */ + }; + var getInstanceMetadataEndpoint = /* @__PURE__ */ __name(async () => (0, import_url_parser.parseUrl)(await getFromEndpointConfig() || await getFromEndpointModeConfig()), "getInstanceMetadataEndpoint"); + var getFromEndpointConfig = /* @__PURE__ */ __name(async () => (0, import_node_config_provider.loadConfig)(ENDPOINT_CONFIG_OPTIONS)(), "getFromEndpointConfig"); + var getFromEndpointModeConfig = /* @__PURE__ */ __name(async () => { + const endpointMode = await (0, import_node_config_provider.loadConfig)(ENDPOINT_MODE_CONFIG_OPTIONS)(); + switch (endpointMode) { + case "IPv4": + return "http://169.254.169.254"; + case "IPv6": + return "http://[fd00:ec2::254]"; + default: + throw new Error(`Unsupported endpoint mode: ${endpointMode}. Select from ${Object.values(EndpointMode)}`); + } + }, "getFromEndpointModeConfig"); + var STATIC_STABILITY_REFRESH_INTERVAL_SECONDS = 5 * 60; + var STATIC_STABILITY_REFRESH_INTERVAL_JITTER_WINDOW_SECONDS = 5 * 60; + var STATIC_STABILITY_DOC_URL = "https://docs.aws.amazon.com/sdkref/latest/guide/feature-static-credentials.html"; + var getExtendedInstanceMetadataCredentials = /* @__PURE__ */ __name((credentials, logger) => { + const refreshInterval = STATIC_STABILITY_REFRESH_INTERVAL_SECONDS + Math.floor(Math.random() * STATIC_STABILITY_REFRESH_INTERVAL_JITTER_WINDOW_SECONDS); + const newExpiration = new Date(Date.now() + refreshInterval * 1e3); + logger.warn( + `Attempting credential expiration extension due to a credential service availability issue. A refresh of these credentials will be attempted after ${new Date(newExpiration)}. +For more information, please visit: ` + STATIC_STABILITY_DOC_URL + ); + const originalExpiration = credentials.originalExpiration ?? credentials.expiration; + return { + ...credentials, + ...originalExpiration ? { originalExpiration } : {}, + expiration: newExpiration }; - } - function iteratorMixin(name, object, kInternalIterator, keyIndex = 0, valueIndex = 1) { - const makeIterator = createIterator(name, kInternalIterator, keyIndex, valueIndex); - const properties = { - keys: { - writable: true, - enumerable: true, - configurable: true, - value: function keys() { - webidl.brandCheck(this, object); - return makeIterator(this, "key"); + }, "getExtendedInstanceMetadataCredentials"); + var staticStabilityProvider = /* @__PURE__ */ __name((provider, options = {}) => { + const logger = (options == null ? void 0 : options.logger) || console; + let pastCredentials; + return async () => { + let credentials; + try { + credentials = await provider(); + if (credentials.expiration && credentials.expiration.getTime() < Date.now()) { + credentials = getExtendedInstanceMetadataCredentials(credentials, logger); } - }, - values: { - writable: true, - enumerable: true, - configurable: true, - value: function values() { - webidl.brandCheck(this, object); - return makeIterator(this, "value"); + } catch (e) { + if (pastCredentials) { + logger.warn("Credential renew failed: ", e); + credentials = getExtendedInstanceMetadataCredentials(pastCredentials, logger); + } else { + throw e; } - }, - entries: { - writable: true, - enumerable: true, - configurable: true, - value: function entries() { - webidl.brandCheck(this, object); - return makeIterator(this, "key+value"); + } + pastCredentials = credentials; + return credentials; + }; + }, "staticStabilityProvider"); + var IMDS_PATH = "/latest/meta-data/iam/security-credentials/"; + var IMDS_TOKEN_PATH = "/latest/api/token"; + var AWS_EC2_METADATA_V1_DISABLED = "AWS_EC2_METADATA_V1_DISABLED"; + var PROFILE_AWS_EC2_METADATA_V1_DISABLED = "ec2_metadata_v1_disabled"; + var X_AWS_EC2_METADATA_TOKEN = "x-aws-ec2-metadata-token"; + var fromInstanceMetadata = /* @__PURE__ */ __name((init = {}) => staticStabilityProvider(getInstanceMetadataProvider(init), { logger: init.logger }), "fromInstanceMetadata"); + var getInstanceMetadataProvider = /* @__PURE__ */ __name((init = {}) => { + let disableFetchToken = false; + const { logger, profile } = init; + const { timeout, maxRetries } = providerConfigFromInit(init); + const getCredentials = /* @__PURE__ */ __name(async (maxRetries2, options) => { + var _a; + const isImdsV1Fallback = disableFetchToken || ((_a = options.headers) == null ? void 0 : _a[X_AWS_EC2_METADATA_TOKEN]) == null; + if (isImdsV1Fallback) { + let fallbackBlockedFromProfile = false; + let fallbackBlockedFromProcessEnv = false; + const configValue = await (0, import_node_config_provider.loadConfig)( + { + environmentVariableSelector: (env) => { + const envValue = env[AWS_EC2_METADATA_V1_DISABLED]; + fallbackBlockedFromProcessEnv = !!envValue && envValue !== "false"; + if (envValue === void 0) { + throw new import_property_provider2.CredentialsProviderError( + `${AWS_EC2_METADATA_V1_DISABLED} not set in env, checking config file next.`, + { logger: init.logger } + ); + } + return fallbackBlockedFromProcessEnv; + }, + configFileSelector: (profile2) => { + const profileValue = profile2[PROFILE_AWS_EC2_METADATA_V1_DISABLED]; + fallbackBlockedFromProfile = !!profileValue && profileValue !== "false"; + return fallbackBlockedFromProfile; + }, + default: false + }, + { + profile + } + )(); + if (init.ec2MetadataV1Disabled || configValue) { + const causes = []; + if (init.ec2MetadataV1Disabled) + causes.push("credential provider initialization (runtime option ec2MetadataV1Disabled)"); + if (fallbackBlockedFromProfile) + causes.push(`config file profile (${PROFILE_AWS_EC2_METADATA_V1_DISABLED})`); + if (fallbackBlockedFromProcessEnv) + causes.push(`process environment variable (${AWS_EC2_METADATA_V1_DISABLED})`); + throw new InstanceMetadataV1FallbackError( + `AWS EC2 Metadata v1 fallback has been blocked by AWS SDK configuration in the following: [${causes.join( + ", " + )}].` + ); } - }, - forEach: { - writable: true, - enumerable: true, - configurable: true, - value: function forEach(callbackfn, thisArg = globalThis) { - webidl.brandCheck(this, object); - webidl.argumentLengthCheck(arguments, 1, `${name}.forEach`); - if (typeof callbackfn !== "function") { - throw new TypeError( - `Failed to execute 'forEach' on '${name}': parameter 1 is not of type 'Function'.` - ); + } + const imdsProfile = (await retry2(async () => { + let profile2; + try { + profile2 = await getProfile(options); + } catch (err) { + if (err.statusCode === 401) { + disableFetchToken = false; } - for (const { 0: key, 1: value } of makeIterator(this, "key+value")) { - callbackfn.call(thisArg, value, key, this); + throw err; + } + return profile2; + }, maxRetries2)).trim(); + return retry2(async () => { + let creds; + try { + creds = await getCredentialsFromProfile(imdsProfile, options, init); + } catch (err) { + if (err.statusCode === 401) { + disableFetchToken = false; + } + throw err; + } + return creds; + }, maxRetries2); + }, "getCredentials"); + return async () => { + const endpoint2 = await getInstanceMetadataEndpoint(); + if (disableFetchToken) { + logger == null ? void 0 : logger.debug("AWS SDK Instance Metadata", "using v1 fallback (no token fetch)"); + return getCredentials(maxRetries, { ...endpoint2, timeout }); + } else { + let token; + try { + token = (await getMetadataToken({ ...endpoint2, timeout })).toString(); + } catch (error) { + if ((error == null ? void 0 : error.statusCode) === 400) { + throw Object.assign(error, { + message: "EC2 Metadata token request returned error" + }); + } else if (error.message === "TimeoutError" || [403, 404, 405].includes(error.statusCode)) { + disableFetchToken = true; } + logger == null ? void 0 : logger.debug("AWS SDK Instance Metadata", "using v1 fallback (initial)"); + return getCredentials(maxRetries, { ...endpoint2, timeout }); } + return getCredentials(maxRetries, { + ...endpoint2, + headers: { + [X_AWS_EC2_METADATA_TOKEN]: token + }, + timeout + }); } }; - return Object.defineProperties(object.prototype, { - ...properties, - [Symbol.iterator]: { - writable: true, - enumerable: false, - configurable: true, - value: properties.entries.value - } - }); - } - async function fullyReadBody(body, processBody, processBodyError, shouldClone) { - const successSteps = processBody; - const errorSteps = processBodyError; - let reader; - try { - reader = body.stream.getReader(); - } catch (e) { - errorSteps(e); + }, "getInstanceMetadataProvider"); + var getMetadataToken = /* @__PURE__ */ __name(async (options) => httpRequest({ + ...options, + path: IMDS_TOKEN_PATH, + method: "PUT", + headers: { + "x-aws-ec2-metadata-token-ttl-seconds": "21600" + } + }), "getMetadataToken"); + var getProfile = /* @__PURE__ */ __name(async (options) => (await httpRequest({ ...options, path: IMDS_PATH })).toString(), "getProfile"); + var getCredentialsFromProfile = /* @__PURE__ */ __name(async (profile, options, init) => { + const credentialsResponse = JSON.parse( + (await httpRequest({ + ...options, + path: IMDS_PATH + profile + })).toString() + ); + if (!isImdsCredentials(credentialsResponse)) { + throw new import_property_provider2.CredentialsProviderError("Invalid response received from instance metadata service.", { + logger: init.logger + }); + } + return fromImdsCredentials(credentialsResponse); + }, "getCredentialsFromProfile"); + } +}); + +// node_modules/@aws-sdk/credential-provider-http/dist-cjs/fromHttp/checkUrl.js +var require_checkUrl = __commonJS({ + "node_modules/@aws-sdk/credential-provider-http/dist-cjs/fromHttp/checkUrl.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.checkUrl = void 0; + var property_provider_1 = require_dist_cjs12(); + var ECS_CONTAINER_HOST = "169.254.170.2"; + var EKS_CONTAINER_HOST_IPv4 = "169.254.170.23"; + var EKS_CONTAINER_HOST_IPv6 = "[fd00:ec2::23]"; + var checkUrl = (url, logger) => { + if (url.protocol === "https:") { return; } - try { - successSteps(await readAllBytes(reader, shouldClone)); - } catch (e) { - errorSteps(e); + if (url.hostname === ECS_CONTAINER_HOST || url.hostname === EKS_CONTAINER_HOST_IPv4 || url.hostname === EKS_CONTAINER_HOST_IPv6) { + return; } - } - function isReadableStreamLike(stream) { - return stream instanceof ReadableStream || stream[Symbol.toStringTag] === "ReadableStream" && typeof stream.tee === "function"; - } - function readableStreamClose(controller) { - try { - controller.close(); - controller.byobRequest?.respond(0); - } catch (err) { - if (!err.message.includes("Controller is already closed") && !err.message.includes("ReadableStream is already closed")) { - throw err; + if (url.hostname.includes("[")) { + if (url.hostname === "[::1]" || url.hostname === "[0000:0000:0000:0000:0000:0000:0000:0001]") { + return; + } + } else { + if (url.hostname === "localhost") { + return; + } + const ipComponents = url.hostname.split("."); + const inRange = (component) => { + const num = parseInt(component, 10); + return 0 <= num && num <= 255; + }; + if (ipComponents[0] === "127" && inRange(ipComponents[1]) && inRange(ipComponents[2]) && inRange(ipComponents[3]) && ipComponents.length === 4) { + return; } } + throw new property_provider_1.CredentialsProviderError(`URL not accepted. It must either be HTTPS or match one of the following: + - loopback CIDR 127.0.0.0/8 or [::1/128] + - ECS container host 169.254.170.2 + - EKS container host 169.254.170.23 or [fd00:ec2::23]`, { logger }); + }; + exports2.checkUrl = checkUrl; + } +}); + +// node_modules/@aws-sdk/credential-provider-http/dist-cjs/fromHttp/requestHelpers.js +var require_requestHelpers = __commonJS({ + "node_modules/@aws-sdk/credential-provider-http/dist-cjs/fromHttp/requestHelpers.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.getCredentials = exports2.createGetRequest = void 0; + var property_provider_1 = require_dist_cjs12(); + var protocol_http_1 = require_dist_cjs2(); + var smithy_client_1 = require_dist_cjs32(); + var util_stream_1 = require_dist_cjs31(); + function createGetRequest(url) { + return new protocol_http_1.HttpRequest({ + protocol: url.protocol, + hostname: url.hostname, + port: Number(url.port), + path: url.pathname, + query: Array.from(url.searchParams.entries()).reduce((acc, [k, v]) => { + acc[k] = v; + return acc; + }, {}), + fragment: url.hash + }); } - var invalidIsomorphicEncodeValueRegex = /[^\x00-\xFF]/; - function isomorphicEncode(input) { - assert(!invalidIsomorphicEncodeValueRegex.test(input)); - return input; - } - async function readAllBytes(reader, shouldClone) { - const bytes = []; - let byteLength = 0; - while (true) { - const { done, value: chunk } = await reader.read(); - if (done) { - if (bytes.length === 1) { - const { buffer, byteOffset, byteLength: byteLength2 } = bytes[0]; - if (shouldClone === false) { - return Buffer.from(buffer, byteOffset, byteLength2); - } - return Buffer.from(buffer.slice(byteOffset, byteOffset + byteLength2), 0, byteLength2); - } - return Buffer.concat(bytes, byteLength); + exports2.createGetRequest = createGetRequest; + async function getCredentials(response, logger) { + const stream = (0, util_stream_1.sdkStreamMixin)(response.body); + const str = await stream.transformToString(); + if (response.statusCode === 200) { + const parsed = JSON.parse(str); + if (typeof parsed.AccessKeyId !== "string" || typeof parsed.SecretAccessKey !== "string" || typeof parsed.Token !== "string" || typeof parsed.Expiration !== "string") { + throw new property_provider_1.CredentialsProviderError("HTTP credential provider response not of the required format, an object matching: { AccessKeyId: string, SecretAccessKey: string, Token: string, Expiration: string(rfc3339) }", { logger }); } - if (!isUint8Array(chunk)) { - throw new TypeError("Received non-Uint8Array chunk"); + return { + accessKeyId: parsed.AccessKeyId, + secretAccessKey: parsed.SecretAccessKey, + sessionToken: parsed.Token, + expiration: (0, smithy_client_1.parseRfc3339DateTime)(parsed.Expiration) + }; + } + if (response.statusCode >= 400 && response.statusCode < 500) { + let parsedBody = {}; + try { + parsedBody = JSON.parse(str); + } catch (e) { } - bytes.push(chunk); - byteLength += chunk.length; + throw Object.assign(new property_provider_1.CredentialsProviderError(`Server responded with status: ${response.statusCode}`, { logger }), { + Code: parsedBody.Code, + Message: parsedBody.Message + }); } + throw new property_provider_1.CredentialsProviderError(`Server responded with status: ${response.statusCode}`, { logger }); } - function urlIsLocal(url) { - assert("protocol" in url); - const protocol = url.protocol; - return protocol === "about:" || protocol === "blob:" || protocol === "data:"; - } - function urlHasHttpsScheme(url) { - return typeof url === "string" && url[5] === ":" && url[0] === "h" && url[1] === "t" && url[2] === "t" && url[3] === "p" && url[4] === "s" || url.protocol === "https:"; - } - function urlIsHttpHttpsScheme(url) { - assert("protocol" in url); - const protocol = url.protocol; - return protocol === "http:" || protocol === "https:"; - } - function simpleRangeHeaderValue(value, allowWhitespace) { - const data = value; - if (!data.startsWith("bytes")) { - return "failure"; - } - const position = { position: 5 }; - if (allowWhitespace) { - collectASequenceOfCodePoints( - (char) => char === " " || char === " ", - data, - position - ); - } - if (data.charCodeAt(position.position) !== 61) { - return "failure"; - } - position.position++; - if (allowWhitespace) { - collectASequenceOfCodePoints( - (char) => char === " " || char === " ", - data, - position - ); - } - const rangeStart = collectASequenceOfCodePoints( - (char) => { - const code = char.charCodeAt(0); - return code >= 48 && code <= 57; - }, - data, - position - ); - const rangeStartValue = rangeStart.length ? Number(rangeStart) : null; - if (allowWhitespace) { - collectASequenceOfCodePoints( - (char) => char === " " || char === " ", - data, - position - ); - } - if (data.charCodeAt(position.position) !== 45) { - return "failure"; - } - position.position++; - if (allowWhitespace) { - collectASequenceOfCodePoints( - (char) => char === " " || char === " ", - data, - position - ); - } - const rangeEnd = collectASequenceOfCodePoints( - (char) => { - const code = char.charCodeAt(0); - return code >= 48 && code <= 57; - }, - data, - position - ); - const rangeEndValue = rangeEnd.length ? Number(rangeEnd) : null; - if (position.position < data.length) { - return "failure"; - } - if (rangeEndValue === null && rangeStartValue === null) { - return "failure"; - } - if (rangeStartValue > rangeEndValue) { - return "failure"; - } - return { rangeStartValue, rangeEndValue }; - } - function buildContentRange(rangeStart, rangeEnd, fullLength) { - let contentRange = "bytes "; - contentRange += isomorphicEncode(`${rangeStart}`); - contentRange += "-"; - contentRange += isomorphicEncode(`${rangeEnd}`); - contentRange += "/"; - contentRange += isomorphicEncode(`${fullLength}`); - return contentRange; - } - var InflateStream = class extends Transform { - _transform(chunk, encoding, callback) { - if (!this._inflateStream) { - if (chunk.length === 0) { - callback(); - return; + exports2.getCredentials = getCredentials; + } +}); + +// node_modules/@aws-sdk/credential-provider-http/dist-cjs/fromHttp/retry-wrapper.js +var require_retry_wrapper = __commonJS({ + "node_modules/@aws-sdk/credential-provider-http/dist-cjs/fromHttp/retry-wrapper.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.retryWrapper = void 0; + var retryWrapper = (toRetry, maxRetries, delayMs) => { + return async () => { + for (let i = 0; i < maxRetries; ++i) { + try { + return await toRetry(); + } catch (e) { + await new Promise((resolve) => setTimeout(resolve, delayMs)); } - this._inflateStream = (chunk[0] & 15) === 8 ? zlib.createInflate() : zlib.createInflateRaw(); - this._inflateStream.on("data", this.push.bind(this)); - this._inflateStream.on("end", () => this.push(null)); - this._inflateStream.on("error", (err) => this.destroy(err)); } - this._inflateStream.write(chunk, encoding, callback); - } - _final(callback) { - if (this._inflateStream) { - this._inflateStream.end(); - this._inflateStream = null; - } - callback(); - } + return await toRetry(); + }; }; - function createInflate() { - return new InflateStream(); - } - function extractMimeType(headers) { - let charset = null; - let essence = null; - let mimeType = null; - const values = getDecodeSplit("content-type", headers); - if (values === null) { - return "failure"; - } - for (const value of values) { - const temporaryMimeType = parseMIMEType(value); - if (temporaryMimeType === "failure" || temporaryMimeType.essence === "*/*") { - continue; + exports2.retryWrapper = retryWrapper; + } +}); + +// node_modules/@aws-sdk/credential-provider-http/dist-cjs/fromHttp/fromHttp.js +var require_fromHttp = __commonJS({ + "node_modules/@aws-sdk/credential-provider-http/dist-cjs/fromHttp/fromHttp.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.fromHttp = void 0; + var tslib_1 = (init_tslib_es6(), __toCommonJS(tslib_es6_exports)); + var node_http_handler_1 = require_dist_cjs28(); + var property_provider_1 = require_dist_cjs12(); + var promises_1 = tslib_1.__importDefault(require("fs/promises")); + var checkUrl_1 = require_checkUrl(); + var requestHelpers_1 = require_requestHelpers(); + var retry_wrapper_1 = require_retry_wrapper(); + var AWS_CONTAINER_CREDENTIALS_RELATIVE_URI = "AWS_CONTAINER_CREDENTIALS_RELATIVE_URI"; + var DEFAULT_LINK_LOCAL_HOST = "http://169.254.170.2"; + var AWS_CONTAINER_CREDENTIALS_FULL_URI = "AWS_CONTAINER_CREDENTIALS_FULL_URI"; + var AWS_CONTAINER_AUTHORIZATION_TOKEN_FILE = "AWS_CONTAINER_AUTHORIZATION_TOKEN_FILE"; + var AWS_CONTAINER_AUTHORIZATION_TOKEN = "AWS_CONTAINER_AUTHORIZATION_TOKEN"; + var fromHttp = (options = {}) => { + options.logger?.debug("@aws-sdk/credential-provider-http - fromHttp"); + let host; + const relative = options.awsContainerCredentialsRelativeUri ?? process.env[AWS_CONTAINER_CREDENTIALS_RELATIVE_URI]; + const full = options.awsContainerCredentialsFullUri ?? process.env[AWS_CONTAINER_CREDENTIALS_FULL_URI]; + const token = options.awsContainerAuthorizationToken ?? process.env[AWS_CONTAINER_AUTHORIZATION_TOKEN]; + const tokenFile = options.awsContainerAuthorizationTokenFile ?? process.env[AWS_CONTAINER_AUTHORIZATION_TOKEN_FILE]; + const warn = options.logger?.constructor?.name === "NoOpLogger" || !options.logger ? console.warn : options.logger.warn; + if (relative && full) { + warn("@aws-sdk/credential-provider-http: you have set both awsContainerCredentialsRelativeUri and awsContainerCredentialsFullUri."); + warn("awsContainerCredentialsFullUri will take precedence."); + } + if (token && tokenFile) { + warn("@aws-sdk/credential-provider-http: you have set both awsContainerAuthorizationToken and awsContainerAuthorizationTokenFile."); + warn("awsContainerAuthorizationToken will take precedence."); + } + if (full) { + host = full; + } else if (relative) { + host = `${DEFAULT_LINK_LOCAL_HOST}${relative}`; + } else { + throw new property_provider_1.CredentialsProviderError(`No HTTP credential provider host provided. +Set AWS_CONTAINER_CREDENTIALS_FULL_URI or AWS_CONTAINER_CREDENTIALS_RELATIVE_URI.`, { logger: options.logger }); + } + const url = new URL(host); + (0, checkUrl_1.checkUrl)(url, options.logger); + const requestHandler = new node_http_handler_1.NodeHttpHandler({ + requestTimeout: options.timeout ?? 1e3, + connectionTimeout: options.timeout ?? 1e3 + }); + return (0, retry_wrapper_1.retryWrapper)(async () => { + const request2 = (0, requestHelpers_1.createGetRequest)(url); + if (token) { + request2.headers.Authorization = token; + } else if (tokenFile) { + request2.headers.Authorization = (await promises_1.default.readFile(tokenFile)).toString(); } - mimeType = temporaryMimeType; - if (mimeType.essence !== essence) { - charset = null; - if (mimeType.parameters.has("charset")) { - charset = mimeType.parameters.get("charset"); - } - essence = mimeType.essence; - } else if (!mimeType.parameters.has("charset") && charset !== null) { - mimeType.parameters.set("charset", charset); + try { + const result = await requestHandler.handle(request2); + return (0, requestHelpers_1.getCredentials)(result.response); + } catch (e) { + throw new property_provider_1.CredentialsProviderError(String(e), { logger: options.logger }); } - } - if (mimeType == null) { - return "failure"; - } - return mimeType; - } - function gettingDecodingSplitting(value) { - const input = value; - const position = { position: 0 }; - const values = []; - let temporaryValue = ""; - while (position.position < input.length) { - temporaryValue += collectASequenceOfCodePoints( - (char) => char !== '"' && char !== ",", - input, - position - ); - if (position.position < input.length) { - if (input.charCodeAt(position.position) === 34) { - temporaryValue += collectAnHTTPQuotedString( - input, - position - ); - if (position.position < input.length) { - continue; - } - } else { - assert(input.charCodeAt(position.position) === 44); - position.position++; + }, options.maxRetries ?? 3, options.timeout ?? 1e3); + }; + exports2.fromHttp = fromHttp; + } +}); + +// node_modules/@aws-sdk/credential-provider-http/dist-cjs/index.js +var require_dist_cjs38 = __commonJS({ + "node_modules/@aws-sdk/credential-provider-http/dist-cjs/index.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.fromHttp = void 0; + var fromHttp_1 = require_fromHttp(); + Object.defineProperty(exports2, "fromHttp", { enumerable: true, get: function() { + return fromHttp_1.fromHttp; + } }); + } +}); + +// node_modules/@aws-sdk/client-sso/dist-cjs/auth/httpAuthSchemeProvider.js +var require_httpAuthSchemeProvider2 = __commonJS({ + "node_modules/@aws-sdk/client-sso/dist-cjs/auth/httpAuthSchemeProvider.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.resolveHttpAuthSchemeConfig = exports2.defaultSSOHttpAuthSchemeProvider = exports2.defaultSSOHttpAuthSchemeParametersProvider = void 0; + var core_1 = (init_dist_es2(), __toCommonJS(dist_es_exports2)); + var util_middleware_1 = require_dist_cjs10(); + var defaultSSOHttpAuthSchemeParametersProvider = async (config, context, input) => { + return { + operation: (0, util_middleware_1.getSmithyContext)(context).operation, + region: await (0, util_middleware_1.normalizeProvider)(config.region)() || (() => { + throw new Error("expected `region` to be configured for `aws.auth#sigv4`"); + })() + }; + }; + exports2.defaultSSOHttpAuthSchemeParametersProvider = defaultSSOHttpAuthSchemeParametersProvider; + function createAwsAuthSigv4HttpAuthOption(authParameters) { + return { + schemeId: "aws.auth#sigv4", + signingProperties: { + name: "awsssoportal", + region: authParameters.region + }, + propertiesExtractor: (config, context) => ({ + signingProperties: { + config, + context } - } - temporaryValue = removeChars(temporaryValue, true, true, (char) => char === 9 || char === 32); - values.push(temporaryValue); - temporaryValue = ""; - } - return values; - } - function getDecodeSplit(name, list) { - const value = list.get(name, true); - if (value === null) { - return null; - } - return gettingDecodingSplitting(value); + }) + }; } - var textDecoder = new TextDecoder(); - function utf8DecodeBytes(buffer) { - if (buffer.length === 0) { - return ""; - } - if (buffer[0] === 239 && buffer[1] === 187 && buffer[2] === 191) { - buffer = buffer.subarray(3); - } - const output = textDecoder.decode(buffer); - return output; + function createSmithyApiNoAuthHttpAuthOption(authParameters) { + return { + schemeId: "smithy.api#noAuth" + }; } - var EnvironmentSettingsObjectBase = class { - get baseUrl() { - return getGlobalOrigin(); - } - get origin() { - return this.baseUrl?.origin; + var defaultSSOHttpAuthSchemeProvider = (authParameters) => { + const options = []; + switch (authParameters.operation) { + case "GetRoleCredentials": { + options.push(createSmithyApiNoAuthHttpAuthOption(authParameters)); + break; + } + case "ListAccountRoles": { + options.push(createSmithyApiNoAuthHttpAuthOption(authParameters)); + break; + } + case "ListAccounts": { + options.push(createSmithyApiNoAuthHttpAuthOption(authParameters)); + break; + } + case "Logout": { + options.push(createSmithyApiNoAuthHttpAuthOption(authParameters)); + break; + } + default: { + options.push(createAwsAuthSigv4HttpAuthOption(authParameters)); + } } - policyContainer = makePolicyContainer(); - }; - var EnvironmentSettingsObject = class { - settingsObject = new EnvironmentSettingsObjectBase(); + return options; }; - var environmentSettingsObject = new EnvironmentSettingsObject(); - module2.exports = { - isAborted, - isCancelled, - isValidEncodedURL, - createDeferredPromise, - ReadableStreamFrom, - tryUpgradeRequestToAPotentiallyTrustworthyURL, - clampAndCoarsenConnectionTimingInfo, - coarsenedSharedCurrentTime, - determineRequestsReferrer, - makePolicyContainer, - clonePolicyContainer, - appendFetchMetadata, - appendRequestOriginHeader, - TAOCheck, - corsCheck, - crossOriginResourcePolicyCheck, - createOpaqueTimingInfo, - setRequestReferrerPolicyOnRedirect, - isValidHTTPToken, - requestBadPort, - requestCurrentURL, - responseURL, - responseLocationURL, - isBlobLike, - isURLPotentiallyTrustworthy, - isValidReasonPhrase, - sameOrigin, - normalizeMethod, - serializeJavascriptValueToJSONString, - iteratorMixin, - createIterator, - isValidHeaderName, - isValidHeaderValue, - isErrorLike, - fullyReadBody, - bytesMatch, - isReadableStreamLike, - readableStreamClose, - isomorphicEncode, - urlIsLocal, - urlHasHttpsScheme, - urlIsHttpHttpsScheme, - readAllBytes, - normalizeMethodRecord, - simpleRangeHeaderValue, - buildContentRange, - parseMetadata, - createInflate, - extractMimeType, - getDecodeSplit, - utf8DecodeBytes, - environmentSettingsObject + exports2.defaultSSOHttpAuthSchemeProvider = defaultSSOHttpAuthSchemeProvider; + var resolveHttpAuthSchemeConfig = (config) => { + const config_0 = (0, core_1.resolveAwsSdkSigV4Config)(config); + return { + ...config_0 + }; }; + exports2.resolveHttpAuthSchemeConfig = resolveHttpAuthSchemeConfig; } }); -// node_modules/undici/lib/web/fetch/symbols.js -var require_symbols7 = __commonJS({ - "node_modules/undici/lib/web/fetch/symbols.js"(exports2, module2) { - "use strict"; +// node_modules/@aws-sdk/client-sso/package.json +var require_package2 = __commonJS({ + "node_modules/@aws-sdk/client-sso/package.json"(exports2, module2) { module2.exports = { - kUrl: Symbol("url"), - kHeaders: Symbol("headers"), - kSignal: Symbol("signal"), - kState: Symbol("state"), - kDispatcher: Symbol("dispatcher") + name: "@aws-sdk/client-sso", + description: "AWS SDK for JavaScript Sso Client for Node.js, Browser and React Native", + version: "3.635.0", + scripts: { + build: "concurrently 'yarn:build:cjs' 'yarn:build:es' 'yarn:build:types'", + "build:cjs": "node ../../scripts/compilation/inline client-sso", + "build:es": "tsc -p tsconfig.es.json", + "build:include:deps": "lerna run --scope $npm_package_name --include-dependencies build", + "build:types": "tsc -p tsconfig.types.json", + "build:types:downlevel": "downlevel-dts dist-types dist-types/ts3.4", + clean: "rimraf ./dist-* && rimraf *.tsbuildinfo", + "extract:docs": "api-extractor run --local", + "generate:client": "node ../../scripts/generate-clients/single-service --solo sso" + }, + main: "./dist-cjs/index.js", + types: "./dist-types/index.d.ts", + module: "./dist-es/index.js", + sideEffects: false, + dependencies: { + "@aws-crypto/sha256-browser": "5.2.0", + "@aws-crypto/sha256-js": "5.2.0", + "@aws-sdk/core": "3.635.0", + "@aws-sdk/middleware-host-header": "3.620.0", + "@aws-sdk/middleware-logger": "3.609.0", + "@aws-sdk/middleware-recursion-detection": "3.620.0", + "@aws-sdk/middleware-user-agent": "3.632.0", + "@aws-sdk/region-config-resolver": "3.614.0", + "@aws-sdk/types": "3.609.0", + "@aws-sdk/util-endpoints": "3.632.0", + "@aws-sdk/util-user-agent-browser": "3.609.0", + "@aws-sdk/util-user-agent-node": "3.614.0", + "@smithy/config-resolver": "^3.0.5", + "@smithy/core": "^2.4.0", + "@smithy/fetch-http-handler": "^3.2.4", + "@smithy/hash-node": "^3.0.3", + "@smithy/invalid-dependency": "^3.0.3", + "@smithy/middleware-content-length": "^3.0.5", + "@smithy/middleware-endpoint": "^3.1.0", + "@smithy/middleware-retry": "^3.0.15", + "@smithy/middleware-serde": "^3.0.3", + "@smithy/middleware-stack": "^3.0.3", + "@smithy/node-config-provider": "^3.1.4", + "@smithy/node-http-handler": "^3.1.4", + "@smithy/protocol-http": "^4.1.0", + "@smithy/smithy-client": "^3.2.0", + "@smithy/types": "^3.3.0", + "@smithy/url-parser": "^3.0.3", + "@smithy/util-base64": "^3.0.0", + "@smithy/util-body-length-browser": "^3.0.0", + "@smithy/util-body-length-node": "^3.0.0", + "@smithy/util-defaults-mode-browser": "^3.0.15", + "@smithy/util-defaults-mode-node": "^3.0.15", + "@smithy/util-endpoints": "^2.0.5", + "@smithy/util-middleware": "^3.0.3", + "@smithy/util-retry": "^3.0.3", + "@smithy/util-utf8": "^3.0.0", + tslib: "^2.6.2" + }, + devDependencies: { + "@tsconfig/node16": "16.1.3", + "@types/node": "^16.18.96", + concurrently: "7.0.0", + "downlevel-dts": "0.10.1", + rimraf: "3.0.2", + typescript: "~4.9.5" + }, + engines: { + node: ">=16.0.0" + }, + typesVersions: { + "<4.0": { + "dist-types/*": [ + "dist-types/ts3.4/*" + ] + } + }, + files: [ + "dist-*/**" + ], + author: { + name: "AWS SDK for JavaScript Team", + url: "https://aws.amazon.com/javascript/" + }, + license: "Apache-2.0", + browser: { + "./dist-es/runtimeConfig": "./dist-es/runtimeConfig.browser" + }, + "react-native": { + "./dist-es/runtimeConfig": "./dist-es/runtimeConfig.native" + }, + homepage: "https://github.com/aws/aws-sdk-js-v3/tree/main/clients/client-sso", + repository: { + type: "git", + url: "https://github.com/aws/aws-sdk-js-v3.git", + directory: "clients/client-sso" + } }; } }); -// node_modules/undici/lib/web/fetch/file.js -var require_file2 = __commonJS({ - "node_modules/undici/lib/web/fetch/file.js"(exports2, module2) { +// node_modules/@aws-sdk/util-user-agent-node/dist-cjs/index.js +var require_dist_cjs39 = __commonJS({ + "node_modules/@aws-sdk/util-user-agent-node/dist-cjs/index.js"(exports2, module2) { "use strict"; - var { Blob: Blob2, File } = require("node:buffer"); - var { kState } = require_symbols7(); - var { webidl } = require_webidl2(); - var FileLike = class _FileLike { - constructor(blobLike, fileName, options = {}) { - const n = fileName; - const t = options.type; - const d = options.lastModified ?? Date.now(); - this[kState] = { - blobLike, - name: n, - type: t, - lastModified: d - }; + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); + }; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + } + return to; + }; + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + UA_APP_ID_ENV_NAME: () => UA_APP_ID_ENV_NAME, + UA_APP_ID_INI_NAME: () => UA_APP_ID_INI_NAME, + crtAvailability: () => crtAvailability, + defaultUserAgent: () => defaultUserAgent + }); + module2.exports = __toCommonJS2(src_exports); + var import_node_config_provider = require_dist_cjs14(); + var import_os = require("os"); + var import_process = require("process"); + var crtAvailability = { + isCrtAvailable: false + }; + var isCrtAvailable = /* @__PURE__ */ __name(() => { + if (crtAvailability.isCrtAvailable) { + return ["md/crt-avail"]; } - stream(...args) { - webidl.brandCheck(this, _FileLike); - return this[kState].blobLike.stream(...args); + return null; + }, "isCrtAvailable"); + var UA_APP_ID_ENV_NAME = "AWS_SDK_UA_APP_ID"; + var UA_APP_ID_INI_NAME = "sdk-ua-app-id"; + var defaultUserAgent = /* @__PURE__ */ __name(({ serviceId, clientVersion }) => { + const sections = [ + // sdk-metadata + ["aws-sdk-js", clientVersion], + // ua-metadata + ["ua", "2.0"], + // os-metadata + [`os/${(0, import_os.platform)()}`, (0, import_os.release)()], + // language-metadata + // ECMAScript edition doesn't matter in JS, so no version needed. + ["lang/js"], + ["md/nodejs", `${import_process.versions.node}`] + ]; + const crtAvailable = isCrtAvailable(); + if (crtAvailable) { + sections.push(crtAvailable); } - arrayBuffer(...args) { - webidl.brandCheck(this, _FileLike); - return this[kState].blobLike.arrayBuffer(...args); + if (serviceId) { + sections.push([`api/${serviceId}`, clientVersion]); } - slice(...args) { - webidl.brandCheck(this, _FileLike); - return this[kState].blobLike.slice(...args); + if (import_process.env.AWS_EXECUTION_ENV) { + sections.push([`exec-env/${import_process.env.AWS_EXECUTION_ENV}`]); } - text(...args) { - webidl.brandCheck(this, _FileLike); - return this[kState].blobLike.text(...args); + const appIdPromise = (0, import_node_config_provider.loadConfig)({ + environmentVariableSelector: (env2) => env2[UA_APP_ID_ENV_NAME], + configFileSelector: (profile) => profile[UA_APP_ID_INI_NAME], + default: void 0 + })(); + let resolvedUserAgent = void 0; + return async () => { + if (!resolvedUserAgent) { + const appId2 = await appIdPromise; + resolvedUserAgent = appId2 ? [...sections, [`app/${appId2}`]] : [...sections]; + } + return resolvedUserAgent; + }; + }, "defaultUserAgent"); + } +}); + +// node_modules/@smithy/hash-node/dist-cjs/index.js +var require_dist_cjs40 = __commonJS({ + "node_modules/@smithy/hash-node/dist-cjs/index.js"(exports2, module2) { + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); + }; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + } + return to; + }; + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + Hash: () => Hash + }); + module2.exports = __toCommonJS2(src_exports); + var import_util_buffer_from = require_dist_cjs23(); + var import_util_utf8 = require_dist_cjs24(); + var import_buffer = require("buffer"); + var import_crypto8 = require("crypto"); + var _Hash = class _Hash { + constructor(algorithmIdentifier, secret) { + this.algorithmIdentifier = algorithmIdentifier; + this.secret = secret; + this.reset(); } - get size() { - webidl.brandCheck(this, _FileLike); - return this[kState].blobLike.size; + update(toHash, encoding) { + this.hash.update((0, import_util_utf8.toUint8Array)(castSourceData(toHash, encoding))); } - get type() { - webidl.brandCheck(this, _FileLike); - return this[kState].blobLike.type; + digest() { + return Promise.resolve(this.hash.digest()); } - get name() { - webidl.brandCheck(this, _FileLike); - return this[kState].name; + reset() { + this.hash = this.secret ? (0, import_crypto8.createHmac)(this.algorithmIdentifier, castSourceData(this.secret)) : (0, import_crypto8.createHash)(this.algorithmIdentifier); } - get lastModified() { - webidl.brandCheck(this, _FileLike); - return this[kState].lastModified; + }; + __name(_Hash, "Hash"); + var Hash = _Hash; + function castSourceData(toCast, encoding) { + if (import_buffer.Buffer.isBuffer(toCast)) { + return toCast; } - get [Symbol.toStringTag]() { - return "File"; + if (typeof toCast === "string") { + return (0, import_util_buffer_from.fromString)(toCast, encoding); } - }; - webidl.converters.Blob = webidl.interfaceConverter(Blob2); - function isFileLike(object) { - return object instanceof File || object && (typeof object.stream === "function" || typeof object.arrayBuffer === "function") && object[Symbol.toStringTag] === "File"; + if (ArrayBuffer.isView(toCast)) { + return (0, import_util_buffer_from.fromArrayBuffer)(toCast.buffer, toCast.byteOffset, toCast.byteLength); + } + return (0, import_util_buffer_from.fromArrayBuffer)(toCast); } - module2.exports = { FileLike, isFileLike }; + __name(castSourceData, "castSourceData"); } }); -// node_modules/undici/lib/web/fetch/formdata.js -var require_formdata2 = __commonJS({ - "node_modules/undici/lib/web/fetch/formdata.js"(exports2, module2) { - "use strict"; - var { isBlobLike, iteratorMixin } = require_util9(); - var { kState } = require_symbols7(); - var { kEnumerableProperty } = require_util8(); - var { FileLike, isFileLike } = require_file2(); - var { webidl } = require_webidl2(); - var { File: NativeFile } = require("node:buffer"); - var nodeUtil = require("node:util"); - var File = globalThis.File ?? NativeFile; - var FormData = class _FormData { - constructor(form) { - if (form !== void 0) { - throw webidl.errors.conversionFailed({ - prefix: "FormData constructor", - argument: "Argument 1", - types: ["undefined"] - }); - } - this[kState] = []; +// node_modules/@smithy/util-body-length-node/dist-cjs/index.js +var require_dist_cjs41 = __commonJS({ + "node_modules/@smithy/util-body-length-node/dist-cjs/index.js"(exports2, module2) { + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); + }; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + } + return to; + }; + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + calculateBodyLength: () => calculateBodyLength + }); + module2.exports = __toCommonJS2(src_exports); + var import_fs = require("fs"); + var calculateBodyLength = /* @__PURE__ */ __name((body) => { + if (!body) { + return 0; } - append(name, value, filename = void 0) { - webidl.brandCheck(this, _FormData); - const prefix = "FormData.append"; - webidl.argumentLengthCheck(arguments, 2, prefix); - if (arguments.length === 3 && !isBlobLike(value)) { - throw new TypeError( - "Failed to execute 'append' on 'FormData': parameter 2 is not of type 'Blob'" + if (typeof body === "string") { + return Buffer.byteLength(body); + } else if (typeof body.byteLength === "number") { + return body.byteLength; + } else if (typeof body.size === "number") { + return body.size; + } else if (typeof body.start === "number" && typeof body.end === "number") { + return body.end + 1 - body.start; + } else if (typeof body.path === "string" || Buffer.isBuffer(body.path)) { + return (0, import_fs.lstatSync)(body.path).size; + } else if (typeof body.fd === "number") { + return (0, import_fs.fstatSync)(body.fd).size; + } + throw new Error(`Body Length computation failed for ${body}`); + }, "calculateBodyLength"); + } +}); + +// node_modules/@aws-sdk/client-sso/dist-cjs/endpoint/ruleset.js +var require_ruleset = __commonJS({ + "node_modules/@aws-sdk/client-sso/dist-cjs/endpoint/ruleset.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.ruleSet = void 0; + var u = "required"; + var v = "fn"; + var w = "argv"; + var x = "ref"; + var a = true; + var b = "isSet"; + var c = "booleanEquals"; + var d = "error"; + var e = "endpoint"; + var f = "tree"; + var g = "PartitionResult"; + var h = "getAttr"; + var i = { [u]: false, "type": "String" }; + var j = { [u]: true, "default": false, "type": "Boolean" }; + var k = { [x]: "Endpoint" }; + var l = { [v]: c, [w]: [{ [x]: "UseFIPS" }, true] }; + var m = { [v]: c, [w]: [{ [x]: "UseDualStack" }, true] }; + var n = {}; + var o = { [v]: h, [w]: [{ [x]: g }, "supportsFIPS"] }; + var p = { [x]: g }; + var q = { [v]: c, [w]: [true, { [v]: h, [w]: [p, "supportsDualStack"] }] }; + var r = [l]; + var s = [m]; + var t = [{ [x]: "Region" }]; + var _data = { version: "1.0", parameters: { Region: i, UseDualStack: j, UseFIPS: j, Endpoint: i }, rules: [{ conditions: [{ [v]: b, [w]: [k] }], rules: [{ conditions: r, error: "Invalid Configuration: FIPS and custom endpoint are not supported", type: d }, { conditions: s, error: "Invalid Configuration: Dualstack and custom endpoint are not supported", type: d }, { endpoint: { url: k, properties: n, headers: n }, type: e }], type: f }, { conditions: [{ [v]: b, [w]: t }], rules: [{ conditions: [{ [v]: "aws.partition", [w]: t, assign: g }], rules: [{ conditions: [l, m], rules: [{ conditions: [{ [v]: c, [w]: [a, o] }, q], rules: [{ endpoint: { url: "https://portal.sso-fips.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: n, headers: n }, type: e }], type: f }, { error: "FIPS and DualStack are enabled, but this partition does not support one or both", type: d }], type: f }, { conditions: r, rules: [{ conditions: [{ [v]: c, [w]: [o, a] }], rules: [{ conditions: [{ [v]: "stringEquals", [w]: [{ [v]: h, [w]: [p, "name"] }, "aws-us-gov"] }], endpoint: { url: "https://portal.sso.{Region}.amazonaws.com", properties: n, headers: n }, type: e }, { endpoint: { url: "https://portal.sso-fips.{Region}.{PartitionResult#dnsSuffix}", properties: n, headers: n }, type: e }], type: f }, { error: "FIPS is enabled but this partition does not support FIPS", type: d }], type: f }, { conditions: s, rules: [{ conditions: [q], rules: [{ endpoint: { url: "https://portal.sso.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: n, headers: n }, type: e }], type: f }, { error: "DualStack is enabled but this partition does not support DualStack", type: d }], type: f }, { endpoint: { url: "https://portal.sso.{Region}.{PartitionResult#dnsSuffix}", properties: n, headers: n }, type: e }], type: f }], type: f }, { error: "Invalid Configuration: Missing Region", type: d }] }; + exports2.ruleSet = _data; + } +}); + +// node_modules/@aws-sdk/client-sso/dist-cjs/endpoint/endpointResolver.js +var require_endpointResolver = __commonJS({ + "node_modules/@aws-sdk/client-sso/dist-cjs/endpoint/endpointResolver.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.defaultEndpointResolver = void 0; + var util_endpoints_1 = require_dist_cjs7(); + var util_endpoints_2 = require_dist_cjs6(); + var ruleset_1 = require_ruleset(); + var defaultEndpointResolver = (endpointParams, context = {}) => { + return (0, util_endpoints_2.resolveEndpoint)(ruleset_1.ruleSet, { + endpointParams, + logger: context.logger + }); + }; + exports2.defaultEndpointResolver = defaultEndpointResolver; + util_endpoints_2.customEndpointFunctions.aws = util_endpoints_1.awsEndpointFunctions; + } +}); + +// node_modules/@aws-sdk/client-sso/dist-cjs/runtimeConfig.shared.js +var require_runtimeConfig_shared = __commonJS({ + "node_modules/@aws-sdk/client-sso/dist-cjs/runtimeConfig.shared.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.getRuntimeConfig = void 0; + var core_1 = (init_dist_es2(), __toCommonJS(dist_es_exports2)); + var core_2 = (init_dist_es(), __toCommonJS(dist_es_exports)); + var smithy_client_1 = require_dist_cjs32(); + var url_parser_1 = require_dist_cjs16(); + var util_base64_1 = require_dist_cjs25(); + var util_utf8_1 = require_dist_cjs24(); + var httpAuthSchemeProvider_1 = require_httpAuthSchemeProvider2(); + var endpointResolver_1 = require_endpointResolver(); + var getRuntimeConfig = (config) => { + return { + apiVersion: "2019-06-10", + base64Decoder: config?.base64Decoder ?? util_base64_1.fromBase64, + base64Encoder: config?.base64Encoder ?? util_base64_1.toBase64, + disableHostPrefix: config?.disableHostPrefix ?? false, + endpointProvider: config?.endpointProvider ?? endpointResolver_1.defaultEndpointResolver, + extensions: config?.extensions ?? [], + httpAuthSchemeProvider: config?.httpAuthSchemeProvider ?? httpAuthSchemeProvider_1.defaultSSOHttpAuthSchemeProvider, + httpAuthSchemes: config?.httpAuthSchemes ?? [ + { + schemeId: "aws.auth#sigv4", + identityProvider: (ipc) => ipc.getIdentityProvider("aws.auth#sigv4"), + signer: new core_1.AwsSdkSigV4Signer() + }, + { + schemeId: "smithy.api#noAuth", + identityProvider: (ipc) => ipc.getIdentityProvider("smithy.api#noAuth") || (async () => ({})), + signer: new core_2.NoAuthSigner() + } + ], + logger: config?.logger ?? new smithy_client_1.NoOpLogger(), + serviceId: config?.serviceId ?? "SSO", + urlParser: config?.urlParser ?? url_parser_1.parseUrl, + utf8Decoder: config?.utf8Decoder ?? util_utf8_1.fromUtf8, + utf8Encoder: config?.utf8Encoder ?? util_utf8_1.toUtf8 + }; + }; + exports2.getRuntimeConfig = getRuntimeConfig; + } +}); + +// node_modules/@smithy/util-defaults-mode-node/dist-cjs/index.js +var require_dist_cjs42 = __commonJS({ + "node_modules/@smithy/util-defaults-mode-node/dist-cjs/index.js"(exports2, module2) { + var __create2 = Object.create; + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __getProtoOf2 = Object.getPrototypeOf; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); + }; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + } + return to; + }; + var __toESM2 = (mod, isNodeMode, target) => (target = mod != null ? __create2(__getProtoOf2(mod)) : {}, __copyProps2( + // If the importer is in node compatibility mode or this is not an ESM + // file that has been converted to a CommonJS file using a Babel- + // compatible transform (i.e. "__esModule" has not been set), then set + // "default" to the CommonJS "module.exports" for node compatibility. + isNodeMode || !mod || !mod.__esModule ? __defProp2(target, "default", { value: mod, enumerable: true }) : target, + mod + )); + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + resolveDefaultsModeConfig: () => resolveDefaultsModeConfig + }); + module2.exports = __toCommonJS2(src_exports); + var import_config_resolver = require_dist_cjs11(); + var import_node_config_provider = require_dist_cjs14(); + var import_property_provider2 = require_dist_cjs12(); + var AWS_EXECUTION_ENV = "AWS_EXECUTION_ENV"; + var AWS_REGION_ENV = "AWS_REGION"; + var AWS_DEFAULT_REGION_ENV = "AWS_DEFAULT_REGION"; + var ENV_IMDS_DISABLED = "AWS_EC2_METADATA_DISABLED"; + var DEFAULTS_MODE_OPTIONS = ["in-region", "cross-region", "mobile", "standard", "legacy"]; + var IMDS_REGION_PATH = "/latest/meta-data/placement/region"; + var AWS_DEFAULTS_MODE_ENV = "AWS_DEFAULTS_MODE"; + var AWS_DEFAULTS_MODE_CONFIG = "defaults_mode"; + var NODE_DEFAULTS_MODE_CONFIG_OPTIONS = { + environmentVariableSelector: (env) => { + return env[AWS_DEFAULTS_MODE_ENV]; + }, + configFileSelector: (profile) => { + return profile[AWS_DEFAULTS_MODE_CONFIG]; + }, + default: "legacy" + }; + var resolveDefaultsModeConfig = /* @__PURE__ */ __name(({ + region = (0, import_node_config_provider.loadConfig)(import_config_resolver.NODE_REGION_CONFIG_OPTIONS), + defaultsMode = (0, import_node_config_provider.loadConfig)(NODE_DEFAULTS_MODE_CONFIG_OPTIONS) + } = {}) => (0, import_property_provider2.memoize)(async () => { + const mode = typeof defaultsMode === "function" ? await defaultsMode() : defaultsMode; + switch (mode == null ? void 0 : mode.toLowerCase()) { + case "auto": + return resolveNodeDefaultsModeAuto(region); + case "in-region": + case "cross-region": + case "mobile": + case "standard": + case "legacy": + return Promise.resolve(mode == null ? void 0 : mode.toLocaleLowerCase()); + case void 0: + return Promise.resolve("legacy"); + default: + throw new Error( + `Invalid parameter for "defaultsMode", expect ${DEFAULTS_MODE_OPTIONS.join(", ")}, got ${mode}` ); - } - name = webidl.converters.USVString(name, prefix, "name"); - value = isBlobLike(value) ? webidl.converters.Blob(value, prefix, "value", { strict: false }) : webidl.converters.USVString(value, prefix, "value"); - filename = arguments.length === 3 ? webidl.converters.USVString(filename, prefix, "filename") : void 0; - const entry = makeEntry(name, value, filename); - this[kState].push(entry); - } - delete(name) { - webidl.brandCheck(this, _FormData); - const prefix = "FormData.delete"; - webidl.argumentLengthCheck(arguments, 1, prefix); - name = webidl.converters.USVString(name, prefix, "name"); - this[kState] = this[kState].filter((entry) => entry.name !== name); } - get(name) { - webidl.brandCheck(this, _FormData); - const prefix = "FormData.get"; - webidl.argumentLengthCheck(arguments, 1, prefix); - name = webidl.converters.USVString(name, prefix, "name"); - const idx = this[kState].findIndex((entry) => entry.name === name); - if (idx === -1) { - return null; + }), "resolveDefaultsModeConfig"); + var resolveNodeDefaultsModeAuto = /* @__PURE__ */ __name(async (clientRegion) => { + if (clientRegion) { + const resolvedRegion = typeof clientRegion === "function" ? await clientRegion() : clientRegion; + const inferredRegion = await inferPhysicalRegion(); + if (!inferredRegion) { + return "standard"; + } + if (resolvedRegion === inferredRegion) { + return "in-region"; + } else { + return "cross-region"; } - return this[kState][idx].value; - } - getAll(name) { - webidl.brandCheck(this, _FormData); - const prefix = "FormData.getAll"; - webidl.argumentLengthCheck(arguments, 1, prefix); - name = webidl.converters.USVString(name, prefix, "name"); - return this[kState].filter((entry) => entry.name === name).map((entry) => entry.value); } - has(name) { - webidl.brandCheck(this, _FormData); - const prefix = "FormData.has"; - webidl.argumentLengthCheck(arguments, 1, prefix); - name = webidl.converters.USVString(name, prefix, "name"); - return this[kState].findIndex((entry) => entry.name === name) !== -1; + return "standard"; + }, "resolveNodeDefaultsModeAuto"); + var inferPhysicalRegion = /* @__PURE__ */ __name(async () => { + if (process.env[AWS_EXECUTION_ENV] && (process.env[AWS_REGION_ENV] || process.env[AWS_DEFAULT_REGION_ENV])) { + return process.env[AWS_REGION_ENV] ?? process.env[AWS_DEFAULT_REGION_ENV]; } - set(name, value, filename = void 0) { - webidl.brandCheck(this, _FormData); - const prefix = "FormData.set"; - webidl.argumentLengthCheck(arguments, 2, prefix); - if (arguments.length === 3 && !isBlobLike(value)) { - throw new TypeError( - "Failed to execute 'set' on 'FormData': parameter 2 is not of type 'Blob'" - ); + if (!process.env[ENV_IMDS_DISABLED]) { + try { + const { getInstanceMetadataEndpoint, httpRequest } = await Promise.resolve().then(() => __toESM2(require_dist_cjs37())); + const endpoint2 = await getInstanceMetadataEndpoint(); + return (await httpRequest({ ...endpoint2, path: IMDS_REGION_PATH })).toString(); + } catch (e) { } - name = webidl.converters.USVString(name, prefix, "name"); - value = isBlobLike(value) ? webidl.converters.Blob(value, prefix, "name", { strict: false }) : webidl.converters.USVString(value, prefix, "name"); - filename = arguments.length === 3 ? webidl.converters.USVString(filename, prefix, "name") : void 0; - const entry = makeEntry(name, value, filename); - const idx = this[kState].findIndex((entry2) => entry2.name === name); - if (idx !== -1) { - this[kState] = [ - ...this[kState].slice(0, idx), - entry, - ...this[kState].slice(idx + 1).filter((entry2) => entry2.name !== name) - ]; - } else { - this[kState].push(entry); + } + }, "inferPhysicalRegion"); + } +}); + +// node_modules/@aws-sdk/client-sso/dist-cjs/runtimeConfig.js +var require_runtimeConfig = __commonJS({ + "node_modules/@aws-sdk/client-sso/dist-cjs/runtimeConfig.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.getRuntimeConfig = void 0; + var tslib_1 = (init_tslib_es6(), __toCommonJS(tslib_es6_exports)); + var package_json_1 = tslib_1.__importDefault(require_package2()); + var core_1 = (init_dist_es2(), __toCommonJS(dist_es_exports2)); + var util_user_agent_node_1 = require_dist_cjs39(); + var config_resolver_1 = require_dist_cjs11(); + var hash_node_1 = require_dist_cjs40(); + var middleware_retry_1 = require_dist_cjs33(); + var node_config_provider_1 = require_dist_cjs14(); + var node_http_handler_1 = require_dist_cjs28(); + var util_body_length_node_1 = require_dist_cjs41(); + var util_retry_1 = require_dist_cjs20(); + var runtimeConfig_shared_1 = require_runtimeConfig_shared(); + var smithy_client_1 = require_dist_cjs32(); + var util_defaults_mode_node_1 = require_dist_cjs42(); + var smithy_client_2 = require_dist_cjs32(); + var getRuntimeConfig = (config) => { + (0, smithy_client_2.emitWarningIfUnsupportedVersion)(process.version); + const defaultsMode = (0, util_defaults_mode_node_1.resolveDefaultsModeConfig)(config); + const defaultConfigProvider = () => defaultsMode().then(smithy_client_1.loadConfigsForDefaultMode); + const clientSharedValues = (0, runtimeConfig_shared_1.getRuntimeConfig)(config); + (0, core_1.emitWarningIfUnsupportedVersion)(process.version); + return { + ...clientSharedValues, + ...config, + runtime: "node", + defaultsMode, + bodyLengthChecker: config?.bodyLengthChecker ?? util_body_length_node_1.calculateBodyLength, + defaultUserAgentProvider: config?.defaultUserAgentProvider ?? (0, util_user_agent_node_1.defaultUserAgent)({ serviceId: clientSharedValues.serviceId, clientVersion: package_json_1.default.version }), + maxAttempts: config?.maxAttempts ?? (0, node_config_provider_1.loadConfig)(middleware_retry_1.NODE_MAX_ATTEMPT_CONFIG_OPTIONS), + region: config?.region ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_REGION_CONFIG_OPTIONS, config_resolver_1.NODE_REGION_CONFIG_FILE_OPTIONS), + requestHandler: node_http_handler_1.NodeHttpHandler.create(config?.requestHandler ?? defaultConfigProvider), + retryMode: config?.retryMode ?? (0, node_config_provider_1.loadConfig)({ + ...middleware_retry_1.NODE_RETRY_MODE_CONFIG_OPTIONS, + default: async () => (await defaultConfigProvider()).retryMode || util_retry_1.DEFAULT_RETRY_MODE + }), + sha256: config?.sha256 ?? hash_node_1.Hash.bind(null, "sha256"), + streamCollector: config?.streamCollector ?? node_http_handler_1.streamCollector, + useDualstackEndpoint: config?.useDualstackEndpoint ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS), + useFipsEndpoint: config?.useFipsEndpoint ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS) + }; + }; + exports2.getRuntimeConfig = getRuntimeConfig; + } +}); + +// node_modules/@aws-sdk/region-config-resolver/dist-cjs/index.js +var require_dist_cjs43 = __commonJS({ + "node_modules/@aws-sdk/region-config-resolver/dist-cjs/index.js"(exports2, module2) { + "use strict"; + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); + }; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + } + return to; + }; + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + NODE_REGION_CONFIG_FILE_OPTIONS: () => NODE_REGION_CONFIG_FILE_OPTIONS, + NODE_REGION_CONFIG_OPTIONS: () => NODE_REGION_CONFIG_OPTIONS, + REGION_ENV_NAME: () => REGION_ENV_NAME, + REGION_INI_NAME: () => REGION_INI_NAME, + getAwsRegionExtensionConfiguration: () => getAwsRegionExtensionConfiguration, + resolveAwsRegionExtensionConfiguration: () => resolveAwsRegionExtensionConfiguration, + resolveRegionConfig: () => resolveRegionConfig + }); + module2.exports = __toCommonJS2(src_exports); + var getAwsRegionExtensionConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { + let runtimeConfigRegion = /* @__PURE__ */ __name(async () => { + if (runtimeConfig.region === void 0) { + throw new Error("Region is missing from runtimeConfig"); + } + const region = runtimeConfig.region; + if (typeof region === "string") { + return region; + } + return region(); + }, "runtimeConfigRegion"); + return { + setRegion(region) { + runtimeConfigRegion = region; + }, + region() { + return runtimeConfigRegion; } + }; + }, "getAwsRegionExtensionConfiguration"); + var resolveAwsRegionExtensionConfiguration = /* @__PURE__ */ __name((awsRegionExtensionConfiguration) => { + return { + region: awsRegionExtensionConfiguration.region() + }; + }, "resolveAwsRegionExtensionConfiguration"); + var REGION_ENV_NAME = "AWS_REGION"; + var REGION_INI_NAME = "region"; + var NODE_REGION_CONFIG_OPTIONS = { + environmentVariableSelector: (env) => env[REGION_ENV_NAME], + configFileSelector: (profile) => profile[REGION_INI_NAME], + default: () => { + throw new Error("Region is missing"); + } + }; + var NODE_REGION_CONFIG_FILE_OPTIONS = { + preferredFile: "credentials" + }; + var isFipsRegion = /* @__PURE__ */ __name((region) => typeof region === "string" && (region.startsWith("fips-") || region.endsWith("-fips")), "isFipsRegion"); + var getRealRegion = /* @__PURE__ */ __name((region) => isFipsRegion(region) ? ["fips-aws-global", "aws-fips"].includes(region) ? "us-east-1" : region.replace(/fips-(dkr-|prod-)?|-fips/, "") : region, "getRealRegion"); + var resolveRegionConfig = /* @__PURE__ */ __name((input) => { + const { region, useFipsEndpoint } = input; + if (!region) { + throw new Error("Region is missing"); } - [nodeUtil.inspect.custom](depth, options) { - const state = this[kState].reduce((a, b) => { - if (a[b.name]) { - if (Array.isArray(a[b.name])) { - a[b.name].push(b.value); - } else { - a[b.name] = [a[b.name], b.value]; - } - } else { - a[b.name] = b.value; + return { + ...input, + region: async () => { + if (typeof region === "string") { + return getRealRegion(region); } - return a; - }, { __proto__: null }); - options.depth ??= depth; - options.colors ??= true; - const output = nodeUtil.formatWithOptions(options, state); - return `FormData ${output.slice(output.indexOf("]") + 2)}`; - } - }; - iteratorMixin("FormData", FormData, kState, "name", "value"); - Object.defineProperties(FormData.prototype, { - append: kEnumerableProperty, - delete: kEnumerableProperty, - get: kEnumerableProperty, - getAll: kEnumerableProperty, - has: kEnumerableProperty, - set: kEnumerableProperty, - [Symbol.toStringTag]: { - value: "FormData", - configurable: true - } - }); - function makeEntry(name, value, filename) { - if (typeof value === "string") { - } else { - if (!isFileLike(value)) { - value = value instanceof Blob ? new File([value], "blob", { type: value.type }) : new FileLike(value, "blob", { type: value.type }); - } - if (filename !== void 0) { - const options = { - type: value.type, - lastModified: value.lastModified - }; - value = value instanceof NativeFile ? new File([value], filename, options) : new FileLike(value, filename, options); + const providedRegion = await region(); + return getRealRegion(providedRegion); + }, + useFipsEndpoint: async () => { + const providedRegion = typeof region === "string" ? region : await region(); + if (isFipsRegion(providedRegion)) { + return true; + } + return typeof useFipsEndpoint !== "function" ? Promise.resolve(!!useFipsEndpoint) : useFipsEndpoint(); } - } - return { name, value }; - } - module2.exports = { FormData, makeEntry }; + }; + }, "resolveRegionConfig"); } }); -// node_modules/undici/lib/web/fetch/formdata-parser.js -var require_formdata_parser = __commonJS({ - "node_modules/undici/lib/web/fetch/formdata-parser.js"(exports2, module2) { +// node_modules/@aws-sdk/client-sso/dist-cjs/index.js +var require_dist_cjs44 = __commonJS({ + "node_modules/@aws-sdk/client-sso/dist-cjs/index.js"(exports2, module2) { "use strict"; - var { isUSVString, bufferToLowerCasedHeaderName } = require_util8(); - var { utf8DecodeBytes } = require_util9(); - var { HTTP_TOKEN_CODEPOINTS, isomorphicDecode } = require_data_url(); - var { isFileLike } = require_file2(); - var { makeEntry } = require_formdata2(); - var assert = require("node:assert"); - var { File: NodeFile } = require("node:buffer"); - var File = globalThis.File ?? NodeFile; - var formDataNameBuffer = Buffer.from('form-data; name="'); - var filenameBuffer = Buffer.from("; filename"); - var dd = Buffer.from("--"); - var ddcrlf = Buffer.from("--\r\n"); - function isAsciiString(chars) { - for (let i = 0; i < chars.length; ++i) { - if ((chars.charCodeAt(i) & ~127) !== 0) { - return false; + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); + }; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + } + return to; + }; + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + GetRoleCredentialsCommand: () => GetRoleCredentialsCommand, + GetRoleCredentialsRequestFilterSensitiveLog: () => GetRoleCredentialsRequestFilterSensitiveLog, + GetRoleCredentialsResponseFilterSensitiveLog: () => GetRoleCredentialsResponseFilterSensitiveLog, + InvalidRequestException: () => InvalidRequestException, + ListAccountRolesCommand: () => ListAccountRolesCommand, + ListAccountRolesRequestFilterSensitiveLog: () => ListAccountRolesRequestFilterSensitiveLog, + ListAccountsCommand: () => ListAccountsCommand, + ListAccountsRequestFilterSensitiveLog: () => ListAccountsRequestFilterSensitiveLog, + LogoutCommand: () => LogoutCommand, + LogoutRequestFilterSensitiveLog: () => LogoutRequestFilterSensitiveLog, + ResourceNotFoundException: () => ResourceNotFoundException, + RoleCredentialsFilterSensitiveLog: () => RoleCredentialsFilterSensitiveLog, + SSO: () => SSO, + SSOClient: () => SSOClient, + SSOServiceException: () => SSOServiceException, + TooManyRequestsException: () => TooManyRequestsException, + UnauthorizedException: () => UnauthorizedException, + __Client: () => import_smithy_client5.Client, + paginateListAccountRoles: () => paginateListAccountRoles, + paginateListAccounts: () => paginateListAccounts + }); + module2.exports = __toCommonJS2(src_exports); + var import_middleware_host_header = require_dist_cjs3(); + var import_middleware_logger = require_dist_cjs4(); + var import_middleware_recursion_detection = require_dist_cjs5(); + var import_middleware_user_agent = require_dist_cjs8(); + var import_config_resolver = require_dist_cjs11(); + var import_core5 = (init_dist_es(), __toCommonJS(dist_es_exports)); + var import_middleware_content_length = require_dist_cjs34(); + var import_middleware_endpoint2 = require_dist_cjs18(); + var import_middleware_retry2 = require_dist_cjs33(); + var import_httpAuthSchemeProvider = require_httpAuthSchemeProvider2(); + var resolveClientEndpointParameters = /* @__PURE__ */ __name((options) => { + return { + ...options, + useDualstackEndpoint: options.useDualstackEndpoint ?? false, + useFipsEndpoint: options.useFipsEndpoint ?? false, + defaultSigningName: "awsssoportal" + }; + }, "resolveClientEndpointParameters"); + var commonParams = { + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" } + }; + var import_runtimeConfig = require_runtimeConfig(); + var import_region_config_resolver = require_dist_cjs43(); + var import_protocol_http8 = require_dist_cjs2(); + var import_smithy_client5 = require_dist_cjs32(); + var getHttpAuthExtensionConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { + const _httpAuthSchemes = runtimeConfig.httpAuthSchemes; + let _httpAuthSchemeProvider = runtimeConfig.httpAuthSchemeProvider; + let _credentials = runtimeConfig.credentials; + return { + setHttpAuthScheme(httpAuthScheme) { + const index = _httpAuthSchemes.findIndex((scheme) => scheme.schemeId === httpAuthScheme.schemeId); + if (index === -1) { + _httpAuthSchemes.push(httpAuthScheme); + } else { + _httpAuthSchemes.splice(index, 1, httpAuthScheme); + } + }, + httpAuthSchemes() { + return _httpAuthSchemes; + }, + setHttpAuthSchemeProvider(httpAuthSchemeProvider) { + _httpAuthSchemeProvider = httpAuthSchemeProvider; + }, + httpAuthSchemeProvider() { + return _httpAuthSchemeProvider; + }, + setCredentials(credentials) { + _credentials = credentials; + }, + credentials() { + return _credentials; } + }; + }, "getHttpAuthExtensionConfiguration"); + var resolveHttpAuthRuntimeConfig = /* @__PURE__ */ __name((config) => { + return { + httpAuthSchemes: config.httpAuthSchemes(), + httpAuthSchemeProvider: config.httpAuthSchemeProvider(), + credentials: config.credentials() + }; + }, "resolveHttpAuthRuntimeConfig"); + var asPartial = /* @__PURE__ */ __name((t) => t, "asPartial"); + var resolveRuntimeExtensions = /* @__PURE__ */ __name((runtimeConfig, extensions) => { + const extensionConfiguration = { + ...asPartial((0, import_region_config_resolver.getAwsRegionExtensionConfiguration)(runtimeConfig)), + ...asPartial((0, import_smithy_client5.getDefaultExtensionConfiguration)(runtimeConfig)), + ...asPartial((0, import_protocol_http8.getHttpHandlerExtensionConfiguration)(runtimeConfig)), + ...asPartial(getHttpAuthExtensionConfiguration(runtimeConfig)) + }; + extensions.forEach((extension) => extension.configure(extensionConfiguration)); + return { + ...runtimeConfig, + ...(0, import_region_config_resolver.resolveAwsRegionExtensionConfiguration)(extensionConfiguration), + ...(0, import_smithy_client5.resolveDefaultRuntimeConfig)(extensionConfiguration), + ...(0, import_protocol_http8.resolveHttpHandlerRuntimeConfig)(extensionConfiguration), + ...resolveHttpAuthRuntimeConfig(extensionConfiguration) + }; + }, "resolveRuntimeExtensions"); + var _SSOClient = class _SSOClient extends import_smithy_client5.Client { + constructor(...[configuration]) { + const _config_0 = (0, import_runtimeConfig.getRuntimeConfig)(configuration || {}); + const _config_1 = resolveClientEndpointParameters(_config_0); + const _config_2 = (0, import_middleware_user_agent.resolveUserAgentConfig)(_config_1); + const _config_3 = (0, import_middleware_retry2.resolveRetryConfig)(_config_2); + const _config_4 = (0, import_config_resolver.resolveRegionConfig)(_config_3); + const _config_5 = (0, import_middleware_host_header.resolveHostHeaderConfig)(_config_4); + const _config_6 = (0, import_middleware_endpoint2.resolveEndpointConfig)(_config_5); + const _config_7 = (0, import_httpAuthSchemeProvider.resolveHttpAuthSchemeConfig)(_config_6); + const _config_8 = resolveRuntimeExtensions(_config_7, (configuration == null ? void 0 : configuration.extensions) || []); + super(_config_8); + this.config = _config_8; + this.middlewareStack.use((0, import_middleware_user_agent.getUserAgentPlugin)(this.config)); + this.middlewareStack.use((0, import_middleware_retry2.getRetryPlugin)(this.config)); + this.middlewareStack.use((0, import_middleware_content_length.getContentLengthPlugin)(this.config)); + this.middlewareStack.use((0, import_middleware_host_header.getHostHeaderPlugin)(this.config)); + this.middlewareStack.use((0, import_middleware_logger.getLoggerPlugin)(this.config)); + this.middlewareStack.use((0, import_middleware_recursion_detection.getRecursionDetectionPlugin)(this.config)); + this.middlewareStack.use( + (0, import_core5.getHttpAuthSchemeEndpointRuleSetPlugin)(this.config, { + httpAuthSchemeParametersProvider: import_httpAuthSchemeProvider.defaultSSOHttpAuthSchemeParametersProvider, + identityProviderConfigProvider: async (config) => new import_core5.DefaultIdentityProviderConfig({ + "aws.auth#sigv4": config.credentials + }) + }) + ); + this.middlewareStack.use((0, import_core5.getHttpSigningPlugin)(this.config)); } - return true; - } - function validateBoundary(boundary) { - const length = boundary.length; - if (length < 27 || length > 70) { - return false; + /** + * Destroy underlying resources, like sockets. It's usually not necessary to do this. + * However in Node.js, it's best to explicitly shut down the client's agent when it is no longer needed. + * Otherwise, sockets might stay open for quite a long time before the server terminates them. + */ + destroy() { + super.destroy(); } - for (let i = 0; i < length; ++i) { - const cp = boundary.charCodeAt(i); - if (!(cp >= 48 && cp <= 57 || cp >= 65 && cp <= 90 || cp >= 97 && cp <= 122 || cp === 39 || cp === 45 || cp === 95)) { - return false; - } + }; + __name(_SSOClient, "SSOClient"); + var SSOClient = _SSOClient; + var import_middleware_serde2 = require_dist_cjs17(); + var _SSOServiceException = class _SSOServiceException2 extends import_smithy_client5.ServiceException { + /** + * @internal + */ + constructor(options) { + super(options); + Object.setPrototypeOf(this, _SSOServiceException2.prototype); } - return true; - } - function multipartFormDataParser(input, mimeType) { - assert(mimeType !== "failure" && mimeType.essence === "multipart/form-data"); - const boundaryString = mimeType.parameters.get("boundary"); - if (boundaryString === void 0) { - return "failure"; + }; + __name(_SSOServiceException, "SSOServiceException"); + var SSOServiceException = _SSOServiceException; + var _InvalidRequestException = class _InvalidRequestException2 extends SSOServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "InvalidRequestException", + $fault: "client", + ...opts + }); + this.name = "InvalidRequestException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _InvalidRequestException2.prototype); } - const boundary = Buffer.from(`--${boundaryString}`, "utf8"); - const entryList = []; - const position = { position: 0 }; - if (input[0] === 13 && input[1] === 10) { - position.position += 2; + }; + __name(_InvalidRequestException, "InvalidRequestException"); + var InvalidRequestException = _InvalidRequestException; + var _ResourceNotFoundException = class _ResourceNotFoundException2 extends SSOServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "ResourceNotFoundException", + $fault: "client", + ...opts + }); + this.name = "ResourceNotFoundException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _ResourceNotFoundException2.prototype); } - while (true) { - if (input.subarray(position.position, position.position + boundary.length).equals(boundary)) { - position.position += boundary.length; - } else { - return "failure"; - } - if (position.position === input.length - 2 && bufferStartsWith(input, dd, position) || position.position === input.length - 4 && bufferStartsWith(input, ddcrlf, position)) { - return entryList; - } - if (input[position.position] !== 13 || input[position.position + 1] !== 10) { - return "failure"; - } - position.position += 2; - const result = parseMultipartFormDataHeaders(input, position); - if (result === "failure") { - return "failure"; - } - let { name, filename, contentType, encoding } = result; - position.position += 2; - let body; - { - const boundaryIndex = input.indexOf(boundary.subarray(2), position.position); - if (boundaryIndex === -1) { - return "failure"; - } - body = input.subarray(position.position, boundaryIndex - 4); - position.position += body.length; - if (encoding === "base64") { - body = Buffer.from(body.toString(), "base64"); - } - } - if (input[position.position] !== 13 || input[position.position + 1] !== 10) { - return "failure"; - } else { - position.position += 2; - } - let value; - if (filename !== null) { - contentType ??= "text/plain"; - if (!isAsciiString(contentType)) { - contentType = ""; - } - value = new File([body], filename, { type: contentType }); - } else { - value = utf8DecodeBytes(Buffer.from(body)); - } - assert(isUSVString(name)); - assert(typeof value === "string" && isUSVString(value) || isFileLike(value)); - entryList.push(makeEntry(name, value, filename)); + }; + __name(_ResourceNotFoundException, "ResourceNotFoundException"); + var ResourceNotFoundException = _ResourceNotFoundException; + var _TooManyRequestsException = class _TooManyRequestsException2 extends SSOServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "TooManyRequestsException", + $fault: "client", + ...opts + }); + this.name = "TooManyRequestsException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _TooManyRequestsException2.prototype); } - } - function parseMultipartFormDataHeaders(input, position) { - let name = null; - let filename = null; - let contentType = null; - let encoding = null; - while (true) { - if (input[position.position] === 13 && input[position.position + 1] === 10) { - if (name === null) { - return "failure"; + }; + __name(_TooManyRequestsException, "TooManyRequestsException"); + var TooManyRequestsException = _TooManyRequestsException; + var _UnauthorizedException = class _UnauthorizedException2 extends SSOServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "UnauthorizedException", + $fault: "client", + ...opts + }); + this.name = "UnauthorizedException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _UnauthorizedException2.prototype); + } + }; + __name(_UnauthorizedException, "UnauthorizedException"); + var UnauthorizedException = _UnauthorizedException; + var GetRoleCredentialsRequestFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ + ...obj, + ...obj.accessToken && { accessToken: import_smithy_client5.SENSITIVE_STRING } + }), "GetRoleCredentialsRequestFilterSensitiveLog"); + var RoleCredentialsFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ + ...obj, + ...obj.secretAccessKey && { secretAccessKey: import_smithy_client5.SENSITIVE_STRING }, + ...obj.sessionToken && { sessionToken: import_smithy_client5.SENSITIVE_STRING } + }), "RoleCredentialsFilterSensitiveLog"); + var GetRoleCredentialsResponseFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ + ...obj, + ...obj.roleCredentials && { roleCredentials: RoleCredentialsFilterSensitiveLog(obj.roleCredentials) } + }), "GetRoleCredentialsResponseFilterSensitiveLog"); + var ListAccountRolesRequestFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ + ...obj, + ...obj.accessToken && { accessToken: import_smithy_client5.SENSITIVE_STRING } + }), "ListAccountRolesRequestFilterSensitiveLog"); + var ListAccountsRequestFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ + ...obj, + ...obj.accessToken && { accessToken: import_smithy_client5.SENSITIVE_STRING } + }), "ListAccountsRequestFilterSensitiveLog"); + var LogoutRequestFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ + ...obj, + ...obj.accessToken && { accessToken: import_smithy_client5.SENSITIVE_STRING } + }), "LogoutRequestFilterSensitiveLog"); + var import_core22 = (init_dist_es2(), __toCommonJS(dist_es_exports2)); + var se_GetRoleCredentialsCommand = /* @__PURE__ */ __name(async (input, context) => { + const b = (0, import_core5.requestBuilder)(input, context); + const headers = (0, import_smithy_client5.map)({}, isSerializableHeaderValue, { + [_xasbt]: input[_aT] + }); + b.bp("/federation/credentials"); + const query = (0, import_smithy_client5.map)({ + [_rn]: [, (0, import_smithy_client5.expectNonNull)(input[_rN], `roleName`)], + [_ai]: [, (0, import_smithy_client5.expectNonNull)(input[_aI], `accountId`)] + }); + let body; + b.m("GET").h(headers).q(query).b(body); + return b.build(); + }, "se_GetRoleCredentialsCommand"); + var se_ListAccountRolesCommand = /* @__PURE__ */ __name(async (input, context) => { + const b = (0, import_core5.requestBuilder)(input, context); + const headers = (0, import_smithy_client5.map)({}, isSerializableHeaderValue, { + [_xasbt]: input[_aT] + }); + b.bp("/assignment/roles"); + const query = (0, import_smithy_client5.map)({ + [_nt]: [, input[_nT]], + [_mr]: [() => input.maxResults !== void 0, () => input[_mR].toString()], + [_ai]: [, (0, import_smithy_client5.expectNonNull)(input[_aI], `accountId`)] + }); + let body; + b.m("GET").h(headers).q(query).b(body); + return b.build(); + }, "se_ListAccountRolesCommand"); + var se_ListAccountsCommand = /* @__PURE__ */ __name(async (input, context) => { + const b = (0, import_core5.requestBuilder)(input, context); + const headers = (0, import_smithy_client5.map)({}, isSerializableHeaderValue, { + [_xasbt]: input[_aT] + }); + b.bp("/assignment/accounts"); + const query = (0, import_smithy_client5.map)({ + [_nt]: [, input[_nT]], + [_mr]: [() => input.maxResults !== void 0, () => input[_mR].toString()] + }); + let body; + b.m("GET").h(headers).q(query).b(body); + return b.build(); + }, "se_ListAccountsCommand"); + var se_LogoutCommand = /* @__PURE__ */ __name(async (input, context) => { + const b = (0, import_core5.requestBuilder)(input, context); + const headers = (0, import_smithy_client5.map)({}, isSerializableHeaderValue, { + [_xasbt]: input[_aT] + }); + b.bp("/logout"); + let body; + b.m("POST").h(headers).b(body); + return b.build(); + }, "se_LogoutCommand"); + var de_GetRoleCredentialsCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode !== 200 && output.statusCode >= 300) { + return de_CommandError(output, context); + } + const contents = (0, import_smithy_client5.map)({ + $metadata: deserializeMetadata(output) + }); + const data = (0, import_smithy_client5.expectNonNull)((0, import_smithy_client5.expectObject)(await (0, import_core22.parseJsonBody)(output.body, context)), "body"); + const doc = (0, import_smithy_client5.take)(data, { + roleCredentials: import_smithy_client5._json + }); + Object.assign(contents, doc); + return contents; + }, "de_GetRoleCredentialsCommand"); + var de_ListAccountRolesCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode !== 200 && output.statusCode >= 300) { + return de_CommandError(output, context); + } + const contents = (0, import_smithy_client5.map)({ + $metadata: deserializeMetadata(output) + }); + const data = (0, import_smithy_client5.expectNonNull)((0, import_smithy_client5.expectObject)(await (0, import_core22.parseJsonBody)(output.body, context)), "body"); + const doc = (0, import_smithy_client5.take)(data, { + nextToken: import_smithy_client5.expectString, + roleList: import_smithy_client5._json + }); + Object.assign(contents, doc); + return contents; + }, "de_ListAccountRolesCommand"); + var de_ListAccountsCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode !== 200 && output.statusCode >= 300) { + return de_CommandError(output, context); + } + const contents = (0, import_smithy_client5.map)({ + $metadata: deserializeMetadata(output) + }); + const data = (0, import_smithy_client5.expectNonNull)((0, import_smithy_client5.expectObject)(await (0, import_core22.parseJsonBody)(output.body, context)), "body"); + const doc = (0, import_smithy_client5.take)(data, { + accountList: import_smithy_client5._json, + nextToken: import_smithy_client5.expectString + }); + Object.assign(contents, doc); + return contents; + }, "de_ListAccountsCommand"); + var de_LogoutCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode !== 200 && output.statusCode >= 300) { + return de_CommandError(output, context); + } + const contents = (0, import_smithy_client5.map)({ + $metadata: deserializeMetadata(output) + }); + await (0, import_smithy_client5.collectBody)(output.body, context); + return contents; + }, "de_LogoutCommand"); + var de_CommandError = /* @__PURE__ */ __name(async (output, context) => { + const parsedOutput = { + ...output, + body: await (0, import_core22.parseJsonErrorBody)(output.body, context) + }; + const errorCode = (0, import_core22.loadRestJsonErrorCode)(output, parsedOutput.body); + switch (errorCode) { + case "InvalidRequestException": + case "com.amazonaws.sso#InvalidRequestException": + throw await de_InvalidRequestExceptionRes(parsedOutput, context); + case "ResourceNotFoundException": + case "com.amazonaws.sso#ResourceNotFoundException": + throw await de_ResourceNotFoundExceptionRes(parsedOutput, context); + case "TooManyRequestsException": + case "com.amazonaws.sso#TooManyRequestsException": + throw await de_TooManyRequestsExceptionRes(parsedOutput, context); + case "UnauthorizedException": + case "com.amazonaws.sso#UnauthorizedException": + throw await de_UnauthorizedExceptionRes(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody, + errorCode + }); + } + }, "de_CommandError"); + var throwDefaultError = (0, import_smithy_client5.withBaseException)(SSOServiceException); + var de_InvalidRequestExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const contents = (0, import_smithy_client5.map)({}); + const data = parsedOutput.body; + const doc = (0, import_smithy_client5.take)(data, { + message: import_smithy_client5.expectString + }); + Object.assign(contents, doc); + const exception = new InvalidRequestException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents + }); + return (0, import_smithy_client5.decorateServiceException)(exception, parsedOutput.body); + }, "de_InvalidRequestExceptionRes"); + var de_ResourceNotFoundExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const contents = (0, import_smithy_client5.map)({}); + const data = parsedOutput.body; + const doc = (0, import_smithy_client5.take)(data, { + message: import_smithy_client5.expectString + }); + Object.assign(contents, doc); + const exception = new ResourceNotFoundException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents + }); + return (0, import_smithy_client5.decorateServiceException)(exception, parsedOutput.body); + }, "de_ResourceNotFoundExceptionRes"); + var de_TooManyRequestsExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const contents = (0, import_smithy_client5.map)({}); + const data = parsedOutput.body; + const doc = (0, import_smithy_client5.take)(data, { + message: import_smithy_client5.expectString + }); + Object.assign(contents, doc); + const exception = new TooManyRequestsException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents + }); + return (0, import_smithy_client5.decorateServiceException)(exception, parsedOutput.body); + }, "de_TooManyRequestsExceptionRes"); + var de_UnauthorizedExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const contents = (0, import_smithy_client5.map)({}); + const data = parsedOutput.body; + const doc = (0, import_smithy_client5.take)(data, { + message: import_smithy_client5.expectString + }); + Object.assign(contents, doc); + const exception = new UnauthorizedException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents + }); + return (0, import_smithy_client5.decorateServiceException)(exception, parsedOutput.body); + }, "de_UnauthorizedExceptionRes"); + var deserializeMetadata = /* @__PURE__ */ __name((output) => ({ + httpStatusCode: output.statusCode, + requestId: output.headers["x-amzn-requestid"] ?? output.headers["x-amzn-request-id"] ?? output.headers["x-amz-request-id"], + extendedRequestId: output.headers["x-amz-id-2"], + cfId: output.headers["x-amz-cf-id"] + }), "deserializeMetadata"); + var isSerializableHeaderValue = /* @__PURE__ */ __name((value) => value !== void 0 && value !== null && value !== "" && (!Object.getOwnPropertyNames(value).includes("length") || value.length != 0) && (!Object.getOwnPropertyNames(value).includes("size") || value.size != 0), "isSerializableHeaderValue"); + var _aI = "accountId"; + var _aT = "accessToken"; + var _ai = "account_id"; + var _mR = "maxResults"; + var _mr = "max_result"; + var _nT = "nextToken"; + var _nt = "next_token"; + var _rN = "roleName"; + var _rn = "role_name"; + var _xasbt = "x-amz-sso_bearer_token"; + var _GetRoleCredentialsCommand = class _GetRoleCredentialsCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("SWBPortalService", "GetRoleCredentials", {}).n("SSOClient", "GetRoleCredentialsCommand").f(GetRoleCredentialsRequestFilterSensitiveLog, GetRoleCredentialsResponseFilterSensitiveLog).ser(se_GetRoleCredentialsCommand).de(de_GetRoleCredentialsCommand).build() { + }; + __name(_GetRoleCredentialsCommand, "GetRoleCredentialsCommand"); + var GetRoleCredentialsCommand = _GetRoleCredentialsCommand; + var _ListAccountRolesCommand = class _ListAccountRolesCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("SWBPortalService", "ListAccountRoles", {}).n("SSOClient", "ListAccountRolesCommand").f(ListAccountRolesRequestFilterSensitiveLog, void 0).ser(se_ListAccountRolesCommand).de(de_ListAccountRolesCommand).build() { + }; + __name(_ListAccountRolesCommand, "ListAccountRolesCommand"); + var ListAccountRolesCommand = _ListAccountRolesCommand; + var _ListAccountsCommand = class _ListAccountsCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("SWBPortalService", "ListAccounts", {}).n("SSOClient", "ListAccountsCommand").f(ListAccountsRequestFilterSensitiveLog, void 0).ser(se_ListAccountsCommand).de(de_ListAccountsCommand).build() { + }; + __name(_ListAccountsCommand, "ListAccountsCommand"); + var ListAccountsCommand = _ListAccountsCommand; + var _LogoutCommand = class _LogoutCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("SWBPortalService", "Logout", {}).n("SSOClient", "LogoutCommand").f(LogoutRequestFilterSensitiveLog, void 0).ser(se_LogoutCommand).de(de_LogoutCommand).build() { + }; + __name(_LogoutCommand, "LogoutCommand"); + var LogoutCommand = _LogoutCommand; + var commands = { + GetRoleCredentialsCommand, + ListAccountRolesCommand, + ListAccountsCommand, + LogoutCommand + }; + var _SSO = class _SSO extends SSOClient { + }; + __name(_SSO, "SSO"); + var SSO = _SSO; + (0, import_smithy_client5.createAggregatedClient)(commands, SSO); + var paginateListAccountRoles = (0, import_core5.createPaginator)(SSOClient, ListAccountRolesCommand, "nextToken", "nextToken", "maxResults"); + var paginateListAccounts = (0, import_core5.createPaginator)(SSOClient, ListAccountsCommand, "nextToken", "nextToken", "maxResults"); + } +}); + +// node_modules/@aws-sdk/client-sso-oidc/dist-cjs/auth/httpAuthSchemeProvider.js +var require_httpAuthSchemeProvider3 = __commonJS({ + "node_modules/@aws-sdk/client-sso-oidc/dist-cjs/auth/httpAuthSchemeProvider.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.resolveHttpAuthSchemeConfig = exports2.defaultSSOOIDCHttpAuthSchemeProvider = exports2.defaultSSOOIDCHttpAuthSchemeParametersProvider = void 0; + var core_1 = (init_dist_es2(), __toCommonJS(dist_es_exports2)); + var util_middleware_1 = require_dist_cjs10(); + var defaultSSOOIDCHttpAuthSchemeParametersProvider = async (config, context, input) => { + return { + operation: (0, util_middleware_1.getSmithyContext)(context).operation, + region: await (0, util_middleware_1.normalizeProvider)(config.region)() || (() => { + throw new Error("expected `region` to be configured for `aws.auth#sigv4`"); + })() + }; + }; + exports2.defaultSSOOIDCHttpAuthSchemeParametersProvider = defaultSSOOIDCHttpAuthSchemeParametersProvider; + function createAwsAuthSigv4HttpAuthOption(authParameters) { + return { + schemeId: "aws.auth#sigv4", + signingProperties: { + name: "sso-oauth", + region: authParameters.region + }, + propertiesExtractor: (config, context) => ({ + signingProperties: { + config, + context } - return { name, filename, contentType, encoding }; - } - let headerName = collectASequenceOfBytes( - (char) => char !== 10 && char !== 13 && char !== 58, - input, - position - ); - headerName = removeChars(headerName, true, true, (char) => char === 9 || char === 32); - if (!HTTP_TOKEN_CODEPOINTS.test(headerName.toString())) { - return "failure"; + }) + }; + } + function createSmithyApiNoAuthHttpAuthOption(authParameters) { + return { + schemeId: "smithy.api#noAuth" + }; + } + var defaultSSOOIDCHttpAuthSchemeProvider = (authParameters) => { + const options = []; + switch (authParameters.operation) { + case "CreateToken": { + options.push(createSmithyApiNoAuthHttpAuthOption(authParameters)); + break; } - if (input[position.position] !== 58) { - return "failure"; + case "RegisterClient": { + options.push(createSmithyApiNoAuthHttpAuthOption(authParameters)); + break; } - position.position++; - collectASequenceOfBytes( - (char) => char === 32 || char === 9, - input, - position - ); - switch (bufferToLowerCasedHeaderName(headerName)) { - case "content-disposition": { - name = filename = null; - if (!bufferStartsWith(input, formDataNameBuffer, position)) { - return "failure"; - } - position.position += 17; - name = parseMultipartFormDataName(input, position); - if (name === null) { - return "failure"; - } - if (bufferStartsWith(input, filenameBuffer, position)) { - let check = position.position + filenameBuffer.length; - if (input[check] === 42) { - position.position += 1; - check += 1; - } - if (input[check] !== 61 || input[check + 1] !== 34) { - return "failure"; - } - position.position += 12; - filename = parseMultipartFormDataName(input, position); - if (filename === null) { - return "failure"; - } - } - break; - } - case "content-type": { - let headerValue = collectASequenceOfBytes( - (char) => char !== 10 && char !== 13, - input, - position - ); - headerValue = removeChars(headerValue, false, true, (char) => char === 9 || char === 32); - contentType = isomorphicDecode(headerValue); - break; - } - case "content-transfer-encoding": { - let headerValue = collectASequenceOfBytes( - (char) => char !== 10 && char !== 13, - input, - position - ); - headerValue = removeChars(headerValue, false, true, (char) => char === 9 || char === 32); - encoding = isomorphicDecode(headerValue); - break; - } - default: { - collectASequenceOfBytes( - (char) => char !== 10 && char !== 13, - input, - position - ); - } + case "StartDeviceAuthorization": { + options.push(createSmithyApiNoAuthHttpAuthOption(authParameters)); + break; } - if (input[position.position] !== 13 && input[position.position + 1] !== 10) { - return "failure"; - } else { - position.position += 2; + default: { + options.push(createAwsAuthSigv4HttpAuthOption(authParameters)); } } - } - function parseMultipartFormDataName(input, position) { - assert(input[position.position - 1] === 34); - let name = collectASequenceOfBytes( - (char) => char !== 10 && char !== 13 && char !== 34, - input, - position - ); - if (input[position.position] !== 34) { - return null; - } else { - position.position++; - } - name = new TextDecoder().decode(name).replace(/%0A/ig, "\n").replace(/%0D/ig, "\r").replace(/%22/g, '"'); - return name; - } - function collectASequenceOfBytes(condition, input, position) { - let start = position.position; - while (start < input.length && condition(input[start])) { - ++start; - } - return input.subarray(position.position, position.position = start); - } - function removeChars(buf, leading, trailing, predicate) { - let lead = 0; - let trail = buf.length - 1; - if (leading) { - while (lead < buf.length && predicate(buf[lead])) lead++; - } - if (trailing) { - while (trail > 0 && predicate(buf[trail])) trail--; - } - return lead === 0 && trail === buf.length - 1 ? buf : buf.subarray(lead, trail + 1); - } - function bufferStartsWith(buffer, start, position) { - if (buffer.length < start.length) { - return false; - } - for (let i = 0; i < start.length; i++) { - if (start[i] !== buffer[position.position + i]) { - return false; + return options; + }; + exports2.defaultSSOOIDCHttpAuthSchemeProvider = defaultSSOOIDCHttpAuthSchemeProvider; + var resolveHttpAuthSchemeConfig = (config) => { + const config_0 = (0, core_1.resolveAwsSdkSigV4Config)(config); + return { + ...config_0 + }; + }; + exports2.resolveHttpAuthSchemeConfig = resolveHttpAuthSchemeConfig; + } +}); + +// node_modules/@aws-sdk/client-sso-oidc/package.json +var require_package3 = __commonJS({ + "node_modules/@aws-sdk/client-sso-oidc/package.json"(exports2, module2) { + module2.exports = { + name: "@aws-sdk/client-sso-oidc", + description: "AWS SDK for JavaScript Sso Oidc Client for Node.js, Browser and React Native", + version: "3.635.0", + scripts: { + build: "concurrently 'yarn:build:cjs' 'yarn:build:es' 'yarn:build:types'", + "build:cjs": "node ../../scripts/compilation/inline client-sso-oidc", + "build:es": "tsc -p tsconfig.es.json", + "build:include:deps": "lerna run --scope $npm_package_name --include-dependencies build", + "build:types": "tsc -p tsconfig.types.json", + "build:types:downlevel": "downlevel-dts dist-types dist-types/ts3.4", + clean: "rimraf ./dist-* && rimraf *.tsbuildinfo", + "extract:docs": "api-extractor run --local", + "generate:client": "node ../../scripts/generate-clients/single-service --solo sso-oidc" + }, + main: "./dist-cjs/index.js", + types: "./dist-types/index.d.ts", + module: "./dist-es/index.js", + sideEffects: false, + dependencies: { + "@aws-crypto/sha256-browser": "5.2.0", + "@aws-crypto/sha256-js": "5.2.0", + "@aws-sdk/core": "3.635.0", + "@aws-sdk/credential-provider-node": "3.635.0", + "@aws-sdk/middleware-host-header": "3.620.0", + "@aws-sdk/middleware-logger": "3.609.0", + "@aws-sdk/middleware-recursion-detection": "3.620.0", + "@aws-sdk/middleware-user-agent": "3.632.0", + "@aws-sdk/region-config-resolver": "3.614.0", + "@aws-sdk/types": "3.609.0", + "@aws-sdk/util-endpoints": "3.632.0", + "@aws-sdk/util-user-agent-browser": "3.609.0", + "@aws-sdk/util-user-agent-node": "3.614.0", + "@smithy/config-resolver": "^3.0.5", + "@smithy/core": "^2.4.0", + "@smithy/fetch-http-handler": "^3.2.4", + "@smithy/hash-node": "^3.0.3", + "@smithy/invalid-dependency": "^3.0.3", + "@smithy/middleware-content-length": "^3.0.5", + "@smithy/middleware-endpoint": "^3.1.0", + "@smithy/middleware-retry": "^3.0.15", + "@smithy/middleware-serde": "^3.0.3", + "@smithy/middleware-stack": "^3.0.3", + "@smithy/node-config-provider": "^3.1.4", + "@smithy/node-http-handler": "^3.1.4", + "@smithy/protocol-http": "^4.1.0", + "@smithy/smithy-client": "^3.2.0", + "@smithy/types": "^3.3.0", + "@smithy/url-parser": "^3.0.3", + "@smithy/util-base64": "^3.0.0", + "@smithy/util-body-length-browser": "^3.0.0", + "@smithy/util-body-length-node": "^3.0.0", + "@smithy/util-defaults-mode-browser": "^3.0.15", + "@smithy/util-defaults-mode-node": "^3.0.15", + "@smithy/util-endpoints": "^2.0.5", + "@smithy/util-middleware": "^3.0.3", + "@smithy/util-retry": "^3.0.3", + "@smithy/util-utf8": "^3.0.0", + tslib: "^2.6.2" + }, + devDependencies: { + "@tsconfig/node16": "16.1.3", + "@types/node": "^16.18.96", + concurrently: "7.0.0", + "downlevel-dts": "0.10.1", + rimraf: "3.0.2", + typescript: "~4.9.5" + }, + engines: { + node: ">=16.0.0" + }, + typesVersions: { + "<4.0": { + "dist-types/*": [ + "dist-types/ts3.4/*" + ] } + }, + files: [ + "dist-*/**" + ], + author: { + name: "AWS SDK for JavaScript Team", + url: "https://aws.amazon.com/javascript/" + }, + license: "Apache-2.0", + peerDependencies: { + "@aws-sdk/client-sts": "^3.635.0" + }, + browser: { + "./dist-es/runtimeConfig": "./dist-es/runtimeConfig.browser" + }, + "react-native": { + "./dist-es/runtimeConfig": "./dist-es/runtimeConfig.native" + }, + homepage: "https://github.com/aws/aws-sdk-js-v3/tree/main/clients/client-sso-oidc", + repository: { + type: "git", + url: "https://github.com/aws/aws-sdk-js-v3.git", + directory: "clients/client-sso-oidc" } - return true; - } - module2.exports = { - multipartFormDataParser, - validateBoundary }; } }); -// node_modules/undici/lib/web/fetch/body.js -var require_body2 = __commonJS({ - "node_modules/undici/lib/web/fetch/body.js"(exports2, module2) { +// node_modules/@aws-sdk/client-sso-oidc/dist-cjs/endpoint/ruleset.js +var require_ruleset2 = __commonJS({ + "node_modules/@aws-sdk/client-sso-oidc/dist-cjs/endpoint/ruleset.js"(exports2) { "use strict"; - var util = require_util8(); - var { - ReadableStreamFrom, - isBlobLike, - isReadableStreamLike, - readableStreamClose, - createDeferredPromise, - fullyReadBody, - extractMimeType, - utf8DecodeBytes - } = require_util9(); - var { FormData } = require_formdata2(); - var { kState } = require_symbols7(); - var { webidl } = require_webidl2(); - var { Blob: Blob2 } = require("node:buffer"); - var assert = require("node:assert"); - var { isErrored } = require_util8(); - var { isArrayBuffer } = require("node:util/types"); - var { serializeAMimeType } = require_data_url(); - var { multipartFormDataParser } = require_formdata_parser(); - var textEncoder = new TextEncoder(); - function extractBody(object, keepalive = false) { - let stream = null; - if (object instanceof ReadableStream) { - stream = object; - } else if (isBlobLike(object)) { - stream = object.stream(); - } else { - stream = new ReadableStream({ - async pull(controller) { - const buffer = typeof source === "string" ? textEncoder.encode(source) : source; - if (buffer.byteLength) { - controller.enqueue(buffer); - } - queueMicrotask(() => readableStreamClose(controller)); - }, - start() { + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.ruleSet = void 0; + var u = "required"; + var v = "fn"; + var w = "argv"; + var x = "ref"; + var a = true; + var b = "isSet"; + var c = "booleanEquals"; + var d = "error"; + var e = "endpoint"; + var f = "tree"; + var g = "PartitionResult"; + var h = "getAttr"; + var i = { [u]: false, "type": "String" }; + var j = { [u]: true, "default": false, "type": "Boolean" }; + var k = { [x]: "Endpoint" }; + var l = { [v]: c, [w]: [{ [x]: "UseFIPS" }, true] }; + var m = { [v]: c, [w]: [{ [x]: "UseDualStack" }, true] }; + var n = {}; + var o = { [v]: h, [w]: [{ [x]: g }, "supportsFIPS"] }; + var p = { [x]: g }; + var q = { [v]: c, [w]: [true, { [v]: h, [w]: [p, "supportsDualStack"] }] }; + var r = [l]; + var s = [m]; + var t = [{ [x]: "Region" }]; + var _data = { version: "1.0", parameters: { Region: i, UseDualStack: j, UseFIPS: j, Endpoint: i }, rules: [{ conditions: [{ [v]: b, [w]: [k] }], rules: [{ conditions: r, error: "Invalid Configuration: FIPS and custom endpoint are not supported", type: d }, { conditions: s, error: "Invalid Configuration: Dualstack and custom endpoint are not supported", type: d }, { endpoint: { url: k, properties: n, headers: n }, type: e }], type: f }, { conditions: [{ [v]: b, [w]: t }], rules: [{ conditions: [{ [v]: "aws.partition", [w]: t, assign: g }], rules: [{ conditions: [l, m], rules: [{ conditions: [{ [v]: c, [w]: [a, o] }, q], rules: [{ endpoint: { url: "https://oidc-fips.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: n, headers: n }, type: e }], type: f }, { error: "FIPS and DualStack are enabled, but this partition does not support one or both", type: d }], type: f }, { conditions: r, rules: [{ conditions: [{ [v]: c, [w]: [o, a] }], rules: [{ conditions: [{ [v]: "stringEquals", [w]: [{ [v]: h, [w]: [p, "name"] }, "aws-us-gov"] }], endpoint: { url: "https://oidc.{Region}.amazonaws.com", properties: n, headers: n }, type: e }, { endpoint: { url: "https://oidc-fips.{Region}.{PartitionResult#dnsSuffix}", properties: n, headers: n }, type: e }], type: f }, { error: "FIPS is enabled but this partition does not support FIPS", type: d }], type: f }, { conditions: s, rules: [{ conditions: [q], rules: [{ endpoint: { url: "https://oidc.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: n, headers: n }, type: e }], type: f }, { error: "DualStack is enabled but this partition does not support DualStack", type: d }], type: f }, { endpoint: { url: "https://oidc.{Region}.{PartitionResult#dnsSuffix}", properties: n, headers: n }, type: e }], type: f }], type: f }, { error: "Invalid Configuration: Missing Region", type: d }] }; + exports2.ruleSet = _data; + } +}); + +// node_modules/@aws-sdk/client-sso-oidc/dist-cjs/endpoint/endpointResolver.js +var require_endpointResolver2 = __commonJS({ + "node_modules/@aws-sdk/client-sso-oidc/dist-cjs/endpoint/endpointResolver.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.defaultEndpointResolver = void 0; + var util_endpoints_1 = require_dist_cjs7(); + var util_endpoints_2 = require_dist_cjs6(); + var ruleset_1 = require_ruleset2(); + var defaultEndpointResolver = (endpointParams, context = {}) => { + return (0, util_endpoints_2.resolveEndpoint)(ruleset_1.ruleSet, { + endpointParams, + logger: context.logger + }); + }; + exports2.defaultEndpointResolver = defaultEndpointResolver; + util_endpoints_2.customEndpointFunctions.aws = util_endpoints_1.awsEndpointFunctions; + } +}); + +// node_modules/@aws-sdk/client-sso-oidc/dist-cjs/runtimeConfig.shared.js +var require_runtimeConfig_shared2 = __commonJS({ + "node_modules/@aws-sdk/client-sso-oidc/dist-cjs/runtimeConfig.shared.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.getRuntimeConfig = void 0; + var core_1 = (init_dist_es2(), __toCommonJS(dist_es_exports2)); + var core_2 = (init_dist_es(), __toCommonJS(dist_es_exports)); + var smithy_client_1 = require_dist_cjs32(); + var url_parser_1 = require_dist_cjs16(); + var util_base64_1 = require_dist_cjs25(); + var util_utf8_1 = require_dist_cjs24(); + var httpAuthSchemeProvider_1 = require_httpAuthSchemeProvider3(); + var endpointResolver_1 = require_endpointResolver2(); + var getRuntimeConfig = (config) => { + return { + apiVersion: "2019-06-10", + base64Decoder: config?.base64Decoder ?? util_base64_1.fromBase64, + base64Encoder: config?.base64Encoder ?? util_base64_1.toBase64, + disableHostPrefix: config?.disableHostPrefix ?? false, + endpointProvider: config?.endpointProvider ?? endpointResolver_1.defaultEndpointResolver, + extensions: config?.extensions ?? [], + httpAuthSchemeProvider: config?.httpAuthSchemeProvider ?? httpAuthSchemeProvider_1.defaultSSOOIDCHttpAuthSchemeProvider, + httpAuthSchemes: config?.httpAuthSchemes ?? [ + { + schemeId: "aws.auth#sigv4", + identityProvider: (ipc) => ipc.getIdentityProvider("aws.auth#sigv4"), + signer: new core_1.AwsSdkSigV4Signer() }, - type: "bytes" + { + schemeId: "smithy.api#noAuth", + identityProvider: (ipc) => ipc.getIdentityProvider("smithy.api#noAuth") || (async () => ({})), + signer: new core_2.NoAuthSigner() + } + ], + logger: config?.logger ?? new smithy_client_1.NoOpLogger(), + serviceId: config?.serviceId ?? "SSO OIDC", + urlParser: config?.urlParser ?? url_parser_1.parseUrl, + utf8Decoder: config?.utf8Decoder ?? util_utf8_1.fromUtf8, + utf8Encoder: config?.utf8Encoder ?? util_utf8_1.toUtf8 + }; + }; + exports2.getRuntimeConfig = getRuntimeConfig; + } +}); + +// node_modules/@aws-sdk/client-sso-oidc/dist-cjs/runtimeConfig.js +var require_runtimeConfig2 = __commonJS({ + "node_modules/@aws-sdk/client-sso-oidc/dist-cjs/runtimeConfig.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.getRuntimeConfig = void 0; + var tslib_1 = (init_tslib_es6(), __toCommonJS(tslib_es6_exports)); + var package_json_1 = tslib_1.__importDefault(require_package3()); + var core_1 = (init_dist_es2(), __toCommonJS(dist_es_exports2)); + var credential_provider_node_1 = require_dist_cjs52(); + var util_user_agent_node_1 = require_dist_cjs39(); + var config_resolver_1 = require_dist_cjs11(); + var hash_node_1 = require_dist_cjs40(); + var middleware_retry_1 = require_dist_cjs33(); + var node_config_provider_1 = require_dist_cjs14(); + var node_http_handler_1 = require_dist_cjs28(); + var util_body_length_node_1 = require_dist_cjs41(); + var util_retry_1 = require_dist_cjs20(); + var runtimeConfig_shared_1 = require_runtimeConfig_shared2(); + var smithy_client_1 = require_dist_cjs32(); + var util_defaults_mode_node_1 = require_dist_cjs42(); + var smithy_client_2 = require_dist_cjs32(); + var getRuntimeConfig = (config) => { + (0, smithy_client_2.emitWarningIfUnsupportedVersion)(process.version); + const defaultsMode = (0, util_defaults_mode_node_1.resolveDefaultsModeConfig)(config); + const defaultConfigProvider = () => defaultsMode().then(smithy_client_1.loadConfigsForDefaultMode); + const clientSharedValues = (0, runtimeConfig_shared_1.getRuntimeConfig)(config); + (0, core_1.emitWarningIfUnsupportedVersion)(process.version); + return { + ...clientSharedValues, + ...config, + runtime: "node", + defaultsMode, + bodyLengthChecker: config?.bodyLengthChecker ?? util_body_length_node_1.calculateBodyLength, + credentialDefaultProvider: config?.credentialDefaultProvider ?? credential_provider_node_1.defaultProvider, + defaultUserAgentProvider: config?.defaultUserAgentProvider ?? (0, util_user_agent_node_1.defaultUserAgent)({ serviceId: clientSharedValues.serviceId, clientVersion: package_json_1.default.version }), + maxAttempts: config?.maxAttempts ?? (0, node_config_provider_1.loadConfig)(middleware_retry_1.NODE_MAX_ATTEMPT_CONFIG_OPTIONS), + region: config?.region ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_REGION_CONFIG_OPTIONS, config_resolver_1.NODE_REGION_CONFIG_FILE_OPTIONS), + requestHandler: node_http_handler_1.NodeHttpHandler.create(config?.requestHandler ?? defaultConfigProvider), + retryMode: config?.retryMode ?? (0, node_config_provider_1.loadConfig)({ + ...middleware_retry_1.NODE_RETRY_MODE_CONFIG_OPTIONS, + default: async () => (await defaultConfigProvider()).retryMode || util_retry_1.DEFAULT_RETRY_MODE + }), + sha256: config?.sha256 ?? hash_node_1.Hash.bind(null, "sha256"), + streamCollector: config?.streamCollector ?? node_http_handler_1.streamCollector, + useDualstackEndpoint: config?.useDualstackEndpoint ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS), + useFipsEndpoint: config?.useFipsEndpoint ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS) + }; + }; + exports2.getRuntimeConfig = getRuntimeConfig; + } +}); + +// node_modules/@aws-sdk/client-sso-oidc/dist-cjs/index.js +var require_dist_cjs45 = __commonJS({ + "node_modules/@aws-sdk/client-sso-oidc/dist-cjs/index.js"(exports2, module2) { + "use strict"; + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); + }; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + } + return to; + }; + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + AccessDeniedException: () => AccessDeniedException, + AuthorizationPendingException: () => AuthorizationPendingException, + CreateTokenCommand: () => CreateTokenCommand, + CreateTokenRequestFilterSensitiveLog: () => CreateTokenRequestFilterSensitiveLog, + CreateTokenResponseFilterSensitiveLog: () => CreateTokenResponseFilterSensitiveLog, + CreateTokenWithIAMCommand: () => CreateTokenWithIAMCommand, + CreateTokenWithIAMRequestFilterSensitiveLog: () => CreateTokenWithIAMRequestFilterSensitiveLog, + CreateTokenWithIAMResponseFilterSensitiveLog: () => CreateTokenWithIAMResponseFilterSensitiveLog, + ExpiredTokenException: () => ExpiredTokenException, + InternalServerException: () => InternalServerException, + InvalidClientException: () => InvalidClientException, + InvalidClientMetadataException: () => InvalidClientMetadataException, + InvalidGrantException: () => InvalidGrantException, + InvalidRedirectUriException: () => InvalidRedirectUriException, + InvalidRequestException: () => InvalidRequestException, + InvalidRequestRegionException: () => InvalidRequestRegionException, + InvalidScopeException: () => InvalidScopeException, + RegisterClientCommand: () => RegisterClientCommand, + RegisterClientResponseFilterSensitiveLog: () => RegisterClientResponseFilterSensitiveLog, + SSOOIDC: () => SSOOIDC, + SSOOIDCClient: () => SSOOIDCClient, + SSOOIDCServiceException: () => SSOOIDCServiceException, + SlowDownException: () => SlowDownException, + StartDeviceAuthorizationCommand: () => StartDeviceAuthorizationCommand, + StartDeviceAuthorizationRequestFilterSensitiveLog: () => StartDeviceAuthorizationRequestFilterSensitiveLog, + UnauthorizedClientException: () => UnauthorizedClientException, + UnsupportedGrantTypeException: () => UnsupportedGrantTypeException, + __Client: () => import_smithy_client5.Client + }); + module2.exports = __toCommonJS2(src_exports); + var import_middleware_host_header = require_dist_cjs3(); + var import_middleware_logger = require_dist_cjs4(); + var import_middleware_recursion_detection = require_dist_cjs5(); + var import_middleware_user_agent = require_dist_cjs8(); + var import_config_resolver = require_dist_cjs11(); + var import_core5 = (init_dist_es(), __toCommonJS(dist_es_exports)); + var import_middleware_content_length = require_dist_cjs34(); + var import_middleware_endpoint2 = require_dist_cjs18(); + var import_middleware_retry2 = require_dist_cjs33(); + var import_httpAuthSchemeProvider = require_httpAuthSchemeProvider3(); + var resolveClientEndpointParameters = /* @__PURE__ */ __name((options) => { + return { + ...options, + useDualstackEndpoint: options.useDualstackEndpoint ?? false, + useFipsEndpoint: options.useFipsEndpoint ?? false, + defaultSigningName: "sso-oauth" + }; + }, "resolveClientEndpointParameters"); + var commonParams = { + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" } + }; + var import_runtimeConfig = require_runtimeConfig2(); + var import_region_config_resolver = require_dist_cjs43(); + var import_protocol_http8 = require_dist_cjs2(); + var import_smithy_client5 = require_dist_cjs32(); + var getHttpAuthExtensionConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { + const _httpAuthSchemes = runtimeConfig.httpAuthSchemes; + let _httpAuthSchemeProvider = runtimeConfig.httpAuthSchemeProvider; + let _credentials = runtimeConfig.credentials; + return { + setHttpAuthScheme(httpAuthScheme) { + const index = _httpAuthSchemes.findIndex((scheme) => scheme.schemeId === httpAuthScheme.schemeId); + if (index === -1) { + _httpAuthSchemes.push(httpAuthScheme); + } else { + _httpAuthSchemes.splice(index, 1, httpAuthScheme); + } + }, + httpAuthSchemes() { + return _httpAuthSchemes; + }, + setHttpAuthSchemeProvider(httpAuthSchemeProvider) { + _httpAuthSchemeProvider = httpAuthSchemeProvider; + }, + httpAuthSchemeProvider() { + return _httpAuthSchemeProvider; + }, + setCredentials(credentials) { + _credentials = credentials; + }, + credentials() { + return _credentials; + } + }; + }, "getHttpAuthExtensionConfiguration"); + var resolveHttpAuthRuntimeConfig = /* @__PURE__ */ __name((config) => { + return { + httpAuthSchemes: config.httpAuthSchemes(), + httpAuthSchemeProvider: config.httpAuthSchemeProvider(), + credentials: config.credentials() + }; + }, "resolveHttpAuthRuntimeConfig"); + var asPartial = /* @__PURE__ */ __name((t) => t, "asPartial"); + var resolveRuntimeExtensions = /* @__PURE__ */ __name((runtimeConfig, extensions) => { + const extensionConfiguration = { + ...asPartial((0, import_region_config_resolver.getAwsRegionExtensionConfiguration)(runtimeConfig)), + ...asPartial((0, import_smithy_client5.getDefaultExtensionConfiguration)(runtimeConfig)), + ...asPartial((0, import_protocol_http8.getHttpHandlerExtensionConfiguration)(runtimeConfig)), + ...asPartial(getHttpAuthExtensionConfiguration(runtimeConfig)) + }; + extensions.forEach((extension) => extension.configure(extensionConfiguration)); + return { + ...runtimeConfig, + ...(0, import_region_config_resolver.resolveAwsRegionExtensionConfiguration)(extensionConfiguration), + ...(0, import_smithy_client5.resolveDefaultRuntimeConfig)(extensionConfiguration), + ...(0, import_protocol_http8.resolveHttpHandlerRuntimeConfig)(extensionConfiguration), + ...resolveHttpAuthRuntimeConfig(extensionConfiguration) + }; + }, "resolveRuntimeExtensions"); + var _SSOOIDCClient = class _SSOOIDCClient extends import_smithy_client5.Client { + constructor(...[configuration]) { + const _config_0 = (0, import_runtimeConfig.getRuntimeConfig)(configuration || {}); + const _config_1 = resolveClientEndpointParameters(_config_0); + const _config_2 = (0, import_middleware_user_agent.resolveUserAgentConfig)(_config_1); + const _config_3 = (0, import_middleware_retry2.resolveRetryConfig)(_config_2); + const _config_4 = (0, import_config_resolver.resolveRegionConfig)(_config_3); + const _config_5 = (0, import_middleware_host_header.resolveHostHeaderConfig)(_config_4); + const _config_6 = (0, import_middleware_endpoint2.resolveEndpointConfig)(_config_5); + const _config_7 = (0, import_httpAuthSchemeProvider.resolveHttpAuthSchemeConfig)(_config_6); + const _config_8 = resolveRuntimeExtensions(_config_7, (configuration == null ? void 0 : configuration.extensions) || []); + super(_config_8); + this.config = _config_8; + this.middlewareStack.use((0, import_middleware_user_agent.getUserAgentPlugin)(this.config)); + this.middlewareStack.use((0, import_middleware_retry2.getRetryPlugin)(this.config)); + this.middlewareStack.use((0, import_middleware_content_length.getContentLengthPlugin)(this.config)); + this.middlewareStack.use((0, import_middleware_host_header.getHostHeaderPlugin)(this.config)); + this.middlewareStack.use((0, import_middleware_logger.getLoggerPlugin)(this.config)); + this.middlewareStack.use((0, import_middleware_recursion_detection.getRecursionDetectionPlugin)(this.config)); + this.middlewareStack.use( + (0, import_core5.getHttpAuthSchemeEndpointRuleSetPlugin)(this.config, { + httpAuthSchemeParametersProvider: import_httpAuthSchemeProvider.defaultSSOOIDCHttpAuthSchemeParametersProvider, + identityProviderConfigProvider: async (config) => new import_core5.DefaultIdentityProviderConfig({ + "aws.auth#sigv4": config.credentials + }) + }) + ); + this.middlewareStack.use((0, import_core5.getHttpSigningPlugin)(this.config)); + } + /** + * Destroy underlying resources, like sockets. It's usually not necessary to do this. + * However in Node.js, it's best to explicitly shut down the client's agent when it is no longer needed. + * Otherwise, sockets might stay open for quite a long time before the server terminates them. + */ + destroy() { + super.destroy(); + } + }; + __name(_SSOOIDCClient, "SSOOIDCClient"); + var SSOOIDCClient = _SSOOIDCClient; + var import_middleware_serde2 = require_dist_cjs17(); + var _SSOOIDCServiceException = class _SSOOIDCServiceException2 extends import_smithy_client5.ServiceException { + /** + * @internal + */ + constructor(options) { + super(options); + Object.setPrototypeOf(this, _SSOOIDCServiceException2.prototype); + } + }; + __name(_SSOOIDCServiceException, "SSOOIDCServiceException"); + var SSOOIDCServiceException = _SSOOIDCServiceException; + var _AccessDeniedException = class _AccessDeniedException2 extends SSOOIDCServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "AccessDeniedException", + $fault: "client", + ...opts }); + this.name = "AccessDeniedException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _AccessDeniedException2.prototype); + this.error = opts.error; + this.error_description = opts.error_description; } - assert(isReadableStreamLike(stream)); - let action = null; - let source = null; - let length = null; - let type = null; - if (typeof object === "string") { - source = object; - type = "text/plain;charset=UTF-8"; - } else if (object instanceof URLSearchParams) { - source = object.toString(); - type = "application/x-www-form-urlencoded;charset=UTF-8"; - } else if (isArrayBuffer(object)) { - source = new Uint8Array(object.slice()); - } else if (ArrayBuffer.isView(object)) { - source = new Uint8Array(object.buffer.slice(object.byteOffset, object.byteOffset + object.byteLength)); - } else if (util.isFormDataLike(object)) { - const boundary = `----formdata-undici-0${`${Math.floor(Math.random() * 1e11)}`.padStart(11, "0")}`; - const prefix = `--${boundary}\r -Content-Disposition: form-data`; - const escape = (str) => str.replace(/\n/g, "%0A").replace(/\r/g, "%0D").replace(/"/g, "%22"); - const normalizeLinefeeds = (value) => value.replace(/\r?\n|\r/g, "\r\n"); - const blobParts = []; - const rn = new Uint8Array([13, 10]); - length = 0; - let hasUnknownSizeValue = false; - for (const [name, value] of object) { - if (typeof value === "string") { - const chunk2 = textEncoder.encode(prefix + `; name="${escape(normalizeLinefeeds(name))}"\r -\r -${normalizeLinefeeds(value)}\r -`); - blobParts.push(chunk2); - length += chunk2.byteLength; - } else { - const chunk2 = textEncoder.encode(`${prefix}; name="${escape(normalizeLinefeeds(name))}"` + (value.name ? `; filename="${escape(value.name)}"` : "") + `\r -Content-Type: ${value.type || "application/octet-stream"}\r -\r -`); - blobParts.push(chunk2, value, rn); - if (typeof value.size === "number") { - length += chunk2.byteLength + value.size + rn.byteLength; - } else { - hasUnknownSizeValue = true; - } - } + }; + __name(_AccessDeniedException, "AccessDeniedException"); + var AccessDeniedException = _AccessDeniedException; + var _AuthorizationPendingException = class _AuthorizationPendingException2 extends SSOOIDCServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "AuthorizationPendingException", + $fault: "client", + ...opts + }); + this.name = "AuthorizationPendingException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _AuthorizationPendingException2.prototype); + this.error = opts.error; + this.error_description = opts.error_description; + } + }; + __name(_AuthorizationPendingException, "AuthorizationPendingException"); + var AuthorizationPendingException = _AuthorizationPendingException; + var _ExpiredTokenException = class _ExpiredTokenException2 extends SSOOIDCServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "ExpiredTokenException", + $fault: "client", + ...opts + }); + this.name = "ExpiredTokenException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _ExpiredTokenException2.prototype); + this.error = opts.error; + this.error_description = opts.error_description; + } + }; + __name(_ExpiredTokenException, "ExpiredTokenException"); + var ExpiredTokenException = _ExpiredTokenException; + var _InternalServerException = class _InternalServerException2 extends SSOOIDCServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "InternalServerException", + $fault: "server", + ...opts + }); + this.name = "InternalServerException"; + this.$fault = "server"; + Object.setPrototypeOf(this, _InternalServerException2.prototype); + this.error = opts.error; + this.error_description = opts.error_description; + } + }; + __name(_InternalServerException, "InternalServerException"); + var InternalServerException = _InternalServerException; + var _InvalidClientException = class _InvalidClientException2 extends SSOOIDCServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "InvalidClientException", + $fault: "client", + ...opts + }); + this.name = "InvalidClientException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _InvalidClientException2.prototype); + this.error = opts.error; + this.error_description = opts.error_description; + } + }; + __name(_InvalidClientException, "InvalidClientException"); + var InvalidClientException = _InvalidClientException; + var _InvalidGrantException = class _InvalidGrantException2 extends SSOOIDCServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "InvalidGrantException", + $fault: "client", + ...opts + }); + this.name = "InvalidGrantException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _InvalidGrantException2.prototype); + this.error = opts.error; + this.error_description = opts.error_description; + } + }; + __name(_InvalidGrantException, "InvalidGrantException"); + var InvalidGrantException = _InvalidGrantException; + var _InvalidRequestException = class _InvalidRequestException2 extends SSOOIDCServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "InvalidRequestException", + $fault: "client", + ...opts + }); + this.name = "InvalidRequestException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _InvalidRequestException2.prototype); + this.error = opts.error; + this.error_description = opts.error_description; + } + }; + __name(_InvalidRequestException, "InvalidRequestException"); + var InvalidRequestException = _InvalidRequestException; + var _InvalidScopeException = class _InvalidScopeException2 extends SSOOIDCServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "InvalidScopeException", + $fault: "client", + ...opts + }); + this.name = "InvalidScopeException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _InvalidScopeException2.prototype); + this.error = opts.error; + this.error_description = opts.error_description; + } + }; + __name(_InvalidScopeException, "InvalidScopeException"); + var InvalidScopeException = _InvalidScopeException; + var _SlowDownException = class _SlowDownException2 extends SSOOIDCServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "SlowDownException", + $fault: "client", + ...opts + }); + this.name = "SlowDownException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _SlowDownException2.prototype); + this.error = opts.error; + this.error_description = opts.error_description; + } + }; + __name(_SlowDownException, "SlowDownException"); + var SlowDownException = _SlowDownException; + var _UnauthorizedClientException = class _UnauthorizedClientException2 extends SSOOIDCServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "UnauthorizedClientException", + $fault: "client", + ...opts + }); + this.name = "UnauthorizedClientException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _UnauthorizedClientException2.prototype); + this.error = opts.error; + this.error_description = opts.error_description; + } + }; + __name(_UnauthorizedClientException, "UnauthorizedClientException"); + var UnauthorizedClientException = _UnauthorizedClientException; + var _UnsupportedGrantTypeException = class _UnsupportedGrantTypeException2 extends SSOOIDCServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "UnsupportedGrantTypeException", + $fault: "client", + ...opts + }); + this.name = "UnsupportedGrantTypeException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _UnsupportedGrantTypeException2.prototype); + this.error = opts.error; + this.error_description = opts.error_description; + } + }; + __name(_UnsupportedGrantTypeException, "UnsupportedGrantTypeException"); + var UnsupportedGrantTypeException = _UnsupportedGrantTypeException; + var _InvalidRequestRegionException = class _InvalidRequestRegionException2 extends SSOOIDCServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "InvalidRequestRegionException", + $fault: "client", + ...opts + }); + this.name = "InvalidRequestRegionException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _InvalidRequestRegionException2.prototype); + this.error = opts.error; + this.error_description = opts.error_description; + this.endpoint = opts.endpoint; + this.region = opts.region; + } + }; + __name(_InvalidRequestRegionException, "InvalidRequestRegionException"); + var InvalidRequestRegionException = _InvalidRequestRegionException; + var _InvalidClientMetadataException = class _InvalidClientMetadataException2 extends SSOOIDCServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "InvalidClientMetadataException", + $fault: "client", + ...opts + }); + this.name = "InvalidClientMetadataException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _InvalidClientMetadataException2.prototype); + this.error = opts.error; + this.error_description = opts.error_description; + } + }; + __name(_InvalidClientMetadataException, "InvalidClientMetadataException"); + var InvalidClientMetadataException = _InvalidClientMetadataException; + var _InvalidRedirectUriException = class _InvalidRedirectUriException2 extends SSOOIDCServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "InvalidRedirectUriException", + $fault: "client", + ...opts + }); + this.name = "InvalidRedirectUriException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _InvalidRedirectUriException2.prototype); + this.error = opts.error; + this.error_description = opts.error_description; + } + }; + __name(_InvalidRedirectUriException, "InvalidRedirectUriException"); + var InvalidRedirectUriException = _InvalidRedirectUriException; + var CreateTokenRequestFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ + ...obj, + ...obj.clientSecret && { clientSecret: import_smithy_client5.SENSITIVE_STRING }, + ...obj.refreshToken && { refreshToken: import_smithy_client5.SENSITIVE_STRING }, + ...obj.codeVerifier && { codeVerifier: import_smithy_client5.SENSITIVE_STRING } + }), "CreateTokenRequestFilterSensitiveLog"); + var CreateTokenResponseFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ + ...obj, + ...obj.accessToken && { accessToken: import_smithy_client5.SENSITIVE_STRING }, + ...obj.refreshToken && { refreshToken: import_smithy_client5.SENSITIVE_STRING }, + ...obj.idToken && { idToken: import_smithy_client5.SENSITIVE_STRING } + }), "CreateTokenResponseFilterSensitiveLog"); + var CreateTokenWithIAMRequestFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ + ...obj, + ...obj.refreshToken && { refreshToken: import_smithy_client5.SENSITIVE_STRING }, + ...obj.assertion && { assertion: import_smithy_client5.SENSITIVE_STRING }, + ...obj.subjectToken && { subjectToken: import_smithy_client5.SENSITIVE_STRING }, + ...obj.codeVerifier && { codeVerifier: import_smithy_client5.SENSITIVE_STRING } + }), "CreateTokenWithIAMRequestFilterSensitiveLog"); + var CreateTokenWithIAMResponseFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ + ...obj, + ...obj.accessToken && { accessToken: import_smithy_client5.SENSITIVE_STRING }, + ...obj.refreshToken && { refreshToken: import_smithy_client5.SENSITIVE_STRING }, + ...obj.idToken && { idToken: import_smithy_client5.SENSITIVE_STRING } + }), "CreateTokenWithIAMResponseFilterSensitiveLog"); + var RegisterClientResponseFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ + ...obj, + ...obj.clientSecret && { clientSecret: import_smithy_client5.SENSITIVE_STRING } + }), "RegisterClientResponseFilterSensitiveLog"); + var StartDeviceAuthorizationRequestFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ + ...obj, + ...obj.clientSecret && { clientSecret: import_smithy_client5.SENSITIVE_STRING } + }), "StartDeviceAuthorizationRequestFilterSensitiveLog"); + var import_core22 = (init_dist_es2(), __toCommonJS(dist_es_exports2)); + var se_CreateTokenCommand = /* @__PURE__ */ __name(async (input, context) => { + const b = (0, import_core5.requestBuilder)(input, context); + const headers = { + "content-type": "application/json" + }; + b.bp("/token"); + let body; + body = JSON.stringify( + (0, import_smithy_client5.take)(input, { + clientId: [], + clientSecret: [], + code: [], + codeVerifier: [], + deviceCode: [], + grantType: [], + redirectUri: [], + refreshToken: [], + scope: (_) => (0, import_smithy_client5._json)(_) + }) + ); + b.m("POST").h(headers).b(body); + return b.build(); + }, "se_CreateTokenCommand"); + var se_CreateTokenWithIAMCommand = /* @__PURE__ */ __name(async (input, context) => { + const b = (0, import_core5.requestBuilder)(input, context); + const headers = { + "content-type": "application/json" + }; + b.bp("/token"); + const query = (0, import_smithy_client5.map)({ + [_ai]: [, "t"] + }); + let body; + body = JSON.stringify( + (0, import_smithy_client5.take)(input, { + assertion: [], + clientId: [], + code: [], + codeVerifier: [], + grantType: [], + redirectUri: [], + refreshToken: [], + requestedTokenType: [], + scope: (_) => (0, import_smithy_client5._json)(_), + subjectToken: [], + subjectTokenType: [] + }) + ); + b.m("POST").h(headers).q(query).b(body); + return b.build(); + }, "se_CreateTokenWithIAMCommand"); + var se_RegisterClientCommand = /* @__PURE__ */ __name(async (input, context) => { + const b = (0, import_core5.requestBuilder)(input, context); + const headers = { + "content-type": "application/json" + }; + b.bp("/client/register"); + let body; + body = JSON.stringify( + (0, import_smithy_client5.take)(input, { + clientName: [], + clientType: [], + entitledApplicationArn: [], + grantTypes: (_) => (0, import_smithy_client5._json)(_), + issuerUrl: [], + redirectUris: (_) => (0, import_smithy_client5._json)(_), + scopes: (_) => (0, import_smithy_client5._json)(_) + }) + ); + b.m("POST").h(headers).b(body); + return b.build(); + }, "se_RegisterClientCommand"); + var se_StartDeviceAuthorizationCommand = /* @__PURE__ */ __name(async (input, context) => { + const b = (0, import_core5.requestBuilder)(input, context); + const headers = { + "content-type": "application/json" + }; + b.bp("/device_authorization"); + let body; + body = JSON.stringify( + (0, import_smithy_client5.take)(input, { + clientId: [], + clientSecret: [], + startUrl: [] + }) + ); + b.m("POST").h(headers).b(body); + return b.build(); + }, "se_StartDeviceAuthorizationCommand"); + var de_CreateTokenCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode !== 200 && output.statusCode >= 300) { + return de_CommandError(output, context); + } + const contents = (0, import_smithy_client5.map)({ + $metadata: deserializeMetadata(output) + }); + const data = (0, import_smithy_client5.expectNonNull)((0, import_smithy_client5.expectObject)(await (0, import_core22.parseJsonBody)(output.body, context)), "body"); + const doc = (0, import_smithy_client5.take)(data, { + accessToken: import_smithy_client5.expectString, + expiresIn: import_smithy_client5.expectInt32, + idToken: import_smithy_client5.expectString, + refreshToken: import_smithy_client5.expectString, + tokenType: import_smithy_client5.expectString + }); + Object.assign(contents, doc); + return contents; + }, "de_CreateTokenCommand"); + var de_CreateTokenWithIAMCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode !== 200 && output.statusCode >= 300) { + return de_CommandError(output, context); + } + const contents = (0, import_smithy_client5.map)({ + $metadata: deserializeMetadata(output) + }); + const data = (0, import_smithy_client5.expectNonNull)((0, import_smithy_client5.expectObject)(await (0, import_core22.parseJsonBody)(output.body, context)), "body"); + const doc = (0, import_smithy_client5.take)(data, { + accessToken: import_smithy_client5.expectString, + expiresIn: import_smithy_client5.expectInt32, + idToken: import_smithy_client5.expectString, + issuedTokenType: import_smithy_client5.expectString, + refreshToken: import_smithy_client5.expectString, + scope: import_smithy_client5._json, + tokenType: import_smithy_client5.expectString + }); + Object.assign(contents, doc); + return contents; + }, "de_CreateTokenWithIAMCommand"); + var de_RegisterClientCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode !== 200 && output.statusCode >= 300) { + return de_CommandError(output, context); + } + const contents = (0, import_smithy_client5.map)({ + $metadata: deserializeMetadata(output) + }); + const data = (0, import_smithy_client5.expectNonNull)((0, import_smithy_client5.expectObject)(await (0, import_core22.parseJsonBody)(output.body, context)), "body"); + const doc = (0, import_smithy_client5.take)(data, { + authorizationEndpoint: import_smithy_client5.expectString, + clientId: import_smithy_client5.expectString, + clientIdIssuedAt: import_smithy_client5.expectLong, + clientSecret: import_smithy_client5.expectString, + clientSecretExpiresAt: import_smithy_client5.expectLong, + tokenEndpoint: import_smithy_client5.expectString + }); + Object.assign(contents, doc); + return contents; + }, "de_RegisterClientCommand"); + var de_StartDeviceAuthorizationCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode !== 200 && output.statusCode >= 300) { + return de_CommandError(output, context); + } + const contents = (0, import_smithy_client5.map)({ + $metadata: deserializeMetadata(output) + }); + const data = (0, import_smithy_client5.expectNonNull)((0, import_smithy_client5.expectObject)(await (0, import_core22.parseJsonBody)(output.body, context)), "body"); + const doc = (0, import_smithy_client5.take)(data, { + deviceCode: import_smithy_client5.expectString, + expiresIn: import_smithy_client5.expectInt32, + interval: import_smithy_client5.expectInt32, + userCode: import_smithy_client5.expectString, + verificationUri: import_smithy_client5.expectString, + verificationUriComplete: import_smithy_client5.expectString + }); + Object.assign(contents, doc); + return contents; + }, "de_StartDeviceAuthorizationCommand"); + var de_CommandError = /* @__PURE__ */ __name(async (output, context) => { + const parsedOutput = { + ...output, + body: await (0, import_core22.parseJsonErrorBody)(output.body, context) + }; + const errorCode = (0, import_core22.loadRestJsonErrorCode)(output, parsedOutput.body); + switch (errorCode) { + case "AccessDeniedException": + case "com.amazonaws.ssooidc#AccessDeniedException": + throw await de_AccessDeniedExceptionRes(parsedOutput, context); + case "AuthorizationPendingException": + case "com.amazonaws.ssooidc#AuthorizationPendingException": + throw await de_AuthorizationPendingExceptionRes(parsedOutput, context); + case "ExpiredTokenException": + case "com.amazonaws.ssooidc#ExpiredTokenException": + throw await de_ExpiredTokenExceptionRes(parsedOutput, context); + case "InternalServerException": + case "com.amazonaws.ssooidc#InternalServerException": + throw await de_InternalServerExceptionRes(parsedOutput, context); + case "InvalidClientException": + case "com.amazonaws.ssooidc#InvalidClientException": + throw await de_InvalidClientExceptionRes(parsedOutput, context); + case "InvalidGrantException": + case "com.amazonaws.ssooidc#InvalidGrantException": + throw await de_InvalidGrantExceptionRes(parsedOutput, context); + case "InvalidRequestException": + case "com.amazonaws.ssooidc#InvalidRequestException": + throw await de_InvalidRequestExceptionRes(parsedOutput, context); + case "InvalidScopeException": + case "com.amazonaws.ssooidc#InvalidScopeException": + throw await de_InvalidScopeExceptionRes(parsedOutput, context); + case "SlowDownException": + case "com.amazonaws.ssooidc#SlowDownException": + throw await de_SlowDownExceptionRes(parsedOutput, context); + case "UnauthorizedClientException": + case "com.amazonaws.ssooidc#UnauthorizedClientException": + throw await de_UnauthorizedClientExceptionRes(parsedOutput, context); + case "UnsupportedGrantTypeException": + case "com.amazonaws.ssooidc#UnsupportedGrantTypeException": + throw await de_UnsupportedGrantTypeExceptionRes(parsedOutput, context); + case "InvalidRequestRegionException": + case "com.amazonaws.ssooidc#InvalidRequestRegionException": + throw await de_InvalidRequestRegionExceptionRes(parsedOutput, context); + case "InvalidClientMetadataException": + case "com.amazonaws.ssooidc#InvalidClientMetadataException": + throw await de_InvalidClientMetadataExceptionRes(parsedOutput, context); + case "InvalidRedirectUriException": + case "com.amazonaws.ssooidc#InvalidRedirectUriException": + throw await de_InvalidRedirectUriExceptionRes(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody, + errorCode + }); + } + }, "de_CommandError"); + var throwDefaultError = (0, import_smithy_client5.withBaseException)(SSOOIDCServiceException); + var de_AccessDeniedExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const contents = (0, import_smithy_client5.map)({}); + const data = parsedOutput.body; + const doc = (0, import_smithy_client5.take)(data, { + error: import_smithy_client5.expectString, + error_description: import_smithy_client5.expectString + }); + Object.assign(contents, doc); + const exception = new AccessDeniedException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents + }); + return (0, import_smithy_client5.decorateServiceException)(exception, parsedOutput.body); + }, "de_AccessDeniedExceptionRes"); + var de_AuthorizationPendingExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const contents = (0, import_smithy_client5.map)({}); + const data = parsedOutput.body; + const doc = (0, import_smithy_client5.take)(data, { + error: import_smithy_client5.expectString, + error_description: import_smithy_client5.expectString + }); + Object.assign(contents, doc); + const exception = new AuthorizationPendingException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents + }); + return (0, import_smithy_client5.decorateServiceException)(exception, parsedOutput.body); + }, "de_AuthorizationPendingExceptionRes"); + var de_ExpiredTokenExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const contents = (0, import_smithy_client5.map)({}); + const data = parsedOutput.body; + const doc = (0, import_smithy_client5.take)(data, { + error: import_smithy_client5.expectString, + error_description: import_smithy_client5.expectString + }); + Object.assign(contents, doc); + const exception = new ExpiredTokenException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents + }); + return (0, import_smithy_client5.decorateServiceException)(exception, parsedOutput.body); + }, "de_ExpiredTokenExceptionRes"); + var de_InternalServerExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const contents = (0, import_smithy_client5.map)({}); + const data = parsedOutput.body; + const doc = (0, import_smithy_client5.take)(data, { + error: import_smithy_client5.expectString, + error_description: import_smithy_client5.expectString + }); + Object.assign(contents, doc); + const exception = new InternalServerException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents + }); + return (0, import_smithy_client5.decorateServiceException)(exception, parsedOutput.body); + }, "de_InternalServerExceptionRes"); + var de_InvalidClientExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const contents = (0, import_smithy_client5.map)({}); + const data = parsedOutput.body; + const doc = (0, import_smithy_client5.take)(data, { + error: import_smithy_client5.expectString, + error_description: import_smithy_client5.expectString + }); + Object.assign(contents, doc); + const exception = new InvalidClientException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents + }); + return (0, import_smithy_client5.decorateServiceException)(exception, parsedOutput.body); + }, "de_InvalidClientExceptionRes"); + var de_InvalidClientMetadataExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const contents = (0, import_smithy_client5.map)({}); + const data = parsedOutput.body; + const doc = (0, import_smithy_client5.take)(data, { + error: import_smithy_client5.expectString, + error_description: import_smithy_client5.expectString + }); + Object.assign(contents, doc); + const exception = new InvalidClientMetadataException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents + }); + return (0, import_smithy_client5.decorateServiceException)(exception, parsedOutput.body); + }, "de_InvalidClientMetadataExceptionRes"); + var de_InvalidGrantExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const contents = (0, import_smithy_client5.map)({}); + const data = parsedOutput.body; + const doc = (0, import_smithy_client5.take)(data, { + error: import_smithy_client5.expectString, + error_description: import_smithy_client5.expectString + }); + Object.assign(contents, doc); + const exception = new InvalidGrantException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents + }); + return (0, import_smithy_client5.decorateServiceException)(exception, parsedOutput.body); + }, "de_InvalidGrantExceptionRes"); + var de_InvalidRedirectUriExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const contents = (0, import_smithy_client5.map)({}); + const data = parsedOutput.body; + const doc = (0, import_smithy_client5.take)(data, { + error: import_smithy_client5.expectString, + error_description: import_smithy_client5.expectString + }); + Object.assign(contents, doc); + const exception = new InvalidRedirectUriException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents + }); + return (0, import_smithy_client5.decorateServiceException)(exception, parsedOutput.body); + }, "de_InvalidRedirectUriExceptionRes"); + var de_InvalidRequestExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const contents = (0, import_smithy_client5.map)({}); + const data = parsedOutput.body; + const doc = (0, import_smithy_client5.take)(data, { + error: import_smithy_client5.expectString, + error_description: import_smithy_client5.expectString + }); + Object.assign(contents, doc); + const exception = new InvalidRequestException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents + }); + return (0, import_smithy_client5.decorateServiceException)(exception, parsedOutput.body); + }, "de_InvalidRequestExceptionRes"); + var de_InvalidRequestRegionExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const contents = (0, import_smithy_client5.map)({}); + const data = parsedOutput.body; + const doc = (0, import_smithy_client5.take)(data, { + endpoint: import_smithy_client5.expectString, + error: import_smithy_client5.expectString, + error_description: import_smithy_client5.expectString, + region: import_smithy_client5.expectString + }); + Object.assign(contents, doc); + const exception = new InvalidRequestRegionException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents + }); + return (0, import_smithy_client5.decorateServiceException)(exception, parsedOutput.body); + }, "de_InvalidRequestRegionExceptionRes"); + var de_InvalidScopeExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const contents = (0, import_smithy_client5.map)({}); + const data = parsedOutput.body; + const doc = (0, import_smithy_client5.take)(data, { + error: import_smithy_client5.expectString, + error_description: import_smithy_client5.expectString + }); + Object.assign(contents, doc); + const exception = new InvalidScopeException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents + }); + return (0, import_smithy_client5.decorateServiceException)(exception, parsedOutput.body); + }, "de_InvalidScopeExceptionRes"); + var de_SlowDownExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const contents = (0, import_smithy_client5.map)({}); + const data = parsedOutput.body; + const doc = (0, import_smithy_client5.take)(data, { + error: import_smithy_client5.expectString, + error_description: import_smithy_client5.expectString + }); + Object.assign(contents, doc); + const exception = new SlowDownException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents + }); + return (0, import_smithy_client5.decorateServiceException)(exception, parsedOutput.body); + }, "de_SlowDownExceptionRes"); + var de_UnauthorizedClientExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const contents = (0, import_smithy_client5.map)({}); + const data = parsedOutput.body; + const doc = (0, import_smithy_client5.take)(data, { + error: import_smithy_client5.expectString, + error_description: import_smithy_client5.expectString + }); + Object.assign(contents, doc); + const exception = new UnauthorizedClientException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents + }); + return (0, import_smithy_client5.decorateServiceException)(exception, parsedOutput.body); + }, "de_UnauthorizedClientExceptionRes"); + var de_UnsupportedGrantTypeExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const contents = (0, import_smithy_client5.map)({}); + const data = parsedOutput.body; + const doc = (0, import_smithy_client5.take)(data, { + error: import_smithy_client5.expectString, + error_description: import_smithy_client5.expectString + }); + Object.assign(contents, doc); + const exception = new UnsupportedGrantTypeException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents + }); + return (0, import_smithy_client5.decorateServiceException)(exception, parsedOutput.body); + }, "de_UnsupportedGrantTypeExceptionRes"); + var deserializeMetadata = /* @__PURE__ */ __name((output) => ({ + httpStatusCode: output.statusCode, + requestId: output.headers["x-amzn-requestid"] ?? output.headers["x-amzn-request-id"] ?? output.headers["x-amz-request-id"], + extendedRequestId: output.headers["x-amz-id-2"], + cfId: output.headers["x-amz-cf-id"] + }), "deserializeMetadata"); + var _ai = "aws_iam"; + var _CreateTokenCommand = class _CreateTokenCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("AWSSSOOIDCService", "CreateToken", {}).n("SSOOIDCClient", "CreateTokenCommand").f(CreateTokenRequestFilterSensitiveLog, CreateTokenResponseFilterSensitiveLog).ser(se_CreateTokenCommand).de(de_CreateTokenCommand).build() { + }; + __name(_CreateTokenCommand, "CreateTokenCommand"); + var CreateTokenCommand = _CreateTokenCommand; + var _CreateTokenWithIAMCommand = class _CreateTokenWithIAMCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("AWSSSOOIDCService", "CreateTokenWithIAM", {}).n("SSOOIDCClient", "CreateTokenWithIAMCommand").f(CreateTokenWithIAMRequestFilterSensitiveLog, CreateTokenWithIAMResponseFilterSensitiveLog).ser(se_CreateTokenWithIAMCommand).de(de_CreateTokenWithIAMCommand).build() { + }; + __name(_CreateTokenWithIAMCommand, "CreateTokenWithIAMCommand"); + var CreateTokenWithIAMCommand = _CreateTokenWithIAMCommand; + var _RegisterClientCommand = class _RegisterClientCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("AWSSSOOIDCService", "RegisterClient", {}).n("SSOOIDCClient", "RegisterClientCommand").f(void 0, RegisterClientResponseFilterSensitiveLog).ser(se_RegisterClientCommand).de(de_RegisterClientCommand).build() { + }; + __name(_RegisterClientCommand, "RegisterClientCommand"); + var RegisterClientCommand = _RegisterClientCommand; + var _StartDeviceAuthorizationCommand = class _StartDeviceAuthorizationCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("AWSSSOOIDCService", "StartDeviceAuthorization", {}).n("SSOOIDCClient", "StartDeviceAuthorizationCommand").f(StartDeviceAuthorizationRequestFilterSensitiveLog, void 0).ser(se_StartDeviceAuthorizationCommand).de(de_StartDeviceAuthorizationCommand).build() { + }; + __name(_StartDeviceAuthorizationCommand, "StartDeviceAuthorizationCommand"); + var StartDeviceAuthorizationCommand = _StartDeviceAuthorizationCommand; + var commands = { + CreateTokenCommand, + CreateTokenWithIAMCommand, + RegisterClientCommand, + StartDeviceAuthorizationCommand + }; + var _SSOOIDC = class _SSOOIDC extends SSOOIDCClient { + }; + __name(_SSOOIDC, "SSOOIDC"); + var SSOOIDC = _SSOOIDC; + (0, import_smithy_client5.createAggregatedClient)(commands, SSOOIDC); + } +}); + +// node_modules/@aws-sdk/token-providers/dist-cjs/index.js +var require_dist_cjs46 = __commonJS({ + "node_modules/@aws-sdk/token-providers/dist-cjs/index.js"(exports2, module2) { + "use strict"; + var __create2 = Object.create; + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __getProtoOf2 = Object.getPrototypeOf; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); + }; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + } + return to; + }; + var __toESM2 = (mod, isNodeMode, target) => (target = mod != null ? __create2(__getProtoOf2(mod)) : {}, __copyProps2( + // If the importer is in node compatibility mode or this is not an ESM + // file that has been converted to a CommonJS file using a Babel- + // compatible transform (i.e. "__esModule" has not been set), then set + // "default" to the CommonJS "module.exports" for node compatibility. + isNodeMode || !mod || !mod.__esModule ? __defProp2(target, "default", { value: mod, enumerable: true }) : target, + mod + )); + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + fromSso: () => fromSso, + fromStatic: () => fromStatic, + nodeProvider: () => nodeProvider + }); + module2.exports = __toCommonJS2(src_exports); + var EXPIRE_WINDOW_MS = 5 * 60 * 1e3; + var REFRESH_MESSAGE = `To refresh this SSO session run 'aws sso login' with the corresponding profile.`; + var ssoOidcClientsHash = {}; + var getSsoOidcClient = /* @__PURE__ */ __name(async (ssoRegion) => { + const { SSOOIDCClient } = await Promise.resolve().then(() => __toESM2(require_dist_cjs45())); + if (ssoOidcClientsHash[ssoRegion]) { + return ssoOidcClientsHash[ssoRegion]; + } + const ssoOidcClient = new SSOOIDCClient({ region: ssoRegion }); + ssoOidcClientsHash[ssoRegion] = ssoOidcClient; + return ssoOidcClient; + }, "getSsoOidcClient"); + var getNewSsoOidcToken = /* @__PURE__ */ __name(async (ssoToken, ssoRegion) => { + const { CreateTokenCommand } = await Promise.resolve().then(() => __toESM2(require_dist_cjs45())); + const ssoOidcClient = await getSsoOidcClient(ssoRegion); + return ssoOidcClient.send( + new CreateTokenCommand({ + clientId: ssoToken.clientId, + clientSecret: ssoToken.clientSecret, + refreshToken: ssoToken.refreshToken, + grantType: "refresh_token" + }) + ); + }, "getNewSsoOidcToken"); + var import_property_provider2 = require_dist_cjs12(); + var validateTokenExpiry = /* @__PURE__ */ __name((token) => { + if (token.expiration && token.expiration.getTime() < Date.now()) { + throw new import_property_provider2.TokenProviderError(`Token is expired. ${REFRESH_MESSAGE}`, false); + } + }, "validateTokenExpiry"); + var validateTokenKey = /* @__PURE__ */ __name((key, value, forRefresh = false) => { + if (typeof value === "undefined") { + throw new import_property_provider2.TokenProviderError( + `Value not present for '${key}' in SSO Token${forRefresh ? ". Cannot refresh" : ""}. ${REFRESH_MESSAGE}`, + false + ); + } + }, "validateTokenKey"); + var import_shared_ini_file_loader = require_dist_cjs13(); + var import_fs = require("fs"); + var { writeFile } = import_fs.promises; + var writeSSOTokenToFile = /* @__PURE__ */ __name((id, ssoToken) => { + const tokenFilepath = (0, import_shared_ini_file_loader.getSSOTokenFilepath)(id); + const tokenString = JSON.stringify(ssoToken, null, 2); + return writeFile(tokenFilepath, tokenString); + }, "writeSSOTokenToFile"); + var lastRefreshAttemptTime = /* @__PURE__ */ new Date(0); + var fromSso = /* @__PURE__ */ __name((init = {}) => async () => { + var _a; + (_a = init.logger) == null ? void 0 : _a.debug("@aws-sdk/token-providers - fromSso"); + const profiles = await (0, import_shared_ini_file_loader.parseKnownFiles)(init); + const profileName = (0, import_shared_ini_file_loader.getProfileName)(init); + const profile = profiles[profileName]; + if (!profile) { + throw new import_property_provider2.TokenProviderError(`Profile '${profileName}' could not be found in shared credentials file.`, false); + } else if (!profile["sso_session"]) { + throw new import_property_provider2.TokenProviderError(`Profile '${profileName}' is missing required property 'sso_session'.`); + } + const ssoSessionName = profile["sso_session"]; + const ssoSessions = await (0, import_shared_ini_file_loader.loadSsoSessionData)(init); + const ssoSession = ssoSessions[ssoSessionName]; + if (!ssoSession) { + throw new import_property_provider2.TokenProviderError( + `Sso session '${ssoSessionName}' could not be found in shared credentials file.`, + false + ); + } + for (const ssoSessionRequiredKey of ["sso_start_url", "sso_region"]) { + if (!ssoSession[ssoSessionRequiredKey]) { + throw new import_property_provider2.TokenProviderError( + `Sso session '${ssoSessionName}' is missing required property '${ssoSessionRequiredKey}'.`, + false + ); } - const chunk = textEncoder.encode(`--${boundary}--`); - blobParts.push(chunk); - length += chunk.byteLength; - if (hasUnknownSizeValue) { - length = null; + } + const ssoStartUrl = ssoSession["sso_start_url"]; + const ssoRegion = ssoSession["sso_region"]; + let ssoToken; + try { + ssoToken = await (0, import_shared_ini_file_loader.getSSOTokenFromFile)(ssoSessionName); + } catch (e) { + throw new import_property_provider2.TokenProviderError( + `The SSO session token associated with profile=${profileName} was not found or is invalid. ${REFRESH_MESSAGE}`, + false + ); + } + validateTokenKey("accessToken", ssoToken.accessToken); + validateTokenKey("expiresAt", ssoToken.expiresAt); + const { accessToken, expiresAt } = ssoToken; + const existingToken = { token: accessToken, expiration: new Date(expiresAt) }; + if (existingToken.expiration.getTime() - Date.now() > EXPIRE_WINDOW_MS) { + return existingToken; + } + if (Date.now() - lastRefreshAttemptTime.getTime() < 30 * 1e3) { + validateTokenExpiry(existingToken); + return existingToken; + } + validateTokenKey("clientId", ssoToken.clientId, true); + validateTokenKey("clientSecret", ssoToken.clientSecret, true); + validateTokenKey("refreshToken", ssoToken.refreshToken, true); + try { + lastRefreshAttemptTime.setTime(Date.now()); + const newSsoOidcToken = await getNewSsoOidcToken(ssoToken, ssoRegion); + validateTokenKey("accessToken", newSsoOidcToken.accessToken); + validateTokenKey("expiresIn", newSsoOidcToken.expiresIn); + const newTokenExpiration = new Date(Date.now() + newSsoOidcToken.expiresIn * 1e3); + try { + await writeSSOTokenToFile(ssoSessionName, { + ...ssoToken, + accessToken: newSsoOidcToken.accessToken, + expiresAt: newTokenExpiration.toISOString(), + refreshToken: newSsoOidcToken.refreshToken + }); + } catch (error) { } - source = object; - action = async function* () { - for (const part of blobParts) { - if (part.stream) { - yield* part.stream(); - } else { - yield part; - } - } + return { + token: newSsoOidcToken.accessToken, + expiration: newTokenExpiration }; - type = `multipart/form-data; boundary=${boundary}`; - } else if (isBlobLike(object)) { - source = object; - length = object.size; - if (object.type) { - type = object.type; - } - } else if (typeof object[Symbol.asyncIterator] === "function") { - if (keepalive) { - throw new TypeError("keepalive"); + } catch (error) { + validateTokenExpiry(existingToken); + return existingToken; + } + }, "fromSso"); + var fromStatic = /* @__PURE__ */ __name(({ token, logger }) => async () => { + logger == null ? void 0 : logger.debug("@aws-sdk/token-providers - fromStatic"); + if (!token || !token.token) { + throw new import_property_provider2.TokenProviderError(`Please pass a valid token to fromStatic`, false); + } + return token; + }, "fromStatic"); + var nodeProvider = /* @__PURE__ */ __name((init = {}) => (0, import_property_provider2.memoize)( + (0, import_property_provider2.chain)(fromSso(init), async () => { + throw new import_property_provider2.TokenProviderError("Could not load token from any providers", false); + }), + (token) => token.expiration !== void 0 && token.expiration.getTime() - Date.now() < 3e5, + (token) => token.expiration !== void 0 + ), "nodeProvider"); + } +}); + +// node_modules/@aws-sdk/credential-provider-sso/dist-cjs/index.js +var require_dist_cjs47 = __commonJS({ + "node_modules/@aws-sdk/credential-provider-sso/dist-cjs/index.js"(exports2, module2) { + "use strict"; + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __esm2 = (fn, res) => function __init() { + return fn && (res = (0, fn[__getOwnPropNames2(fn)[0]])(fn = 0)), res; + }; + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); + }; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + } + return to; + }; + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var loadSso_exports = {}; + __export2(loadSso_exports, { + GetRoleCredentialsCommand: () => import_client_sso.GetRoleCredentialsCommand, + SSOClient: () => import_client_sso.SSOClient + }); + var import_client_sso; + var init_loadSso = __esm2({ + "src/loadSso.ts"() { + "use strict"; + import_client_sso = require_dist_cjs44(); + } + }); + var src_exports = {}; + __export2(src_exports, { + fromSSO: () => fromSSO, + isSsoProfile: () => isSsoProfile, + validateSsoProfile: () => validateSsoProfile + }); + module2.exports = __toCommonJS2(src_exports); + var isSsoProfile = /* @__PURE__ */ __name((arg) => arg && (typeof arg.sso_start_url === "string" || typeof arg.sso_account_id === "string" || typeof arg.sso_session === "string" || typeof arg.sso_region === "string" || typeof arg.sso_role_name === "string"), "isSsoProfile"); + var import_token_providers = require_dist_cjs46(); + var import_property_provider2 = require_dist_cjs12(); + var import_shared_ini_file_loader = require_dist_cjs13(); + var SHOULD_FAIL_CREDENTIAL_CHAIN = false; + var resolveSSOCredentials = /* @__PURE__ */ __name(async ({ + ssoStartUrl, + ssoSession, + ssoAccountId, + ssoRegion, + ssoRoleName, + ssoClient, + clientConfig, + profile, + logger + }) => { + let token; + const refreshMessage = `To refresh this SSO session run aws sso login with the corresponding profile.`; + if (ssoSession) { + try { + const _token = await (0, import_token_providers.fromSso)({ profile })(); + token = { + accessToken: _token.token, + expiresAt: new Date(_token.expiration).toISOString() + }; + } catch (e) { + throw new import_property_provider2.CredentialsProviderError(e.message, { + tryNextLink: SHOULD_FAIL_CREDENTIAL_CHAIN, + logger + }); } - if (util.isDisturbed(object) || object.locked) { - throw new TypeError( - "Response body object should not be disturbed or locked" - ); + } else { + try { + token = await (0, import_shared_ini_file_loader.getSSOTokenFromFile)(ssoStartUrl); + } catch (e) { + throw new import_property_provider2.CredentialsProviderError(`The SSO session associated with this profile is invalid. ${refreshMessage}`, { + tryNextLink: SHOULD_FAIL_CREDENTIAL_CHAIN, + logger + }); } - stream = object instanceof ReadableStream ? object : ReadableStreamFrom(object); } - if (typeof source === "string" || util.isBuffer(source)) { - length = Buffer.byteLength(source); + if (new Date(token.expiresAt).getTime() - Date.now() <= 0) { + throw new import_property_provider2.CredentialsProviderError(`The SSO session associated with this profile has expired. ${refreshMessage}`, { + tryNextLink: SHOULD_FAIL_CREDENTIAL_CHAIN, + logger + }); } - if (action != null) { - let iterator; - stream = new ReadableStream({ - async start() { - iterator = action(object)[Symbol.asyncIterator](); - }, - async pull(controller) { - const { value, done } = await iterator.next(); - if (done) { - queueMicrotask(() => { - controller.close(); - controller.byobRequest?.respond(0); - }); - } else { - if (!isErrored(stream)) { - const buffer = new Uint8Array(value); - if (buffer.byteLength) { - controller.enqueue(buffer); - } - } - } - return controller.desiredSize > 0; - }, - async cancel(reason) { - await iterator.return(); - }, - type: "bytes" + const { accessToken } = token; + const { SSOClient: SSOClient2, GetRoleCredentialsCommand: GetRoleCredentialsCommand2 } = await Promise.resolve().then(() => (init_loadSso(), loadSso_exports)); + const sso = ssoClient || new SSOClient2( + Object.assign({}, clientConfig ?? {}, { + region: (clientConfig == null ? void 0 : clientConfig.region) ?? ssoRegion + }) + ); + let ssoResp; + try { + ssoResp = await sso.send( + new GetRoleCredentialsCommand2({ + accountId: ssoAccountId, + roleName: ssoRoleName, + accessToken + }) + ); + } catch (e) { + throw new import_property_provider2.CredentialsProviderError(e, { + tryNextLink: SHOULD_FAIL_CREDENTIAL_CHAIN, + logger }); } - const body = { stream, source, length }; - return [body, type]; - } - function safelyExtractBody(object, keepalive = false) { - if (object instanceof ReadableStream) { - assert(!util.isDisturbed(object), "The body has already been consumed."); - assert(!object.locked, "The stream is locked."); + const { + roleCredentials: { accessKeyId, secretAccessKey, sessionToken, expiration, credentialScope, accountId } = {} + } = ssoResp; + if (!accessKeyId || !secretAccessKey || !sessionToken || !expiration) { + throw new import_property_provider2.CredentialsProviderError("SSO returns an invalid temporary credential.", { + tryNextLink: SHOULD_FAIL_CREDENTIAL_CHAIN, + logger + }); } - return extractBody(object, keepalive); + return { + accessKeyId, + secretAccessKey, + sessionToken, + expiration: new Date(expiration), + ...credentialScope && { credentialScope }, + ...accountId && { accountId } + }; + }, "resolveSSOCredentials"); + var validateSsoProfile = /* @__PURE__ */ __name((profile, logger) => { + const { sso_start_url, sso_account_id, sso_region, sso_role_name } = profile; + if (!sso_start_url || !sso_account_id || !sso_region || !sso_role_name) { + throw new import_property_provider2.CredentialsProviderError( + `Profile is configured with invalid SSO credentials. Required parameters "sso_account_id", "sso_region", "sso_role_name", "sso_start_url". Got ${Object.keys(profile).join( + ", " + )} +Reference: https://docs.aws.amazon.com/cli/latest/userguide/cli-configure-sso.html`, + { tryNextLink: false, logger } + ); + } + return profile; + }, "validateSsoProfile"); + var fromSSO = /* @__PURE__ */ __name((init = {}) => async () => { + var _a; + (_a = init.logger) == null ? void 0 : _a.debug("@aws-sdk/credential-provider-sso - fromSSO"); + const { ssoStartUrl, ssoAccountId, ssoRegion, ssoRoleName, ssoSession } = init; + const { ssoClient } = init; + const profileName = (0, import_shared_ini_file_loader.getProfileName)(init); + if (!ssoStartUrl && !ssoAccountId && !ssoRegion && !ssoRoleName && !ssoSession) { + const profiles = await (0, import_shared_ini_file_loader.parseKnownFiles)(init); + const profile = profiles[profileName]; + if (!profile) { + throw new import_property_provider2.CredentialsProviderError(`Profile ${profileName} was not found.`, { logger: init.logger }); + } + if (!isSsoProfile(profile)) { + throw new import_property_provider2.CredentialsProviderError(`Profile ${profileName} is not configured with SSO credentials.`, { + logger: init.logger + }); + } + if (profile == null ? void 0 : profile.sso_session) { + const ssoSessions = await (0, import_shared_ini_file_loader.loadSsoSessionData)(init); + const session = ssoSessions[profile.sso_session]; + const conflictMsg = ` configurations in profile ${profileName} and sso-session ${profile.sso_session}`; + if (ssoRegion && ssoRegion !== session.sso_region) { + throw new import_property_provider2.CredentialsProviderError(`Conflicting SSO region` + conflictMsg, { + tryNextLink: false, + logger: init.logger + }); + } + if (ssoStartUrl && ssoStartUrl !== session.sso_start_url) { + throw new import_property_provider2.CredentialsProviderError(`Conflicting SSO start_url` + conflictMsg, { + tryNextLink: false, + logger: init.logger + }); + } + profile.sso_region = session.sso_region; + profile.sso_start_url = session.sso_start_url; + } + const { sso_start_url, sso_account_id, sso_region, sso_role_name, sso_session } = validateSsoProfile( + profile, + init.logger + ); + return resolveSSOCredentials({ + ssoStartUrl: sso_start_url, + ssoSession: sso_session, + ssoAccountId: sso_account_id, + ssoRegion: sso_region, + ssoRoleName: sso_role_name, + ssoClient, + clientConfig: init.clientConfig, + profile: profileName + }); + } else if (!ssoStartUrl || !ssoAccountId || !ssoRegion || !ssoRoleName) { + throw new import_property_provider2.CredentialsProviderError( + 'Incomplete configuration. The fromSSO() argument hash must include "ssoStartUrl", "ssoAccountId", "ssoRegion", "ssoRoleName"', + { tryNextLink: false, logger: init.logger } + ); + } else { + return resolveSSOCredentials({ + ssoStartUrl, + ssoSession, + ssoAccountId, + ssoRegion, + ssoRoleName, + ssoClient, + clientConfig: init.clientConfig, + profile: profileName + }); + } + }, "fromSSO"); + } +}); + +// node_modules/@aws-sdk/client-sts/dist-cjs/auth/httpAuthSchemeProvider.js +var require_httpAuthSchemeProvider4 = __commonJS({ + "node_modules/@aws-sdk/client-sts/dist-cjs/auth/httpAuthSchemeProvider.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.resolveHttpAuthSchemeConfig = exports2.resolveStsAuthConfig = exports2.defaultSTSHttpAuthSchemeProvider = exports2.defaultSTSHttpAuthSchemeParametersProvider = void 0; + var core_1 = (init_dist_es2(), __toCommonJS(dist_es_exports2)); + var util_middleware_1 = require_dist_cjs10(); + var STSClient_1 = require_STSClient(); + var defaultSTSHttpAuthSchemeParametersProvider = async (config, context, input) => { + return { + operation: (0, util_middleware_1.getSmithyContext)(context).operation, + region: await (0, util_middleware_1.normalizeProvider)(config.region)() || (() => { + throw new Error("expected `region` to be configured for `aws.auth#sigv4`"); + })() + }; + }; + exports2.defaultSTSHttpAuthSchemeParametersProvider = defaultSTSHttpAuthSchemeParametersProvider; + function createAwsAuthSigv4HttpAuthOption(authParameters) { + return { + schemeId: "aws.auth#sigv4", + signingProperties: { + name: "sts", + region: authParameters.region + }, + propertiesExtractor: (config, context) => ({ + signingProperties: { + config, + context + } + }) + }; } - function cloneBody(body) { - const [out1, out2] = body.stream.tee(); - body.stream = out1; + function createSmithyApiNoAuthHttpAuthOption(authParameters) { return { - stream: out2, - length: body.length, - source: body.source + schemeId: "smithy.api#noAuth" }; } - function throwIfAborted(state) { - if (state.aborted) { - throw new DOMException("The operation was aborted.", "AbortError"); + var defaultSTSHttpAuthSchemeProvider = (authParameters) => { + const options = []; + switch (authParameters.operation) { + case "AssumeRoleWithSAML": { + options.push(createSmithyApiNoAuthHttpAuthOption(authParameters)); + break; + } + case "AssumeRoleWithWebIdentity": { + options.push(createSmithyApiNoAuthHttpAuthOption(authParameters)); + break; + } + default: { + options.push(createAwsAuthSigv4HttpAuthOption(authParameters)); + } } - } - function bodyMixinMethods(instance) { - const methods = { - blob() { - return consumeBody(this, (bytes) => { - let mimeType = bodyMimeType(this); - if (mimeType === null) { - mimeType = ""; - } else if (mimeType) { - mimeType = serializeAMimeType(mimeType); - } - return new Blob2([bytes], { type: mimeType }); - }, instance, false); + return options; + }; + exports2.defaultSTSHttpAuthSchemeProvider = defaultSTSHttpAuthSchemeProvider; + var resolveStsAuthConfig = (input) => ({ + ...input, + stsClientCtor: STSClient_1.STSClient + }); + exports2.resolveStsAuthConfig = resolveStsAuthConfig; + var resolveHttpAuthSchemeConfig = (config) => { + const config_0 = (0, exports2.resolveStsAuthConfig)(config); + const config_1 = (0, core_1.resolveAwsSdkSigV4Config)(config_0); + return { + ...config_1 + }; + }; + exports2.resolveHttpAuthSchemeConfig = resolveHttpAuthSchemeConfig; + } +}); + +// node_modules/@aws-sdk/client-sts/dist-cjs/endpoint/EndpointParameters.js +var require_EndpointParameters = __commonJS({ + "node_modules/@aws-sdk/client-sts/dist-cjs/endpoint/EndpointParameters.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.commonParams = exports2.resolveClientEndpointParameters = void 0; + var resolveClientEndpointParameters = (options) => { + return { + ...options, + useDualstackEndpoint: options.useDualstackEndpoint ?? false, + useFipsEndpoint: options.useFipsEndpoint ?? false, + useGlobalEndpoint: options.useGlobalEndpoint ?? false, + defaultSigningName: "sts" + }; + }; + exports2.resolveClientEndpointParameters = resolveClientEndpointParameters; + exports2.commonParams = { + UseGlobalEndpoint: { type: "builtInParams", name: "useGlobalEndpoint" }, + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" } + }; + } +}); + +// node_modules/@aws-sdk/client-sts/package.json +var require_package4 = __commonJS({ + "node_modules/@aws-sdk/client-sts/package.json"(exports2, module2) { + module2.exports = { + name: "@aws-sdk/client-sts", + description: "AWS SDK for JavaScript Sts Client for Node.js, Browser and React Native", + version: "3.635.0", + scripts: { + build: "concurrently 'yarn:build:cjs' 'yarn:build:es' 'yarn:build:types'", + "build:cjs": "node ../../scripts/compilation/inline client-sts", + "build:es": "tsc -p tsconfig.es.json", + "build:include:deps": "lerna run --scope $npm_package_name --include-dependencies build", + "build:types": "rimraf ./dist-types tsconfig.types.tsbuildinfo && tsc -p tsconfig.types.json", + "build:types:downlevel": "downlevel-dts dist-types dist-types/ts3.4", + clean: "rimraf ./dist-* && rimraf *.tsbuildinfo", + "extract:docs": "api-extractor run --local", + "generate:client": "node ../../scripts/generate-clients/single-service --solo sts", + test: "yarn test:unit", + "test:unit": "jest" + }, + main: "./dist-cjs/index.js", + types: "./dist-types/index.d.ts", + module: "./dist-es/index.js", + sideEffects: false, + dependencies: { + "@aws-crypto/sha256-browser": "5.2.0", + "@aws-crypto/sha256-js": "5.2.0", + "@aws-sdk/client-sso-oidc": "3.635.0", + "@aws-sdk/core": "3.635.0", + "@aws-sdk/credential-provider-node": "3.635.0", + "@aws-sdk/middleware-host-header": "3.620.0", + "@aws-sdk/middleware-logger": "3.609.0", + "@aws-sdk/middleware-recursion-detection": "3.620.0", + "@aws-sdk/middleware-user-agent": "3.632.0", + "@aws-sdk/region-config-resolver": "3.614.0", + "@aws-sdk/types": "3.609.0", + "@aws-sdk/util-endpoints": "3.632.0", + "@aws-sdk/util-user-agent-browser": "3.609.0", + "@aws-sdk/util-user-agent-node": "3.614.0", + "@smithy/config-resolver": "^3.0.5", + "@smithy/core": "^2.4.0", + "@smithy/fetch-http-handler": "^3.2.4", + "@smithy/hash-node": "^3.0.3", + "@smithy/invalid-dependency": "^3.0.3", + "@smithy/middleware-content-length": "^3.0.5", + "@smithy/middleware-endpoint": "^3.1.0", + "@smithy/middleware-retry": "^3.0.15", + "@smithy/middleware-serde": "^3.0.3", + "@smithy/middleware-stack": "^3.0.3", + "@smithy/node-config-provider": "^3.1.4", + "@smithy/node-http-handler": "^3.1.4", + "@smithy/protocol-http": "^4.1.0", + "@smithy/smithy-client": "^3.2.0", + "@smithy/types": "^3.3.0", + "@smithy/url-parser": "^3.0.3", + "@smithy/util-base64": "^3.0.0", + "@smithy/util-body-length-browser": "^3.0.0", + "@smithy/util-body-length-node": "^3.0.0", + "@smithy/util-defaults-mode-browser": "^3.0.15", + "@smithy/util-defaults-mode-node": "^3.0.15", + "@smithy/util-endpoints": "^2.0.5", + "@smithy/util-middleware": "^3.0.3", + "@smithy/util-retry": "^3.0.3", + "@smithy/util-utf8": "^3.0.0", + tslib: "^2.6.2" + }, + devDependencies: { + "@tsconfig/node16": "16.1.3", + "@types/node": "^16.18.96", + concurrently: "7.0.0", + "downlevel-dts": "0.10.1", + rimraf: "3.0.2", + typescript: "~4.9.5" + }, + engines: { + node: ">=16.0.0" + }, + typesVersions: { + "<4.0": { + "dist-types/*": [ + "dist-types/ts3.4/*" + ] + } + }, + files: [ + "dist-*/**" + ], + author: { + name: "AWS SDK for JavaScript Team", + url: "https://aws.amazon.com/javascript/" + }, + license: "Apache-2.0", + browser: { + "./dist-es/runtimeConfig": "./dist-es/runtimeConfig.browser" + }, + "react-native": { + "./dist-es/runtimeConfig": "./dist-es/runtimeConfig.native" + }, + homepage: "https://github.com/aws/aws-sdk-js-v3/tree/main/clients/client-sts", + repository: { + type: "git", + url: "https://github.com/aws/aws-sdk-js-v3.git", + directory: "clients/client-sts" + } + }; + } +}); + +// node_modules/@aws-sdk/client-sts/dist-cjs/endpoint/ruleset.js +var require_ruleset3 = __commonJS({ + "node_modules/@aws-sdk/client-sts/dist-cjs/endpoint/ruleset.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.ruleSet = void 0; + var F = "required"; + var G = "type"; + var H = "fn"; + var I = "argv"; + var J = "ref"; + var a = false; + var b = true; + var c = "booleanEquals"; + var d = "stringEquals"; + var e = "sigv4"; + var f = "sts"; + var g = "us-east-1"; + var h = "endpoint"; + var i = "https://sts.{Region}.{PartitionResult#dnsSuffix}"; + var j = "tree"; + var k = "error"; + var l = "getAttr"; + var m = { [F]: false, [G]: "String" }; + var n = { [F]: true, "default": false, [G]: "Boolean" }; + var o = { [J]: "Endpoint" }; + var p = { [H]: "isSet", [I]: [{ [J]: "Region" }] }; + var q = { [J]: "Region" }; + var r = { [H]: "aws.partition", [I]: [q], "assign": "PartitionResult" }; + var s = { [J]: "UseFIPS" }; + var t = { [J]: "UseDualStack" }; + var u = { "url": "https://sts.amazonaws.com", "properties": { "authSchemes": [{ "name": e, "signingName": f, "signingRegion": g }] }, "headers": {} }; + var v = {}; + var w = { "conditions": [{ [H]: d, [I]: [q, "aws-global"] }], [h]: u, [G]: h }; + var x = { [H]: c, [I]: [s, true] }; + var y = { [H]: c, [I]: [t, true] }; + var z = { [H]: l, [I]: [{ [J]: "PartitionResult" }, "supportsFIPS"] }; + var A = { [J]: "PartitionResult" }; + var B = { [H]: c, [I]: [true, { [H]: l, [I]: [A, "supportsDualStack"] }] }; + var C = [{ [H]: "isSet", [I]: [o] }]; + var D = [x]; + var E = [y]; + var _data = { version: "1.0", parameters: { Region: m, UseDualStack: n, UseFIPS: n, Endpoint: m, UseGlobalEndpoint: n }, rules: [{ conditions: [{ [H]: c, [I]: [{ [J]: "UseGlobalEndpoint" }, b] }, { [H]: "not", [I]: C }, p, r, { [H]: c, [I]: [s, a] }, { [H]: c, [I]: [t, a] }], rules: [{ conditions: [{ [H]: d, [I]: [q, "ap-northeast-1"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "ap-south-1"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "ap-southeast-1"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "ap-southeast-2"] }], endpoint: u, [G]: h }, w, { conditions: [{ [H]: d, [I]: [q, "ca-central-1"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "eu-central-1"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "eu-north-1"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "eu-west-1"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "eu-west-2"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "eu-west-3"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "sa-east-1"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, g] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "us-east-2"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "us-west-1"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "us-west-2"] }], endpoint: u, [G]: h }, { endpoint: { url: i, properties: { authSchemes: [{ name: e, signingName: f, signingRegion: "{Region}" }] }, headers: v }, [G]: h }], [G]: j }, { conditions: C, rules: [{ conditions: D, error: "Invalid Configuration: FIPS and custom endpoint are not supported", [G]: k }, { conditions: E, error: "Invalid Configuration: Dualstack and custom endpoint are not supported", [G]: k }, { endpoint: { url: o, properties: v, headers: v }, [G]: h }], [G]: j }, { conditions: [p], rules: [{ conditions: [r], rules: [{ conditions: [x, y], rules: [{ conditions: [{ [H]: c, [I]: [b, z] }, B], rules: [{ endpoint: { url: "https://sts-fips.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: v, headers: v }, [G]: h }], [G]: j }, { error: "FIPS and DualStack are enabled, but this partition does not support one or both", [G]: k }], [G]: j }, { conditions: D, rules: [{ conditions: [{ [H]: c, [I]: [z, b] }], rules: [{ conditions: [{ [H]: d, [I]: [{ [H]: l, [I]: [A, "name"] }, "aws-us-gov"] }], endpoint: { url: "https://sts.{Region}.amazonaws.com", properties: v, headers: v }, [G]: h }, { endpoint: { url: "https://sts-fips.{Region}.{PartitionResult#dnsSuffix}", properties: v, headers: v }, [G]: h }], [G]: j }, { error: "FIPS is enabled but this partition does not support FIPS", [G]: k }], [G]: j }, { conditions: E, rules: [{ conditions: [B], rules: [{ endpoint: { url: "https://sts.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: v, headers: v }, [G]: h }], [G]: j }, { error: "DualStack is enabled but this partition does not support DualStack", [G]: k }], [G]: j }, w, { endpoint: { url: i, properties: v, headers: v }, [G]: h }], [G]: j }], [G]: j }, { error: "Invalid Configuration: Missing Region", [G]: k }] }; + exports2.ruleSet = _data; + } +}); + +// node_modules/@aws-sdk/client-sts/dist-cjs/endpoint/endpointResolver.js +var require_endpointResolver3 = __commonJS({ + "node_modules/@aws-sdk/client-sts/dist-cjs/endpoint/endpointResolver.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.defaultEndpointResolver = void 0; + var util_endpoints_1 = require_dist_cjs7(); + var util_endpoints_2 = require_dist_cjs6(); + var ruleset_1 = require_ruleset3(); + var defaultEndpointResolver = (endpointParams, context = {}) => { + return (0, util_endpoints_2.resolveEndpoint)(ruleset_1.ruleSet, { + endpointParams, + logger: context.logger + }); + }; + exports2.defaultEndpointResolver = defaultEndpointResolver; + util_endpoints_2.customEndpointFunctions.aws = util_endpoints_1.awsEndpointFunctions; + } +}); + +// node_modules/@aws-sdk/client-sts/dist-cjs/runtimeConfig.shared.js +var require_runtimeConfig_shared3 = __commonJS({ + "node_modules/@aws-sdk/client-sts/dist-cjs/runtimeConfig.shared.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.getRuntimeConfig = void 0; + var core_1 = (init_dist_es2(), __toCommonJS(dist_es_exports2)); + var core_2 = (init_dist_es(), __toCommonJS(dist_es_exports)); + var smithy_client_1 = require_dist_cjs32(); + var url_parser_1 = require_dist_cjs16(); + var util_base64_1 = require_dist_cjs25(); + var util_utf8_1 = require_dist_cjs24(); + var httpAuthSchemeProvider_1 = require_httpAuthSchemeProvider4(); + var endpointResolver_1 = require_endpointResolver3(); + var getRuntimeConfig = (config) => { + return { + apiVersion: "2011-06-15", + base64Decoder: config?.base64Decoder ?? util_base64_1.fromBase64, + base64Encoder: config?.base64Encoder ?? util_base64_1.toBase64, + disableHostPrefix: config?.disableHostPrefix ?? false, + endpointProvider: config?.endpointProvider ?? endpointResolver_1.defaultEndpointResolver, + extensions: config?.extensions ?? [], + httpAuthSchemeProvider: config?.httpAuthSchemeProvider ?? httpAuthSchemeProvider_1.defaultSTSHttpAuthSchemeProvider, + httpAuthSchemes: config?.httpAuthSchemes ?? [ + { + schemeId: "aws.auth#sigv4", + identityProvider: (ipc) => ipc.getIdentityProvider("aws.auth#sigv4"), + signer: new core_1.AwsSdkSigV4Signer() + }, + { + schemeId: "smithy.api#noAuth", + identityProvider: (ipc) => ipc.getIdentityProvider("smithy.api#noAuth") || (async () => ({})), + signer: new core_2.NoAuthSigner() + } + ], + logger: config?.logger ?? new smithy_client_1.NoOpLogger(), + serviceId: config?.serviceId ?? "STS", + urlParser: config?.urlParser ?? url_parser_1.parseUrl, + utf8Decoder: config?.utf8Decoder ?? util_utf8_1.fromUtf8, + utf8Encoder: config?.utf8Encoder ?? util_utf8_1.toUtf8 + }; + }; + exports2.getRuntimeConfig = getRuntimeConfig; + } +}); + +// node_modules/@aws-sdk/client-sts/dist-cjs/runtimeConfig.js +var require_runtimeConfig3 = __commonJS({ + "node_modules/@aws-sdk/client-sts/dist-cjs/runtimeConfig.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.getRuntimeConfig = void 0; + var tslib_1 = (init_tslib_es6(), __toCommonJS(tslib_es6_exports)); + var package_json_1 = tslib_1.__importDefault(require_package4()); + var core_1 = (init_dist_es2(), __toCommonJS(dist_es_exports2)); + var credential_provider_node_1 = require_dist_cjs52(); + var util_user_agent_node_1 = require_dist_cjs39(); + var config_resolver_1 = require_dist_cjs11(); + var core_2 = (init_dist_es(), __toCommonJS(dist_es_exports)); + var hash_node_1 = require_dist_cjs40(); + var middleware_retry_1 = require_dist_cjs33(); + var node_config_provider_1 = require_dist_cjs14(); + var node_http_handler_1 = require_dist_cjs28(); + var util_body_length_node_1 = require_dist_cjs41(); + var util_retry_1 = require_dist_cjs20(); + var runtimeConfig_shared_1 = require_runtimeConfig_shared3(); + var smithy_client_1 = require_dist_cjs32(); + var util_defaults_mode_node_1 = require_dist_cjs42(); + var smithy_client_2 = require_dist_cjs32(); + var getRuntimeConfig = (config) => { + (0, smithy_client_2.emitWarningIfUnsupportedVersion)(process.version); + const defaultsMode = (0, util_defaults_mode_node_1.resolveDefaultsModeConfig)(config); + const defaultConfigProvider = () => defaultsMode().then(smithy_client_1.loadConfigsForDefaultMode); + const clientSharedValues = (0, runtimeConfig_shared_1.getRuntimeConfig)(config); + (0, core_1.emitWarningIfUnsupportedVersion)(process.version); + return { + ...clientSharedValues, + ...config, + runtime: "node", + defaultsMode, + bodyLengthChecker: config?.bodyLengthChecker ?? util_body_length_node_1.calculateBodyLength, + credentialDefaultProvider: config?.credentialDefaultProvider ?? credential_provider_node_1.defaultProvider, + defaultUserAgentProvider: config?.defaultUserAgentProvider ?? (0, util_user_agent_node_1.defaultUserAgent)({ serviceId: clientSharedValues.serviceId, clientVersion: package_json_1.default.version }), + httpAuthSchemes: config?.httpAuthSchemes ?? [ + { + schemeId: "aws.auth#sigv4", + identityProvider: (ipc) => ipc.getIdentityProvider("aws.auth#sigv4") || (async (idProps) => await (0, credential_provider_node_1.defaultProvider)(idProps?.__config || {})()), + signer: new core_1.AwsSdkSigV4Signer() + }, + { + schemeId: "smithy.api#noAuth", + identityProvider: (ipc) => ipc.getIdentityProvider("smithy.api#noAuth") || (async () => ({})), + signer: new core_2.NoAuthSigner() + } + ], + maxAttempts: config?.maxAttempts ?? (0, node_config_provider_1.loadConfig)(middleware_retry_1.NODE_MAX_ATTEMPT_CONFIG_OPTIONS), + region: config?.region ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_REGION_CONFIG_OPTIONS, config_resolver_1.NODE_REGION_CONFIG_FILE_OPTIONS), + requestHandler: node_http_handler_1.NodeHttpHandler.create(config?.requestHandler ?? defaultConfigProvider), + retryMode: config?.retryMode ?? (0, node_config_provider_1.loadConfig)({ + ...middleware_retry_1.NODE_RETRY_MODE_CONFIG_OPTIONS, + default: async () => (await defaultConfigProvider()).retryMode || util_retry_1.DEFAULT_RETRY_MODE + }), + sha256: config?.sha256 ?? hash_node_1.Hash.bind(null, "sha256"), + streamCollector: config?.streamCollector ?? node_http_handler_1.streamCollector, + useDualstackEndpoint: config?.useDualstackEndpoint ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS), + useFipsEndpoint: config?.useFipsEndpoint ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS) + }; + }; + exports2.getRuntimeConfig = getRuntimeConfig; + } +}); + +// node_modules/@aws-sdk/client-sts/dist-cjs/auth/httpAuthExtensionConfiguration.js +var require_httpAuthExtensionConfiguration = __commonJS({ + "node_modules/@aws-sdk/client-sts/dist-cjs/auth/httpAuthExtensionConfiguration.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.resolveHttpAuthRuntimeConfig = exports2.getHttpAuthExtensionConfiguration = void 0; + var getHttpAuthExtensionConfiguration = (runtimeConfig) => { + const _httpAuthSchemes = runtimeConfig.httpAuthSchemes; + let _httpAuthSchemeProvider = runtimeConfig.httpAuthSchemeProvider; + let _credentials = runtimeConfig.credentials; + return { + setHttpAuthScheme(httpAuthScheme) { + const index = _httpAuthSchemes.findIndex((scheme) => scheme.schemeId === httpAuthScheme.schemeId); + if (index === -1) { + _httpAuthSchemes.push(httpAuthScheme); + } else { + _httpAuthSchemes.splice(index, 1, httpAuthScheme); + } }, - arrayBuffer() { - return consumeBody(this, (bytes) => { - return bytes.buffer; - }, instance, true); + httpAuthSchemes() { + return _httpAuthSchemes; }, - text() { - return consumeBody(this, utf8DecodeBytes, instance, false); + setHttpAuthSchemeProvider(httpAuthSchemeProvider) { + _httpAuthSchemeProvider = httpAuthSchemeProvider; }, - json() { - return consumeBody(this, parseJSONFromBytes, instance, false); + httpAuthSchemeProvider() { + return _httpAuthSchemeProvider; }, - formData() { - return consumeBody(this, (value) => { - const mimeType = bodyMimeType(this); - if (mimeType !== null) { - switch (mimeType.essence) { - case "multipart/form-data": { - const parsed = multipartFormDataParser(value, mimeType); - if (parsed === "failure") { - throw new TypeError("Failed to parse body as FormData."); - } - const fd = new FormData(); - fd[kState] = parsed; - return fd; - } - case "application/x-www-form-urlencoded": { - const entries = new URLSearchParams(value.toString()); - const fd = new FormData(); - for (const [name, value2] of entries) { - fd.append(name, value2); - } - return fd; - } - } - } - throw new TypeError( - 'Content-Type was not one of "multipart/form-data" or "application/x-www-form-urlencoded".' - ); - }, instance, false); + setCredentials(credentials) { + _credentials = credentials; }, - bytes() { - return consumeBody(this, (bytes) => { - return new Uint8Array(bytes.buffer, 0, bytes.byteLength); - }, instance, true); + credentials() { + return _credentials; } }; - return methods; - } - function mixinBody(prototype) { - Object.assign(prototype.prototype, bodyMixinMethods(prototype)); - } - async function consumeBody(object, convertBytesToJSValue, instance, shouldClone) { - webidl.brandCheck(object, instance); - if (bodyUnusable(object[kState].body)) { - throw new TypeError("Body is unusable: Body has already been read"); - } - throwIfAborted(object[kState]); - const promise = createDeferredPromise(); - const errorSteps = (error) => promise.reject(error); - const successSteps = (data) => { - try { - promise.resolve(convertBytesToJSValue(data)); - } catch (e) { - errorSteps(e); - } + }; + exports2.getHttpAuthExtensionConfiguration = getHttpAuthExtensionConfiguration; + var resolveHttpAuthRuntimeConfig = (config) => { + return { + httpAuthSchemes: config.httpAuthSchemes(), + httpAuthSchemeProvider: config.httpAuthSchemeProvider(), + credentials: config.credentials() }; - if (object[kState].body == null) { - successSteps(Buffer.allocUnsafe(0)); - return promise.promise; - } - await fullyReadBody(object[kState].body, successSteps, errorSteps, shouldClone); - return promise.promise; - } - function bodyUnusable(body) { - return body != null && (body.stream.locked || util.isDisturbed(body.stream)); - } - function parseJSONFromBytes(bytes) { - return JSON.parse(utf8DecodeBytes(bytes)); - } - function bodyMimeType(requestOrResponse) { - const headers = requestOrResponse[kState].headersList; - const mimeType = extractMimeType(headers); - if (mimeType === "failure") { - return null; - } - return mimeType; - } - module2.exports = { - extractBody, - safelyExtractBody, - cloneBody, - mixinBody }; + exports2.resolveHttpAuthRuntimeConfig = resolveHttpAuthRuntimeConfig; } }); -// node_modules/undici/lib/dispatcher/client-h1.js -var require_client_h1 = __commonJS({ - "node_modules/undici/lib/dispatcher/client-h1.js"(exports2, module2) { +// node_modules/@aws-sdk/client-sts/dist-cjs/runtimeExtensions.js +var require_runtimeExtensions = __commonJS({ + "node_modules/@aws-sdk/client-sts/dist-cjs/runtimeExtensions.js"(exports2) { "use strict"; - var assert = require("node:assert"); - var util = require_util8(); - var { channels } = require_diagnostics(); - var timers = require_timers2(); - var { - RequestContentLengthMismatchError, - ResponseContentLengthMismatchError, - RequestAbortedError, - HeadersTimeoutError, - HeadersOverflowError, - SocketError, - InformationalError, - BodyTimeoutError, - HTTPParserError, - ResponseExceededMaxSizeError - } = require_errors2(); - var { - kUrl, - kReset, - kClient, - kParser, - kBlocking, - kRunning, - kPending, - kSize, - kWriting, - kQueue, - kNoRef, - kKeepAliveDefaultTimeout, - kHostHeader, - kPendingIdx, - kRunningIdx, - kError, - kPipelining, - kSocket, - kKeepAliveTimeoutValue, - kMaxHeadersSize, - kKeepAliveMaxTimeout, - kKeepAliveTimeoutThreshold, - kHeadersTimeout, - kBodyTimeout, - kStrictContentLength, - kMaxRequests, - kCounter, - kMaxResponseSize, - kOnError, - kResume, - kHTTPContext - } = require_symbols6(); - var constants = require_constants7(); - var EMPTY_BUF = Buffer.alloc(0); - var FastBuffer = Buffer[Symbol.species]; - var addListener = util.addListener; - var removeAllListeners = util.removeAllListeners; - var extractBody; - async function lazyllhttp() { - const llhttpWasmData = process.env.JEST_WORKER_ID ? require_llhttp_wasm2() : void 0; - let mod; - try { - mod = await WebAssembly.compile(require_llhttp_simd_wasm2()); - } catch (e) { - mod = await WebAssembly.compile(llhttpWasmData || require_llhttp_wasm2()); + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.resolveRuntimeExtensions = void 0; + var region_config_resolver_1 = require_dist_cjs43(); + var protocol_http_1 = require_dist_cjs2(); + var smithy_client_1 = require_dist_cjs32(); + var httpAuthExtensionConfiguration_1 = require_httpAuthExtensionConfiguration(); + var asPartial = (t) => t; + var resolveRuntimeExtensions = (runtimeConfig, extensions) => { + const extensionConfiguration = { + ...asPartial((0, region_config_resolver_1.getAwsRegionExtensionConfiguration)(runtimeConfig)), + ...asPartial((0, smithy_client_1.getDefaultExtensionConfiguration)(runtimeConfig)), + ...asPartial((0, protocol_http_1.getHttpHandlerExtensionConfiguration)(runtimeConfig)), + ...asPartial((0, httpAuthExtensionConfiguration_1.getHttpAuthExtensionConfiguration)(runtimeConfig)) + }; + extensions.forEach((extension) => extension.configure(extensionConfiguration)); + return { + ...runtimeConfig, + ...(0, region_config_resolver_1.resolveAwsRegionExtensionConfiguration)(extensionConfiguration), + ...(0, smithy_client_1.resolveDefaultRuntimeConfig)(extensionConfiguration), + ...(0, protocol_http_1.resolveHttpHandlerRuntimeConfig)(extensionConfiguration), + ...(0, httpAuthExtensionConfiguration_1.resolveHttpAuthRuntimeConfig)(extensionConfiguration) + }; + }; + exports2.resolveRuntimeExtensions = resolveRuntimeExtensions; + } +}); + +// node_modules/@aws-sdk/client-sts/dist-cjs/STSClient.js +var require_STSClient = __commonJS({ + "node_modules/@aws-sdk/client-sts/dist-cjs/STSClient.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.STSClient = exports2.__Client = void 0; + var middleware_host_header_1 = require_dist_cjs3(); + var middleware_logger_1 = require_dist_cjs4(); + var middleware_recursion_detection_1 = require_dist_cjs5(); + var middleware_user_agent_1 = require_dist_cjs8(); + var config_resolver_1 = require_dist_cjs11(); + var core_1 = (init_dist_es(), __toCommonJS(dist_es_exports)); + var middleware_content_length_1 = require_dist_cjs34(); + var middleware_endpoint_1 = require_dist_cjs18(); + var middleware_retry_1 = require_dist_cjs33(); + var smithy_client_1 = require_dist_cjs32(); + Object.defineProperty(exports2, "__Client", { enumerable: true, get: function() { + return smithy_client_1.Client; + } }); + var httpAuthSchemeProvider_1 = require_httpAuthSchemeProvider4(); + var EndpointParameters_1 = require_EndpointParameters(); + var runtimeConfig_1 = require_runtimeConfig3(); + var runtimeExtensions_1 = require_runtimeExtensions(); + var STSClient2 = class extends smithy_client_1.Client { + constructor(...[configuration]) { + const _config_0 = (0, runtimeConfig_1.getRuntimeConfig)(configuration || {}); + const _config_1 = (0, EndpointParameters_1.resolveClientEndpointParameters)(_config_0); + const _config_2 = (0, middleware_user_agent_1.resolveUserAgentConfig)(_config_1); + const _config_3 = (0, middleware_retry_1.resolveRetryConfig)(_config_2); + const _config_4 = (0, config_resolver_1.resolveRegionConfig)(_config_3); + const _config_5 = (0, middleware_host_header_1.resolveHostHeaderConfig)(_config_4); + const _config_6 = (0, middleware_endpoint_1.resolveEndpointConfig)(_config_5); + const _config_7 = (0, httpAuthSchemeProvider_1.resolveHttpAuthSchemeConfig)(_config_6); + const _config_8 = (0, runtimeExtensions_1.resolveRuntimeExtensions)(_config_7, configuration?.extensions || []); + super(_config_8); + this.config = _config_8; + this.middlewareStack.use((0, middleware_user_agent_1.getUserAgentPlugin)(this.config)); + this.middlewareStack.use((0, middleware_retry_1.getRetryPlugin)(this.config)); + this.middlewareStack.use((0, middleware_content_length_1.getContentLengthPlugin)(this.config)); + this.middlewareStack.use((0, middleware_host_header_1.getHostHeaderPlugin)(this.config)); + this.middlewareStack.use((0, middleware_logger_1.getLoggerPlugin)(this.config)); + this.middlewareStack.use((0, middleware_recursion_detection_1.getRecursionDetectionPlugin)(this.config)); + this.middlewareStack.use((0, core_1.getHttpAuthSchemeEndpointRuleSetPlugin)(this.config, { + httpAuthSchemeParametersProvider: httpAuthSchemeProvider_1.defaultSTSHttpAuthSchemeParametersProvider, + identityProviderConfigProvider: async (config) => new core_1.DefaultIdentityProviderConfig({ + "aws.auth#sigv4": config.credentials + }) + })); + this.middlewareStack.use((0, core_1.getHttpSigningPlugin)(this.config)); } - return await WebAssembly.instantiate(mod, { - env: { - /* eslint-disable camelcase */ - wasm_on_url: (p, at, len) => { - return 0; - }, - wasm_on_status: (p, at, len) => { - assert.strictEqual(currentParser.ptr, p); - const start = at - currentBufferPtr + currentBufferRef.byteOffset; - return currentParser.onStatus(new FastBuffer(currentBufferRef.buffer, start, len)) || 0; - }, - wasm_on_message_begin: (p) => { - assert.strictEqual(currentParser.ptr, p); - return currentParser.onMessageBegin() || 0; - }, - wasm_on_header_field: (p, at, len) => { - assert.strictEqual(currentParser.ptr, p); - const start = at - currentBufferPtr + currentBufferRef.byteOffset; - return currentParser.onHeaderField(new FastBuffer(currentBufferRef.buffer, start, len)) || 0; - }, - wasm_on_header_value: (p, at, len) => { - assert.strictEqual(currentParser.ptr, p); - const start = at - currentBufferPtr + currentBufferRef.byteOffset; - return currentParser.onHeaderValue(new FastBuffer(currentBufferRef.buffer, start, len)) || 0; - }, - wasm_on_headers_complete: (p, statusCode, upgrade, shouldKeepAlive) => { - assert.strictEqual(currentParser.ptr, p); - return currentParser.onHeadersComplete(statusCode, Boolean(upgrade), Boolean(shouldKeepAlive)) || 0; - }, - wasm_on_body: (p, at, len) => { - assert.strictEqual(currentParser.ptr, p); - const start = at - currentBufferPtr + currentBufferRef.byteOffset; - return currentParser.onBody(new FastBuffer(currentBufferRef.buffer, start, len)) || 0; - }, - wasm_on_message_complete: (p) => { - assert.strictEqual(currentParser.ptr, p); - return currentParser.onMessageComplete() || 0; - } - /* eslint-enable camelcase */ - } + destroy() { + super.destroy(); + } + }; + exports2.STSClient = STSClient2; + } +}); + +// node_modules/@aws-sdk/client-sts/dist-cjs/index.js +var require_dist_cjs48 = __commonJS({ + "node_modules/@aws-sdk/client-sts/dist-cjs/index.js"(exports2, module2) { + "use strict"; + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); + }; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + } + return to; + }; + var __reExport = (target, mod, secondTarget) => (__copyProps2(target, mod, "default"), secondTarget && __copyProps2(secondTarget, mod, "default")); + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + AssumeRoleCommand: () => AssumeRoleCommand, + AssumeRoleResponseFilterSensitiveLog: () => AssumeRoleResponseFilterSensitiveLog, + AssumeRoleWithSAMLCommand: () => AssumeRoleWithSAMLCommand, + AssumeRoleWithSAMLRequestFilterSensitiveLog: () => AssumeRoleWithSAMLRequestFilterSensitiveLog, + AssumeRoleWithSAMLResponseFilterSensitiveLog: () => AssumeRoleWithSAMLResponseFilterSensitiveLog, + AssumeRoleWithWebIdentityCommand: () => AssumeRoleWithWebIdentityCommand, + AssumeRoleWithWebIdentityRequestFilterSensitiveLog: () => AssumeRoleWithWebIdentityRequestFilterSensitiveLog, + AssumeRoleWithWebIdentityResponseFilterSensitiveLog: () => AssumeRoleWithWebIdentityResponseFilterSensitiveLog, + ClientInputEndpointParameters: () => import_EndpointParameters9.ClientInputEndpointParameters, + CredentialsFilterSensitiveLog: () => CredentialsFilterSensitiveLog, + DecodeAuthorizationMessageCommand: () => DecodeAuthorizationMessageCommand, + ExpiredTokenException: () => ExpiredTokenException, + GetAccessKeyInfoCommand: () => GetAccessKeyInfoCommand, + GetCallerIdentityCommand: () => GetCallerIdentityCommand, + GetFederationTokenCommand: () => GetFederationTokenCommand, + GetFederationTokenResponseFilterSensitiveLog: () => GetFederationTokenResponseFilterSensitiveLog, + GetSessionTokenCommand: () => GetSessionTokenCommand, + GetSessionTokenResponseFilterSensitiveLog: () => GetSessionTokenResponseFilterSensitiveLog, + IDPCommunicationErrorException: () => IDPCommunicationErrorException, + IDPRejectedClaimException: () => IDPRejectedClaimException, + InvalidAuthorizationMessageException: () => InvalidAuthorizationMessageException, + InvalidIdentityTokenException: () => InvalidIdentityTokenException, + MalformedPolicyDocumentException: () => MalformedPolicyDocumentException, + PackedPolicyTooLargeException: () => PackedPolicyTooLargeException, + RegionDisabledException: () => RegionDisabledException, + STS: () => STS, + STSServiceException: () => STSServiceException, + decorateDefaultCredentialProvider: () => decorateDefaultCredentialProvider, + getDefaultRoleAssumer: () => getDefaultRoleAssumer2, + getDefaultRoleAssumerWithWebIdentity: () => getDefaultRoleAssumerWithWebIdentity2 + }); + module2.exports = __toCommonJS2(src_exports); + __reExport(src_exports, require_STSClient(), module2.exports); + var import_middleware_endpoint2 = require_dist_cjs18(); + var import_middleware_serde2 = require_dist_cjs17(); + var import_EndpointParameters = require_EndpointParameters(); + var import_smithy_client5 = require_dist_cjs32(); + var _STSServiceException = class _STSServiceException2 extends import_smithy_client5.ServiceException { + /** + * @internal + */ + constructor(options) { + super(options); + Object.setPrototypeOf(this, _STSServiceException2.prototype); + } + }; + __name(_STSServiceException, "STSServiceException"); + var STSServiceException = _STSServiceException; + var _ExpiredTokenException = class _ExpiredTokenException2 extends STSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "ExpiredTokenException", + $fault: "client", + ...opts + }); + this.name = "ExpiredTokenException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _ExpiredTokenException2.prototype); + } + }; + __name(_ExpiredTokenException, "ExpiredTokenException"); + var ExpiredTokenException = _ExpiredTokenException; + var _MalformedPolicyDocumentException = class _MalformedPolicyDocumentException2 extends STSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "MalformedPolicyDocumentException", + $fault: "client", + ...opts + }); + this.name = "MalformedPolicyDocumentException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _MalformedPolicyDocumentException2.prototype); + } + }; + __name(_MalformedPolicyDocumentException, "MalformedPolicyDocumentException"); + var MalformedPolicyDocumentException = _MalformedPolicyDocumentException; + var _PackedPolicyTooLargeException = class _PackedPolicyTooLargeException2 extends STSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "PackedPolicyTooLargeException", + $fault: "client", + ...opts + }); + this.name = "PackedPolicyTooLargeException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _PackedPolicyTooLargeException2.prototype); + } + }; + __name(_PackedPolicyTooLargeException, "PackedPolicyTooLargeException"); + var PackedPolicyTooLargeException = _PackedPolicyTooLargeException; + var _RegionDisabledException = class _RegionDisabledException2 extends STSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "RegionDisabledException", + $fault: "client", + ...opts + }); + this.name = "RegionDisabledException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _RegionDisabledException2.prototype); + } + }; + __name(_RegionDisabledException, "RegionDisabledException"); + var RegionDisabledException = _RegionDisabledException; + var _IDPRejectedClaimException = class _IDPRejectedClaimException2 extends STSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "IDPRejectedClaimException", + $fault: "client", + ...opts + }); + this.name = "IDPRejectedClaimException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _IDPRejectedClaimException2.prototype); + } + }; + __name(_IDPRejectedClaimException, "IDPRejectedClaimException"); + var IDPRejectedClaimException = _IDPRejectedClaimException; + var _InvalidIdentityTokenException = class _InvalidIdentityTokenException2 extends STSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "InvalidIdentityTokenException", + $fault: "client", + ...opts + }); + this.name = "InvalidIdentityTokenException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _InvalidIdentityTokenException2.prototype); + } + }; + __name(_InvalidIdentityTokenException, "InvalidIdentityTokenException"); + var InvalidIdentityTokenException = _InvalidIdentityTokenException; + var _IDPCommunicationErrorException = class _IDPCommunicationErrorException2 extends STSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "IDPCommunicationErrorException", + $fault: "client", + ...opts + }); + this.name = "IDPCommunicationErrorException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _IDPCommunicationErrorException2.prototype); + } + }; + __name(_IDPCommunicationErrorException, "IDPCommunicationErrorException"); + var IDPCommunicationErrorException = _IDPCommunicationErrorException; + var _InvalidAuthorizationMessageException = class _InvalidAuthorizationMessageException2 extends STSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "InvalidAuthorizationMessageException", + $fault: "client", + ...opts + }); + this.name = "InvalidAuthorizationMessageException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _InvalidAuthorizationMessageException2.prototype); + } + }; + __name(_InvalidAuthorizationMessageException, "InvalidAuthorizationMessageException"); + var InvalidAuthorizationMessageException = _InvalidAuthorizationMessageException; + var CredentialsFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ + ...obj, + ...obj.SecretAccessKey && { SecretAccessKey: import_smithy_client5.SENSITIVE_STRING } + }), "CredentialsFilterSensitiveLog"); + var AssumeRoleResponseFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ + ...obj, + ...obj.Credentials && { Credentials: CredentialsFilterSensitiveLog(obj.Credentials) } + }), "AssumeRoleResponseFilterSensitiveLog"); + var AssumeRoleWithSAMLRequestFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ + ...obj, + ...obj.SAMLAssertion && { SAMLAssertion: import_smithy_client5.SENSITIVE_STRING } + }), "AssumeRoleWithSAMLRequestFilterSensitiveLog"); + var AssumeRoleWithSAMLResponseFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ + ...obj, + ...obj.Credentials && { Credentials: CredentialsFilterSensitiveLog(obj.Credentials) } + }), "AssumeRoleWithSAMLResponseFilterSensitiveLog"); + var AssumeRoleWithWebIdentityRequestFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ + ...obj, + ...obj.WebIdentityToken && { WebIdentityToken: import_smithy_client5.SENSITIVE_STRING } + }), "AssumeRoleWithWebIdentityRequestFilterSensitiveLog"); + var AssumeRoleWithWebIdentityResponseFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ + ...obj, + ...obj.Credentials && { Credentials: CredentialsFilterSensitiveLog(obj.Credentials) } + }), "AssumeRoleWithWebIdentityResponseFilterSensitiveLog"); + var GetFederationTokenResponseFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ + ...obj, + ...obj.Credentials && { Credentials: CredentialsFilterSensitiveLog(obj.Credentials) } + }), "GetFederationTokenResponseFilterSensitiveLog"); + var GetSessionTokenResponseFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ + ...obj, + ...obj.Credentials && { Credentials: CredentialsFilterSensitiveLog(obj.Credentials) } + }), "GetSessionTokenResponseFilterSensitiveLog"); + var import_core5 = (init_dist_es2(), __toCommonJS(dist_es_exports2)); + var import_protocol_http8 = require_dist_cjs2(); + var se_AssumeRoleCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = SHARED_HEADERS; + let body; + body = buildFormUrlencodedString({ + ...se_AssumeRoleRequest(input, context), + [_A]: _AR, + [_V]: _ }); - } - var llhttpInstance = null; - var llhttpPromise = lazyllhttp(); - llhttpPromise.catch(); - var currentParser = null; - var currentBufferRef = null; - var currentBufferSize = 0; - var currentBufferPtr = null; - var TIMEOUT_HEADERS = 1; - var TIMEOUT_BODY = 2; - var TIMEOUT_IDLE = 3; - var Parser = class { - constructor(client, socket, { exports: exports3 }) { - assert(Number.isFinite(client[kMaxHeadersSize]) && client[kMaxHeadersSize] > 0); - this.llhttp = exports3; - this.ptr = this.llhttp.llhttp_alloc(constants.TYPE.RESPONSE); - this.client = client; - this.socket = socket; - this.timeout = null; - this.timeoutValue = null; - this.timeoutType = null; - this.statusCode = null; - this.statusText = ""; - this.upgrade = false; - this.headers = []; - this.headersSize = 0; - this.headersMaxSize = client[kMaxHeadersSize]; - this.shouldKeepAlive = false; - this.paused = false; - this.resume = this.resume.bind(this); - this.bytesRead = 0; - this.keepAlive = ""; - this.contentLength = ""; - this.connection = ""; - this.maxResponseSize = client[kMaxResponseSize]; + return buildHttpRpcRequest(context, headers, "/", void 0, body); + }, "se_AssumeRoleCommand"); + var se_AssumeRoleWithSAMLCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = SHARED_HEADERS; + let body; + body = buildFormUrlencodedString({ + ...se_AssumeRoleWithSAMLRequest(input, context), + [_A]: _ARWSAML, + [_V]: _ + }); + return buildHttpRpcRequest(context, headers, "/", void 0, body); + }, "se_AssumeRoleWithSAMLCommand"); + var se_AssumeRoleWithWebIdentityCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = SHARED_HEADERS; + let body; + body = buildFormUrlencodedString({ + ...se_AssumeRoleWithWebIdentityRequest(input, context), + [_A]: _ARWWI, + [_V]: _ + }); + return buildHttpRpcRequest(context, headers, "/", void 0, body); + }, "se_AssumeRoleWithWebIdentityCommand"); + var se_DecodeAuthorizationMessageCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = SHARED_HEADERS; + let body; + body = buildFormUrlencodedString({ + ...se_DecodeAuthorizationMessageRequest(input, context), + [_A]: _DAM, + [_V]: _ + }); + return buildHttpRpcRequest(context, headers, "/", void 0, body); + }, "se_DecodeAuthorizationMessageCommand"); + var se_GetAccessKeyInfoCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = SHARED_HEADERS; + let body; + body = buildFormUrlencodedString({ + ...se_GetAccessKeyInfoRequest(input, context), + [_A]: _GAKI, + [_V]: _ + }); + return buildHttpRpcRequest(context, headers, "/", void 0, body); + }, "se_GetAccessKeyInfoCommand"); + var se_GetCallerIdentityCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = SHARED_HEADERS; + let body; + body = buildFormUrlencodedString({ + ...se_GetCallerIdentityRequest(input, context), + [_A]: _GCI, + [_V]: _ + }); + return buildHttpRpcRequest(context, headers, "/", void 0, body); + }, "se_GetCallerIdentityCommand"); + var se_GetFederationTokenCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = SHARED_HEADERS; + let body; + body = buildFormUrlencodedString({ + ...se_GetFederationTokenRequest(input, context), + [_A]: _GFT, + [_V]: _ + }); + return buildHttpRpcRequest(context, headers, "/", void 0, body); + }, "se_GetFederationTokenCommand"); + var se_GetSessionTokenCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = SHARED_HEADERS; + let body; + body = buildFormUrlencodedString({ + ...se_GetSessionTokenRequest(input, context), + [_A]: _GST, + [_V]: _ + }); + return buildHttpRpcRequest(context, headers, "/", void 0, body); + }, "se_GetSessionTokenCommand"); + var de_AssumeRoleCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core5.parseXmlBody)(output.body, context); + let contents = {}; + contents = de_AssumeRoleResponse(data.AssumeRoleResult, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; + }, "de_AssumeRoleCommand"); + var de_AssumeRoleWithSAMLCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core5.parseXmlBody)(output.body, context); + let contents = {}; + contents = de_AssumeRoleWithSAMLResponse(data.AssumeRoleWithSAMLResult, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; + }, "de_AssumeRoleWithSAMLCommand"); + var de_AssumeRoleWithWebIdentityCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core5.parseXmlBody)(output.body, context); + let contents = {}; + contents = de_AssumeRoleWithWebIdentityResponse(data.AssumeRoleWithWebIdentityResult, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; + }, "de_AssumeRoleWithWebIdentityCommand"); + var de_DecodeAuthorizationMessageCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core5.parseXmlBody)(output.body, context); + let contents = {}; + contents = de_DecodeAuthorizationMessageResponse(data.DecodeAuthorizationMessageResult, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; + }, "de_DecodeAuthorizationMessageCommand"); + var de_GetAccessKeyInfoCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core5.parseXmlBody)(output.body, context); + let contents = {}; + contents = de_GetAccessKeyInfoResponse(data.GetAccessKeyInfoResult, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; + }, "de_GetAccessKeyInfoCommand"); + var de_GetCallerIdentityCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core5.parseXmlBody)(output.body, context); + let contents = {}; + contents = de_GetCallerIdentityResponse(data.GetCallerIdentityResult, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; + }, "de_GetCallerIdentityCommand"); + var de_GetFederationTokenCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core5.parseXmlBody)(output.body, context); + let contents = {}; + contents = de_GetFederationTokenResponse(data.GetFederationTokenResult, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; + }, "de_GetFederationTokenCommand"); + var de_GetSessionTokenCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core5.parseXmlBody)(output.body, context); + let contents = {}; + contents = de_GetSessionTokenResponse(data.GetSessionTokenResult, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; + }, "de_GetSessionTokenCommand"); + var de_CommandError = /* @__PURE__ */ __name(async (output, context) => { + const parsedOutput = { + ...output, + body: await (0, import_core5.parseXmlErrorBody)(output.body, context) + }; + const errorCode = loadQueryErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "ExpiredTokenException": + case "com.amazonaws.sts#ExpiredTokenException": + throw await de_ExpiredTokenExceptionRes(parsedOutput, context); + case "MalformedPolicyDocument": + case "com.amazonaws.sts#MalformedPolicyDocumentException": + throw await de_MalformedPolicyDocumentExceptionRes(parsedOutput, context); + case "PackedPolicyTooLarge": + case "com.amazonaws.sts#PackedPolicyTooLargeException": + throw await de_PackedPolicyTooLargeExceptionRes(parsedOutput, context); + case "RegionDisabledException": + case "com.amazonaws.sts#RegionDisabledException": + throw await de_RegionDisabledExceptionRes(parsedOutput, context); + case "IDPRejectedClaim": + case "com.amazonaws.sts#IDPRejectedClaimException": + throw await de_IDPRejectedClaimExceptionRes(parsedOutput, context); + case "InvalidIdentityToken": + case "com.amazonaws.sts#InvalidIdentityTokenException": + throw await de_InvalidIdentityTokenExceptionRes(parsedOutput, context); + case "IDPCommunicationError": + case "com.amazonaws.sts#IDPCommunicationErrorException": + throw await de_IDPCommunicationErrorExceptionRes(parsedOutput, context); + case "InvalidAuthorizationMessageException": + case "com.amazonaws.sts#InvalidAuthorizationMessageException": + throw await de_InvalidAuthorizationMessageExceptionRes(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody: parsedBody.Error, + errorCode + }); } - setTimeout(value, type) { - this.timeoutType = type; - if (value !== this.timeoutValue) { - timers.clearTimeout(this.timeout); - if (value) { - this.timeout = timers.setTimeout(onParserTimeout, value, this); - if (this.timeout.unref) { - this.timeout.unref(); - } - } else { - this.timeout = null; - } - this.timeoutValue = value; - } else if (this.timeout) { - if (this.timeout.refresh) { - this.timeout.refresh(); - } - } + }, "de_CommandError"); + var de_ExpiredTokenExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = de_ExpiredTokenException(body.Error, context); + const exception = new ExpiredTokenException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client5.decorateServiceException)(exception, body); + }, "de_ExpiredTokenExceptionRes"); + var de_IDPCommunicationErrorExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = de_IDPCommunicationErrorException(body.Error, context); + const exception = new IDPCommunicationErrorException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client5.decorateServiceException)(exception, body); + }, "de_IDPCommunicationErrorExceptionRes"); + var de_IDPRejectedClaimExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = de_IDPRejectedClaimException(body.Error, context); + const exception = new IDPRejectedClaimException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client5.decorateServiceException)(exception, body); + }, "de_IDPRejectedClaimExceptionRes"); + var de_InvalidAuthorizationMessageExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = de_InvalidAuthorizationMessageException(body.Error, context); + const exception = new InvalidAuthorizationMessageException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client5.decorateServiceException)(exception, body); + }, "de_InvalidAuthorizationMessageExceptionRes"); + var de_InvalidIdentityTokenExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = de_InvalidIdentityTokenException(body.Error, context); + const exception = new InvalidIdentityTokenException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client5.decorateServiceException)(exception, body); + }, "de_InvalidIdentityTokenExceptionRes"); + var de_MalformedPolicyDocumentExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = de_MalformedPolicyDocumentException(body.Error, context); + const exception = new MalformedPolicyDocumentException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client5.decorateServiceException)(exception, body); + }, "de_MalformedPolicyDocumentExceptionRes"); + var de_PackedPolicyTooLargeExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = de_PackedPolicyTooLargeException(body.Error, context); + const exception = new PackedPolicyTooLargeException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client5.decorateServiceException)(exception, body); + }, "de_PackedPolicyTooLargeExceptionRes"); + var de_RegionDisabledExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = de_RegionDisabledException(body.Error, context); + const exception = new RegionDisabledException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client5.decorateServiceException)(exception, body); + }, "de_RegionDisabledExceptionRes"); + var se_AssumeRoleRequest = /* @__PURE__ */ __name((input, context) => { + var _a2, _b, _c, _d; + const entries = {}; + if (input[_RA] != null) { + entries[_RA] = input[_RA]; + } + if (input[_RSN] != null) { + entries[_RSN] = input[_RSN]; + } + if (input[_PA] != null) { + const memberEntries = se_policyDescriptorListType(input[_PA], context); + if (((_a2 = input[_PA]) == null ? void 0 : _a2.length) === 0) { + entries.PolicyArns = []; + } + Object.entries(memberEntries).forEach(([key, value]) => { + const loc = `PolicyArns.${key}`; + entries[loc] = value; + }); } - resume() { - if (this.socket.destroyed || !this.paused) { - return; - } - assert(this.ptr != null); - assert(currentParser == null); - this.llhttp.llhttp_resume(this.ptr); - assert(this.timeoutType === TIMEOUT_BODY); - if (this.timeout) { - if (this.timeout.refresh) { - this.timeout.refresh(); - } - } - this.paused = false; - this.execute(this.socket.read() || EMPTY_BUF); - this.readMore(); + if (input[_P] != null) { + entries[_P] = input[_P]; } - readMore() { - while (!this.paused && this.ptr) { - const chunk = this.socket.read(); - if (chunk === null) { - break; - } - this.execute(chunk); + if (input[_DS] != null) { + entries[_DS] = input[_DS]; + } + if (input[_T] != null) { + const memberEntries = se_tagListType(input[_T], context); + if (((_b = input[_T]) == null ? void 0 : _b.length) === 0) { + entries.Tags = []; } + Object.entries(memberEntries).forEach(([key, value]) => { + const loc = `Tags.${key}`; + entries[loc] = value; + }); } - execute(data) { - assert(this.ptr != null); - assert(currentParser == null); - assert(!this.paused); - const { socket, llhttp } = this; - if (data.length > currentBufferSize) { - if (currentBufferPtr) { - llhttp.free(currentBufferPtr); - } - currentBufferSize = Math.ceil(data.length / 4096) * 4096; - currentBufferPtr = llhttp.malloc(currentBufferSize); + if (input[_TTK] != null) { + const memberEntries = se_tagKeyListType(input[_TTK], context); + if (((_c = input[_TTK]) == null ? void 0 : _c.length) === 0) { + entries.TransitiveTagKeys = []; } - new Uint8Array(llhttp.memory.buffer, currentBufferPtr, currentBufferSize).set(data); - try { - let ret; - try { - currentBufferRef = data; - currentParser = this; - ret = llhttp.llhttp_execute(this.ptr, currentBufferPtr, data.length); - } catch (err) { - throw err; - } finally { - currentParser = null; - currentBufferRef = null; - } - const offset = llhttp.llhttp_get_error_pos(this.ptr) - currentBufferPtr; - if (ret === constants.ERROR.PAUSED_UPGRADE) { - this.onUpgrade(data.slice(offset)); - } else if (ret === constants.ERROR.PAUSED) { - this.paused = true; - socket.unshift(data.slice(offset)); - } else if (ret !== constants.ERROR.OK) { - const ptr = llhttp.llhttp_get_error_reason(this.ptr); - let message = ""; - if (ptr) { - const len = new Uint8Array(llhttp.memory.buffer, ptr).indexOf(0); - message = "Response does not match the HTTP/1.1 protocol (" + Buffer.from(llhttp.memory.buffer, ptr, len).toString() + ")"; - } - throw new HTTPParserError(message, constants.ERROR[ret], data.slice(offset)); - } - } catch (err) { - util.destroy(socket, err); + Object.entries(memberEntries).forEach(([key, value]) => { + const loc = `TransitiveTagKeys.${key}`; + entries[loc] = value; + }); + } + if (input[_EI] != null) { + entries[_EI] = input[_EI]; + } + if (input[_SN] != null) { + entries[_SN] = input[_SN]; + } + if (input[_TC] != null) { + entries[_TC] = input[_TC]; + } + if (input[_SI] != null) { + entries[_SI] = input[_SI]; + } + if (input[_PC] != null) { + const memberEntries = se_ProvidedContextsListType(input[_PC], context); + if (((_d = input[_PC]) == null ? void 0 : _d.length) === 0) { + entries.ProvidedContexts = []; } + Object.entries(memberEntries).forEach(([key, value]) => { + const loc = `ProvidedContexts.${key}`; + entries[loc] = value; + }); } - destroy() { - assert(this.ptr != null); - assert(currentParser == null); - this.llhttp.llhttp_free(this.ptr); - this.ptr = null; - timers.clearTimeout(this.timeout); - this.timeout = null; - this.timeoutValue = null; - this.timeoutType = null; - this.paused = false; + return entries; + }, "se_AssumeRoleRequest"); + var se_AssumeRoleWithSAMLRequest = /* @__PURE__ */ __name((input, context) => { + var _a2; + const entries = {}; + if (input[_RA] != null) { + entries[_RA] = input[_RA]; } - onStatus(buf) { - this.statusText = buf.toString(); + if (input[_PAr] != null) { + entries[_PAr] = input[_PAr]; } - onMessageBegin() { - const { socket, client } = this; - if (socket.destroyed) { - return -1; + if (input[_SAMLA] != null) { + entries[_SAMLA] = input[_SAMLA]; + } + if (input[_PA] != null) { + const memberEntries = se_policyDescriptorListType(input[_PA], context); + if (((_a2 = input[_PA]) == null ? void 0 : _a2.length) === 0) { + entries.PolicyArns = []; } - const request2 = client[kQueue][client[kRunningIdx]]; - if (!request2) { - return -1; + Object.entries(memberEntries).forEach(([key, value]) => { + const loc = `PolicyArns.${key}`; + entries[loc] = value; + }); + } + if (input[_P] != null) { + entries[_P] = input[_P]; + } + if (input[_DS] != null) { + entries[_DS] = input[_DS]; + } + return entries; + }, "se_AssumeRoleWithSAMLRequest"); + var se_AssumeRoleWithWebIdentityRequest = /* @__PURE__ */ __name((input, context) => { + var _a2; + const entries = {}; + if (input[_RA] != null) { + entries[_RA] = input[_RA]; + } + if (input[_RSN] != null) { + entries[_RSN] = input[_RSN]; + } + if (input[_WIT] != null) { + entries[_WIT] = input[_WIT]; + } + if (input[_PI] != null) { + entries[_PI] = input[_PI]; + } + if (input[_PA] != null) { + const memberEntries = se_policyDescriptorListType(input[_PA], context); + if (((_a2 = input[_PA]) == null ? void 0 : _a2.length) === 0) { + entries.PolicyArns = []; } - request2.onResponseStarted(); + Object.entries(memberEntries).forEach(([key, value]) => { + const loc = `PolicyArns.${key}`; + entries[loc] = value; + }); } - onHeaderField(buf) { - const len = this.headers.length; - if ((len & 1) === 0) { - this.headers.push(buf); - } else { - this.headers[len - 1] = Buffer.concat([this.headers[len - 1], buf]); + if (input[_P] != null) { + entries[_P] = input[_P]; + } + if (input[_DS] != null) { + entries[_DS] = input[_DS]; + } + return entries; + }, "se_AssumeRoleWithWebIdentityRequest"); + var se_DecodeAuthorizationMessageRequest = /* @__PURE__ */ __name((input, context) => { + const entries = {}; + if (input[_EM] != null) { + entries[_EM] = input[_EM]; + } + return entries; + }, "se_DecodeAuthorizationMessageRequest"); + var se_GetAccessKeyInfoRequest = /* @__PURE__ */ __name((input, context) => { + const entries = {}; + if (input[_AKI] != null) { + entries[_AKI] = input[_AKI]; + } + return entries; + }, "se_GetAccessKeyInfoRequest"); + var se_GetCallerIdentityRequest = /* @__PURE__ */ __name((input, context) => { + const entries = {}; + return entries; + }, "se_GetCallerIdentityRequest"); + var se_GetFederationTokenRequest = /* @__PURE__ */ __name((input, context) => { + var _a2, _b; + const entries = {}; + if (input[_N] != null) { + entries[_N] = input[_N]; + } + if (input[_P] != null) { + entries[_P] = input[_P]; + } + if (input[_PA] != null) { + const memberEntries = se_policyDescriptorListType(input[_PA], context); + if (((_a2 = input[_PA]) == null ? void 0 : _a2.length) === 0) { + entries.PolicyArns = []; + } + Object.entries(memberEntries).forEach(([key, value]) => { + const loc = `PolicyArns.${key}`; + entries[loc] = value; + }); + } + if (input[_DS] != null) { + entries[_DS] = input[_DS]; + } + if (input[_T] != null) { + const memberEntries = se_tagListType(input[_T], context); + if (((_b = input[_T]) == null ? void 0 : _b.length) === 0) { + entries.Tags = []; } - this.trackHeader(buf.length); + Object.entries(memberEntries).forEach(([key, value]) => { + const loc = `Tags.${key}`; + entries[loc] = value; + }); } - onHeaderValue(buf) { - let len = this.headers.length; - if ((len & 1) === 1) { - this.headers.push(buf); - len += 1; - } else { - this.headers[len - 1] = Buffer.concat([this.headers[len - 1], buf]); + return entries; + }, "se_GetFederationTokenRequest"); + var se_GetSessionTokenRequest = /* @__PURE__ */ __name((input, context) => { + const entries = {}; + if (input[_DS] != null) { + entries[_DS] = input[_DS]; + } + if (input[_SN] != null) { + entries[_SN] = input[_SN]; + } + if (input[_TC] != null) { + entries[_TC] = input[_TC]; + } + return entries; + }, "se_GetSessionTokenRequest"); + var se_policyDescriptorListType = /* @__PURE__ */ __name((input, context) => { + const entries = {}; + let counter = 1; + for (const entry of input) { + if (entry === null) { + continue; } - const key = this.headers[len - 2]; - if (key.length === 10) { - const headerName = util.bufferToLowerCasedHeaderName(key); - if (headerName === "keep-alive") { - this.keepAlive += buf.toString(); - } else if (headerName === "connection") { - this.connection += buf.toString(); - } - } else if (key.length === 14 && util.bufferToLowerCasedHeaderName(key) === "content-length") { - this.contentLength += buf.toString(); + const memberEntries = se_PolicyDescriptorType(entry, context); + Object.entries(memberEntries).forEach(([key, value]) => { + entries[`member.${counter}.${key}`] = value; + }); + counter++; + } + return entries; + }, "se_policyDescriptorListType"); + var se_PolicyDescriptorType = /* @__PURE__ */ __name((input, context) => { + const entries = {}; + if (input[_a] != null) { + entries[_a] = input[_a]; + } + return entries; + }, "se_PolicyDescriptorType"); + var se_ProvidedContext = /* @__PURE__ */ __name((input, context) => { + const entries = {}; + if (input[_PAro] != null) { + entries[_PAro] = input[_PAro]; + } + if (input[_CA] != null) { + entries[_CA] = input[_CA]; + } + return entries; + }, "se_ProvidedContext"); + var se_ProvidedContextsListType = /* @__PURE__ */ __name((input, context) => { + const entries = {}; + let counter = 1; + for (const entry of input) { + if (entry === null) { + continue; } - this.trackHeader(buf.length); - } - trackHeader(len) { - this.headersSize += len; - if (this.headersSize >= this.headersMaxSize) { - util.destroy(this.socket, new HeadersOverflowError()); + const memberEntries = se_ProvidedContext(entry, context); + Object.entries(memberEntries).forEach(([key, value]) => { + entries[`member.${counter}.${key}`] = value; + }); + counter++; + } + return entries; + }, "se_ProvidedContextsListType"); + var se_Tag = /* @__PURE__ */ __name((input, context) => { + const entries = {}; + if (input[_K] != null) { + entries[_K] = input[_K]; + } + if (input[_Va] != null) { + entries[_Va] = input[_Va]; + } + return entries; + }, "se_Tag"); + var se_tagKeyListType = /* @__PURE__ */ __name((input, context) => { + const entries = {}; + let counter = 1; + for (const entry of input) { + if (entry === null) { + continue; } + entries[`member.${counter}`] = entry; + counter++; } - onUpgrade(head) { - const { upgrade, client, socket, headers, statusCode } = this; - assert(upgrade); - const request2 = client[kQueue][client[kRunningIdx]]; - assert(request2); - assert(!socket.destroyed); - assert(socket === client[kSocket]); - assert(!this.paused); - assert(request2.upgrade || request2.method === "CONNECT"); - this.statusCode = null; - this.statusText = ""; - this.shouldKeepAlive = null; - assert(this.headers.length % 2 === 0); - this.headers = []; - this.headersSize = 0; - socket.unshift(head); - socket[kParser].destroy(); - socket[kParser] = null; - socket[kClient] = null; - socket[kError] = null; - removeAllListeners(socket); - client[kSocket] = null; - client[kHTTPContext] = null; - client[kQueue][client[kRunningIdx]++] = null; - client.emit("disconnect", client[kUrl], [client], new InformationalError("upgrade")); - try { - request2.onUpgrade(statusCode, headers, socket); - } catch (err) { - util.destroy(socket, err); + return entries; + }, "se_tagKeyListType"); + var se_tagListType = /* @__PURE__ */ __name((input, context) => { + const entries = {}; + let counter = 1; + for (const entry of input) { + if (entry === null) { + continue; } - client[kResume](); + const memberEntries = se_Tag(entry, context); + Object.entries(memberEntries).forEach(([key, value]) => { + entries[`member.${counter}.${key}`] = value; + }); + counter++; } - onHeadersComplete(statusCode, upgrade, shouldKeepAlive) { - const { client, socket, headers, statusText } = this; - if (socket.destroyed) { - return -1; - } - const request2 = client[kQueue][client[kRunningIdx]]; - if (!request2) { - return -1; - } - assert(!this.upgrade); - assert(this.statusCode < 200); - if (statusCode === 100) { - util.destroy(socket, new SocketError("bad response", util.getSocketInfo(socket))); - return -1; + return entries; + }, "se_tagListType"); + var de_AssumedRoleUser = /* @__PURE__ */ __name((output, context) => { + const contents = {}; + if (output[_ARI] != null) { + contents[_ARI] = (0, import_smithy_client5.expectString)(output[_ARI]); + } + if (output[_Ar] != null) { + contents[_Ar] = (0, import_smithy_client5.expectString)(output[_Ar]); + } + return contents; + }, "de_AssumedRoleUser"); + var de_AssumeRoleResponse = /* @__PURE__ */ __name((output, context) => { + const contents = {}; + if (output[_C] != null) { + contents[_C] = de_Credentials(output[_C], context); + } + if (output[_ARU] != null) { + contents[_ARU] = de_AssumedRoleUser(output[_ARU], context); + } + if (output[_PPS] != null) { + contents[_PPS] = (0, import_smithy_client5.strictParseInt32)(output[_PPS]); + } + if (output[_SI] != null) { + contents[_SI] = (0, import_smithy_client5.expectString)(output[_SI]); + } + return contents; + }, "de_AssumeRoleResponse"); + var de_AssumeRoleWithSAMLResponse = /* @__PURE__ */ __name((output, context) => { + const contents = {}; + if (output[_C] != null) { + contents[_C] = de_Credentials(output[_C], context); + } + if (output[_ARU] != null) { + contents[_ARU] = de_AssumedRoleUser(output[_ARU], context); + } + if (output[_PPS] != null) { + contents[_PPS] = (0, import_smithy_client5.strictParseInt32)(output[_PPS]); + } + if (output[_S] != null) { + contents[_S] = (0, import_smithy_client5.expectString)(output[_S]); + } + if (output[_ST] != null) { + contents[_ST] = (0, import_smithy_client5.expectString)(output[_ST]); + } + if (output[_I] != null) { + contents[_I] = (0, import_smithy_client5.expectString)(output[_I]); + } + if (output[_Au] != null) { + contents[_Au] = (0, import_smithy_client5.expectString)(output[_Au]); + } + if (output[_NQ] != null) { + contents[_NQ] = (0, import_smithy_client5.expectString)(output[_NQ]); + } + if (output[_SI] != null) { + contents[_SI] = (0, import_smithy_client5.expectString)(output[_SI]); + } + return contents; + }, "de_AssumeRoleWithSAMLResponse"); + var de_AssumeRoleWithWebIdentityResponse = /* @__PURE__ */ __name((output, context) => { + const contents = {}; + if (output[_C] != null) { + contents[_C] = de_Credentials(output[_C], context); + } + if (output[_SFWIT] != null) { + contents[_SFWIT] = (0, import_smithy_client5.expectString)(output[_SFWIT]); + } + if (output[_ARU] != null) { + contents[_ARU] = de_AssumedRoleUser(output[_ARU], context); + } + if (output[_PPS] != null) { + contents[_PPS] = (0, import_smithy_client5.strictParseInt32)(output[_PPS]); + } + if (output[_Pr] != null) { + contents[_Pr] = (0, import_smithy_client5.expectString)(output[_Pr]); + } + if (output[_Au] != null) { + contents[_Au] = (0, import_smithy_client5.expectString)(output[_Au]); + } + if (output[_SI] != null) { + contents[_SI] = (0, import_smithy_client5.expectString)(output[_SI]); + } + return contents; + }, "de_AssumeRoleWithWebIdentityResponse"); + var de_Credentials = /* @__PURE__ */ __name((output, context) => { + const contents = {}; + if (output[_AKI] != null) { + contents[_AKI] = (0, import_smithy_client5.expectString)(output[_AKI]); + } + if (output[_SAK] != null) { + contents[_SAK] = (0, import_smithy_client5.expectString)(output[_SAK]); + } + if (output[_STe] != null) { + contents[_STe] = (0, import_smithy_client5.expectString)(output[_STe]); + } + if (output[_E] != null) { + contents[_E] = (0, import_smithy_client5.expectNonNull)((0, import_smithy_client5.parseRfc3339DateTimeWithOffset)(output[_E])); + } + return contents; + }, "de_Credentials"); + var de_DecodeAuthorizationMessageResponse = /* @__PURE__ */ __name((output, context) => { + const contents = {}; + if (output[_DM] != null) { + contents[_DM] = (0, import_smithy_client5.expectString)(output[_DM]); + } + return contents; + }, "de_DecodeAuthorizationMessageResponse"); + var de_ExpiredTokenException = /* @__PURE__ */ __name((output, context) => { + const contents = {}; + if (output[_m] != null) { + contents[_m] = (0, import_smithy_client5.expectString)(output[_m]); + } + return contents; + }, "de_ExpiredTokenException"); + var de_FederatedUser = /* @__PURE__ */ __name((output, context) => { + const contents = {}; + if (output[_FUI] != null) { + contents[_FUI] = (0, import_smithy_client5.expectString)(output[_FUI]); + } + if (output[_Ar] != null) { + contents[_Ar] = (0, import_smithy_client5.expectString)(output[_Ar]); + } + return contents; + }, "de_FederatedUser"); + var de_GetAccessKeyInfoResponse = /* @__PURE__ */ __name((output, context) => { + const contents = {}; + if (output[_Ac] != null) { + contents[_Ac] = (0, import_smithy_client5.expectString)(output[_Ac]); + } + return contents; + }, "de_GetAccessKeyInfoResponse"); + var de_GetCallerIdentityResponse = /* @__PURE__ */ __name((output, context) => { + const contents = {}; + if (output[_UI] != null) { + contents[_UI] = (0, import_smithy_client5.expectString)(output[_UI]); + } + if (output[_Ac] != null) { + contents[_Ac] = (0, import_smithy_client5.expectString)(output[_Ac]); + } + if (output[_Ar] != null) { + contents[_Ar] = (0, import_smithy_client5.expectString)(output[_Ar]); + } + return contents; + }, "de_GetCallerIdentityResponse"); + var de_GetFederationTokenResponse = /* @__PURE__ */ __name((output, context) => { + const contents = {}; + if (output[_C] != null) { + contents[_C] = de_Credentials(output[_C], context); + } + if (output[_FU] != null) { + contents[_FU] = de_FederatedUser(output[_FU], context); + } + if (output[_PPS] != null) { + contents[_PPS] = (0, import_smithy_client5.strictParseInt32)(output[_PPS]); + } + return contents; + }, "de_GetFederationTokenResponse"); + var de_GetSessionTokenResponse = /* @__PURE__ */ __name((output, context) => { + const contents = {}; + if (output[_C] != null) { + contents[_C] = de_Credentials(output[_C], context); + } + return contents; + }, "de_GetSessionTokenResponse"); + var de_IDPCommunicationErrorException = /* @__PURE__ */ __name((output, context) => { + const contents = {}; + if (output[_m] != null) { + contents[_m] = (0, import_smithy_client5.expectString)(output[_m]); + } + return contents; + }, "de_IDPCommunicationErrorException"); + var de_IDPRejectedClaimException = /* @__PURE__ */ __name((output, context) => { + const contents = {}; + if (output[_m] != null) { + contents[_m] = (0, import_smithy_client5.expectString)(output[_m]); + } + return contents; + }, "de_IDPRejectedClaimException"); + var de_InvalidAuthorizationMessageException = /* @__PURE__ */ __name((output, context) => { + const contents = {}; + if (output[_m] != null) { + contents[_m] = (0, import_smithy_client5.expectString)(output[_m]); + } + return contents; + }, "de_InvalidAuthorizationMessageException"); + var de_InvalidIdentityTokenException = /* @__PURE__ */ __name((output, context) => { + const contents = {}; + if (output[_m] != null) { + contents[_m] = (0, import_smithy_client5.expectString)(output[_m]); + } + return contents; + }, "de_InvalidIdentityTokenException"); + var de_MalformedPolicyDocumentException = /* @__PURE__ */ __name((output, context) => { + const contents = {}; + if (output[_m] != null) { + contents[_m] = (0, import_smithy_client5.expectString)(output[_m]); + } + return contents; + }, "de_MalformedPolicyDocumentException"); + var de_PackedPolicyTooLargeException = /* @__PURE__ */ __name((output, context) => { + const contents = {}; + if (output[_m] != null) { + contents[_m] = (0, import_smithy_client5.expectString)(output[_m]); + } + return contents; + }, "de_PackedPolicyTooLargeException"); + var de_RegionDisabledException = /* @__PURE__ */ __name((output, context) => { + const contents = {}; + if (output[_m] != null) { + contents[_m] = (0, import_smithy_client5.expectString)(output[_m]); + } + return contents; + }, "de_RegionDisabledException"); + var deserializeMetadata = /* @__PURE__ */ __name((output) => ({ + httpStatusCode: output.statusCode, + requestId: output.headers["x-amzn-requestid"] ?? output.headers["x-amzn-request-id"] ?? output.headers["x-amz-request-id"], + extendedRequestId: output.headers["x-amz-id-2"], + cfId: output.headers["x-amz-cf-id"] + }), "deserializeMetadata"); + var throwDefaultError = (0, import_smithy_client5.withBaseException)(STSServiceException); + var buildHttpRpcRequest = /* @__PURE__ */ __name(async (context, headers, path, resolvedHostname, body) => { + const { hostname, protocol = "https", port, path: basePath } = await context.endpoint(); + const contents = { + protocol, + hostname, + port, + method: "POST", + path: basePath.endsWith("/") ? basePath.slice(0, -1) + path : basePath + path, + headers + }; + if (resolvedHostname !== void 0) { + contents.hostname = resolvedHostname; + } + if (body !== void 0) { + contents.body = body; + } + return new import_protocol_http8.HttpRequest(contents); + }, "buildHttpRpcRequest"); + var SHARED_HEADERS = { + "content-type": "application/x-www-form-urlencoded" + }; + var _ = "2011-06-15"; + var _A = "Action"; + var _AKI = "AccessKeyId"; + var _AR = "AssumeRole"; + var _ARI = "AssumedRoleId"; + var _ARU = "AssumedRoleUser"; + var _ARWSAML = "AssumeRoleWithSAML"; + var _ARWWI = "AssumeRoleWithWebIdentity"; + var _Ac = "Account"; + var _Ar = "Arn"; + var _Au = "Audience"; + var _C = "Credentials"; + var _CA = "ContextAssertion"; + var _DAM = "DecodeAuthorizationMessage"; + var _DM = "DecodedMessage"; + var _DS = "DurationSeconds"; + var _E = "Expiration"; + var _EI = "ExternalId"; + var _EM = "EncodedMessage"; + var _FU = "FederatedUser"; + var _FUI = "FederatedUserId"; + var _GAKI = "GetAccessKeyInfo"; + var _GCI = "GetCallerIdentity"; + var _GFT = "GetFederationToken"; + var _GST = "GetSessionToken"; + var _I = "Issuer"; + var _K = "Key"; + var _N = "Name"; + var _NQ = "NameQualifier"; + var _P = "Policy"; + var _PA = "PolicyArns"; + var _PAr = "PrincipalArn"; + var _PAro = "ProviderArn"; + var _PC = "ProvidedContexts"; + var _PI = "ProviderId"; + var _PPS = "PackedPolicySize"; + var _Pr = "Provider"; + var _RA = "RoleArn"; + var _RSN = "RoleSessionName"; + var _S = "Subject"; + var _SAK = "SecretAccessKey"; + var _SAMLA = "SAMLAssertion"; + var _SFWIT = "SubjectFromWebIdentityToken"; + var _SI = "SourceIdentity"; + var _SN = "SerialNumber"; + var _ST = "SubjectType"; + var _STe = "SessionToken"; + var _T = "Tags"; + var _TC = "TokenCode"; + var _TTK = "TransitiveTagKeys"; + var _UI = "UserId"; + var _V = "Version"; + var _Va = "Value"; + var _WIT = "WebIdentityToken"; + var _a = "arn"; + var _m = "message"; + var buildFormUrlencodedString = /* @__PURE__ */ __name((formEntries) => Object.entries(formEntries).map(([key, value]) => (0, import_smithy_client5.extendedEncodeURIComponent)(key) + "=" + (0, import_smithy_client5.extendedEncodeURIComponent)(value)).join("&"), "buildFormUrlencodedString"); + var loadQueryErrorCode = /* @__PURE__ */ __name((output, data) => { + var _a2; + if (((_a2 = data.Error) == null ? void 0 : _a2.Code) !== void 0) { + return data.Error.Code; + } + if (output.statusCode == 404) { + return "NotFound"; + } + }, "loadQueryErrorCode"); + var _AssumeRoleCommand = class _AssumeRoleCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...import_EndpointParameters.commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("AWSSecurityTokenServiceV20110615", "AssumeRole", {}).n("STSClient", "AssumeRoleCommand").f(void 0, AssumeRoleResponseFilterSensitiveLog).ser(se_AssumeRoleCommand).de(de_AssumeRoleCommand).build() { + }; + __name(_AssumeRoleCommand, "AssumeRoleCommand"); + var AssumeRoleCommand = _AssumeRoleCommand; + var import_EndpointParameters2 = require_EndpointParameters(); + var _AssumeRoleWithSAMLCommand = class _AssumeRoleWithSAMLCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...import_EndpointParameters2.commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("AWSSecurityTokenServiceV20110615", "AssumeRoleWithSAML", {}).n("STSClient", "AssumeRoleWithSAMLCommand").f(AssumeRoleWithSAMLRequestFilterSensitiveLog, AssumeRoleWithSAMLResponseFilterSensitiveLog).ser(se_AssumeRoleWithSAMLCommand).de(de_AssumeRoleWithSAMLCommand).build() { + }; + __name(_AssumeRoleWithSAMLCommand, "AssumeRoleWithSAMLCommand"); + var AssumeRoleWithSAMLCommand = _AssumeRoleWithSAMLCommand; + var import_EndpointParameters3 = require_EndpointParameters(); + var _AssumeRoleWithWebIdentityCommand = class _AssumeRoleWithWebIdentityCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...import_EndpointParameters3.commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("AWSSecurityTokenServiceV20110615", "AssumeRoleWithWebIdentity", {}).n("STSClient", "AssumeRoleWithWebIdentityCommand").f(AssumeRoleWithWebIdentityRequestFilterSensitiveLog, AssumeRoleWithWebIdentityResponseFilterSensitiveLog).ser(se_AssumeRoleWithWebIdentityCommand).de(de_AssumeRoleWithWebIdentityCommand).build() { + }; + __name(_AssumeRoleWithWebIdentityCommand, "AssumeRoleWithWebIdentityCommand"); + var AssumeRoleWithWebIdentityCommand = _AssumeRoleWithWebIdentityCommand; + var import_EndpointParameters4 = require_EndpointParameters(); + var _DecodeAuthorizationMessageCommand = class _DecodeAuthorizationMessageCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...import_EndpointParameters4.commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("AWSSecurityTokenServiceV20110615", "DecodeAuthorizationMessage", {}).n("STSClient", "DecodeAuthorizationMessageCommand").f(void 0, void 0).ser(se_DecodeAuthorizationMessageCommand).de(de_DecodeAuthorizationMessageCommand).build() { + }; + __name(_DecodeAuthorizationMessageCommand, "DecodeAuthorizationMessageCommand"); + var DecodeAuthorizationMessageCommand = _DecodeAuthorizationMessageCommand; + var import_EndpointParameters5 = require_EndpointParameters(); + var _GetAccessKeyInfoCommand = class _GetAccessKeyInfoCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...import_EndpointParameters5.commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("AWSSecurityTokenServiceV20110615", "GetAccessKeyInfo", {}).n("STSClient", "GetAccessKeyInfoCommand").f(void 0, void 0).ser(se_GetAccessKeyInfoCommand).de(de_GetAccessKeyInfoCommand).build() { + }; + __name(_GetAccessKeyInfoCommand, "GetAccessKeyInfoCommand"); + var GetAccessKeyInfoCommand = _GetAccessKeyInfoCommand; + var import_EndpointParameters6 = require_EndpointParameters(); + var _GetCallerIdentityCommand = class _GetCallerIdentityCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...import_EndpointParameters6.commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("AWSSecurityTokenServiceV20110615", "GetCallerIdentity", {}).n("STSClient", "GetCallerIdentityCommand").f(void 0, void 0).ser(se_GetCallerIdentityCommand).de(de_GetCallerIdentityCommand).build() { + }; + __name(_GetCallerIdentityCommand, "GetCallerIdentityCommand"); + var GetCallerIdentityCommand = _GetCallerIdentityCommand; + var import_EndpointParameters7 = require_EndpointParameters(); + var _GetFederationTokenCommand = class _GetFederationTokenCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...import_EndpointParameters7.commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("AWSSecurityTokenServiceV20110615", "GetFederationToken", {}).n("STSClient", "GetFederationTokenCommand").f(void 0, GetFederationTokenResponseFilterSensitiveLog).ser(se_GetFederationTokenCommand).de(de_GetFederationTokenCommand).build() { + }; + __name(_GetFederationTokenCommand, "GetFederationTokenCommand"); + var GetFederationTokenCommand = _GetFederationTokenCommand; + var import_EndpointParameters8 = require_EndpointParameters(); + var _GetSessionTokenCommand = class _GetSessionTokenCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...import_EndpointParameters8.commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("AWSSecurityTokenServiceV20110615", "GetSessionToken", {}).n("STSClient", "GetSessionTokenCommand").f(void 0, GetSessionTokenResponseFilterSensitiveLog).ser(se_GetSessionTokenCommand).de(de_GetSessionTokenCommand).build() { + }; + __name(_GetSessionTokenCommand, "GetSessionTokenCommand"); + var GetSessionTokenCommand = _GetSessionTokenCommand; + var import_STSClient = require_STSClient(); + var commands = { + AssumeRoleCommand, + AssumeRoleWithSAMLCommand, + AssumeRoleWithWebIdentityCommand, + DecodeAuthorizationMessageCommand, + GetAccessKeyInfoCommand, + GetCallerIdentityCommand, + GetFederationTokenCommand, + GetSessionTokenCommand + }; + var _STS = class _STS extends import_STSClient.STSClient { + }; + __name(_STS, "STS"); + var STS = _STS; + (0, import_smithy_client5.createAggregatedClient)(commands, STS); + var import_EndpointParameters9 = require_EndpointParameters(); + var ASSUME_ROLE_DEFAULT_REGION = "us-east-1"; + var getAccountIdFromAssumedRoleUser = /* @__PURE__ */ __name((assumedRoleUser) => { + if (typeof (assumedRoleUser == null ? void 0 : assumedRoleUser.Arn) === "string") { + const arnComponents = assumedRoleUser.Arn.split(":"); + if (arnComponents.length > 4 && arnComponents[4] !== "") { + return arnComponents[4]; } - if (upgrade && !request2.upgrade) { - util.destroy(socket, new SocketError("bad upgrade", util.getSocketInfo(socket))); - return -1; + } + return void 0; + }, "getAccountIdFromAssumedRoleUser"); + var resolveRegion = /* @__PURE__ */ __name(async (_region, _parentRegion, credentialProviderLogger) => { + var _a2; + const region = typeof _region === "function" ? await _region() : _region; + const parentRegion = typeof _parentRegion === "function" ? await _parentRegion() : _parentRegion; + (_a2 = credentialProviderLogger == null ? void 0 : credentialProviderLogger.debug) == null ? void 0 : _a2.call( + credentialProviderLogger, + "@aws-sdk/client-sts::resolveRegion", + "accepting first of:", + `${region} (provider)`, + `${parentRegion} (parent client)`, + `${ASSUME_ROLE_DEFAULT_REGION} (STS default)` + ); + return region ?? parentRegion ?? ASSUME_ROLE_DEFAULT_REGION; + }, "resolveRegion"); + var getDefaultRoleAssumer = /* @__PURE__ */ __name((stsOptions, stsClientCtor) => { + let stsClient; + let closureSourceCreds; + return async (sourceCreds, params) => { + var _a2, _b, _c; + closureSourceCreds = sourceCreds; + if (!stsClient) { + const { + logger = (_a2 = stsOptions == null ? void 0 : stsOptions.parentClientConfig) == null ? void 0 : _a2.logger, + region, + requestHandler = (_b = stsOptions == null ? void 0 : stsOptions.parentClientConfig) == null ? void 0 : _b.requestHandler, + credentialProviderLogger + } = stsOptions; + const resolvedRegion = await resolveRegion( + region, + (_c = stsOptions == null ? void 0 : stsOptions.parentClientConfig) == null ? void 0 : _c.region, + credentialProviderLogger + ); + const isCompatibleRequestHandler = !isH2(requestHandler); + stsClient = new stsClientCtor({ + // A hack to make sts client uses the credential in current closure. + credentialDefaultProvider: () => async () => closureSourceCreds, + region: resolvedRegion, + requestHandler: isCompatibleRequestHandler ? requestHandler : void 0, + logger + }); } - assert.strictEqual(this.timeoutType, TIMEOUT_HEADERS); - this.statusCode = statusCode; - this.shouldKeepAlive = shouldKeepAlive || // Override llhttp value which does not allow keepAlive for HEAD. - request2.method === "HEAD" && !socket[kReset] && this.connection.toLowerCase() === "keep-alive"; - if (this.statusCode >= 200) { - const bodyTimeout = request2.bodyTimeout != null ? request2.bodyTimeout : client[kBodyTimeout]; - this.setTimeout(bodyTimeout, TIMEOUT_BODY); - } else if (this.timeout) { - if (this.timeout.refresh) { - this.timeout.refresh(); - } + const { Credentials: Credentials2, AssumedRoleUser: AssumedRoleUser2 } = await stsClient.send(new AssumeRoleCommand(params)); + if (!Credentials2 || !Credentials2.AccessKeyId || !Credentials2.SecretAccessKey) { + throw new Error(`Invalid response from STS.assumeRole call with role ${params.RoleArn}`); } - if (request2.method === "CONNECT") { - assert(client[kRunning] === 1); - this.upgrade = true; - return 2; + const accountId = getAccountIdFromAssumedRoleUser(AssumedRoleUser2); + return { + accessKeyId: Credentials2.AccessKeyId, + secretAccessKey: Credentials2.SecretAccessKey, + sessionToken: Credentials2.SessionToken, + expiration: Credentials2.Expiration, + // TODO(credentialScope): access normally when shape is updated. + ...Credentials2.CredentialScope && { credentialScope: Credentials2.CredentialScope }, + ...accountId && { accountId } + }; + }; + }, "getDefaultRoleAssumer"); + var getDefaultRoleAssumerWithWebIdentity = /* @__PURE__ */ __name((stsOptions, stsClientCtor) => { + let stsClient; + return async (params) => { + var _a2, _b, _c; + if (!stsClient) { + const { + logger = (_a2 = stsOptions == null ? void 0 : stsOptions.parentClientConfig) == null ? void 0 : _a2.logger, + region, + requestHandler = (_b = stsOptions == null ? void 0 : stsOptions.parentClientConfig) == null ? void 0 : _b.requestHandler, + credentialProviderLogger + } = stsOptions; + const resolvedRegion = await resolveRegion( + region, + (_c = stsOptions == null ? void 0 : stsOptions.parentClientConfig) == null ? void 0 : _c.region, + credentialProviderLogger + ); + const isCompatibleRequestHandler = !isH2(requestHandler); + stsClient = new stsClientCtor({ + region: resolvedRegion, + requestHandler: isCompatibleRequestHandler ? requestHandler : void 0, + logger + }); } - if (upgrade) { - assert(client[kRunning] === 1); - this.upgrade = true; - return 2; + const { Credentials: Credentials2, AssumedRoleUser: AssumedRoleUser2 } = await stsClient.send(new AssumeRoleWithWebIdentityCommand(params)); + if (!Credentials2 || !Credentials2.AccessKeyId || !Credentials2.SecretAccessKey) { + throw new Error(`Invalid response from STS.assumeRoleWithWebIdentity call with role ${params.RoleArn}`); } - assert(this.headers.length % 2 === 0); - this.headers = []; - this.headersSize = 0; - if (this.shouldKeepAlive && client[kPipelining]) { - const keepAliveTimeout = this.keepAlive ? util.parseKeepAliveTimeout(this.keepAlive) : null; - if (keepAliveTimeout != null) { - const timeout = Math.min( - keepAliveTimeout - client[kKeepAliveTimeoutThreshold], - client[kKeepAliveMaxTimeout] - ); - if (timeout <= 0) { - socket[kReset] = true; - } else { - client[kKeepAliveTimeoutValue] = timeout; + const accountId = getAccountIdFromAssumedRoleUser(AssumedRoleUser2); + return { + accessKeyId: Credentials2.AccessKeyId, + secretAccessKey: Credentials2.SecretAccessKey, + sessionToken: Credentials2.SessionToken, + expiration: Credentials2.Expiration, + // TODO(credentialScope): access normally when shape is updated. + ...Credentials2.CredentialScope && { credentialScope: Credentials2.CredentialScope }, + ...accountId && { accountId } + }; + }; + }, "getDefaultRoleAssumerWithWebIdentity"); + var isH2 = /* @__PURE__ */ __name((requestHandler) => { + var _a2; + return ((_a2 = requestHandler == null ? void 0 : requestHandler.metadata) == null ? void 0 : _a2.handlerProtocol) === "h2"; + }, "isH2"); + var import_STSClient2 = require_STSClient(); + var getCustomizableStsClientCtor = /* @__PURE__ */ __name((baseCtor, customizations) => { + var _a2; + if (!customizations) + return baseCtor; + else + return _a2 = class extends baseCtor { + constructor(config) { + super(config); + for (const customization of customizations) { + this.middlewareStack.use(customization); + } + } + }, __name(_a2, "CustomizableSTSClient"), _a2; + }, "getCustomizableStsClientCtor"); + var getDefaultRoleAssumer2 = /* @__PURE__ */ __name((stsOptions = {}, stsPlugins) => getDefaultRoleAssumer(stsOptions, getCustomizableStsClientCtor(import_STSClient2.STSClient, stsPlugins)), "getDefaultRoleAssumer"); + var getDefaultRoleAssumerWithWebIdentity2 = /* @__PURE__ */ __name((stsOptions = {}, stsPlugins) => getDefaultRoleAssumerWithWebIdentity(stsOptions, getCustomizableStsClientCtor(import_STSClient2.STSClient, stsPlugins)), "getDefaultRoleAssumerWithWebIdentity"); + var decorateDefaultCredentialProvider = /* @__PURE__ */ __name((provider) => (input) => provider({ + roleAssumer: getDefaultRoleAssumer2(input), + roleAssumerWithWebIdentity: getDefaultRoleAssumerWithWebIdentity2(input), + ...input + }), "decorateDefaultCredentialProvider"); + } +}); + +// node_modules/@aws-sdk/credential-provider-process/dist-cjs/index.js +var require_dist_cjs49 = __commonJS({ + "node_modules/@aws-sdk/credential-provider-process/dist-cjs/index.js"(exports2, module2) { + "use strict"; + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); + }; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + } + return to; + }; + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + fromProcess: () => fromProcess + }); + module2.exports = __toCommonJS2(src_exports); + var import_shared_ini_file_loader = require_dist_cjs13(); + var import_property_provider2 = require_dist_cjs12(); + var import_child_process = require("child_process"); + var import_util = require("util"); + var getValidatedProcessCredentials = /* @__PURE__ */ __name((profileName, data, profiles) => { + var _a; + if (data.Version !== 1) { + throw Error(`Profile ${profileName} credential_process did not return Version 1.`); + } + if (data.AccessKeyId === void 0 || data.SecretAccessKey === void 0) { + throw Error(`Profile ${profileName} credential_process returned invalid credentials.`); + } + if (data.Expiration) { + const currentTime = /* @__PURE__ */ new Date(); + const expireTime = new Date(data.Expiration); + if (expireTime < currentTime) { + throw Error(`Profile ${profileName} credential_process returned expired credentials.`); + } + } + let accountId = data.AccountId; + if (!accountId && ((_a = profiles == null ? void 0 : profiles[profileName]) == null ? void 0 : _a.aws_account_id)) { + accountId = profiles[profileName].aws_account_id; + } + return { + accessKeyId: data.AccessKeyId, + secretAccessKey: data.SecretAccessKey, + ...data.SessionToken && { sessionToken: data.SessionToken }, + ...data.Expiration && { expiration: new Date(data.Expiration) }, + ...data.CredentialScope && { credentialScope: data.CredentialScope }, + ...accountId && { accountId } + }; + }, "getValidatedProcessCredentials"); + var resolveProcessCredentials = /* @__PURE__ */ __name(async (profileName, profiles, logger) => { + const profile = profiles[profileName]; + if (profiles[profileName]) { + const credentialProcess = profile["credential_process"]; + if (credentialProcess !== void 0) { + const execPromise = (0, import_util.promisify)(import_child_process.exec); + try { + const { stdout } = await execPromise(credentialProcess); + let data; + try { + data = JSON.parse(stdout.trim()); + } catch { + throw Error(`Profile ${profileName} credential_process returned invalid JSON.`); } - } else { - client[kKeepAliveTimeoutValue] = client[kKeepAliveDefaultTimeout]; + return getValidatedProcessCredentials(profileName, data, profiles); + } catch (error) { + throw new import_property_provider2.CredentialsProviderError(error.message, { logger }); } } else { - socket[kReset] = true; - } - const pause = request2.onHeaders(statusCode, headers, this.resume, statusText) === false; - if (request2.aborted) { - return -1; - } - if (request2.method === "HEAD") { - return 1; - } - if (statusCode < 200) { - return 1; - } - if (socket[kBlocking]) { - socket[kBlocking] = false; - client[kResume](); + throw new import_property_provider2.CredentialsProviderError(`Profile ${profileName} did not contain credential_process.`, { logger }); } - return pause ? constants.ERROR.PAUSED : 0; + } else { + throw new import_property_provider2.CredentialsProviderError(`Profile ${profileName} could not be found in shared credentials file.`, { + logger + }); } - onBody(buf) { - const { client, socket, statusCode, maxResponseSize } = this; - if (socket.destroyed) { - return -1; - } - const request2 = client[kQueue][client[kRunningIdx]]; - assert(request2); - assert.strictEqual(this.timeoutType, TIMEOUT_BODY); - if (this.timeout) { - if (this.timeout.refresh) { - this.timeout.refresh(); - } - } - assert(statusCode >= 200); - if (maxResponseSize > -1 && this.bytesRead + buf.length > maxResponseSize) { - util.destroy(socket, new ResponseExceededMaxSizeError()); - return -1; - } - this.bytesRead += buf.length; - if (request2.onData(buf) === false) { - return constants.ERROR.PAUSED; - } + }, "resolveProcessCredentials"); + var fromProcess = /* @__PURE__ */ __name((init = {}) => async () => { + var _a; + (_a = init.logger) == null ? void 0 : _a.debug("@aws-sdk/credential-provider-process - fromProcess"); + const profiles = await (0, import_shared_ini_file_loader.parseKnownFiles)(init); + return resolveProcessCredentials((0, import_shared_ini_file_loader.getProfileName)(init), profiles, init.logger); + }, "fromProcess"); + } +}); + +// node_modules/@aws-sdk/credential-provider-web-identity/dist-cjs/fromWebToken.js +var require_fromWebToken = __commonJS({ + "node_modules/@aws-sdk/credential-provider-web-identity/dist-cjs/fromWebToken.js"(exports2) { + "use strict"; + var __createBinding2 = exports2 && exports2.__createBinding || (Object.create ? function(o, m, k, k2) { + if (k2 === void 0) k2 = k; + var desc = Object.getOwnPropertyDescriptor(m, k); + if (!desc || ("get" in desc ? !m.__esModule : desc.writable || desc.configurable)) { + desc = { enumerable: true, get: function() { + return m[k]; + } }; } - onMessageComplete() { - const { client, socket, statusCode, upgrade, headers, contentLength, bytesRead, shouldKeepAlive } = this; - if (socket.destroyed && (!statusCode || shouldKeepAlive)) { - return -1; - } - if (upgrade) { - return; - } - const request2 = client[kQueue][client[kRunningIdx]]; - assert(request2); - assert(statusCode >= 100); - this.statusCode = null; - this.statusText = ""; - this.bytesRead = 0; - this.contentLength = ""; - this.keepAlive = ""; - this.connection = ""; - assert(this.headers.length % 2 === 0); - this.headers = []; - this.headersSize = 0; - if (statusCode < 200) { - return; - } - if (request2.method !== "HEAD" && contentLength && bytesRead !== parseInt(contentLength, 10)) { - util.destroy(socket, new ResponseContentLengthMismatchError()); - return -1; - } - request2.onComplete(headers); - client[kQueue][client[kRunningIdx]++] = null; - if (socket[kWriting]) { - assert.strictEqual(client[kRunning], 0); - util.destroy(socket, new InformationalError("reset")); - return constants.ERROR.PAUSED; - } else if (!shouldKeepAlive) { - util.destroy(socket, new InformationalError("reset")); - return constants.ERROR.PAUSED; - } else if (socket[kReset] && client[kRunning] === 0) { - util.destroy(socket, new InformationalError("reset")); - return constants.ERROR.PAUSED; - } else if (client[kPipelining] == null || client[kPipelining] === 1) { - setImmediate(() => client[kResume]()); - } else { - client[kResume](); - } + Object.defineProperty(o, k2, desc); + } : function(o, m, k, k2) { + if (k2 === void 0) k2 = k; + o[k2] = m[k]; + }); + var __setModuleDefault2 = exports2 && exports2.__setModuleDefault || (Object.create ? function(o, v) { + Object.defineProperty(o, "default", { enumerable: true, value: v }); + } : function(o, v) { + o["default"] = v; + }); + var __importStar2 = exports2 && exports2.__importStar || function(mod) { + if (mod && mod.__esModule) return mod; + var result = {}; + if (mod != null) { + for (var k in mod) if (k !== "default" && Object.prototype.hasOwnProperty.call(mod, k)) __createBinding2(result, mod, k); } + __setModuleDefault2(result, mod); + return result; }; - function onParserTimeout(parser) { - const { socket, timeoutType, client } = parser; - if (timeoutType === TIMEOUT_HEADERS) { - if (!socket[kWriting] || socket.writableNeedDrain || client[kRunning] > 1) { - assert(!parser.paused, "cannot be paused while waiting for headers"); - util.destroy(socket, new HeadersTimeoutError()); - } - } else if (timeoutType === TIMEOUT_BODY) { - if (!parser.paused) { - util.destroy(socket, new BodyTimeoutError()); + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.fromWebToken = void 0; + var fromWebToken2 = (init) => async () => { + init.logger?.debug("@aws-sdk/credential-provider-web-identity - fromWebToken"); + const { roleArn, roleSessionName, webIdentityToken, providerId, policyArns, policy, durationSeconds } = init; + let { roleAssumerWithWebIdentity } = init; + if (!roleAssumerWithWebIdentity) { + const { getDefaultRoleAssumerWithWebIdentity } = await Promise.resolve().then(() => __importStar2(require_dist_cjs48())); + roleAssumerWithWebIdentity = getDefaultRoleAssumerWithWebIdentity({ + ...init.clientConfig, + credentialProviderLogger: init.logger, + parentClientConfig: init.parentClientConfig + }, init.clientPlugins); + } + return roleAssumerWithWebIdentity({ + RoleArn: roleArn, + RoleSessionName: roleSessionName ?? `aws-sdk-js-session-${Date.now()}`, + WebIdentityToken: webIdentityToken, + ProviderId: providerId, + PolicyArns: policyArns, + Policy: policy, + DurationSeconds: durationSeconds + }); + }; + exports2.fromWebToken = fromWebToken2; + } +}); + +// node_modules/@aws-sdk/credential-provider-web-identity/dist-cjs/fromTokenFile.js +var require_fromTokenFile = __commonJS({ + "node_modules/@aws-sdk/credential-provider-web-identity/dist-cjs/fromTokenFile.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.fromTokenFile = void 0; + var property_provider_1 = require_dist_cjs12(); + var fs_1 = require("fs"); + var fromWebToken_1 = require_fromWebToken(); + var ENV_TOKEN_FILE = "AWS_WEB_IDENTITY_TOKEN_FILE"; + var ENV_ROLE_ARN = "AWS_ROLE_ARN"; + var ENV_ROLE_SESSION_NAME = "AWS_ROLE_SESSION_NAME"; + var fromTokenFile2 = (init = {}) => async () => { + init.logger?.debug("@aws-sdk/credential-provider-web-identity - fromTokenFile"); + const webIdentityTokenFile = init?.webIdentityTokenFile ?? process.env[ENV_TOKEN_FILE]; + const roleArn = init?.roleArn ?? process.env[ENV_ROLE_ARN]; + const roleSessionName = init?.roleSessionName ?? process.env[ENV_ROLE_SESSION_NAME]; + if (!webIdentityTokenFile || !roleArn) { + throw new property_provider_1.CredentialsProviderError("Web identity configuration not specified", { + logger: init.logger + }); + } + return (0, fromWebToken_1.fromWebToken)({ + ...init, + webIdentityToken: (0, fs_1.readFileSync)(webIdentityTokenFile, { encoding: "ascii" }), + roleArn, + roleSessionName + })(); + }; + exports2.fromTokenFile = fromTokenFile2; + } +}); + +// node_modules/@aws-sdk/credential-provider-web-identity/dist-cjs/index.js +var require_dist_cjs50 = __commonJS({ + "node_modules/@aws-sdk/credential-provider-web-identity/dist-cjs/index.js"(exports2, module2) { + "use strict"; + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + } + return to; + }; + var __reExport = (target, mod, secondTarget) => (__copyProps2(target, mod, "default"), secondTarget && __copyProps2(secondTarget, mod, "default")); + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + module2.exports = __toCommonJS2(src_exports); + __reExport(src_exports, require_fromTokenFile(), module2.exports); + __reExport(src_exports, require_fromWebToken(), module2.exports); + } +}); + +// node_modules/@aws-sdk/credential-provider-ini/dist-cjs/index.js +var require_dist_cjs51 = __commonJS({ + "node_modules/@aws-sdk/credential-provider-ini/dist-cjs/index.js"(exports2, module2) { + "use strict"; + var __create2 = Object.create; + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __getProtoOf2 = Object.getPrototypeOf; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); + }; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + } + return to; + }; + var __toESM2 = (mod, isNodeMode, target) => (target = mod != null ? __create2(__getProtoOf2(mod)) : {}, __copyProps2( + // If the importer is in node compatibility mode or this is not an ESM + // file that has been converted to a CommonJS file using a Babel- + // compatible transform (i.e. "__esModule" has not been set), then set + // "default" to the CommonJS "module.exports" for node compatibility. + isNodeMode || !mod || !mod.__esModule ? __defProp2(target, "default", { value: mod, enumerable: true }) : target, + mod + )); + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + fromIni: () => fromIni + }); + module2.exports = __toCommonJS2(src_exports); + var import_shared_ini_file_loader = require_dist_cjs13(); + var import_property_provider2 = require_dist_cjs12(); + var resolveCredentialSource = /* @__PURE__ */ __name((credentialSource, profileName, logger) => { + const sourceProvidersMap = { + EcsContainer: async (options) => { + const { fromHttp } = await Promise.resolve().then(() => __toESM2(require_dist_cjs38())); + const { fromContainerMetadata } = await Promise.resolve().then(() => __toESM2(require_dist_cjs37())); + logger == null ? void 0 : logger.debug("@aws-sdk/credential-provider-ini - credential_source is EcsContainer"); + return (0, import_property_provider2.chain)(fromHttp(options ?? {}), fromContainerMetadata(options)); + }, + Ec2InstanceMetadata: async (options) => { + logger == null ? void 0 : logger.debug("@aws-sdk/credential-provider-ini - credential_source is Ec2InstanceMetadata"); + const { fromInstanceMetadata } = await Promise.resolve().then(() => __toESM2(require_dist_cjs37())); + return fromInstanceMetadata(options); + }, + Environment: async (options) => { + logger == null ? void 0 : logger.debug("@aws-sdk/credential-provider-ini - credential_source is Environment"); + const { fromEnv } = await Promise.resolve().then(() => __toESM2(require_dist_cjs36())); + return fromEnv(options); } - } else if (timeoutType === TIMEOUT_IDLE) { - assert(client[kRunning] === 0 && client[kKeepAliveTimeoutValue]); - util.destroy(socket, new InformationalError("socket idle timeout")); + }; + if (credentialSource in sourceProvidersMap) { + return sourceProvidersMap[credentialSource]; + } else { + throw new import_property_provider2.CredentialsProviderError( + `Unsupported credential source in profile ${profileName}. Got ${credentialSource}, expected EcsContainer or Ec2InstanceMetadata or Environment.`, + { logger } + ); } - } - async function connectH1(client, socket) { - client[kSocket] = socket; - if (!llhttpInstance) { - llhttpInstance = await llhttpPromise; - llhttpPromise = null; + }, "resolveCredentialSource"); + var isAssumeRoleProfile = /* @__PURE__ */ __name((arg, { profile = "default", logger } = {}) => { + return Boolean(arg) && typeof arg === "object" && typeof arg.role_arn === "string" && ["undefined", "string"].indexOf(typeof arg.role_session_name) > -1 && ["undefined", "string"].indexOf(typeof arg.external_id) > -1 && ["undefined", "string"].indexOf(typeof arg.mfa_serial) > -1 && (isAssumeRoleWithSourceProfile(arg, { profile, logger }) || isCredentialSourceProfile(arg, { profile, logger })); + }, "isAssumeRoleProfile"); + var isAssumeRoleWithSourceProfile = /* @__PURE__ */ __name((arg, { profile, logger }) => { + var _a; + const withSourceProfile = typeof arg.source_profile === "string" && typeof arg.credential_source === "undefined"; + if (withSourceProfile) { + (_a = logger == null ? void 0 : logger.debug) == null ? void 0 : _a.call(logger, ` ${profile} isAssumeRoleWithSourceProfile source_profile=${arg.source_profile}`); + } + return withSourceProfile; + }, "isAssumeRoleWithSourceProfile"); + var isCredentialSourceProfile = /* @__PURE__ */ __name((arg, { profile, logger }) => { + var _a; + const withProviderProfile = typeof arg.credential_source === "string" && typeof arg.source_profile === "undefined"; + if (withProviderProfile) { + (_a = logger == null ? void 0 : logger.debug) == null ? void 0 : _a.call(logger, ` ${profile} isCredentialSourceProfile credential_source=${arg.credential_source}`); + } + return withProviderProfile; + }, "isCredentialSourceProfile"); + var resolveAssumeRoleCredentials = /* @__PURE__ */ __name(async (profileName, profiles, options, visitedProfiles = {}) => { + var _a, _b; + (_a = options.logger) == null ? void 0 : _a.debug("@aws-sdk/credential-provider-ini - resolveAssumeRoleCredentials (STS)"); + const data = profiles[profileName]; + if (!options.roleAssumer) { + const { getDefaultRoleAssumer } = await Promise.resolve().then(() => __toESM2(require_dist_cjs48())); + options.roleAssumer = getDefaultRoleAssumer( + { + ...options.clientConfig, + credentialProviderLogger: options.logger, + parentClientConfig: options == null ? void 0 : options.parentClientConfig + }, + options.clientPlugins + ); } - socket[kNoRef] = false; - socket[kWriting] = false; - socket[kReset] = false; - socket[kBlocking] = false; - socket[kParser] = new Parser(client, socket, llhttpInstance); - addListener(socket, "error", function(err) { - const parser = this[kParser]; - assert(err.code !== "ERR_TLS_CERT_ALTNAME_INVALID"); - if (err.code === "ECONNRESET" && parser.statusCode && !parser.shouldKeepAlive) { - parser.onMessageComplete(); - return; - } - this[kError] = err; - this[kClient][kOnError](err); - }); - addListener(socket, "readable", function() { - const parser = this[kParser]; - if (parser) { - parser.readMore(); - } - }); - addListener(socket, "end", function() { - const parser = this[kParser]; - if (parser.statusCode && !parser.shouldKeepAlive) { - parser.onMessageComplete(); - return; + const { source_profile } = data; + if (source_profile && source_profile in visitedProfiles) { + throw new import_property_provider2.CredentialsProviderError( + `Detected a cycle attempting to resolve credentials for profile ${(0, import_shared_ini_file_loader.getProfileName)(options)}. Profiles visited: ` + Object.keys(visitedProfiles).join(", "), + { logger: options.logger } + ); + } + (_b = options.logger) == null ? void 0 : _b.debug( + `@aws-sdk/credential-provider-ini - finding credential resolver using ${source_profile ? `source_profile=[${source_profile}]` : `profile=[${profileName}]`}` + ); + const sourceCredsProvider = source_profile ? resolveProfileData( + source_profile, + { + ...profiles, + [source_profile]: { + ...profiles[source_profile], + // This assigns the role_arn of the "root" profile + // to the credential_source profile so this recursive call knows + // what role to assume. + role_arn: data.role_arn ?? profiles[source_profile].role_arn + } + }, + options, + { + ...visitedProfiles, + [source_profile]: true + } + ) : (await resolveCredentialSource(data.credential_source, profileName, options.logger)(options))(); + const params = { + RoleArn: data.role_arn, + RoleSessionName: data.role_session_name || `aws-sdk-js-${Date.now()}`, + ExternalId: data.external_id, + DurationSeconds: parseInt(data.duration_seconds || "3600", 10) + }; + const { mfa_serial } = data; + if (mfa_serial) { + if (!options.mfaCodeProvider) { + throw new import_property_provider2.CredentialsProviderError( + `Profile ${profileName} requires multi-factor authentication, but no MFA code callback was provided.`, + { logger: options.logger, tryNextLink: false } + ); } - util.destroy(this, new SocketError("other side closed", util.getSocketInfo(this))); + params.SerialNumber = mfa_serial; + params.TokenCode = await options.mfaCodeProvider(mfa_serial); + } + const sourceCreds = await sourceCredsProvider; + return options.roleAssumer(sourceCreds, params); + }, "resolveAssumeRoleCredentials"); + var isProcessProfile = /* @__PURE__ */ __name((arg) => Boolean(arg) && typeof arg === "object" && typeof arg.credential_process === "string", "isProcessProfile"); + var resolveProcessCredentials = /* @__PURE__ */ __name(async (options, profile) => Promise.resolve().then(() => __toESM2(require_dist_cjs49())).then( + ({ fromProcess }) => fromProcess({ + ...options, + profile + })() + ), "resolveProcessCredentials"); + var resolveSsoCredentials = /* @__PURE__ */ __name(async (profile, options = {}) => { + const { fromSSO } = await Promise.resolve().then(() => __toESM2(require_dist_cjs47())); + return fromSSO({ + profile, + logger: options.logger + })(); + }, "resolveSsoCredentials"); + var isSsoProfile = /* @__PURE__ */ __name((arg) => arg && (typeof arg.sso_start_url === "string" || typeof arg.sso_account_id === "string" || typeof arg.sso_session === "string" || typeof arg.sso_region === "string" || typeof arg.sso_role_name === "string"), "isSsoProfile"); + var isStaticCredsProfile = /* @__PURE__ */ __name((arg) => Boolean(arg) && typeof arg === "object" && typeof arg.aws_access_key_id === "string" && typeof arg.aws_secret_access_key === "string" && ["undefined", "string"].indexOf(typeof arg.aws_session_token) > -1 && ["undefined", "string"].indexOf(typeof arg.aws_account_id) > -1, "isStaticCredsProfile"); + var resolveStaticCredentials = /* @__PURE__ */ __name((profile, options) => { + var _a; + (_a = options == null ? void 0 : options.logger) == null ? void 0 : _a.debug("@aws-sdk/credential-provider-ini - resolveStaticCredentials"); + return Promise.resolve({ + accessKeyId: profile.aws_access_key_id, + secretAccessKey: profile.aws_secret_access_key, + sessionToken: profile.aws_session_token, + ...profile.aws_credential_scope && { credentialScope: profile.aws_credential_scope }, + ...profile.aws_account_id && { accountId: profile.aws_account_id } }); - addListener(socket, "close", function() { - const client2 = this[kClient]; - const parser = this[kParser]; - if (parser) { - if (!this[kError] && parser.statusCode && !parser.shouldKeepAlive) { - parser.onMessageComplete(); + }, "resolveStaticCredentials"); + var isWebIdentityProfile = /* @__PURE__ */ __name((arg) => Boolean(arg) && typeof arg === "object" && typeof arg.web_identity_token_file === "string" && typeof arg.role_arn === "string" && ["undefined", "string"].indexOf(typeof arg.role_session_name) > -1, "isWebIdentityProfile"); + var resolveWebIdentityCredentials = /* @__PURE__ */ __name(async (profile, options) => Promise.resolve().then(() => __toESM2(require_dist_cjs50())).then( + ({ fromTokenFile: fromTokenFile2 }) => fromTokenFile2({ + webIdentityTokenFile: profile.web_identity_token_file, + roleArn: profile.role_arn, + roleSessionName: profile.role_session_name, + roleAssumerWithWebIdentity: options.roleAssumerWithWebIdentity, + logger: options.logger, + parentClientConfig: options.parentClientConfig + })() + ), "resolveWebIdentityCredentials"); + var resolveProfileData = /* @__PURE__ */ __name(async (profileName, profiles, options, visitedProfiles = {}) => { + const data = profiles[profileName]; + if (Object.keys(visitedProfiles).length > 0 && isStaticCredsProfile(data)) { + return resolveStaticCredentials(data, options); + } + if (isAssumeRoleProfile(data, { profile: profileName, logger: options.logger })) { + return resolveAssumeRoleCredentials(profileName, profiles, options, visitedProfiles); + } + if (isStaticCredsProfile(data)) { + return resolveStaticCredentials(data, options); + } + if (isWebIdentityProfile(data)) { + return resolveWebIdentityCredentials(data, options); + } + if (isProcessProfile(data)) { + return resolveProcessCredentials(options, profileName); + } + if (isSsoProfile(data)) { + return await resolveSsoCredentials(profileName, options); + } + throw new import_property_provider2.CredentialsProviderError( + `Could not resolve credentials using profile: [${profileName}] in configuration/credentials file(s).`, + { logger: options.logger } + ); + }, "resolveProfileData"); + var fromIni = /* @__PURE__ */ __name((init = {}) => async () => { + var _a; + (_a = init.logger) == null ? void 0 : _a.debug("@aws-sdk/credential-provider-ini - fromIni"); + const profiles = await (0, import_shared_ini_file_loader.parseKnownFiles)(init); + return resolveProfileData((0, import_shared_ini_file_loader.getProfileName)(init), profiles, init); + }, "fromIni"); + } +}); + +// node_modules/@aws-sdk/credential-provider-node/dist-cjs/index.js +var require_dist_cjs52 = __commonJS({ + "node_modules/@aws-sdk/credential-provider-node/dist-cjs/index.js"(exports2, module2) { + "use strict"; + var __create2 = Object.create; + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __getProtoOf2 = Object.getPrototypeOf; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); + }; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + } + return to; + }; + var __toESM2 = (mod, isNodeMode, target) => (target = mod != null ? __create2(__getProtoOf2(mod)) : {}, __copyProps2( + // If the importer is in node compatibility mode or this is not an ESM + // file that has been converted to a CommonJS file using a Babel- + // compatible transform (i.e. "__esModule" has not been set), then set + // "default" to the CommonJS "module.exports" for node compatibility. + isNodeMode || !mod || !mod.__esModule ? __defProp2(target, "default", { value: mod, enumerable: true }) : target, + mod + )); + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + credentialsTreatedAsExpired: () => credentialsTreatedAsExpired, + credentialsWillNeedRefresh: () => credentialsWillNeedRefresh, + defaultProvider: () => defaultProvider + }); + module2.exports = __toCommonJS2(src_exports); + var import_credential_provider_env = require_dist_cjs36(); + var import_shared_ini_file_loader = require_dist_cjs13(); + var import_property_provider2 = require_dist_cjs12(); + var ENV_IMDS_DISABLED = "AWS_EC2_METADATA_DISABLED"; + var remoteProvider = /* @__PURE__ */ __name(async (init) => { + var _a, _b; + const { ENV_CMDS_FULL_URI, ENV_CMDS_RELATIVE_URI, fromContainerMetadata, fromInstanceMetadata } = await Promise.resolve().then(() => __toESM2(require_dist_cjs37())); + if (process.env[ENV_CMDS_RELATIVE_URI] || process.env[ENV_CMDS_FULL_URI]) { + (_a = init.logger) == null ? void 0 : _a.debug("@aws-sdk/credential-provider-node - remoteProvider::fromHttp/fromContainerMetadata"); + const { fromHttp } = await Promise.resolve().then(() => __toESM2(require_dist_cjs38())); + return (0, import_property_provider2.chain)(fromHttp(init), fromContainerMetadata(init)); + } + if (process.env[ENV_IMDS_DISABLED]) { + return async () => { + throw new import_property_provider2.CredentialsProviderError("EC2 Instance Metadata Service access disabled", { logger: init.logger }); + }; + } + (_b = init.logger) == null ? void 0 : _b.debug("@aws-sdk/credential-provider-node - remoteProvider::fromInstanceMetadata"); + return fromInstanceMetadata(init); + }, "remoteProvider"); + var multipleCredentialSourceWarningEmitted = false; + var defaultProvider = /* @__PURE__ */ __name((init = {}) => (0, import_property_provider2.memoize)( + (0, import_property_provider2.chain)( + async () => { + var _a, _b, _c, _d; + const profile = init.profile ?? process.env[import_shared_ini_file_loader.ENV_PROFILE]; + if (profile) { + const envStaticCredentialsAreSet = process.env[import_credential_provider_env.ENV_KEY] && process.env[import_credential_provider_env.ENV_SECRET]; + if (envStaticCredentialsAreSet) { + if (!multipleCredentialSourceWarningEmitted) { + const warnFn = ((_a = init.logger) == null ? void 0 : _a.warn) && ((_c = (_b = init.logger) == null ? void 0 : _b.constructor) == null ? void 0 : _c.name) !== "NoOpLogger" ? init.logger.warn : console.warn; + warnFn( + `@aws-sdk/credential-provider-node - defaultProvider::fromEnv WARNING: + Multiple credential sources detected: + Both AWS_PROFILE and the pair AWS_ACCESS_KEY_ID/AWS_SECRET_ACCESS_KEY static credentials are set. + This SDK will proceed with the AWS_PROFILE value. + + However, a future version may change this behavior to prefer the ENV static credentials. + Please ensure that your environment only sets either the AWS_PROFILE or the + AWS_ACCESS_KEY_ID/AWS_SECRET_ACCESS_KEY pair. +` + ); + multipleCredentialSourceWarningEmitted = true; + } + } + throw new import_property_provider2.CredentialsProviderError("AWS_PROFILE is set, skipping fromEnv provider.", { + logger: init.logger, + tryNextLink: true + }); } - this[kParser].destroy(); - this[kParser] = null; - } - const err = this[kError] || new SocketError("closed", util.getSocketInfo(this)); - client2[kSocket] = null; - client2[kHTTPContext] = null; - if (client2.destroyed) { - assert(client2[kPending] === 0); - const requests = client2[kQueue].splice(client2[kRunningIdx]); - for (let i = 0; i < requests.length; i++) { - const request2 = requests[i]; - util.errorRequest(client2, request2, err); + (_d = init.logger) == null ? void 0 : _d.debug("@aws-sdk/credential-provider-node - defaultProvider::fromEnv"); + return (0, import_credential_provider_env.fromEnv)(init)(); + }, + async () => { + var _a; + (_a = init.logger) == null ? void 0 : _a.debug("@aws-sdk/credential-provider-node - defaultProvider::fromSSO"); + const { ssoStartUrl, ssoAccountId, ssoRegion, ssoRoleName, ssoSession } = init; + if (!ssoStartUrl && !ssoAccountId && !ssoRegion && !ssoRoleName && !ssoSession) { + throw new import_property_provider2.CredentialsProviderError( + "Skipping SSO provider in default chain (inputs do not include SSO fields).", + { logger: init.logger } + ); } - } else if (client2[kRunning] > 0 && err.code !== "UND_ERR_INFO") { - const request2 = client2[kQueue][client2[kRunningIdx]]; - client2[kQueue][client2[kRunningIdx]++] = null; - util.errorRequest(client2, request2, err); + const { fromSSO } = await Promise.resolve().then(() => __toESM2(require_dist_cjs47())); + return fromSSO(init)(); + }, + async () => { + var _a; + (_a = init.logger) == null ? void 0 : _a.debug("@aws-sdk/credential-provider-node - defaultProvider::fromIni"); + const { fromIni } = await Promise.resolve().then(() => __toESM2(require_dist_cjs51())); + return fromIni(init)(); + }, + async () => { + var _a; + (_a = init.logger) == null ? void 0 : _a.debug("@aws-sdk/credential-provider-node - defaultProvider::fromProcess"); + const { fromProcess } = await Promise.resolve().then(() => __toESM2(require_dist_cjs49())); + return fromProcess(init)(); + }, + async () => { + var _a; + (_a = init.logger) == null ? void 0 : _a.debug("@aws-sdk/credential-provider-node - defaultProvider::fromTokenFile"); + const { fromTokenFile: fromTokenFile2 } = await Promise.resolve().then(() => __toESM2(require_dist_cjs50())); + return fromTokenFile2(init)(); + }, + async () => { + var _a; + (_a = init.logger) == null ? void 0 : _a.debug("@aws-sdk/credential-provider-node - defaultProvider::remoteProvider"); + return (await remoteProvider(init))(); + }, + async () => { + throw new import_property_provider2.CredentialsProviderError("Could not load credentials from any providers", { + tryNextLink: false, + logger: init.logger + }); } - client2[kPendingIdx] = client2[kRunningIdx]; - assert(client2[kRunning] === 0); - client2.emit("disconnect", client2[kUrl], [client2], err); - client2[kResume](); - }); - let closed = false; - socket.on("close", () => { - closed = true; + ), + credentialsTreatedAsExpired, + credentialsWillNeedRefresh + ), "defaultProvider"); + var credentialsWillNeedRefresh = /* @__PURE__ */ __name((credentials) => (credentials == null ? void 0 : credentials.expiration) !== void 0, "credentialsWillNeedRefresh"); + var credentialsTreatedAsExpired = /* @__PURE__ */ __name((credentials) => (credentials == null ? void 0 : credentials.expiration) !== void 0 && credentials.expiration.getTime() - Date.now() < 3e5, "credentialsTreatedAsExpired"); + } +}); + +// node_modules/@aws-sdk/client-kms/dist-cjs/endpoint/ruleset.js +var require_ruleset4 = __commonJS({ + "node_modules/@aws-sdk/client-kms/dist-cjs/endpoint/ruleset.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.ruleSet = void 0; + var s = "required"; + var t = "fn"; + var u = "argv"; + var v = "ref"; + var a = true; + var b = "isSet"; + var c = "booleanEquals"; + var d = "error"; + var e = "endpoint"; + var f = "tree"; + var g = "PartitionResult"; + var h = { [s]: false, "type": "String" }; + var i = { [s]: true, "default": false, "type": "Boolean" }; + var j = { [v]: "Endpoint" }; + var k = { [t]: c, [u]: [{ [v]: "UseFIPS" }, true] }; + var l = { [t]: c, [u]: [{ [v]: "UseDualStack" }, true] }; + var m = {}; + var n = { [t]: "getAttr", [u]: [{ [v]: g }, "supportsFIPS"] }; + var o = { [t]: c, [u]: [true, { [t]: "getAttr", [u]: [{ [v]: g }, "supportsDualStack"] }] }; + var p = [k]; + var q = [l]; + var r = [{ [v]: "Region" }]; + var _data = { version: "1.0", parameters: { Region: h, UseDualStack: i, UseFIPS: i, Endpoint: h }, rules: [{ conditions: [{ [t]: b, [u]: [j] }], rules: [{ conditions: p, error: "Invalid Configuration: FIPS and custom endpoint are not supported", type: d }, { conditions: q, error: "Invalid Configuration: Dualstack and custom endpoint are not supported", type: d }, { endpoint: { url: j, properties: m, headers: m }, type: e }], type: f }, { conditions: [{ [t]: b, [u]: r }], rules: [{ conditions: [{ [t]: "aws.partition", [u]: r, assign: g }], rules: [{ conditions: [k, l], rules: [{ conditions: [{ [t]: c, [u]: [a, n] }, o], rules: [{ endpoint: { url: "https://kms-fips.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: m, headers: m }, type: e }], type: f }, { error: "FIPS and DualStack are enabled, but this partition does not support one or both", type: d }], type: f }, { conditions: p, rules: [{ conditions: [{ [t]: c, [u]: [n, a] }], rules: [{ endpoint: { url: "https://kms-fips.{Region}.{PartitionResult#dnsSuffix}", properties: m, headers: m }, type: e }], type: f }, { error: "FIPS is enabled but this partition does not support FIPS", type: d }], type: f }, { conditions: q, rules: [{ conditions: [o], rules: [{ endpoint: { url: "https://kms.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: m, headers: m }, type: e }], type: f }, { error: "DualStack is enabled but this partition does not support DualStack", type: d }], type: f }, { endpoint: { url: "https://kms.{Region}.{PartitionResult#dnsSuffix}", properties: m, headers: m }, type: e }], type: f }], type: f }, { error: "Invalid Configuration: Missing Region", type: d }] }; + exports2.ruleSet = _data; + } +}); + +// node_modules/@aws-sdk/client-kms/dist-cjs/endpoint/endpointResolver.js +var require_endpointResolver4 = __commonJS({ + "node_modules/@aws-sdk/client-kms/dist-cjs/endpoint/endpointResolver.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.defaultEndpointResolver = void 0; + var util_endpoints_1 = require_dist_cjs7(); + var util_endpoints_2 = require_dist_cjs6(); + var ruleset_1 = require_ruleset4(); + var defaultEndpointResolver = (endpointParams, context = {}) => { + return (0, util_endpoints_2.resolveEndpoint)(ruleset_1.ruleSet, { + endpointParams, + logger: context.logger }); + }; + exports2.defaultEndpointResolver = defaultEndpointResolver; + util_endpoints_2.customEndpointFunctions.aws = util_endpoints_1.awsEndpointFunctions; + } +}); + +// node_modules/@aws-sdk/client-kms/dist-cjs/runtimeConfig.shared.js +var require_runtimeConfig_shared4 = __commonJS({ + "node_modules/@aws-sdk/client-kms/dist-cjs/runtimeConfig.shared.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.getRuntimeConfig = void 0; + var core_1 = (init_dist_es2(), __toCommonJS(dist_es_exports2)); + var smithy_client_1 = require_dist_cjs32(); + var url_parser_1 = require_dist_cjs16(); + var util_base64_1 = require_dist_cjs25(); + var util_utf8_1 = require_dist_cjs24(); + var httpAuthSchemeProvider_1 = require_httpAuthSchemeProvider(); + var endpointResolver_1 = require_endpointResolver4(); + var getRuntimeConfig = (config) => { return { - version: "h1", - defaultPipelining: 1, - write(...args) { - return writeH1(client, ...args); - }, - resume() { - resumeH1(client); - }, - destroy(err, callback) { - if (closed) { - queueMicrotask(callback); + apiVersion: "2014-11-01", + base64Decoder: config?.base64Decoder ?? util_base64_1.fromBase64, + base64Encoder: config?.base64Encoder ?? util_base64_1.toBase64, + disableHostPrefix: config?.disableHostPrefix ?? false, + endpointProvider: config?.endpointProvider ?? endpointResolver_1.defaultEndpointResolver, + extensions: config?.extensions ?? [], + httpAuthSchemeProvider: config?.httpAuthSchemeProvider ?? httpAuthSchemeProvider_1.defaultKMSHttpAuthSchemeProvider, + httpAuthSchemes: config?.httpAuthSchemes ?? [ + { + schemeId: "aws.auth#sigv4", + identityProvider: (ipc) => ipc.getIdentityProvider("aws.auth#sigv4"), + signer: new core_1.AwsSdkSigV4Signer() + } + ], + logger: config?.logger ?? new smithy_client_1.NoOpLogger(), + serviceId: config?.serviceId ?? "KMS", + urlParser: config?.urlParser ?? url_parser_1.parseUrl, + utf8Decoder: config?.utf8Decoder ?? util_utf8_1.fromUtf8, + utf8Encoder: config?.utf8Encoder ?? util_utf8_1.toUtf8 + }; + }; + exports2.getRuntimeConfig = getRuntimeConfig; + } +}); + +// node_modules/@aws-sdk/client-kms/dist-cjs/runtimeConfig.js +var require_runtimeConfig4 = __commonJS({ + "node_modules/@aws-sdk/client-kms/dist-cjs/runtimeConfig.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.getRuntimeConfig = void 0; + var tslib_1 = (init_tslib_es6(), __toCommonJS(tslib_es6_exports)); + var package_json_1 = tslib_1.__importDefault(require_package()); + var core_1 = (init_dist_es2(), __toCommonJS(dist_es_exports2)); + var credential_provider_node_1 = require_dist_cjs52(); + var util_user_agent_node_1 = require_dist_cjs39(); + var config_resolver_1 = require_dist_cjs11(); + var hash_node_1 = require_dist_cjs40(); + var middleware_retry_1 = require_dist_cjs33(); + var node_config_provider_1 = require_dist_cjs14(); + var node_http_handler_1 = require_dist_cjs28(); + var util_body_length_node_1 = require_dist_cjs41(); + var util_retry_1 = require_dist_cjs20(); + var runtimeConfig_shared_1 = require_runtimeConfig_shared4(); + var smithy_client_1 = require_dist_cjs32(); + var util_defaults_mode_node_1 = require_dist_cjs42(); + var smithy_client_2 = require_dist_cjs32(); + var getRuntimeConfig = (config) => { + (0, smithy_client_2.emitWarningIfUnsupportedVersion)(process.version); + const defaultsMode = (0, util_defaults_mode_node_1.resolveDefaultsModeConfig)(config); + const defaultConfigProvider = () => defaultsMode().then(smithy_client_1.loadConfigsForDefaultMode); + const clientSharedValues = (0, runtimeConfig_shared_1.getRuntimeConfig)(config); + (0, core_1.emitWarningIfUnsupportedVersion)(process.version); + return { + ...clientSharedValues, + ...config, + runtime: "node", + defaultsMode, + bodyLengthChecker: config?.bodyLengthChecker ?? util_body_length_node_1.calculateBodyLength, + credentialDefaultProvider: config?.credentialDefaultProvider ?? credential_provider_node_1.defaultProvider, + defaultUserAgentProvider: config?.defaultUserAgentProvider ?? (0, util_user_agent_node_1.defaultUserAgent)({ serviceId: clientSharedValues.serviceId, clientVersion: package_json_1.default.version }), + maxAttempts: config?.maxAttempts ?? (0, node_config_provider_1.loadConfig)(middleware_retry_1.NODE_MAX_ATTEMPT_CONFIG_OPTIONS), + region: config?.region ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_REGION_CONFIG_OPTIONS, config_resolver_1.NODE_REGION_CONFIG_FILE_OPTIONS), + requestHandler: node_http_handler_1.NodeHttpHandler.create(config?.requestHandler ?? defaultConfigProvider), + retryMode: config?.retryMode ?? (0, node_config_provider_1.loadConfig)({ + ...middleware_retry_1.NODE_RETRY_MODE_CONFIG_OPTIONS, + default: async () => (await defaultConfigProvider()).retryMode || util_retry_1.DEFAULT_RETRY_MODE + }), + sha256: config?.sha256 ?? hash_node_1.Hash.bind(null, "sha256"), + streamCollector: config?.streamCollector ?? node_http_handler_1.streamCollector, + useDualstackEndpoint: config?.useDualstackEndpoint ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS), + useFipsEndpoint: config?.useFipsEndpoint ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS) + }; + }; + exports2.getRuntimeConfig = getRuntimeConfig; + } +}); + +// node_modules/@aws-sdk/client-kms/dist-cjs/index.js +var require_dist_cjs53 = __commonJS({ + "node_modules/@aws-sdk/client-kms/dist-cjs/index.js"(exports2, module2) { + "use strict"; + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); + }; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + } + return to; + }; + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + AlgorithmSpec: () => AlgorithmSpec, + AlreadyExistsException: () => AlreadyExistsException, + CancelKeyDeletionCommand: () => CancelKeyDeletionCommand, + CloudHsmClusterInUseException: () => CloudHsmClusterInUseException, + CloudHsmClusterInvalidConfigurationException: () => CloudHsmClusterInvalidConfigurationException, + CloudHsmClusterNotActiveException: () => CloudHsmClusterNotActiveException, + CloudHsmClusterNotFoundException: () => CloudHsmClusterNotFoundException, + CloudHsmClusterNotRelatedException: () => CloudHsmClusterNotRelatedException, + ConflictException: () => ConflictException, + ConnectCustomKeyStoreCommand: () => ConnectCustomKeyStoreCommand, + ConnectionErrorCodeType: () => ConnectionErrorCodeType, + ConnectionStateType: () => ConnectionStateType, + CreateAliasCommand: () => CreateAliasCommand, + CreateCustomKeyStoreCommand: () => CreateCustomKeyStoreCommand, + CreateCustomKeyStoreRequestFilterSensitiveLog: () => CreateCustomKeyStoreRequestFilterSensitiveLog, + CreateGrantCommand: () => CreateGrantCommand, + CreateKeyCommand: () => CreateKeyCommand, + CustomKeyStoreHasCMKsException: () => CustomKeyStoreHasCMKsException, + CustomKeyStoreInvalidStateException: () => CustomKeyStoreInvalidStateException, + CustomKeyStoreNameInUseException: () => CustomKeyStoreNameInUseException, + CustomKeyStoreNotFoundException: () => CustomKeyStoreNotFoundException, + CustomKeyStoreType: () => CustomKeyStoreType, + CustomKeyStoresListEntryFilterSensitiveLog: () => CustomKeyStoresListEntryFilterSensitiveLog, + CustomerMasterKeySpec: () => CustomerMasterKeySpec, + DataKeyPairSpec: () => DataKeyPairSpec, + DataKeySpec: () => DataKeySpec, + DecryptCommand: () => DecryptCommand, + DecryptResponseFilterSensitiveLog: () => DecryptResponseFilterSensitiveLog, + DeleteAliasCommand: () => DeleteAliasCommand, + DeleteCustomKeyStoreCommand: () => DeleteCustomKeyStoreCommand, + DeleteImportedKeyMaterialCommand: () => DeleteImportedKeyMaterialCommand, + DependencyTimeoutException: () => DependencyTimeoutException, + DeriveSharedSecretCommand: () => DeriveSharedSecretCommand, + DeriveSharedSecretResponseFilterSensitiveLog: () => DeriveSharedSecretResponseFilterSensitiveLog, + DescribeCustomKeyStoresCommand: () => DescribeCustomKeyStoresCommand, + DescribeCustomKeyStoresResponseFilterSensitiveLog: () => DescribeCustomKeyStoresResponseFilterSensitiveLog, + DescribeKeyCommand: () => DescribeKeyCommand, + DisableKeyCommand: () => DisableKeyCommand, + DisableKeyRotationCommand: () => DisableKeyRotationCommand, + DisabledException: () => DisabledException, + DisconnectCustomKeyStoreCommand: () => DisconnectCustomKeyStoreCommand, + DryRunOperationException: () => DryRunOperationException, + EnableKeyCommand: () => EnableKeyCommand, + EnableKeyRotationCommand: () => EnableKeyRotationCommand, + EncryptCommand: () => EncryptCommand, + EncryptRequestFilterSensitiveLog: () => EncryptRequestFilterSensitiveLog, + EncryptionAlgorithmSpec: () => EncryptionAlgorithmSpec, + ExpirationModelType: () => ExpirationModelType, + ExpiredImportTokenException: () => ExpiredImportTokenException, + GenerateDataKeyCommand: () => GenerateDataKeyCommand, + GenerateDataKeyPairCommand: () => GenerateDataKeyPairCommand, + GenerateDataKeyPairResponseFilterSensitiveLog: () => GenerateDataKeyPairResponseFilterSensitiveLog, + GenerateDataKeyPairWithoutPlaintextCommand: () => GenerateDataKeyPairWithoutPlaintextCommand, + GenerateDataKeyResponseFilterSensitiveLog: () => GenerateDataKeyResponseFilterSensitiveLog, + GenerateDataKeyWithoutPlaintextCommand: () => GenerateDataKeyWithoutPlaintextCommand, + GenerateMacCommand: () => GenerateMacCommand, + GenerateMacRequestFilterSensitiveLog: () => GenerateMacRequestFilterSensitiveLog, + GenerateRandomCommand: () => GenerateRandomCommand, + GenerateRandomResponseFilterSensitiveLog: () => GenerateRandomResponseFilterSensitiveLog, + GetKeyPolicyCommand: () => GetKeyPolicyCommand, + GetKeyRotationStatusCommand: () => GetKeyRotationStatusCommand, + GetParametersForImportCommand: () => GetParametersForImportCommand, + GetParametersForImportResponseFilterSensitiveLog: () => GetParametersForImportResponseFilterSensitiveLog, + GetPublicKeyCommand: () => GetPublicKeyCommand, + GrantOperation: () => GrantOperation, + ImportKeyMaterialCommand: () => ImportKeyMaterialCommand, + IncorrectKeyException: () => IncorrectKeyException, + IncorrectKeyMaterialException: () => IncorrectKeyMaterialException, + IncorrectTrustAnchorException: () => IncorrectTrustAnchorException, + InvalidAliasNameException: () => InvalidAliasNameException, + InvalidArnException: () => InvalidArnException, + InvalidCiphertextException: () => InvalidCiphertextException, + InvalidGrantIdException: () => InvalidGrantIdException, + InvalidGrantTokenException: () => InvalidGrantTokenException, + InvalidImportTokenException: () => InvalidImportTokenException, + InvalidKeyUsageException: () => InvalidKeyUsageException, + InvalidMarkerException: () => InvalidMarkerException, + KMS: () => KMS, + KMSClient: () => KMSClient2, + KMSInternalException: () => KMSInternalException, + KMSInvalidMacException: () => KMSInvalidMacException, + KMSInvalidSignatureException: () => KMSInvalidSignatureException, + KMSInvalidStateException: () => KMSInvalidStateException, + KMSServiceException: () => KMSServiceException, + KeyAgreementAlgorithmSpec: () => KeyAgreementAlgorithmSpec, + KeyEncryptionMechanism: () => KeyEncryptionMechanism, + KeyManagerType: () => KeyManagerType, + KeySpec: () => KeySpec, + KeyState: () => KeyState, + KeyUnavailableException: () => KeyUnavailableException, + KeyUsageType: () => KeyUsageType, + LimitExceededException: () => LimitExceededException, + ListAliasesCommand: () => ListAliasesCommand, + ListGrantsCommand: () => ListGrantsCommand, + ListKeyPoliciesCommand: () => ListKeyPoliciesCommand, + ListKeyRotationsCommand: () => ListKeyRotationsCommand, + ListKeysCommand: () => ListKeysCommand, + ListResourceTagsCommand: () => ListResourceTagsCommand, + ListRetirableGrantsCommand: () => ListRetirableGrantsCommand, + MacAlgorithmSpec: () => MacAlgorithmSpec, + MalformedPolicyDocumentException: () => MalformedPolicyDocumentException, + MessageType: () => MessageType, + MultiRegionKeyType: () => MultiRegionKeyType, + NotFoundException: () => NotFoundException, + OriginType: () => OriginType, + PutKeyPolicyCommand: () => PutKeyPolicyCommand, + ReEncryptCommand: () => ReEncryptCommand, + ReplicateKeyCommand: () => ReplicateKeyCommand, + RetireGrantCommand: () => RetireGrantCommand, + RevokeGrantCommand: () => RevokeGrantCommand, + RotateKeyOnDemandCommand: () => RotateKeyOnDemandCommand, + RotationType: () => RotationType, + ScheduleKeyDeletionCommand: () => ScheduleKeyDeletionCommand, + SignCommand: () => SignCommand2, + SignRequestFilterSensitiveLog: () => SignRequestFilterSensitiveLog, + SigningAlgorithmSpec: () => SigningAlgorithmSpec, + TagException: () => TagException, + TagResourceCommand: () => TagResourceCommand, + UnsupportedOperationException: () => UnsupportedOperationException, + UntagResourceCommand: () => UntagResourceCommand, + UpdateAliasCommand: () => UpdateAliasCommand, + UpdateCustomKeyStoreCommand: () => UpdateCustomKeyStoreCommand, + UpdateCustomKeyStoreRequestFilterSensitiveLog: () => UpdateCustomKeyStoreRequestFilterSensitiveLog, + UpdateKeyDescriptionCommand: () => UpdateKeyDescriptionCommand, + UpdatePrimaryRegionCommand: () => UpdatePrimaryRegionCommand, + VerifyCommand: () => VerifyCommand, + VerifyMacCommand: () => VerifyMacCommand, + VerifyMacRequestFilterSensitiveLog: () => VerifyMacRequestFilterSensitiveLog, + VerifyRequestFilterSensitiveLog: () => VerifyRequestFilterSensitiveLog, + WrappingKeySpec: () => WrappingKeySpec, + XksKeyAlreadyInUseException: () => XksKeyAlreadyInUseException, + XksKeyInvalidConfigurationException: () => XksKeyInvalidConfigurationException, + XksKeyNotFoundException: () => XksKeyNotFoundException, + XksProxyAuthenticationCredentialTypeFilterSensitiveLog: () => XksProxyAuthenticationCredentialTypeFilterSensitiveLog, + XksProxyConfigurationTypeFilterSensitiveLog: () => XksProxyConfigurationTypeFilterSensitiveLog, + XksProxyConnectivityType: () => XksProxyConnectivityType, + XksProxyIncorrectAuthenticationCredentialException: () => XksProxyIncorrectAuthenticationCredentialException, + XksProxyInvalidConfigurationException: () => XksProxyInvalidConfigurationException, + XksProxyInvalidResponseException: () => XksProxyInvalidResponseException, + XksProxyUriEndpointInUseException: () => XksProxyUriEndpointInUseException, + XksProxyUriInUseException: () => XksProxyUriInUseException, + XksProxyUriUnreachableException: () => XksProxyUriUnreachableException, + XksProxyVpcEndpointServiceInUseException: () => XksProxyVpcEndpointServiceInUseException, + XksProxyVpcEndpointServiceInvalidConfigurationException: () => XksProxyVpcEndpointServiceInvalidConfigurationException, + XksProxyVpcEndpointServiceNotFoundException: () => XksProxyVpcEndpointServiceNotFoundException, + __Client: () => import_smithy_client5.Client, + paginateDescribeCustomKeyStores: () => paginateDescribeCustomKeyStores, + paginateListAliases: () => paginateListAliases, + paginateListGrants: () => paginateListGrants, + paginateListKeyPolicies: () => paginateListKeyPolicies, + paginateListKeyRotations: () => paginateListKeyRotations, + paginateListKeys: () => paginateListKeys, + paginateListResourceTags: () => paginateListResourceTags, + paginateListRetirableGrants: () => paginateListRetirableGrants + }); + module2.exports = __toCommonJS2(src_exports); + var import_middleware_host_header = require_dist_cjs3(); + var import_middleware_logger = require_dist_cjs4(); + var import_middleware_recursion_detection = require_dist_cjs5(); + var import_middleware_user_agent = require_dist_cjs8(); + var import_config_resolver = require_dist_cjs11(); + var import_core5 = (init_dist_es(), __toCommonJS(dist_es_exports)); + var import_middleware_content_length = require_dist_cjs34(); + var import_middleware_endpoint2 = require_dist_cjs18(); + var import_middleware_retry2 = require_dist_cjs33(); + var import_httpAuthSchemeProvider = require_httpAuthSchemeProvider(); + var resolveClientEndpointParameters = /* @__PURE__ */ __name((options) => { + return { + ...options, + useDualstackEndpoint: options.useDualstackEndpoint ?? false, + useFipsEndpoint: options.useFipsEndpoint ?? false, + defaultSigningName: "kms" + }; + }, "resolveClientEndpointParameters"); + var commonParams = { + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" } + }; + var import_runtimeConfig = require_runtimeConfig4(); + var import_region_config_resolver = require_dist_cjs43(); + var import_protocol_http8 = require_dist_cjs2(); + var import_smithy_client5 = require_dist_cjs32(); + var getHttpAuthExtensionConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { + const _httpAuthSchemes = runtimeConfig.httpAuthSchemes; + let _httpAuthSchemeProvider = runtimeConfig.httpAuthSchemeProvider; + let _credentials = runtimeConfig.credentials; + return { + setHttpAuthScheme(httpAuthScheme) { + const index = _httpAuthSchemes.findIndex((scheme) => scheme.schemeId === httpAuthScheme.schemeId); + if (index === -1) { + _httpAuthSchemes.push(httpAuthScheme); } else { - socket.destroy(err).on("close", callback); + _httpAuthSchemes.splice(index, 1, httpAuthScheme); } }, - get destroyed() { - return socket.destroyed; + httpAuthSchemes() { + return _httpAuthSchemes; }, - busy(request2) { - if (socket[kWriting] || socket[kReset] || socket[kBlocking]) { - return true; - } - if (request2) { - if (client[kRunning] > 0 && !request2.idempotent) { - return true; - } - if (client[kRunning] > 0 && (request2.upgrade || request2.method === "CONNECT")) { - return true; - } - if (client[kRunning] > 0 && util.bodyLength(request2.body) !== 0 && (util.isStream(request2.body) || util.isAsyncIterable(request2.body) || util.isFormDataLike(request2.body))) { - return true; - } - } - return false; + setHttpAuthSchemeProvider(httpAuthSchemeProvider) { + _httpAuthSchemeProvider = httpAuthSchemeProvider; + }, + httpAuthSchemeProvider() { + return _httpAuthSchemeProvider; + }, + setCredentials(credentials) { + _credentials = credentials; + }, + credentials() { + return _credentials; } }; - } - function resumeH1(client) { - const socket = client[kSocket]; - if (socket && !socket.destroyed) { - if (client[kSize] === 0) { - if (!socket[kNoRef] && socket.unref) { - socket.unref(); - socket[kNoRef] = true; - } - } else if (socket[kNoRef] && socket.ref) { - socket.ref(); - socket[kNoRef] = false; - } - if (client[kSize] === 0) { - if (socket[kParser].timeoutType !== TIMEOUT_IDLE) { - socket[kParser].setTimeout(client[kKeepAliveTimeoutValue], TIMEOUT_IDLE); - } - } else if (client[kRunning] > 0 && socket[kParser].statusCode < 200) { - if (socket[kParser].timeoutType !== TIMEOUT_HEADERS) { - const request2 = client[kQueue][client[kRunningIdx]]; - const headersTimeout = request2.headersTimeout != null ? request2.headersTimeout : client[kHeadersTimeout]; - socket[kParser].setTimeout(headersTimeout, TIMEOUT_HEADERS); - } - } - } - } - function shouldSendContentLength(method) { - return method !== "GET" && method !== "HEAD" && method !== "OPTIONS" && method !== "TRACE" && method !== "CONNECT"; - } - function writeH1(client, request2) { - const { method, path, host, upgrade, blocking, reset } = request2; - let { body, headers, contentLength } = request2; - const expectsPayload = method === "PUT" || method === "POST" || method === "PATCH"; - if (util.isFormDataLike(body)) { - if (!extractBody) { - extractBody = require_body2().extractBody; - } - const [bodyStream, contentType] = extractBody(body); - if (request2.contentType == null) { - headers.push("content-type", contentType); - } - body = bodyStream.stream; - contentLength = bodyStream.length; - } else if (util.isBlobLike(body) && request2.contentType == null && body.type) { - headers.push("content-type", body.type); + }, "getHttpAuthExtensionConfiguration"); + var resolveHttpAuthRuntimeConfig = /* @__PURE__ */ __name((config) => { + return { + httpAuthSchemes: config.httpAuthSchemes(), + httpAuthSchemeProvider: config.httpAuthSchemeProvider(), + credentials: config.credentials() + }; + }, "resolveHttpAuthRuntimeConfig"); + var asPartial = /* @__PURE__ */ __name((t) => t, "asPartial"); + var resolveRuntimeExtensions = /* @__PURE__ */ __name((runtimeConfig, extensions) => { + const extensionConfiguration = { + ...asPartial((0, import_region_config_resolver.getAwsRegionExtensionConfiguration)(runtimeConfig)), + ...asPartial((0, import_smithy_client5.getDefaultExtensionConfiguration)(runtimeConfig)), + ...asPartial((0, import_protocol_http8.getHttpHandlerExtensionConfiguration)(runtimeConfig)), + ...asPartial(getHttpAuthExtensionConfiguration(runtimeConfig)) + }; + extensions.forEach((extension) => extension.configure(extensionConfiguration)); + return { + ...runtimeConfig, + ...(0, import_region_config_resolver.resolveAwsRegionExtensionConfiguration)(extensionConfiguration), + ...(0, import_smithy_client5.resolveDefaultRuntimeConfig)(extensionConfiguration), + ...(0, import_protocol_http8.resolveHttpHandlerRuntimeConfig)(extensionConfiguration), + ...resolveHttpAuthRuntimeConfig(extensionConfiguration) + }; + }, "resolveRuntimeExtensions"); + var _KMSClient = class _KMSClient extends import_smithy_client5.Client { + constructor(...[configuration]) { + const _config_0 = (0, import_runtimeConfig.getRuntimeConfig)(configuration || {}); + const _config_1 = resolveClientEndpointParameters(_config_0); + const _config_2 = (0, import_middleware_user_agent.resolveUserAgentConfig)(_config_1); + const _config_3 = (0, import_middleware_retry2.resolveRetryConfig)(_config_2); + const _config_4 = (0, import_config_resolver.resolveRegionConfig)(_config_3); + const _config_5 = (0, import_middleware_host_header.resolveHostHeaderConfig)(_config_4); + const _config_6 = (0, import_middleware_endpoint2.resolveEndpointConfig)(_config_5); + const _config_7 = (0, import_httpAuthSchemeProvider.resolveHttpAuthSchemeConfig)(_config_6); + const _config_8 = resolveRuntimeExtensions(_config_7, (configuration == null ? void 0 : configuration.extensions) || []); + super(_config_8); + this.config = _config_8; + this.middlewareStack.use((0, import_middleware_user_agent.getUserAgentPlugin)(this.config)); + this.middlewareStack.use((0, import_middleware_retry2.getRetryPlugin)(this.config)); + this.middlewareStack.use((0, import_middleware_content_length.getContentLengthPlugin)(this.config)); + this.middlewareStack.use((0, import_middleware_host_header.getHostHeaderPlugin)(this.config)); + this.middlewareStack.use((0, import_middleware_logger.getLoggerPlugin)(this.config)); + this.middlewareStack.use((0, import_middleware_recursion_detection.getRecursionDetectionPlugin)(this.config)); + this.middlewareStack.use( + (0, import_core5.getHttpAuthSchemeEndpointRuleSetPlugin)(this.config, { + httpAuthSchemeParametersProvider: import_httpAuthSchemeProvider.defaultKMSHttpAuthSchemeParametersProvider, + identityProviderConfigProvider: async (config) => new import_core5.DefaultIdentityProviderConfig({ + "aws.auth#sigv4": config.credentials + }) + }) + ); + this.middlewareStack.use((0, import_core5.getHttpSigningPlugin)(this.config)); } - if (body && typeof body.read === "function") { - body.read(0); + /** + * Destroy underlying resources, like sockets. It's usually not necessary to do this. + * However in Node.js, it's best to explicitly shut down the client's agent when it is no longer needed. + * Otherwise, sockets might stay open for quite a long time before the server terminates them. + */ + destroy() { + super.destroy(); } - const bodyLength = util.bodyLength(body); - contentLength = bodyLength ?? contentLength; - if (contentLength === null) { - contentLength = request2.contentLength; + }; + __name(_KMSClient, "KMSClient"); + var KMSClient2 = _KMSClient; + var import_middleware_serde2 = require_dist_cjs17(); + var import_core22 = (init_dist_es2(), __toCommonJS(dist_es_exports2)); + var _KMSServiceException = class _KMSServiceException2 extends import_smithy_client5.ServiceException { + /** + * @internal + */ + constructor(options) { + super(options); + Object.setPrototypeOf(this, _KMSServiceException2.prototype); } - if (contentLength === 0 && !expectsPayload) { - contentLength = null; + }; + __name(_KMSServiceException, "KMSServiceException"); + var KMSServiceException = _KMSServiceException; + var AlgorithmSpec = { + RSAES_OAEP_SHA_1: "RSAES_OAEP_SHA_1", + RSAES_OAEP_SHA_256: "RSAES_OAEP_SHA_256", + RSAES_PKCS1_V1_5: "RSAES_PKCS1_V1_5", + RSA_AES_KEY_WRAP_SHA_1: "RSA_AES_KEY_WRAP_SHA_1", + RSA_AES_KEY_WRAP_SHA_256: "RSA_AES_KEY_WRAP_SHA_256", + SM2PKE: "SM2PKE" + }; + var _AlreadyExistsException = class _AlreadyExistsException2 extends KMSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "AlreadyExistsException", + $fault: "client", + ...opts + }); + this.name = "AlreadyExistsException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _AlreadyExistsException2.prototype); } - if (shouldSendContentLength(method) && contentLength > 0 && request2.contentLength !== null && request2.contentLength !== contentLength) { - if (client[kStrictContentLength]) { - util.errorRequest(client, request2, new RequestContentLengthMismatchError()); - return false; - } - process.emitWarning(new RequestContentLengthMismatchError()); + }; + __name(_AlreadyExistsException, "AlreadyExistsException"); + var AlreadyExistsException = _AlreadyExistsException; + var _DependencyTimeoutException = class _DependencyTimeoutException2 extends KMSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "DependencyTimeoutException", + $fault: "server", + ...opts + }); + this.name = "DependencyTimeoutException"; + this.$fault = "server"; + Object.setPrototypeOf(this, _DependencyTimeoutException2.prototype); } - const socket = client[kSocket]; - const abort = (err) => { - if (request2.aborted || request2.completed) { - return; - } - util.errorRequest(client, request2, err || new RequestAbortedError()); - util.destroy(body); - util.destroy(socket, new InformationalError("aborted")); - }; - try { - request2.onConnect(abort); - } catch (err) { - util.errorRequest(client, request2, err); + }; + __name(_DependencyTimeoutException, "DependencyTimeoutException"); + var DependencyTimeoutException = _DependencyTimeoutException; + var _InvalidArnException = class _InvalidArnException2 extends KMSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "InvalidArnException", + $fault: "client", + ...opts + }); + this.name = "InvalidArnException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _InvalidArnException2.prototype); } - if (request2.aborted) { - return false; + }; + __name(_InvalidArnException, "InvalidArnException"); + var InvalidArnException = _InvalidArnException; + var _KMSInternalException = class _KMSInternalException2 extends KMSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "KMSInternalException", + $fault: "server", + ...opts + }); + this.name = "KMSInternalException"; + this.$fault = "server"; + Object.setPrototypeOf(this, _KMSInternalException2.prototype); } - if (method === "HEAD") { - socket[kReset] = true; + }; + __name(_KMSInternalException, "KMSInternalException"); + var KMSInternalException = _KMSInternalException; + var _KMSInvalidStateException = class _KMSInvalidStateException2 extends KMSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "KMSInvalidStateException", + $fault: "client", + ...opts + }); + this.name = "KMSInvalidStateException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _KMSInvalidStateException2.prototype); } - if (upgrade || method === "CONNECT") { - socket[kReset] = true; + }; + __name(_KMSInvalidStateException, "KMSInvalidStateException"); + var KMSInvalidStateException = _KMSInvalidStateException; + var _NotFoundException = class _NotFoundException2 extends KMSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "NotFoundException", + $fault: "client", + ...opts + }); + this.name = "NotFoundException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _NotFoundException2.prototype); } - if (reset != null) { - socket[kReset] = reset; + }; + __name(_NotFoundException, "NotFoundException"); + var NotFoundException = _NotFoundException; + var _CloudHsmClusterInUseException = class _CloudHsmClusterInUseException2 extends KMSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "CloudHsmClusterInUseException", + $fault: "client", + ...opts + }); + this.name = "CloudHsmClusterInUseException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _CloudHsmClusterInUseException2.prototype); } - if (client[kMaxRequests] && socket[kCounter]++ >= client[kMaxRequests]) { - socket[kReset] = true; + }; + __name(_CloudHsmClusterInUseException, "CloudHsmClusterInUseException"); + var CloudHsmClusterInUseException = _CloudHsmClusterInUseException; + var _CloudHsmClusterInvalidConfigurationException = class _CloudHsmClusterInvalidConfigurationException2 extends KMSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "CloudHsmClusterInvalidConfigurationException", + $fault: "client", + ...opts + }); + this.name = "CloudHsmClusterInvalidConfigurationException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _CloudHsmClusterInvalidConfigurationException2.prototype); } - if (blocking) { - socket[kBlocking] = true; + }; + __name(_CloudHsmClusterInvalidConfigurationException, "CloudHsmClusterInvalidConfigurationException"); + var CloudHsmClusterInvalidConfigurationException = _CloudHsmClusterInvalidConfigurationException; + var _CloudHsmClusterNotActiveException = class _CloudHsmClusterNotActiveException2 extends KMSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "CloudHsmClusterNotActiveException", + $fault: "client", + ...opts + }); + this.name = "CloudHsmClusterNotActiveException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _CloudHsmClusterNotActiveException2.prototype); } - let header = `${method} ${path} HTTP/1.1\r -`; - if (typeof host === "string") { - header += `host: ${host}\r -`; - } else { - header += client[kHostHeader]; + }; + __name(_CloudHsmClusterNotActiveException, "CloudHsmClusterNotActiveException"); + var CloudHsmClusterNotActiveException = _CloudHsmClusterNotActiveException; + var _CloudHsmClusterNotFoundException = class _CloudHsmClusterNotFoundException2 extends KMSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "CloudHsmClusterNotFoundException", + $fault: "client", + ...opts + }); + this.name = "CloudHsmClusterNotFoundException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _CloudHsmClusterNotFoundException2.prototype); } - if (upgrade) { - header += `connection: upgrade\r -upgrade: ${upgrade}\r -`; - } else if (client[kPipelining] && !socket[kReset]) { - header += "connection: keep-alive\r\n"; - } else { - header += "connection: close\r\n"; + }; + __name(_CloudHsmClusterNotFoundException, "CloudHsmClusterNotFoundException"); + var CloudHsmClusterNotFoundException = _CloudHsmClusterNotFoundException; + var _CloudHsmClusterNotRelatedException = class _CloudHsmClusterNotRelatedException2 extends KMSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "CloudHsmClusterNotRelatedException", + $fault: "client", + ...opts + }); + this.name = "CloudHsmClusterNotRelatedException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _CloudHsmClusterNotRelatedException2.prototype); } - if (Array.isArray(headers)) { - for (let n = 0; n < headers.length; n += 2) { - const key = headers[n + 0]; - const val = headers[n + 1]; - if (Array.isArray(val)) { - for (let i = 0; i < val.length; i++) { - header += `${key}: ${val[i]}\r -`; - } - } else { - header += `${key}: ${val}\r -`; - } - } + }; + __name(_CloudHsmClusterNotRelatedException, "CloudHsmClusterNotRelatedException"); + var CloudHsmClusterNotRelatedException = _CloudHsmClusterNotRelatedException; + var _ConflictException = class _ConflictException2 extends KMSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "ConflictException", + $fault: "client", + ...opts + }); + this.name = "ConflictException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _ConflictException2.prototype); } - if (channels.sendHeaders.hasSubscribers) { - channels.sendHeaders.publish({ request: request2, headers: header, socket }); + }; + __name(_ConflictException, "ConflictException"); + var ConflictException = _ConflictException; + var _CustomKeyStoreInvalidStateException = class _CustomKeyStoreInvalidStateException2 extends KMSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "CustomKeyStoreInvalidStateException", + $fault: "client", + ...opts + }); + this.name = "CustomKeyStoreInvalidStateException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _CustomKeyStoreInvalidStateException2.prototype); } - if (!body || bodyLength === 0) { - writeBuffer({ abort, body: null, client, request: request2, socket, contentLength, header, expectsPayload }); - } else if (util.isBuffer(body)) { - writeBuffer({ abort, body, client, request: request2, socket, contentLength, header, expectsPayload }); - } else if (util.isBlobLike(body)) { - if (typeof body.stream === "function") { - writeIterable({ abort, body: body.stream(), client, request: request2, socket, contentLength, header, expectsPayload }); - } else { - writeBlob({ abort, body, client, request: request2, socket, contentLength, header, expectsPayload }); - } - } else if (util.isStream(body)) { - writeStream({ abort, body, client, request: request2, socket, contentLength, header, expectsPayload }); - } else if (util.isIterable(body)) { - writeIterable({ abort, body, client, request: request2, socket, contentLength, header, expectsPayload }); - } else { - assert(false); + }; + __name(_CustomKeyStoreInvalidStateException, "CustomKeyStoreInvalidStateException"); + var CustomKeyStoreInvalidStateException = _CustomKeyStoreInvalidStateException; + var _CustomKeyStoreNotFoundException = class _CustomKeyStoreNotFoundException2 extends KMSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "CustomKeyStoreNotFoundException", + $fault: "client", + ...opts + }); + this.name = "CustomKeyStoreNotFoundException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _CustomKeyStoreNotFoundException2.prototype); + } + }; + __name(_CustomKeyStoreNotFoundException, "CustomKeyStoreNotFoundException"); + var CustomKeyStoreNotFoundException = _CustomKeyStoreNotFoundException; + var ConnectionErrorCodeType = { + CLUSTER_NOT_FOUND: "CLUSTER_NOT_FOUND", + INSUFFICIENT_CLOUDHSM_HSMS: "INSUFFICIENT_CLOUDHSM_HSMS", + INSUFFICIENT_FREE_ADDRESSES_IN_SUBNET: "INSUFFICIENT_FREE_ADDRESSES_IN_SUBNET", + INTERNAL_ERROR: "INTERNAL_ERROR", + INVALID_CREDENTIALS: "INVALID_CREDENTIALS", + NETWORK_ERRORS: "NETWORK_ERRORS", + SUBNET_NOT_FOUND: "SUBNET_NOT_FOUND", + USER_LOCKED_OUT: "USER_LOCKED_OUT", + USER_LOGGED_IN: "USER_LOGGED_IN", + USER_NOT_FOUND: "USER_NOT_FOUND", + XKS_PROXY_ACCESS_DENIED: "XKS_PROXY_ACCESS_DENIED", + XKS_PROXY_INVALID_CONFIGURATION: "XKS_PROXY_INVALID_CONFIGURATION", + XKS_PROXY_INVALID_RESPONSE: "XKS_PROXY_INVALID_RESPONSE", + XKS_PROXY_INVALID_TLS_CONFIGURATION: "XKS_PROXY_INVALID_TLS_CONFIGURATION", + XKS_PROXY_NOT_REACHABLE: "XKS_PROXY_NOT_REACHABLE", + XKS_PROXY_TIMED_OUT: "XKS_PROXY_TIMED_OUT", + XKS_VPC_ENDPOINT_SERVICE_INVALID_CONFIGURATION: "XKS_VPC_ENDPOINT_SERVICE_INVALID_CONFIGURATION", + XKS_VPC_ENDPOINT_SERVICE_NOT_FOUND: "XKS_VPC_ENDPOINT_SERVICE_NOT_FOUND" + }; + var ConnectionStateType = { + CONNECTED: "CONNECTED", + CONNECTING: "CONNECTING", + DISCONNECTED: "DISCONNECTED", + DISCONNECTING: "DISCONNECTING", + FAILED: "FAILED" + }; + var _InvalidAliasNameException = class _InvalidAliasNameException2 extends KMSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "InvalidAliasNameException", + $fault: "client", + ...opts + }); + this.name = "InvalidAliasNameException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _InvalidAliasNameException2.prototype); } - return true; - } - function writeStream({ abort, body, client, request: request2, socket, contentLength, header, expectsPayload }) { - assert(contentLength !== 0 || client[kRunning] === 0, "stream body cannot be pipelined"); - let finished = false; - const writer = new AsyncWriter({ abort, socket, request: request2, contentLength, client, expectsPayload, header }); - const onData = function(chunk) { - if (finished) { - return; - } - try { - if (!writer.write(chunk) && this.pause) { - this.pause(); - } - } catch (err) { - util.destroy(this, err); - } - }; - const onDrain = function() { - if (finished) { - return; - } - if (body.resume) { - body.resume(); - } - }; - const onClose = function() { - queueMicrotask(() => { - body.removeListener("error", onFinished); + }; + __name(_InvalidAliasNameException, "InvalidAliasNameException"); + var InvalidAliasNameException = _InvalidAliasNameException; + var _LimitExceededException = class _LimitExceededException2 extends KMSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "LimitExceededException", + $fault: "client", + ...opts }); - if (!finished) { - const err = new RequestAbortedError(); - queueMicrotask(() => onFinished(err)); - } - }; - const onFinished = function(err) { - if (finished) { - return; - } - finished = true; - assert(socket.destroyed || socket[kWriting] && client[kRunning] <= 1); - socket.off("drain", onDrain).off("error", onFinished); - body.removeListener("data", onData).removeListener("end", onFinished).removeListener("close", onClose); - if (!err) { - try { - writer.end(); - } catch (er) { - err = er; - } - } - writer.destroy(err); - if (err && (err.code !== "UND_ERR_INFO" || err.message !== "reset")) { - util.destroy(body, err); - } else { - util.destroy(body); - } - }; - body.on("data", onData).on("end", onFinished).on("error", onFinished).on("close", onClose); - if (body.resume) { - body.resume(); + this.name = "LimitExceededException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _LimitExceededException2.prototype); } - socket.on("drain", onDrain).on("error", onFinished); - if (body.errorEmitted ?? body.errored) { - setImmediate(() => onFinished(body.errored)); - } else if (body.endEmitted ?? body.readableEnded) { - setImmediate(() => onFinished(null)); + }; + __name(_LimitExceededException, "LimitExceededException"); + var LimitExceededException = _LimitExceededException; + var CustomKeyStoreType = { + AWS_CLOUDHSM: "AWS_CLOUDHSM", + EXTERNAL_KEY_STORE: "EXTERNAL_KEY_STORE" + }; + var XksProxyConnectivityType = { + PUBLIC_ENDPOINT: "PUBLIC_ENDPOINT", + VPC_ENDPOINT_SERVICE: "VPC_ENDPOINT_SERVICE" + }; + var _CustomKeyStoreNameInUseException = class _CustomKeyStoreNameInUseException2 extends KMSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "CustomKeyStoreNameInUseException", + $fault: "client", + ...opts + }); + this.name = "CustomKeyStoreNameInUseException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _CustomKeyStoreNameInUseException2.prototype); } - if (body.closeEmitted ?? body.closed) { - setImmediate(onClose); + }; + __name(_CustomKeyStoreNameInUseException, "CustomKeyStoreNameInUseException"); + var CustomKeyStoreNameInUseException = _CustomKeyStoreNameInUseException; + var _IncorrectTrustAnchorException = class _IncorrectTrustAnchorException2 extends KMSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "IncorrectTrustAnchorException", + $fault: "client", + ...opts + }); + this.name = "IncorrectTrustAnchorException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _IncorrectTrustAnchorException2.prototype); } - } - function writeBuffer({ abort, body, client, request: request2, socket, contentLength, header, expectsPayload }) { - try { - if (!body) { - if (contentLength === 0) { - socket.write(`${header}content-length: 0\r -\r -`, "latin1"); - } else { - assert(contentLength === null, "no body must not have content length"); - socket.write(`${header}\r -`, "latin1"); - } - } else if (util.isBuffer(body)) { - assert(contentLength === body.byteLength, "buffer body must have content length"); - socket.cork(); - socket.write(`${header}content-length: ${contentLength}\r -\r -`, "latin1"); - socket.write(body); - socket.uncork(); - request2.onBodySent(body); - if (!expectsPayload) { - socket[kReset] = true; - } - } - request2.onRequestSent(); - client[kResume](); - } catch (err) { - abort(err); + }; + __name(_IncorrectTrustAnchorException, "IncorrectTrustAnchorException"); + var IncorrectTrustAnchorException = _IncorrectTrustAnchorException; + var _XksProxyIncorrectAuthenticationCredentialException = class _XksProxyIncorrectAuthenticationCredentialException2 extends KMSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "XksProxyIncorrectAuthenticationCredentialException", + $fault: "client", + ...opts + }); + this.name = "XksProxyIncorrectAuthenticationCredentialException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _XksProxyIncorrectAuthenticationCredentialException2.prototype); } - } - async function writeBlob({ abort, body, client, request: request2, socket, contentLength, header, expectsPayload }) { - assert(contentLength === body.size, "blob body must have content length"); - try { - if (contentLength != null && contentLength !== body.size) { - throw new RequestContentLengthMismatchError(); - } - const buffer = Buffer.from(await body.arrayBuffer()); - socket.cork(); - socket.write(`${header}content-length: ${contentLength}\r -\r -`, "latin1"); - socket.write(buffer); - socket.uncork(); - request2.onBodySent(buffer); - request2.onRequestSent(); - if (!expectsPayload) { - socket[kReset] = true; - } - client[kResume](); - } catch (err) { - abort(err); + }; + __name(_XksProxyIncorrectAuthenticationCredentialException, "XksProxyIncorrectAuthenticationCredentialException"); + var XksProxyIncorrectAuthenticationCredentialException = _XksProxyIncorrectAuthenticationCredentialException; + var _XksProxyInvalidConfigurationException = class _XksProxyInvalidConfigurationException2 extends KMSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "XksProxyInvalidConfigurationException", + $fault: "client", + ...opts + }); + this.name = "XksProxyInvalidConfigurationException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _XksProxyInvalidConfigurationException2.prototype); } - } - async function writeIterable({ abort, body, client, request: request2, socket, contentLength, header, expectsPayload }) { - assert(contentLength !== 0 || client[kRunning] === 0, "iterator body cannot be pipelined"); - let callback = null; - function onDrain() { - if (callback) { - const cb = callback; - callback = null; - cb(); - } + }; + __name(_XksProxyInvalidConfigurationException, "XksProxyInvalidConfigurationException"); + var XksProxyInvalidConfigurationException = _XksProxyInvalidConfigurationException; + var _XksProxyInvalidResponseException = class _XksProxyInvalidResponseException2 extends KMSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "XksProxyInvalidResponseException", + $fault: "client", + ...opts + }); + this.name = "XksProxyInvalidResponseException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _XksProxyInvalidResponseException2.prototype); } - const waitForDrain = () => new Promise((resolve, reject) => { - assert(callback === null); - if (socket[kError]) { - reject(socket[kError]); - } else { - callback = resolve; - } - }); - socket.on("close", onDrain).on("drain", onDrain); - const writer = new AsyncWriter({ abort, socket, request: request2, contentLength, client, expectsPayload, header }); - try { - for await (const chunk of body) { - if (socket[kError]) { - throw socket[kError]; - } - if (!writer.write(chunk)) { - await waitForDrain(); - } - } - writer.end(); - } catch (err) { - writer.destroy(err); - } finally { - socket.off("close", onDrain).off("drain", onDrain); + }; + __name(_XksProxyInvalidResponseException, "XksProxyInvalidResponseException"); + var XksProxyInvalidResponseException = _XksProxyInvalidResponseException; + var _XksProxyUriEndpointInUseException = class _XksProxyUriEndpointInUseException2 extends KMSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "XksProxyUriEndpointInUseException", + $fault: "client", + ...opts + }); + this.name = "XksProxyUriEndpointInUseException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _XksProxyUriEndpointInUseException2.prototype); } - } - var AsyncWriter = class { - constructor({ abort, socket, request: request2, contentLength, client, expectsPayload, header }) { - this.socket = socket; - this.request = request2; - this.contentLength = contentLength; - this.client = client; - this.bytesWritten = 0; - this.expectsPayload = expectsPayload; - this.header = header; - this.abort = abort; - socket[kWriting] = true; + }; + __name(_XksProxyUriEndpointInUseException, "XksProxyUriEndpointInUseException"); + var XksProxyUriEndpointInUseException = _XksProxyUriEndpointInUseException; + var _XksProxyUriInUseException = class _XksProxyUriInUseException2 extends KMSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "XksProxyUriInUseException", + $fault: "client", + ...opts + }); + this.name = "XksProxyUriInUseException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _XksProxyUriInUseException2.prototype); } - write(chunk) { - const { socket, request: request2, contentLength, client, bytesWritten, expectsPayload, header } = this; - if (socket[kError]) { - throw socket[kError]; - } - if (socket.destroyed) { - return false; - } - const len = Buffer.byteLength(chunk); - if (!len) { - return true; - } - if (contentLength !== null && bytesWritten + len > contentLength) { - if (client[kStrictContentLength]) { - throw new RequestContentLengthMismatchError(); - } - process.emitWarning(new RequestContentLengthMismatchError()); - } - socket.cork(); - if (bytesWritten === 0) { - if (!expectsPayload) { - socket[kReset] = true; - } - if (contentLength === null) { - socket.write(`${header}transfer-encoding: chunked\r -`, "latin1"); - } else { - socket.write(`${header}content-length: ${contentLength}\r -\r -`, "latin1"); - } - } - if (contentLength === null) { - socket.write(`\r -${len.toString(16)}\r -`, "latin1"); - } - this.bytesWritten += len; - const ret = socket.write(chunk); - socket.uncork(); - request2.onBodySent(chunk); - if (!ret) { - if (socket[kParser].timeout && socket[kParser].timeoutType === TIMEOUT_HEADERS) { - if (socket[kParser].timeout.refresh) { - socket[kParser].timeout.refresh(); - } - } - } - return ret; + }; + __name(_XksProxyUriInUseException, "XksProxyUriInUseException"); + var XksProxyUriInUseException = _XksProxyUriInUseException; + var _XksProxyUriUnreachableException = class _XksProxyUriUnreachableException2 extends KMSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "XksProxyUriUnreachableException", + $fault: "client", + ...opts + }); + this.name = "XksProxyUriUnreachableException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _XksProxyUriUnreachableException2.prototype); } - end() { - const { socket, contentLength, client, bytesWritten, expectsPayload, header, request: request2 } = this; - request2.onRequestSent(); - socket[kWriting] = false; - if (socket[kError]) { - throw socket[kError]; - } - if (socket.destroyed) { - return; - } - if (bytesWritten === 0) { - if (expectsPayload) { - socket.write(`${header}content-length: 0\r -\r -`, "latin1"); - } else { - socket.write(`${header}\r -`, "latin1"); - } - } else if (contentLength === null) { - socket.write("\r\n0\r\n\r\n", "latin1"); - } - if (contentLength !== null && bytesWritten !== contentLength) { - if (client[kStrictContentLength]) { - throw new RequestContentLengthMismatchError(); - } else { - process.emitWarning(new RequestContentLengthMismatchError()); - } - } - if (socket[kParser].timeout && socket[kParser].timeoutType === TIMEOUT_HEADERS) { - if (socket[kParser].timeout.refresh) { - socket[kParser].timeout.refresh(); - } - } - client[kResume](); + }; + __name(_XksProxyUriUnreachableException, "XksProxyUriUnreachableException"); + var XksProxyUriUnreachableException = _XksProxyUriUnreachableException; + var _XksProxyVpcEndpointServiceInUseException = class _XksProxyVpcEndpointServiceInUseException2 extends KMSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "XksProxyVpcEndpointServiceInUseException", + $fault: "client", + ...opts + }); + this.name = "XksProxyVpcEndpointServiceInUseException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _XksProxyVpcEndpointServiceInUseException2.prototype); } - destroy(err) { - const { socket, client, abort } = this; - socket[kWriting] = false; - if (err) { - assert(client[kRunning] <= 1, "pipeline should only contain this request"); - abort(err); - } + }; + __name(_XksProxyVpcEndpointServiceInUseException, "XksProxyVpcEndpointServiceInUseException"); + var XksProxyVpcEndpointServiceInUseException = _XksProxyVpcEndpointServiceInUseException; + var _XksProxyVpcEndpointServiceInvalidConfigurationException = class _XksProxyVpcEndpointServiceInvalidConfigurationException2 extends KMSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "XksProxyVpcEndpointServiceInvalidConfigurationException", + $fault: "client", + ...opts + }); + this.name = "XksProxyVpcEndpointServiceInvalidConfigurationException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _XksProxyVpcEndpointServiceInvalidConfigurationException2.prototype); } }; - module2.exports = connectH1; - } -}); - -// node_modules/undici/lib/dispatcher/client-h2.js -var require_client_h2 = __commonJS({ - "node_modules/undici/lib/dispatcher/client-h2.js"(exports2, module2) { - "use strict"; - var assert = require("node:assert"); - var { pipeline } = require("node:stream"); - var util = require_util8(); - var { - RequestContentLengthMismatchError, - RequestAbortedError, - SocketError, - InformationalError - } = require_errors2(); - var { - kUrl, - kReset, - kClient, - kRunning, - kPending, - kQueue, - kPendingIdx, - kRunningIdx, - kError, - kSocket, - kStrictContentLength, - kOnError, - kMaxConcurrentStreams, - kHTTP2Session, - kResume - } = require_symbols6(); - var kOpenStreams = Symbol("open streams"); - var h2ExperimentalWarned = false; - var http2; - try { - http2 = require("node:http2"); - } catch { - http2 = { constants: {} }; - } - var { - constants: { - HTTP2_HEADER_AUTHORITY, - HTTP2_HEADER_METHOD, - HTTP2_HEADER_PATH, - HTTP2_HEADER_SCHEME, - HTTP2_HEADER_CONTENT_LENGTH, - HTTP2_HEADER_EXPECT, - HTTP2_HEADER_STATUS + __name(_XksProxyVpcEndpointServiceInvalidConfigurationException, "XksProxyVpcEndpointServiceInvalidConfigurationException"); + var XksProxyVpcEndpointServiceInvalidConfigurationException = _XksProxyVpcEndpointServiceInvalidConfigurationException; + var _XksProxyVpcEndpointServiceNotFoundException = class _XksProxyVpcEndpointServiceNotFoundException2 extends KMSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "XksProxyVpcEndpointServiceNotFoundException", + $fault: "client", + ...opts + }); + this.name = "XksProxyVpcEndpointServiceNotFoundException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _XksProxyVpcEndpointServiceNotFoundException2.prototype); + } + }; + __name(_XksProxyVpcEndpointServiceNotFoundException, "XksProxyVpcEndpointServiceNotFoundException"); + var XksProxyVpcEndpointServiceNotFoundException = _XksProxyVpcEndpointServiceNotFoundException; + var GrantOperation = { + CreateGrant: "CreateGrant", + Decrypt: "Decrypt", + DeriveSharedSecret: "DeriveSharedSecret", + DescribeKey: "DescribeKey", + Encrypt: "Encrypt", + GenerateDataKey: "GenerateDataKey", + GenerateDataKeyPair: "GenerateDataKeyPair", + GenerateDataKeyPairWithoutPlaintext: "GenerateDataKeyPairWithoutPlaintext", + GenerateDataKeyWithoutPlaintext: "GenerateDataKeyWithoutPlaintext", + GenerateMac: "GenerateMac", + GetPublicKey: "GetPublicKey", + ReEncryptFrom: "ReEncryptFrom", + ReEncryptTo: "ReEncryptTo", + RetireGrant: "RetireGrant", + Sign: "Sign", + Verify: "Verify", + VerifyMac: "VerifyMac" + }; + var _DisabledException = class _DisabledException2 extends KMSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "DisabledException", + $fault: "client", + ...opts + }); + this.name = "DisabledException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _DisabledException2.prototype); } - } = http2; - function parseH2Headers(headers) { - const result = []; - for (const [name, value] of Object.entries(headers)) { - if (Array.isArray(value)) { - for (const subvalue of value) { - result.push(Buffer.from(name), Buffer.from(subvalue)); - } - } else { - result.push(Buffer.from(name), Buffer.from(value)); - } + }; + __name(_DisabledException, "DisabledException"); + var DisabledException = _DisabledException; + var _DryRunOperationException = class _DryRunOperationException2 extends KMSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "DryRunOperationException", + $fault: "client", + ...opts + }); + this.name = "DryRunOperationException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _DryRunOperationException2.prototype); } - return result; - } - async function connectH2(client, socket) { - client[kSocket] = socket; - if (!h2ExperimentalWarned) { - h2ExperimentalWarned = true; - process.emitWarning("H2 support is experimental, expect them to change at any time.", { - code: "UNDICI-H2" + }; + __name(_DryRunOperationException, "DryRunOperationException"); + var DryRunOperationException = _DryRunOperationException; + var _InvalidGrantTokenException = class _InvalidGrantTokenException2 extends KMSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "InvalidGrantTokenException", + $fault: "client", + ...opts + }); + this.name = "InvalidGrantTokenException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _InvalidGrantTokenException2.prototype); + } + }; + __name(_InvalidGrantTokenException, "InvalidGrantTokenException"); + var InvalidGrantTokenException = _InvalidGrantTokenException; + var CustomerMasterKeySpec = { + ECC_NIST_P256: "ECC_NIST_P256", + ECC_NIST_P384: "ECC_NIST_P384", + ECC_NIST_P521: "ECC_NIST_P521", + ECC_SECG_P256K1: "ECC_SECG_P256K1", + HMAC_224: "HMAC_224", + HMAC_256: "HMAC_256", + HMAC_384: "HMAC_384", + HMAC_512: "HMAC_512", + RSA_2048: "RSA_2048", + RSA_3072: "RSA_3072", + RSA_4096: "RSA_4096", + SM2: "SM2", + SYMMETRIC_DEFAULT: "SYMMETRIC_DEFAULT" + }; + var KeySpec = { + ECC_NIST_P256: "ECC_NIST_P256", + ECC_NIST_P384: "ECC_NIST_P384", + ECC_NIST_P521: "ECC_NIST_P521", + ECC_SECG_P256K1: "ECC_SECG_P256K1", + HMAC_224: "HMAC_224", + HMAC_256: "HMAC_256", + HMAC_384: "HMAC_384", + HMAC_512: "HMAC_512", + RSA_2048: "RSA_2048", + RSA_3072: "RSA_3072", + RSA_4096: "RSA_4096", + SM2: "SM2", + SYMMETRIC_DEFAULT: "SYMMETRIC_DEFAULT" + }; + var KeyUsageType = { + ENCRYPT_DECRYPT: "ENCRYPT_DECRYPT", + GENERATE_VERIFY_MAC: "GENERATE_VERIFY_MAC", + KEY_AGREEMENT: "KEY_AGREEMENT", + SIGN_VERIFY: "SIGN_VERIFY" + }; + var OriginType = { + AWS_CLOUDHSM: "AWS_CLOUDHSM", + AWS_KMS: "AWS_KMS", + EXTERNAL: "EXTERNAL", + EXTERNAL_KEY_STORE: "EXTERNAL_KEY_STORE" + }; + var EncryptionAlgorithmSpec = { + RSAES_OAEP_SHA_1: "RSAES_OAEP_SHA_1", + RSAES_OAEP_SHA_256: "RSAES_OAEP_SHA_256", + SM2PKE: "SM2PKE", + SYMMETRIC_DEFAULT: "SYMMETRIC_DEFAULT" + }; + var ExpirationModelType = { + KEY_MATERIAL_DOES_NOT_EXPIRE: "KEY_MATERIAL_DOES_NOT_EXPIRE", + KEY_MATERIAL_EXPIRES: "KEY_MATERIAL_EXPIRES" + }; + var KeyAgreementAlgorithmSpec = { + ECDH: "ECDH" + }; + var KeyManagerType = { + AWS: "AWS", + CUSTOMER: "CUSTOMER" + }; + var KeyState = { + Creating: "Creating", + Disabled: "Disabled", + Enabled: "Enabled", + PendingDeletion: "PendingDeletion", + PendingImport: "PendingImport", + PendingReplicaDeletion: "PendingReplicaDeletion", + Unavailable: "Unavailable", + Updating: "Updating" + }; + var MacAlgorithmSpec = { + HMAC_SHA_224: "HMAC_SHA_224", + HMAC_SHA_256: "HMAC_SHA_256", + HMAC_SHA_384: "HMAC_SHA_384", + HMAC_SHA_512: "HMAC_SHA_512" + }; + var MultiRegionKeyType = { + PRIMARY: "PRIMARY", + REPLICA: "REPLICA" + }; + var SigningAlgorithmSpec = { + ECDSA_SHA_256: "ECDSA_SHA_256", + ECDSA_SHA_384: "ECDSA_SHA_384", + ECDSA_SHA_512: "ECDSA_SHA_512", + RSASSA_PKCS1_V1_5_SHA_256: "RSASSA_PKCS1_V1_5_SHA_256", + RSASSA_PKCS1_V1_5_SHA_384: "RSASSA_PKCS1_V1_5_SHA_384", + RSASSA_PKCS1_V1_5_SHA_512: "RSASSA_PKCS1_V1_5_SHA_512", + RSASSA_PSS_SHA_256: "RSASSA_PSS_SHA_256", + RSASSA_PSS_SHA_384: "RSASSA_PSS_SHA_384", + RSASSA_PSS_SHA_512: "RSASSA_PSS_SHA_512", + SM2DSA: "SM2DSA" + }; + var _MalformedPolicyDocumentException = class _MalformedPolicyDocumentException2 extends KMSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "MalformedPolicyDocumentException", + $fault: "client", + ...opts }); + this.name = "MalformedPolicyDocumentException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _MalformedPolicyDocumentException2.prototype); } - const session = http2.connect(client[kUrl], { - createConnection: () => socket, - peerMaxConcurrentStreams: client[kMaxConcurrentStreams] - }); - session[kOpenStreams] = 0; - session[kClient] = client; - session[kSocket] = socket; - util.addListener(session, "error", onHttp2SessionError); - util.addListener(session, "frameError", onHttp2FrameError); - util.addListener(session, "end", onHttp2SessionEnd); - util.addListener(session, "goaway", onHTTP2GoAway); - util.addListener(session, "close", function() { - const { [kClient]: client2 } = this; - const { [kSocket]: socket2 } = client2; - const err = this[kSocket][kError] || this[kError] || new SocketError("closed", util.getSocketInfo(socket2)); - client2[kHTTP2Session] = null; - if (client2.destroyed) { - assert(client2[kPending] === 0); - const requests = client2[kQueue].splice(client2[kRunningIdx]); - for (let i = 0; i < requests.length; i++) { - const request2 = requests[i]; - util.errorRequest(client2, request2, err); - } - } - }); - session.unref(); - client[kHTTP2Session] = session; - socket[kHTTP2Session] = session; - util.addListener(socket, "error", function(err) { - assert(err.code !== "ERR_TLS_CERT_ALTNAME_INVALID"); - this[kError] = err; - this[kClient][kOnError](err); - }); - util.addListener(socket, "end", function() { - util.destroy(this, new SocketError("other side closed", util.getSocketInfo(this))); - }); - util.addListener(socket, "close", function() { - const err = this[kError] || new SocketError("closed", util.getSocketInfo(this)); - client[kSocket] = null; - if (this[kHTTP2Session] != null) { - this[kHTTP2Session].destroy(err); - } - client[kPendingIdx] = client[kRunningIdx]; - assert(client[kRunning] === 0); - client.emit("disconnect", client[kUrl], [client], err); - client[kResume](); - }); - let closed = false; - socket.on("close", () => { - closed = true; - }); - return { - version: "h2", - defaultPipelining: Infinity, - write(...args) { - writeH2(client, ...args); - }, - resume() { - }, - destroy(err, callback) { - if (closed) { - queueMicrotask(callback); - } else { - socket.destroy(err).on("close", callback); - } - }, - get destroyed() { - return socket.destroyed; - }, - busy() { - return false; - } - }; - } - function onHttp2SessionError(err) { - assert(err.code !== "ERR_TLS_CERT_ALTNAME_INVALID"); - this[kSocket][kError] = err; - this[kClient][kOnError](err); - } - function onHttp2FrameError(type, code, id) { - if (id === 0) { - const err = new InformationalError(`HTTP/2: "frameError" received - type ${type}, code ${code}`); - this[kSocket][kError] = err; - this[kClient][kOnError](err); - } - } - function onHttp2SessionEnd() { - const err = new SocketError("other side closed", util.getSocketInfo(this[kSocket])); - this.destroy(err); - util.destroy(this[kSocket], err); - } - function onHTTP2GoAway(code) { - const err = new RequestAbortedError(`HTTP/2: "GOAWAY" frame received with code ${code}`); - this[kSocket][kError] = err; - this[kClient][kOnError](err); - this.unref(); - util.destroy(this[kSocket], err); - } - function shouldSendContentLength(method) { - return method !== "GET" && method !== "HEAD" && method !== "OPTIONS" && method !== "TRACE" && method !== "CONNECT"; - } - function writeH2(client, request2) { - const session = client[kHTTP2Session]; - const { body, method, path, host, upgrade, expectContinue, signal, headers: reqHeaders } = request2; - if (upgrade) { - util.errorRequest(client, request2, new Error("Upgrade not supported for H2")); - return false; - } - if (request2.aborted) { - return false; - } - const headers = {}; - for (let n = 0; n < reqHeaders.length; n += 2) { - const key = reqHeaders[n + 0]; - const val = reqHeaders[n + 1]; - if (Array.isArray(val)) { - for (let i = 0; i < val.length; i++) { - if (headers[key]) { - headers[key] += `,${val[i]}`; - } else { - headers[key] = val[i]; - } - } - } else { - headers[key] = val; - } - } - let stream; - const { hostname, port } = client[kUrl]; - headers[HTTP2_HEADER_AUTHORITY] = host || `${hostname}${port ? `:${port}` : ""}`; - headers[HTTP2_HEADER_METHOD] = method; - const abort = (err) => { - if (request2.aborted || request2.completed) { - return; - } - err = err || new RequestAbortedError(); - util.errorRequest(client, request2, err); - if (stream != null) { - util.destroy(stream, err); - } - util.destroy(body, err); - }; - try { - request2.onConnect(abort); - } catch (err) { - util.errorRequest(client, request2, err); - } - if (method === "CONNECT") { - session.ref(); - stream = session.request(headers, { endStream: false, signal }); - if (stream.id && !stream.pending) { - request2.onUpgrade(null, null, stream); - ++session[kOpenStreams]; - } else { - stream.once("ready", () => { - request2.onUpgrade(null, null, stream); - ++session[kOpenStreams]; - }); - } - stream.once("close", () => { - session[kOpenStreams] -= 1; - if (session[kOpenStreams] === 0) session.unref(); + }; + __name(_MalformedPolicyDocumentException, "MalformedPolicyDocumentException"); + var MalformedPolicyDocumentException = _MalformedPolicyDocumentException; + var _TagException = class _TagException2 extends KMSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "TagException", + $fault: "client", + ...opts }); - return true; + this.name = "TagException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _TagException2.prototype); } - headers[HTTP2_HEADER_PATH] = path; - headers[HTTP2_HEADER_SCHEME] = "https"; - const expectsPayload = method === "PUT" || method === "POST" || method === "PATCH"; - if (body && typeof body.read === "function") { - body.read(0); + }; + __name(_TagException, "TagException"); + var TagException = _TagException; + var _UnsupportedOperationException = class _UnsupportedOperationException2 extends KMSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "UnsupportedOperationException", + $fault: "client", + ...opts + }); + this.name = "UnsupportedOperationException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _UnsupportedOperationException2.prototype); } - let contentLength = util.bodyLength(body); - if (contentLength == null) { - contentLength = request2.contentLength; + }; + __name(_UnsupportedOperationException, "UnsupportedOperationException"); + var UnsupportedOperationException = _UnsupportedOperationException; + var _XksKeyAlreadyInUseException = class _XksKeyAlreadyInUseException2 extends KMSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "XksKeyAlreadyInUseException", + $fault: "client", + ...opts + }); + this.name = "XksKeyAlreadyInUseException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _XksKeyAlreadyInUseException2.prototype); } - if (contentLength === 0 || !expectsPayload) { - contentLength = null; + }; + __name(_XksKeyAlreadyInUseException, "XksKeyAlreadyInUseException"); + var XksKeyAlreadyInUseException = _XksKeyAlreadyInUseException; + var _XksKeyInvalidConfigurationException = class _XksKeyInvalidConfigurationException2 extends KMSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "XksKeyInvalidConfigurationException", + $fault: "client", + ...opts + }); + this.name = "XksKeyInvalidConfigurationException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _XksKeyInvalidConfigurationException2.prototype); } - if (shouldSendContentLength(method) && contentLength > 0 && request2.contentLength != null && request2.contentLength !== contentLength) { - if (client[kStrictContentLength]) { - util.errorRequest(client, request2, new RequestContentLengthMismatchError()); - return false; - } - process.emitWarning(new RequestContentLengthMismatchError()); + }; + __name(_XksKeyInvalidConfigurationException, "XksKeyInvalidConfigurationException"); + var XksKeyInvalidConfigurationException = _XksKeyInvalidConfigurationException; + var _XksKeyNotFoundException = class _XksKeyNotFoundException2 extends KMSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "XksKeyNotFoundException", + $fault: "client", + ...opts + }); + this.name = "XksKeyNotFoundException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _XksKeyNotFoundException2.prototype); } - if (contentLength != null) { - assert(body, "no body must not have content length"); - headers[HTTP2_HEADER_CONTENT_LENGTH] = `${contentLength}`; + }; + __name(_XksKeyNotFoundException, "XksKeyNotFoundException"); + var XksKeyNotFoundException = _XksKeyNotFoundException; + var _CustomKeyStoreHasCMKsException = class _CustomKeyStoreHasCMKsException2 extends KMSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "CustomKeyStoreHasCMKsException", + $fault: "client", + ...opts + }); + this.name = "CustomKeyStoreHasCMKsException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _CustomKeyStoreHasCMKsException2.prototype); + } + }; + __name(_CustomKeyStoreHasCMKsException, "CustomKeyStoreHasCMKsException"); + var CustomKeyStoreHasCMKsException = _CustomKeyStoreHasCMKsException; + var DataKeyPairSpec = { + ECC_NIST_P256: "ECC_NIST_P256", + ECC_NIST_P384: "ECC_NIST_P384", + ECC_NIST_P521: "ECC_NIST_P521", + ECC_SECG_P256K1: "ECC_SECG_P256K1", + RSA_2048: "RSA_2048", + RSA_3072: "RSA_3072", + RSA_4096: "RSA_4096", + SM2: "SM2" + }; + var DataKeySpec = { + AES_128: "AES_128", + AES_256: "AES_256" + }; + var KeyEncryptionMechanism = { + RSAES_OAEP_SHA_256: "RSAES_OAEP_SHA_256" + }; + var _IncorrectKeyException = class _IncorrectKeyException2 extends KMSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "IncorrectKeyException", + $fault: "client", + ...opts + }); + this.name = "IncorrectKeyException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _IncorrectKeyException2.prototype); } - session.ref(); - const shouldEndStream = method === "GET" || method === "HEAD" || body === null; - if (expectContinue) { - headers[HTTP2_HEADER_EXPECT] = "100-continue"; - stream = session.request(headers, { endStream: shouldEndStream, signal }); - stream.once("continue", writeBodyH2); - } else { - stream = session.request(headers, { - endStream: shouldEndStream, - signal + }; + __name(_IncorrectKeyException, "IncorrectKeyException"); + var IncorrectKeyException = _IncorrectKeyException; + var _InvalidCiphertextException = class _InvalidCiphertextException2 extends KMSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "InvalidCiphertextException", + $fault: "client", + ...opts }); - writeBodyH2(); + this.name = "InvalidCiphertextException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _InvalidCiphertextException2.prototype); } - ++session[kOpenStreams]; - stream.once("response", (headers2) => { - const { [HTTP2_HEADER_STATUS]: statusCode, ...realHeaders } = headers2; - request2.onResponseStarted(); - if (request2.aborted) { - const err = new RequestAbortedError(); - util.errorRequest(client, request2, err); - util.destroy(stream, err); - return; - } - if (request2.onHeaders(Number(statusCode), parseH2Headers(realHeaders), stream.resume.bind(stream), "") === false) { - stream.pause(); - } - stream.on("data", (chunk) => { - if (request2.onData(chunk) === false) { - stream.pause(); - } + }; + __name(_InvalidCiphertextException, "InvalidCiphertextException"); + var InvalidCiphertextException = _InvalidCiphertextException; + var _InvalidKeyUsageException = class _InvalidKeyUsageException2 extends KMSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "InvalidKeyUsageException", + $fault: "client", + ...opts }); - }); - stream.once("end", () => { - if (stream.state?.state == null || stream.state.state < 6) { - request2.onComplete([]); - return; - } - if (session[kOpenStreams] === 0) { - session.unref(); - } - abort(new InformationalError("HTTP/2: stream half-closed (remote)")); - }); - stream.once("close", () => { - session[kOpenStreams] -= 1; - if (session[kOpenStreams] === 0) { - session.unref(); - } - }); - stream.once("error", function(err) { - abort(err); - }); - stream.once("frameError", (type, code) => { - abort(new InformationalError(`HTTP/2: "frameError" received - type ${type}, code ${code}`)); - }); - return true; - function writeBodyH2() { - if (!body || contentLength === 0) { - writeBuffer({ - abort, - client, - request: request2, - contentLength, - expectsPayload, - h2stream: stream, - body: null, - socket: client[kSocket] - }); - } else if (util.isBuffer(body)) { - writeBuffer({ - abort, - client, - request: request2, - contentLength, - body, - expectsPayload, - h2stream: stream, - socket: client[kSocket] - }); - } else if (util.isBlobLike(body)) { - if (typeof body.stream === "function") { - writeIterable({ - abort, - client, - request: request2, - contentLength, - expectsPayload, - h2stream: stream, - body: body.stream(), - socket: client[kSocket] - }); - } else { - writeBlob({ - abort, - body, - client, - request: request2, - contentLength, - expectsPayload, - h2stream: stream, - socket: client[kSocket] - }); - } - } else if (util.isStream(body)) { - writeStream({ - abort, - body, - client, - request: request2, - contentLength, - expectsPayload, - socket: client[kSocket], - h2stream: stream, - header: "" - }); - } else if (util.isIterable(body)) { - writeIterable({ - abort, - body, - client, - request: request2, - contentLength, - expectsPayload, - header: "", - h2stream: stream, - socket: client[kSocket] - }); - } else { - assert(false); - } + this.name = "InvalidKeyUsageException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _InvalidKeyUsageException2.prototype); } - } - function writeBuffer({ abort, h2stream, body, client, request: request2, socket, contentLength, expectsPayload }) { - try { - if (body != null && util.isBuffer(body)) { - assert(contentLength === body.byteLength, "buffer body must have content length"); - h2stream.cork(); - h2stream.write(body); - h2stream.uncork(); - h2stream.end(); - request2.onBodySent(body); - } - if (!expectsPayload) { - socket[kReset] = true; - } - request2.onRequestSent(); - client[kResume](); - } catch (error) { - abort(error); + }; + __name(_InvalidKeyUsageException, "InvalidKeyUsageException"); + var InvalidKeyUsageException = _InvalidKeyUsageException; + var _KeyUnavailableException = class _KeyUnavailableException2 extends KMSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "KeyUnavailableException", + $fault: "server", + ...opts + }); + this.name = "KeyUnavailableException"; + this.$fault = "server"; + Object.setPrototypeOf(this, _KeyUnavailableException2.prototype); } - } - function writeStream({ abort, socket, expectsPayload, h2stream, body, client, request: request2, contentLength }) { - assert(contentLength !== 0 || client[kRunning] === 0, "stream body cannot be pipelined"); - const pipe = pipeline( - body, - h2stream, - (err) => { - if (err) { - util.destroy(pipe, err); - abort(err); - } else { - util.removeAllListeners(pipe); - request2.onRequestSent(); - if (!expectsPayload) { - socket[kReset] = true; - } - client[kResume](); - } - } - ); - util.addListener(pipe, "data", onPipeData); - function onPipeData(chunk) { - request2.onBodySent(chunk); + }; + __name(_KeyUnavailableException, "KeyUnavailableException"); + var KeyUnavailableException = _KeyUnavailableException; + var _InvalidMarkerException = class _InvalidMarkerException2 extends KMSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "InvalidMarkerException", + $fault: "client", + ...opts + }); + this.name = "InvalidMarkerException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _InvalidMarkerException2.prototype); } - } - async function writeBlob({ abort, h2stream, body, client, request: request2, socket, contentLength, expectsPayload }) { - assert(contentLength === body.size, "blob body must have content length"); - try { - if (contentLength != null && contentLength !== body.size) { - throw new RequestContentLengthMismatchError(); - } - const buffer = Buffer.from(await body.arrayBuffer()); - h2stream.cork(); - h2stream.write(buffer); - h2stream.uncork(); - h2stream.end(); - request2.onBodySent(buffer); - request2.onRequestSent(); - if (!expectsPayload) { - socket[kReset] = true; - } - client[kResume](); - } catch (err) { - abort(err); + }; + __name(_InvalidMarkerException, "InvalidMarkerException"); + var InvalidMarkerException = _InvalidMarkerException; + var _ExpiredImportTokenException = class _ExpiredImportTokenException2 extends KMSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "ExpiredImportTokenException", + $fault: "client", + ...opts + }); + this.name = "ExpiredImportTokenException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _ExpiredImportTokenException2.prototype); } - } - async function writeIterable({ abort, h2stream, body, client, request: request2, socket, contentLength, expectsPayload }) { - assert(contentLength !== 0 || client[kRunning] === 0, "iterator body cannot be pipelined"); - let callback = null; - function onDrain() { - if (callback) { - const cb = callback; - callback = null; - cb(); - } + }; + __name(_ExpiredImportTokenException, "ExpiredImportTokenException"); + var ExpiredImportTokenException = _ExpiredImportTokenException; + var WrappingKeySpec = { + RSA_2048: "RSA_2048", + RSA_3072: "RSA_3072", + RSA_4096: "RSA_4096", + SM2: "SM2" + }; + var _IncorrectKeyMaterialException = class _IncorrectKeyMaterialException2 extends KMSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "IncorrectKeyMaterialException", + $fault: "client", + ...opts + }); + this.name = "IncorrectKeyMaterialException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _IncorrectKeyMaterialException2.prototype); } - const waitForDrain = () => new Promise((resolve, reject) => { - assert(callback === null); - if (socket[kError]) { - reject(socket[kError]); - } else { - callback = resolve; - } - }); - h2stream.on("close", onDrain).on("drain", onDrain); - try { - for await (const chunk of body) { - if (socket[kError]) { - throw socket[kError]; - } - const res = h2stream.write(chunk); - request2.onBodySent(chunk); - if (!res) { - await waitForDrain(); - } - } - h2stream.end(); - request2.onRequestSent(); - if (!expectsPayload) { - socket[kReset] = true; - } - client[kResume](); - } catch (err) { - abort(err); - } finally { - h2stream.off("close", onDrain).off("drain", onDrain); + }; + __name(_IncorrectKeyMaterialException, "IncorrectKeyMaterialException"); + var IncorrectKeyMaterialException = _IncorrectKeyMaterialException; + var _InvalidImportTokenException = class _InvalidImportTokenException2 extends KMSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "InvalidImportTokenException", + $fault: "client", + ...opts + }); + this.name = "InvalidImportTokenException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _InvalidImportTokenException2.prototype); } - } - module2.exports = connectH2; - } -}); - -// node_modules/undici/lib/handler/redirect-handler.js -var require_redirect_handler = __commonJS({ - "node_modules/undici/lib/handler/redirect-handler.js"(exports2, module2) { - "use strict"; - var util = require_util8(); - var { kBodyUsed } = require_symbols6(); - var assert = require("node:assert"); - var { InvalidArgumentError } = require_errors2(); - var EE = require("node:events"); - var redirectableStatusCodes = [300, 301, 302, 303, 307, 308]; - var kBody = Symbol("body"); - var BodyAsyncIterable = class { - constructor(body) { - this[kBody] = body; - this[kBodyUsed] = false; + }; + __name(_InvalidImportTokenException, "InvalidImportTokenException"); + var InvalidImportTokenException = _InvalidImportTokenException; + var _InvalidGrantIdException = class _InvalidGrantIdException2 extends KMSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "InvalidGrantIdException", + $fault: "client", + ...opts + }); + this.name = "InvalidGrantIdException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _InvalidGrantIdException2.prototype); } - async *[Symbol.asyncIterator]() { - assert(!this[kBodyUsed], "disturbed"); - this[kBodyUsed] = true; - yield* this[kBody]; + }; + __name(_InvalidGrantIdException, "InvalidGrantIdException"); + var InvalidGrantIdException = _InvalidGrantIdException; + var _KMSInvalidMacException = class _KMSInvalidMacException2 extends KMSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "KMSInvalidMacException", + $fault: "client", + ...opts + }); + this.name = "KMSInvalidMacException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _KMSInvalidMacException2.prototype); } }; - var RedirectHandler = class { - constructor(dispatch, maxRedirections, opts, handler) { - if (maxRedirections != null && (!Number.isInteger(maxRedirections) || maxRedirections < 0)) { - throw new InvalidArgumentError("maxRedirections must be a positive number"); - } - util.validateHandler(handler, opts.method, opts.upgrade); - this.dispatch = dispatch; - this.location = null; - this.abort = null; - this.opts = { ...opts, maxRedirections: 0 }; - this.maxRedirections = maxRedirections; - this.handler = handler; - this.history = []; - this.redirectionLimitReached = false; - if (util.isStream(this.opts.body)) { - if (util.bodyLength(this.opts.body) === 0) { - this.opts.body.on("data", function() { - assert(false); - }); - } - if (typeof this.opts.body.readableDidRead !== "boolean") { - this.opts.body[kBodyUsed] = false; - EE.prototype.on.call(this.opts.body, "data", function() { - this[kBodyUsed] = true; - }); - } - } else if (this.opts.body && typeof this.opts.body.pipeTo === "function") { - this.opts.body = new BodyAsyncIterable(this.opts.body); - } else if (this.opts.body && typeof this.opts.body !== "string" && !ArrayBuffer.isView(this.opts.body) && util.isIterable(this.opts.body)) { - this.opts.body = new BodyAsyncIterable(this.opts.body); - } + __name(_KMSInvalidMacException, "KMSInvalidMacException"); + var KMSInvalidMacException = _KMSInvalidMacException; + var _KMSInvalidSignatureException = class _KMSInvalidSignatureException2 extends KMSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "KMSInvalidSignatureException", + $fault: "client", + ...opts + }); + this.name = "KMSInvalidSignatureException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _KMSInvalidSignatureException2.prototype); + } + }; + __name(_KMSInvalidSignatureException, "KMSInvalidSignatureException"); + var KMSInvalidSignatureException = _KMSInvalidSignatureException; + var RotationType = { + AUTOMATIC: "AUTOMATIC", + ON_DEMAND: "ON_DEMAND" + }; + var MessageType = { + DIGEST: "DIGEST", + RAW: "RAW" + }; + var XksProxyAuthenticationCredentialTypeFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ + ...obj, + ...obj.AccessKeyId && { AccessKeyId: import_smithy_client5.SENSITIVE_STRING }, + ...obj.RawSecretAccessKey && { RawSecretAccessKey: import_smithy_client5.SENSITIVE_STRING } + }), "XksProxyAuthenticationCredentialTypeFilterSensitiveLog"); + var CreateCustomKeyStoreRequestFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ + ...obj, + ...obj.KeyStorePassword && { KeyStorePassword: import_smithy_client5.SENSITIVE_STRING }, + ...obj.XksProxyAuthenticationCredential && { + XksProxyAuthenticationCredential: XksProxyAuthenticationCredentialTypeFilterSensitiveLog( + obj.XksProxyAuthenticationCredential + ) } - onConnect(abort) { - this.abort = abort; - this.handler.onConnect(abort, { history: this.history }); + }), "CreateCustomKeyStoreRequestFilterSensitiveLog"); + var XksProxyConfigurationTypeFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ + ...obj, + ...obj.AccessKeyId && { AccessKeyId: import_smithy_client5.SENSITIVE_STRING } + }), "XksProxyConfigurationTypeFilterSensitiveLog"); + var CustomKeyStoresListEntryFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ + ...obj, + ...obj.XksProxyConfiguration && { + XksProxyConfiguration: XksProxyConfigurationTypeFilterSensitiveLog(obj.XksProxyConfiguration) + } + }), "CustomKeyStoresListEntryFilterSensitiveLog"); + var DecryptResponseFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ + ...obj, + ...obj.Plaintext && { Plaintext: import_smithy_client5.SENSITIVE_STRING } + }), "DecryptResponseFilterSensitiveLog"); + var DeriveSharedSecretResponseFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ + ...obj, + ...obj.SharedSecret && { SharedSecret: import_smithy_client5.SENSITIVE_STRING } + }), "DeriveSharedSecretResponseFilterSensitiveLog"); + var DescribeCustomKeyStoresResponseFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ + ...obj, + ...obj.CustomKeyStores && { + CustomKeyStores: obj.CustomKeyStores.map((item) => CustomKeyStoresListEntryFilterSensitiveLog(item)) + } + }), "DescribeCustomKeyStoresResponseFilterSensitiveLog"); + var EncryptRequestFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ + ...obj, + ...obj.Plaintext && { Plaintext: import_smithy_client5.SENSITIVE_STRING } + }), "EncryptRequestFilterSensitiveLog"); + var GenerateDataKeyResponseFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ + ...obj, + ...obj.Plaintext && { Plaintext: import_smithy_client5.SENSITIVE_STRING } + }), "GenerateDataKeyResponseFilterSensitiveLog"); + var GenerateDataKeyPairResponseFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ + ...obj, + ...obj.PrivateKeyPlaintext && { PrivateKeyPlaintext: import_smithy_client5.SENSITIVE_STRING } + }), "GenerateDataKeyPairResponseFilterSensitiveLog"); + var GenerateMacRequestFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ + ...obj, + ...obj.Message && { Message: import_smithy_client5.SENSITIVE_STRING } + }), "GenerateMacRequestFilterSensitiveLog"); + var GenerateRandomResponseFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ + ...obj, + ...obj.Plaintext && { Plaintext: import_smithy_client5.SENSITIVE_STRING } + }), "GenerateRandomResponseFilterSensitiveLog"); + var GetParametersForImportResponseFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ + ...obj, + ...obj.PublicKey && { PublicKey: import_smithy_client5.SENSITIVE_STRING } + }), "GetParametersForImportResponseFilterSensitiveLog"); + var SignRequestFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ + ...obj, + ...obj.Message && { Message: import_smithy_client5.SENSITIVE_STRING } + }), "SignRequestFilterSensitiveLog"); + var UpdateCustomKeyStoreRequestFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ + ...obj, + ...obj.KeyStorePassword && { KeyStorePassword: import_smithy_client5.SENSITIVE_STRING }, + ...obj.XksProxyAuthenticationCredential && { + XksProxyAuthenticationCredential: XksProxyAuthenticationCredentialTypeFilterSensitiveLog( + obj.XksProxyAuthenticationCredential + ) } - onUpgrade(statusCode, headers, socket) { - this.handler.onUpgrade(statusCode, headers, socket); + }), "UpdateCustomKeyStoreRequestFilterSensitiveLog"); + var VerifyRequestFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ + ...obj, + ...obj.Message && { Message: import_smithy_client5.SENSITIVE_STRING } + }), "VerifyRequestFilterSensitiveLog"); + var VerifyMacRequestFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ + ...obj, + ...obj.Message && { Message: import_smithy_client5.SENSITIVE_STRING } + }), "VerifyMacRequestFilterSensitiveLog"); + var se_CancelKeyDeletionCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("CancelKeyDeletion"); + let body; + body = JSON.stringify((0, import_smithy_client5._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); + }, "se_CancelKeyDeletionCommand"); + var se_ConnectCustomKeyStoreCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("ConnectCustomKeyStore"); + let body; + body = JSON.stringify((0, import_smithy_client5._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); + }, "se_ConnectCustomKeyStoreCommand"); + var se_CreateAliasCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("CreateAlias"); + let body; + body = JSON.stringify((0, import_smithy_client5._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); + }, "se_CreateAliasCommand"); + var se_CreateCustomKeyStoreCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("CreateCustomKeyStore"); + let body; + body = JSON.stringify((0, import_smithy_client5._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); + }, "se_CreateCustomKeyStoreCommand"); + var se_CreateGrantCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("CreateGrant"); + let body; + body = JSON.stringify((0, import_smithy_client5._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); + }, "se_CreateGrantCommand"); + var se_CreateKeyCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("CreateKey"); + let body; + body = JSON.stringify((0, import_smithy_client5._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); + }, "se_CreateKeyCommand"); + var se_DecryptCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("Decrypt"); + let body; + body = JSON.stringify(se_DecryptRequest(input, context)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); + }, "se_DecryptCommand"); + var se_DeleteAliasCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("DeleteAlias"); + let body; + body = JSON.stringify((0, import_smithy_client5._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); + }, "se_DeleteAliasCommand"); + var se_DeleteCustomKeyStoreCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("DeleteCustomKeyStore"); + let body; + body = JSON.stringify((0, import_smithy_client5._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); + }, "se_DeleteCustomKeyStoreCommand"); + var se_DeleteImportedKeyMaterialCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("DeleteImportedKeyMaterial"); + let body; + body = JSON.stringify((0, import_smithy_client5._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); + }, "se_DeleteImportedKeyMaterialCommand"); + var se_DeriveSharedSecretCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("DeriveSharedSecret"); + let body; + body = JSON.stringify(se_DeriveSharedSecretRequest(input, context)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); + }, "se_DeriveSharedSecretCommand"); + var se_DescribeCustomKeyStoresCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("DescribeCustomKeyStores"); + let body; + body = JSON.stringify((0, import_smithy_client5._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); + }, "se_DescribeCustomKeyStoresCommand"); + var se_DescribeKeyCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("DescribeKey"); + let body; + body = JSON.stringify((0, import_smithy_client5._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); + }, "se_DescribeKeyCommand"); + var se_DisableKeyCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("DisableKey"); + let body; + body = JSON.stringify((0, import_smithy_client5._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); + }, "se_DisableKeyCommand"); + var se_DisableKeyRotationCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("DisableKeyRotation"); + let body; + body = JSON.stringify((0, import_smithy_client5._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); + }, "se_DisableKeyRotationCommand"); + var se_DisconnectCustomKeyStoreCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("DisconnectCustomKeyStore"); + let body; + body = JSON.stringify((0, import_smithy_client5._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); + }, "se_DisconnectCustomKeyStoreCommand"); + var se_EnableKeyCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("EnableKey"); + let body; + body = JSON.stringify((0, import_smithy_client5._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); + }, "se_EnableKeyCommand"); + var se_EnableKeyRotationCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("EnableKeyRotation"); + let body; + body = JSON.stringify((0, import_smithy_client5._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); + }, "se_EnableKeyRotationCommand"); + var se_EncryptCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("Encrypt"); + let body; + body = JSON.stringify(se_EncryptRequest(input, context)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); + }, "se_EncryptCommand"); + var se_GenerateDataKeyCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("GenerateDataKey"); + let body; + body = JSON.stringify(se_GenerateDataKeyRequest(input, context)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); + }, "se_GenerateDataKeyCommand"); + var se_GenerateDataKeyPairCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("GenerateDataKeyPair"); + let body; + body = JSON.stringify(se_GenerateDataKeyPairRequest(input, context)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); + }, "se_GenerateDataKeyPairCommand"); + var se_GenerateDataKeyPairWithoutPlaintextCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("GenerateDataKeyPairWithoutPlaintext"); + let body; + body = JSON.stringify((0, import_smithy_client5._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); + }, "se_GenerateDataKeyPairWithoutPlaintextCommand"); + var se_GenerateDataKeyWithoutPlaintextCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("GenerateDataKeyWithoutPlaintext"); + let body; + body = JSON.stringify((0, import_smithy_client5._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); + }, "se_GenerateDataKeyWithoutPlaintextCommand"); + var se_GenerateMacCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("GenerateMac"); + let body; + body = JSON.stringify(se_GenerateMacRequest(input, context)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); + }, "se_GenerateMacCommand"); + var se_GenerateRandomCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("GenerateRandom"); + let body; + body = JSON.stringify(se_GenerateRandomRequest(input, context)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); + }, "se_GenerateRandomCommand"); + var se_GetKeyPolicyCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("GetKeyPolicy"); + let body; + body = JSON.stringify((0, import_smithy_client5._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); + }, "se_GetKeyPolicyCommand"); + var se_GetKeyRotationStatusCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("GetKeyRotationStatus"); + let body; + body = JSON.stringify((0, import_smithy_client5._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); + }, "se_GetKeyRotationStatusCommand"); + var se_GetParametersForImportCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("GetParametersForImport"); + let body; + body = JSON.stringify((0, import_smithy_client5._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); + }, "se_GetParametersForImportCommand"); + var se_GetPublicKeyCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("GetPublicKey"); + let body; + body = JSON.stringify((0, import_smithy_client5._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); + }, "se_GetPublicKeyCommand"); + var se_ImportKeyMaterialCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("ImportKeyMaterial"); + let body; + body = JSON.stringify(se_ImportKeyMaterialRequest(input, context)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); + }, "se_ImportKeyMaterialCommand"); + var se_ListAliasesCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("ListAliases"); + let body; + body = JSON.stringify((0, import_smithy_client5._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); + }, "se_ListAliasesCommand"); + var se_ListGrantsCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("ListGrants"); + let body; + body = JSON.stringify((0, import_smithy_client5._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); + }, "se_ListGrantsCommand"); + var se_ListKeyPoliciesCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("ListKeyPolicies"); + let body; + body = JSON.stringify((0, import_smithy_client5._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); + }, "se_ListKeyPoliciesCommand"); + var se_ListKeyRotationsCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("ListKeyRotations"); + let body; + body = JSON.stringify((0, import_smithy_client5._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); + }, "se_ListKeyRotationsCommand"); + var se_ListKeysCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("ListKeys"); + let body; + body = JSON.stringify((0, import_smithy_client5._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); + }, "se_ListKeysCommand"); + var se_ListResourceTagsCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("ListResourceTags"); + let body; + body = JSON.stringify((0, import_smithy_client5._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); + }, "se_ListResourceTagsCommand"); + var se_ListRetirableGrantsCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("ListRetirableGrants"); + let body; + body = JSON.stringify((0, import_smithy_client5._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); + }, "se_ListRetirableGrantsCommand"); + var se_PutKeyPolicyCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("PutKeyPolicy"); + let body; + body = JSON.stringify((0, import_smithy_client5._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); + }, "se_PutKeyPolicyCommand"); + var se_ReEncryptCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("ReEncrypt"); + let body; + body = JSON.stringify(se_ReEncryptRequest(input, context)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); + }, "se_ReEncryptCommand"); + var se_ReplicateKeyCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("ReplicateKey"); + let body; + body = JSON.stringify((0, import_smithy_client5._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); + }, "se_ReplicateKeyCommand"); + var se_RetireGrantCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("RetireGrant"); + let body; + body = JSON.stringify((0, import_smithy_client5._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); + }, "se_RetireGrantCommand"); + var se_RevokeGrantCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("RevokeGrant"); + let body; + body = JSON.stringify((0, import_smithy_client5._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); + }, "se_RevokeGrantCommand"); + var se_RotateKeyOnDemandCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("RotateKeyOnDemand"); + let body; + body = JSON.stringify((0, import_smithy_client5._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); + }, "se_RotateKeyOnDemandCommand"); + var se_ScheduleKeyDeletionCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("ScheduleKeyDeletion"); + let body; + body = JSON.stringify((0, import_smithy_client5._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); + }, "se_ScheduleKeyDeletionCommand"); + var se_SignCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("Sign"); + let body; + body = JSON.stringify(se_SignRequest(input, context)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); + }, "se_SignCommand"); + var se_TagResourceCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("TagResource"); + let body; + body = JSON.stringify((0, import_smithy_client5._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); + }, "se_TagResourceCommand"); + var se_UntagResourceCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("UntagResource"); + let body; + body = JSON.stringify((0, import_smithy_client5._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); + }, "se_UntagResourceCommand"); + var se_UpdateAliasCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("UpdateAlias"); + let body; + body = JSON.stringify((0, import_smithy_client5._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); + }, "se_UpdateAliasCommand"); + var se_UpdateCustomKeyStoreCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("UpdateCustomKeyStore"); + let body; + body = JSON.stringify((0, import_smithy_client5._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); + }, "se_UpdateCustomKeyStoreCommand"); + var se_UpdateKeyDescriptionCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("UpdateKeyDescription"); + let body; + body = JSON.stringify((0, import_smithy_client5._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); + }, "se_UpdateKeyDescriptionCommand"); + var se_UpdatePrimaryRegionCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("UpdatePrimaryRegion"); + let body; + body = JSON.stringify((0, import_smithy_client5._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); + }, "se_UpdatePrimaryRegionCommand"); + var se_VerifyCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("Verify"); + let body; + body = JSON.stringify(se_VerifyRequest(input, context)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); + }, "se_VerifyCommand"); + var se_VerifyMacCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("VerifyMac"); + let body; + body = JSON.stringify(se_VerifyMacRequest(input, context)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); + }, "se_VerifyMacCommand"); + var de_CancelKeyDeletionCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core22.parseJsonBody)(output.body, context); + let contents = {}; + contents = (0, import_smithy_client5._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; + }, "de_CancelKeyDeletionCommand"); + var de_ConnectCustomKeyStoreCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core22.parseJsonBody)(output.body, context); + let contents = {}; + contents = (0, import_smithy_client5._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; + }, "de_ConnectCustomKeyStoreCommand"); + var de_CreateAliasCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + await (0, import_smithy_client5.collectBody)(output.body, context); + const response = { + $metadata: deserializeMetadata(output) + }; + return response; + }, "de_CreateAliasCommand"); + var de_CreateCustomKeyStoreCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core22.parseJsonBody)(output.body, context); + let contents = {}; + contents = (0, import_smithy_client5._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; + }, "de_CreateCustomKeyStoreCommand"); + var de_CreateGrantCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core22.parseJsonBody)(output.body, context); + let contents = {}; + contents = (0, import_smithy_client5._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; + }, "de_CreateGrantCommand"); + var de_CreateKeyCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core22.parseJsonBody)(output.body, context); + let contents = {}; + contents = de_CreateKeyResponse(data, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; + }, "de_CreateKeyCommand"); + var de_DecryptCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core22.parseJsonBody)(output.body, context); + let contents = {}; + contents = de_DecryptResponse(data, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; + }, "de_DecryptCommand"); + var de_DeleteAliasCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + await (0, import_smithy_client5.collectBody)(output.body, context); + const response = { + $metadata: deserializeMetadata(output) + }; + return response; + }, "de_DeleteAliasCommand"); + var de_DeleteCustomKeyStoreCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core22.parseJsonBody)(output.body, context); + let contents = {}; + contents = (0, import_smithy_client5._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; + }, "de_DeleteCustomKeyStoreCommand"); + var de_DeleteImportedKeyMaterialCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + await (0, import_smithy_client5.collectBody)(output.body, context); + const response = { + $metadata: deserializeMetadata(output) + }; + return response; + }, "de_DeleteImportedKeyMaterialCommand"); + var de_DeriveSharedSecretCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core22.parseJsonBody)(output.body, context); + let contents = {}; + contents = de_DeriveSharedSecretResponse(data, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; + }, "de_DeriveSharedSecretCommand"); + var de_DescribeCustomKeyStoresCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core22.parseJsonBody)(output.body, context); + let contents = {}; + contents = de_DescribeCustomKeyStoresResponse(data, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; + }, "de_DescribeCustomKeyStoresCommand"); + var de_DescribeKeyCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core22.parseJsonBody)(output.body, context); + let contents = {}; + contents = de_DescribeKeyResponse(data, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; + }, "de_DescribeKeyCommand"); + var de_DisableKeyCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + await (0, import_smithy_client5.collectBody)(output.body, context); + const response = { + $metadata: deserializeMetadata(output) + }; + return response; + }, "de_DisableKeyCommand"); + var de_DisableKeyRotationCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + await (0, import_smithy_client5.collectBody)(output.body, context); + const response = { + $metadata: deserializeMetadata(output) + }; + return response; + }, "de_DisableKeyRotationCommand"); + var de_DisconnectCustomKeyStoreCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core22.parseJsonBody)(output.body, context); + let contents = {}; + contents = (0, import_smithy_client5._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; + }, "de_DisconnectCustomKeyStoreCommand"); + var de_EnableKeyCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + await (0, import_smithy_client5.collectBody)(output.body, context); + const response = { + $metadata: deserializeMetadata(output) + }; + return response; + }, "de_EnableKeyCommand"); + var de_EnableKeyRotationCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + await (0, import_smithy_client5.collectBody)(output.body, context); + const response = { + $metadata: deserializeMetadata(output) + }; + return response; + }, "de_EnableKeyRotationCommand"); + var de_EncryptCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core22.parseJsonBody)(output.body, context); + let contents = {}; + contents = de_EncryptResponse(data, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; + }, "de_EncryptCommand"); + var de_GenerateDataKeyCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core22.parseJsonBody)(output.body, context); + let contents = {}; + contents = de_GenerateDataKeyResponse(data, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; + }, "de_GenerateDataKeyCommand"); + var de_GenerateDataKeyPairCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core22.parseJsonBody)(output.body, context); + let contents = {}; + contents = de_GenerateDataKeyPairResponse(data, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; + }, "de_GenerateDataKeyPairCommand"); + var de_GenerateDataKeyPairWithoutPlaintextCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core22.parseJsonBody)(output.body, context); + let contents = {}; + contents = de_GenerateDataKeyPairWithoutPlaintextResponse(data, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; + }, "de_GenerateDataKeyPairWithoutPlaintextCommand"); + var de_GenerateDataKeyWithoutPlaintextCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core22.parseJsonBody)(output.body, context); + let contents = {}; + contents = de_GenerateDataKeyWithoutPlaintextResponse(data, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; + }, "de_GenerateDataKeyWithoutPlaintextCommand"); + var de_GenerateMacCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core22.parseJsonBody)(output.body, context); + let contents = {}; + contents = de_GenerateMacResponse(data, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; + }, "de_GenerateMacCommand"); + var de_GenerateRandomCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core22.parseJsonBody)(output.body, context); + let contents = {}; + contents = de_GenerateRandomResponse(data, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; + }, "de_GenerateRandomCommand"); + var de_GetKeyPolicyCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core22.parseJsonBody)(output.body, context); + let contents = {}; + contents = (0, import_smithy_client5._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; + }, "de_GetKeyPolicyCommand"); + var de_GetKeyRotationStatusCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core22.parseJsonBody)(output.body, context); + let contents = {}; + contents = de_GetKeyRotationStatusResponse(data, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; + }, "de_GetKeyRotationStatusCommand"); + var de_GetParametersForImportCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core22.parseJsonBody)(output.body, context); + let contents = {}; + contents = de_GetParametersForImportResponse(data, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; + }, "de_GetParametersForImportCommand"); + var de_GetPublicKeyCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core22.parseJsonBody)(output.body, context); + let contents = {}; + contents = de_GetPublicKeyResponse(data, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; + }, "de_GetPublicKeyCommand"); + var de_ImportKeyMaterialCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core22.parseJsonBody)(output.body, context); + let contents = {}; + contents = (0, import_smithy_client5._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; + }, "de_ImportKeyMaterialCommand"); + var de_ListAliasesCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core22.parseJsonBody)(output.body, context); + let contents = {}; + contents = de_ListAliasesResponse(data, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; + }, "de_ListAliasesCommand"); + var de_ListGrantsCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core22.parseJsonBody)(output.body, context); + let contents = {}; + contents = de_ListGrantsResponse(data, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; + }, "de_ListGrantsCommand"); + var de_ListKeyPoliciesCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core22.parseJsonBody)(output.body, context); + let contents = {}; + contents = (0, import_smithy_client5._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; + }, "de_ListKeyPoliciesCommand"); + var de_ListKeyRotationsCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core22.parseJsonBody)(output.body, context); + let contents = {}; + contents = de_ListKeyRotationsResponse(data, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; + }, "de_ListKeyRotationsCommand"); + var de_ListKeysCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core22.parseJsonBody)(output.body, context); + let contents = {}; + contents = (0, import_smithy_client5._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; + }, "de_ListKeysCommand"); + var de_ListResourceTagsCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core22.parseJsonBody)(output.body, context); + let contents = {}; + contents = (0, import_smithy_client5._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; + }, "de_ListResourceTagsCommand"); + var de_ListRetirableGrantsCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core22.parseJsonBody)(output.body, context); + let contents = {}; + contents = de_ListGrantsResponse(data, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; + }, "de_ListRetirableGrantsCommand"); + var de_PutKeyPolicyCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + await (0, import_smithy_client5.collectBody)(output.body, context); + const response = { + $metadata: deserializeMetadata(output) + }; + return response; + }, "de_PutKeyPolicyCommand"); + var de_ReEncryptCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core22.parseJsonBody)(output.body, context); + let contents = {}; + contents = de_ReEncryptResponse(data, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; + }, "de_ReEncryptCommand"); + var de_ReplicateKeyCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core22.parseJsonBody)(output.body, context); + let contents = {}; + contents = de_ReplicateKeyResponse(data, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; + }, "de_ReplicateKeyCommand"); + var de_RetireGrantCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + await (0, import_smithy_client5.collectBody)(output.body, context); + const response = { + $metadata: deserializeMetadata(output) + }; + return response; + }, "de_RetireGrantCommand"); + var de_RevokeGrantCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + await (0, import_smithy_client5.collectBody)(output.body, context); + const response = { + $metadata: deserializeMetadata(output) + }; + return response; + }, "de_RevokeGrantCommand"); + var de_RotateKeyOnDemandCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core22.parseJsonBody)(output.body, context); + let contents = {}; + contents = (0, import_smithy_client5._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; + }, "de_RotateKeyOnDemandCommand"); + var de_ScheduleKeyDeletionCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core22.parseJsonBody)(output.body, context); + let contents = {}; + contents = de_ScheduleKeyDeletionResponse(data, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; + }, "de_ScheduleKeyDeletionCommand"); + var de_SignCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core22.parseJsonBody)(output.body, context); + let contents = {}; + contents = de_SignResponse(data, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; + }, "de_SignCommand"); + var de_TagResourceCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + await (0, import_smithy_client5.collectBody)(output.body, context); + const response = { + $metadata: deserializeMetadata(output) + }; + return response; + }, "de_TagResourceCommand"); + var de_UntagResourceCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + await (0, import_smithy_client5.collectBody)(output.body, context); + const response = { + $metadata: deserializeMetadata(output) + }; + return response; + }, "de_UntagResourceCommand"); + var de_UpdateAliasCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + await (0, import_smithy_client5.collectBody)(output.body, context); + const response = { + $metadata: deserializeMetadata(output) + }; + return response; + }, "de_UpdateAliasCommand"); + var de_UpdateCustomKeyStoreCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core22.parseJsonBody)(output.body, context); + let contents = {}; + contents = (0, import_smithy_client5._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; + }, "de_UpdateCustomKeyStoreCommand"); + var de_UpdateKeyDescriptionCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + await (0, import_smithy_client5.collectBody)(output.body, context); + const response = { + $metadata: deserializeMetadata(output) + }; + return response; + }, "de_UpdateKeyDescriptionCommand"); + var de_UpdatePrimaryRegionCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + await (0, import_smithy_client5.collectBody)(output.body, context); + const response = { + $metadata: deserializeMetadata(output) + }; + return response; + }, "de_UpdatePrimaryRegionCommand"); + var de_VerifyCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core22.parseJsonBody)(output.body, context); + let contents = {}; + contents = (0, import_smithy_client5._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; + }, "de_VerifyCommand"); + var de_VerifyMacCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core22.parseJsonBody)(output.body, context); + let contents = {}; + contents = (0, import_smithy_client5._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; + }, "de_VerifyMacCommand"); + var de_CommandError = /* @__PURE__ */ __name(async (output, context) => { + const parsedOutput = { + ...output, + body: await (0, import_core22.parseJsonErrorBody)(output.body, context) + }; + const errorCode = (0, import_core22.loadRestJsonErrorCode)(output, parsedOutput.body); + switch (errorCode) { + case "DependencyTimeoutException": + case "com.amazonaws.kms#DependencyTimeoutException": + throw await de_DependencyTimeoutExceptionRes(parsedOutput, context); + case "InvalidArnException": + case "com.amazonaws.kms#InvalidArnException": + throw await de_InvalidArnExceptionRes(parsedOutput, context); + case "KMSInternalException": + case "com.amazonaws.kms#KMSInternalException": + throw await de_KMSInternalExceptionRes(parsedOutput, context); + case "KMSInvalidStateException": + case "com.amazonaws.kms#KMSInvalidStateException": + throw await de_KMSInvalidStateExceptionRes(parsedOutput, context); + case "NotFoundException": + case "com.amazonaws.kms#NotFoundException": + throw await de_NotFoundExceptionRes(parsedOutput, context); + case "CloudHsmClusterInvalidConfigurationException": + case "com.amazonaws.kms#CloudHsmClusterInvalidConfigurationException": + throw await de_CloudHsmClusterInvalidConfigurationExceptionRes(parsedOutput, context); + case "CloudHsmClusterNotActiveException": + case "com.amazonaws.kms#CloudHsmClusterNotActiveException": + throw await de_CloudHsmClusterNotActiveExceptionRes(parsedOutput, context); + case "CustomKeyStoreInvalidStateException": + case "com.amazonaws.kms#CustomKeyStoreInvalidStateException": + throw await de_CustomKeyStoreInvalidStateExceptionRes(parsedOutput, context); + case "CustomKeyStoreNotFoundException": + case "com.amazonaws.kms#CustomKeyStoreNotFoundException": + throw await de_CustomKeyStoreNotFoundExceptionRes(parsedOutput, context); + case "AlreadyExistsException": + case "com.amazonaws.kms#AlreadyExistsException": + throw await de_AlreadyExistsExceptionRes(parsedOutput, context); + case "InvalidAliasNameException": + case "com.amazonaws.kms#InvalidAliasNameException": + throw await de_InvalidAliasNameExceptionRes(parsedOutput, context); + case "LimitExceededException": + case "com.amazonaws.kms#LimitExceededException": + throw await de_LimitExceededExceptionRes(parsedOutput, context); + case "CloudHsmClusterInUseException": + case "com.amazonaws.kms#CloudHsmClusterInUseException": + throw await de_CloudHsmClusterInUseExceptionRes(parsedOutput, context); + case "CloudHsmClusterNotFoundException": + case "com.amazonaws.kms#CloudHsmClusterNotFoundException": + throw await de_CloudHsmClusterNotFoundExceptionRes(parsedOutput, context); + case "CustomKeyStoreNameInUseException": + case "com.amazonaws.kms#CustomKeyStoreNameInUseException": + throw await de_CustomKeyStoreNameInUseExceptionRes(parsedOutput, context); + case "IncorrectTrustAnchorException": + case "com.amazonaws.kms#IncorrectTrustAnchorException": + throw await de_IncorrectTrustAnchorExceptionRes(parsedOutput, context); + case "XksProxyIncorrectAuthenticationCredentialException": + case "com.amazonaws.kms#XksProxyIncorrectAuthenticationCredentialException": + throw await de_XksProxyIncorrectAuthenticationCredentialExceptionRes(parsedOutput, context); + case "XksProxyInvalidConfigurationException": + case "com.amazonaws.kms#XksProxyInvalidConfigurationException": + throw await de_XksProxyInvalidConfigurationExceptionRes(parsedOutput, context); + case "XksProxyInvalidResponseException": + case "com.amazonaws.kms#XksProxyInvalidResponseException": + throw await de_XksProxyInvalidResponseExceptionRes(parsedOutput, context); + case "XksProxyUriEndpointInUseException": + case "com.amazonaws.kms#XksProxyUriEndpointInUseException": + throw await de_XksProxyUriEndpointInUseExceptionRes(parsedOutput, context); + case "XksProxyUriInUseException": + case "com.amazonaws.kms#XksProxyUriInUseException": + throw await de_XksProxyUriInUseExceptionRes(parsedOutput, context); + case "XksProxyUriUnreachableException": + case "com.amazonaws.kms#XksProxyUriUnreachableException": + throw await de_XksProxyUriUnreachableExceptionRes(parsedOutput, context); + case "XksProxyVpcEndpointServiceInUseException": + case "com.amazonaws.kms#XksProxyVpcEndpointServiceInUseException": + throw await de_XksProxyVpcEndpointServiceInUseExceptionRes(parsedOutput, context); + case "XksProxyVpcEndpointServiceInvalidConfigurationException": + case "com.amazonaws.kms#XksProxyVpcEndpointServiceInvalidConfigurationException": + throw await de_XksProxyVpcEndpointServiceInvalidConfigurationExceptionRes(parsedOutput, context); + case "XksProxyVpcEndpointServiceNotFoundException": + case "com.amazonaws.kms#XksProxyVpcEndpointServiceNotFoundException": + throw await de_XksProxyVpcEndpointServiceNotFoundExceptionRes(parsedOutput, context); + case "DisabledException": + case "com.amazonaws.kms#DisabledException": + throw await de_DisabledExceptionRes(parsedOutput, context); + case "DryRunOperationException": + case "com.amazonaws.kms#DryRunOperationException": + throw await de_DryRunOperationExceptionRes(parsedOutput, context); + case "InvalidGrantTokenException": + case "com.amazonaws.kms#InvalidGrantTokenException": + throw await de_InvalidGrantTokenExceptionRes(parsedOutput, context); + case "MalformedPolicyDocumentException": + case "com.amazonaws.kms#MalformedPolicyDocumentException": + throw await de_MalformedPolicyDocumentExceptionRes(parsedOutput, context); + case "TagException": + case "com.amazonaws.kms#TagException": + throw await de_TagExceptionRes(parsedOutput, context); + case "UnsupportedOperationException": + case "com.amazonaws.kms#UnsupportedOperationException": + throw await de_UnsupportedOperationExceptionRes(parsedOutput, context); + case "XksKeyAlreadyInUseException": + case "com.amazonaws.kms#XksKeyAlreadyInUseException": + throw await de_XksKeyAlreadyInUseExceptionRes(parsedOutput, context); + case "XksKeyInvalidConfigurationException": + case "com.amazonaws.kms#XksKeyInvalidConfigurationException": + throw await de_XksKeyInvalidConfigurationExceptionRes(parsedOutput, context); + case "XksKeyNotFoundException": + case "com.amazonaws.kms#XksKeyNotFoundException": + throw await de_XksKeyNotFoundExceptionRes(parsedOutput, context); + case "IncorrectKeyException": + case "com.amazonaws.kms#IncorrectKeyException": + throw await de_IncorrectKeyExceptionRes(parsedOutput, context); + case "InvalidCiphertextException": + case "com.amazonaws.kms#InvalidCiphertextException": + throw await de_InvalidCiphertextExceptionRes(parsedOutput, context); + case "InvalidKeyUsageException": + case "com.amazonaws.kms#InvalidKeyUsageException": + throw await de_InvalidKeyUsageExceptionRes(parsedOutput, context); + case "KeyUnavailableException": + case "com.amazonaws.kms#KeyUnavailableException": + throw await de_KeyUnavailableExceptionRes(parsedOutput, context); + case "CustomKeyStoreHasCMKsException": + case "com.amazonaws.kms#CustomKeyStoreHasCMKsException": + throw await de_CustomKeyStoreHasCMKsExceptionRes(parsedOutput, context); + case "InvalidMarkerException": + case "com.amazonaws.kms#InvalidMarkerException": + throw await de_InvalidMarkerExceptionRes(parsedOutput, context); + case "ExpiredImportTokenException": + case "com.amazonaws.kms#ExpiredImportTokenException": + throw await de_ExpiredImportTokenExceptionRes(parsedOutput, context); + case "IncorrectKeyMaterialException": + case "com.amazonaws.kms#IncorrectKeyMaterialException": + throw await de_IncorrectKeyMaterialExceptionRes(parsedOutput, context); + case "InvalidImportTokenException": + case "com.amazonaws.kms#InvalidImportTokenException": + throw await de_InvalidImportTokenExceptionRes(parsedOutput, context); + case "InvalidGrantIdException": + case "com.amazonaws.kms#InvalidGrantIdException": + throw await de_InvalidGrantIdExceptionRes(parsedOutput, context); + case "ConflictException": + case "com.amazonaws.kms#ConflictException": + throw await de_ConflictExceptionRes(parsedOutput, context); + case "CloudHsmClusterNotRelatedException": + case "com.amazonaws.kms#CloudHsmClusterNotRelatedException": + throw await de_CloudHsmClusterNotRelatedExceptionRes(parsedOutput, context); + case "KMSInvalidSignatureException": + case "com.amazonaws.kms#KMSInvalidSignatureException": + throw await de_KMSInvalidSignatureExceptionRes(parsedOutput, context); + case "KMSInvalidMacException": + case "com.amazonaws.kms#KMSInvalidMacException": + throw await de_KMSInvalidMacExceptionRes(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody, + errorCode + }); } - onError(error) { - this.handler.onError(error); + }, "de_CommandError"); + var de_AlreadyExistsExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client5._json)(body); + const exception = new AlreadyExistsException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client5.decorateServiceException)(exception, body); + }, "de_AlreadyExistsExceptionRes"); + var de_CloudHsmClusterInUseExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client5._json)(body); + const exception = new CloudHsmClusterInUseException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client5.decorateServiceException)(exception, body); + }, "de_CloudHsmClusterInUseExceptionRes"); + var de_CloudHsmClusterInvalidConfigurationExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client5._json)(body); + const exception = new CloudHsmClusterInvalidConfigurationException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client5.decorateServiceException)(exception, body); + }, "de_CloudHsmClusterInvalidConfigurationExceptionRes"); + var de_CloudHsmClusterNotActiveExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client5._json)(body); + const exception = new CloudHsmClusterNotActiveException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client5.decorateServiceException)(exception, body); + }, "de_CloudHsmClusterNotActiveExceptionRes"); + var de_CloudHsmClusterNotFoundExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client5._json)(body); + const exception = new CloudHsmClusterNotFoundException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client5.decorateServiceException)(exception, body); + }, "de_CloudHsmClusterNotFoundExceptionRes"); + var de_CloudHsmClusterNotRelatedExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client5._json)(body); + const exception = new CloudHsmClusterNotRelatedException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client5.decorateServiceException)(exception, body); + }, "de_CloudHsmClusterNotRelatedExceptionRes"); + var de_ConflictExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client5._json)(body); + const exception = new ConflictException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client5.decorateServiceException)(exception, body); + }, "de_ConflictExceptionRes"); + var de_CustomKeyStoreHasCMKsExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client5._json)(body); + const exception = new CustomKeyStoreHasCMKsException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client5.decorateServiceException)(exception, body); + }, "de_CustomKeyStoreHasCMKsExceptionRes"); + var de_CustomKeyStoreInvalidStateExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client5._json)(body); + const exception = new CustomKeyStoreInvalidStateException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client5.decorateServiceException)(exception, body); + }, "de_CustomKeyStoreInvalidStateExceptionRes"); + var de_CustomKeyStoreNameInUseExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client5._json)(body); + const exception = new CustomKeyStoreNameInUseException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client5.decorateServiceException)(exception, body); + }, "de_CustomKeyStoreNameInUseExceptionRes"); + var de_CustomKeyStoreNotFoundExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client5._json)(body); + const exception = new CustomKeyStoreNotFoundException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client5.decorateServiceException)(exception, body); + }, "de_CustomKeyStoreNotFoundExceptionRes"); + var de_DependencyTimeoutExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client5._json)(body); + const exception = new DependencyTimeoutException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client5.decorateServiceException)(exception, body); + }, "de_DependencyTimeoutExceptionRes"); + var de_DisabledExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client5._json)(body); + const exception = new DisabledException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client5.decorateServiceException)(exception, body); + }, "de_DisabledExceptionRes"); + var de_DryRunOperationExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client5._json)(body); + const exception = new DryRunOperationException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client5.decorateServiceException)(exception, body); + }, "de_DryRunOperationExceptionRes"); + var de_ExpiredImportTokenExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client5._json)(body); + const exception = new ExpiredImportTokenException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client5.decorateServiceException)(exception, body); + }, "de_ExpiredImportTokenExceptionRes"); + var de_IncorrectKeyExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client5._json)(body); + const exception = new IncorrectKeyException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client5.decorateServiceException)(exception, body); + }, "de_IncorrectKeyExceptionRes"); + var de_IncorrectKeyMaterialExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client5._json)(body); + const exception = new IncorrectKeyMaterialException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client5.decorateServiceException)(exception, body); + }, "de_IncorrectKeyMaterialExceptionRes"); + var de_IncorrectTrustAnchorExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client5._json)(body); + const exception = new IncorrectTrustAnchorException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client5.decorateServiceException)(exception, body); + }, "de_IncorrectTrustAnchorExceptionRes"); + var de_InvalidAliasNameExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client5._json)(body); + const exception = new InvalidAliasNameException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client5.decorateServiceException)(exception, body); + }, "de_InvalidAliasNameExceptionRes"); + var de_InvalidArnExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client5._json)(body); + const exception = new InvalidArnException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client5.decorateServiceException)(exception, body); + }, "de_InvalidArnExceptionRes"); + var de_InvalidCiphertextExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client5._json)(body); + const exception = new InvalidCiphertextException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client5.decorateServiceException)(exception, body); + }, "de_InvalidCiphertextExceptionRes"); + var de_InvalidGrantIdExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client5._json)(body); + const exception = new InvalidGrantIdException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client5.decorateServiceException)(exception, body); + }, "de_InvalidGrantIdExceptionRes"); + var de_InvalidGrantTokenExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client5._json)(body); + const exception = new InvalidGrantTokenException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client5.decorateServiceException)(exception, body); + }, "de_InvalidGrantTokenExceptionRes"); + var de_InvalidImportTokenExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client5._json)(body); + const exception = new InvalidImportTokenException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client5.decorateServiceException)(exception, body); + }, "de_InvalidImportTokenExceptionRes"); + var de_InvalidKeyUsageExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client5._json)(body); + const exception = new InvalidKeyUsageException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client5.decorateServiceException)(exception, body); + }, "de_InvalidKeyUsageExceptionRes"); + var de_InvalidMarkerExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client5._json)(body); + const exception = new InvalidMarkerException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client5.decorateServiceException)(exception, body); + }, "de_InvalidMarkerExceptionRes"); + var de_KeyUnavailableExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client5._json)(body); + const exception = new KeyUnavailableException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client5.decorateServiceException)(exception, body); + }, "de_KeyUnavailableExceptionRes"); + var de_KMSInternalExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client5._json)(body); + const exception = new KMSInternalException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client5.decorateServiceException)(exception, body); + }, "de_KMSInternalExceptionRes"); + var de_KMSInvalidMacExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client5._json)(body); + const exception = new KMSInvalidMacException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client5.decorateServiceException)(exception, body); + }, "de_KMSInvalidMacExceptionRes"); + var de_KMSInvalidSignatureExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client5._json)(body); + const exception = new KMSInvalidSignatureException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client5.decorateServiceException)(exception, body); + }, "de_KMSInvalidSignatureExceptionRes"); + var de_KMSInvalidStateExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client5._json)(body); + const exception = new KMSInvalidStateException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client5.decorateServiceException)(exception, body); + }, "de_KMSInvalidStateExceptionRes"); + var de_LimitExceededExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client5._json)(body); + const exception = new LimitExceededException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client5.decorateServiceException)(exception, body); + }, "de_LimitExceededExceptionRes"); + var de_MalformedPolicyDocumentExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client5._json)(body); + const exception = new MalformedPolicyDocumentException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client5.decorateServiceException)(exception, body); + }, "de_MalformedPolicyDocumentExceptionRes"); + var de_NotFoundExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client5._json)(body); + const exception = new NotFoundException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client5.decorateServiceException)(exception, body); + }, "de_NotFoundExceptionRes"); + var de_TagExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client5._json)(body); + const exception = new TagException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client5.decorateServiceException)(exception, body); + }, "de_TagExceptionRes"); + var de_UnsupportedOperationExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client5._json)(body); + const exception = new UnsupportedOperationException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client5.decorateServiceException)(exception, body); + }, "de_UnsupportedOperationExceptionRes"); + var de_XksKeyAlreadyInUseExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client5._json)(body); + const exception = new XksKeyAlreadyInUseException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client5.decorateServiceException)(exception, body); + }, "de_XksKeyAlreadyInUseExceptionRes"); + var de_XksKeyInvalidConfigurationExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client5._json)(body); + const exception = new XksKeyInvalidConfigurationException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client5.decorateServiceException)(exception, body); + }, "de_XksKeyInvalidConfigurationExceptionRes"); + var de_XksKeyNotFoundExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client5._json)(body); + const exception = new XksKeyNotFoundException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client5.decorateServiceException)(exception, body); + }, "de_XksKeyNotFoundExceptionRes"); + var de_XksProxyIncorrectAuthenticationCredentialExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client5._json)(body); + const exception = new XksProxyIncorrectAuthenticationCredentialException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client5.decorateServiceException)(exception, body); + }, "de_XksProxyIncorrectAuthenticationCredentialExceptionRes"); + var de_XksProxyInvalidConfigurationExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client5._json)(body); + const exception = new XksProxyInvalidConfigurationException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client5.decorateServiceException)(exception, body); + }, "de_XksProxyInvalidConfigurationExceptionRes"); + var de_XksProxyInvalidResponseExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client5._json)(body); + const exception = new XksProxyInvalidResponseException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client5.decorateServiceException)(exception, body); + }, "de_XksProxyInvalidResponseExceptionRes"); + var de_XksProxyUriEndpointInUseExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client5._json)(body); + const exception = new XksProxyUriEndpointInUseException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client5.decorateServiceException)(exception, body); + }, "de_XksProxyUriEndpointInUseExceptionRes"); + var de_XksProxyUriInUseExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client5._json)(body); + const exception = new XksProxyUriInUseException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client5.decorateServiceException)(exception, body); + }, "de_XksProxyUriInUseExceptionRes"); + var de_XksProxyUriUnreachableExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client5._json)(body); + const exception = new XksProxyUriUnreachableException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client5.decorateServiceException)(exception, body); + }, "de_XksProxyUriUnreachableExceptionRes"); + var de_XksProxyVpcEndpointServiceInUseExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client5._json)(body); + const exception = new XksProxyVpcEndpointServiceInUseException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client5.decorateServiceException)(exception, body); + }, "de_XksProxyVpcEndpointServiceInUseExceptionRes"); + var de_XksProxyVpcEndpointServiceInvalidConfigurationExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client5._json)(body); + const exception = new XksProxyVpcEndpointServiceInvalidConfigurationException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client5.decorateServiceException)(exception, body); + }, "de_XksProxyVpcEndpointServiceInvalidConfigurationExceptionRes"); + var de_XksProxyVpcEndpointServiceNotFoundExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client5._json)(body); + const exception = new XksProxyVpcEndpointServiceNotFoundException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client5.decorateServiceException)(exception, body); + }, "de_XksProxyVpcEndpointServiceNotFoundExceptionRes"); + var se_DecryptRequest = /* @__PURE__ */ __name((input, context) => { + return (0, import_smithy_client5.take)(input, { + CiphertextBlob: context.base64Encoder, + DryRun: [], + EncryptionAlgorithm: [], + EncryptionContext: import_smithy_client5._json, + GrantTokens: import_smithy_client5._json, + KeyId: [], + Recipient: (_) => se_RecipientInfo(_, context) + }); + }, "se_DecryptRequest"); + var se_DeriveSharedSecretRequest = /* @__PURE__ */ __name((input, context) => { + return (0, import_smithy_client5.take)(input, { + DryRun: [], + GrantTokens: import_smithy_client5._json, + KeyAgreementAlgorithm: [], + KeyId: [], + PublicKey: context.base64Encoder, + Recipient: (_) => se_RecipientInfo(_, context) + }); + }, "se_DeriveSharedSecretRequest"); + var se_EncryptRequest = /* @__PURE__ */ __name((input, context) => { + return (0, import_smithy_client5.take)(input, { + DryRun: [], + EncryptionAlgorithm: [], + EncryptionContext: import_smithy_client5._json, + GrantTokens: import_smithy_client5._json, + KeyId: [], + Plaintext: context.base64Encoder + }); + }, "se_EncryptRequest"); + var se_GenerateDataKeyPairRequest = /* @__PURE__ */ __name((input, context) => { + return (0, import_smithy_client5.take)(input, { + DryRun: [], + EncryptionContext: import_smithy_client5._json, + GrantTokens: import_smithy_client5._json, + KeyId: [], + KeyPairSpec: [], + Recipient: (_) => se_RecipientInfo(_, context) + }); + }, "se_GenerateDataKeyPairRequest"); + var se_GenerateDataKeyRequest = /* @__PURE__ */ __name((input, context) => { + return (0, import_smithy_client5.take)(input, { + DryRun: [], + EncryptionContext: import_smithy_client5._json, + GrantTokens: import_smithy_client5._json, + KeyId: [], + KeySpec: [], + NumberOfBytes: [], + Recipient: (_) => se_RecipientInfo(_, context) + }); + }, "se_GenerateDataKeyRequest"); + var se_GenerateMacRequest = /* @__PURE__ */ __name((input, context) => { + return (0, import_smithy_client5.take)(input, { + DryRun: [], + GrantTokens: import_smithy_client5._json, + KeyId: [], + MacAlgorithm: [], + Message: context.base64Encoder + }); + }, "se_GenerateMacRequest"); + var se_GenerateRandomRequest = /* @__PURE__ */ __name((input, context) => { + return (0, import_smithy_client5.take)(input, { + CustomKeyStoreId: [], + NumberOfBytes: [], + Recipient: (_) => se_RecipientInfo(_, context) + }); + }, "se_GenerateRandomRequest"); + var se_ImportKeyMaterialRequest = /* @__PURE__ */ __name((input, context) => { + return (0, import_smithy_client5.take)(input, { + EncryptedKeyMaterial: context.base64Encoder, + ExpirationModel: [], + ImportToken: context.base64Encoder, + KeyId: [], + ValidTo: (_) => _.getTime() / 1e3 + }); + }, "se_ImportKeyMaterialRequest"); + var se_RecipientInfo = /* @__PURE__ */ __name((input, context) => { + return (0, import_smithy_client5.take)(input, { + AttestationDocument: context.base64Encoder, + KeyEncryptionAlgorithm: [] + }); + }, "se_RecipientInfo"); + var se_ReEncryptRequest = /* @__PURE__ */ __name((input, context) => { + return (0, import_smithy_client5.take)(input, { + CiphertextBlob: context.base64Encoder, + DestinationEncryptionAlgorithm: [], + DestinationEncryptionContext: import_smithy_client5._json, + DestinationKeyId: [], + DryRun: [], + GrantTokens: import_smithy_client5._json, + SourceEncryptionAlgorithm: [], + SourceEncryptionContext: import_smithy_client5._json, + SourceKeyId: [] + }); + }, "se_ReEncryptRequest"); + var se_SignRequest = /* @__PURE__ */ __name((input, context) => { + return (0, import_smithy_client5.take)(input, { + DryRun: [], + GrantTokens: import_smithy_client5._json, + KeyId: [], + Message: context.base64Encoder, + MessageType: [], + SigningAlgorithm: [] + }); + }, "se_SignRequest"); + var se_VerifyMacRequest = /* @__PURE__ */ __name((input, context) => { + return (0, import_smithy_client5.take)(input, { + DryRun: [], + GrantTokens: import_smithy_client5._json, + KeyId: [], + Mac: context.base64Encoder, + MacAlgorithm: [], + Message: context.base64Encoder + }); + }, "se_VerifyMacRequest"); + var se_VerifyRequest = /* @__PURE__ */ __name((input, context) => { + return (0, import_smithy_client5.take)(input, { + DryRun: [], + GrantTokens: import_smithy_client5._json, + KeyId: [], + Message: context.base64Encoder, + MessageType: [], + Signature: context.base64Encoder, + SigningAlgorithm: [] + }); + }, "se_VerifyRequest"); + var de_AliasList = /* @__PURE__ */ __name((output, context) => { + const retVal = (output || []).filter((e) => e != null).map((entry) => { + return de_AliasListEntry(entry, context); + }); + return retVal; + }, "de_AliasList"); + var de_AliasListEntry = /* @__PURE__ */ __name((output, context) => { + return (0, import_smithy_client5.take)(output, { + AliasArn: import_smithy_client5.expectString, + AliasName: import_smithy_client5.expectString, + CreationDate: (_) => (0, import_smithy_client5.expectNonNull)((0, import_smithy_client5.parseEpochTimestamp)((0, import_smithy_client5.expectNumber)(_))), + LastUpdatedDate: (_) => (0, import_smithy_client5.expectNonNull)((0, import_smithy_client5.parseEpochTimestamp)((0, import_smithy_client5.expectNumber)(_))), + TargetKeyId: import_smithy_client5.expectString + }); + }, "de_AliasListEntry"); + var de_CreateKeyResponse = /* @__PURE__ */ __name((output, context) => { + return (0, import_smithy_client5.take)(output, { + KeyMetadata: (_) => de_KeyMetadata(_, context) + }); + }, "de_CreateKeyResponse"); + var de_CustomKeyStoresList = /* @__PURE__ */ __name((output, context) => { + const retVal = (output || []).filter((e) => e != null).map((entry) => { + return de_CustomKeyStoresListEntry(entry, context); + }); + return retVal; + }, "de_CustomKeyStoresList"); + var de_CustomKeyStoresListEntry = /* @__PURE__ */ __name((output, context) => { + return (0, import_smithy_client5.take)(output, { + CloudHsmClusterId: import_smithy_client5.expectString, + ConnectionErrorCode: import_smithy_client5.expectString, + ConnectionState: import_smithy_client5.expectString, + CreationDate: (_) => (0, import_smithy_client5.expectNonNull)((0, import_smithy_client5.parseEpochTimestamp)((0, import_smithy_client5.expectNumber)(_))), + CustomKeyStoreId: import_smithy_client5.expectString, + CustomKeyStoreName: import_smithy_client5.expectString, + CustomKeyStoreType: import_smithy_client5.expectString, + TrustAnchorCertificate: import_smithy_client5.expectString, + XksProxyConfiguration: import_smithy_client5._json + }); + }, "de_CustomKeyStoresListEntry"); + var de_DecryptResponse = /* @__PURE__ */ __name((output, context) => { + return (0, import_smithy_client5.take)(output, { + CiphertextForRecipient: context.base64Decoder, + EncryptionAlgorithm: import_smithy_client5.expectString, + KeyId: import_smithy_client5.expectString, + Plaintext: context.base64Decoder + }); + }, "de_DecryptResponse"); + var de_DeriveSharedSecretResponse = /* @__PURE__ */ __name((output, context) => { + return (0, import_smithy_client5.take)(output, { + CiphertextForRecipient: context.base64Decoder, + KeyAgreementAlgorithm: import_smithy_client5.expectString, + KeyId: import_smithy_client5.expectString, + KeyOrigin: import_smithy_client5.expectString, + SharedSecret: context.base64Decoder + }); + }, "de_DeriveSharedSecretResponse"); + var de_DescribeCustomKeyStoresResponse = /* @__PURE__ */ __name((output, context) => { + return (0, import_smithy_client5.take)(output, { + CustomKeyStores: (_) => de_CustomKeyStoresList(_, context), + NextMarker: import_smithy_client5.expectString, + Truncated: import_smithy_client5.expectBoolean + }); + }, "de_DescribeCustomKeyStoresResponse"); + var de_DescribeKeyResponse = /* @__PURE__ */ __name((output, context) => { + return (0, import_smithy_client5.take)(output, { + KeyMetadata: (_) => de_KeyMetadata(_, context) + }); + }, "de_DescribeKeyResponse"); + var de_EncryptResponse = /* @__PURE__ */ __name((output, context) => { + return (0, import_smithy_client5.take)(output, { + CiphertextBlob: context.base64Decoder, + EncryptionAlgorithm: import_smithy_client5.expectString, + KeyId: import_smithy_client5.expectString + }); + }, "de_EncryptResponse"); + var de_GenerateDataKeyPairResponse = /* @__PURE__ */ __name((output, context) => { + return (0, import_smithy_client5.take)(output, { + CiphertextForRecipient: context.base64Decoder, + KeyId: import_smithy_client5.expectString, + KeyPairSpec: import_smithy_client5.expectString, + PrivateKeyCiphertextBlob: context.base64Decoder, + PrivateKeyPlaintext: context.base64Decoder, + PublicKey: context.base64Decoder + }); + }, "de_GenerateDataKeyPairResponse"); + var de_GenerateDataKeyPairWithoutPlaintextResponse = /* @__PURE__ */ __name((output, context) => { + return (0, import_smithy_client5.take)(output, { + KeyId: import_smithy_client5.expectString, + KeyPairSpec: import_smithy_client5.expectString, + PrivateKeyCiphertextBlob: context.base64Decoder, + PublicKey: context.base64Decoder + }); + }, "de_GenerateDataKeyPairWithoutPlaintextResponse"); + var de_GenerateDataKeyResponse = /* @__PURE__ */ __name((output, context) => { + return (0, import_smithy_client5.take)(output, { + CiphertextBlob: context.base64Decoder, + CiphertextForRecipient: context.base64Decoder, + KeyId: import_smithy_client5.expectString, + Plaintext: context.base64Decoder + }); + }, "de_GenerateDataKeyResponse"); + var de_GenerateDataKeyWithoutPlaintextResponse = /* @__PURE__ */ __name((output, context) => { + return (0, import_smithy_client5.take)(output, { + CiphertextBlob: context.base64Decoder, + KeyId: import_smithy_client5.expectString + }); + }, "de_GenerateDataKeyWithoutPlaintextResponse"); + var de_GenerateMacResponse = /* @__PURE__ */ __name((output, context) => { + return (0, import_smithy_client5.take)(output, { + KeyId: import_smithy_client5.expectString, + Mac: context.base64Decoder, + MacAlgorithm: import_smithy_client5.expectString + }); + }, "de_GenerateMacResponse"); + var de_GenerateRandomResponse = /* @__PURE__ */ __name((output, context) => { + return (0, import_smithy_client5.take)(output, { + CiphertextForRecipient: context.base64Decoder, + Plaintext: context.base64Decoder + }); + }, "de_GenerateRandomResponse"); + var de_GetKeyRotationStatusResponse = /* @__PURE__ */ __name((output, context) => { + return (0, import_smithy_client5.take)(output, { + KeyId: import_smithy_client5.expectString, + KeyRotationEnabled: import_smithy_client5.expectBoolean, + NextRotationDate: (_) => (0, import_smithy_client5.expectNonNull)((0, import_smithy_client5.parseEpochTimestamp)((0, import_smithy_client5.expectNumber)(_))), + OnDemandRotationStartDate: (_) => (0, import_smithy_client5.expectNonNull)((0, import_smithy_client5.parseEpochTimestamp)((0, import_smithy_client5.expectNumber)(_))), + RotationPeriodInDays: import_smithy_client5.expectInt32 + }); + }, "de_GetKeyRotationStatusResponse"); + var de_GetParametersForImportResponse = /* @__PURE__ */ __name((output, context) => { + return (0, import_smithy_client5.take)(output, { + ImportToken: context.base64Decoder, + KeyId: import_smithy_client5.expectString, + ParametersValidTo: (_) => (0, import_smithy_client5.expectNonNull)((0, import_smithy_client5.parseEpochTimestamp)((0, import_smithy_client5.expectNumber)(_))), + PublicKey: context.base64Decoder + }); + }, "de_GetParametersForImportResponse"); + var de_GetPublicKeyResponse = /* @__PURE__ */ __name((output, context) => { + return (0, import_smithy_client5.take)(output, { + CustomerMasterKeySpec: import_smithy_client5.expectString, + EncryptionAlgorithms: import_smithy_client5._json, + KeyAgreementAlgorithms: import_smithy_client5._json, + KeyId: import_smithy_client5.expectString, + KeySpec: import_smithy_client5.expectString, + KeyUsage: import_smithy_client5.expectString, + PublicKey: context.base64Decoder, + SigningAlgorithms: import_smithy_client5._json + }); + }, "de_GetPublicKeyResponse"); + var de_GrantList = /* @__PURE__ */ __name((output, context) => { + const retVal = (output || []).filter((e) => e != null).map((entry) => { + return de_GrantListEntry(entry, context); + }); + return retVal; + }, "de_GrantList"); + var de_GrantListEntry = /* @__PURE__ */ __name((output, context) => { + return (0, import_smithy_client5.take)(output, { + Constraints: import_smithy_client5._json, + CreationDate: (_) => (0, import_smithy_client5.expectNonNull)((0, import_smithy_client5.parseEpochTimestamp)((0, import_smithy_client5.expectNumber)(_))), + GrantId: import_smithy_client5.expectString, + GranteePrincipal: import_smithy_client5.expectString, + IssuingAccount: import_smithy_client5.expectString, + KeyId: import_smithy_client5.expectString, + Name: import_smithy_client5.expectString, + Operations: import_smithy_client5._json, + RetiringPrincipal: import_smithy_client5.expectString + }); + }, "de_GrantListEntry"); + var de_KeyMetadata = /* @__PURE__ */ __name((output, context) => { + return (0, import_smithy_client5.take)(output, { + AWSAccountId: import_smithy_client5.expectString, + Arn: import_smithy_client5.expectString, + CloudHsmClusterId: import_smithy_client5.expectString, + CreationDate: (_) => (0, import_smithy_client5.expectNonNull)((0, import_smithy_client5.parseEpochTimestamp)((0, import_smithy_client5.expectNumber)(_))), + CustomKeyStoreId: import_smithy_client5.expectString, + CustomerMasterKeySpec: import_smithy_client5.expectString, + DeletionDate: (_) => (0, import_smithy_client5.expectNonNull)((0, import_smithy_client5.parseEpochTimestamp)((0, import_smithy_client5.expectNumber)(_))), + Description: import_smithy_client5.expectString, + Enabled: import_smithy_client5.expectBoolean, + EncryptionAlgorithms: import_smithy_client5._json, + ExpirationModel: import_smithy_client5.expectString, + KeyAgreementAlgorithms: import_smithy_client5._json, + KeyId: import_smithy_client5.expectString, + KeyManager: import_smithy_client5.expectString, + KeySpec: import_smithy_client5.expectString, + KeyState: import_smithy_client5.expectString, + KeyUsage: import_smithy_client5.expectString, + MacAlgorithms: import_smithy_client5._json, + MultiRegion: import_smithy_client5.expectBoolean, + MultiRegionConfiguration: import_smithy_client5._json, + Origin: import_smithy_client5.expectString, + PendingDeletionWindowInDays: import_smithy_client5.expectInt32, + SigningAlgorithms: import_smithy_client5._json, + ValidTo: (_) => (0, import_smithy_client5.expectNonNull)((0, import_smithy_client5.parseEpochTimestamp)((0, import_smithy_client5.expectNumber)(_))), + XksKeyConfiguration: import_smithy_client5._json + }); + }, "de_KeyMetadata"); + var de_ListAliasesResponse = /* @__PURE__ */ __name((output, context) => { + return (0, import_smithy_client5.take)(output, { + Aliases: (_) => de_AliasList(_, context), + NextMarker: import_smithy_client5.expectString, + Truncated: import_smithy_client5.expectBoolean + }); + }, "de_ListAliasesResponse"); + var de_ListGrantsResponse = /* @__PURE__ */ __name((output, context) => { + return (0, import_smithy_client5.take)(output, { + Grants: (_) => de_GrantList(_, context), + NextMarker: import_smithy_client5.expectString, + Truncated: import_smithy_client5.expectBoolean + }); + }, "de_ListGrantsResponse"); + var de_ListKeyRotationsResponse = /* @__PURE__ */ __name((output, context) => { + return (0, import_smithy_client5.take)(output, { + NextMarker: import_smithy_client5.expectString, + Rotations: (_) => de_RotationsList(_, context), + Truncated: import_smithy_client5.expectBoolean + }); + }, "de_ListKeyRotationsResponse"); + var de_ReEncryptResponse = /* @__PURE__ */ __name((output, context) => { + return (0, import_smithy_client5.take)(output, { + CiphertextBlob: context.base64Decoder, + DestinationEncryptionAlgorithm: import_smithy_client5.expectString, + KeyId: import_smithy_client5.expectString, + SourceEncryptionAlgorithm: import_smithy_client5.expectString, + SourceKeyId: import_smithy_client5.expectString + }); + }, "de_ReEncryptResponse"); + var de_ReplicateKeyResponse = /* @__PURE__ */ __name((output, context) => { + return (0, import_smithy_client5.take)(output, { + ReplicaKeyMetadata: (_) => de_KeyMetadata(_, context), + ReplicaPolicy: import_smithy_client5.expectString, + ReplicaTags: import_smithy_client5._json + }); + }, "de_ReplicateKeyResponse"); + var de_RotationsList = /* @__PURE__ */ __name((output, context) => { + const retVal = (output || []).filter((e) => e != null).map((entry) => { + return de_RotationsListEntry(entry, context); + }); + return retVal; + }, "de_RotationsList"); + var de_RotationsListEntry = /* @__PURE__ */ __name((output, context) => { + return (0, import_smithy_client5.take)(output, { + KeyId: import_smithy_client5.expectString, + RotationDate: (_) => (0, import_smithy_client5.expectNonNull)((0, import_smithy_client5.parseEpochTimestamp)((0, import_smithy_client5.expectNumber)(_))), + RotationType: import_smithy_client5.expectString + }); + }, "de_RotationsListEntry"); + var de_ScheduleKeyDeletionResponse = /* @__PURE__ */ __name((output, context) => { + return (0, import_smithy_client5.take)(output, { + DeletionDate: (_) => (0, import_smithy_client5.expectNonNull)((0, import_smithy_client5.parseEpochTimestamp)((0, import_smithy_client5.expectNumber)(_))), + KeyId: import_smithy_client5.expectString, + KeyState: import_smithy_client5.expectString, + PendingWindowInDays: import_smithy_client5.expectInt32 + }); + }, "de_ScheduleKeyDeletionResponse"); + var de_SignResponse = /* @__PURE__ */ __name((output, context) => { + return (0, import_smithy_client5.take)(output, { + KeyId: import_smithy_client5.expectString, + Signature: context.base64Decoder, + SigningAlgorithm: import_smithy_client5.expectString + }); + }, "de_SignResponse"); + var deserializeMetadata = /* @__PURE__ */ __name((output) => ({ + httpStatusCode: output.statusCode, + requestId: output.headers["x-amzn-requestid"] ?? output.headers["x-amzn-request-id"] ?? output.headers["x-amz-request-id"], + extendedRequestId: output.headers["x-amz-id-2"], + cfId: output.headers["x-amz-cf-id"] + }), "deserializeMetadata"); + var throwDefaultError = (0, import_smithy_client5.withBaseException)(KMSServiceException); + var buildHttpRpcRequest = /* @__PURE__ */ __name(async (context, headers, path, resolvedHostname, body) => { + const { hostname, protocol = "https", port, path: basePath } = await context.endpoint(); + const contents = { + protocol, + hostname, + port, + method: "POST", + path: basePath.endsWith("/") ? basePath.slice(0, -1) + path : basePath + path, + headers + }; + if (resolvedHostname !== void 0) { + contents.hostname = resolvedHostname; } - onHeaders(statusCode, headers, resume, statusText) { - this.location = this.history.length >= this.maxRedirections || util.isDisturbed(this.opts.body) ? null : parseLocation(statusCode, headers); - if (this.opts.throwOnMaxRedirect && this.history.length >= this.maxRedirections) { - if (this.request) { - this.request.abort(new Error("max redirects")); - } - this.redirectionLimitReached = true; - this.abort(new Error("max redirects")); - return; - } - if (this.opts.origin) { - this.history.push(new URL(this.opts.path, this.opts.origin)); - } - if (!this.location) { - return this.handler.onHeaders(statusCode, headers, resume, statusText); - } - const { origin, pathname, search } = util.parseURL(new URL(this.location, this.opts.origin && new URL(this.opts.path, this.opts.origin))); - const path = search ? `${pathname}${search}` : pathname; - this.opts.headers = cleanRequestHeaders(this.opts.headers, statusCode === 303, this.opts.origin !== origin); - this.opts.path = path; - this.opts.origin = origin; - this.opts.maxRedirections = 0; - this.opts.query = null; - if (statusCode === 303 && this.opts.method !== "HEAD") { - this.opts.method = "GET"; - this.opts.body = null; - } + if (body !== void 0) { + contents.body = body; } - onData(chunk) { - if (this.location) { - } else { - return this.handler.onData(chunk); - } + return new import_protocol_http8.HttpRequest(contents); + }, "buildHttpRpcRequest"); + function sharedHeaders(operation) { + return { + "content-type": "application/x-amz-json-1.1", + "x-amz-target": `TrentService.${operation}` + }; + } + __name(sharedHeaders, "sharedHeaders"); + var _CancelKeyDeletionCommand = class _CancelKeyDeletionCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("TrentService", "CancelKeyDeletion", {}).n("KMSClient", "CancelKeyDeletionCommand").f(void 0, void 0).ser(se_CancelKeyDeletionCommand).de(de_CancelKeyDeletionCommand).build() { + }; + __name(_CancelKeyDeletionCommand, "CancelKeyDeletionCommand"); + var CancelKeyDeletionCommand = _CancelKeyDeletionCommand; + var _ConnectCustomKeyStoreCommand = class _ConnectCustomKeyStoreCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("TrentService", "ConnectCustomKeyStore", {}).n("KMSClient", "ConnectCustomKeyStoreCommand").f(void 0, void 0).ser(se_ConnectCustomKeyStoreCommand).de(de_ConnectCustomKeyStoreCommand).build() { + }; + __name(_ConnectCustomKeyStoreCommand, "ConnectCustomKeyStoreCommand"); + var ConnectCustomKeyStoreCommand = _ConnectCustomKeyStoreCommand; + var _CreateAliasCommand = class _CreateAliasCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("TrentService", "CreateAlias", {}).n("KMSClient", "CreateAliasCommand").f(void 0, void 0).ser(se_CreateAliasCommand).de(de_CreateAliasCommand).build() { + }; + __name(_CreateAliasCommand, "CreateAliasCommand"); + var CreateAliasCommand = _CreateAliasCommand; + var _CreateCustomKeyStoreCommand = class _CreateCustomKeyStoreCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("TrentService", "CreateCustomKeyStore", {}).n("KMSClient", "CreateCustomKeyStoreCommand").f(CreateCustomKeyStoreRequestFilterSensitiveLog, void 0).ser(se_CreateCustomKeyStoreCommand).de(de_CreateCustomKeyStoreCommand).build() { + }; + __name(_CreateCustomKeyStoreCommand, "CreateCustomKeyStoreCommand"); + var CreateCustomKeyStoreCommand = _CreateCustomKeyStoreCommand; + var _CreateGrantCommand = class _CreateGrantCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("TrentService", "CreateGrant", {}).n("KMSClient", "CreateGrantCommand").f(void 0, void 0).ser(se_CreateGrantCommand).de(de_CreateGrantCommand).build() { + }; + __name(_CreateGrantCommand, "CreateGrantCommand"); + var CreateGrantCommand = _CreateGrantCommand; + var _CreateKeyCommand = class _CreateKeyCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("TrentService", "CreateKey", {}).n("KMSClient", "CreateKeyCommand").f(void 0, void 0).ser(se_CreateKeyCommand).de(de_CreateKeyCommand).build() { + }; + __name(_CreateKeyCommand, "CreateKeyCommand"); + var CreateKeyCommand = _CreateKeyCommand; + var _DecryptCommand = class _DecryptCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("TrentService", "Decrypt", {}).n("KMSClient", "DecryptCommand").f(void 0, DecryptResponseFilterSensitiveLog).ser(se_DecryptCommand).de(de_DecryptCommand).build() { + }; + __name(_DecryptCommand, "DecryptCommand"); + var DecryptCommand = _DecryptCommand; + var _DeleteAliasCommand = class _DeleteAliasCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("TrentService", "DeleteAlias", {}).n("KMSClient", "DeleteAliasCommand").f(void 0, void 0).ser(se_DeleteAliasCommand).de(de_DeleteAliasCommand).build() { + }; + __name(_DeleteAliasCommand, "DeleteAliasCommand"); + var DeleteAliasCommand = _DeleteAliasCommand; + var _DeleteCustomKeyStoreCommand = class _DeleteCustomKeyStoreCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("TrentService", "DeleteCustomKeyStore", {}).n("KMSClient", "DeleteCustomKeyStoreCommand").f(void 0, void 0).ser(se_DeleteCustomKeyStoreCommand).de(de_DeleteCustomKeyStoreCommand).build() { + }; + __name(_DeleteCustomKeyStoreCommand, "DeleteCustomKeyStoreCommand"); + var DeleteCustomKeyStoreCommand = _DeleteCustomKeyStoreCommand; + var _DeleteImportedKeyMaterialCommand = class _DeleteImportedKeyMaterialCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("TrentService", "DeleteImportedKeyMaterial", {}).n("KMSClient", "DeleteImportedKeyMaterialCommand").f(void 0, void 0).ser(se_DeleteImportedKeyMaterialCommand).de(de_DeleteImportedKeyMaterialCommand).build() { + }; + __name(_DeleteImportedKeyMaterialCommand, "DeleteImportedKeyMaterialCommand"); + var DeleteImportedKeyMaterialCommand = _DeleteImportedKeyMaterialCommand; + var _DeriveSharedSecretCommand = class _DeriveSharedSecretCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("TrentService", "DeriveSharedSecret", {}).n("KMSClient", "DeriveSharedSecretCommand").f(void 0, DeriveSharedSecretResponseFilterSensitiveLog).ser(se_DeriveSharedSecretCommand).de(de_DeriveSharedSecretCommand).build() { + }; + __name(_DeriveSharedSecretCommand, "DeriveSharedSecretCommand"); + var DeriveSharedSecretCommand = _DeriveSharedSecretCommand; + var _DescribeCustomKeyStoresCommand = class _DescribeCustomKeyStoresCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("TrentService", "DescribeCustomKeyStores", {}).n("KMSClient", "DescribeCustomKeyStoresCommand").f(void 0, DescribeCustomKeyStoresResponseFilterSensitiveLog).ser(se_DescribeCustomKeyStoresCommand).de(de_DescribeCustomKeyStoresCommand).build() { + }; + __name(_DescribeCustomKeyStoresCommand, "DescribeCustomKeyStoresCommand"); + var DescribeCustomKeyStoresCommand = _DescribeCustomKeyStoresCommand; + var _DescribeKeyCommand = class _DescribeKeyCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("TrentService", "DescribeKey", {}).n("KMSClient", "DescribeKeyCommand").f(void 0, void 0).ser(se_DescribeKeyCommand).de(de_DescribeKeyCommand).build() { + }; + __name(_DescribeKeyCommand, "DescribeKeyCommand"); + var DescribeKeyCommand = _DescribeKeyCommand; + var _DisableKeyCommand = class _DisableKeyCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("TrentService", "DisableKey", {}).n("KMSClient", "DisableKeyCommand").f(void 0, void 0).ser(se_DisableKeyCommand).de(de_DisableKeyCommand).build() { + }; + __name(_DisableKeyCommand, "DisableKeyCommand"); + var DisableKeyCommand = _DisableKeyCommand; + var _DisableKeyRotationCommand = class _DisableKeyRotationCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("TrentService", "DisableKeyRotation", {}).n("KMSClient", "DisableKeyRotationCommand").f(void 0, void 0).ser(se_DisableKeyRotationCommand).de(de_DisableKeyRotationCommand).build() { + }; + __name(_DisableKeyRotationCommand, "DisableKeyRotationCommand"); + var DisableKeyRotationCommand = _DisableKeyRotationCommand; + var _DisconnectCustomKeyStoreCommand = class _DisconnectCustomKeyStoreCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("TrentService", "DisconnectCustomKeyStore", {}).n("KMSClient", "DisconnectCustomKeyStoreCommand").f(void 0, void 0).ser(se_DisconnectCustomKeyStoreCommand).de(de_DisconnectCustomKeyStoreCommand).build() { + }; + __name(_DisconnectCustomKeyStoreCommand, "DisconnectCustomKeyStoreCommand"); + var DisconnectCustomKeyStoreCommand = _DisconnectCustomKeyStoreCommand; + var _EnableKeyCommand = class _EnableKeyCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("TrentService", "EnableKey", {}).n("KMSClient", "EnableKeyCommand").f(void 0, void 0).ser(se_EnableKeyCommand).de(de_EnableKeyCommand).build() { + }; + __name(_EnableKeyCommand, "EnableKeyCommand"); + var EnableKeyCommand = _EnableKeyCommand; + var _EnableKeyRotationCommand = class _EnableKeyRotationCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("TrentService", "EnableKeyRotation", {}).n("KMSClient", "EnableKeyRotationCommand").f(void 0, void 0).ser(se_EnableKeyRotationCommand).de(de_EnableKeyRotationCommand).build() { + }; + __name(_EnableKeyRotationCommand, "EnableKeyRotationCommand"); + var EnableKeyRotationCommand = _EnableKeyRotationCommand; + var _EncryptCommand = class _EncryptCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("TrentService", "Encrypt", {}).n("KMSClient", "EncryptCommand").f(EncryptRequestFilterSensitiveLog, void 0).ser(se_EncryptCommand).de(de_EncryptCommand).build() { + }; + __name(_EncryptCommand, "EncryptCommand"); + var EncryptCommand = _EncryptCommand; + var _GenerateDataKeyCommand = class _GenerateDataKeyCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("TrentService", "GenerateDataKey", {}).n("KMSClient", "GenerateDataKeyCommand").f(void 0, GenerateDataKeyResponseFilterSensitiveLog).ser(se_GenerateDataKeyCommand).de(de_GenerateDataKeyCommand).build() { + }; + __name(_GenerateDataKeyCommand, "GenerateDataKeyCommand"); + var GenerateDataKeyCommand = _GenerateDataKeyCommand; + var _GenerateDataKeyPairCommand = class _GenerateDataKeyPairCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("TrentService", "GenerateDataKeyPair", {}).n("KMSClient", "GenerateDataKeyPairCommand").f(void 0, GenerateDataKeyPairResponseFilterSensitiveLog).ser(se_GenerateDataKeyPairCommand).de(de_GenerateDataKeyPairCommand).build() { + }; + __name(_GenerateDataKeyPairCommand, "GenerateDataKeyPairCommand"); + var GenerateDataKeyPairCommand = _GenerateDataKeyPairCommand; + var _GenerateDataKeyPairWithoutPlaintextCommand = class _GenerateDataKeyPairWithoutPlaintextCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("TrentService", "GenerateDataKeyPairWithoutPlaintext", {}).n("KMSClient", "GenerateDataKeyPairWithoutPlaintextCommand").f(void 0, void 0).ser(se_GenerateDataKeyPairWithoutPlaintextCommand).de(de_GenerateDataKeyPairWithoutPlaintextCommand).build() { + }; + __name(_GenerateDataKeyPairWithoutPlaintextCommand, "GenerateDataKeyPairWithoutPlaintextCommand"); + var GenerateDataKeyPairWithoutPlaintextCommand = _GenerateDataKeyPairWithoutPlaintextCommand; + var _GenerateDataKeyWithoutPlaintextCommand = class _GenerateDataKeyWithoutPlaintextCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("TrentService", "GenerateDataKeyWithoutPlaintext", {}).n("KMSClient", "GenerateDataKeyWithoutPlaintextCommand").f(void 0, void 0).ser(se_GenerateDataKeyWithoutPlaintextCommand).de(de_GenerateDataKeyWithoutPlaintextCommand).build() { + }; + __name(_GenerateDataKeyWithoutPlaintextCommand, "GenerateDataKeyWithoutPlaintextCommand"); + var GenerateDataKeyWithoutPlaintextCommand = _GenerateDataKeyWithoutPlaintextCommand; + var _GenerateMacCommand = class _GenerateMacCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("TrentService", "GenerateMac", {}).n("KMSClient", "GenerateMacCommand").f(GenerateMacRequestFilterSensitiveLog, void 0).ser(se_GenerateMacCommand).de(de_GenerateMacCommand).build() { + }; + __name(_GenerateMacCommand, "GenerateMacCommand"); + var GenerateMacCommand = _GenerateMacCommand; + var _GenerateRandomCommand = class _GenerateRandomCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("TrentService", "GenerateRandom", {}).n("KMSClient", "GenerateRandomCommand").f(void 0, GenerateRandomResponseFilterSensitiveLog).ser(se_GenerateRandomCommand).de(de_GenerateRandomCommand).build() { + }; + __name(_GenerateRandomCommand, "GenerateRandomCommand"); + var GenerateRandomCommand = _GenerateRandomCommand; + var _GetKeyPolicyCommand = class _GetKeyPolicyCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("TrentService", "GetKeyPolicy", {}).n("KMSClient", "GetKeyPolicyCommand").f(void 0, void 0).ser(se_GetKeyPolicyCommand).de(de_GetKeyPolicyCommand).build() { + }; + __name(_GetKeyPolicyCommand, "GetKeyPolicyCommand"); + var GetKeyPolicyCommand = _GetKeyPolicyCommand; + var _GetKeyRotationStatusCommand = class _GetKeyRotationStatusCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("TrentService", "GetKeyRotationStatus", {}).n("KMSClient", "GetKeyRotationStatusCommand").f(void 0, void 0).ser(se_GetKeyRotationStatusCommand).de(de_GetKeyRotationStatusCommand).build() { + }; + __name(_GetKeyRotationStatusCommand, "GetKeyRotationStatusCommand"); + var GetKeyRotationStatusCommand = _GetKeyRotationStatusCommand; + var _GetParametersForImportCommand = class _GetParametersForImportCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("TrentService", "GetParametersForImport", {}).n("KMSClient", "GetParametersForImportCommand").f(void 0, GetParametersForImportResponseFilterSensitiveLog).ser(se_GetParametersForImportCommand).de(de_GetParametersForImportCommand).build() { + }; + __name(_GetParametersForImportCommand, "GetParametersForImportCommand"); + var GetParametersForImportCommand = _GetParametersForImportCommand; + var _GetPublicKeyCommand = class _GetPublicKeyCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("TrentService", "GetPublicKey", {}).n("KMSClient", "GetPublicKeyCommand").f(void 0, void 0).ser(se_GetPublicKeyCommand).de(de_GetPublicKeyCommand).build() { + }; + __name(_GetPublicKeyCommand, "GetPublicKeyCommand"); + var GetPublicKeyCommand = _GetPublicKeyCommand; + var _ImportKeyMaterialCommand = class _ImportKeyMaterialCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("TrentService", "ImportKeyMaterial", {}).n("KMSClient", "ImportKeyMaterialCommand").f(void 0, void 0).ser(se_ImportKeyMaterialCommand).de(de_ImportKeyMaterialCommand).build() { + }; + __name(_ImportKeyMaterialCommand, "ImportKeyMaterialCommand"); + var ImportKeyMaterialCommand = _ImportKeyMaterialCommand; + var _ListAliasesCommand = class _ListAliasesCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("TrentService", "ListAliases", {}).n("KMSClient", "ListAliasesCommand").f(void 0, void 0).ser(se_ListAliasesCommand).de(de_ListAliasesCommand).build() { + }; + __name(_ListAliasesCommand, "ListAliasesCommand"); + var ListAliasesCommand = _ListAliasesCommand; + var _ListGrantsCommand = class _ListGrantsCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("TrentService", "ListGrants", {}).n("KMSClient", "ListGrantsCommand").f(void 0, void 0).ser(se_ListGrantsCommand).de(de_ListGrantsCommand).build() { + }; + __name(_ListGrantsCommand, "ListGrantsCommand"); + var ListGrantsCommand = _ListGrantsCommand; + var _ListKeyPoliciesCommand = class _ListKeyPoliciesCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("TrentService", "ListKeyPolicies", {}).n("KMSClient", "ListKeyPoliciesCommand").f(void 0, void 0).ser(se_ListKeyPoliciesCommand).de(de_ListKeyPoliciesCommand).build() { + }; + __name(_ListKeyPoliciesCommand, "ListKeyPoliciesCommand"); + var ListKeyPoliciesCommand = _ListKeyPoliciesCommand; + var _ListKeyRotationsCommand = class _ListKeyRotationsCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("TrentService", "ListKeyRotations", {}).n("KMSClient", "ListKeyRotationsCommand").f(void 0, void 0).ser(se_ListKeyRotationsCommand).de(de_ListKeyRotationsCommand).build() { + }; + __name(_ListKeyRotationsCommand, "ListKeyRotationsCommand"); + var ListKeyRotationsCommand = _ListKeyRotationsCommand; + var _ListKeysCommand = class _ListKeysCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("TrentService", "ListKeys", {}).n("KMSClient", "ListKeysCommand").f(void 0, void 0).ser(se_ListKeysCommand).de(de_ListKeysCommand).build() { + }; + __name(_ListKeysCommand, "ListKeysCommand"); + var ListKeysCommand = _ListKeysCommand; + var _ListResourceTagsCommand = class _ListResourceTagsCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("TrentService", "ListResourceTags", {}).n("KMSClient", "ListResourceTagsCommand").f(void 0, void 0).ser(se_ListResourceTagsCommand).de(de_ListResourceTagsCommand).build() { + }; + __name(_ListResourceTagsCommand, "ListResourceTagsCommand"); + var ListResourceTagsCommand = _ListResourceTagsCommand; + var _ListRetirableGrantsCommand = class _ListRetirableGrantsCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("TrentService", "ListRetirableGrants", {}).n("KMSClient", "ListRetirableGrantsCommand").f(void 0, void 0).ser(se_ListRetirableGrantsCommand).de(de_ListRetirableGrantsCommand).build() { + }; + __name(_ListRetirableGrantsCommand, "ListRetirableGrantsCommand"); + var ListRetirableGrantsCommand = _ListRetirableGrantsCommand; + var _PutKeyPolicyCommand = class _PutKeyPolicyCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("TrentService", "PutKeyPolicy", {}).n("KMSClient", "PutKeyPolicyCommand").f(void 0, void 0).ser(se_PutKeyPolicyCommand).de(de_PutKeyPolicyCommand).build() { + }; + __name(_PutKeyPolicyCommand, "PutKeyPolicyCommand"); + var PutKeyPolicyCommand = _PutKeyPolicyCommand; + var _ReEncryptCommand = class _ReEncryptCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("TrentService", "ReEncrypt", {}).n("KMSClient", "ReEncryptCommand").f(void 0, void 0).ser(se_ReEncryptCommand).de(de_ReEncryptCommand).build() { + }; + __name(_ReEncryptCommand, "ReEncryptCommand"); + var ReEncryptCommand = _ReEncryptCommand; + var _ReplicateKeyCommand = class _ReplicateKeyCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("TrentService", "ReplicateKey", {}).n("KMSClient", "ReplicateKeyCommand").f(void 0, void 0).ser(se_ReplicateKeyCommand).de(de_ReplicateKeyCommand).build() { + }; + __name(_ReplicateKeyCommand, "ReplicateKeyCommand"); + var ReplicateKeyCommand = _ReplicateKeyCommand; + var _RetireGrantCommand = class _RetireGrantCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("TrentService", "RetireGrant", {}).n("KMSClient", "RetireGrantCommand").f(void 0, void 0).ser(se_RetireGrantCommand).de(de_RetireGrantCommand).build() { + }; + __name(_RetireGrantCommand, "RetireGrantCommand"); + var RetireGrantCommand = _RetireGrantCommand; + var _RevokeGrantCommand = class _RevokeGrantCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("TrentService", "RevokeGrant", {}).n("KMSClient", "RevokeGrantCommand").f(void 0, void 0).ser(se_RevokeGrantCommand).de(de_RevokeGrantCommand).build() { + }; + __name(_RevokeGrantCommand, "RevokeGrantCommand"); + var RevokeGrantCommand = _RevokeGrantCommand; + var _RotateKeyOnDemandCommand = class _RotateKeyOnDemandCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("TrentService", "RotateKeyOnDemand", {}).n("KMSClient", "RotateKeyOnDemandCommand").f(void 0, void 0).ser(se_RotateKeyOnDemandCommand).de(de_RotateKeyOnDemandCommand).build() { + }; + __name(_RotateKeyOnDemandCommand, "RotateKeyOnDemandCommand"); + var RotateKeyOnDemandCommand = _RotateKeyOnDemandCommand; + var _ScheduleKeyDeletionCommand = class _ScheduleKeyDeletionCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("TrentService", "ScheduleKeyDeletion", {}).n("KMSClient", "ScheduleKeyDeletionCommand").f(void 0, void 0).ser(se_ScheduleKeyDeletionCommand).de(de_ScheduleKeyDeletionCommand).build() { + }; + __name(_ScheduleKeyDeletionCommand, "ScheduleKeyDeletionCommand"); + var ScheduleKeyDeletionCommand = _ScheduleKeyDeletionCommand; + var _SignCommand = class _SignCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("TrentService", "Sign", {}).n("KMSClient", "SignCommand").f(SignRequestFilterSensitiveLog, void 0).ser(se_SignCommand).de(de_SignCommand).build() { + }; + __name(_SignCommand, "SignCommand"); + var SignCommand2 = _SignCommand; + var _TagResourceCommand = class _TagResourceCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("TrentService", "TagResource", {}).n("KMSClient", "TagResourceCommand").f(void 0, void 0).ser(se_TagResourceCommand).de(de_TagResourceCommand).build() { + }; + __name(_TagResourceCommand, "TagResourceCommand"); + var TagResourceCommand = _TagResourceCommand; + var _UntagResourceCommand = class _UntagResourceCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("TrentService", "UntagResource", {}).n("KMSClient", "UntagResourceCommand").f(void 0, void 0).ser(se_UntagResourceCommand).de(de_UntagResourceCommand).build() { + }; + __name(_UntagResourceCommand, "UntagResourceCommand"); + var UntagResourceCommand = _UntagResourceCommand; + var _UpdateAliasCommand = class _UpdateAliasCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("TrentService", "UpdateAlias", {}).n("KMSClient", "UpdateAliasCommand").f(void 0, void 0).ser(se_UpdateAliasCommand).de(de_UpdateAliasCommand).build() { + }; + __name(_UpdateAliasCommand, "UpdateAliasCommand"); + var UpdateAliasCommand = _UpdateAliasCommand; + var _UpdateCustomKeyStoreCommand = class _UpdateCustomKeyStoreCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("TrentService", "UpdateCustomKeyStore", {}).n("KMSClient", "UpdateCustomKeyStoreCommand").f(UpdateCustomKeyStoreRequestFilterSensitiveLog, void 0).ser(se_UpdateCustomKeyStoreCommand).de(de_UpdateCustomKeyStoreCommand).build() { + }; + __name(_UpdateCustomKeyStoreCommand, "UpdateCustomKeyStoreCommand"); + var UpdateCustomKeyStoreCommand = _UpdateCustomKeyStoreCommand; + var _UpdateKeyDescriptionCommand = class _UpdateKeyDescriptionCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("TrentService", "UpdateKeyDescription", {}).n("KMSClient", "UpdateKeyDescriptionCommand").f(void 0, void 0).ser(se_UpdateKeyDescriptionCommand).de(de_UpdateKeyDescriptionCommand).build() { + }; + __name(_UpdateKeyDescriptionCommand, "UpdateKeyDescriptionCommand"); + var UpdateKeyDescriptionCommand = _UpdateKeyDescriptionCommand; + var _UpdatePrimaryRegionCommand = class _UpdatePrimaryRegionCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("TrentService", "UpdatePrimaryRegion", {}).n("KMSClient", "UpdatePrimaryRegionCommand").f(void 0, void 0).ser(se_UpdatePrimaryRegionCommand).de(de_UpdatePrimaryRegionCommand).build() { + }; + __name(_UpdatePrimaryRegionCommand, "UpdatePrimaryRegionCommand"); + var UpdatePrimaryRegionCommand = _UpdatePrimaryRegionCommand; + var _VerifyCommand = class _VerifyCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("TrentService", "Verify", {}).n("KMSClient", "VerifyCommand").f(VerifyRequestFilterSensitiveLog, void 0).ser(se_VerifyCommand).de(de_VerifyCommand).build() { + }; + __name(_VerifyCommand, "VerifyCommand"); + var VerifyCommand = _VerifyCommand; + var _VerifyMacCommand = class _VerifyMacCommand extends import_smithy_client5.Command.classBuilder().ep({ + ...commonParams + }).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; + }).s("TrentService", "VerifyMac", {}).n("KMSClient", "VerifyMacCommand").f(VerifyMacRequestFilterSensitiveLog, void 0).ser(se_VerifyMacCommand).de(de_VerifyMacCommand).build() { + }; + __name(_VerifyMacCommand, "VerifyMacCommand"); + var VerifyMacCommand = _VerifyMacCommand; + var commands = { + CancelKeyDeletionCommand, + ConnectCustomKeyStoreCommand, + CreateAliasCommand, + CreateCustomKeyStoreCommand, + CreateGrantCommand, + CreateKeyCommand, + DecryptCommand, + DeleteAliasCommand, + DeleteCustomKeyStoreCommand, + DeleteImportedKeyMaterialCommand, + DeriveSharedSecretCommand, + DescribeCustomKeyStoresCommand, + DescribeKeyCommand, + DisableKeyCommand, + DisableKeyRotationCommand, + DisconnectCustomKeyStoreCommand, + EnableKeyCommand, + EnableKeyRotationCommand, + EncryptCommand, + GenerateDataKeyCommand, + GenerateDataKeyPairCommand, + GenerateDataKeyPairWithoutPlaintextCommand, + GenerateDataKeyWithoutPlaintextCommand, + GenerateMacCommand, + GenerateRandomCommand, + GetKeyPolicyCommand, + GetKeyRotationStatusCommand, + GetParametersForImportCommand, + GetPublicKeyCommand, + ImportKeyMaterialCommand, + ListAliasesCommand, + ListGrantsCommand, + ListKeyPoliciesCommand, + ListKeyRotationsCommand, + ListKeysCommand, + ListResourceTagsCommand, + ListRetirableGrantsCommand, + PutKeyPolicyCommand, + ReEncryptCommand, + ReplicateKeyCommand, + RetireGrantCommand, + RevokeGrantCommand, + RotateKeyOnDemandCommand, + ScheduleKeyDeletionCommand, + SignCommand: SignCommand2, + TagResourceCommand, + UntagResourceCommand, + UpdateAliasCommand, + UpdateCustomKeyStoreCommand, + UpdateKeyDescriptionCommand, + UpdatePrimaryRegionCommand, + VerifyCommand, + VerifyMacCommand + }; + var _KMS = class _KMS extends KMSClient2 { + }; + __name(_KMS, "KMS"); + var KMS = _KMS; + (0, import_smithy_client5.createAggregatedClient)(commands, KMS); + var paginateDescribeCustomKeyStores = (0, import_core5.createPaginator)(KMSClient2, DescribeCustomKeyStoresCommand, "Marker", "NextMarker", "Limit"); + var paginateListAliases = (0, import_core5.createPaginator)(KMSClient2, ListAliasesCommand, "Marker", "NextMarker", "Limit"); + var paginateListGrants = (0, import_core5.createPaginator)(KMSClient2, ListGrantsCommand, "Marker", "NextMarker", "Limit"); + var paginateListKeyPolicies = (0, import_core5.createPaginator)(KMSClient2, ListKeyPoliciesCommand, "Marker", "NextMarker", "Limit"); + var paginateListKeyRotations = (0, import_core5.createPaginator)(KMSClient2, ListKeyRotationsCommand, "Marker", "NextMarker", "Limit"); + var paginateListKeys = (0, import_core5.createPaginator)(KMSClient2, ListKeysCommand, "Marker", "NextMarker", "Limit"); + var paginateListResourceTags = (0, import_core5.createPaginator)(KMSClient2, ListResourceTagsCommand, "Marker", "NextMarker", "Limit"); + var paginateListRetirableGrants = (0, import_core5.createPaginator)(KMSClient2, ListRetirableGrantsCommand, "Marker", "NextMarker", "Limit"); + } +}); + +// node_modules/undici/lib/core/symbols.js +var require_symbols6 = __commonJS({ + "node_modules/undici/lib/core/symbols.js"(exports2, module2) { + module2.exports = { + kClose: Symbol("close"), + kDestroy: Symbol("destroy"), + kDispatch: Symbol("dispatch"), + kUrl: Symbol("url"), + kWriting: Symbol("writing"), + kResuming: Symbol("resuming"), + kQueue: Symbol("queue"), + kConnect: Symbol("connect"), + kConnecting: Symbol("connecting"), + kKeepAliveDefaultTimeout: Symbol("default keep alive timeout"), + kKeepAliveMaxTimeout: Symbol("max keep alive timeout"), + kKeepAliveTimeoutThreshold: Symbol("keep alive timeout threshold"), + kKeepAliveTimeoutValue: Symbol("keep alive timeout"), + kKeepAlive: Symbol("keep alive"), + kHeadersTimeout: Symbol("headers timeout"), + kBodyTimeout: Symbol("body timeout"), + kServerName: Symbol("server name"), + kLocalAddress: Symbol("local address"), + kHost: Symbol("host"), + kNoRef: Symbol("no ref"), + kBodyUsed: Symbol("used"), + kBody: Symbol("abstracted request body"), + kRunning: Symbol("running"), + kBlocking: Symbol("blocking"), + kPending: Symbol("pending"), + kSize: Symbol("size"), + kBusy: Symbol("busy"), + kQueued: Symbol("queued"), + kFree: Symbol("free"), + kConnected: Symbol("connected"), + kClosed: Symbol("closed"), + kNeedDrain: Symbol("need drain"), + kReset: Symbol("reset"), + kDestroyed: Symbol.for("nodejs.stream.destroyed"), + kResume: Symbol("resume"), + kOnError: Symbol("on error"), + kMaxHeadersSize: Symbol("max headers size"), + kRunningIdx: Symbol("running index"), + kPendingIdx: Symbol("pending index"), + kError: Symbol("error"), + kClients: Symbol("clients"), + kClient: Symbol("client"), + kParser: Symbol("parser"), + kOnDestroyed: Symbol("destroy callbacks"), + kPipelining: Symbol("pipelining"), + kSocket: Symbol("socket"), + kHostHeader: Symbol("host header"), + kConnector: Symbol("connector"), + kStrictContentLength: Symbol("strict content length"), + kMaxRedirections: Symbol("maxRedirections"), + kMaxRequests: Symbol("maxRequestsPerClient"), + kProxy: Symbol("proxy agent options"), + kCounter: Symbol("socket request counter"), + kInterceptors: Symbol("dispatch interceptors"), + kMaxResponseSize: Symbol("max response size"), + kHTTP2Session: Symbol("http2Session"), + kHTTP2SessionState: Symbol("http2Session state"), + kRetryHandlerDefaultRetry: Symbol("retry agent default retry"), + kConstruct: Symbol("constructable"), + kListeners: Symbol("listeners"), + kHTTPContext: Symbol("http context"), + kMaxConcurrentStreams: Symbol("max concurrent streams"), + kNoProxyAgent: Symbol("no proxy agent"), + kHttpProxyAgent: Symbol("http proxy agent"), + kHttpsProxyAgent: Symbol("https proxy agent") + }; + } +}); + +// node_modules/undici/lib/core/errors.js +var require_errors2 = __commonJS({ + "node_modules/undici/lib/core/errors.js"(exports2, module2) { + "use strict"; + var UndiciError = class extends Error { + constructor(message) { + super(message); + this.name = "UndiciError"; + this.code = "UND_ERR"; } - onComplete(trailers) { - if (this.location) { - this.location = null; - this.abort = null; - this.dispatch(this.opts, this); - } else { - this.handler.onComplete(trailers); - } + }; + var ConnectTimeoutError = class extends UndiciError { + constructor(message) { + super(message); + this.name = "ConnectTimeoutError"; + this.message = message || "Connect Timeout Error"; + this.code = "UND_ERR_CONNECT_TIMEOUT"; } - onBodySent(chunk) { - if (this.handler.onBodySent) { - this.handler.onBodySent(chunk); - } + }; + var HeadersTimeoutError = class extends UndiciError { + constructor(message) { + super(message); + this.name = "HeadersTimeoutError"; + this.message = message || "Headers Timeout Error"; + this.code = "UND_ERR_HEADERS_TIMEOUT"; } }; - function parseLocation(statusCode, headers) { - if (redirectableStatusCodes.indexOf(statusCode) === -1) { - return null; + var HeadersOverflowError = class extends UndiciError { + constructor(message) { + super(message); + this.name = "HeadersOverflowError"; + this.message = message || "Headers Overflow Error"; + this.code = "UND_ERR_HEADERS_OVERFLOW"; } - for (let i = 0; i < headers.length; i += 2) { - if (headers[i].length === 8 && util.headerNameToString(headers[i]) === "location") { - return headers[i + 1]; - } + }; + var BodyTimeoutError = class extends UndiciError { + constructor(message) { + super(message); + this.name = "BodyTimeoutError"; + this.message = message || "Body Timeout Error"; + this.code = "UND_ERR_BODY_TIMEOUT"; } - } - function shouldRemoveHeader(header, removeContent, unknownOrigin) { - if (header.length === 4) { - return util.headerNameToString(header) === "host"; + }; + var ResponseStatusCodeError = class extends UndiciError { + constructor(message, statusCode, headers, body) { + super(message); + this.name = "ResponseStatusCodeError"; + this.message = message || "Response Status Code Error"; + this.code = "UND_ERR_RESPONSE_STATUS_CODE"; + this.body = body; + this.status = statusCode; + this.statusCode = statusCode; + this.headers = headers; } - if (removeContent && util.headerNameToString(header).startsWith("content-")) { - return true; + }; + var InvalidArgumentError = class extends UndiciError { + constructor(message) { + super(message); + this.name = "InvalidArgumentError"; + this.message = message || "Invalid Argument Error"; + this.code = "UND_ERR_INVALID_ARG"; } - if (unknownOrigin && (header.length === 13 || header.length === 6 || header.length === 19)) { - const name = util.headerNameToString(header); - return name === "authorization" || name === "cookie" || name === "proxy-authorization"; + }; + var InvalidReturnValueError = class extends UndiciError { + constructor(message) { + super(message); + this.name = "InvalidReturnValueError"; + this.message = message || "Invalid Return Value Error"; + this.code = "UND_ERR_INVALID_RETURN_VALUE"; } - return false; - } - function cleanRequestHeaders(headers, removeContent, unknownOrigin) { - const ret = []; - if (Array.isArray(headers)) { - for (let i = 0; i < headers.length; i += 2) { - if (!shouldRemoveHeader(headers[i], removeContent, unknownOrigin)) { - ret.push(headers[i], headers[i + 1]); - } - } - } else if (headers && typeof headers === "object") { - for (const key of Object.keys(headers)) { - if (!shouldRemoveHeader(key, removeContent, unknownOrigin)) { - ret.push(key, headers[key]); - } - } - } else { - assert(headers == null, "headers must be an object or an array"); + }; + var AbortError2 = class extends UndiciError { + constructor(message) { + super(message); + this.name = "AbortError"; + this.message = message || "The operation was aborted"; } - return ret; - } - module2.exports = RedirectHandler; - } -}); - -// node_modules/undici/lib/interceptor/redirect-interceptor.js -var require_redirect_interceptor = __commonJS({ - "node_modules/undici/lib/interceptor/redirect-interceptor.js"(exports2, module2) { - "use strict"; - var RedirectHandler = require_redirect_handler(); - function createRedirectInterceptor({ maxRedirections: defaultMaxRedirections }) { - return (dispatch) => { - return function Intercept(opts, handler) { - const { maxRedirections = defaultMaxRedirections } = opts; - if (!maxRedirections) { - return dispatch(opts, handler); - } - const redirectHandler = new RedirectHandler(dispatch, maxRedirections, opts, handler); - opts = { ...opts, maxRedirections: 0 }; - return dispatch(opts, redirectHandler); - }; - }; - } - module2.exports = createRedirectInterceptor; - } -}); - -// node_modules/undici/lib/dispatcher/client.js -var require_client2 = __commonJS({ - "node_modules/undici/lib/dispatcher/client.js"(exports2, module2) { - "use strict"; - var assert = require("node:assert"); - var net = require("node:net"); - var http = require("node:http"); - var util = require_util8(); - var { channels } = require_diagnostics(); - var Request = require_request3(); - var DispatcherBase = require_dispatcher_base2(); - var { - InvalidArgumentError, - InformationalError, - ClientDestroyedError - } = require_errors2(); - var buildConnector = require_connect2(); - var { - kUrl, - kServerName, - kClient, - kBusy, - kConnect, - kResuming, - kRunning, - kPending, - kSize, - kQueue, - kConnected, - kConnecting, - kNeedDrain, - kKeepAliveDefaultTimeout, - kHostHeader, - kPendingIdx, - kRunningIdx, - kError, - kPipelining, - kKeepAliveTimeoutValue, - kMaxHeadersSize, - kKeepAliveMaxTimeout, - kKeepAliveTimeoutThreshold, - kHeadersTimeout, - kBodyTimeout, - kStrictContentLength, - kConnector, - kMaxRedirections, - kMaxRequests, - kCounter, - kClose, - kDestroy, - kDispatch, - kInterceptors, - kLocalAddress, - kMaxResponseSize, - kOnError, - kHTTPContext, - kMaxConcurrentStreams, - kResume - } = require_symbols6(); - var connectH1 = require_client_h1(); - var connectH2 = require_client_h2(); - var deprecatedInterceptorWarned = false; - var kClosedResolve = Symbol("kClosedResolve"); - function getPipelining(client) { - return client[kPipelining] ?? client[kHTTPContext]?.defaultPipelining ?? 1; - } - var Client = class extends DispatcherBase { - /** - * - * @param {string|URL} url - * @param {import('../../types/client.js').Client.Options} options - */ - constructor(url, { - interceptors, - maxHeaderSize, - headersTimeout, - socketTimeout, - requestTimeout, - connectTimeout, - bodyTimeout, - idleTimeout, - keepAlive, - keepAliveTimeout, - maxKeepAliveTimeout, - keepAliveMaxTimeout, - keepAliveTimeoutThreshold, - socketPath, - pipelining, - tls, - strictContentLength, - maxCachedSessions, - maxRedirections, - connect: connect2, - maxRequestsPerClient, - localAddress, - maxResponseSize, - autoSelectFamily, - autoSelectFamilyAttemptTimeout, - // h2 - maxConcurrentStreams, - allowH2 - } = {}) { - super(); - if (keepAlive !== void 0) { - throw new InvalidArgumentError("unsupported keepAlive, use pipelining=0 instead"); - } - if (socketTimeout !== void 0) { - throw new InvalidArgumentError("unsupported socketTimeout, use headersTimeout & bodyTimeout instead"); - } - if (requestTimeout !== void 0) { - throw new InvalidArgumentError("unsupported requestTimeout, use headersTimeout & bodyTimeout instead"); - } - if (idleTimeout !== void 0) { - throw new InvalidArgumentError("unsupported idleTimeout, use keepAliveTimeout instead"); - } - if (maxKeepAliveTimeout !== void 0) { - throw new InvalidArgumentError("unsupported maxKeepAliveTimeout, use keepAliveMaxTimeout instead"); - } - if (maxHeaderSize != null && !Number.isFinite(maxHeaderSize)) { - throw new InvalidArgumentError("invalid maxHeaderSize"); - } - if (socketPath != null && typeof socketPath !== "string") { - throw new InvalidArgumentError("invalid socketPath"); - } - if (connectTimeout != null && (!Number.isFinite(connectTimeout) || connectTimeout < 0)) { - throw new InvalidArgumentError("invalid connectTimeout"); - } - if (keepAliveTimeout != null && (!Number.isFinite(keepAliveTimeout) || keepAliveTimeout <= 0)) { - throw new InvalidArgumentError("invalid keepAliveTimeout"); - } - if (keepAliveMaxTimeout != null && (!Number.isFinite(keepAliveMaxTimeout) || keepAliveMaxTimeout <= 0)) { - throw new InvalidArgumentError("invalid keepAliveMaxTimeout"); - } - if (keepAliveTimeoutThreshold != null && !Number.isFinite(keepAliveTimeoutThreshold)) { - throw new InvalidArgumentError("invalid keepAliveTimeoutThreshold"); - } - if (headersTimeout != null && (!Number.isInteger(headersTimeout) || headersTimeout < 0)) { - throw new InvalidArgumentError("headersTimeout must be a positive integer or zero"); - } - if (bodyTimeout != null && (!Number.isInteger(bodyTimeout) || bodyTimeout < 0)) { - throw new InvalidArgumentError("bodyTimeout must be a positive integer or zero"); - } - if (connect2 != null && typeof connect2 !== "function" && typeof connect2 !== "object") { - throw new InvalidArgumentError("connect must be a function or an object"); - } - if (maxRedirections != null && (!Number.isInteger(maxRedirections) || maxRedirections < 0)) { - throw new InvalidArgumentError("maxRedirections must be a positive number"); - } - if (maxRequestsPerClient != null && (!Number.isInteger(maxRequestsPerClient) || maxRequestsPerClient < 0)) { - throw new InvalidArgumentError("maxRequestsPerClient must be a positive number"); - } - if (localAddress != null && (typeof localAddress !== "string" || net.isIP(localAddress) === 0)) { - throw new InvalidArgumentError("localAddress must be valid string IP address"); - } - if (maxResponseSize != null && (!Number.isInteger(maxResponseSize) || maxResponseSize < -1)) { - throw new InvalidArgumentError("maxResponseSize must be a positive number"); - } - if (autoSelectFamilyAttemptTimeout != null && (!Number.isInteger(autoSelectFamilyAttemptTimeout) || autoSelectFamilyAttemptTimeout < -1)) { - throw new InvalidArgumentError("autoSelectFamilyAttemptTimeout must be a positive number"); - } - if (allowH2 != null && typeof allowH2 !== "boolean") { - throw new InvalidArgumentError("allowH2 must be a valid boolean value"); - } - if (maxConcurrentStreams != null && (typeof maxConcurrentStreams !== "number" || maxConcurrentStreams < 1)) { - throw new InvalidArgumentError("maxConcurrentStreams must be a positive integer, greater than 0"); - } - if (typeof connect2 !== "function") { - connect2 = buildConnector({ - ...tls, - maxCachedSessions, - allowH2, - socketPath, - timeout: connectTimeout, - ...autoSelectFamily ? { autoSelectFamily, autoSelectFamilyAttemptTimeout } : void 0, - ...connect2 - }); - } - if (interceptors?.Client && Array.isArray(interceptors.Client)) { - this[kInterceptors] = interceptors.Client; - if (!deprecatedInterceptorWarned) { - deprecatedInterceptorWarned = true; - process.emitWarning("Client.Options#interceptor is deprecated. Use Dispatcher#compose instead.", { - code: "UNDICI-CLIENT-INTERCEPTOR-DEPRECATED" - }); - } - } else { - this[kInterceptors] = [createRedirectInterceptor({ maxRedirections })]; - } - this[kUrl] = util.parseOrigin(url); - this[kConnector] = connect2; - this[kPipelining] = pipelining != null ? pipelining : 1; - this[kMaxHeadersSize] = maxHeaderSize || http.maxHeaderSize; - this[kKeepAliveDefaultTimeout] = keepAliveTimeout == null ? 4e3 : keepAliveTimeout; - this[kKeepAliveMaxTimeout] = keepAliveMaxTimeout == null ? 6e5 : keepAliveMaxTimeout; - this[kKeepAliveTimeoutThreshold] = keepAliveTimeoutThreshold == null ? 2e3 : keepAliveTimeoutThreshold; - this[kKeepAliveTimeoutValue] = this[kKeepAliveDefaultTimeout]; - this[kServerName] = null; - this[kLocalAddress] = localAddress != null ? localAddress : null; - this[kResuming] = 0; - this[kNeedDrain] = 0; - this[kHostHeader] = `host: ${this[kUrl].hostname}${this[kUrl].port ? `:${this[kUrl].port}` : ""}\r -`; - this[kBodyTimeout] = bodyTimeout != null ? bodyTimeout : 3e5; - this[kHeadersTimeout] = headersTimeout != null ? headersTimeout : 3e5; - this[kStrictContentLength] = strictContentLength == null ? true : strictContentLength; - this[kMaxRedirections] = maxRedirections; - this[kMaxRequests] = maxRequestsPerClient; - this[kClosedResolve] = null; - this[kMaxResponseSize] = maxResponseSize > -1 ? maxResponseSize : -1; - this[kMaxConcurrentStreams] = maxConcurrentStreams != null ? maxConcurrentStreams : 100; - this[kHTTPContext] = null; - this[kQueue] = []; - this[kRunningIdx] = 0; - this[kPendingIdx] = 0; - this[kResume] = (sync) => resume(this, sync); - this[kOnError] = (err) => onError(this, err); - } - get pipelining() { - return this[kPipelining]; - } - set pipelining(value) { - this[kPipelining] = value; - this[kResume](true); - } - get [kPending]() { - return this[kQueue].length - this[kPendingIdx]; - } - get [kRunning]() { - return this[kPendingIdx] - this[kRunningIdx]; - } - get [kSize]() { - return this[kQueue].length - this[kRunningIdx]; + }; + var RequestAbortedError = class extends AbortError2 { + constructor(message) { + super(message); + this.name = "AbortError"; + this.message = message || "Request aborted"; + this.code = "UND_ERR_ABORTED"; } - get [kConnected]() { - return !!this[kHTTPContext] && !this[kConnecting] && !this[kHTTPContext].destroyed; + }; + var InformationalError = class extends UndiciError { + constructor(message) { + super(message); + this.name = "InformationalError"; + this.message = message || "Request information"; + this.code = "UND_ERR_INFO"; } - get [kBusy]() { - return Boolean( - this[kHTTPContext]?.busy(null) || this[kSize] >= (getPipelining(this) || 1) || this[kPending] > 0 - ); + }; + var RequestContentLengthMismatchError = class extends UndiciError { + constructor(message) { + super(message); + this.name = "RequestContentLengthMismatchError"; + this.message = message || "Request body length does not match content-length header"; + this.code = "UND_ERR_REQ_CONTENT_LENGTH_MISMATCH"; } - /* istanbul ignore: only used for test */ - [kConnect](cb) { - connect(this); - this.once("connect", cb); + }; + var ResponseContentLengthMismatchError = class extends UndiciError { + constructor(message) { + super(message); + this.name = "ResponseContentLengthMismatchError"; + this.message = message || "Response body length does not match content-length header"; + this.code = "UND_ERR_RES_CONTENT_LENGTH_MISMATCH"; } - [kDispatch](opts, handler) { - const origin = opts.origin || this[kUrl].origin; - const request2 = new Request(origin, opts, handler); - this[kQueue].push(request2); - if (this[kResuming]) { - } else if (util.bodyLength(request2.body) == null && util.isIterable(request2.body)) { - this[kResuming] = 1; - queueMicrotask(() => resume(this)); - } else { - this[kResume](true); - } - if (this[kResuming] && this[kNeedDrain] !== 2 && this[kBusy]) { - this[kNeedDrain] = 2; - } - return this[kNeedDrain] < 2; + }; + var ClientDestroyedError = class extends UndiciError { + constructor(message) { + super(message); + this.name = "ClientDestroyedError"; + this.message = message || "The client is destroyed"; + this.code = "UND_ERR_DESTROYED"; } - async [kClose]() { - return new Promise((resolve) => { - if (this[kSize]) { - this[kClosedResolve] = resolve; - } else { - resolve(null); - } - }); + }; + var ClientClosedError = class extends UndiciError { + constructor(message) { + super(message); + this.name = "ClientClosedError"; + this.message = message || "The client is closed"; + this.code = "UND_ERR_CLOSED"; } - async [kDestroy](err) { - return new Promise((resolve) => { - const requests = this[kQueue].splice(this[kPendingIdx]); - for (let i = 0; i < requests.length; i++) { - const request2 = requests[i]; - util.errorRequest(this, request2, err); - } - const callback = () => { - if (this[kClosedResolve]) { - this[kClosedResolve](); - this[kClosedResolve] = null; - } - resolve(null); - }; - if (this[kHTTPContext]) { - this[kHTTPContext].destroy(err, callback); - this[kHTTPContext] = null; - } else { - queueMicrotask(callback); - } - this[kResume](); - }); + }; + var SocketError = class extends UndiciError { + constructor(message, socket) { + super(message); + this.name = "SocketError"; + this.message = message || "Socket error"; + this.code = "UND_ERR_SOCKET"; + this.socket = socket; } }; - var createRedirectInterceptor = require_redirect_interceptor(); - function onError(client, err) { - if (client[kRunning] === 0 && err.code !== "UND_ERR_INFO" && err.code !== "UND_ERR_SOCKET") { - assert(client[kPendingIdx] === client[kRunningIdx]); - const requests = client[kQueue].splice(client[kRunningIdx]); - for (let i = 0; i < requests.length; i++) { - const request2 = requests[i]; - util.errorRequest(client, request2, err); - } - assert(client[kSize] === 0); + var NotSupportedError = class extends UndiciError { + constructor(message) { + super(message); + this.name = "NotSupportedError"; + this.message = message || "Not supported error"; + this.code = "UND_ERR_NOT_SUPPORTED"; } - } - async function connect(client) { - assert(!client[kConnecting]); - assert(!client[kHTTPContext]); - let { host, hostname, protocol, port } = client[kUrl]; - if (hostname[0] === "[") { - const idx = hostname.indexOf("]"); - assert(idx !== -1); - const ip = hostname.substring(1, idx); - assert(net.isIP(ip)); - hostname = ip; + }; + var BalancedPoolMissingUpstreamError = class extends UndiciError { + constructor(message) { + super(message); + this.name = "MissingUpstreamError"; + this.message = message || "No upstream has been added to the BalancedPool"; + this.code = "UND_ERR_BPL_MISSING_UPSTREAM"; } - client[kConnecting] = true; - if (channels.beforeConnect.hasSubscribers) { - channels.beforeConnect.publish({ - connectParams: { - host, - hostname, - protocol, - port, - version: client[kHTTPContext]?.version, - servername: client[kServerName], - localAddress: client[kLocalAddress] - }, - connector: client[kConnector] - }); + }; + var HTTPParserError = class extends Error { + constructor(message, code, data) { + super(message); + this.name = "HTTPParserError"; + this.code = code ? `HPE_${code}` : void 0; + this.data = data ? data.toString() : void 0; } - try { - const socket = await new Promise((resolve, reject) => { - client[kConnector]({ - host, - hostname, - protocol, - port, - servername: client[kServerName], - localAddress: client[kLocalAddress] - }, (err, socket2) => { - if (err) { - reject(err); - } else { - resolve(socket2); - } - }); - }); - if (client.destroyed) { - util.destroy(socket.on("error", () => { - }), new ClientDestroyedError()); - return; - } - assert(socket); - try { - client[kHTTPContext] = socket.alpnProtocol === "h2" ? await connectH2(client, socket) : await connectH1(client, socket); - } catch (err) { - socket.destroy().on("error", () => { - }); - throw err; - } - client[kConnecting] = false; - socket[kCounter] = 0; - socket[kMaxRequests] = client[kMaxRequests]; - socket[kClient] = client; - socket[kError] = null; - if (channels.connected.hasSubscribers) { - channels.connected.publish({ - connectParams: { - host, - hostname, - protocol, - port, - version: client[kHTTPContext]?.version, - servername: client[kServerName], - localAddress: client[kLocalAddress] - }, - connector: client[kConnector], - socket - }); - } - client.emit("connect", client[kUrl], [client]); - } catch (err) { - if (client.destroyed) { - return; - } - client[kConnecting] = false; - if (channels.connectError.hasSubscribers) { - channels.connectError.publish({ - connectParams: { - host, - hostname, - protocol, - port, - version: client[kHTTPContext]?.version, - servername: client[kServerName], - localAddress: client[kLocalAddress] - }, - connector: client[kConnector], - error: err - }); - } - if (err.code === "ERR_TLS_CERT_ALTNAME_INVALID") { - assert(client[kRunning] === 0); - while (client[kPending] > 0 && client[kQueue][client[kPendingIdx]].servername === client[kServerName]) { - const request2 = client[kQueue][client[kPendingIdx]++]; - util.errorRequest(client, request2, err); - } - } else { - onError(client, err); - } - client.emit("connectionError", client[kUrl], [client], err); + }; + var ResponseExceededMaxSizeError = class extends UndiciError { + constructor(message) { + super(message); + this.name = "ResponseExceededMaxSizeError"; + this.message = message || "Response content exceeded max size"; + this.code = "UND_ERR_RES_EXCEEDED_MAX_SIZE"; } - client[kResume](); - } - function emitDrain(client) { - client[kNeedDrain] = 0; - client.emit("drain", client[kUrl], [client]); - } - function resume(client, sync) { - if (client[kResuming] === 2) { - return; + }; + var RequestRetryError = class extends UndiciError { + constructor(message, code, { headers, data }) { + super(message); + this.name = "RequestRetryError"; + this.message = message || "Request retry error"; + this.code = "UND_ERR_REQ_RETRY"; + this.statusCode = code; + this.data = data; + this.headers = headers; } - client[kResuming] = 2; - _resume(client, sync); - client[kResuming] = 0; - if (client[kRunningIdx] > 256) { - client[kQueue].splice(0, client[kRunningIdx]); - client[kPendingIdx] -= client[kRunningIdx]; - client[kRunningIdx] = 0; + }; + var SecureProxyConnectionError = class extends UndiciError { + constructor(cause, message, options) { + super(message, { cause, ...options ?? {} }); + this.name = "SecureProxyConnectionError"; + this.message = message || "Secure Proxy Connection failed"; + this.code = "UND_ERR_PRX_TLS"; + this.cause = cause; } - } - function _resume(client, sync) { - while (true) { - if (client.destroyed) { - assert(client[kPending] === 0); - return; + }; + module2.exports = { + AbortError: AbortError2, + HTTPParserError, + UndiciError, + HeadersTimeoutError, + HeadersOverflowError, + BodyTimeoutError, + RequestContentLengthMismatchError, + ConnectTimeoutError, + ResponseStatusCodeError, + InvalidArgumentError, + InvalidReturnValueError, + RequestAbortedError, + ClientDestroyedError, + ClientClosedError, + InformationalError, + SocketError, + NotSupportedError, + ResponseContentLengthMismatchError, + BalancedPoolMissingUpstreamError, + ResponseExceededMaxSizeError, + RequestRetryError, + SecureProxyConnectionError + }; + } +}); + +// node_modules/undici/lib/core/constants.js +var require_constants6 = __commonJS({ + "node_modules/undici/lib/core/constants.js"(exports2, module2) { + "use strict"; + var headerNameLowerCasedRecord = {}; + var wellknownHeaderNames = [ + "Accept", + "Accept-Encoding", + "Accept-Language", + "Accept-Ranges", + "Access-Control-Allow-Credentials", + "Access-Control-Allow-Headers", + "Access-Control-Allow-Methods", + "Access-Control-Allow-Origin", + "Access-Control-Expose-Headers", + "Access-Control-Max-Age", + "Access-Control-Request-Headers", + "Access-Control-Request-Method", + "Age", + "Allow", + "Alt-Svc", + "Alt-Used", + "Authorization", + "Cache-Control", + "Clear-Site-Data", + "Connection", + "Content-Disposition", + "Content-Encoding", + "Content-Language", + "Content-Length", + "Content-Location", + "Content-Range", + "Content-Security-Policy", + "Content-Security-Policy-Report-Only", + "Content-Type", + "Cookie", + "Cross-Origin-Embedder-Policy", + "Cross-Origin-Opener-Policy", + "Cross-Origin-Resource-Policy", + "Date", + "Device-Memory", + "Downlink", + "ECT", + "ETag", + "Expect", + "Expect-CT", + "Expires", + "Forwarded", + "From", + "Host", + "If-Match", + "If-Modified-Since", + "If-None-Match", + "If-Range", + "If-Unmodified-Since", + "Keep-Alive", + "Last-Modified", + "Link", + "Location", + "Max-Forwards", + "Origin", + "Permissions-Policy", + "Pragma", + "Proxy-Authenticate", + "Proxy-Authorization", + "RTT", + "Range", + "Referer", + "Referrer-Policy", + "Refresh", + "Retry-After", + "Sec-WebSocket-Accept", + "Sec-WebSocket-Extensions", + "Sec-WebSocket-Key", + "Sec-WebSocket-Protocol", + "Sec-WebSocket-Version", + "Server", + "Server-Timing", + "Service-Worker-Allowed", + "Service-Worker-Navigation-Preload", + "Set-Cookie", + "SourceMap", + "Strict-Transport-Security", + "Supports-Loading-Mode", + "TE", + "Timing-Allow-Origin", + "Trailer", + "Transfer-Encoding", + "Upgrade", + "Upgrade-Insecure-Requests", + "User-Agent", + "Vary", + "Via", + "WWW-Authenticate", + "X-Content-Type-Options", + "X-DNS-Prefetch-Control", + "X-Frame-Options", + "X-Permitted-Cross-Domain-Policies", + "X-Powered-By", + "X-Requested-With", + "X-XSS-Protection" + ]; + for (let i = 0; i < wellknownHeaderNames.length; ++i) { + const key = wellknownHeaderNames[i]; + const lowerCasedKey = key.toLowerCase(); + headerNameLowerCasedRecord[key] = headerNameLowerCasedRecord[lowerCasedKey] = lowerCasedKey; + } + Object.setPrototypeOf(headerNameLowerCasedRecord, null); + module2.exports = { + wellknownHeaderNames, + headerNameLowerCasedRecord + }; + } +}); + +// node_modules/undici/lib/core/tree.js +var require_tree = __commonJS({ + "node_modules/undici/lib/core/tree.js"(exports2, module2) { + "use strict"; + var { + wellknownHeaderNames, + headerNameLowerCasedRecord + } = require_constants6(); + var TstNode = class _TstNode { + /** @type {any} */ + value = null; + /** @type {null | TstNode} */ + left = null; + /** @type {null | TstNode} */ + middle = null; + /** @type {null | TstNode} */ + right = null; + /** @type {number} */ + code; + /** + * @param {string} key + * @param {any} value + * @param {number} index + */ + constructor(key, value, index) { + if (index === void 0 || index >= key.length) { + throw new TypeError("Unreachable"); } - if (client[kClosedResolve] && !client[kSize]) { - client[kClosedResolve](); - client[kClosedResolve] = null; - return; + const code = this.code = key.charCodeAt(index); + if (code > 127) { + throw new TypeError("key must be ascii string"); } - if (client[kHTTPContext]) { - client[kHTTPContext].resume(); + if (key.length !== ++index) { + this.middle = new _TstNode(key, value, index); + } else { + this.value = value; } - if (client[kBusy]) { - client[kNeedDrain] = 2; - } else if (client[kNeedDrain] === 2) { - if (sync) { - client[kNeedDrain] = 1; - queueMicrotask(() => emitDrain(client)); + } + /** + * @param {string} key + * @param {any} value + */ + add(key, value) { + const length = key.length; + if (length === 0) { + throw new TypeError("Unreachable"); + } + let index = 0; + let node = this; + while (true) { + const code = key.charCodeAt(index); + if (code > 127) { + throw new TypeError("key must be ascii string"); + } + if (node.code === code) { + if (length === ++index) { + node.value = value; + break; + } else if (node.middle !== null) { + node = node.middle; + } else { + node.middle = new _TstNode(key, value, index); + break; + } + } else if (node.code < code) { + if (node.left !== null) { + node = node.left; + } else { + node.left = new _TstNode(key, value, index); + break; + } + } else if (node.right !== null) { + node = node.right; } else { - emitDrain(client); + node.right = new _TstNode(key, value, index); + break; } - continue; - } - if (client[kPending] === 0) { - return; } - if (client[kRunning] >= (getPipelining(client) || 1)) { - return; - } - const request2 = client[kQueue][client[kPendingIdx]]; - if (client[kUrl].protocol === "https:" && client[kServerName] !== request2.servername) { - if (client[kRunning] > 0) { - return; + } + /** + * @param {Uint8Array} key + * @return {TstNode | null} + */ + search(key) { + const keylength = key.length; + let index = 0; + let node = this; + while (node !== null && index < keylength) { + let code = key[index]; + if (code <= 90 && code >= 65) { + code |= 32; + } + while (node !== null) { + if (code === node.code) { + if (keylength === ++index) { + return node; + } + node = node.middle; + break; + } + node = node.code < code ? node.left : node.right; } - client[kServerName] = request2.servername; - client[kHTTPContext]?.destroy(new InformationalError("servername changed"), () => { - client[kHTTPContext] = null; - resume(client); - }); - } - if (client[kConnecting]) { - return; - } - if (!client[kHTTPContext]) { - connect(client); - return; - } - if (client[kHTTPContext].destroyed) { - return; - } - if (client[kHTTPContext].busy(request2)) { - return; } - if (!request2.aborted && client[kHTTPContext].write(request2)) { - client[kPendingIdx]++; + return null; + } + }; + var TernarySearchTree = class { + /** @type {TstNode | null} */ + node = null; + /** + * @param {string} key + * @param {any} value + * */ + insert(key, value) { + if (this.node === null) { + this.node = new TstNode(key, value, 0); } else { - client[kQueue].splice(client[kPendingIdx], 1); + this.node.add(key, value); } } + /** + * @param {Uint8Array} key + * @return {any} + */ + lookup(key) { + return this.node?.search(key)?.value ?? null; + } + }; + var tree = new TernarySearchTree(); + for (let i = 0; i < wellknownHeaderNames.length; ++i) { + const key = headerNameLowerCasedRecord[wellknownHeaderNames[i]]; + tree.insert(key, key); } - module2.exports = Client; + module2.exports = { + TernarySearchTree, + tree + }; } }); -// node_modules/undici/lib/dispatcher/fixed-queue.js -var require_fixed_queue2 = __commonJS({ - "node_modules/undici/lib/dispatcher/fixed-queue.js"(exports2, module2) { +// node_modules/undici/lib/core/util.js +var require_util9 = __commonJS({ + "node_modules/undici/lib/core/util.js"(exports2, module2) { "use strict"; - var kSize = 2048; - var kMask = kSize - 1; - var FixedCircularBuffer = class { - constructor() { - this.bottom = 0; - this.top = 0; - this.list = new Array(kSize); - this.next = null; - } - isEmpty() { - return this.top === this.bottom; + var assert = require("node:assert"); + var { kDestroyed, kBodyUsed, kListeners, kBody } = require_symbols6(); + var { IncomingMessage } = require("node:http"); + var stream = require("node:stream"); + var net = require("node:net"); + var { Blob: Blob2 } = require("node:buffer"); + var nodeUtil = require("node:util"); + var { stringify: stringify3 } = require("node:querystring"); + var { EventEmitter: EE } = require("node:events"); + var { InvalidArgumentError } = require_errors2(); + var { headerNameLowerCasedRecord } = require_constants6(); + var { tree } = require_tree(); + var [nodeMajor, nodeMinor] = process.versions.node.split(".").map((v) => Number(v)); + var BodyAsyncIterable = class { + constructor(body) { + this[kBody] = body; + this[kBodyUsed] = false; } - isFull() { - return (this.top + 1 & kMask) === this.bottom; + async *[Symbol.asyncIterator]() { + assert(!this[kBodyUsed], "disturbed"); + this[kBodyUsed] = true; + yield* this[kBody]; } - push(data) { - this.list[this.top] = data; - this.top = this.top + 1 & kMask; + }; + function wrapRequestBody(body) { + if (isStream(body)) { + if (bodyLength(body) === 0) { + body.on("data", function() { + assert(false); + }); + } + if (typeof body.readableDidRead !== "boolean") { + body[kBodyUsed] = false; + EE.prototype.on.call(body, "data", function() { + this[kBodyUsed] = true; + }); + } + return body; + } else if (body && typeof body.pipeTo === "function") { + return new BodyAsyncIterable(body); + } else if (body && typeof body !== "string" && !ArrayBuffer.isView(body) && isIterable(body)) { + return new BodyAsyncIterable(body); + } else { + return body; } - shift() { - const nextItem = this.list[this.bottom]; - if (nextItem === void 0) - return null; - this.list[this.bottom] = void 0; - this.bottom = this.bottom + 1 & kMask; - return nextItem; + } + function nop() { + } + function isStream(obj) { + return obj && typeof obj === "object" && typeof obj.pipe === "function" && typeof obj.on === "function"; + } + function isBlobLike(object) { + if (object === null) { + return false; + } else if (object instanceof Blob2) { + return true; + } else if (typeof object !== "object") { + return false; + } else { + const sTag = object[Symbol.toStringTag]; + return (sTag === "Blob" || sTag === "File") && ("stream" in object && typeof object.stream === "function" || "arrayBuffer" in object && typeof object.arrayBuffer === "function"); } - }; - module2.exports = class FixedQueue { - constructor() { - this.head = this.tail = new FixedCircularBuffer(); + } + function buildURL(url, queryParams) { + if (url.includes("?") || url.includes("#")) { + throw new Error('Query params cannot be passed when url already contains "?" or "#".'); } - isEmpty() { - return this.head.isEmpty(); + const stringified = stringify3(queryParams); + if (stringified) { + url += "?" + stringified; } - push(data) { - if (this.head.isFull()) { - this.head = this.head.next = new FixedCircularBuffer(); + return url; + } + function isValidPort(port) { + const value = parseInt(port, 10); + return value === Number(port) && value >= 0 && value <= 65535; + } + function isHttpOrHttpsPrefixed(value) { + return value != null && value[0] === "h" && value[1] === "t" && value[2] === "t" && value[3] === "p" && (value[4] === ":" || value[4] === "s" && value[5] === ":"); + } + function parseURL(url) { + if (typeof url === "string") { + url = new URL(url); + if (!isHttpOrHttpsPrefixed(url.origin || url.protocol)) { + throw new InvalidArgumentError("Invalid URL protocol: the URL must start with `http:` or `https:`."); } - this.head.push(data); + return url; } - shift() { - const tail = this.tail; - const next = tail.shift(); - if (tail.isEmpty() && tail.next !== null) { - this.tail = tail.next; + if (!url || typeof url !== "object") { + throw new InvalidArgumentError("Invalid URL: The URL argument must be a non-null object."); + } + if (!(url instanceof URL)) { + if (url.port != null && url.port !== "" && isValidPort(url.port) === false) { + throw new InvalidArgumentError("Invalid URL: port must be a valid integer or a string representation of an integer."); } - return next; + if (url.path != null && typeof url.path !== "string") { + throw new InvalidArgumentError("Invalid URL path: the path must be a string or null/undefined."); + } + if (url.pathname != null && typeof url.pathname !== "string") { + throw new InvalidArgumentError("Invalid URL pathname: the pathname must be a string or null/undefined."); + } + if (url.hostname != null && typeof url.hostname !== "string") { + throw new InvalidArgumentError("Invalid URL hostname: the hostname must be a string or null/undefined."); + } + if (url.origin != null && typeof url.origin !== "string") { + throw new InvalidArgumentError("Invalid URL origin: the origin must be a string or null/undefined."); + } + if (!isHttpOrHttpsPrefixed(url.origin || url.protocol)) { + throw new InvalidArgumentError("Invalid URL protocol: the URL must start with `http:` or `https:`."); + } + const port = url.port != null ? url.port : url.protocol === "https:" ? 443 : 80; + let origin = url.origin != null ? url.origin : `${url.protocol || ""}//${url.hostname || ""}:${port}`; + let path = url.path != null ? url.path : `${url.pathname || ""}${url.search || ""}`; + if (origin[origin.length - 1] === "/") { + origin = origin.slice(0, origin.length - 1); + } + if (path && path[0] !== "/") { + path = `/${path}`; + } + return new URL(`${origin}${path}`); } - }; - } -}); - -// node_modules/undici/lib/dispatcher/pool-stats.js -var require_pool_stats2 = __commonJS({ - "node_modules/undici/lib/dispatcher/pool-stats.js"(exports2, module2) { - var { kFree, kConnected, kPending, kQueued, kRunning, kSize } = require_symbols6(); - var kPool = Symbol("pool"); - var PoolStats = class { - constructor(pool) { - this[kPool] = pool; + if (!isHttpOrHttpsPrefixed(url.origin || url.protocol)) { + throw new InvalidArgumentError("Invalid URL protocol: the URL must start with `http:` or `https:`."); } - get connected() { - return this[kPool][kConnected]; + return url; + } + function parseOrigin(url) { + url = parseURL(url); + if (url.pathname !== "/" || url.search || url.hash) { + throw new InvalidArgumentError("invalid url"); } - get free() { - return this[kPool][kFree]; + return url; + } + function getHostname(host) { + if (host[0] === "[") { + const idx2 = host.indexOf("]"); + assert(idx2 !== -1); + return host.substring(1, idx2); } - get pending() { - return this[kPool][kPending]; + const idx = host.indexOf(":"); + if (idx === -1) return host; + return host.substring(0, idx); + } + function getServerName(host) { + if (!host) { + return null; } - get queued() { - return this[kPool][kQueued]; + assert.strictEqual(typeof host, "string"); + const servername = getHostname(host); + if (net.isIP(servername)) { + return ""; } - get running() { - return this[kPool][kRunning]; + return servername; + } + function deepClone(obj) { + return JSON.parse(JSON.stringify(obj)); + } + function isAsyncIterable(obj) { + return !!(obj != null && typeof obj[Symbol.asyncIterator] === "function"); + } + function isIterable(obj) { + return !!(obj != null && (typeof obj[Symbol.iterator] === "function" || typeof obj[Symbol.asyncIterator] === "function")); + } + function bodyLength(body) { + if (body == null) { + return 0; + } else if (isStream(body)) { + const state = body._readableState; + return state && state.objectMode === false && state.ended === true && Number.isFinite(state.length) ? state.length : null; + } else if (isBlobLike(body)) { + return body.size != null ? body.size : null; + } else if (isBuffer(body)) { + return body.byteLength; } - get size() { - return this[kPool][kSize]; + return null; + } + function isDestroyed(body) { + return body && !!(body.destroyed || body[kDestroyed] || stream.isDestroyed?.(body)); + } + function destroy(stream2, err) { + if (stream2 == null || !isStream(stream2) || isDestroyed(stream2)) { + return; } - }; - module2.exports = PoolStats; - } -}); - -// node_modules/undici/lib/dispatcher/pool-base.js -var require_pool_base2 = __commonJS({ - "node_modules/undici/lib/dispatcher/pool-base.js"(exports2, module2) { - "use strict"; - var DispatcherBase = require_dispatcher_base2(); - var FixedQueue = require_fixed_queue2(); - var { kConnected, kSize, kRunning, kPending, kQueued, kBusy, kFree, kUrl, kClose, kDestroy, kDispatch } = require_symbols6(); - var PoolStats = require_pool_stats2(); - var kClients = Symbol("clients"); - var kNeedDrain = Symbol("needDrain"); - var kQueue = Symbol("queue"); - var kClosedResolve = Symbol("closed resolve"); - var kOnDrain = Symbol("onDrain"); - var kOnConnect = Symbol("onConnect"); - var kOnDisconnect = Symbol("onDisconnect"); - var kOnConnectionError = Symbol("onConnectionError"); - var kGetDispatcher = Symbol("get dispatcher"); - var kAddClient = Symbol("add client"); - var kRemoveClient = Symbol("remove client"); - var kStats = Symbol("stats"); - var PoolBase = class extends DispatcherBase { - constructor() { - super(); - this[kQueue] = new FixedQueue(); - this[kClients] = []; - this[kQueued] = 0; - const pool = this; - this[kOnDrain] = function onDrain(origin, targets) { - const queue = pool[kQueue]; - let needDrain = false; - while (!needDrain) { - const item = queue.shift(); - if (!item) { - break; - } - pool[kQueued]--; - needDrain = !this.dispatch(item.opts, item.handler); - } - this[kNeedDrain] = needDrain; - if (!this[kNeedDrain] && pool[kNeedDrain]) { - pool[kNeedDrain] = false; - pool.emit("drain", origin, [pool, ...targets]); + if (typeof stream2.destroy === "function") { + if (Object.getPrototypeOf(stream2).constructor === IncomingMessage) { + stream2.socket = null; + } + stream2.destroy(err); + } else if (err) { + queueMicrotask(() => { + stream2.emit("error", err); + }); + } + if (stream2.destroyed !== true) { + stream2[kDestroyed] = true; + } + } + var KEEPALIVE_TIMEOUT_EXPR = /timeout=(\d+)/; + function parseKeepAliveTimeout(val2) { + const m = val2.toString().match(KEEPALIVE_TIMEOUT_EXPR); + return m ? parseInt(m[1], 10) * 1e3 : null; + } + function headerNameToString(value) { + return typeof value === "string" ? headerNameLowerCasedRecord[value] ?? value.toLowerCase() : tree.lookup(value) ?? value.toString("latin1").toLowerCase(); + } + function bufferToLowerCasedHeaderName(value) { + return tree.lookup(value) ?? value.toString("latin1").toLowerCase(); + } + function parseHeaders(headers, obj) { + if (obj === void 0) obj = {}; + for (let i = 0; i < headers.length; i += 2) { + const key = headerNameToString(headers[i]); + let val2 = obj[key]; + if (val2) { + if (typeof val2 === "string") { + val2 = [val2]; + obj[key] = val2; } - if (pool[kClosedResolve] && queue.isEmpty()) { - Promise.all(pool[kClients].map((c) => c.close())).then(pool[kClosedResolve]); + val2.push(headers[i + 1].toString("utf8")); + } else { + const headersValue = headers[i + 1]; + if (typeof headersValue === "string") { + obj[key] = headersValue; + } else { + obj[key] = Array.isArray(headersValue) ? headersValue.map((x) => x.toString("utf8")) : headersValue.toString("utf8"); } - }; - this[kOnConnect] = (origin, targets) => { - pool.emit("connect", origin, [pool, ...targets]); - }; - this[kOnDisconnect] = (origin, targets, err) => { - pool.emit("disconnect", origin, [pool, ...targets], err); - }; - this[kOnConnectionError] = (origin, targets, err) => { - pool.emit("connectionError", origin, [pool, ...targets], err); - }; - this[kStats] = new PoolStats(this); + } } - get [kBusy]() { - return this[kNeedDrain]; + if ("content-length" in obj && "content-disposition" in obj) { + obj["content-disposition"] = Buffer.from(obj["content-disposition"]).toString("latin1"); } - get [kConnected]() { - return this[kClients].filter((client) => client[kConnected]).length; + return obj; + } + function parseRawHeaders(headers) { + const len = headers.length; + const ret = new Array(len); + let hasContentLength = false; + let contentDispositionIdx = -1; + let key; + let val2; + let kLen = 0; + for (let n = 0; n < headers.length; n += 2) { + key = headers[n]; + val2 = headers[n + 1]; + typeof key !== "string" && (key = key.toString()); + typeof val2 !== "string" && (val2 = val2.toString("utf8")); + kLen = key.length; + if (kLen === 14 && key[7] === "-" && (key === "content-length" || key.toLowerCase() === "content-length")) { + hasContentLength = true; + } else if (kLen === 19 && key[7] === "-" && (key === "content-disposition" || key.toLowerCase() === "content-disposition")) { + contentDispositionIdx = n + 1; + } + ret[n] = key; + ret[n + 1] = val2; } - get [kFree]() { - return this[kClients].filter((client) => client[kConnected] && !client[kNeedDrain]).length; + if (hasContentLength && contentDispositionIdx !== -1) { + ret[contentDispositionIdx] = Buffer.from(ret[contentDispositionIdx]).toString("latin1"); } - get [kPending]() { - let ret = this[kQueued]; - for (const { [kPending]: pending } of this[kClients]) { - ret += pending; - } - return ret; + return ret; + } + function isBuffer(buffer) { + return buffer instanceof Uint8Array || Buffer.isBuffer(buffer); + } + function validateHandler(handler, method, upgrade) { + if (!handler || typeof handler !== "object") { + throw new InvalidArgumentError("handler must be an object"); } - get [kRunning]() { - let ret = 0; - for (const { [kRunning]: running } of this[kClients]) { - ret += running; - } - return ret; + if (typeof handler.onConnect !== "function") { + throw new InvalidArgumentError("invalid onConnect method"); } - get [kSize]() { - let ret = this[kQueued]; - for (const { [kSize]: size } of this[kClients]) { - ret += size; - } - return ret; + if (typeof handler.onError !== "function") { + throw new InvalidArgumentError("invalid onError method"); } - get stats() { - return this[kStats]; + if (typeof handler.onBodySent !== "function" && handler.onBodySent !== void 0) { + throw new InvalidArgumentError("invalid onBodySent method"); } - async [kClose]() { - if (this[kQueue].isEmpty()) { - return Promise.all(this[kClients].map((c) => c.close())); - } else { - return new Promise((resolve) => { - this[kClosedResolve] = resolve; - }); + if (upgrade || method === "CONNECT") { + if (typeof handler.onUpgrade !== "function") { + throw new InvalidArgumentError("invalid onUpgrade method"); } - } - async [kDestroy](err) { - while (true) { - const item = this[kQueue].shift(); - if (!item) { - break; - } - item.handler.onError(err); + } else { + if (typeof handler.onHeaders !== "function") { + throw new InvalidArgumentError("invalid onHeaders method"); } - return Promise.all(this[kClients].map((c) => c.destroy(err))); - } - [kDispatch](opts, handler) { - const dispatcher = this[kGetDispatcher](); - if (!dispatcher) { - this[kNeedDrain] = true; - this[kQueue].push({ opts, handler }); - this[kQueued]++; - } else if (!dispatcher.dispatch(opts, handler)) { - dispatcher[kNeedDrain] = true; - this[kNeedDrain] = !this[kGetDispatcher](); + if (typeof handler.onData !== "function") { + throw new InvalidArgumentError("invalid onData method"); + } + if (typeof handler.onComplete !== "function") { + throw new InvalidArgumentError("invalid onComplete method"); } - return !this[kNeedDrain]; } - [kAddClient](client) { - client.on("drain", this[kOnDrain]).on("connect", this[kOnConnect]).on("disconnect", this[kOnDisconnect]).on("connectionError", this[kOnConnectionError]); - this[kClients].push(client); - if (this[kNeedDrain]) { - queueMicrotask(() => { - if (this[kNeedDrain]) { - this[kOnDrain](client[kUrl], [this, client]); + } + function isDisturbed(body) { + return !!(body && (stream.isDisturbed(body) || body[kBodyUsed])); + } + function isErrored(body) { + return !!(body && stream.isErrored(body)); + } + function isReadable(body) { + return !!(body && stream.isReadable(body)); + } + function getSocketInfo(socket) { + return { + localAddress: socket.localAddress, + localPort: socket.localPort, + remoteAddress: socket.remoteAddress, + remotePort: socket.remotePort, + remoteFamily: socket.remoteFamily, + timeout: socket.timeout, + bytesWritten: socket.bytesWritten, + bytesRead: socket.bytesRead + }; + } + function ReadableStreamFrom(iterable) { + let iterator; + return new ReadableStream( + { + async start() { + iterator = iterable[Symbol.asyncIterator](); + }, + async pull(controller) { + const { done, value } = await iterator.next(); + if (done) { + queueMicrotask(() => { + controller.close(); + controller.byobRequest?.respond(0); + }); + } else { + const buf = Buffer.isBuffer(value) ? value : Buffer.from(value); + if (buf.byteLength) { + controller.enqueue(new Uint8Array(buf)); + } } - }); + return controller.desiredSize > 0; + }, + async cancel(reason) { + await iterator.return(); + }, + type: "bytes" } - return this; + ); + } + function isFormDataLike(object) { + return object && typeof object === "object" && typeof object.append === "function" && typeof object.delete === "function" && typeof object.get === "function" && typeof object.getAll === "function" && typeof object.has === "function" && typeof object.set === "function" && object[Symbol.toStringTag] === "FormData"; + } + function addAbortListener(signal, listener) { + if ("addEventListener" in signal) { + signal.addEventListener("abort", listener, { once: true }); + return () => signal.removeEventListener("abort", listener); } - [kRemoveClient](client) { - client.close(() => { - const idx = this[kClients].indexOf(client); - if (idx !== -1) { - this[kClients].splice(idx, 1); - } - }); - this[kNeedDrain] = this[kClients].some((dispatcher) => !dispatcher[kNeedDrain] && dispatcher.closed !== true && dispatcher.destroyed !== true); + signal.addListener("abort", listener); + return () => signal.removeListener("abort", listener); + } + var hasToWellFormed = typeof String.prototype.toWellFormed === "function"; + var hasIsWellFormed = typeof String.prototype.isWellFormed === "function"; + function toUSVString(val2) { + return hasToWellFormed ? `${val2}`.toWellFormed() : nodeUtil.toUSVString(val2); + } + function isUSVString(val2) { + return hasIsWellFormed ? `${val2}`.isWellFormed() : toUSVString(val2) === `${val2}`; + } + function isTokenCharCode(c) { + switch (c) { + case 34: + case 40: + case 41: + case 44: + case 47: + case 58: + case 59: + case 60: + case 61: + case 62: + case 63: + case 64: + case 91: + case 92: + case 93: + case 123: + case 125: + return false; + default: + return c >= 33 && c <= 126; } - }; - module2.exports = { - PoolBase, - kClients, - kNeedDrain, - kAddClient, - kRemoveClient, - kGetDispatcher - }; - } -}); - -// node_modules/undici/lib/dispatcher/pool.js -var require_pool2 = __commonJS({ - "node_modules/undici/lib/dispatcher/pool.js"(exports2, module2) { - "use strict"; - var { - PoolBase, - kClients, - kNeedDrain, - kAddClient, - kGetDispatcher - } = require_pool_base2(); - var Client = require_client2(); - var { - InvalidArgumentError - } = require_errors2(); - var util = require_util8(); - var { kUrl, kInterceptors } = require_symbols6(); - var buildConnector = require_connect2(); - var kOptions = Symbol("options"); - var kConnections = Symbol("connections"); - var kFactory = Symbol("factory"); - function defaultFactory(origin, opts) { - return new Client(origin, opts); } - var Pool = class extends PoolBase { - constructor(origin, { - connections, - factory = defaultFactory, - connect, - connectTimeout, - tls, - maxCachedSessions, - socketPath, - autoSelectFamily, - autoSelectFamilyAttemptTimeout, - allowH2, - ...options - } = {}) { - super(); - if (connections != null && (!Number.isFinite(connections) || connections < 0)) { - throw new InvalidArgumentError("invalid connections"); - } - if (typeof factory !== "function") { - throw new InvalidArgumentError("factory must be a function."); - } - if (connect != null && typeof connect !== "function" && typeof connect !== "object") { - throw new InvalidArgumentError("connect must be a function or an object"); - } - if (typeof connect !== "function") { - connect = buildConnector({ - ...tls, - maxCachedSessions, - allowH2, - socketPath, - timeout: connectTimeout, - ...autoSelectFamily ? { autoSelectFamily, autoSelectFamilyAttemptTimeout } : void 0, - ...connect - }); - } - this[kInterceptors] = options.interceptors?.Pool && Array.isArray(options.interceptors.Pool) ? options.interceptors.Pool : []; - this[kConnections] = connections || null; - this[kUrl] = util.parseOrigin(origin); - this[kOptions] = { ...util.deepClone(options), connect, allowH2 }; - this[kOptions].interceptors = options.interceptors ? { ...options.interceptors } : void 0; - this[kFactory] = factory; + function isValidHTTPToken(characters) { + if (characters.length === 0) { + return false; } - [kGetDispatcher]() { - for (const client of this[kClients]) { - if (!client[kNeedDrain]) { - return client; - } - } - if (!this[kConnections] || this[kClients].length < this[kConnections]) { - const dispatcher = this[kFactory](this[kUrl], this[kOptions]); - this[kAddClient](dispatcher); - return dispatcher; + for (let i = 0; i < characters.length; ++i) { + if (!isTokenCharCode(characters.charCodeAt(i))) { + return false; } } - }; - module2.exports = Pool; - } -}); - -// node_modules/undici/lib/dispatcher/balanced-pool.js -var require_balanced_pool2 = __commonJS({ - "node_modules/undici/lib/dispatcher/balanced-pool.js"(exports2, module2) { - "use strict"; - var { - BalancedPoolMissingUpstreamError, - InvalidArgumentError - } = require_errors2(); - var { - PoolBase, - kClients, - kNeedDrain, - kAddClient, - kRemoveClient, - kGetDispatcher - } = require_pool_base2(); - var Pool = require_pool2(); - var { kUrl, kInterceptors } = require_symbols6(); - var { parseOrigin } = require_util8(); - var kFactory = Symbol("factory"); - var kOptions = Symbol("options"); - var kGreatestCommonDivisor = Symbol("kGreatestCommonDivisor"); - var kCurrentWeight = Symbol("kCurrentWeight"); - var kIndex = Symbol("kIndex"); - var kWeight = Symbol("kWeight"); - var kMaxWeightPerServer = Symbol("kMaxWeightPerServer"); - var kErrorPenalty = Symbol("kErrorPenalty"); - function getGreatestCommonDivisor(a, b) { - if (b === 0) return a; - return getGreatestCommonDivisor(b, a % b); + return true; } - function defaultFactory(origin, opts) { - return new Pool(origin, opts); + var headerCharRegex = /[^\t\x20-\x7e\x80-\xff]/; + function isValidHeaderValue(characters) { + return !headerCharRegex.test(characters); } - var BalancedPool = class extends PoolBase { - constructor(upstreams = [], { factory = defaultFactory, ...opts } = {}) { - super(); - this[kOptions] = opts; - this[kIndex] = -1; - this[kCurrentWeight] = 0; - this[kMaxWeightPerServer] = this[kOptions].maxWeightPerServer || 100; - this[kErrorPenalty] = this[kOptions].errorPenalty || 15; - if (!Array.isArray(upstreams)) { - upstreams = [upstreams]; - } - if (typeof factory !== "function") { - throw new InvalidArgumentError("factory must be a function."); - } - this[kInterceptors] = opts.interceptors?.BalancedPool && Array.isArray(opts.interceptors.BalancedPool) ? opts.interceptors.BalancedPool : []; - this[kFactory] = factory; - for (const upstream of upstreams) { - this.addUpstream(upstream); - } - this._updateBalancedPoolStats(); + function parseRangeHeader(range) { + if (range == null || range === "") return { start: 0, end: null, size: null }; + const m = range ? range.match(/^bytes (\d+)-(\d+)\/(\d+)?$/) : null; + return m ? { + start: parseInt(m[1]), + end: m[2] ? parseInt(m[2]) : null, + size: m[3] ? parseInt(m[3]) : null + } : null; + } + function addListener(obj, name, listener) { + const listeners = obj[kListeners] ??= []; + listeners.push([name, listener]); + obj.on(name, listener); + return obj; + } + function removeAllListeners(obj) { + for (const [name, listener] of obj[kListeners] ?? []) { + obj.removeListener(name, listener); } - addUpstream(upstream) { - const upstreamOrigin = parseOrigin(upstream).origin; - if (this[kClients].find((pool2) => pool2[kUrl].origin === upstreamOrigin && pool2.closed !== true && pool2.destroyed !== true)) { - return this; - } - const pool = this[kFactory](upstreamOrigin, Object.assign({}, this[kOptions])); - this[kAddClient](pool); - pool.on("connect", () => { - pool[kWeight] = Math.min(this[kMaxWeightPerServer], pool[kWeight] + this[kErrorPenalty]); + obj[kListeners] = null; + } + function errorRequest(client, request2, err) { + try { + request2.onError(err); + assert(request2.aborted); + } catch (err2) { + client.emit("error", err2); + } + } + var kEnumerableProperty = /* @__PURE__ */ Object.create(null); + kEnumerableProperty.enumerable = true; + var normalizedMethodRecordsBase = { + delete: "DELETE", + DELETE: "DELETE", + get: "GET", + GET: "GET", + head: "HEAD", + HEAD: "HEAD", + options: "OPTIONS", + OPTIONS: "OPTIONS", + post: "POST", + POST: "POST", + put: "PUT", + PUT: "PUT" + }; + var normalizedMethodRecords = { + ...normalizedMethodRecordsBase, + patch: "patch", + PATCH: "PATCH" + }; + Object.setPrototypeOf(normalizedMethodRecordsBase, null); + Object.setPrototypeOf(normalizedMethodRecords, null); + module2.exports = { + kEnumerableProperty, + nop, + isDisturbed, + isErrored, + isReadable, + toUSVString, + isUSVString, + isBlobLike, + parseOrigin, + parseURL, + getServerName, + isStream, + isIterable, + isAsyncIterable, + isDestroyed, + headerNameToString, + bufferToLowerCasedHeaderName, + addListener, + removeAllListeners, + errorRequest, + parseRawHeaders, + parseHeaders, + parseKeepAliveTimeout, + destroy, + bodyLength, + deepClone, + ReadableStreamFrom, + isBuffer, + validateHandler, + getSocketInfo, + isFormDataLike, + buildURL, + addAbortListener, + isValidHTTPToken, + isValidHeaderValue, + isTokenCharCode, + parseRangeHeader, + normalizedMethodRecordsBase, + normalizedMethodRecords, + isValidPort, + isHttpOrHttpsPrefixed, + nodeMajor, + nodeMinor, + safeHTTPMethods: ["GET", "HEAD", "OPTIONS", "TRACE"], + wrapRequestBody + }; + } +}); + +// node_modules/undici/lib/core/diagnostics.js +var require_diagnostics = __commonJS({ + "node_modules/undici/lib/core/diagnostics.js"(exports2, module2) { + "use strict"; + var diagnosticsChannel = require("node:diagnostics_channel"); + var util = require("node:util"); + var undiciDebugLog = util.debuglog("undici"); + var fetchDebuglog = util.debuglog("fetch"); + var websocketDebuglog = util.debuglog("websocket"); + var isClientSet = false; + var channels = { + // Client + beforeConnect: diagnosticsChannel.channel("undici:client:beforeConnect"), + connected: diagnosticsChannel.channel("undici:client:connected"), + connectError: diagnosticsChannel.channel("undici:client:connectError"), + sendHeaders: diagnosticsChannel.channel("undici:client:sendHeaders"), + // Request + create: diagnosticsChannel.channel("undici:request:create"), + bodySent: diagnosticsChannel.channel("undici:request:bodySent"), + headers: diagnosticsChannel.channel("undici:request:headers"), + trailers: diagnosticsChannel.channel("undici:request:trailers"), + error: diagnosticsChannel.channel("undici:request:error"), + // WebSocket + open: diagnosticsChannel.channel("undici:websocket:open"), + close: diagnosticsChannel.channel("undici:websocket:close"), + socketError: diagnosticsChannel.channel("undici:websocket:socket_error"), + ping: diagnosticsChannel.channel("undici:websocket:ping"), + pong: diagnosticsChannel.channel("undici:websocket:pong") + }; + if (undiciDebugLog.enabled || fetchDebuglog.enabled) { + const debuglog = fetchDebuglog.enabled ? fetchDebuglog : undiciDebugLog; + diagnosticsChannel.channel("undici:client:beforeConnect").subscribe((evt) => { + const { + connectParams: { version: version3, protocol, port, host } + } = evt; + debuglog( + "connecting to %s using %s%s", + `${host}${port ? `:${port}` : ""}`, + protocol, + version3 + ); + }); + diagnosticsChannel.channel("undici:client:connected").subscribe((evt) => { + const { + connectParams: { version: version3, protocol, port, host } + } = evt; + debuglog( + "connected to %s using %s%s", + `${host}${port ? `:${port}` : ""}`, + protocol, + version3 + ); + }); + diagnosticsChannel.channel("undici:client:connectError").subscribe((evt) => { + const { + connectParams: { version: version3, protocol, port, host }, + error + } = evt; + debuglog( + "connection to %s using %s%s errored - %s", + `${host}${port ? `:${port}` : ""}`, + protocol, + version3, + error.message + ); + }); + diagnosticsChannel.channel("undici:client:sendHeaders").subscribe((evt) => { + const { + request: { method, path, origin } + } = evt; + debuglog("sending request to %s %s/%s", method, origin, path); + }); + diagnosticsChannel.channel("undici:request:headers").subscribe((evt) => { + const { + request: { method, path, origin }, + response: { statusCode } + } = evt; + debuglog( + "received response to %s %s/%s - HTTP %d", + method, + origin, + path, + statusCode + ); + }); + diagnosticsChannel.channel("undici:request:trailers").subscribe((evt) => { + const { + request: { method, path, origin } + } = evt; + debuglog("trailers received from %s %s/%s", method, origin, path); + }); + diagnosticsChannel.channel("undici:request:error").subscribe((evt) => { + const { + request: { method, path, origin }, + error + } = evt; + debuglog( + "request to %s %s/%s errored - %s", + method, + origin, + path, + error.message + ); + }); + isClientSet = true; + } + if (websocketDebuglog.enabled) { + if (!isClientSet) { + const debuglog = undiciDebugLog.enabled ? undiciDebugLog : websocketDebuglog; + diagnosticsChannel.channel("undici:client:beforeConnect").subscribe((evt) => { + const { + connectParams: { version: version3, protocol, port, host } + } = evt; + debuglog( + "connecting to %s%s using %s%s", + host, + port ? `:${port}` : "", + protocol, + version3 + ); }); - pool.on("connectionError", () => { - pool[kWeight] = Math.max(1, pool[kWeight] - this[kErrorPenalty]); - this._updateBalancedPoolStats(); + diagnosticsChannel.channel("undici:client:connected").subscribe((evt) => { + const { + connectParams: { version: version3, protocol, port, host } + } = evt; + debuglog( + "connected to %s%s using %s%s", + host, + port ? `:${port}` : "", + protocol, + version3 + ); }); - pool.on("disconnect", (...args) => { - const err = args[2]; - if (err && err.code === "UND_ERR_SOCKET") { - pool[kWeight] = Math.max(1, pool[kWeight] - this[kErrorPenalty]); - this._updateBalancedPoolStats(); - } + diagnosticsChannel.channel("undici:client:connectError").subscribe((evt) => { + const { + connectParams: { version: version3, protocol, port, host }, + error + } = evt; + debuglog( + "connection to %s%s using %s%s errored - %s", + host, + port ? `:${port}` : "", + protocol, + version3, + error.message + ); + }); + diagnosticsChannel.channel("undici:client:sendHeaders").subscribe((evt) => { + const { + request: { method, path, origin } + } = evt; + debuglog("sending request to %s %s/%s", method, origin, path); }); - for (const client of this[kClients]) { - client[kWeight] = this[kMaxWeightPerServer]; - } - this._updateBalancedPoolStats(); - return this; - } - _updateBalancedPoolStats() { - this[kGreatestCommonDivisor] = this[kClients].map((p) => p[kWeight]).reduce(getGreatestCommonDivisor, 0); - } - removeUpstream(upstream) { - const upstreamOrigin = parseOrigin(upstream).origin; - const pool = this[kClients].find((pool2) => pool2[kUrl].origin === upstreamOrigin && pool2.closed !== true && pool2.destroyed !== true); - if (pool) { - this[kRemoveClient](pool); - } - return this; - } - get upstreams() { - return this[kClients].filter((dispatcher) => dispatcher.closed !== true && dispatcher.destroyed !== true).map((p) => p[kUrl].origin); - } - [kGetDispatcher]() { - if (this[kClients].length === 0) { - throw new BalancedPoolMissingUpstreamError(); - } - const dispatcher = this[kClients].find((dispatcher2) => !dispatcher2[kNeedDrain] && dispatcher2.closed !== true && dispatcher2.destroyed !== true); - if (!dispatcher) { - return; - } - const allClientsBusy = this[kClients].map((pool) => pool[kNeedDrain]).reduce((a, b) => a && b, true); - if (allClientsBusy) { - return; - } - let counter = 0; - let maxWeightIndex = this[kClients].findIndex((pool) => !pool[kNeedDrain]); - while (counter++ < this[kClients].length) { - this[kIndex] = (this[kIndex] + 1) % this[kClients].length; - const pool = this[kClients][this[kIndex]]; - if (pool[kWeight] > this[kClients][maxWeightIndex][kWeight] && !pool[kNeedDrain]) { - maxWeightIndex = this[kIndex]; - } - if (this[kIndex] === 0) { - this[kCurrentWeight] = this[kCurrentWeight] - this[kGreatestCommonDivisor]; - if (this[kCurrentWeight] <= 0) { - this[kCurrentWeight] = this[kMaxWeightPerServer]; - } - } - if (pool[kWeight] >= this[kCurrentWeight] && !pool[kNeedDrain]) { - return pool; - } - } - this[kCurrentWeight] = this[kClients][maxWeightIndex][kWeight]; - this[kIndex] = maxWeightIndex; - return this[kClients][maxWeightIndex]; } + diagnosticsChannel.channel("undici:websocket:open").subscribe((evt) => { + const { + address: { address, port } + } = evt; + websocketDebuglog("connection opened %s%s", address, port ? `:${port}` : ""); + }); + diagnosticsChannel.channel("undici:websocket:close").subscribe((evt) => { + const { websocket, code, reason } = evt; + websocketDebuglog( + "closed connection to %s - %s %s", + websocket.url, + code, + reason + ); + }); + diagnosticsChannel.channel("undici:websocket:socket_error").subscribe((err) => { + websocketDebuglog("connection errored - %s", err.message); + }); + diagnosticsChannel.channel("undici:websocket:ping").subscribe((evt) => { + websocketDebuglog("ping received"); + }); + diagnosticsChannel.channel("undici:websocket:pong").subscribe((evt) => { + websocketDebuglog("pong received"); + }); + } + module2.exports = { + channels }; - module2.exports = BalancedPool; } }); -// node_modules/undici/lib/dispatcher/agent.js -var require_agent2 = __commonJS({ - "node_modules/undici/lib/dispatcher/agent.js"(exports2, module2) { +// node_modules/undici/lib/core/request.js +var require_request3 = __commonJS({ + "node_modules/undici/lib/core/request.js"(exports2, module2) { "use strict"; - var { InvalidArgumentError } = require_errors2(); - var { kClients, kRunning, kClose, kDestroy, kDispatch, kInterceptors } = require_symbols6(); - var DispatcherBase = require_dispatcher_base2(); - var Pool = require_pool2(); - var Client = require_client2(); - var util = require_util8(); - var createRedirectInterceptor = require_redirect_interceptor(); - var kOnConnect = Symbol("onConnect"); - var kOnDisconnect = Symbol("onDisconnect"); - var kOnConnectionError = Symbol("onConnectionError"); - var kMaxRedirections = Symbol("maxRedirections"); - var kOnDrain = Symbol("onDrain"); - var kFactory = Symbol("factory"); - var kOptions = Symbol("options"); - function defaultFactory(origin, opts) { - return opts && opts.connections === 1 ? new Client(origin, opts) : new Pool(origin, opts); - } - var Agent = class extends DispatcherBase { - constructor({ factory = defaultFactory, maxRedirections = 0, connect, ...options } = {}) { - super(); - if (typeof factory !== "function") { - throw new InvalidArgumentError("factory must be a function."); + var { + InvalidArgumentError, + NotSupportedError + } = require_errors2(); + var assert = require("node:assert"); + var { + isValidHTTPToken, + isValidHeaderValue, + isStream, + destroy, + isBuffer, + isFormDataLike, + isIterable, + isBlobLike, + buildURL, + validateHandler, + getServerName, + normalizedMethodRecords + } = require_util9(); + var { channels } = require_diagnostics(); + var { headerNameLowerCasedRecord } = require_constants6(); + var invalidPathRegex = /[^\u0021-\u00ff]/; + var kHandler = Symbol("handler"); + var Request2 = class { + constructor(origin, { + path, + method, + body, + headers, + query, + idempotent, + blocking, + upgrade, + headersTimeout, + bodyTimeout, + reset, + throwOnError, + expectContinue, + servername + }, handler) { + if (typeof path !== "string") { + throw new InvalidArgumentError("path must be a string"); + } else if (path[0] !== "/" && !(path.startsWith("http://") || path.startsWith("https://")) && method !== "CONNECT") { + throw new InvalidArgumentError("path must be an absolute URL or start with a slash"); + } else if (invalidPathRegex.test(path)) { + throw new InvalidArgumentError("invalid request path"); } - if (connect != null && typeof connect !== "function" && typeof connect !== "object") { - throw new InvalidArgumentError("connect must be a function or an object"); + if (typeof method !== "string") { + throw new InvalidArgumentError("method must be a string"); + } else if (normalizedMethodRecords[method] === void 0 && !isValidHTTPToken(method)) { + throw new InvalidArgumentError("invalid request method"); } - if (!Number.isInteger(maxRedirections) || maxRedirections < 0) { - throw new InvalidArgumentError("maxRedirections must be a positive number"); + if (upgrade && typeof upgrade !== "string") { + throw new InvalidArgumentError("upgrade must be a string"); } - if (connect && typeof connect !== "function") { - connect = { ...connect }; + if (headersTimeout != null && (!Number.isFinite(headersTimeout) || headersTimeout < 0)) { + throw new InvalidArgumentError("invalid headersTimeout"); } - this[kInterceptors] = options.interceptors?.Agent && Array.isArray(options.interceptors.Agent) ? options.interceptors.Agent : [createRedirectInterceptor({ maxRedirections })]; - this[kOptions] = { ...util.deepClone(options), connect }; - this[kOptions].interceptors = options.interceptors ? { ...options.interceptors } : void 0; - this[kMaxRedirections] = maxRedirections; - this[kFactory] = factory; - this[kClients] = /* @__PURE__ */ new Map(); - this[kOnDrain] = (origin, targets) => { - this.emit("drain", origin, [this, ...targets]); - }; - this[kOnConnect] = (origin, targets) => { - this.emit("connect", origin, [this, ...targets]); - }; - this[kOnDisconnect] = (origin, targets, err) => { - this.emit("disconnect", origin, [this, ...targets], err); - }; - this[kOnConnectionError] = (origin, targets, err) => { - this.emit("connectionError", origin, [this, ...targets], err); - }; - } - get [kRunning]() { - let ret = 0; - for (const client of this[kClients].values()) { - ret += client[kRunning]; + if (bodyTimeout != null && (!Number.isFinite(bodyTimeout) || bodyTimeout < 0)) { + throw new InvalidArgumentError("invalid bodyTimeout"); } - return ret; - } - [kDispatch](opts, handler) { - let key; - if (opts.origin && (typeof opts.origin === "string" || opts.origin instanceof URL)) { - key = String(opts.origin); + if (reset != null && typeof reset !== "boolean") { + throw new InvalidArgumentError("invalid reset"); + } + if (expectContinue != null && typeof expectContinue !== "boolean") { + throw new InvalidArgumentError("invalid expectContinue"); + } + this.headersTimeout = headersTimeout; + this.bodyTimeout = bodyTimeout; + this.throwOnError = throwOnError === true; + this.method = method; + this.abort = null; + if (body == null) { + this.body = null; + } else if (isStream(body)) { + this.body = body; + const rState = this.body._readableState; + if (!rState || !rState.autoDestroy) { + this.endHandler = function autoDestroy() { + destroy(this); + }; + this.body.on("end", this.endHandler); + } + this.errorHandler = (err) => { + if (this.abort) { + this.abort(err); + } else { + this.error = err; + } + }; + this.body.on("error", this.errorHandler); + } else if (isBuffer(body)) { + this.body = body.byteLength ? body : null; + } else if (ArrayBuffer.isView(body)) { + this.body = body.buffer.byteLength ? Buffer.from(body.buffer, body.byteOffset, body.byteLength) : null; + } else if (body instanceof ArrayBuffer) { + this.body = body.byteLength ? Buffer.from(body) : null; + } else if (typeof body === "string") { + this.body = body.length ? Buffer.from(body) : null; + } else if (isFormDataLike(body) || isIterable(body) || isBlobLike(body)) { + this.body = body; } else { - throw new InvalidArgumentError("opts.origin must be a non-empty string or URL."); + throw new InvalidArgumentError("body must be a string, a Buffer, a Readable stream, an iterable, or an async iterable"); } - let dispatcher = this[kClients].get(key); - if (!dispatcher) { - dispatcher = this[kFactory](opts.origin, this[kOptions]).on("drain", this[kOnDrain]).on("connect", this[kOnConnect]).on("disconnect", this[kOnDisconnect]).on("connectionError", this[kOnConnectionError]); - this[kClients].set(key, dispatcher); + this.completed = false; + this.aborted = false; + this.upgrade = upgrade || null; + this.path = query ? buildURL(path, query) : path; + this.origin = origin; + this.idempotent = idempotent == null ? method === "HEAD" || method === "GET" : idempotent; + this.blocking = blocking == null ? false : blocking; + this.reset = reset == null ? null : reset; + this.host = null; + this.contentLength = null; + this.contentType = null; + this.headers = []; + this.expectContinue = expectContinue != null ? expectContinue : false; + if (Array.isArray(headers)) { + if (headers.length % 2 !== 0) { + throw new InvalidArgumentError("headers array must be even"); + } + for (let i = 0; i < headers.length; i += 2) { + processHeader(this, headers[i], headers[i + 1]); + } + } else if (headers && typeof headers === "object") { + if (headers[Symbol.iterator]) { + for (const header of headers) { + if (!Array.isArray(header) || header.length !== 2) { + throw new InvalidArgumentError("headers must be in key-value pair format"); + } + processHeader(this, header[0], header[1]); + } + } else { + const keys = Object.keys(headers); + for (let i = 0; i < keys.length; ++i) { + processHeader(this, keys[i], headers[keys[i]]); + } + } + } else if (headers != null) { + throw new InvalidArgumentError("headers must be an object or an array"); + } + validateHandler(handler, method, upgrade); + this.servername = servername || getServerName(this.host); + this[kHandler] = handler; + if (channels.create.hasSubscribers) { + channels.create.publish({ request: this }); } - return dispatcher.dispatch(opts, handler); } - async [kClose]() { - const closePromises = []; - for (const client of this[kClients].values()) { - closePromises.push(client.close()); - } - this[kClients].clear(); - await Promise.all(closePromises); - } - async [kDestroy](err) { - const destroyPromises = []; - for (const client of this[kClients].values()) { - destroyPromises.push(client.destroy(err)); + onBodySent(chunk) { + if (this[kHandler].onBodySent) { + try { + return this[kHandler].onBodySent(chunk); + } catch (err) { + this.abort(err); + } } - this[kClients].clear(); - await Promise.all(destroyPromises); } - }; - module2.exports = Agent; - } -}); - -// node_modules/undici/lib/dispatcher/proxy-agent.js -var require_proxy_agent2 = __commonJS({ - "node_modules/undici/lib/dispatcher/proxy-agent.js"(exports2, module2) { - "use strict"; - var { kProxy, kClose, kDestroy, kInterceptors } = require_symbols6(); - var { URL: URL3 } = require("node:url"); - var Agent = require_agent2(); - var Pool = require_pool2(); - var DispatcherBase = require_dispatcher_base2(); - var { InvalidArgumentError, RequestAbortedError, SecureProxyConnectionError } = require_errors2(); - var buildConnector = require_connect2(); - var kAgent = Symbol("proxy agent"); - var kClient = Symbol("proxy client"); - var kProxyHeaders = Symbol("proxy headers"); - var kRequestTls = Symbol("request tls settings"); - var kProxyTls = Symbol("proxy tls settings"); - var kConnectEndpoint = Symbol("connect endpoint function"); - function defaultProtocolPort(protocol) { - return protocol === "https:" ? 443 : 80; - } - function defaultFactory(origin, opts) { - return new Pool(origin, opts); - } - var ProxyAgent2 = class extends DispatcherBase { - constructor(opts) { - super(); - if (!opts || typeof opts === "object" && !(opts instanceof URL3) && !opts.uri) { - throw new InvalidArgumentError("Proxy uri is mandatory"); - } - const { clientFactory = defaultFactory } = opts; - if (typeof clientFactory !== "function") { - throw new InvalidArgumentError("Proxy opts.clientFactory must be a function."); - } - const url = this.#getUrl(opts); - const { href, origin, port, protocol, username, password, hostname: proxyHostname } = url; - this[kProxy] = { uri: href, protocol }; - this[kInterceptors] = opts.interceptors?.ProxyAgent && Array.isArray(opts.interceptors.ProxyAgent) ? opts.interceptors.ProxyAgent : []; - this[kRequestTls] = opts.requestTls; - this[kProxyTls] = opts.proxyTls; - this[kProxyHeaders] = opts.headers || {}; - if (opts.auth && opts.token) { - throw new InvalidArgumentError("opts.auth cannot be used in combination with opts.token"); - } else if (opts.auth) { - this[kProxyHeaders]["proxy-authorization"] = `Basic ${opts.auth}`; - } else if (opts.token) { - this[kProxyHeaders]["proxy-authorization"] = opts.token; - } else if (username && password) { - this[kProxyHeaders]["proxy-authorization"] = `Basic ${Buffer.from(`${decodeURIComponent(username)}:${decodeURIComponent(password)}`).toString("base64")}`; + onRequestSent() { + if (channels.bodySent.hasSubscribers) { + channels.bodySent.publish({ request: this }); } - const connect = buildConnector({ ...opts.proxyTls }); - this[kConnectEndpoint] = buildConnector({ ...opts.requestTls }); - this[kClient] = clientFactory(url, { connect }); - this[kAgent] = new Agent({ - ...opts, - connect: async (opts2, callback) => { - let requestedPath = opts2.host; - if (!opts2.port) { - requestedPath += `:${defaultProtocolPort(opts2.protocol)}`; - } - try { - const { socket, statusCode } = await this[kClient].connect({ - origin, - port, - path: requestedPath, - signal: opts2.signal, - headers: { - ...this[kProxyHeaders], - host: opts2.host - }, - servername: this[kProxyTls]?.servername || proxyHostname - }); - if (statusCode !== 200) { - socket.on("error", () => { - }).destroy(); - callback(new RequestAbortedError(`Proxy response (${statusCode}) !== 200 when HTTP Tunneling`)); - } - if (opts2.protocol !== "https:") { - callback(null, socket); - return; - } - let servername; - if (this[kRequestTls]) { - servername = this[kRequestTls].servername; - } else { - servername = opts2.servername; - } - this[kConnectEndpoint]({ ...opts2, servername, httpSocket: socket }, callback); - } catch (err) { - if (err.code === "ERR_TLS_CERT_ALTNAME_INVALID") { - callback(new SecureProxyConnectionError(err)); - } else { - callback(err); - } - } + if (this[kHandler].onRequestSent) { + try { + return this[kHandler].onRequestSent(); + } catch (err) { + this.abort(err); } - }); - } - dispatch(opts, handler) { - const headers = buildHeaders(opts.headers); - throwIfProxyAuthIsSent(headers); - if (headers && !("host" in headers) && !("Host" in headers)) { - const { host } = new URL3(opts.origin); - headers.host = host; } - return this[kAgent].dispatch( - { - ...opts, - headers - }, - handler - ); } - /** - * @param {import('../types/proxy-agent').ProxyAgent.Options | string | URL} opts - * @returns {URL} - */ - #getUrl(opts) { - if (typeof opts === "string") { - return new URL3(opts); - } else if (opts instanceof URL3) { - return opts; + onConnect(abort) { + assert(!this.aborted); + assert(!this.completed); + if (this.error) { + abort(this.error); } else { - return new URL3(opts.uri); - } - } - async [kClose]() { - await this[kAgent].close(); - await this[kClient].close(); - } - async [kDestroy]() { - await this[kAgent].destroy(); - await this[kClient].destroy(); - } - }; - function buildHeaders(headers) { - if (Array.isArray(headers)) { - const headersPair = {}; - for (let i = 0; i < headers.length; i += 2) { - headersPair[headers[i]] = headers[i + 1]; + this.abort = abort; + return this[kHandler].onConnect(abort); } - return headersPair; } - return headers; - } - function throwIfProxyAuthIsSent(headers) { - const existProxyAuth = headers && Object.keys(headers).find((key) => key.toLowerCase() === "proxy-authorization"); - if (existProxyAuth) { - throw new InvalidArgumentError("Proxy-Authorization should be sent in ProxyAgent constructor"); + onResponseStarted() { + return this[kHandler].onResponseStarted?.(); } - } - module2.exports = ProxyAgent2; - } -}); - -// node_modules/undici/lib/dispatcher/env-http-proxy-agent.js -var require_env_http_proxy_agent = __commonJS({ - "node_modules/undici/lib/dispatcher/env-http-proxy-agent.js"(exports2, module2) { - "use strict"; - var DispatcherBase = require_dispatcher_base2(); - var { kClose, kDestroy, kClosed, kDestroyed, kDispatch, kNoProxyAgent, kHttpProxyAgent, kHttpsProxyAgent } = require_symbols6(); - var ProxyAgent2 = require_proxy_agent2(); - var Agent = require_agent2(); - var DEFAULT_PORTS = { - "http:": 80, - "https:": 443 - }; - var experimentalWarned = false; - var EnvHttpProxyAgent = class extends DispatcherBase { - #noProxyValue = null; - #noProxyEntries = null; - #opts = null; - constructor(opts = {}) { - super(); - this.#opts = opts; - if (!experimentalWarned) { - experimentalWarned = true; - process.emitWarning("EnvHttpProxyAgent is experimental, expect them to change at any time.", { - code: "UNDICI-EHPA" - }); + onHeaders(statusCode, headers, resume, statusText) { + assert(!this.aborted); + assert(!this.completed); + if (channels.headers.hasSubscribers) { + channels.headers.publish({ request: this, response: { statusCode, headers, statusText } }); } - const { httpProxy, httpsProxy, noProxy, ...agentOpts } = opts; - this[kNoProxyAgent] = new Agent(agentOpts); - const HTTP_PROXY = httpProxy ?? process.env.http_proxy ?? process.env.HTTP_PROXY; - if (HTTP_PROXY) { - this[kHttpProxyAgent] = new ProxyAgent2({ ...agentOpts, uri: HTTP_PROXY }); - } else { - this[kHttpProxyAgent] = this[kNoProxyAgent]; + try { + return this[kHandler].onHeaders(statusCode, headers, resume, statusText); + } catch (err) { + this.abort(err); } - const HTTPS_PROXY = httpsProxy ?? process.env.https_proxy ?? process.env.HTTPS_PROXY; - if (HTTPS_PROXY) { - this[kHttpsProxyAgent] = new ProxyAgent2({ ...agentOpts, uri: HTTPS_PROXY }); - } else { - this[kHttpsProxyAgent] = this[kHttpProxyAgent]; + } + onData(chunk) { + assert(!this.aborted); + assert(!this.completed); + try { + return this[kHandler].onData(chunk); + } catch (err) { + this.abort(err); + return false; } - this.#parseNoProxy(); } - [kDispatch](opts, handler) { - const url = new URL(opts.origin); - const agent = this.#getProxyAgentForUrl(url); - return agent.dispatch(opts, handler); + onUpgrade(statusCode, headers, socket) { + assert(!this.aborted); + assert(!this.completed); + return this[kHandler].onUpgrade(statusCode, headers, socket); } - async [kClose]() { - await this[kNoProxyAgent].close(); - if (!this[kHttpProxyAgent][kClosed]) { - await this[kHttpProxyAgent].close(); + onComplete(trailers) { + this.onFinally(); + assert(!this.aborted); + this.completed = true; + if (channels.trailers.hasSubscribers) { + channels.trailers.publish({ request: this, trailers }); } - if (!this[kHttpsProxyAgent][kClosed]) { - await this[kHttpsProxyAgent].close(); + try { + return this[kHandler].onComplete(trailers); + } catch (err) { + this.onError(err); } } - async [kDestroy](err) { - await this[kNoProxyAgent].destroy(err); - if (!this[kHttpProxyAgent][kDestroyed]) { - await this[kHttpProxyAgent].destroy(err); + onError(error) { + this.onFinally(); + if (channels.error.hasSubscribers) { + channels.error.publish({ request: this, error }); } - if (!this[kHttpsProxyAgent][kDestroyed]) { - await this[kHttpsProxyAgent].destroy(err); + if (this.aborted) { + return; } + this.aborted = true; + return this[kHandler].onError(error); } - #getProxyAgentForUrl(url) { - let { protocol, host: hostname, port } = url; - hostname = hostname.replace(/:\d*$/, "").toLowerCase(); - port = Number.parseInt(port, 10) || DEFAULT_PORTS[protocol] || 0; - if (!this.#shouldProxy(hostname, port)) { - return this[kNoProxyAgent]; + onFinally() { + if (this.errorHandler) { + this.body.off("error", this.errorHandler); + this.errorHandler = null; } - if (protocol === "https:") { - return this[kHttpsProxyAgent]; + if (this.endHandler) { + this.body.off("end", this.endHandler); + this.endHandler = null; } - return this[kHttpProxyAgent]; } - #shouldProxy(hostname, port) { - if (this.#noProxyChanged) { - this.#parseNoProxy(); - } - if (this.#noProxyEntries.length === 0) { - return true; - } - if (this.#noProxyValue === "*") { - return false; + addHeader(key, value) { + processHeader(this, key, value); + return this; + } + }; + function processHeader(request2, key, val2) { + if (val2 && (typeof val2 === "object" && !Array.isArray(val2))) { + throw new InvalidArgumentError(`invalid ${key} header`); + } else if (val2 === void 0) { + return; + } + let headerName = headerNameLowerCasedRecord[key]; + if (headerName === void 0) { + headerName = key.toLowerCase(); + if (headerNameLowerCasedRecord[headerName] === void 0 && !isValidHTTPToken(headerName)) { + throw new InvalidArgumentError("invalid header key"); } - for (let i = 0; i < this.#noProxyEntries.length; i++) { - const entry = this.#noProxyEntries[i]; - if (entry.port && entry.port !== port) { - continue; - } - if (!/^[.*]/.test(entry.hostname)) { - if (hostname === entry.hostname) { - return false; + } + if (Array.isArray(val2)) { + const arr = []; + for (let i = 0; i < val2.length; i++) { + if (typeof val2[i] === "string") { + if (!isValidHeaderValue(val2[i])) { + throw new InvalidArgumentError(`invalid ${key} header`); } + arr.push(val2[i]); + } else if (val2[i] === null) { + arr.push(""); + } else if (typeof val2[i] === "object") { + throw new InvalidArgumentError(`invalid ${key} header`); } else { - if (hostname.endsWith(entry.hostname.replace(/^\*/, ""))) { - return false; - } + arr.push(`${val2[i]}`); } } - return true; - } - #parseNoProxy() { - const noProxyValue = this.#opts.noProxy ?? this.#noProxyEnv; - const noProxySplit = noProxyValue.split(/[,\s]/); - const noProxyEntries = []; - for (let i = 0; i < noProxySplit.length; i++) { - const entry = noProxySplit[i]; - if (!entry) { - continue; - } - const parsed = entry.match(/^(.+):(\d+)$/); - noProxyEntries.push({ - hostname: (parsed ? parsed[1] : entry).toLowerCase(), - port: parsed ? Number.parseInt(parsed[2], 10) : 0 - }); + val2 = arr; + } else if (typeof val2 === "string") { + if (!isValidHeaderValue(val2)) { + throw new InvalidArgumentError(`invalid ${key} header`); } - this.#noProxyValue = noProxyValue; - this.#noProxyEntries = noProxyEntries; + } else if (val2 === null) { + val2 = ""; + } else { + val2 = `${val2}`; } - get #noProxyChanged() { - if (this.#opts.noProxy !== void 0) { - return false; + if (request2.host === null && headerName === "host") { + if (typeof val2 !== "string") { + throw new InvalidArgumentError("invalid host header"); } - return this.#noProxyValue !== this.#noProxyEnv; - } - get #noProxyEnv() { - return process.env.no_proxy ?? process.env.NO_PROXY ?? ""; + request2.host = val2; + } else if (request2.contentLength === null && headerName === "content-length") { + request2.contentLength = parseInt(val2, 10); + if (!Number.isFinite(request2.contentLength)) { + throw new InvalidArgumentError("invalid content-length header"); + } + } else if (request2.contentType === null && headerName === "content-type") { + request2.contentType = val2; + request2.headers.push(key, val2); + } else if (headerName === "transfer-encoding" || headerName === "keep-alive" || headerName === "upgrade") { + throw new InvalidArgumentError(`invalid ${headerName} header`); + } else if (headerName === "connection") { + const value = typeof val2 === "string" ? val2.toLowerCase() : null; + if (value !== "close" && value !== "keep-alive") { + throw new InvalidArgumentError("invalid connection header"); + } + if (value === "close") { + request2.reset = true; + } + } else if (headerName === "expect") { + throw new NotSupportedError("expect header not supported"); + } else { + request2.headers.push(key, val2); } - }; - module2.exports = EnvHttpProxyAgent; + } + module2.exports = Request2; } }); -// node_modules/undici/lib/handler/retry-handler.js -var require_retry_handler = __commonJS({ - "node_modules/undici/lib/handler/retry-handler.js"(exports2, module2) { +// node_modules/undici/lib/dispatcher/dispatcher.js +var require_dispatcher2 = __commonJS({ + "node_modules/undici/lib/dispatcher/dispatcher.js"(exports2, module2) { "use strict"; - var assert = require("node:assert"); - var { kRetryHandlerDefaultRetry } = require_symbols6(); - var { RequestRetryError } = require_errors2(); - var { - isDisturbed, - parseHeaders, - parseRangeHeader, - wrapRequestBody - } = require_util8(); - function calculateRetryAfterHeader(retryAfter) { - const current = Date.now(); - return new Date(retryAfter).getTime() - current; - } - var RetryHandler = class _RetryHandler { - constructor(opts, handlers) { - const { retryOptions, ...dispatchOpts } = opts; - const { - // Retry scoped - retry: retryFn, - maxRetries, - maxTimeout, - minTimeout, - timeoutFactor, - // Response scoped - methods, - errorCodes, - retryAfter, - statusCodes - } = retryOptions ?? {}; - this.dispatch = handlers.dispatch; - this.handler = handlers.handler; - this.opts = { ...dispatchOpts, body: wrapRequestBody(opts.body) }; - this.abort = null; - this.aborted = false; - this.retryOpts = { - retry: retryFn ?? _RetryHandler[kRetryHandlerDefaultRetry], - retryAfter: retryAfter ?? true, - maxTimeout: maxTimeout ?? 30 * 1e3, - // 30s, - minTimeout: minTimeout ?? 500, - // .5s - timeoutFactor: timeoutFactor ?? 2, - maxRetries: maxRetries ?? 5, - // What errors we should retry - methods: methods ?? ["GET", "HEAD", "OPTIONS", "PUT", "DELETE", "TRACE"], - // Indicates which errors to retry - statusCodes: statusCodes ?? [500, 502, 503, 504, 429], - // List of errors to retry - errorCodes: errorCodes ?? [ - "ECONNRESET", - "ECONNREFUSED", - "ENOTFOUND", - "ENETDOWN", - "ENETUNREACH", - "EHOSTDOWN", - "EHOSTUNREACH", - "EPIPE", - "UND_ERR_SOCKET" - ] - }; - this.retryCount = 0; - this.retryCountCheckpoint = 0; - this.start = 0; - this.end = null; - this.etag = null; - this.resume = null; - this.handler.onConnect((reason) => { - this.aborted = true; - if (this.abort) { - this.abort(reason); - } else { - this.reason = reason; - } - }); + var EventEmitter = require("node:events"); + var Dispatcher = class extends EventEmitter { + dispatch() { + throw new Error("not implemented"); } - onRequestSent() { - if (this.handler.onRequestSent) { - this.handler.onRequestSent(); - } + close() { + throw new Error("not implemented"); } - onUpgrade(statusCode, headers, socket) { - if (this.handler.onUpgrade) { - this.handler.onUpgrade(statusCode, headers, socket); - } + destroy() { + throw new Error("not implemented"); } - onConnect(abort) { - if (this.aborted) { - abort(this.reason); - } else { - this.abort = abort; + compose(...args) { + const interceptors = Array.isArray(args[0]) ? args[0] : args; + let dispatch = this.dispatch.bind(this); + for (const interceptor of interceptors) { + if (interceptor == null) { + continue; + } + if (typeof interceptor !== "function") { + throw new TypeError(`invalid interceptor, expected function received ${typeof interceptor}`); + } + dispatch = interceptor(dispatch); + if (dispatch == null || typeof dispatch !== "function" || dispatch.length !== 2) { + throw new TypeError("invalid interceptor"); + } } + return new ComposedDispatcher(this, dispatch); } - onBodySent(chunk) { - if (this.handler.onBodySent) return this.handler.onBodySent(chunk); + }; + var ComposedDispatcher = class extends Dispatcher { + #dispatcher = null; + #dispatch = null; + constructor(dispatcher, dispatch) { + super(); + this.#dispatcher = dispatcher; + this.#dispatch = dispatch; } - static [kRetryHandlerDefaultRetry](err, { state, opts }, cb) { - const { statusCode, code, headers } = err; - const { method, retryOptions } = opts; - const { - maxRetries, - minTimeout, - maxTimeout, - timeoutFactor, - statusCodes, - errorCodes, - methods - } = retryOptions; - const { counter } = state; - if (code && code !== "UND_ERR_REQ_RETRY" && !errorCodes.includes(code)) { - cb(err); - return; + dispatch(...args) { + this.#dispatch(...args); + } + close(...args) { + return this.#dispatcher.close(...args); + } + destroy(...args) { + return this.#dispatcher.destroy(...args); + } + }; + module2.exports = Dispatcher; + } +}); + +// node_modules/undici/lib/dispatcher/dispatcher-base.js +var require_dispatcher_base2 = __commonJS({ + "node_modules/undici/lib/dispatcher/dispatcher-base.js"(exports2, module2) { + "use strict"; + var Dispatcher = require_dispatcher2(); + var { + ClientDestroyedError, + ClientClosedError, + InvalidArgumentError + } = require_errors2(); + var { kDestroy, kClose, kClosed, kDestroyed, kDispatch, kInterceptors } = require_symbols6(); + var kOnDestroyed = Symbol("onDestroyed"); + var kOnClosed = Symbol("onClosed"); + var kInterceptedDispatch = Symbol("Intercepted Dispatch"); + var DispatcherBase = class extends Dispatcher { + constructor() { + super(); + this[kDestroyed] = false; + this[kOnDestroyed] = null; + this[kClosed] = false; + this[kOnClosed] = []; + } + get destroyed() { + return this[kDestroyed]; + } + get closed() { + return this[kClosed]; + } + get interceptors() { + return this[kInterceptors]; + } + set interceptors(newInterceptors) { + if (newInterceptors) { + for (let i = newInterceptors.length - 1; i >= 0; i--) { + const interceptor = this[kInterceptors][i]; + if (typeof interceptor !== "function") { + throw new InvalidArgumentError("interceptor must be an function"); + } + } } - if (Array.isArray(methods) && !methods.includes(method)) { - cb(err); - return; + this[kInterceptors] = newInterceptors; + } + close(callback) { + if (callback === void 0) { + return new Promise((resolve, reject) => { + this.close((err, data) => { + return err ? reject(err) : resolve(data); + }); + }); } - if (statusCode != null && Array.isArray(statusCodes) && !statusCodes.includes(statusCode)) { - cb(err); - return; + if (typeof callback !== "function") { + throw new InvalidArgumentError("invalid callback"); } - if (counter > maxRetries) { - cb(err); + if (this[kDestroyed]) { + queueMicrotask(() => callback(new ClientDestroyedError(), null)); return; } - let retryAfterHeader = headers?.["retry-after"]; - if (retryAfterHeader) { - retryAfterHeader = Number(retryAfterHeader); - retryAfterHeader = Number.isNaN(retryAfterHeader) ? calculateRetryAfterHeader(retryAfterHeader) : retryAfterHeader * 1e3; - } - const retryTimeout = retryAfterHeader > 0 ? Math.min(retryAfterHeader, maxTimeout) : Math.min(minTimeout * timeoutFactor ** (counter - 1), maxTimeout); - setTimeout(() => cb(null), retryTimeout); - } - onHeaders(statusCode, rawHeaders, resume, statusMessage) { - const headers = parseHeaders(rawHeaders); - this.retryCount += 1; - if (statusCode >= 300) { - if (this.retryOpts.statusCodes.includes(statusCode) === false) { - return this.handler.onHeaders( - statusCode, - rawHeaders, - resume, - statusMessage - ); + if (this[kClosed]) { + if (this[kOnClosed]) { + this[kOnClosed].push(callback); } else { - this.abort( - new RequestRetryError("Request failed", statusCode, { - headers, - data: { - count: this.retryCount - } - }) - ); - return false; + queueMicrotask(() => callback(null, null)); } + return; } - if (this.resume != null) { - this.resume = null; - if (statusCode !== 206) { - return true; - } - const contentRange = parseRangeHeader(headers["content-range"]); - if (!contentRange) { - this.abort( - new RequestRetryError("Content-Range mismatch", statusCode, { - headers, - count: this.retryCount - }) - ); - return false; - } - if (this.etag != null && this.etag !== headers.etag) { - this.abort( - new RequestRetryError("ETag mismatch", statusCode, { - headers, - count: this.retryCount - }) - ); - return false; + this[kClosed] = true; + this[kOnClosed].push(callback); + const onClosed = () => { + const callbacks = this[kOnClosed]; + this[kOnClosed] = null; + for (let i = 0; i < callbacks.length; i++) { + callbacks[i](null, null); } - const { start, size, end = size } = contentRange; - assert(this.start === start, "content-range mismatch"); - assert(this.end == null || this.end === end, "content-range mismatch"); - this.resume = resume; - return true; + }; + this[kClose]().then(() => this.destroy()).then(() => { + queueMicrotask(onClosed); + }); + } + destroy(err, callback) { + if (typeof err === "function") { + callback = err; + err = null; } - if (this.end == null) { - if (statusCode === 206) { - const range = parseRangeHeader(headers["content-range"]); - if (range == null) { - return this.handler.onHeaders( - statusCode, - rawHeaders, - resume, - statusMessage - ); - } - const { start, size, end = size } = range; - assert( - start != null && Number.isFinite(start), - "content-range mismatch" - ); - assert(end != null && Number.isFinite(end), "invalid content-length"); - this.start = start; - this.end = end; - } - if (this.end == null) { - const contentLength = headers["content-length"]; - this.end = contentLength != null ? Number(contentLength) : null; - } - assert(Number.isFinite(this.start)); - assert( - this.end == null || Number.isFinite(this.end), - "invalid content-length" - ); - this.resume = resume; - this.etag = headers.etag != null ? headers.etag : null; - if (this.etag != null && this.etag.startsWith("W/")) { - this.etag = null; + if (callback === void 0) { + return new Promise((resolve, reject) => { + this.destroy(err, (err2, data) => { + return err2 ? ( + /* istanbul ignore next: should never error */ + reject(err2) + ) : resolve(data); + }); + }); + } + if (typeof callback !== "function") { + throw new InvalidArgumentError("invalid callback"); + } + if (this[kDestroyed]) { + if (this[kOnDestroyed]) { + this[kOnDestroyed].push(callback); + } else { + queueMicrotask(() => callback(null, null)); } - return this.handler.onHeaders( - statusCode, - rawHeaders, - resume, - statusMessage - ); + return; } - const err = new RequestRetryError("Request failed", statusCode, { - headers, - data: { count: this.retryCount } + if (!err) { + err = new ClientDestroyedError(); + } + this[kDestroyed] = true; + this[kOnDestroyed] = this[kOnDestroyed] || []; + this[kOnDestroyed].push(callback); + const onDestroyed = () => { + const callbacks = this[kOnDestroyed]; + this[kOnDestroyed] = null; + for (let i = 0; i < callbacks.length; i++) { + callbacks[i](null, null); + } + }; + this[kDestroy](err).then(() => { + queueMicrotask(onDestroyed); }); - this.abort(err); - return false; - } - onData(chunk) { - this.start += chunk.length; - return this.handler.onData(chunk); - } - onComplete(rawTrailers) { - this.retryCount = 0; - return this.handler.onComplete(rawTrailers); } - onError(err) { - if (this.aborted || isDisturbed(this.opts.body)) { - return this.handler.onError(err); + [kInterceptedDispatch](opts, handler) { + if (!this[kInterceptors] || this[kInterceptors].length === 0) { + this[kInterceptedDispatch] = this[kDispatch]; + return this[kDispatch](opts, handler); } - if (this.retryCount - this.retryCountCheckpoint > 0) { - this.retryCount = this.retryCountCheckpoint + (this.retryCount - this.retryCountCheckpoint); - } else { - this.retryCount += 1; + let dispatch = this[kDispatch].bind(this); + for (let i = this[kInterceptors].length - 1; i >= 0; i--) { + dispatch = this[kInterceptors][i](dispatch); } - this.retryOpts.retry( - err, - { - state: { counter: this.retryCount }, - opts: { retryOptions: this.retryOpts, ...this.opts } - }, - onRetry.bind(this) - ); - function onRetry(err2) { - if (err2 != null || this.aborted || isDisturbed(this.opts.body)) { - return this.handler.onError(err2); + this[kInterceptedDispatch] = dispatch; + return dispatch(opts, handler); + } + dispatch(opts, handler) { + if (!handler || typeof handler !== "object") { + throw new InvalidArgumentError("handler must be an object"); + } + try { + if (!opts || typeof opts !== "object") { + throw new InvalidArgumentError("opts must be an object."); } - if (this.start !== 0) { - const headers = { range: `bytes=${this.start}-${this.end ?? ""}` }; - if (this.etag != null) { - headers["if-match"] = this.etag; - } - this.opts = { - ...this.opts, - headers: { - ...this.opts.headers, - ...headers - } - }; + if (this[kDestroyed] || this[kOnDestroyed]) { + throw new ClientDestroyedError(); } - try { - this.retryCountCheckpoint = this.retryCount; - this.dispatch(this.opts, this); - } catch (err3) { - this.handler.onError(err3); + if (this[kClosed]) { + throw new ClientClosedError(); + } + return this[kInterceptedDispatch](opts, handler); + } catch (err) { + if (typeof handler.onError !== "function") { + throw new InvalidArgumentError("invalid onError method"); } + handler.onError(err); + return false; } } }; - module2.exports = RetryHandler; - } -}); - -// node_modules/undici/lib/dispatcher/retry-agent.js -var require_retry_agent = __commonJS({ - "node_modules/undici/lib/dispatcher/retry-agent.js"(exports2, module2) { - "use strict"; - var Dispatcher = require_dispatcher2(); - var RetryHandler = require_retry_handler(); - var RetryAgent = class extends Dispatcher { - #agent = null; - #options = null; - constructor(agent, options = {}) { - super(options); - this.#agent = agent; - this.#options = options; - } - dispatch(opts, handler) { - const retry2 = new RetryHandler({ - ...opts, - retryOptions: this.#options - }, { - dispatch: this.#agent.dispatch.bind(this.#agent), - handler - }); - return this.#agent.dispatch(opts, retry2); - } - close() { - return this.#agent.close(); - } - destroy() { - return this.#agent.destroy(); - } - }; - module2.exports = RetryAgent; + module2.exports = DispatcherBase; } }); -// node_modules/undici/lib/api/readable.js -var require_readable2 = __commonJS({ - "node_modules/undici/lib/api/readable.js"(exports2, module2) { +// node_modules/undici/lib/core/connect.js +var require_connect2 = __commonJS({ + "node_modules/undici/lib/core/connect.js"(exports2, module2) { "use strict"; + var net = require("node:net"); var assert = require("node:assert"); - var { Readable } = require("node:stream"); - var { RequestAbortedError, NotSupportedError, InvalidArgumentError, AbortError: AbortError2 } = require_errors2(); - var util = require_util8(); - var { ReadableStreamFrom } = require_util8(); - var kConsume = Symbol("kConsume"); - var kReading = Symbol("kReading"); - var kBody = Symbol("kBody"); - var kAbort = Symbol("kAbort"); - var kContentType = Symbol("kContentType"); - var kContentLength = Symbol("kContentLength"); - var noop = () => { - }; - var BodyReadable = class extends Readable { - constructor({ - resume, - abort, - contentType = "", - contentLength, - highWaterMark = 64 * 1024 - // Same as nodejs fs streams. - }) { - super({ - autoDestroy: true, - read: resume, - highWaterMark - }); - this._readableState.dataEmitted = false; - this[kAbort] = abort; - this[kConsume] = null; - this[kBody] = null; - this[kContentType] = contentType; - this[kContentLength] = contentLength; - this[kReading] = false; - } - destroy(err) { - if (!err && !this._readableState.endEmitted) { - err = new RequestAbortedError(); - } - if (err) { - this[kAbort](); - } - return super.destroy(err); - } - _destroy(err, callback) { - if (!this[kReading]) { - setImmediate(() => { - callback(err); + var util = require_util9(); + var { InvalidArgumentError, ConnectTimeoutError } = require_errors2(); + var tls; + var SessionCache; + if (global.FinalizationRegistry && !(process.env.NODE_V8_COVERAGE || process.env.UNDICI_NO_FG)) { + SessionCache = class WeakSessionCache { + constructor(maxCachedSessions) { + this._maxCachedSessions = maxCachedSessions; + this._sessionCache = /* @__PURE__ */ new Map(); + this._sessionRegistry = new global.FinalizationRegistry((key) => { + if (this._sessionCache.size < this._maxCachedSessions) { + return; + } + const ref = this._sessionCache.get(key); + if (ref !== void 0 && ref.deref() === void 0) { + this._sessionCache.delete(key); + } }); - } else { - callback(err); } - } - on(ev, ...args) { - if (ev === "data" || ev === "readable") { - this[kReading] = true; - } - return super.on(ev, ...args); - } - addListener(ev, ...args) { - return this.on(ev, ...args); - } - off(ev, ...args) { - const ret = super.off(ev, ...args); - if (ev === "data" || ev === "readable") { - this[kReading] = this.listenerCount("data") > 0 || this.listenerCount("readable") > 0; - } - return ret; - } - removeListener(ev, ...args) { - return this.off(ev, ...args); - } - push(chunk) { - if (this[kConsume] && chunk !== null) { - consumePush(this[kConsume], chunk); - return this[kReading] ? super.push(chunk) : true; + get(sessionKey) { + const ref = this._sessionCache.get(sessionKey); + return ref ? ref.deref() : null; } - return super.push(chunk); - } - // https://fetch.spec.whatwg.org/#dom-body-text - async text() { - return consume(this, "text"); - } - // https://fetch.spec.whatwg.org/#dom-body-json - async json() { - return consume(this, "json"); - } - // https://fetch.spec.whatwg.org/#dom-body-blob - async blob() { - return consume(this, "blob"); - } - // https://fetch.spec.whatwg.org/#dom-body-arraybuffer - async arrayBuffer() { - return consume(this, "arrayBuffer"); - } - // https://fetch.spec.whatwg.org/#dom-body-formdata - async formData() { - throw new NotSupportedError(); - } - // https://fetch.spec.whatwg.org/#dom-body-bodyused - get bodyUsed() { - return util.isDisturbed(this); - } - // https://fetch.spec.whatwg.org/#dom-body-body - get body() { - if (!this[kBody]) { - this[kBody] = ReadableStreamFrom(this); - if (this[kConsume]) { - this[kBody].getReader(); - assert(this[kBody].locked); + set(sessionKey, session) { + if (this._maxCachedSessions === 0) { + return; } + this._sessionCache.set(sessionKey, new WeakRef(session)); + this._sessionRegistry.register(session, sessionKey); } - return this[kBody]; - } - async dump(opts) { - let limit = Number.isFinite(opts?.limit) ? opts.limit : 128 * 1024; - const signal = opts?.signal; - if (signal != null && (typeof signal !== "object" || !("aborted" in signal))) { - throw new InvalidArgumentError("signal must be an AbortSignal"); + }; + } else { + SessionCache = class SimpleSessionCache { + constructor(maxCachedSessions) { + this._maxCachedSessions = maxCachedSessions; + this._sessionCache = /* @__PURE__ */ new Map(); } - signal?.throwIfAborted(); - if (this._readableState.closeEmitted) { - return null; + get(sessionKey) { + return this._sessionCache.get(sessionKey); } - return await new Promise((resolve, reject) => { - if (this[kContentLength] > limit) { - this.destroy(new AbortError2()); + set(sessionKey, session) { + if (this._maxCachedSessions === 0) { + return; } - const onAbort = () => { - this.destroy(signal.reason ?? new AbortError2()); - }; - signal?.addEventListener("abort", onAbort); - this.on("close", function() { - signal?.removeEventListener("abort", onAbort); - if (signal?.aborted) { - reject(signal.reason ?? new AbortError2()); - } else { - resolve(null); - } - }).on("error", noop).on("data", function(chunk) { - limit -= chunk.length; - if (limit <= 0) { - this.destroy(); - } - }).resume(); - }); - } - }; - function isLocked(self) { - return self[kBody] && self[kBody].locked === true || self[kConsume]; - } - function isUnusable(self) { - return util.isDisturbed(self) || isLocked(self); - } - async function consume(stream, type) { - assert(!stream[kConsume]); - return new Promise((resolve, reject) => { - if (isUnusable(stream)) { - const rState = stream._readableState; - if (rState.destroyed && rState.closeEmitted === false) { - stream.on("error", (err) => { - reject(err); - }).on("close", () => { - reject(new TypeError("unusable")); - }); - } else { - reject(rState.errored ?? new TypeError("unusable")); + if (this._sessionCache.size >= this._maxCachedSessions) { + const { value: oldestKey } = this._sessionCache.keys().next(); + this._sessionCache.delete(oldestKey); } - } else { - queueMicrotask(() => { - stream[kConsume] = { - type, - stream, - resolve, - reject, - length: 0, - body: [] - }; - stream.on("error", function(err) { - consumeFinish(this[kConsume], err); - }).on("close", function() { - if (this[kConsume].body !== null) { - consumeFinish(this[kConsume], new RequestAbortedError()); - } - }); - consumeStart(stream[kConsume]); - }); + this._sessionCache.set(sessionKey, session); } - }); + }; } - function consumeStart(consume2) { - if (consume2.body === null) { - return; + function buildConnector({ allowH2, maxCachedSessions, socketPath, timeout, session: customSession, ...opts }) { + if (maxCachedSessions != null && (!Number.isInteger(maxCachedSessions) || maxCachedSessions < 0)) { + throw new InvalidArgumentError("maxCachedSessions must be a positive integer or zero"); } - const { _readableState: state } = consume2.stream; - if (state.bufferIndex) { - const start = state.bufferIndex; - const end = state.buffer.length; - for (let n = start; n < end; n++) { - consumePush(consume2, state.buffer[n]); + const options = { path: socketPath, ...opts }; + const sessionCache = new SessionCache(maxCachedSessions == null ? 100 : maxCachedSessions); + timeout = timeout == null ? 1e4 : timeout; + allowH2 = allowH2 != null ? allowH2 : false; + return function connect({ hostname, host, protocol, port, servername, localAddress, httpSocket }, callback) { + let socket; + if (protocol === "https:") { + if (!tls) { + tls = require("node:tls"); + } + servername = servername || options.servername || util.getServerName(host) || null; + const sessionKey = servername || hostname; + const session = customSession || sessionCache.get(sessionKey) || null; + assert(sessionKey); + socket = tls.connect({ + highWaterMark: 16384, + // TLS in node can't have bigger HWM anyway... + ...options, + servername, + session, + localAddress, + // TODO(HTTP/2): Add support for h2c + ALPNProtocols: allowH2 ? ["http/1.1", "h2"] : ["http/1.1"], + socket: httpSocket, + // upgrade socket connection + port: port || 443, + host: hostname + }); + socket.on("session", function(session2) { + sessionCache.set(sessionKey, session2); + }); + } else { + assert(!httpSocket, "httpSocket can only be sent on TLS update"); + socket = net.connect({ + highWaterMark: 64 * 1024, + // Same as nodejs fs streams. + ...options, + localAddress, + port: port || 80, + host: hostname + }); } - } else { - for (const chunk of state.buffer) { - consumePush(consume2, chunk); + if (options.keepAlive == null || options.keepAlive) { + const keepAliveInitialDelay = options.keepAliveInitialDelay === void 0 ? 6e4 : options.keepAliveInitialDelay; + socket.setKeepAlive(true, keepAliveInitialDelay); } - } - if (state.endEmitted) { - consumeEnd(this[kConsume]); - } else { - consume2.stream.on("end", function() { - consumeEnd(this[kConsume]); + const cancelTimeout = setupTimeout(() => onConnectTimeout(socket), timeout); + socket.setNoDelay(true).once(protocol === "https:" ? "secureConnect" : "connect", function() { + cancelTimeout(); + if (callback) { + const cb = callback; + callback = null; + cb(null, this); + } + }).on("error", function(err) { + cancelTimeout(); + if (callback) { + const cb = callback; + callback = null; + cb(err); + } }); - } - consume2.stream.resume(); - while (consume2.stream.read() != null) { - } + return socket; + }; } - function chunksDecode(chunks, length) { - if (chunks.length === 0 || length === 0) { - return ""; + function setupTimeout(onConnectTimeout2, timeout) { + if (!timeout) { + return () => { + }; } - const buffer = chunks.length === 1 ? chunks[0] : Buffer.concat(chunks, length); - const bufferLength = buffer.length; - const start = bufferLength > 2 && buffer[0] === 239 && buffer[1] === 187 && buffer[2] === 191 ? 3 : 0; - return buffer.utf8Slice(start, bufferLength); - } - function consumeEnd(consume2) { - const { type, body, resolve, stream, length } = consume2; - try { - if (type === "text") { - resolve(chunksDecode(body, length)); - } else if (type === "json") { - resolve(JSON.parse(chunksDecode(body, length))); - } else if (type === "arrayBuffer") { - const dst = new Uint8Array(length); - let pos = 0; - for (const buf of body) { - dst.set(buf, pos); - pos += buf.byteLength; + let s1 = null; + let s2 = null; + const timeoutId = setTimeout(() => { + s1 = setImmediate(() => { + if (process.platform === "win32") { + s2 = setImmediate(() => onConnectTimeout2()); + } else { + onConnectTimeout2(); } - resolve(dst.buffer); - } else if (type === "blob") { - resolve(new Blob(body, { type: stream[kContentType] })); - } - consumeFinish(consume2); - } catch (err) { - stream.destroy(err); - } - } - function consumePush(consume2, chunk) { - consume2.length += chunk.length; - consume2.body.push(chunk); + }); + }, timeout); + return () => { + clearTimeout(timeoutId); + clearImmediate(s1); + clearImmediate(s2); + }; } - function consumeFinish(consume2, err) { - if (consume2.body === null) { - return; - } - if (err) { - consume2.reject(err); - } else { - consume2.resolve(); + function onConnectTimeout(socket) { + let message = "Connect Timeout Error"; + if (Array.isArray(socket.autoSelectFamilyAttemptedAddresses)) { + message += ` (attempted addresses: ${socket.autoSelectFamilyAttemptedAddresses.join(", ")})`; } - consume2.type = null; - consume2.stream = null; - consume2.resolve = null; - consume2.reject = null; - consume2.length = 0; - consume2.body = null; + util.destroy(socket, new ConnectTimeoutError(message)); } - module2.exports = { Readable: BodyReadable, chunksDecode }; + module2.exports = buildConnector; } }); -// node_modules/undici/lib/api/util.js -var require_util10 = __commonJS({ - "node_modules/undici/lib/api/util.js"(exports2, module2) { - var assert = require("node:assert"); - var { - ResponseStatusCodeError - } = require_errors2(); - var { chunksDecode } = require_readable2(); - var CHUNK_LIMIT = 128 * 1024; - async function getResolveErrorBodyCallback({ callback, body, contentType, statusCode, statusMessage, headers }) { - assert(body); - let chunks = []; - let length = 0; - try { - for await (const chunk of body) { - chunks.push(chunk); - length += chunk.length; - if (length > CHUNK_LIMIT) { - chunks = []; - length = 0; - break; +// node_modules/undici/lib/util/timers.js +var require_timers2 = __commonJS({ + "node_modules/undici/lib/util/timers.js"(exports2, module2) { + "use strict"; + var TICK_MS = 499; + var fastNow = Date.now(); + var fastNowTimeout; + var fastTimers = []; + function onTimeout() { + fastNow = Date.now(); + let len = fastTimers.length; + let idx = 0; + while (idx < len) { + const timer = fastTimers[idx]; + if (timer.state === 0) { + timer.state = fastNow + timer.delay - TICK_MS; + } else if (timer.state > 0 && fastNow >= timer.state) { + timer.state = -1; + timer.callback(timer.opaque); + } + if (timer.state === -1) { + timer.state = -2; + if (idx !== len - 1) { + fastTimers[idx] = fastTimers.pop(); + } else { + fastTimers.pop(); } + len -= 1; + } else { + idx += 1; } - } catch { - chunks = []; - length = 0; } - const message = `Response status code ${statusCode}${statusMessage ? `: ${statusMessage}` : ""}`; - if (statusCode === 204 || !contentType || !length) { - queueMicrotask(() => callback(new ResponseStatusCodeError(message, statusCode, headers))); - return; + if (fastTimers.length > 0) { + refreshTimeout(); } - const stackTraceLimit = Error.stackTraceLimit; - Error.stackTraceLimit = 0; - let payload; - try { - if (isContentTypeApplicationJson(contentType)) { - payload = JSON.parse(chunksDecode(chunks, length)); - } else if (isContentTypeText(contentType)) { - payload = chunksDecode(chunks, length); + } + function refreshTimeout() { + if (fastNowTimeout?.refresh) { + fastNowTimeout.refresh(); + } else { + clearTimeout(fastNowTimeout); + fastNowTimeout = setTimeout(onTimeout, TICK_MS); + if (fastNowTimeout.unref) { + fastNowTimeout.unref(); } - } catch { - } finally { - Error.stackTraceLimit = stackTraceLimit; } - queueMicrotask(() => callback(new ResponseStatusCodeError(message, statusCode, headers, payload))); } - var isContentTypeApplicationJson = (contentType) => { - return contentType.length > 15 && contentType[11] === "/" && contentType[0] === "a" && contentType[1] === "p" && contentType[2] === "p" && contentType[3] === "l" && contentType[4] === "i" && contentType[5] === "c" && contentType[6] === "a" && contentType[7] === "t" && contentType[8] === "i" && contentType[9] === "o" && contentType[10] === "n" && contentType[12] === "j" && contentType[13] === "s" && contentType[14] === "o" && contentType[15] === "n"; - }; - var isContentTypeText = (contentType) => { - return contentType.length > 4 && contentType[4] === "/" && contentType[0] === "t" && contentType[1] === "e" && contentType[2] === "x" && contentType[3] === "t"; - }; - module2.exports = { - getResolveErrorBodyCallback, - isContentTypeApplicationJson, - isContentTypeText - }; - } -}); - -// node_modules/undici/lib/api/api-request.js -var require_api_request2 = __commonJS({ - "node_modules/undici/lib/api/api-request.js"(exports2, module2) { - "use strict"; - var assert = require("node:assert"); - var { Readable } = require_readable2(); - var { InvalidArgumentError, RequestAbortedError } = require_errors2(); - var util = require_util8(); - var { getResolveErrorBodyCallback } = require_util10(); - var { AsyncResource } = require("node:async_hooks"); - var RequestHandler = class extends AsyncResource { - constructor(opts, callback) { - if (!opts || typeof opts !== "object") { - throw new InvalidArgumentError("invalid opts"); - } - const { signal, method, opaque, body, onInfo, responseHeaders, throwOnError, highWaterMark } = opts; - try { - if (typeof callback !== "function") { - throw new InvalidArgumentError("invalid callback"); - } - if (highWaterMark && (typeof highWaterMark !== "number" || highWaterMark < 0)) { - throw new InvalidArgumentError("invalid highWaterMark"); - } - if (signal && typeof signal.on !== "function" && typeof signal.addEventListener !== "function") { - throw new InvalidArgumentError("signal must be an EventEmitter or EventTarget"); - } - if (method === "CONNECT") { - throw new InvalidArgumentError("invalid method"); - } - if (onInfo && typeof onInfo !== "function") { - throw new InvalidArgumentError("invalid onInfo callback"); - } - super("UNDICI_REQUEST"); - } catch (err) { - if (util.isStream(body)) { - util.destroy(body.on("error", util.nop), err); - } - throw err; - } - this.method = method; - this.responseHeaders = responseHeaders || null; - this.opaque = opaque || null; + var Timeout = class { + constructor(callback, delay, opaque) { this.callback = callback; - this.res = null; - this.abort = null; - this.body = body; - this.trailers = {}; - this.context = null; - this.onInfo = onInfo || null; - this.throwOnError = throwOnError; - this.highWaterMark = highWaterMark; - this.signal = signal; - this.reason = null; - this.removeAbortListener = null; - if (util.isStream(body)) { - body.on("error", (err) => { - this.onError(err); - }); - } - if (this.signal) { - if (this.signal.aborted) { - this.reason = this.signal.reason ?? new RequestAbortedError(); - } else { - this.removeAbortListener = util.addAbortListener(this.signal, () => { - this.reason = this.signal.reason ?? new RequestAbortedError(); - if (this.res) { - util.destroy(this.res, this.reason); - } else if (this.abort) { - this.abort(this.reason); - } - if (this.removeAbortListener) { - this.res?.off("close", this.removeAbortListener); - this.removeAbortListener(); - this.removeAbortListener = null; - } - }); - } - } - } - onConnect(abort, context) { - if (this.reason) { - abort(this.reason); - return; - } - assert(this.callback); - this.abort = abort; - this.context = context; + this.delay = delay; + this.opaque = opaque; + this.state = -2; + this.refresh(); } - onHeaders(statusCode, rawHeaders, resume, statusMessage) { - const { callback, opaque, abort, context, responseHeaders, highWaterMark } = this; - const headers = responseHeaders === "raw" ? util.parseRawHeaders(rawHeaders) : util.parseHeaders(rawHeaders); - if (statusCode < 200) { - if (this.onInfo) { - this.onInfo({ statusCode, headers }); - } - return; - } - const parsedHeaders = responseHeaders === "raw" ? util.parseHeaders(rawHeaders) : headers; - const contentType = parsedHeaders["content-type"]; - const contentLength = parsedHeaders["content-length"]; - const res = new Readable({ - resume, - abort, - contentType, - contentLength: this.method !== "HEAD" && contentLength ? Number(contentLength) : null, - highWaterMark - }); - if (this.removeAbortListener) { - res.on("close", this.removeAbortListener); - } - this.callback = null; - this.res = res; - if (callback !== null) { - if (this.throwOnError && statusCode >= 400) { - this.runInAsyncScope( - getResolveErrorBodyCallback, - null, - { callback, body: res, contentType, statusCode, statusMessage, headers } - ); - } else { - this.runInAsyncScope(callback, null, null, { - statusCode, - headers, - trailers: this.trailers, - opaque, - body: res, - context - }); + refresh() { + if (this.state === -2) { + fastTimers.push(this); + if (!fastNowTimeout || fastTimers.length === 1) { + refreshTimeout(); } } + this.state = 0; } - onData(chunk) { - return this.res.push(chunk); - } - onComplete(trailers) { - util.parseHeaders(trailers, this.trailers); - this.res.push(null); - } - onError(err) { - const { res, callback, body, opaque } = this; - if (callback) { - this.callback = null; - queueMicrotask(() => { - this.runInAsyncScope(callback, null, err, { opaque }); - }); - } - if (res) { - this.res = null; - queueMicrotask(() => { - util.destroy(res, err); - }); - } - if (body) { - this.body = null; - util.destroy(body, err); - } - if (this.removeAbortListener) { - res?.off("close", this.removeAbortListener); - this.removeAbortListener(); - this.removeAbortListener = null; - } + clear() { + this.state = -1; } }; - function request2(opts, callback) { - if (callback === void 0) { - return new Promise((resolve, reject) => { - request2.call(this, opts, (err, data) => { - return err ? reject(err) : resolve(data); - }); - }); - } - try { - this.dispatch(opts, new RequestHandler(opts, callback)); - } catch (err) { - if (typeof callback !== "function") { - throw err; + module2.exports = { + setTimeout(callback, delay, opaque) { + return delay <= 1e3 ? setTimeout(callback, delay, opaque) : new Timeout(callback, delay, opaque); + }, + clearTimeout(timeout) { + if (timeout instanceof Timeout) { + timeout.clear(); + } else { + clearTimeout(timeout); } - const opaque = opts?.opaque; - queueMicrotask(() => callback(err, { opaque })); } - } - module2.exports = request2; - module2.exports.RequestHandler = RequestHandler; + }; } }); -// node_modules/undici/lib/api/abort-signal.js -var require_abort_signal2 = __commonJS({ - "node_modules/undici/lib/api/abort-signal.js"(exports2, module2) { - var { addAbortListener } = require_util8(); - var { RequestAbortedError } = require_errors2(); - var kListener = Symbol("kListener"); - var kSignal = Symbol("kSignal"); - function abort(self) { +// node_modules/undici/lib/llhttp/utils.js +var require_utils3 = __commonJS({ + "node_modules/undici/lib/llhttp/utils.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.enumToMap = void 0; + function enumToMap(obj) { + const res = {}; + Object.keys(obj).forEach((key) => { + const value = obj[key]; + if (typeof value === "number") { + res[key] = value; + } + }); + return res; + } + exports2.enumToMap = enumToMap; + } +}); + +// node_modules/undici/lib/llhttp/constants.js +var require_constants7 = __commonJS({ + "node_modules/undici/lib/llhttp/constants.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.SPECIAL_HEADERS = exports2.HEADER_STATE = exports2.MINOR = exports2.MAJOR = exports2.CONNECTION_TOKEN_CHARS = exports2.HEADER_CHARS = exports2.TOKEN = exports2.STRICT_TOKEN = exports2.HEX = exports2.URL_CHAR = exports2.STRICT_URL_CHAR = exports2.USERINFO_CHARS = exports2.MARK = exports2.ALPHANUM = exports2.NUM = exports2.HEX_MAP = exports2.NUM_MAP = exports2.ALPHA = exports2.FINISH = exports2.H_METHOD_MAP = exports2.METHOD_MAP = exports2.METHODS_RTSP = exports2.METHODS_ICE = exports2.METHODS_HTTP = exports2.METHODS = exports2.LENIENT_FLAGS = exports2.FLAGS = exports2.TYPE = exports2.ERROR = void 0; + var utils_1 = require_utils3(); + var ERROR; + (function(ERROR2) { + ERROR2[ERROR2["OK"] = 0] = "OK"; + ERROR2[ERROR2["INTERNAL"] = 1] = "INTERNAL"; + ERROR2[ERROR2["STRICT"] = 2] = "STRICT"; + ERROR2[ERROR2["LF_EXPECTED"] = 3] = "LF_EXPECTED"; + ERROR2[ERROR2["UNEXPECTED_CONTENT_LENGTH"] = 4] = "UNEXPECTED_CONTENT_LENGTH"; + ERROR2[ERROR2["CLOSED_CONNECTION"] = 5] = "CLOSED_CONNECTION"; + ERROR2[ERROR2["INVALID_METHOD"] = 6] = "INVALID_METHOD"; + ERROR2[ERROR2["INVALID_URL"] = 7] = "INVALID_URL"; + ERROR2[ERROR2["INVALID_CONSTANT"] = 8] = "INVALID_CONSTANT"; + ERROR2[ERROR2["INVALID_VERSION"] = 9] = "INVALID_VERSION"; + ERROR2[ERROR2["INVALID_HEADER_TOKEN"] = 10] = "INVALID_HEADER_TOKEN"; + ERROR2[ERROR2["INVALID_CONTENT_LENGTH"] = 11] = "INVALID_CONTENT_LENGTH"; + ERROR2[ERROR2["INVALID_CHUNK_SIZE"] = 12] = "INVALID_CHUNK_SIZE"; + ERROR2[ERROR2["INVALID_STATUS"] = 13] = "INVALID_STATUS"; + ERROR2[ERROR2["INVALID_EOF_STATE"] = 14] = "INVALID_EOF_STATE"; + ERROR2[ERROR2["INVALID_TRANSFER_ENCODING"] = 15] = "INVALID_TRANSFER_ENCODING"; + ERROR2[ERROR2["CB_MESSAGE_BEGIN"] = 16] = "CB_MESSAGE_BEGIN"; + ERROR2[ERROR2["CB_HEADERS_COMPLETE"] = 17] = "CB_HEADERS_COMPLETE"; + ERROR2[ERROR2["CB_MESSAGE_COMPLETE"] = 18] = "CB_MESSAGE_COMPLETE"; + ERROR2[ERROR2["CB_CHUNK_HEADER"] = 19] = "CB_CHUNK_HEADER"; + ERROR2[ERROR2["CB_CHUNK_COMPLETE"] = 20] = "CB_CHUNK_COMPLETE"; + ERROR2[ERROR2["PAUSED"] = 21] = "PAUSED"; + ERROR2[ERROR2["PAUSED_UPGRADE"] = 22] = "PAUSED_UPGRADE"; + ERROR2[ERROR2["PAUSED_H2_UPGRADE"] = 23] = "PAUSED_H2_UPGRADE"; + ERROR2[ERROR2["USER"] = 24] = "USER"; + })(ERROR = exports2.ERROR || (exports2.ERROR = {})); + var TYPE; + (function(TYPE2) { + TYPE2[TYPE2["BOTH"] = 0] = "BOTH"; + TYPE2[TYPE2["REQUEST"] = 1] = "REQUEST"; + TYPE2[TYPE2["RESPONSE"] = 2] = "RESPONSE"; + })(TYPE = exports2.TYPE || (exports2.TYPE = {})); + var FLAGS; + (function(FLAGS2) { + FLAGS2[FLAGS2["CONNECTION_KEEP_ALIVE"] = 1] = "CONNECTION_KEEP_ALIVE"; + FLAGS2[FLAGS2["CONNECTION_CLOSE"] = 2] = "CONNECTION_CLOSE"; + FLAGS2[FLAGS2["CONNECTION_UPGRADE"] = 4] = "CONNECTION_UPGRADE"; + FLAGS2[FLAGS2["CHUNKED"] = 8] = "CHUNKED"; + FLAGS2[FLAGS2["UPGRADE"] = 16] = "UPGRADE"; + FLAGS2[FLAGS2["CONTENT_LENGTH"] = 32] = "CONTENT_LENGTH"; + FLAGS2[FLAGS2["SKIPBODY"] = 64] = "SKIPBODY"; + FLAGS2[FLAGS2["TRAILING"] = 128] = "TRAILING"; + FLAGS2[FLAGS2["TRANSFER_ENCODING"] = 512] = "TRANSFER_ENCODING"; + })(FLAGS = exports2.FLAGS || (exports2.FLAGS = {})); + var LENIENT_FLAGS; + (function(LENIENT_FLAGS2) { + LENIENT_FLAGS2[LENIENT_FLAGS2["HEADERS"] = 1] = "HEADERS"; + LENIENT_FLAGS2[LENIENT_FLAGS2["CHUNKED_LENGTH"] = 2] = "CHUNKED_LENGTH"; + LENIENT_FLAGS2[LENIENT_FLAGS2["KEEP_ALIVE"] = 4] = "KEEP_ALIVE"; + })(LENIENT_FLAGS = exports2.LENIENT_FLAGS || (exports2.LENIENT_FLAGS = {})); + var METHODS; + (function(METHODS2) { + METHODS2[METHODS2["DELETE"] = 0] = "DELETE"; + METHODS2[METHODS2["GET"] = 1] = "GET"; + METHODS2[METHODS2["HEAD"] = 2] = "HEAD"; + METHODS2[METHODS2["POST"] = 3] = "POST"; + METHODS2[METHODS2["PUT"] = 4] = "PUT"; + METHODS2[METHODS2["CONNECT"] = 5] = "CONNECT"; + METHODS2[METHODS2["OPTIONS"] = 6] = "OPTIONS"; + METHODS2[METHODS2["TRACE"] = 7] = "TRACE"; + METHODS2[METHODS2["COPY"] = 8] = "COPY"; + METHODS2[METHODS2["LOCK"] = 9] = "LOCK"; + METHODS2[METHODS2["MKCOL"] = 10] = "MKCOL"; + METHODS2[METHODS2["MOVE"] = 11] = "MOVE"; + METHODS2[METHODS2["PROPFIND"] = 12] = "PROPFIND"; + METHODS2[METHODS2["PROPPATCH"] = 13] = "PROPPATCH"; + METHODS2[METHODS2["SEARCH"] = 14] = "SEARCH"; + METHODS2[METHODS2["UNLOCK"] = 15] = "UNLOCK"; + METHODS2[METHODS2["BIND"] = 16] = "BIND"; + METHODS2[METHODS2["REBIND"] = 17] = "REBIND"; + METHODS2[METHODS2["UNBIND"] = 18] = "UNBIND"; + METHODS2[METHODS2["ACL"] = 19] = "ACL"; + METHODS2[METHODS2["REPORT"] = 20] = "REPORT"; + METHODS2[METHODS2["MKACTIVITY"] = 21] = "MKACTIVITY"; + METHODS2[METHODS2["CHECKOUT"] = 22] = "CHECKOUT"; + METHODS2[METHODS2["MERGE"] = 23] = "MERGE"; + METHODS2[METHODS2["M-SEARCH"] = 24] = "M-SEARCH"; + METHODS2[METHODS2["NOTIFY"] = 25] = "NOTIFY"; + METHODS2[METHODS2["SUBSCRIBE"] = 26] = "SUBSCRIBE"; + METHODS2[METHODS2["UNSUBSCRIBE"] = 27] = "UNSUBSCRIBE"; + METHODS2[METHODS2["PATCH"] = 28] = "PATCH"; + METHODS2[METHODS2["PURGE"] = 29] = "PURGE"; + METHODS2[METHODS2["MKCALENDAR"] = 30] = "MKCALENDAR"; + METHODS2[METHODS2["LINK"] = 31] = "LINK"; + METHODS2[METHODS2["UNLINK"] = 32] = "UNLINK"; + METHODS2[METHODS2["SOURCE"] = 33] = "SOURCE"; + METHODS2[METHODS2["PRI"] = 34] = "PRI"; + METHODS2[METHODS2["DESCRIBE"] = 35] = "DESCRIBE"; + METHODS2[METHODS2["ANNOUNCE"] = 36] = "ANNOUNCE"; + METHODS2[METHODS2["SETUP"] = 37] = "SETUP"; + METHODS2[METHODS2["PLAY"] = 38] = "PLAY"; + METHODS2[METHODS2["PAUSE"] = 39] = "PAUSE"; + METHODS2[METHODS2["TEARDOWN"] = 40] = "TEARDOWN"; + METHODS2[METHODS2["GET_PARAMETER"] = 41] = "GET_PARAMETER"; + METHODS2[METHODS2["SET_PARAMETER"] = 42] = "SET_PARAMETER"; + METHODS2[METHODS2["REDIRECT"] = 43] = "REDIRECT"; + METHODS2[METHODS2["RECORD"] = 44] = "RECORD"; + METHODS2[METHODS2["FLUSH"] = 45] = "FLUSH"; + })(METHODS = exports2.METHODS || (exports2.METHODS = {})); + exports2.METHODS_HTTP = [ + METHODS.DELETE, + METHODS.GET, + METHODS.HEAD, + METHODS.POST, + METHODS.PUT, + METHODS.CONNECT, + METHODS.OPTIONS, + METHODS.TRACE, + METHODS.COPY, + METHODS.LOCK, + METHODS.MKCOL, + METHODS.MOVE, + METHODS.PROPFIND, + METHODS.PROPPATCH, + METHODS.SEARCH, + METHODS.UNLOCK, + METHODS.BIND, + METHODS.REBIND, + METHODS.UNBIND, + METHODS.ACL, + METHODS.REPORT, + METHODS.MKACTIVITY, + METHODS.CHECKOUT, + METHODS.MERGE, + METHODS["M-SEARCH"], + METHODS.NOTIFY, + METHODS.SUBSCRIBE, + METHODS.UNSUBSCRIBE, + METHODS.PATCH, + METHODS.PURGE, + METHODS.MKCALENDAR, + METHODS.LINK, + METHODS.UNLINK, + METHODS.PRI, + // TODO(indutny): should we allow it with HTTP? + METHODS.SOURCE + ]; + exports2.METHODS_ICE = [ + METHODS.SOURCE + ]; + exports2.METHODS_RTSP = [ + METHODS.OPTIONS, + METHODS.DESCRIBE, + METHODS.ANNOUNCE, + METHODS.SETUP, + METHODS.PLAY, + METHODS.PAUSE, + METHODS.TEARDOWN, + METHODS.GET_PARAMETER, + METHODS.SET_PARAMETER, + METHODS.REDIRECT, + METHODS.RECORD, + METHODS.FLUSH, + // For AirPlay + METHODS.GET, + METHODS.POST + ]; + exports2.METHOD_MAP = utils_1.enumToMap(METHODS); + exports2.H_METHOD_MAP = {}; + Object.keys(exports2.METHOD_MAP).forEach((key) => { + if (/^H/.test(key)) { + exports2.H_METHOD_MAP[key] = exports2.METHOD_MAP[key]; + } + }); + var FINISH; + (function(FINISH2) { + FINISH2[FINISH2["SAFE"] = 0] = "SAFE"; + FINISH2[FINISH2["SAFE_WITH_CB"] = 1] = "SAFE_WITH_CB"; + FINISH2[FINISH2["UNSAFE"] = 2] = "UNSAFE"; + })(FINISH = exports2.FINISH || (exports2.FINISH = {})); + exports2.ALPHA = []; + for (let i = "A".charCodeAt(0); i <= "Z".charCodeAt(0); i++) { + exports2.ALPHA.push(String.fromCharCode(i)); + exports2.ALPHA.push(String.fromCharCode(i + 32)); + } + exports2.NUM_MAP = { + 0: 0, + 1: 1, + 2: 2, + 3: 3, + 4: 4, + 5: 5, + 6: 6, + 7: 7, + 8: 8, + 9: 9 + }; + exports2.HEX_MAP = { + 0: 0, + 1: 1, + 2: 2, + 3: 3, + 4: 4, + 5: 5, + 6: 6, + 7: 7, + 8: 8, + 9: 9, + A: 10, + B: 11, + C: 12, + D: 13, + E: 14, + F: 15, + a: 10, + b: 11, + c: 12, + d: 13, + e: 14, + f: 15 + }; + exports2.NUM = [ + "0", + "1", + "2", + "3", + "4", + "5", + "6", + "7", + "8", + "9" + ]; + exports2.ALPHANUM = exports2.ALPHA.concat(exports2.NUM); + exports2.MARK = ["-", "_", ".", "!", "~", "*", "'", "(", ")"]; + exports2.USERINFO_CHARS = exports2.ALPHANUM.concat(exports2.MARK).concat(["%", ";", ":", "&", "=", "+", "$", ","]); + exports2.STRICT_URL_CHAR = [ + "!", + '"', + "$", + "%", + "&", + "'", + "(", + ")", + "*", + "+", + ",", + "-", + ".", + "/", + ":", + ";", + "<", + "=", + ">", + "@", + "[", + "\\", + "]", + "^", + "_", + "`", + "{", + "|", + "}", + "~" + ].concat(exports2.ALPHANUM); + exports2.URL_CHAR = exports2.STRICT_URL_CHAR.concat([" ", "\f"]); + for (let i = 128; i <= 255; i++) { + exports2.URL_CHAR.push(i); + } + exports2.HEX = exports2.NUM.concat(["a", "b", "c", "d", "e", "f", "A", "B", "C", "D", "E", "F"]); + exports2.STRICT_TOKEN = [ + "!", + "#", + "$", + "%", + "&", + "'", + "*", + "+", + "-", + ".", + "^", + "_", + "`", + "|", + "~" + ].concat(exports2.ALPHANUM); + exports2.TOKEN = exports2.STRICT_TOKEN.concat([" "]); + exports2.HEADER_CHARS = [" "]; + for (let i = 32; i <= 255; i++) { + if (i !== 127) { + exports2.HEADER_CHARS.push(i); + } + } + exports2.CONNECTION_TOKEN_CHARS = exports2.HEADER_CHARS.filter((c) => c !== 44); + exports2.MAJOR = exports2.NUM_MAP; + exports2.MINOR = exports2.MAJOR; + var HEADER_STATE; + (function(HEADER_STATE2) { + HEADER_STATE2[HEADER_STATE2["GENERAL"] = 0] = "GENERAL"; + HEADER_STATE2[HEADER_STATE2["CONNECTION"] = 1] = "CONNECTION"; + HEADER_STATE2[HEADER_STATE2["CONTENT_LENGTH"] = 2] = "CONTENT_LENGTH"; + HEADER_STATE2[HEADER_STATE2["TRANSFER_ENCODING"] = 3] = "TRANSFER_ENCODING"; + HEADER_STATE2[HEADER_STATE2["UPGRADE"] = 4] = "UPGRADE"; + HEADER_STATE2[HEADER_STATE2["CONNECTION_KEEP_ALIVE"] = 5] = "CONNECTION_KEEP_ALIVE"; + HEADER_STATE2[HEADER_STATE2["CONNECTION_CLOSE"] = 6] = "CONNECTION_CLOSE"; + HEADER_STATE2[HEADER_STATE2["CONNECTION_UPGRADE"] = 7] = "CONNECTION_UPGRADE"; + HEADER_STATE2[HEADER_STATE2["TRANSFER_ENCODING_CHUNKED"] = 8] = "TRANSFER_ENCODING_CHUNKED"; + })(HEADER_STATE = exports2.HEADER_STATE || (exports2.HEADER_STATE = {})); + exports2.SPECIAL_HEADERS = { + "connection": HEADER_STATE.CONNECTION, + "content-length": HEADER_STATE.CONTENT_LENGTH, + "proxy-connection": HEADER_STATE.CONNECTION, + "transfer-encoding": HEADER_STATE.TRANSFER_ENCODING, + "upgrade": HEADER_STATE.UPGRADE + }; + } +}); + +// node_modules/undici/lib/llhttp/llhttp-wasm.js +var require_llhttp_wasm2 = __commonJS({ + "node_modules/undici/lib/llhttp/llhttp-wasm.js"(exports2, module2) { + "use strict"; + var { Buffer: Buffer2 } = require("node:buffer"); + module2.exports = Buffer2.from("AGFzbQEAAAABJwdgAX8Bf2ADf39/AX9gAX8AYAJ/fwBgBH9/f38Bf2AAAGADf39/AALLAQgDZW52GHdhc21fb25faGVhZGVyc19jb21wbGV0ZQAEA2VudhV3YXNtX29uX21lc3NhZ2VfYmVnaW4AAANlbnYLd2FzbV9vbl91cmwAAQNlbnYOd2FzbV9vbl9zdGF0dXMAAQNlbnYUd2FzbV9vbl9oZWFkZXJfZmllbGQAAQNlbnYUd2FzbV9vbl9oZWFkZXJfdmFsdWUAAQNlbnYMd2FzbV9vbl9ib2R5AAEDZW52GHdhc21fb25fbWVzc2FnZV9jb21wbGV0ZQAAAy0sBQYAAAIAAAAAAAACAQIAAgICAAADAAAAAAMDAwMBAQEBAQEBAQEAAAIAAAAEBQFwARISBQMBAAIGCAF/AUGA1AQLB9EFIgZtZW1vcnkCAAtfaW5pdGlhbGl6ZQAIGV9faW5kaXJlY3RfZnVuY3Rpb25fdGFibGUBAAtsbGh0dHBfaW5pdAAJGGxsaHR0cF9zaG91bGRfa2VlcF9hbGl2ZQAvDGxsaHR0cF9hbGxvYwALBm1hbGxvYwAxC2xsaHR0cF9mcmVlAAwEZnJlZQAMD2xsaHR0cF9nZXRfdHlwZQANFWxsaHR0cF9nZXRfaHR0cF9tYWpvcgAOFWxsaHR0cF9nZXRfaHR0cF9taW5vcgAPEWxsaHR0cF9nZXRfbWV0aG9kABAWbGxodHRwX2dldF9zdGF0dXNfY29kZQAREmxsaHR0cF9nZXRfdXBncmFkZQASDGxsaHR0cF9yZXNldAATDmxsaHR0cF9leGVjdXRlABQUbGxodHRwX3NldHRpbmdzX2luaXQAFQ1sbGh0dHBfZmluaXNoABYMbGxodHRwX3BhdXNlABcNbGxodHRwX3Jlc3VtZQAYG2xsaHR0cF9yZXN1bWVfYWZ0ZXJfdXBncmFkZQAZEGxsaHR0cF9nZXRfZXJybm8AGhdsbGh0dHBfZ2V0X2Vycm9yX3JlYXNvbgAbF2xsaHR0cF9zZXRfZXJyb3JfcmVhc29uABwUbGxodHRwX2dldF9lcnJvcl9wb3MAHRFsbGh0dHBfZXJybm9fbmFtZQAeEmxsaHR0cF9tZXRob2RfbmFtZQAfEmxsaHR0cF9zdGF0dXNfbmFtZQAgGmxsaHR0cF9zZXRfbGVuaWVudF9oZWFkZXJzACEhbGxodHRwX3NldF9sZW5pZW50X2NodW5rZWRfbGVuZ3RoACIdbGxodHRwX3NldF9sZW5pZW50X2tlZXBfYWxpdmUAIyRsbGh0dHBfc2V0X2xlbmllbnRfdHJhbnNmZXJfZW5jb2RpbmcAJBhsbGh0dHBfbWVzc2FnZV9uZWVkc19lb2YALgkXAQBBAQsRAQIDBAUKBgcrLSwqKSglJyYK07MCLBYAQYjQACgCAARAAAtBiNAAQQE2AgALFAAgABAwIAAgAjYCOCAAIAE6ACgLFAAgACAALwEyIAAtAC4gABAvEAALHgEBf0HAABAyIgEQMCABQYAINgI4IAEgADoAKCABC48MAQd/AkAgAEUNACAAQQhrIgEgAEEEaygCACIAQXhxIgRqIQUCQCAAQQFxDQAgAEEDcUUNASABIAEoAgAiAGsiAUGc0AAoAgBJDQEgACAEaiEEAkACQEGg0AAoAgAgAUcEQCAAQf8BTQRAIABBA3YhAyABKAIIIgAgASgCDCICRgRAQYzQAEGM0AAoAgBBfiADd3E2AgAMBQsgAiAANgIIIAAgAjYCDAwECyABKAIYIQYgASABKAIMIgBHBEAgACABKAIIIgI2AgggAiAANgIMDAMLIAFBFGoiAygCACICRQRAIAEoAhAiAkUNAiABQRBqIQMLA0AgAyEHIAIiAEEUaiIDKAIAIgINACAAQRBqIQMgACgCECICDQALIAdBADYCAAwCCyAFKAIEIgBBA3FBA0cNAiAFIABBfnE2AgRBlNAAIAQ2AgAgBSAENgIAIAEgBEEBcjYCBAwDC0EAIQALIAZFDQACQCABKAIcIgJBAnRBvNIAaiIDKAIAIAFGBEAgAyAANgIAIAANAUGQ0ABBkNAAKAIAQX4gAndxNgIADAILIAZBEEEUIAYoAhAgAUYbaiAANgIAIABFDQELIAAgBjYCGCABKAIQIgIEQCAAIAI2AhAgAiAANgIYCyABQRRqKAIAIgJFDQAgAEEUaiACNgIAIAIgADYCGAsgASAFTw0AIAUoAgQiAEEBcUUNAAJAAkACQAJAIABBAnFFBEBBpNAAKAIAIAVGBEBBpNAAIAE2AgBBmNAAQZjQACgCACAEaiIANgIAIAEgAEEBcjYCBCABQaDQACgCAEcNBkGU0ABBADYCAEGg0ABBADYCAAwGC0Gg0AAoAgAgBUYEQEGg0AAgATYCAEGU0ABBlNAAKAIAIARqIgA2AgAgASAAQQFyNgIEIAAgAWogADYCAAwGCyAAQXhxIARqIQQgAEH/AU0EQCAAQQN2IQMgBSgCCCIAIAUoAgwiAkYEQEGM0ABBjNAAKAIAQX4gA3dxNgIADAULIAIgADYCCCAAIAI2AgwMBAsgBSgCGCEGIAUgBSgCDCIARwRAQZzQACgCABogACAFKAIIIgI2AgggAiAANgIMDAMLIAVBFGoiAygCACICRQRAIAUoAhAiAkUNAiAFQRBqIQMLA0AgAyEHIAIiAEEUaiIDKAIAIgINACAAQRBqIQMgACgCECICDQALIAdBADYCAAwCCyAFIABBfnE2AgQgASAEaiAENgIAIAEgBEEBcjYCBAwDC0EAIQALIAZFDQACQCAFKAIcIgJBAnRBvNIAaiIDKAIAIAVGBEAgAyAANgIAIAANAUGQ0ABBkNAAKAIAQX4gAndxNgIADAILIAZBEEEUIAYoAhAgBUYbaiAANgIAIABFDQELIAAgBjYCGCAFKAIQIgIEQCAAIAI2AhAgAiAANgIYCyAFQRRqKAIAIgJFDQAgAEEUaiACNgIAIAIgADYCGAsgASAEaiAENgIAIAEgBEEBcjYCBCABQaDQACgCAEcNAEGU0AAgBDYCAAwBCyAEQf8BTQRAIARBeHFBtNAAaiEAAn9BjNAAKAIAIgJBASAEQQN2dCIDcUUEQEGM0AAgAiADcjYCACAADAELIAAoAggLIgIgATYCDCAAIAE2AgggASAANgIMIAEgAjYCCAwBC0EfIQIgBEH///8HTQRAIARBJiAEQQh2ZyIAa3ZBAXEgAEEBdGtBPmohAgsgASACNgIcIAFCADcCECACQQJ0QbzSAGohAAJAQZDQACgCACIDQQEgAnQiB3FFBEAgACABNgIAQZDQACADIAdyNgIAIAEgADYCGCABIAE2AgggASABNgIMDAELIARBGSACQQF2a0EAIAJBH0cbdCECIAAoAgAhAAJAA0AgACIDKAIEQXhxIARGDQEgAkEddiEAIAJBAXQhAiADIABBBHFqQRBqIgcoAgAiAA0ACyAHIAE2AgAgASADNgIYIAEgATYCDCABIAE2AggMAQsgAygCCCIAIAE2AgwgAyABNgIIIAFBADYCGCABIAM2AgwgASAANgIIC0Gs0ABBrNAAKAIAQQFrIgBBfyAAGzYCAAsLBwAgAC0AKAsHACAALQAqCwcAIAAtACsLBwAgAC0AKQsHACAALwEyCwcAIAAtAC4LQAEEfyAAKAIYIQEgAC0ALSECIAAtACghAyAAKAI4IQQgABAwIAAgBDYCOCAAIAM6ACggACACOgAtIAAgATYCGAu74gECB38DfiABIAJqIQQCQCAAIgIoAgwiAA0AIAIoAgQEQCACIAE2AgQLIwBBEGsiCCQAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACfwJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAIAIoAhwiA0EBaw7dAdoBAdkBAgMEBQYHCAkKCwwNDtgBDxDXARES1gETFBUWFxgZGhvgAd8BHB0e1QEfICEiIyQl1AEmJygpKiss0wHSAS0u0QHQAS8wMTIzNDU2Nzg5Ojs8PT4/QEFCQ0RFRtsBR0hJSs8BzgFLzQFMzAFNTk9QUVJTVFVWV1hZWltcXV5fYGFiY2RlZmdoaWprbG1ub3BxcnN0dXZ3eHl6e3x9fn+AAYEBggGDAYQBhQGGAYcBiAGJAYoBiwGMAY0BjgGPAZABkQGSAZMBlAGVAZYBlwGYAZkBmgGbAZwBnQGeAZ8BoAGhAaIBowGkAaUBpgGnAagBqQGqAasBrAGtAa4BrwGwAbEBsgGzAbQBtQG2AbcBywHKAbgByQG5AcgBugG7AbwBvQG+Ab8BwAHBAcIBwwHEAcUBxgEA3AELQQAMxgELQQ4MxQELQQ0MxAELQQ8MwwELQRAMwgELQRMMwQELQRQMwAELQRUMvwELQRYMvgELQRgMvQELQRkMvAELQRoMuwELQRsMugELQRwMuQELQR0MuAELQQgMtwELQR4MtgELQSAMtQELQR8MtAELQQcMswELQSEMsgELQSIMsQELQSMMsAELQSQMrwELQRIMrgELQREMrQELQSUMrAELQSYMqwELQScMqgELQSgMqQELQcMBDKgBC0EqDKcBC0ErDKYBC0EsDKUBC0EtDKQBC0EuDKMBC0EvDKIBC0HEAQyhAQtBMAygAQtBNAyfAQtBDAyeAQtBMQydAQtBMgycAQtBMwybAQtBOQyaAQtBNQyZAQtBxQEMmAELQQsMlwELQToMlgELQTYMlQELQQoMlAELQTcMkwELQTgMkgELQTwMkQELQTsMkAELQT0MjwELQQkMjgELQSkMjQELQT4MjAELQT8MiwELQcAADIoBC0HBAAyJAQtBwgAMiAELQcMADIcBC0HEAAyGAQtBxQAMhQELQcYADIQBC0EXDIMBC0HHAAyCAQtByAAMgQELQckADIABC0HKAAx/C0HLAAx+C0HNAAx9C0HMAAx8C0HOAAx7C0HPAAx6C0HQAAx5C0HRAAx4C0HSAAx3C0HTAAx2C0HUAAx1C0HWAAx0C0HVAAxzC0EGDHILQdcADHELQQUMcAtB2AAMbwtBBAxuC0HZAAxtC0HaAAxsC0HbAAxrC0HcAAxqC0EDDGkLQd0ADGgLQd4ADGcLQd8ADGYLQeEADGULQeAADGQLQeIADGMLQeMADGILQQIMYQtB5AAMYAtB5QAMXwtB5gAMXgtB5wAMXQtB6AAMXAtB6QAMWwtB6gAMWgtB6wAMWQtB7AAMWAtB7QAMVwtB7gAMVgtB7wAMVQtB8AAMVAtB8QAMUwtB8gAMUgtB8wAMUQtB9AAMUAtB9QAMTwtB9gAMTgtB9wAMTQtB+AAMTAtB+QAMSwtB+gAMSgtB+wAMSQtB/AAMSAtB/QAMRwtB/gAMRgtB/wAMRQtBgAEMRAtBgQEMQwtBggEMQgtBgwEMQQtBhAEMQAtBhQEMPwtBhgEMPgtBhwEMPQtBiAEMPAtBiQEMOwtBigEMOgtBiwEMOQtBjAEMOAtBjQEMNwtBjgEMNgtBjwEMNQtBkAEMNAtBkQEMMwtBkgEMMgtBkwEMMQtBlAEMMAtBlQEMLwtBlgEMLgtBlwEMLQtBmAEMLAtBmQEMKwtBmgEMKgtBmwEMKQtBnAEMKAtBnQEMJwtBngEMJgtBnwEMJQtBoAEMJAtBoQEMIwtBogEMIgtBowEMIQtBpAEMIAtBpQEMHwtBpgEMHgtBpwEMHQtBqAEMHAtBqQEMGwtBqgEMGgtBqwEMGQtBrAEMGAtBrQEMFwtBrgEMFgtBAQwVC0GvAQwUC0GwAQwTC0GxAQwSC0GzAQwRC0GyAQwQC0G0AQwPC0G1AQwOC0G2AQwNC0G3AQwMC0G4AQwLC0G5AQwKC0G6AQwJC0G7AQwIC0HGAQwHC0G8AQwGC0G9AQwFC0G+AQwEC0G/AQwDC0HAAQwCC0HCAQwBC0HBAQshAwNAAkACQAJAAkACQAJAAkACQAJAIAICfwJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJ/AkACQAJAAkACQAJAAkACQAJAAkACQAJAAkAgAgJ/AkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACfwJAAkACfwJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACfwJAAkACQAJAAn8CQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQCADDsYBAAECAwQFBgcICQoLDA0ODxAREhMUFRYXGBkaGxwdHyAhIyUmKCorLC8wMTIzNDU2Nzk6Ozw9lANAQkRFRklLTk9QUVJTVFVWWFpbXF1eX2BhYmNkZWZnaGpsb3Bxc3V2eHl6e3x/gAGBAYIBgwGEAYUBhgGHAYgBiQGKAYsBjAGNAY4BjwGQAZEBkgGTAZQBlQGWAZcBmAGZAZoBmwGcAZ0BngGfAaABoQGiAaMBpAGlAaYBpwGoAakBqgGrAawBrQGuAa8BsAGxAbIBswG0AbUBtgG3AbgBuQG6AbsBvAG9Ab4BvwHAAcEBwgHDAcQBxQHGAccByAHJAcsBzAHNAc4BzwGKA4kDiAOHA4QDgwOAA/sC+gL5AvgC9wL0AvMC8gLLAsECsALZAQsgASAERw3wAkHdASEDDLMDCyABIARHDcgBQcMBIQMMsgMLIAEgBEcNe0H3ACEDDLEDCyABIARHDXBB7wAhAwywAwsgASAERw1pQeoAIQMMrwMLIAEgBEcNZUHoACEDDK4DCyABIARHDWJB5gAhAwytAwsgASAERw0aQRghAwysAwsgASAERw0VQRIhAwyrAwsgASAERw1CQcUAIQMMqgMLIAEgBEcNNEE/IQMMqQMLIAEgBEcNMkE8IQMMqAMLIAEgBEcNK0ExIQMMpwMLIAItAC5BAUYNnwMMwQILQQAhAAJAAkACQCACLQAqRQ0AIAItACtFDQAgAi8BMCIDQQJxRQ0BDAILIAIvATAiA0EBcUUNAQtBASEAIAItAChBAUYNACACLwEyIgVB5ABrQeQASQ0AIAVBzAFGDQAgBUGwAkYNACADQcAAcQ0AQQAhACADQYgEcUGABEYNACADQShxQQBHIQALIAJBADsBMCACQQA6AC8gAEUN3wIgAkIANwMgDOACC0EAIQACQCACKAI4IgNFDQAgAygCLCIDRQ0AIAIgAxEAACEACyAARQ3MASAAQRVHDd0CIAJBBDYCHCACIAE2AhQgAkGwGDYCECACQRU2AgxBACEDDKQDCyABIARGBEBBBiEDDKQDCyABQQFqIQFBACEAAkAgAigCOCIDRQ0AIAMoAlQiA0UNACACIAMRAAAhAAsgAA3ZAgwcCyACQgA3AyBBEiEDDIkDCyABIARHDRZBHSEDDKEDCyABIARHBEAgAUEBaiEBQRAhAwyIAwtBByEDDKADCyACIAIpAyAiCiAEIAFrrSILfSIMQgAgCiAMWhs3AyAgCiALWA3UAkEIIQMMnwMLIAEgBEcEQCACQQk2AgggAiABNgIEQRQhAwyGAwtBCSEDDJ4DCyACKQMgQgBSDccBIAIgAi8BMEGAAXI7ATAMQgsgASAERw0/QdAAIQMMnAMLIAEgBEYEQEELIQMMnAMLIAFBAWohAUEAIQACQCACKAI4IgNFDQAgAygCUCIDRQ0AIAIgAxEAACEACyAADc8CDMYBC0EAIQACQCACKAI4IgNFDQAgAygCSCIDRQ0AIAIgAxEAACEACyAARQ3GASAAQRVHDc0CIAJBCzYCHCACIAE2AhQgAkGCGTYCECACQRU2AgxBACEDDJoDC0EAIQACQCACKAI4IgNFDQAgAygCSCIDRQ0AIAIgAxEAACEACyAARQ0MIABBFUcNygIgAkEaNgIcIAIgATYCFCACQYIZNgIQIAJBFTYCDEEAIQMMmQMLQQAhAAJAIAIoAjgiA0UNACADKAJMIgNFDQAgAiADEQAAIQALIABFDcQBIABBFUcNxwIgAkELNgIcIAIgATYCFCACQZEXNgIQIAJBFTYCDEEAIQMMmAMLIAEgBEYEQEEPIQMMmAMLIAEtAAAiAEE7Rg0HIABBDUcNxAIgAUEBaiEBDMMBC0EAIQACQCACKAI4IgNFDQAgAygCTCIDRQ0AIAIgAxEAACEACyAARQ3DASAAQRVHDcICIAJBDzYCHCACIAE2AhQgAkGRFzYCECACQRU2AgxBACEDDJYDCwNAIAEtAABB8DVqLQAAIgBBAUcEQCAAQQJHDcECIAIoAgQhAEEAIQMgAkEANgIEIAIgACABQQFqIgEQLSIADcICDMUBCyAEIAFBAWoiAUcNAAtBEiEDDJUDC0EAIQACQCACKAI4IgNFDQAgAygCTCIDRQ0AIAIgAxEAACEACyAARQ3FASAAQRVHDb0CIAJBGzYCHCACIAE2AhQgAkGRFzYCECACQRU2AgxBACEDDJQDCyABIARGBEBBFiEDDJQDCyACQQo2AgggAiABNgIEQQAhAAJAIAIoAjgiA0UNACADKAJIIgNFDQAgAiADEQAAIQALIABFDcIBIABBFUcNuQIgAkEVNgIcIAIgATYCFCACQYIZNgIQIAJBFTYCDEEAIQMMkwMLIAEgBEcEQANAIAEtAABB8DdqLQAAIgBBAkcEQAJAIABBAWsOBMQCvQIAvgK9AgsgAUEBaiEBQQghAwz8AgsgBCABQQFqIgFHDQALQRUhAwyTAwtBFSEDDJIDCwNAIAEtAABB8DlqLQAAIgBBAkcEQCAAQQFrDgTFArcCwwK4ArcCCyAEIAFBAWoiAUcNAAtBGCEDDJEDCyABIARHBEAgAkELNgIIIAIgATYCBEEHIQMM+AILQRkhAwyQAwsgAUEBaiEBDAILIAEgBEYEQEEaIQMMjwMLAkAgAS0AAEENaw4UtQG/Ab8BvwG/Ab8BvwG/Ab8BvwG/Ab8BvwG/Ab8BvwG/Ab8BvwEAvwELQQAhAyACQQA2AhwgAkGvCzYCECACQQI2AgwgAiABQQFqNgIUDI4DCyABIARGBEBBGyEDDI4DCyABLQAAIgBBO0cEQCAAQQ1HDbECIAFBAWohAQy6AQsgAUEBaiEBC0EiIQMM8wILIAEgBEYEQEEcIQMMjAMLQgAhCgJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkAgAS0AAEEwaw43wQLAAgABAgMEBQYH0AHQAdAB0AHQAdAB0AEICQoLDA3QAdAB0AHQAdAB0AHQAdAB0AHQAdAB0AHQAdAB0AHQAdAB0AHQAdAB0AHQAdAB0AHQAdABDg8QERIT0AELQgIhCgzAAgtCAyEKDL8CC0IEIQoMvgILQgUhCgy9AgtCBiEKDLwCC0IHIQoMuwILQgghCgy6AgtCCSEKDLkCC0IKIQoMuAILQgshCgy3AgtCDCEKDLYCC0INIQoMtQILQg4hCgy0AgtCDyEKDLMCC0IKIQoMsgILQgshCgyxAgtCDCEKDLACC0INIQoMrwILQg4hCgyuAgtCDyEKDK0CC0IAIQoCQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAIAEtAABBMGsON8ACvwIAAQIDBAUGB74CvgK+Ar4CvgK+Ar4CCAkKCwwNvgK+Ar4CvgK+Ar4CvgK+Ar4CvgK+Ar4CvgK+Ar4CvgK+Ar4CvgK+Ar4CvgK+Ar4CvgK+Ag4PEBESE74CC0ICIQoMvwILQgMhCgy+AgtCBCEKDL0CC0IFIQoMvAILQgYhCgy7AgtCByEKDLoCC0IIIQoMuQILQgkhCgy4AgtCCiEKDLcCC0ILIQoMtgILQgwhCgy1AgtCDSEKDLQCC0IOIQoMswILQg8hCgyyAgtCCiEKDLECC0ILIQoMsAILQgwhCgyvAgtCDSEKDK4CC0IOIQoMrQILQg8hCgysAgsgAiACKQMgIgogBCABa60iC30iDEIAIAogDFobNwMgIAogC1gNpwJBHyEDDIkDCyABIARHBEAgAkEJNgIIIAIgATYCBEElIQMM8AILQSAhAwyIAwtBASEFIAIvATAiA0EIcUUEQCACKQMgQgBSIQULAkAgAi0ALgRAQQEhACACLQApQQVGDQEgA0HAAHFFIAVxRQ0BC0EAIQAgA0HAAHENAEECIQAgA0EIcQ0AIANBgARxBEACQCACLQAoQQFHDQAgAi0ALUEKcQ0AQQUhAAwCC0EEIQAMAQsgA0EgcUUEQAJAIAItAChBAUYNACACLwEyIgBB5ABrQeQASQ0AIABBzAFGDQAgAEGwAkYNAEEEIQAgA0EocUUNAiADQYgEcUGABEYNAgtBACEADAELQQBBAyACKQMgUBshAAsgAEEBaw4FvgIAsAEBpAKhAgtBESEDDO0CCyACQQE6AC8MhAMLIAEgBEcNnQJBJCEDDIQDCyABIARHDRxBxgAhAwyDAwtBACEAAkAgAigCOCIDRQ0AIAMoAkQiA0UNACACIAMRAAAhAAsgAEUNJyAAQRVHDZgCIAJB0AA2AhwgAiABNgIUIAJBkRg2AhAgAkEVNgIMQQAhAwyCAwsgASAERgRAQSghAwyCAwtBACEDIAJBADYCBCACQQw2AgggAiABIAEQKiIARQ2UAiACQSc2AhwgAiABNgIUIAIgADYCDAyBAwsgASAERgRAQSkhAwyBAwsgAS0AACIAQSBGDRMgAEEJRw2VAiABQQFqIQEMFAsgASAERwRAIAFBAWohAQwWC0EqIQMM/wILIAEgBEYEQEErIQMM/wILIAEtAAAiAEEJRyAAQSBHcQ2QAiACLQAsQQhHDd0CIAJBADoALAzdAgsgASAERgRAQSwhAwz+AgsgAS0AAEEKRw2OAiABQQFqIQEMsAELIAEgBEcNigJBLyEDDPwCCwNAIAEtAAAiAEEgRwRAIABBCmsOBIQCiAKIAoQChgILIAQgAUEBaiIBRw0AC0ExIQMM+wILQTIhAyABIARGDfoCIAIoAgAiACAEIAFraiEHIAEgAGtBA2ohBgJAA0AgAEHwO2otAAAgAS0AACIFQSByIAUgBUHBAGtB/wFxQRpJG0H/AXFHDQEgAEEDRgRAQQYhAQziAgsgAEEBaiEAIAQgAUEBaiIBRw0ACyACIAc2AgAM+wILIAJBADYCAAyGAgtBMyEDIAQgASIARg35AiAEIAFrIAIoAgAiAWohByAAIAFrQQhqIQYCQANAIAFB9DtqLQAAIAAtAAAiBUEgciAFIAVBwQBrQf8BcUEaSRtB/wFxRw0BIAFBCEYEQEEFIQEM4QILIAFBAWohASAEIABBAWoiAEcNAAsgAiAHNgIADPoCCyACQQA2AgAgACEBDIUCC0E0IQMgBCABIgBGDfgCIAQgAWsgAigCACIBaiEHIAAgAWtBBWohBgJAA0AgAUHQwgBqLQAAIAAtAAAiBUEgciAFIAVBwQBrQf8BcUEaSRtB/wFxRw0BIAFBBUYEQEEHIQEM4AILIAFBAWohASAEIABBAWoiAEcNAAsgAiAHNgIADPkCCyACQQA2AgAgACEBDIQCCyABIARHBEADQCABLQAAQYA+ai0AACIAQQFHBEAgAEECRg0JDIECCyAEIAFBAWoiAUcNAAtBMCEDDPgCC0EwIQMM9wILIAEgBEcEQANAIAEtAAAiAEEgRwRAIABBCmsOBP8B/gH+Af8B/gELIAQgAUEBaiIBRw0AC0E4IQMM9wILQTghAwz2AgsDQCABLQAAIgBBIEcgAEEJR3EN9gEgBCABQQFqIgFHDQALQTwhAwz1AgsDQCABLQAAIgBBIEcEQAJAIABBCmsOBPkBBAT5AQALIABBLEYN9QEMAwsgBCABQQFqIgFHDQALQT8hAwz0AgtBwAAhAyABIARGDfMCIAIoAgAiACAEIAFraiEFIAEgAGtBBmohBgJAA0AgAEGAQGstAAAgAS0AAEEgckcNASAAQQZGDdsCIABBAWohACAEIAFBAWoiAUcNAAsgAiAFNgIADPQCCyACQQA2AgALQTYhAwzZAgsgASAERgRAQcEAIQMM8gILIAJBDDYCCCACIAE2AgQgAi0ALEEBaw4E+wHuAewB6wHUAgsgAUEBaiEBDPoBCyABIARHBEADQAJAIAEtAAAiAEEgciAAIABBwQBrQf8BcUEaSRtB/wFxIgBBCUYNACAAQSBGDQACQAJAAkACQCAAQeMAaw4TAAMDAwMDAwMBAwMDAwMDAwMDAgMLIAFBAWohAUExIQMM3AILIAFBAWohAUEyIQMM2wILIAFBAWohAUEzIQMM2gILDP4BCyAEIAFBAWoiAUcNAAtBNSEDDPACC0E1IQMM7wILIAEgBEcEQANAIAEtAABBgDxqLQAAQQFHDfcBIAQgAUEBaiIBRw0AC0E9IQMM7wILQT0hAwzuAgtBACEAAkAgAigCOCIDRQ0AIAMoAkAiA0UNACACIAMRAAAhAAsgAEUNASAAQRVHDeYBIAJBwgA2AhwgAiABNgIUIAJB4xg2AhAgAkEVNgIMQQAhAwztAgsgAUEBaiEBC0E8IQMM0gILIAEgBEYEQEHCACEDDOsCCwJAA0ACQCABLQAAQQlrDhgAAswCzALRAswCzALMAswCzALMAswCzALMAswCzALMAswCzALMAswCzALMAgDMAgsgBCABQQFqIgFHDQALQcIAIQMM6wILIAFBAWohASACLQAtQQFxRQ3+AQtBLCEDDNACCyABIARHDd4BQcQAIQMM6AILA0AgAS0AAEGQwABqLQAAQQFHDZwBIAQgAUEBaiIBRw0AC0HFACEDDOcCCyABLQAAIgBBIEYN/gEgAEE6Rw3AAiACKAIEIQBBACEDIAJBADYCBCACIAAgARApIgAN3gEM3QELQccAIQMgBCABIgBGDeUCIAQgAWsgAigCACIBaiEHIAAgAWtBBWohBgNAIAFBkMIAai0AACAALQAAIgVBIHIgBSAFQcEAa0H/AXFBGkkbQf8BcUcNvwIgAUEFRg3CAiABQQFqIQEgBCAAQQFqIgBHDQALIAIgBzYCAAzlAgtByAAhAyAEIAEiAEYN5AIgBCABayACKAIAIgFqIQcgACABa0EJaiEGA0AgAUGWwgBqLQAAIAAtAAAiBUEgciAFIAVBwQBrQf8BcUEaSRtB/wFxRw2+AkECIAFBCUYNwgIaIAFBAWohASAEIABBAWoiAEcNAAsgAiAHNgIADOQCCyABIARGBEBByQAhAwzkAgsCQAJAIAEtAAAiAEEgciAAIABBwQBrQf8BcUEaSRtB/wFxQe4Aaw4HAL8CvwK/Ar8CvwIBvwILIAFBAWohAUE+IQMMywILIAFBAWohAUE/IQMMygILQcoAIQMgBCABIgBGDeICIAQgAWsgAigCACIBaiEGIAAgAWtBAWohBwNAIAFBoMIAai0AACAALQAAIgVBIHIgBSAFQcEAa0H/AXFBGkkbQf8BcUcNvAIgAUEBRg2+AiABQQFqIQEgBCAAQQFqIgBHDQALIAIgBjYCAAziAgtBywAhAyAEIAEiAEYN4QIgBCABayACKAIAIgFqIQcgACABa0EOaiEGA0AgAUGiwgBqLQAAIAAtAAAiBUEgciAFIAVBwQBrQf8BcUEaSRtB/wFxRw27AiABQQ5GDb4CIAFBAWohASAEIABBAWoiAEcNAAsgAiAHNgIADOECC0HMACEDIAQgASIARg3gAiAEIAFrIAIoAgAiAWohByAAIAFrQQ9qIQYDQCABQcDCAGotAAAgAC0AACIFQSByIAUgBUHBAGtB/wFxQRpJG0H/AXFHDboCQQMgAUEPRg2+AhogAUEBaiEBIAQgAEEBaiIARw0ACyACIAc2AgAM4AILQc0AIQMgBCABIgBGDd8CIAQgAWsgAigCACIBaiEHIAAgAWtBBWohBgNAIAFB0MIAai0AACAALQAAIgVBIHIgBSAFQcEAa0H/AXFBGkkbQf8BcUcNuQJBBCABQQVGDb0CGiABQQFqIQEgBCAAQQFqIgBHDQALIAIgBzYCAAzfAgsgASAERgRAQc4AIQMM3wILAkACQAJAAkAgAS0AACIAQSByIAAgAEHBAGtB/wFxQRpJG0H/AXFB4wBrDhMAvAK8ArwCvAK8ArwCvAK8ArwCvAK8ArwCAbwCvAK8AgIDvAILIAFBAWohAUHBACEDDMgCCyABQQFqIQFBwgAhAwzHAgsgAUEBaiEBQcMAIQMMxgILIAFBAWohAUHEACEDDMUCCyABIARHBEAgAkENNgIIIAIgATYCBEHFACEDDMUCC0HPACEDDN0CCwJAAkAgAS0AAEEKaw4EAZABkAEAkAELIAFBAWohAQtBKCEDDMMCCyABIARGBEBB0QAhAwzcAgsgAS0AAEEgRw0AIAFBAWohASACLQAtQQFxRQ3QAQtBFyEDDMECCyABIARHDcsBQdIAIQMM2QILQdMAIQMgASAERg3YAiACKAIAIgAgBCABa2ohBiABIABrQQFqIQUDQCABLQAAIABB1sIAai0AAEcNxwEgAEEBRg3KASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBjYCAAzYAgsgASAERgRAQdUAIQMM2AILIAEtAABBCkcNwgEgAUEBaiEBDMoBCyABIARGBEBB1gAhAwzXAgsCQAJAIAEtAABBCmsOBADDAcMBAcMBCyABQQFqIQEMygELIAFBAWohAUHKACEDDL0CC0EAIQACQCACKAI4IgNFDQAgAygCPCIDRQ0AIAIgAxEAACEACyAADb8BQc0AIQMMvAILIAItAClBIkYNzwIMiQELIAQgASIFRgRAQdsAIQMM1AILQQAhAEEBIQFBASEGQQAhAwJAAn8CQAJAAkACQAJAAkACQCAFLQAAQTBrDgrFAcQBAAECAwQFBgjDAQtBAgwGC0EDDAULQQQMBAtBBQwDC0EGDAILQQcMAQtBCAshA0EAIQFBACEGDL0BC0EJIQNBASEAQQAhAUEAIQYMvAELIAEgBEYEQEHdACEDDNMCCyABLQAAQS5HDbgBIAFBAWohAQyIAQsgASAERw22AUHfACEDDNECCyABIARHBEAgAkEONgIIIAIgATYCBEHQACEDDLgCC0HgACEDDNACC0HhACEDIAEgBEYNzwIgAigCACIAIAQgAWtqIQUgASAAa0EDaiEGA0AgAS0AACAAQeLCAGotAABHDbEBIABBA0YNswEgAEEBaiEAIAQgAUEBaiIBRw0ACyACIAU2AgAMzwILQeIAIQMgASAERg3OAiACKAIAIgAgBCABa2ohBSABIABrQQJqIQYDQCABLQAAIABB5sIAai0AAEcNsAEgAEECRg2vASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAzOAgtB4wAhAyABIARGDc0CIAIoAgAiACAEIAFraiEFIAEgAGtBA2ohBgNAIAEtAAAgAEHpwgBqLQAARw2vASAAQQNGDa0BIABBAWohACAEIAFBAWoiAUcNAAsgAiAFNgIADM0CCyABIARGBEBB5QAhAwzNAgsgAUEBaiEBQQAhAAJAIAIoAjgiA0UNACADKAIwIgNFDQAgAiADEQAAIQALIAANqgFB1gAhAwyzAgsgASAERwRAA0AgAS0AACIAQSBHBEACQAJAAkAgAEHIAGsOCwABswGzAbMBswGzAbMBswGzAQKzAQsgAUEBaiEBQdIAIQMMtwILIAFBAWohAUHTACEDDLYCCyABQQFqIQFB1AAhAwy1AgsgBCABQQFqIgFHDQALQeQAIQMMzAILQeQAIQMMywILA0AgAS0AAEHwwgBqLQAAIgBBAUcEQCAAQQJrDgOnAaYBpQGkAQsgBCABQQFqIgFHDQALQeYAIQMMygILIAFBAWogASAERw0CGkHnACEDDMkCCwNAIAEtAABB8MQAai0AACIAQQFHBEACQCAAQQJrDgSiAaEBoAEAnwELQdcAIQMMsQILIAQgAUEBaiIBRw0AC0HoACEDDMgCCyABIARGBEBB6QAhAwzIAgsCQCABLQAAIgBBCmsOGrcBmwGbAbQBmwGbAZsBmwGbAZsBmwGbAZsBmwGbAZsBmwGbAZsBmwGbAZsBpAGbAZsBAJkBCyABQQFqCyEBQQYhAwytAgsDQCABLQAAQfDGAGotAABBAUcNfSAEIAFBAWoiAUcNAAtB6gAhAwzFAgsgAUEBaiABIARHDQIaQesAIQMMxAILIAEgBEYEQEHsACEDDMQCCyABQQFqDAELIAEgBEYEQEHtACEDDMMCCyABQQFqCyEBQQQhAwyoAgsgASAERgRAQe4AIQMMwQILAkACQAJAIAEtAABB8MgAai0AAEEBaw4HkAGPAY4BAHwBAo0BCyABQQFqIQEMCwsgAUEBagyTAQtBACEDIAJBADYCHCACQZsSNgIQIAJBBzYCDCACIAFBAWo2AhQMwAILAkADQCABLQAAQfDIAGotAAAiAEEERwRAAkACQCAAQQFrDgeUAZMBkgGNAQAEAY0BC0HaACEDDKoCCyABQQFqIQFB3AAhAwypAgsgBCABQQFqIgFHDQALQe8AIQMMwAILIAFBAWoMkQELIAQgASIARgRAQfAAIQMMvwILIAAtAABBL0cNASAAQQFqIQEMBwsgBCABIgBGBEBB8QAhAwy+AgsgAC0AACIBQS9GBEAgAEEBaiEBQd0AIQMMpQILIAFBCmsiA0EWSw0AIAAhAUEBIAN0QYmAgAJxDfkBC0EAIQMgAkEANgIcIAIgADYCFCACQYwcNgIQIAJBBzYCDAy8AgsgASAERwRAIAFBAWohAUHeACEDDKMCC0HyACEDDLsCCyABIARGBEBB9AAhAwy7AgsCQCABLQAAQfDMAGotAABBAWsOA/cBcwCCAQtB4QAhAwyhAgsgASAERwRAA0AgAS0AAEHwygBqLQAAIgBBA0cEQAJAIABBAWsOAvkBAIUBC0HfACEDDKMCCyAEIAFBAWoiAUcNAAtB8wAhAwy6AgtB8wAhAwy5AgsgASAERwRAIAJBDzYCCCACIAE2AgRB4AAhAwygAgtB9QAhAwy4AgsgASAERgRAQfYAIQMMuAILIAJBDzYCCCACIAE2AgQLQQMhAwydAgsDQCABLQAAQSBHDY4CIAQgAUEBaiIBRw0AC0H3ACEDDLUCCyABIARGBEBB+AAhAwy1AgsgAS0AAEEgRw16IAFBAWohAQxbC0EAIQACQCACKAI4IgNFDQAgAygCOCIDRQ0AIAIgAxEAACEACyAADXgMgAILIAEgBEYEQEH6ACEDDLMCCyABLQAAQcwARw10IAFBAWohAUETDHYLQfsAIQMgASAERg2xAiACKAIAIgAgBCABa2ohBSABIABrQQVqIQYDQCABLQAAIABB8M4Aai0AAEcNcyAAQQVGDXUgAEEBaiEAIAQgAUEBaiIBRw0ACyACIAU2AgAMsQILIAEgBEYEQEH8ACEDDLECCwJAAkAgAS0AAEHDAGsODAB0dHR0dHR0dHR0AXQLIAFBAWohAUHmACEDDJgCCyABQQFqIQFB5wAhAwyXAgtB/QAhAyABIARGDa8CIAIoAgAiACAEIAFraiEFIAEgAGtBAmohBgJAA0AgAS0AACAAQe3PAGotAABHDXIgAEECRg0BIABBAWohACAEIAFBAWoiAUcNAAsgAiAFNgIADLACCyACQQA2AgAgBkEBaiEBQRAMcwtB/gAhAyABIARGDa4CIAIoAgAiACAEIAFraiEFIAEgAGtBBWohBgJAA0AgAS0AACAAQfbOAGotAABHDXEgAEEFRg0BIABBAWohACAEIAFBAWoiAUcNAAsgAiAFNgIADK8CCyACQQA2AgAgBkEBaiEBQRYMcgtB/wAhAyABIARGDa0CIAIoAgAiACAEIAFraiEFIAEgAGtBA2ohBgJAA0AgAS0AACAAQfzOAGotAABHDXAgAEEDRg0BIABBAWohACAEIAFBAWoiAUcNAAsgAiAFNgIADK4CCyACQQA2AgAgBkEBaiEBQQUMcQsgASAERgRAQYABIQMMrQILIAEtAABB2QBHDW4gAUEBaiEBQQgMcAsgASAERgRAQYEBIQMMrAILAkACQCABLQAAQc4Aaw4DAG8BbwsgAUEBaiEBQesAIQMMkwILIAFBAWohAUHsACEDDJICCyABIARGBEBBggEhAwyrAgsCQAJAIAEtAABByABrDggAbm5ubm5uAW4LIAFBAWohAUHqACEDDJICCyABQQFqIQFB7QAhAwyRAgtBgwEhAyABIARGDakCIAIoAgAiACAEIAFraiEFIAEgAGtBAmohBgJAA0AgAS0AACAAQYDPAGotAABHDWwgAEECRg0BIABBAWohACAEIAFBAWoiAUcNAAsgAiAFNgIADKoCCyACQQA2AgAgBkEBaiEBQQAMbQtBhAEhAyABIARGDagCIAIoAgAiACAEIAFraiEFIAEgAGtBBGohBgJAA0AgAS0AACAAQYPPAGotAABHDWsgAEEERg0BIABBAWohACAEIAFBAWoiAUcNAAsgAiAFNgIADKkCCyACQQA2AgAgBkEBaiEBQSMMbAsgASAERgRAQYUBIQMMqAILAkACQCABLQAAQcwAaw4IAGtra2trawFrCyABQQFqIQFB7wAhAwyPAgsgAUEBaiEBQfAAIQMMjgILIAEgBEYEQEGGASEDDKcCCyABLQAAQcUARw1oIAFBAWohAQxgC0GHASEDIAEgBEYNpQIgAigCACIAIAQgAWtqIQUgASAAa0EDaiEGAkADQCABLQAAIABBiM8Aai0AAEcNaCAAQQNGDQEgAEEBaiEAIAQgAUEBaiIBRw0ACyACIAU2AgAMpgILIAJBADYCACAGQQFqIQFBLQxpC0GIASEDIAEgBEYNpAIgAigCACIAIAQgAWtqIQUgASAAa0EIaiEGAkADQCABLQAAIABB0M8Aai0AAEcNZyAAQQhGDQEgAEEBaiEAIAQgAUEBaiIBRw0ACyACIAU2AgAMpQILIAJBADYCACAGQQFqIQFBKQxoCyABIARGBEBBiQEhAwykAgtBASABLQAAQd8ARw1nGiABQQFqIQEMXgtBigEhAyABIARGDaICIAIoAgAiACAEIAFraiEFIAEgAGtBAWohBgNAIAEtAAAgAEGMzwBqLQAARw1kIABBAUYN+gEgAEEBaiEAIAQgAUEBaiIBRw0ACyACIAU2AgAMogILQYsBIQMgASAERg2hAiACKAIAIgAgBCABa2ohBSABIABrQQJqIQYCQANAIAEtAAAgAEGOzwBqLQAARw1kIABBAkYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAyiAgsgAkEANgIAIAZBAWohAUECDGULQYwBIQMgASAERg2gAiACKAIAIgAgBCABa2ohBSABIABrQQFqIQYCQANAIAEtAAAgAEHwzwBqLQAARw1jIABBAUYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAyhAgsgAkEANgIAIAZBAWohAUEfDGQLQY0BIQMgASAERg2fAiACKAIAIgAgBCABa2ohBSABIABrQQFqIQYCQANAIAEtAAAgAEHyzwBqLQAARw1iIABBAUYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAygAgsgAkEANgIAIAZBAWohAUEJDGMLIAEgBEYEQEGOASEDDJ8CCwJAAkAgAS0AAEHJAGsOBwBiYmJiYgFiCyABQQFqIQFB+AAhAwyGAgsgAUEBaiEBQfkAIQMMhQILQY8BIQMgASAERg2dAiACKAIAIgAgBCABa2ohBSABIABrQQVqIQYCQANAIAEtAAAgAEGRzwBqLQAARw1gIABBBUYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAyeAgsgAkEANgIAIAZBAWohAUEYDGELQZABIQMgASAERg2cAiACKAIAIgAgBCABa2ohBSABIABrQQJqIQYCQANAIAEtAAAgAEGXzwBqLQAARw1fIABBAkYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAydAgsgAkEANgIAIAZBAWohAUEXDGALQZEBIQMgASAERg2bAiACKAIAIgAgBCABa2ohBSABIABrQQZqIQYCQANAIAEtAAAgAEGazwBqLQAARw1eIABBBkYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAycAgsgAkEANgIAIAZBAWohAUEVDF8LQZIBIQMgASAERg2aAiACKAIAIgAgBCABa2ohBSABIABrQQVqIQYCQANAIAEtAAAgAEGhzwBqLQAARw1dIABBBUYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAybAgsgAkEANgIAIAZBAWohAUEeDF4LIAEgBEYEQEGTASEDDJoCCyABLQAAQcwARw1bIAFBAWohAUEKDF0LIAEgBEYEQEGUASEDDJkCCwJAAkAgAS0AAEHBAGsODwBcXFxcXFxcXFxcXFxcAVwLIAFBAWohAUH+ACEDDIACCyABQQFqIQFB/wAhAwz/AQsgASAERgRAQZUBIQMMmAILAkACQCABLQAAQcEAaw4DAFsBWwsgAUEBaiEBQf0AIQMM/wELIAFBAWohAUGAASEDDP4BC0GWASEDIAEgBEYNlgIgAigCACIAIAQgAWtqIQUgASAAa0EBaiEGAkADQCABLQAAIABBp88Aai0AAEcNWSAAQQFGDQEgAEEBaiEAIAQgAUEBaiIBRw0ACyACIAU2AgAMlwILIAJBADYCACAGQQFqIQFBCwxaCyABIARGBEBBlwEhAwyWAgsCQAJAAkACQCABLQAAQS1rDiMAW1tbW1tbW1tbW1tbW1tbW1tbW1tbW1sBW1tbW1sCW1tbA1sLIAFBAWohAUH7ACEDDP8BCyABQQFqIQFB/AAhAwz+AQsgAUEBaiEBQYEBIQMM/QELIAFBAWohAUGCASEDDPwBC0GYASEDIAEgBEYNlAIgAigCACIAIAQgAWtqIQUgASAAa0EEaiEGAkADQCABLQAAIABBqc8Aai0AAEcNVyAAQQRGDQEgAEEBaiEAIAQgAUEBaiIBRw0ACyACIAU2AgAMlQILIAJBADYCACAGQQFqIQFBGQxYC0GZASEDIAEgBEYNkwIgAigCACIAIAQgAWtqIQUgASAAa0EFaiEGAkADQCABLQAAIABBrs8Aai0AAEcNViAAQQVGDQEgAEEBaiEAIAQgAUEBaiIBRw0ACyACIAU2AgAMlAILIAJBADYCACAGQQFqIQFBBgxXC0GaASEDIAEgBEYNkgIgAigCACIAIAQgAWtqIQUgASAAa0EBaiEGAkADQCABLQAAIABBtM8Aai0AAEcNVSAAQQFGDQEgAEEBaiEAIAQgAUEBaiIBRw0ACyACIAU2AgAMkwILIAJBADYCACAGQQFqIQFBHAxWC0GbASEDIAEgBEYNkQIgAigCACIAIAQgAWtqIQUgASAAa0EBaiEGAkADQCABLQAAIABBts8Aai0AAEcNVCAAQQFGDQEgAEEBaiEAIAQgAUEBaiIBRw0ACyACIAU2AgAMkgILIAJBADYCACAGQQFqIQFBJwxVCyABIARGBEBBnAEhAwyRAgsCQAJAIAEtAABB1ABrDgIAAVQLIAFBAWohAUGGASEDDPgBCyABQQFqIQFBhwEhAwz3AQtBnQEhAyABIARGDY8CIAIoAgAiACAEIAFraiEFIAEgAGtBAWohBgJAA0AgAS0AACAAQbjPAGotAABHDVIgAEEBRg0BIABBAWohACAEIAFBAWoiAUcNAAsgAiAFNgIADJACCyACQQA2AgAgBkEBaiEBQSYMUwtBngEhAyABIARGDY4CIAIoAgAiACAEIAFraiEFIAEgAGtBAWohBgJAA0AgAS0AACAAQbrPAGotAABHDVEgAEEBRg0BIABBAWohACAEIAFBAWoiAUcNAAsgAiAFNgIADI8CCyACQQA2AgAgBkEBaiEBQQMMUgtBnwEhAyABIARGDY0CIAIoAgAiACAEIAFraiEFIAEgAGtBAmohBgJAA0AgAS0AACAAQe3PAGotAABHDVAgAEECRg0BIABBAWohACAEIAFBAWoiAUcNAAsgAiAFNgIADI4CCyACQQA2AgAgBkEBaiEBQQwMUQtBoAEhAyABIARGDYwCIAIoAgAiACAEIAFraiEFIAEgAGtBA2ohBgJAA0AgAS0AACAAQbzPAGotAABHDU8gAEEDRg0BIABBAWohACAEIAFBAWoiAUcNAAsgAiAFNgIADI0CCyACQQA2AgAgBkEBaiEBQQ0MUAsgASAERgRAQaEBIQMMjAILAkACQCABLQAAQcYAaw4LAE9PT09PT09PTwFPCyABQQFqIQFBiwEhAwzzAQsgAUEBaiEBQYwBIQMM8gELIAEgBEYEQEGiASEDDIsCCyABLQAAQdAARw1MIAFBAWohAQxGCyABIARGBEBBowEhAwyKAgsCQAJAIAEtAABByQBrDgcBTU1NTU0ATQsgAUEBaiEBQY4BIQMM8QELIAFBAWohAUEiDE0LQaQBIQMgASAERg2IAiACKAIAIgAgBCABa2ohBSABIABrQQFqIQYCQANAIAEtAAAgAEHAzwBqLQAARw1LIABBAUYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAyJAgsgAkEANgIAIAZBAWohAUEdDEwLIAEgBEYEQEGlASEDDIgCCwJAAkAgAS0AAEHSAGsOAwBLAUsLIAFBAWohAUGQASEDDO8BCyABQQFqIQFBBAxLCyABIARGBEBBpgEhAwyHAgsCQAJAAkACQAJAIAEtAABBwQBrDhUATU1NTU1NTU1NTQFNTQJNTQNNTQRNCyABQQFqIQFBiAEhAwzxAQsgAUEBaiEBQYkBIQMM8AELIAFBAWohAUGKASEDDO8BCyABQQFqIQFBjwEhAwzuAQsgAUEBaiEBQZEBIQMM7QELQacBIQMgASAERg2FAiACKAIAIgAgBCABa2ohBSABIABrQQJqIQYCQANAIAEtAAAgAEHtzwBqLQAARw1IIABBAkYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAyGAgsgAkEANgIAIAZBAWohAUERDEkLQagBIQMgASAERg2EAiACKAIAIgAgBCABa2ohBSABIABrQQJqIQYCQANAIAEtAAAgAEHCzwBqLQAARw1HIABBAkYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAyFAgsgAkEANgIAIAZBAWohAUEsDEgLQakBIQMgASAERg2DAiACKAIAIgAgBCABa2ohBSABIABrQQRqIQYCQANAIAEtAAAgAEHFzwBqLQAARw1GIABBBEYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAyEAgsgAkEANgIAIAZBAWohAUErDEcLQaoBIQMgASAERg2CAiACKAIAIgAgBCABa2ohBSABIABrQQJqIQYCQANAIAEtAAAgAEHKzwBqLQAARw1FIABBAkYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAyDAgsgAkEANgIAIAZBAWohAUEUDEYLIAEgBEYEQEGrASEDDIICCwJAAkACQAJAIAEtAABBwgBrDg8AAQJHR0dHR0dHR0dHRwNHCyABQQFqIQFBkwEhAwzrAQsgAUEBaiEBQZQBIQMM6gELIAFBAWohAUGVASEDDOkBCyABQQFqIQFBlgEhAwzoAQsgASAERgRAQawBIQMMgQILIAEtAABBxQBHDUIgAUEBaiEBDD0LQa0BIQMgASAERg3/ASACKAIAIgAgBCABa2ohBSABIABrQQJqIQYCQANAIAEtAAAgAEHNzwBqLQAARw1CIABBAkYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAyAAgsgAkEANgIAIAZBAWohAUEODEMLIAEgBEYEQEGuASEDDP8BCyABLQAAQdAARw1AIAFBAWohAUElDEILQa8BIQMgASAERg39ASACKAIAIgAgBCABa2ohBSABIABrQQhqIQYCQANAIAEtAAAgAEHQzwBqLQAARw1AIABBCEYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAz+AQsgAkEANgIAIAZBAWohAUEqDEELIAEgBEYEQEGwASEDDP0BCwJAAkAgAS0AAEHVAGsOCwBAQEBAQEBAQEABQAsgAUEBaiEBQZoBIQMM5AELIAFBAWohAUGbASEDDOMBCyABIARGBEBBsQEhAwz8AQsCQAJAIAEtAABBwQBrDhQAPz8/Pz8/Pz8/Pz8/Pz8/Pz8/AT8LIAFBAWohAUGZASEDDOMBCyABQQFqIQFBnAEhAwziAQtBsgEhAyABIARGDfoBIAIoAgAiACAEIAFraiEFIAEgAGtBA2ohBgJAA0AgAS0AACAAQdnPAGotAABHDT0gAEEDRg0BIABBAWohACAEIAFBAWoiAUcNAAsgAiAFNgIADPsBCyACQQA2AgAgBkEBaiEBQSEMPgtBswEhAyABIARGDfkBIAIoAgAiACAEIAFraiEFIAEgAGtBBmohBgJAA0AgAS0AACAAQd3PAGotAABHDTwgAEEGRg0BIABBAWohACAEIAFBAWoiAUcNAAsgAiAFNgIADPoBCyACQQA2AgAgBkEBaiEBQRoMPQsgASAERgRAQbQBIQMM+QELAkACQAJAIAEtAABBxQBrDhEAPT09PT09PT09AT09PT09Aj0LIAFBAWohAUGdASEDDOEBCyABQQFqIQFBngEhAwzgAQsgAUEBaiEBQZ8BIQMM3wELQbUBIQMgASAERg33ASACKAIAIgAgBCABa2ohBSABIABrQQVqIQYCQANAIAEtAAAgAEHkzwBqLQAARw06IABBBUYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAz4AQsgAkEANgIAIAZBAWohAUEoDDsLQbYBIQMgASAERg32ASACKAIAIgAgBCABa2ohBSABIABrQQJqIQYCQANAIAEtAAAgAEHqzwBqLQAARw05IABBAkYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAz3AQsgAkEANgIAIAZBAWohAUEHDDoLIAEgBEYEQEG3ASEDDPYBCwJAAkAgAS0AAEHFAGsODgA5OTk5OTk5OTk5OTkBOQsgAUEBaiEBQaEBIQMM3QELIAFBAWohAUGiASEDDNwBC0G4ASEDIAEgBEYN9AEgAigCACIAIAQgAWtqIQUgASAAa0ECaiEGAkADQCABLQAAIABB7c8Aai0AAEcNNyAAQQJGDQEgAEEBaiEAIAQgAUEBaiIBRw0ACyACIAU2AgAM9QELIAJBADYCACAGQQFqIQFBEgw4C0G5ASEDIAEgBEYN8wEgAigCACIAIAQgAWtqIQUgASAAa0EBaiEGAkADQCABLQAAIABB8M8Aai0AAEcNNiAAQQFGDQEgAEEBaiEAIAQgAUEBaiIBRw0ACyACIAU2AgAM9AELIAJBADYCACAGQQFqIQFBIAw3C0G6ASEDIAEgBEYN8gEgAigCACIAIAQgAWtqIQUgASAAa0EBaiEGAkADQCABLQAAIABB8s8Aai0AAEcNNSAAQQFGDQEgAEEBaiEAIAQgAUEBaiIBRw0ACyACIAU2AgAM8wELIAJBADYCACAGQQFqIQFBDww2CyABIARGBEBBuwEhAwzyAQsCQAJAIAEtAABByQBrDgcANTU1NTUBNQsgAUEBaiEBQaUBIQMM2QELIAFBAWohAUGmASEDDNgBC0G8ASEDIAEgBEYN8AEgAigCACIAIAQgAWtqIQUgASAAa0EHaiEGAkADQCABLQAAIABB9M8Aai0AAEcNMyAAQQdGDQEgAEEBaiEAIAQgAUEBaiIBRw0ACyACIAU2AgAM8QELIAJBADYCACAGQQFqIQFBGww0CyABIARGBEBBvQEhAwzwAQsCQAJAAkAgAS0AAEHCAGsOEgA0NDQ0NDQ0NDQBNDQ0NDQ0AjQLIAFBAWohAUGkASEDDNgBCyABQQFqIQFBpwEhAwzXAQsgAUEBaiEBQagBIQMM1gELIAEgBEYEQEG+ASEDDO8BCyABLQAAQc4ARw0wIAFBAWohAQwsCyABIARGBEBBvwEhAwzuAQsCQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQCABLQAAQcEAaw4VAAECAz8EBQY/Pz8HCAkKCz8MDQ4PPwsgAUEBaiEBQegAIQMM4wELIAFBAWohAUHpACEDDOIBCyABQQFqIQFB7gAhAwzhAQsgAUEBaiEBQfIAIQMM4AELIAFBAWohAUHzACEDDN8BCyABQQFqIQFB9gAhAwzeAQsgAUEBaiEBQfcAIQMM3QELIAFBAWohAUH6ACEDDNwBCyABQQFqIQFBgwEhAwzbAQsgAUEBaiEBQYQBIQMM2gELIAFBAWohAUGFASEDDNkBCyABQQFqIQFBkgEhAwzYAQsgAUEBaiEBQZgBIQMM1wELIAFBAWohAUGgASEDDNYBCyABQQFqIQFBowEhAwzVAQsgAUEBaiEBQaoBIQMM1AELIAEgBEcEQCACQRA2AgggAiABNgIEQasBIQMM1AELQcABIQMM7AELQQAhAAJAIAIoAjgiA0UNACADKAI0IgNFDQAgAiADEQAAIQALIABFDV4gAEEVRw0HIAJB0QA2AhwgAiABNgIUIAJBsBc2AhAgAkEVNgIMQQAhAwzrAQsgAUEBaiABIARHDQgaQcIBIQMM6gELA0ACQCABLQAAQQprDgQIAAALAAsgBCABQQFqIgFHDQALQcMBIQMM6QELIAEgBEcEQCACQRE2AgggAiABNgIEQQEhAwzQAQtBxAEhAwzoAQsgASAERgRAQcUBIQMM6AELAkACQCABLQAAQQprDgQBKCgAKAsgAUEBagwJCyABQQFqDAULIAEgBEYEQEHGASEDDOcBCwJAAkAgAS0AAEEKaw4XAQsLAQsLCwsLCwsLCwsLCwsLCwsLCwALCyABQQFqIQELQbABIQMMzQELIAEgBEYEQEHIASEDDOYBCyABLQAAQSBHDQkgAkEAOwEyIAFBAWohAUGzASEDDMwBCwNAIAEhAAJAIAEgBEcEQCABLQAAQTBrQf8BcSIDQQpJDQEMJwtBxwEhAwzmAQsCQCACLwEyIgFBmTNLDQAgAiABQQpsIgU7ATIgBUH+/wNxIANB//8Dc0sNACAAQQFqIQEgAiADIAVqIgM7ATIgA0H//wNxQegHSQ0BCwtBACEDIAJBADYCHCACQcEJNgIQIAJBDTYCDCACIABBAWo2AhQM5AELIAJBADYCHCACIAE2AhQgAkHwDDYCECACQRs2AgxBACEDDOMBCyACKAIEIQAgAkEANgIEIAIgACABECYiAA0BIAFBAWoLIQFBrQEhAwzIAQsgAkHBATYCHCACIAA2AgwgAiABQQFqNgIUQQAhAwzgAQsgAigCBCEAIAJBADYCBCACIAAgARAmIgANASABQQFqCyEBQa4BIQMMxQELIAJBwgE2AhwgAiAANgIMIAIgAUEBajYCFEEAIQMM3QELIAJBADYCHCACIAE2AhQgAkGXCzYCECACQQ02AgxBACEDDNwBCyACQQA2AhwgAiABNgIUIAJB4xA2AhAgAkEJNgIMQQAhAwzbAQsgAkECOgAoDKwBC0EAIQMgAkEANgIcIAJBrws2AhAgAkECNgIMIAIgAUEBajYCFAzZAQtBAiEDDL8BC0ENIQMMvgELQSYhAwy9AQtBFSEDDLwBC0EWIQMMuwELQRghAwy6AQtBHCEDDLkBC0EdIQMMuAELQSAhAwy3AQtBISEDDLYBC0EjIQMMtQELQcYAIQMMtAELQS4hAwyzAQtBPSEDDLIBC0HLACEDDLEBC0HOACEDDLABC0HYACEDDK8BC0HZACEDDK4BC0HbACEDDK0BC0HxACEDDKwBC0H0ACEDDKsBC0GNASEDDKoBC0GXASEDDKkBC0GpASEDDKgBC0GvASEDDKcBC0GxASEDDKYBCyACQQA2AgALQQAhAyACQQA2AhwgAiABNgIUIAJB8Rs2AhAgAkEGNgIMDL0BCyACQQA2AgAgBkEBaiEBQSQLOgApIAIoAgQhACACQQA2AgQgAiAAIAEQJyIARQRAQeUAIQMMowELIAJB+QA2AhwgAiABNgIUIAIgADYCDEEAIQMMuwELIABBFUcEQCACQQA2AhwgAiABNgIUIAJBzA42AhAgAkEgNgIMQQAhAwy7AQsgAkH4ADYCHCACIAE2AhQgAkHKGDYCECACQRU2AgxBACEDDLoBCyACQQA2AhwgAiABNgIUIAJBjhs2AhAgAkEGNgIMQQAhAwy5AQsgAkEANgIcIAIgATYCFCACQf4RNgIQIAJBBzYCDEEAIQMMuAELIAJBADYCHCACIAE2AhQgAkGMHDYCECACQQc2AgxBACEDDLcBCyACQQA2AhwgAiABNgIUIAJBww82AhAgAkEHNgIMQQAhAwy2AQsgAkEANgIcIAIgATYCFCACQcMPNgIQIAJBBzYCDEEAIQMMtQELIAIoAgQhACACQQA2AgQgAiAAIAEQJSIARQ0RIAJB5QA2AhwgAiABNgIUIAIgADYCDEEAIQMMtAELIAIoAgQhACACQQA2AgQgAiAAIAEQJSIARQ0gIAJB0wA2AhwgAiABNgIUIAIgADYCDEEAIQMMswELIAIoAgQhACACQQA2AgQgAiAAIAEQJSIARQ0iIAJB0gA2AhwgAiABNgIUIAIgADYCDEEAIQMMsgELIAIoAgQhACACQQA2AgQgAiAAIAEQJSIARQ0OIAJB5QA2AhwgAiABNgIUIAIgADYCDEEAIQMMsQELIAIoAgQhACACQQA2AgQgAiAAIAEQJSIARQ0dIAJB0wA2AhwgAiABNgIUIAIgADYCDEEAIQMMsAELIAIoAgQhACACQQA2AgQgAiAAIAEQJSIARQ0fIAJB0gA2AhwgAiABNgIUIAIgADYCDEEAIQMMrwELIABBP0cNASABQQFqCyEBQQUhAwyUAQtBACEDIAJBADYCHCACIAE2AhQgAkH9EjYCECACQQc2AgwMrAELIAJBADYCHCACIAE2AhQgAkHcCDYCECACQQc2AgxBACEDDKsBCyACKAIEIQAgAkEANgIEIAIgACABECUiAEUNByACQeUANgIcIAIgATYCFCACIAA2AgxBACEDDKoBCyACKAIEIQAgAkEANgIEIAIgACABECUiAEUNFiACQdMANgIcIAIgATYCFCACIAA2AgxBACEDDKkBCyACKAIEIQAgAkEANgIEIAIgACABECUiAEUNGCACQdIANgIcIAIgATYCFCACIAA2AgxBACEDDKgBCyACQQA2AhwgAiABNgIUIAJBxgo2AhAgAkEHNgIMQQAhAwynAQsgAigCBCEAIAJBADYCBCACIAAgARAlIgBFDQMgAkHlADYCHCACIAE2AhQgAiAANgIMQQAhAwymAQsgAigCBCEAIAJBADYCBCACIAAgARAlIgBFDRIgAkHTADYCHCACIAE2AhQgAiAANgIMQQAhAwylAQsgAigCBCEAIAJBADYCBCACIAAgARAlIgBFDRQgAkHSADYCHCACIAE2AhQgAiAANgIMQQAhAwykAQsgAigCBCEAIAJBADYCBCACIAAgARAlIgBFDQAgAkHlADYCHCACIAE2AhQgAiAANgIMQQAhAwyjAQtB1QAhAwyJAQsgAEEVRwRAIAJBADYCHCACIAE2AhQgAkG5DTYCECACQRo2AgxBACEDDKIBCyACQeQANgIcIAIgATYCFCACQeMXNgIQIAJBFTYCDEEAIQMMoQELIAJBADYCACAGQQFqIQEgAi0AKSIAQSNrQQtJDQQCQCAAQQZLDQBBASAAdEHKAHFFDQAMBQtBACEDIAJBADYCHCACIAE2AhQgAkH3CTYCECACQQg2AgwMoAELIAJBADYCACAGQQFqIQEgAi0AKUEhRg0DIAJBADYCHCACIAE2AhQgAkGbCjYCECACQQg2AgxBACEDDJ8BCyACQQA2AgALQQAhAyACQQA2AhwgAiABNgIUIAJBkDM2AhAgAkEINgIMDJ0BCyACQQA2AgAgBkEBaiEBIAItAClBI0kNACACQQA2AhwgAiABNgIUIAJB0wk2AhAgAkEINgIMQQAhAwycAQtB0QAhAwyCAQsgAS0AAEEwayIAQf8BcUEKSQRAIAIgADoAKiABQQFqIQFBzwAhAwyCAQsgAigCBCEAIAJBADYCBCACIAAgARAoIgBFDYYBIAJB3gA2AhwgAiABNgIUIAIgADYCDEEAIQMMmgELIAIoAgQhACACQQA2AgQgAiAAIAEQKCIARQ2GASACQdwANgIcIAIgATYCFCACIAA2AgxBACEDDJkBCyACKAIEIQAgAkEANgIEIAIgACAFECgiAEUEQCAFIQEMhwELIAJB2gA2AhwgAiAFNgIUIAIgADYCDAyYAQtBACEBQQEhAwsgAiADOgArIAVBAWohAwJAAkACQCACLQAtQRBxDQACQAJAAkAgAi0AKg4DAQACBAsgBkUNAwwCCyAADQEMAgsgAUUNAQsgAigCBCEAIAJBADYCBCACIAAgAxAoIgBFBEAgAyEBDAILIAJB2AA2AhwgAiADNgIUIAIgADYCDEEAIQMMmAELIAIoAgQhACACQQA2AgQgAiAAIAMQKCIARQRAIAMhAQyHAQsgAkHZADYCHCACIAM2AhQgAiAANgIMQQAhAwyXAQtBzAAhAwx9CyAAQRVHBEAgAkEANgIcIAIgATYCFCACQZQNNgIQIAJBITYCDEEAIQMMlgELIAJB1wA2AhwgAiABNgIUIAJByRc2AhAgAkEVNgIMQQAhAwyVAQtBACEDIAJBADYCHCACIAE2AhQgAkGAETYCECACQQk2AgwMlAELIAIoAgQhACACQQA2AgQgAiAAIAEQJSIARQ0AIAJB0wA2AhwgAiABNgIUIAIgADYCDEEAIQMMkwELQckAIQMMeQsgAkEANgIcIAIgATYCFCACQcEoNgIQIAJBBzYCDCACQQA2AgBBACEDDJEBCyACKAIEIQBBACEDIAJBADYCBCACIAAgARAlIgBFDQAgAkHSADYCHCACIAE2AhQgAiAANgIMDJABC0HIACEDDHYLIAJBADYCACAFIQELIAJBgBI7ASogAUEBaiEBQQAhAAJAIAIoAjgiA0UNACADKAIwIgNFDQAgAiADEQAAIQALIAANAQtBxwAhAwxzCyAAQRVGBEAgAkHRADYCHCACIAE2AhQgAkHjFzYCECACQRU2AgxBACEDDIwBC0EAIQMgAkEANgIcIAIgATYCFCACQbkNNgIQIAJBGjYCDAyLAQtBACEDIAJBADYCHCACIAE2AhQgAkGgGTYCECACQR42AgwMigELIAEtAABBOkYEQCACKAIEIQBBACEDIAJBADYCBCACIAAgARApIgBFDQEgAkHDADYCHCACIAA2AgwgAiABQQFqNgIUDIoBC0EAIQMgAkEANgIcIAIgATYCFCACQbERNgIQIAJBCjYCDAyJAQsgAUEBaiEBQTshAwxvCyACQcMANgIcIAIgADYCDCACIAFBAWo2AhQMhwELQQAhAyACQQA2AhwgAiABNgIUIAJB8A42AhAgAkEcNgIMDIYBCyACIAIvATBBEHI7ATAMZgsCQCACLwEwIgBBCHFFDQAgAi0AKEEBRw0AIAItAC1BCHFFDQMLIAIgAEH3+wNxQYAEcjsBMAwECyABIARHBEACQANAIAEtAABBMGsiAEH/AXFBCk8EQEE1IQMMbgsgAikDICIKQpmz5syZs+bMGVYNASACIApCCn4iCjcDICAKIACtQv8BgyILQn+FVg0BIAIgCiALfDcDICAEIAFBAWoiAUcNAAtBOSEDDIUBCyACKAIEIQBBACEDIAJBADYCBCACIAAgAUEBaiIBECoiAA0MDHcLQTkhAwyDAQsgAi0AMEEgcQ0GQcUBIQMMaQtBACEDIAJBADYCBCACIAEgARAqIgBFDQQgAkE6NgIcIAIgADYCDCACIAFBAWo2AhQMgQELIAItAChBAUcNACACLQAtQQhxRQ0BC0E3IQMMZgsgAigCBCEAQQAhAyACQQA2AgQgAiAAIAEQKiIABEAgAkE7NgIcIAIgADYCDCACIAFBAWo2AhQMfwsgAUEBaiEBDG4LIAJBCDoALAwECyABQQFqIQEMbQtBACEDIAJBADYCHCACIAE2AhQgAkHkEjYCECACQQQ2AgwMewsgAigCBCEAQQAhAyACQQA2AgQgAiAAIAEQKiIARQ1sIAJBNzYCHCACIAE2AhQgAiAANgIMDHoLIAIgAi8BMEEgcjsBMAtBMCEDDF8LIAJBNjYCHCACIAE2AhQgAiAANgIMDHcLIABBLEcNASABQQFqIQBBASEBAkACQAJAAkACQCACLQAsQQVrDgQDAQIEAAsgACEBDAQLQQIhAQwBC0EEIQELIAJBAToALCACIAIvATAgAXI7ATAgACEBDAELIAIgAi8BMEEIcjsBMCAAIQELQTkhAwxcCyACQQA6ACwLQTQhAwxaCyABIARGBEBBLSEDDHMLAkACQANAAkAgAS0AAEEKaw4EAgAAAwALIAQgAUEBaiIBRw0AC0EtIQMMdAsgAigCBCEAQQAhAyACQQA2AgQgAiAAIAEQKiIARQ0CIAJBLDYCHCACIAE2AhQgAiAANgIMDHMLIAIoAgQhAEEAIQMgAkEANgIEIAIgACABECoiAEUEQCABQQFqIQEMAgsgAkEsNgIcIAIgADYCDCACIAFBAWo2AhQMcgsgAS0AAEENRgRAIAIoAgQhAEEAIQMgAkEANgIEIAIgACABECoiAEUEQCABQQFqIQEMAgsgAkEsNgIcIAIgADYCDCACIAFBAWo2AhQMcgsgAi0ALUEBcQRAQcQBIQMMWQsgAigCBCEAQQAhAyACQQA2AgQgAiAAIAEQKiIADQEMZQtBLyEDDFcLIAJBLjYCHCACIAE2AhQgAiAANgIMDG8LQQAhAyACQQA2AhwgAiABNgIUIAJB8BQ2AhAgAkEDNgIMDG4LQQEhAwJAAkACQAJAIAItACxBBWsOBAMBAgAECyACIAIvATBBCHI7ATAMAwtBAiEDDAELQQQhAwsgAkEBOgAsIAIgAi8BMCADcjsBMAtBKiEDDFMLQQAhAyACQQA2AhwgAiABNgIUIAJB4Q82AhAgAkEKNgIMDGsLQQEhAwJAAkACQAJAAkACQCACLQAsQQJrDgcFBAQDAQIABAsgAiACLwEwQQhyOwEwDAMLQQIhAwwBC0EEIQMLIAJBAToALCACIAIvATAgA3I7ATALQSshAwxSC0EAIQMgAkEANgIcIAIgATYCFCACQasSNgIQIAJBCzYCDAxqC0EAIQMgAkEANgIcIAIgATYCFCACQf0NNgIQIAJBHTYCDAxpCyABIARHBEADQCABLQAAQSBHDUggBCABQQFqIgFHDQALQSUhAwxpC0ElIQMMaAsgAi0ALUEBcQRAQcMBIQMMTwsgAigCBCEAQQAhAyACQQA2AgQgAiAAIAEQKSIABEAgAkEmNgIcIAIgADYCDCACIAFBAWo2AhQMaAsgAUEBaiEBDFwLIAFBAWohASACLwEwIgBBgAFxBEBBACEAAkAgAigCOCIDRQ0AIAMoAlQiA0UNACACIAMRAAAhAAsgAEUNBiAAQRVHDR8gAkEFNgIcIAIgATYCFCACQfkXNgIQIAJBFTYCDEEAIQMMZwsCQCAAQaAEcUGgBEcNACACLQAtQQJxDQBBACEDIAJBADYCHCACIAE2AhQgAkGWEzYCECACQQQ2AgwMZwsgAgJ/IAIvATBBFHFBFEYEQEEBIAItAChBAUYNARogAi8BMkHlAEYMAQsgAi0AKUEFRgs6AC5BACEAAkAgAigCOCIDRQ0AIAMoAiQiA0UNACACIAMRAAAhAAsCQAJAAkACQAJAIAAOFgIBAAQEBAQEBAQEBAQEBAQEBAQEBAMECyACQQE6AC4LIAIgAi8BMEHAAHI7ATALQSchAwxPCyACQSM2AhwgAiABNgIUIAJBpRY2AhAgAkEVNgIMQQAhAwxnC0EAIQMgAkEANgIcIAIgATYCFCACQdULNgIQIAJBETYCDAxmC0EAIQACQCACKAI4IgNFDQAgAygCLCIDRQ0AIAIgAxEAACEACyAADQELQQ4hAwxLCyAAQRVGBEAgAkECNgIcIAIgATYCFCACQbAYNgIQIAJBFTYCDEEAIQMMZAtBACEDIAJBADYCHCACIAE2AhQgAkGnDjYCECACQRI2AgwMYwtBACEDIAJBADYCHCACIAE2AhQgAkGqHDYCECACQQ82AgwMYgsgAigCBCEAQQAhAyACQQA2AgQgAiAAIAEgCqdqIgEQKyIARQ0AIAJBBTYCHCACIAE2AhQgAiAANgIMDGELQQ8hAwxHC0EAIQMgAkEANgIcIAIgATYCFCACQc0TNgIQIAJBDDYCDAxfC0IBIQoLIAFBAWohAQJAIAIpAyAiC0L//////////w9YBEAgAiALQgSGIAqENwMgDAELQQAhAyACQQA2AhwgAiABNgIUIAJBrQk2AhAgAkEMNgIMDF4LQSQhAwxEC0EAIQMgAkEANgIcIAIgATYCFCACQc0TNgIQIAJBDDYCDAxcCyACKAIEIQBBACEDIAJBADYCBCACIAAgARAsIgBFBEAgAUEBaiEBDFILIAJBFzYCHCACIAA2AgwgAiABQQFqNgIUDFsLIAIoAgQhAEEAIQMgAkEANgIEAkAgAiAAIAEQLCIARQRAIAFBAWohAQwBCyACQRY2AhwgAiAANgIMIAIgAUEBajYCFAxbC0EfIQMMQQtBACEDIAJBADYCHCACIAE2AhQgAkGaDzYCECACQSI2AgwMWQsgAigCBCEAQQAhAyACQQA2AgQgAiAAIAEQLSIARQRAIAFBAWohAQxQCyACQRQ2AhwgAiAANgIMIAIgAUEBajYCFAxYCyACKAIEIQBBACEDIAJBADYCBAJAIAIgACABEC0iAEUEQCABQQFqIQEMAQsgAkETNgIcIAIgADYCDCACIAFBAWo2AhQMWAtBHiEDDD4LQQAhAyACQQA2AhwgAiABNgIUIAJBxgw2AhAgAkEjNgIMDFYLIAIoAgQhAEEAIQMgAkEANgIEIAIgACABEC0iAEUEQCABQQFqIQEMTgsgAkERNgIcIAIgADYCDCACIAFBAWo2AhQMVQsgAkEQNgIcIAIgATYCFCACIAA2AgwMVAtBACEDIAJBADYCHCACIAE2AhQgAkHGDDYCECACQSM2AgwMUwtBACEDIAJBADYCHCACIAE2AhQgAkHAFTYCECACQQI2AgwMUgsgAigCBCEAQQAhAyACQQA2AgQCQCACIAAgARAtIgBFBEAgAUEBaiEBDAELIAJBDjYCHCACIAA2AgwgAiABQQFqNgIUDFILQRshAww4C0EAIQMgAkEANgIcIAIgATYCFCACQcYMNgIQIAJBIzYCDAxQCyACKAIEIQBBACEDIAJBADYCBAJAIAIgACABECwiAEUEQCABQQFqIQEMAQsgAkENNgIcIAIgADYCDCACIAFBAWo2AhQMUAtBGiEDDDYLQQAhAyACQQA2AhwgAiABNgIUIAJBmg82AhAgAkEiNgIMDE4LIAIoAgQhAEEAIQMgAkEANgIEAkAgAiAAIAEQLCIARQRAIAFBAWohAQwBCyACQQw2AhwgAiAANgIMIAIgAUEBajYCFAxOC0EZIQMMNAtBACEDIAJBADYCHCACIAE2AhQgAkGaDzYCECACQSI2AgwMTAsgAEEVRwRAQQAhAyACQQA2AhwgAiABNgIUIAJBgww2AhAgAkETNgIMDEwLIAJBCjYCHCACIAE2AhQgAkHkFjYCECACQRU2AgxBACEDDEsLIAIoAgQhAEEAIQMgAkEANgIEIAIgACABIAqnaiIBECsiAARAIAJBBzYCHCACIAE2AhQgAiAANgIMDEsLQRMhAwwxCyAAQRVHBEBBACEDIAJBADYCHCACIAE2AhQgAkHaDTYCECACQRQ2AgwMSgsgAkEeNgIcIAIgATYCFCACQfkXNgIQIAJBFTYCDEEAIQMMSQtBACEAAkAgAigCOCIDRQ0AIAMoAiwiA0UNACACIAMRAAAhAAsgAEUNQSAAQRVGBEAgAkEDNgIcIAIgATYCFCACQbAYNgIQIAJBFTYCDEEAIQMMSQtBACEDIAJBADYCHCACIAE2AhQgAkGnDjYCECACQRI2AgwMSAtBACEDIAJBADYCHCACIAE2AhQgAkHaDTYCECACQRQ2AgwMRwtBACEDIAJBADYCHCACIAE2AhQgAkGnDjYCECACQRI2AgwMRgsgAkEAOgAvIAItAC1BBHFFDT8LIAJBADoALyACQQE6ADRBACEDDCsLQQAhAyACQQA2AhwgAkHkETYCECACQQc2AgwgAiABQQFqNgIUDEMLAkADQAJAIAEtAABBCmsOBAACAgACCyAEIAFBAWoiAUcNAAtB3QEhAwxDCwJAAkAgAi0ANEEBRw0AQQAhAAJAIAIoAjgiA0UNACADKAJYIgNFDQAgAiADEQAAIQALIABFDQAgAEEVRw0BIAJB3AE2AhwgAiABNgIUIAJB1RY2AhAgAkEVNgIMQQAhAwxEC0HBASEDDCoLIAJBADYCHCACIAE2AhQgAkHpCzYCECACQR82AgxBACEDDEILAkACQCACLQAoQQFrDgIEAQALQcABIQMMKQtBuQEhAwwoCyACQQI6AC9BACEAAkAgAigCOCIDRQ0AIAMoAgAiA0UNACACIAMRAAAhAAsgAEUEQEHCASEDDCgLIABBFUcEQCACQQA2AhwgAiABNgIUIAJBpAw2AhAgAkEQNgIMQQAhAwxBCyACQdsBNgIcIAIgATYCFCACQfoWNgIQIAJBFTYCDEEAIQMMQAsgASAERgRAQdoBIQMMQAsgAS0AAEHIAEYNASACQQE6ACgLQawBIQMMJQtBvwEhAwwkCyABIARHBEAgAkEQNgIIIAIgATYCBEG+ASEDDCQLQdkBIQMMPAsgASAERgRAQdgBIQMMPAsgAS0AAEHIAEcNBCABQQFqIQFBvQEhAwwiCyABIARGBEBB1wEhAww7CwJAAkAgAS0AAEHFAGsOEAAFBQUFBQUFBQUFBQUFBQEFCyABQQFqIQFBuwEhAwwiCyABQQFqIQFBvAEhAwwhC0HWASEDIAEgBEYNOSACKAIAIgAgBCABa2ohBSABIABrQQJqIQYCQANAIAEtAAAgAEGD0ABqLQAARw0DIABBAkYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAw6CyACKAIEIQAgAkIANwMAIAIgACAGQQFqIgEQJyIARQRAQcYBIQMMIQsgAkHVATYCHCACIAE2AhQgAiAANgIMQQAhAww5C0HUASEDIAEgBEYNOCACKAIAIgAgBCABa2ohBSABIABrQQFqIQYCQANAIAEtAAAgAEGB0ABqLQAARw0CIABBAUYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAw5CyACQYEEOwEoIAIoAgQhACACQgA3AwAgAiAAIAZBAWoiARAnIgANAwwCCyACQQA2AgALQQAhAyACQQA2AhwgAiABNgIUIAJB2Bs2AhAgAkEINgIMDDYLQboBIQMMHAsgAkHTATYCHCACIAE2AhQgAiAANgIMQQAhAww0C0EAIQACQCACKAI4IgNFDQAgAygCOCIDRQ0AIAIgAxEAACEACyAARQ0AIABBFUYNASACQQA2AhwgAiABNgIUIAJBzA42AhAgAkEgNgIMQQAhAwwzC0HkACEDDBkLIAJB+AA2AhwgAiABNgIUIAJByhg2AhAgAkEVNgIMQQAhAwwxC0HSASEDIAQgASIARg0wIAQgAWsgAigCACIBaiEFIAAgAWtBBGohBgJAA0AgAC0AACABQfzPAGotAABHDQEgAUEERg0DIAFBAWohASAEIABBAWoiAEcNAAsgAiAFNgIADDELIAJBADYCHCACIAA2AhQgAkGQMzYCECACQQg2AgwgAkEANgIAQQAhAwwwCyABIARHBEAgAkEONgIIIAIgATYCBEG3ASEDDBcLQdEBIQMMLwsgAkEANgIAIAZBAWohAQtBuAEhAwwUCyABIARGBEBB0AEhAwwtCyABLQAAQTBrIgBB/wFxQQpJBEAgAiAAOgAqIAFBAWohAUG2ASEDDBQLIAIoAgQhACACQQA2AgQgAiAAIAEQKCIARQ0UIAJBzwE2AhwgAiABNgIUIAIgADYCDEEAIQMMLAsgASAERgRAQc4BIQMMLAsCQCABLQAAQS5GBEAgAUEBaiEBDAELIAIoAgQhACACQQA2AgQgAiAAIAEQKCIARQ0VIAJBzQE2AhwgAiABNgIUIAIgADYCDEEAIQMMLAtBtQEhAwwSCyAEIAEiBUYEQEHMASEDDCsLQQAhAEEBIQFBASEGQQAhAwJAAkACQAJAAkACfwJAAkACQAJAAkACQAJAIAUtAABBMGsOCgoJAAECAwQFBggLC0ECDAYLQQMMBQtBBAwEC0EFDAMLQQYMAgtBBwwBC0EICyEDQQAhAUEAIQYMAgtBCSEDQQEhAEEAIQFBACEGDAELQQAhAUEBIQMLIAIgAzoAKyAFQQFqIQMCQAJAIAItAC1BEHENAAJAAkACQCACLQAqDgMBAAIECyAGRQ0DDAILIAANAQwCCyABRQ0BCyACKAIEIQAgAkEANgIEIAIgACADECgiAEUEQCADIQEMAwsgAkHJATYCHCACIAM2AhQgAiAANgIMQQAhAwwtCyACKAIEIQAgAkEANgIEIAIgACADECgiAEUEQCADIQEMGAsgAkHKATYCHCACIAM2AhQgAiAANgIMQQAhAwwsCyACKAIEIQAgAkEANgIEIAIgACAFECgiAEUEQCAFIQEMFgsgAkHLATYCHCACIAU2AhQgAiAANgIMDCsLQbQBIQMMEQtBACEAAkAgAigCOCIDRQ0AIAMoAjwiA0UNACACIAMRAAAhAAsCQCAABEAgAEEVRg0BIAJBADYCHCACIAE2AhQgAkGUDTYCECACQSE2AgxBACEDDCsLQbIBIQMMEQsgAkHIATYCHCACIAE2AhQgAkHJFzYCECACQRU2AgxBACEDDCkLIAJBADYCACAGQQFqIQFB9QAhAwwPCyACLQApQQVGBEBB4wAhAwwPC0HiACEDDA4LIAAhASACQQA2AgALIAJBADoALEEJIQMMDAsgAkEANgIAIAdBAWohAUHAACEDDAsLQQELOgAsIAJBADYCACAGQQFqIQELQSkhAwwIC0E4IQMMBwsCQCABIARHBEADQCABLQAAQYA+ai0AACIAQQFHBEAgAEECRw0DIAFBAWohAQwFCyAEIAFBAWoiAUcNAAtBPiEDDCELQT4hAwwgCwsgAkEAOgAsDAELQQshAwwEC0E6IQMMAwsgAUEBaiEBQS0hAwwCCyACIAE6ACwgAkEANgIAIAZBAWohAUEMIQMMAQsgAkEANgIAIAZBAWohAUEKIQMMAAsAC0EAIQMgAkEANgIcIAIgATYCFCACQc0QNgIQIAJBCTYCDAwXC0EAIQMgAkEANgIcIAIgATYCFCACQekKNgIQIAJBCTYCDAwWC0EAIQMgAkEANgIcIAIgATYCFCACQbcQNgIQIAJBCTYCDAwVC0EAIQMgAkEANgIcIAIgATYCFCACQZwRNgIQIAJBCTYCDAwUC0EAIQMgAkEANgIcIAIgATYCFCACQc0QNgIQIAJBCTYCDAwTC0EAIQMgAkEANgIcIAIgATYCFCACQekKNgIQIAJBCTYCDAwSC0EAIQMgAkEANgIcIAIgATYCFCACQbcQNgIQIAJBCTYCDAwRC0EAIQMgAkEANgIcIAIgATYCFCACQZwRNgIQIAJBCTYCDAwQC0EAIQMgAkEANgIcIAIgATYCFCACQZcVNgIQIAJBDzYCDAwPC0EAIQMgAkEANgIcIAIgATYCFCACQZcVNgIQIAJBDzYCDAwOC0EAIQMgAkEANgIcIAIgATYCFCACQcASNgIQIAJBCzYCDAwNC0EAIQMgAkEANgIcIAIgATYCFCACQZUJNgIQIAJBCzYCDAwMC0EAIQMgAkEANgIcIAIgATYCFCACQeEPNgIQIAJBCjYCDAwLC0EAIQMgAkEANgIcIAIgATYCFCACQfsPNgIQIAJBCjYCDAwKC0EAIQMgAkEANgIcIAIgATYCFCACQfEZNgIQIAJBAjYCDAwJC0EAIQMgAkEANgIcIAIgATYCFCACQcQUNgIQIAJBAjYCDAwIC0EAIQMgAkEANgIcIAIgATYCFCACQfIVNgIQIAJBAjYCDAwHCyACQQI2AhwgAiABNgIUIAJBnBo2AhAgAkEWNgIMQQAhAwwGC0EBIQMMBQtB1AAhAyABIARGDQQgCEEIaiEJIAIoAgAhBQJAAkAgASAERwRAIAVB2MIAaiEHIAQgBWogAWshACAFQX9zQQpqIgUgAWohBgNAIAEtAAAgBy0AAEcEQEECIQcMAwsgBUUEQEEAIQcgBiEBDAMLIAVBAWshBSAHQQFqIQcgBCABQQFqIgFHDQALIAAhBSAEIQELIAlBATYCACACIAU2AgAMAQsgAkEANgIAIAkgBzYCAAsgCSABNgIEIAgoAgwhACAIKAIIDgMBBAIACwALIAJBADYCHCACQbUaNgIQIAJBFzYCDCACIABBAWo2AhRBACEDDAILIAJBADYCHCACIAA2AhQgAkHKGjYCECACQQk2AgxBACEDDAELIAEgBEYEQEEiIQMMAQsgAkEJNgIIIAIgATYCBEEhIQMLIAhBEGokACADRQRAIAIoAgwhAAwBCyACIAM2AhxBACEAIAIoAgQiAUUNACACIAEgBCACKAIIEQEAIgFFDQAgAiAENgIUIAIgATYCDCABIQALIAALvgIBAn8gAEEAOgAAIABB3ABqIgFBAWtBADoAACAAQQA6AAIgAEEAOgABIAFBA2tBADoAACABQQJrQQA6AAAgAEEAOgADIAFBBGtBADoAAEEAIABrQQNxIgEgAGoiAEEANgIAQdwAIAFrQXxxIgIgAGoiAUEEa0EANgIAAkAgAkEJSQ0AIABBADYCCCAAQQA2AgQgAUEIa0EANgIAIAFBDGtBADYCACACQRlJDQAgAEEANgIYIABBADYCFCAAQQA2AhAgAEEANgIMIAFBEGtBADYCACABQRRrQQA2AgAgAUEYa0EANgIAIAFBHGtBADYCACACIABBBHFBGHIiAmsiAUEgSQ0AIAAgAmohAANAIABCADcDGCAAQgA3AxAgAEIANwMIIABCADcDACAAQSBqIQAgAUEgayIBQR9LDQALCwtWAQF/AkAgACgCDA0AAkACQAJAAkAgAC0ALw4DAQADAgsgACgCOCIBRQ0AIAEoAiwiAUUNACAAIAERAAAiAQ0DC0EADwsACyAAQcMWNgIQQQ4hAQsgAQsaACAAKAIMRQRAIABB0Rs2AhAgAEEVNgIMCwsUACAAKAIMQRVGBEAgAEEANgIMCwsUACAAKAIMQRZGBEAgAEEANgIMCwsHACAAKAIMCwcAIAAoAhALCQAgACABNgIQCwcAIAAoAhQLFwAgAEEkTwRAAAsgAEECdEGgM2ooAgALFwAgAEEuTwRAAAsgAEECdEGwNGooAgALvwkBAX9B6yghAQJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAIABB5ABrDvQDY2IAAWFhYWFhYQIDBAVhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhBgcICQoLDA0OD2FhYWFhEGFhYWFhYWFhYWFhEWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYRITFBUWFxgZGhthYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhHB0eHyAhIiMkJSYnKCkqKywtLi8wMTIzNDU2YTc4OTphYWFhYWFhYTthYWE8YWFhYT0+P2FhYWFhYWFhQGFhQWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYUJDREVGR0hJSktMTU5PUFFSU2FhYWFhYWFhVFVWV1hZWlthXF1hYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFeYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhX2BhC0HhJw8LQaQhDwtByywPC0H+MQ8LQcAkDwtBqyQPC0GNKA8LQeImDwtBgDAPC0G5Lw8LQdckDwtB7x8PC0HhHw8LQfofDwtB8iAPC0GoLw8LQa4yDwtBiDAPC0HsJw8LQYIiDwtBjh0PC0HQLg8LQcojDwtBxTIPC0HfHA8LQdIcDwtBxCAPC0HXIA8LQaIfDwtB7S4PC0GrMA8LQdQlDwtBzC4PC0H6Lg8LQfwrDwtB0jAPC0HxHQ8LQbsgDwtB9ysPC0GQMQ8LQdcxDwtBoi0PC0HUJw8LQeArDwtBnywPC0HrMQ8LQdUfDwtByjEPC0HeJQ8LQdQeDwtB9BwPC0GnMg8LQbEdDwtBoB0PC0G5MQ8LQbwwDwtBkiEPC0GzJg8LQeksDwtBrB4PC0HUKw8LQfcmDwtBgCYPC0GwIQ8LQf4eDwtBjSMPC0GJLQ8LQfciDwtBoDEPC0GuHw8LQcYlDwtB6B4PC0GTIg8LQcIvDwtBwx0PC0GLLA8LQeEdDwtBjS8PC0HqIQ8LQbQtDwtB0i8PC0HfMg8LQdIyDwtB8DAPC0GpIg8LQfkjDwtBmR4PC0G1LA8LQZswDwtBkjIPC0G2Kw8LQcIiDwtB+DIPC0GeJQ8LQdAiDwtBuh4PC0GBHg8LAAtB1iEhAQsgAQsWACAAIAAtAC1B/gFxIAFBAEdyOgAtCxkAIAAgAC0ALUH9AXEgAUEAR0EBdHI6AC0LGQAgACAALQAtQfsBcSABQQBHQQJ0cjoALQsZACAAIAAtAC1B9wFxIAFBAEdBA3RyOgAtCz4BAn8CQCAAKAI4IgNFDQAgAygCBCIDRQ0AIAAgASACIAFrIAMRAQAiBEF/Rw0AIABBxhE2AhBBGCEECyAECz4BAn8CQCAAKAI4IgNFDQAgAygCCCIDRQ0AIAAgASACIAFrIAMRAQAiBEF/Rw0AIABB9go2AhBBGCEECyAECz4BAn8CQCAAKAI4IgNFDQAgAygCDCIDRQ0AIAAgASACIAFrIAMRAQAiBEF/Rw0AIABB7Ro2AhBBGCEECyAECz4BAn8CQCAAKAI4IgNFDQAgAygCECIDRQ0AIAAgASACIAFrIAMRAQAiBEF/Rw0AIABBlRA2AhBBGCEECyAECz4BAn8CQCAAKAI4IgNFDQAgAygCFCIDRQ0AIAAgASACIAFrIAMRAQAiBEF/Rw0AIABBqhs2AhBBGCEECyAECz4BAn8CQCAAKAI4IgNFDQAgAygCGCIDRQ0AIAAgASACIAFrIAMRAQAiBEF/Rw0AIABB7RM2AhBBGCEECyAECz4BAn8CQCAAKAI4IgNFDQAgAygCKCIDRQ0AIAAgASACIAFrIAMRAQAiBEF/Rw0AIABB9gg2AhBBGCEECyAECz4BAn8CQCAAKAI4IgNFDQAgAygCHCIDRQ0AIAAgASACIAFrIAMRAQAiBEF/Rw0AIABBwhk2AhBBGCEECyAECz4BAn8CQCAAKAI4IgNFDQAgAygCICIDRQ0AIAAgASACIAFrIAMRAQAiBEF/Rw0AIABBlBQ2AhBBGCEECyAEC1kBAn8CQCAALQAoQQFGDQAgAC8BMiIBQeQAa0HkAEkNACABQcwBRg0AIAFBsAJGDQAgAC8BMCIAQcAAcQ0AQQEhAiAAQYgEcUGABEYNACAAQShxRSECCyACC4wBAQJ/AkACQAJAIAAtACpFDQAgAC0AK0UNACAALwEwIgFBAnFFDQEMAgsgAC8BMCIBQQFxRQ0BC0EBIQIgAC0AKEEBRg0AIAAvATIiAEHkAGtB5ABJDQAgAEHMAUYNACAAQbACRg0AIAFBwABxDQBBACECIAFBiARxQYAERg0AIAFBKHFBAEchAgsgAgtXACAAQRhqQgA3AwAgAEIANwMAIABBOGpCADcDACAAQTBqQgA3AwAgAEEoakIANwMAIABBIGpCADcDACAAQRBqQgA3AwAgAEEIakIANwMAIABB3QE2AhwLBgAgABAyC5otAQt/IwBBEGsiCiQAQaTQACgCACIJRQRAQeTTACgCACIFRQRAQfDTAEJ/NwIAQejTAEKAgISAgIDAADcCAEHk0wAgCkEIakFwcUHYqtWqBXMiBTYCAEH40wBBADYCAEHI0wBBADYCAAtBzNMAQYDUBDYCAEGc0ABBgNQENgIAQbDQACAFNgIAQazQAEF/NgIAQdDTAEGArAM2AgADQCABQcjQAGogAUG80ABqIgI2AgAgAiABQbTQAGoiAzYCACABQcDQAGogAzYCACABQdDQAGogAUHE0ABqIgM2AgAgAyACNgIAIAFB2NAAaiABQczQAGoiAjYCACACIAM2AgAgAUHU0ABqIAI2AgAgAUEgaiIBQYACRw0AC0GM1ARBwasDNgIAQajQAEH00wAoAgA2AgBBmNAAQcCrAzYCAEGk0ABBiNQENgIAQcz/B0E4NgIAQYjUBCEJCwJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAIABB7AFNBEBBjNAAKAIAIgZBECAAQRNqQXBxIABBC0kbIgRBA3YiAHYiAUEDcQRAAkAgAUEBcSAAckEBcyICQQN0IgBBtNAAaiIBIABBvNAAaigCACIAKAIIIgNGBEBBjNAAIAZBfiACd3E2AgAMAQsgASADNgIIIAMgATYCDAsgAEEIaiEBIAAgAkEDdCICQQNyNgIEIAAgAmoiACAAKAIEQQFyNgIEDBELQZTQACgCACIIIARPDQEgAQRAAkBBAiAAdCICQQAgAmtyIAEgAHRxaCIAQQN0IgJBtNAAaiIBIAJBvNAAaigCACICKAIIIgNGBEBBjNAAIAZBfiAAd3EiBjYCAAwBCyABIAM2AgggAyABNgIMCyACIARBA3I2AgQgAEEDdCIAIARrIQUgACACaiAFNgIAIAIgBGoiBCAFQQFyNgIEIAgEQCAIQXhxQbTQAGohAEGg0AAoAgAhAwJ/QQEgCEEDdnQiASAGcUUEQEGM0AAgASAGcjYCACAADAELIAAoAggLIgEgAzYCDCAAIAM2AgggAyAANgIMIAMgATYCCAsgAkEIaiEBQaDQACAENgIAQZTQACAFNgIADBELQZDQACgCACILRQ0BIAtoQQJ0QbzSAGooAgAiACgCBEF4cSAEayEFIAAhAgNAAkAgAigCECIBRQRAIAJBFGooAgAiAUUNAQsgASgCBEF4cSAEayIDIAVJIQIgAyAFIAIbIQUgASAAIAIbIQAgASECDAELCyAAKAIYIQkgACgCDCIDIABHBEBBnNAAKAIAGiADIAAoAggiATYCCCABIAM2AgwMEAsgAEEUaiICKAIAIgFFBEAgACgCECIBRQ0DIABBEGohAgsDQCACIQcgASIDQRRqIgIoAgAiAQ0AIANBEGohAiADKAIQIgENAAsgB0EANgIADA8LQX8hBCAAQb9/Sw0AIABBE2oiAUFwcSEEQZDQACgCACIIRQ0AQQAgBGshBQJAAkACQAJ/QQAgBEGAAkkNABpBHyAEQf///wdLDQAaIARBJiABQQh2ZyIAa3ZBAXEgAEEBdGtBPmoLIgZBAnRBvNIAaigCACICRQRAQQAhAUEAIQMMAQtBACEBIARBGSAGQQF2a0EAIAZBH0cbdCEAQQAhAwNAAkAgAigCBEF4cSAEayIHIAVPDQAgAiEDIAciBQ0AQQAhBSACIQEMAwsgASACQRRqKAIAIgcgByACIABBHXZBBHFqQRBqKAIAIgJGGyABIAcbIQEgAEEBdCEAIAINAAsLIAEgA3JFBEBBACEDQQIgBnQiAEEAIABrciAIcSIARQ0DIABoQQJ0QbzSAGooAgAhAQsgAUUNAQsDQCABKAIEQXhxIARrIgIgBUkhACACIAUgABshBSABIAMgABshAyABKAIQIgAEfyAABSABQRRqKAIACyIBDQALCyADRQ0AIAVBlNAAKAIAIARrTw0AIAMoAhghByADIAMoAgwiAEcEQEGc0AAoAgAaIAAgAygCCCIBNgIIIAEgADYCDAwOCyADQRRqIgIoAgAiAUUEQCADKAIQIgFFDQMgA0EQaiECCwNAIAIhBiABIgBBFGoiAigCACIBDQAgAEEQaiECIAAoAhAiAQ0ACyAGQQA2AgAMDQtBlNAAKAIAIgMgBE8EQEGg0AAoAgAhAQJAIAMgBGsiAkEQTwRAIAEgBGoiACACQQFyNgIEIAEgA2ogAjYCACABIARBA3I2AgQMAQsgASADQQNyNgIEIAEgA2oiACAAKAIEQQFyNgIEQQAhAEEAIQILQZTQACACNgIAQaDQACAANgIAIAFBCGohAQwPC0GY0AAoAgAiAyAESwRAIAQgCWoiACADIARrIgFBAXI2AgRBpNAAIAA2AgBBmNAAIAE2AgAgCSAEQQNyNgIEIAlBCGohAQwPC0EAIQEgBAJ/QeTTACgCAARAQezTACgCAAwBC0Hw0wBCfzcCAEHo0wBCgICEgICAwAA3AgBB5NMAIApBDGpBcHFB2KrVqgVzNgIAQfjTAEEANgIAQcjTAEEANgIAQYCABAsiACAEQccAaiIFaiIGQQAgAGsiB3EiAk8EQEH80wBBMDYCAAwPCwJAQcTTACgCACIBRQ0AQbzTACgCACIIIAJqIQAgACABTSAAIAhLcQ0AQQAhAUH80wBBMDYCAAwPC0HI0wAtAABBBHENBAJAAkAgCQRAQczTACEBA0AgASgCACIAIAlNBEAgACABKAIEaiAJSw0DCyABKAIIIgENAAsLQQAQMyIAQX9GDQUgAiEGQejTACgCACIBQQFrIgMgAHEEQCACIABrIAAgA2pBACABa3FqIQYLIAQgBk8NBSAGQf7///8HSw0FQcTTACgCACIDBEBBvNMAKAIAIgcgBmohASABIAdNDQYgASADSw0GCyAGEDMiASAARw0BDAcLIAYgA2sgB3EiBkH+////B0sNBCAGEDMhACAAIAEoAgAgASgCBGpGDQMgACEBCwJAIAYgBEHIAGpPDQAgAUF/Rg0AQezTACgCACIAIAUgBmtqQQAgAGtxIgBB/v///wdLBEAgASEADAcLIAAQM0F/RwRAIAAgBmohBiABIQAMBwtBACAGaxAzGgwECyABIgBBf0cNBQwDC0EAIQMMDAtBACEADAoLIABBf0cNAgtByNMAQcjTACgCAEEEcjYCAAsgAkH+////B0sNASACEDMhAEEAEDMhASAAQX9GDQEgAUF/Rg0BIAAgAU8NASABIABrIgYgBEE4ak0NAQtBvNMAQbzTACgCACAGaiIBNgIAQcDTACgCACABSQRAQcDTACABNgIACwJAAkACQEGk0AAoAgAiAgRAQczTACEBA0AgACABKAIAIgMgASgCBCIFakYNAiABKAIIIgENAAsMAgtBnNAAKAIAIgFBAEcgACABT3FFBEBBnNAAIAA2AgALQQAhAUHQ0wAgBjYCAEHM0wAgADYCAEGs0ABBfzYCAEGw0ABB5NMAKAIANgIAQdjTAEEANgIAA0AgAUHI0ABqIAFBvNAAaiICNgIAIAIgAUG00ABqIgM2AgAgAUHA0ABqIAM2AgAgAUHQ0ABqIAFBxNAAaiIDNgIAIAMgAjYCACABQdjQAGogAUHM0ABqIgI2AgAgAiADNgIAIAFB1NAAaiACNgIAIAFBIGoiAUGAAkcNAAtBeCAAa0EPcSIBIABqIgIgBkE4ayIDIAFrIgFBAXI2AgRBqNAAQfTTACgCADYCAEGY0AAgATYCAEGk0AAgAjYCACAAIANqQTg2AgQMAgsgACACTQ0AIAIgA0kNACABKAIMQQhxDQBBeCACa0EPcSIAIAJqIgNBmNAAKAIAIAZqIgcgAGsiAEEBcjYCBCABIAUgBmo2AgRBqNAAQfTTACgCADYCAEGY0AAgADYCAEGk0AAgAzYCACACIAdqQTg2AgQMAQsgAEGc0AAoAgBJBEBBnNAAIAA2AgALIAAgBmohA0HM0wAhAQJAAkACQANAIAMgASgCAEcEQCABKAIIIgENAQwCCwsgAS0ADEEIcUUNAQtBzNMAIQEDQCABKAIAIgMgAk0EQCADIAEoAgRqIgUgAksNAwsgASgCCCEBDAALAAsgASAANgIAIAEgASgCBCAGajYCBCAAQXggAGtBD3FqIgkgBEEDcjYCBCADQXggA2tBD3FqIgYgBCAJaiIEayEBIAIgBkYEQEGk0AAgBDYCAEGY0ABBmNAAKAIAIAFqIgA2AgAgBCAAQQFyNgIEDAgLQaDQACgCACAGRgRAQaDQACAENgIAQZTQAEGU0AAoAgAgAWoiADYCACAEIABBAXI2AgQgACAEaiAANgIADAgLIAYoAgQiBUEDcUEBRw0GIAVBeHEhCCAFQf8BTQRAIAVBA3YhAyAGKAIIIgAgBigCDCICRgRAQYzQAEGM0AAoAgBBfiADd3E2AgAMBwsgAiAANgIIIAAgAjYCDAwGCyAGKAIYIQcgBiAGKAIMIgBHBEAgACAGKAIIIgI2AgggAiAANgIMDAULIAZBFGoiAigCACIFRQRAIAYoAhAiBUUNBCAGQRBqIQILA0AgAiEDIAUiAEEUaiICKAIAIgUNACAAQRBqIQIgACgCECIFDQALIANBADYCAAwEC0F4IABrQQ9xIgEgAGoiByAGQThrIgMgAWsiAUEBcjYCBCAAIANqQTg2AgQgAiAFQTcgBWtBD3FqQT9rIgMgAyACQRBqSRsiA0EjNgIEQajQAEH00wAoAgA2AgBBmNAAIAE2AgBBpNAAIAc2AgAgA0EQakHU0wApAgA3AgAgA0HM0wApAgA3AghB1NMAIANBCGo2AgBB0NMAIAY2AgBBzNMAIAA2AgBB2NMAQQA2AgAgA0EkaiEBA0AgAUEHNgIAIAUgAUEEaiIBSw0ACyACIANGDQAgAyADKAIEQX5xNgIEIAMgAyACayIFNgIAIAIgBUEBcjYCBCAFQf8BTQRAIAVBeHFBtNAAaiEAAn9BjNAAKAIAIgFBASAFQQN2dCIDcUUEQEGM0AAgASADcjYCACAADAELIAAoAggLIgEgAjYCDCAAIAI2AgggAiAANgIMIAIgATYCCAwBC0EfIQEgBUH///8HTQRAIAVBJiAFQQh2ZyIAa3ZBAXEgAEEBdGtBPmohAQsgAiABNgIcIAJCADcCECABQQJ0QbzSAGohAEGQ0AAoAgAiA0EBIAF0IgZxRQRAIAAgAjYCAEGQ0AAgAyAGcjYCACACIAA2AhggAiACNgIIIAIgAjYCDAwBCyAFQRkgAUEBdmtBACABQR9HG3QhASAAKAIAIQMCQANAIAMiACgCBEF4cSAFRg0BIAFBHXYhAyABQQF0IQEgACADQQRxakEQaiIGKAIAIgMNAAsgBiACNgIAIAIgADYCGCACIAI2AgwgAiACNgIIDAELIAAoAggiASACNgIMIAAgAjYCCCACQQA2AhggAiAANgIMIAIgATYCCAtBmNAAKAIAIgEgBE0NAEGk0AAoAgAiACAEaiICIAEgBGsiAUEBcjYCBEGY0AAgATYCAEGk0AAgAjYCACAAIARBA3I2AgQgAEEIaiEBDAgLQQAhAUH80wBBMDYCAAwHC0EAIQALIAdFDQACQCAGKAIcIgJBAnRBvNIAaiIDKAIAIAZGBEAgAyAANgIAIAANAUGQ0ABBkNAAKAIAQX4gAndxNgIADAILIAdBEEEUIAcoAhAgBkYbaiAANgIAIABFDQELIAAgBzYCGCAGKAIQIgIEQCAAIAI2AhAgAiAANgIYCyAGQRRqKAIAIgJFDQAgAEEUaiACNgIAIAIgADYCGAsgASAIaiEBIAYgCGoiBigCBCEFCyAGIAVBfnE2AgQgASAEaiABNgIAIAQgAUEBcjYCBCABQf8BTQRAIAFBeHFBtNAAaiEAAn9BjNAAKAIAIgJBASABQQN2dCIBcUUEQEGM0AAgASACcjYCACAADAELIAAoAggLIgEgBDYCDCAAIAQ2AgggBCAANgIMIAQgATYCCAwBC0EfIQUgAUH///8HTQRAIAFBJiABQQh2ZyIAa3ZBAXEgAEEBdGtBPmohBQsgBCAFNgIcIARCADcCECAFQQJ0QbzSAGohAEGQ0AAoAgAiAkEBIAV0IgNxRQRAIAAgBDYCAEGQ0AAgAiADcjYCACAEIAA2AhggBCAENgIIIAQgBDYCDAwBCyABQRkgBUEBdmtBACAFQR9HG3QhBSAAKAIAIQACQANAIAAiAigCBEF4cSABRg0BIAVBHXYhACAFQQF0IQUgAiAAQQRxakEQaiIDKAIAIgANAAsgAyAENgIAIAQgAjYCGCAEIAQ2AgwgBCAENgIIDAELIAIoAggiACAENgIMIAIgBDYCCCAEQQA2AhggBCACNgIMIAQgADYCCAsgCUEIaiEBDAILAkAgB0UNAAJAIAMoAhwiAUECdEG80gBqIgIoAgAgA0YEQCACIAA2AgAgAA0BQZDQACAIQX4gAXdxIgg2AgAMAgsgB0EQQRQgBygCECADRhtqIAA2AgAgAEUNAQsgACAHNgIYIAMoAhAiAQRAIAAgATYCECABIAA2AhgLIANBFGooAgAiAUUNACAAQRRqIAE2AgAgASAANgIYCwJAIAVBD00EQCADIAQgBWoiAEEDcjYCBCAAIANqIgAgACgCBEEBcjYCBAwBCyADIARqIgIgBUEBcjYCBCADIARBA3I2AgQgAiAFaiAFNgIAIAVB/wFNBEAgBUF4cUG00ABqIQACf0GM0AAoAgAiAUEBIAVBA3Z0IgVxRQRAQYzQACABIAVyNgIAIAAMAQsgACgCCAsiASACNgIMIAAgAjYCCCACIAA2AgwgAiABNgIIDAELQR8hASAFQf///wdNBEAgBUEmIAVBCHZnIgBrdkEBcSAAQQF0a0E+aiEBCyACIAE2AhwgAkIANwIQIAFBAnRBvNIAaiEAQQEgAXQiBCAIcUUEQCAAIAI2AgBBkNAAIAQgCHI2AgAgAiAANgIYIAIgAjYCCCACIAI2AgwMAQsgBUEZIAFBAXZrQQAgAUEfRxt0IQEgACgCACEEAkADQCAEIgAoAgRBeHEgBUYNASABQR12IQQgAUEBdCEBIAAgBEEEcWpBEGoiBigCACIEDQALIAYgAjYCACACIAA2AhggAiACNgIMIAIgAjYCCAwBCyAAKAIIIgEgAjYCDCAAIAI2AgggAkEANgIYIAIgADYCDCACIAE2AggLIANBCGohAQwBCwJAIAlFDQACQCAAKAIcIgFBAnRBvNIAaiICKAIAIABGBEAgAiADNgIAIAMNAUGQ0AAgC0F+IAF3cTYCAAwCCyAJQRBBFCAJKAIQIABGG2ogAzYCACADRQ0BCyADIAk2AhggACgCECIBBEAgAyABNgIQIAEgAzYCGAsgAEEUaigCACIBRQ0AIANBFGogATYCACABIAM2AhgLAkAgBUEPTQRAIAAgBCAFaiIBQQNyNgIEIAAgAWoiASABKAIEQQFyNgIEDAELIAAgBGoiByAFQQFyNgIEIAAgBEEDcjYCBCAFIAdqIAU2AgAgCARAIAhBeHFBtNAAaiEBQaDQACgCACEDAn9BASAIQQN2dCICIAZxRQRAQYzQACACIAZyNgIAIAEMAQsgASgCCAsiAiADNgIMIAEgAzYCCCADIAE2AgwgAyACNgIIC0Gg0AAgBzYCAEGU0AAgBTYCAAsgAEEIaiEBCyAKQRBqJAAgAQtDACAARQRAPwBBEHQPCwJAIABB//8DcQ0AIABBAEgNACAAQRB2QAAiAEF/RgRAQfzTAEEwNgIAQX8PCyAAQRB0DwsACwvcPyIAQYAICwkBAAAAAgAAAAMAQZQICwUEAAAABQBBpAgLCQYAAAAHAAAACABB3AgLii1JbnZhbGlkIGNoYXIgaW4gdXJsIHF1ZXJ5AFNwYW4gY2FsbGJhY2sgZXJyb3IgaW4gb25fYm9keQBDb250ZW50LUxlbmd0aCBvdmVyZmxvdwBDaHVuayBzaXplIG92ZXJmbG93AFJlc3BvbnNlIG92ZXJmbG93AEludmFsaWQgbWV0aG9kIGZvciBIVFRQL3gueCByZXF1ZXN0AEludmFsaWQgbWV0aG9kIGZvciBSVFNQL3gueCByZXF1ZXN0AEV4cGVjdGVkIFNPVVJDRSBtZXRob2QgZm9yIElDRS94LnggcmVxdWVzdABJbnZhbGlkIGNoYXIgaW4gdXJsIGZyYWdtZW50IHN0YXJ0AEV4cGVjdGVkIGRvdABTcGFuIGNhbGxiYWNrIGVycm9yIGluIG9uX3N0YXR1cwBJbnZhbGlkIHJlc3BvbnNlIHN0YXR1cwBJbnZhbGlkIGNoYXJhY3RlciBpbiBjaHVuayBleHRlbnNpb25zAFVzZXIgY2FsbGJhY2sgZXJyb3IAYG9uX3Jlc2V0YCBjYWxsYmFjayBlcnJvcgBgb25fY2h1bmtfaGVhZGVyYCBjYWxsYmFjayBlcnJvcgBgb25fbWVzc2FnZV9iZWdpbmAgY2FsbGJhY2sgZXJyb3IAYG9uX2NodW5rX2V4dGVuc2lvbl92YWx1ZWAgY2FsbGJhY2sgZXJyb3IAYG9uX3N0YXR1c19jb21wbGV0ZWAgY2FsbGJhY2sgZXJyb3IAYG9uX3ZlcnNpb25fY29tcGxldGVgIGNhbGxiYWNrIGVycm9yAGBvbl91cmxfY29tcGxldGVgIGNhbGxiYWNrIGVycm9yAGBvbl9jaHVua19jb21wbGV0ZWAgY2FsbGJhY2sgZXJyb3IAYG9uX2hlYWRlcl92YWx1ZV9jb21wbGV0ZWAgY2FsbGJhY2sgZXJyb3IAYG9uX21lc3NhZ2VfY29tcGxldGVgIGNhbGxiYWNrIGVycm9yAGBvbl9tZXRob2RfY29tcGxldGVgIGNhbGxiYWNrIGVycm9yAGBvbl9oZWFkZXJfZmllbGRfY29tcGxldGVgIGNhbGxiYWNrIGVycm9yAGBvbl9jaHVua19leHRlbnNpb25fbmFtZWAgY2FsbGJhY2sgZXJyb3IAVW5leHBlY3RlZCBjaGFyIGluIHVybCBzZXJ2ZXIASW52YWxpZCBoZWFkZXIgdmFsdWUgY2hhcgBJbnZhbGlkIGhlYWRlciBmaWVsZCBjaGFyAFNwYW4gY2FsbGJhY2sgZXJyb3IgaW4gb25fdmVyc2lvbgBJbnZhbGlkIG1pbm9yIHZlcnNpb24ASW52YWxpZCBtYWpvciB2ZXJzaW9uAEV4cGVjdGVkIHNwYWNlIGFmdGVyIHZlcnNpb24ARXhwZWN0ZWQgQ1JMRiBhZnRlciB2ZXJzaW9uAEludmFsaWQgSFRUUCB2ZXJzaW9uAEludmFsaWQgaGVhZGVyIHRva2VuAFNwYW4gY2FsbGJhY2sgZXJyb3IgaW4gb25fdXJsAEludmFsaWQgY2hhcmFjdGVycyBpbiB1cmwAVW5leHBlY3RlZCBzdGFydCBjaGFyIGluIHVybABEb3VibGUgQCBpbiB1cmwARW1wdHkgQ29udGVudC1MZW5ndGgASW52YWxpZCBjaGFyYWN0ZXIgaW4gQ29udGVudC1MZW5ndGgARHVwbGljYXRlIENvbnRlbnQtTGVuZ3RoAEludmFsaWQgY2hhciBpbiB1cmwgcGF0aABDb250ZW50LUxlbmd0aCBjYW4ndCBiZSBwcmVzZW50IHdpdGggVHJhbnNmZXItRW5jb2RpbmcASW52YWxpZCBjaGFyYWN0ZXIgaW4gY2h1bmsgc2l6ZQBTcGFuIGNhbGxiYWNrIGVycm9yIGluIG9uX2hlYWRlcl92YWx1ZQBTcGFuIGNhbGxiYWNrIGVycm9yIGluIG9uX2NodW5rX2V4dGVuc2lvbl92YWx1ZQBJbnZhbGlkIGNoYXJhY3RlciBpbiBjaHVuayBleHRlbnNpb25zIHZhbHVlAE1pc3NpbmcgZXhwZWN0ZWQgTEYgYWZ0ZXIgaGVhZGVyIHZhbHVlAEludmFsaWQgYFRyYW5zZmVyLUVuY29kaW5nYCBoZWFkZXIgdmFsdWUASW52YWxpZCBjaGFyYWN0ZXIgaW4gY2h1bmsgZXh0ZW5zaW9ucyBxdW90ZSB2YWx1ZQBJbnZhbGlkIGNoYXJhY3RlciBpbiBjaHVuayBleHRlbnNpb25zIHF1b3RlZCB2YWx1ZQBQYXVzZWQgYnkgb25faGVhZGVyc19jb21wbGV0ZQBJbnZhbGlkIEVPRiBzdGF0ZQBvbl9yZXNldCBwYXVzZQBvbl9jaHVua19oZWFkZXIgcGF1c2UAb25fbWVzc2FnZV9iZWdpbiBwYXVzZQBvbl9jaHVua19leHRlbnNpb25fdmFsdWUgcGF1c2UAb25fc3RhdHVzX2NvbXBsZXRlIHBhdXNlAG9uX3ZlcnNpb25fY29tcGxldGUgcGF1c2UAb25fdXJsX2NvbXBsZXRlIHBhdXNlAG9uX2NodW5rX2NvbXBsZXRlIHBhdXNlAG9uX2hlYWRlcl92YWx1ZV9jb21wbGV0ZSBwYXVzZQBvbl9tZXNzYWdlX2NvbXBsZXRlIHBhdXNlAG9uX21ldGhvZF9jb21wbGV0ZSBwYXVzZQBvbl9oZWFkZXJfZmllbGRfY29tcGxldGUgcGF1c2UAb25fY2h1bmtfZXh0ZW5zaW9uX25hbWUgcGF1c2UAVW5leHBlY3RlZCBzcGFjZSBhZnRlciBzdGFydCBsaW5lAFNwYW4gY2FsbGJhY2sgZXJyb3IgaW4gb25fY2h1bmtfZXh0ZW5zaW9uX25hbWUASW52YWxpZCBjaGFyYWN0ZXIgaW4gY2h1bmsgZXh0ZW5zaW9ucyBuYW1lAFBhdXNlIG9uIENPTk5FQ1QvVXBncmFkZQBQYXVzZSBvbiBQUkkvVXBncmFkZQBFeHBlY3RlZCBIVFRQLzIgQ29ubmVjdGlvbiBQcmVmYWNlAFNwYW4gY2FsbGJhY2sgZXJyb3IgaW4gb25fbWV0aG9kAEV4cGVjdGVkIHNwYWNlIGFmdGVyIG1ldGhvZABTcGFuIGNhbGxiYWNrIGVycm9yIGluIG9uX2hlYWRlcl9maWVsZABQYXVzZWQASW52YWxpZCB3b3JkIGVuY291bnRlcmVkAEludmFsaWQgbWV0aG9kIGVuY291bnRlcmVkAFVuZXhwZWN0ZWQgY2hhciBpbiB1cmwgc2NoZW1hAFJlcXVlc3QgaGFzIGludmFsaWQgYFRyYW5zZmVyLUVuY29kaW5nYABTV0lUQ0hfUFJPWFkAVVNFX1BST1hZAE1LQUNUSVZJVFkAVU5QUk9DRVNTQUJMRV9FTlRJVFkAQ09QWQBNT1ZFRF9QRVJNQU5FTlRMWQBUT09fRUFSTFkATk9USUZZAEZBSUxFRF9ERVBFTkRFTkNZAEJBRF9HQVRFV0FZAFBMQVkAUFVUAENIRUNLT1VUAEdBVEVXQVlfVElNRU9VVABSRVFVRVNUX1RJTUVPVVQATkVUV09SS19DT05ORUNUX1RJTUVPVVQAQ09OTkVDVElPTl9USU1FT1VUAExPR0lOX1RJTUVPVVQATkVUV09SS19SRUFEX1RJTUVPVVQAUE9TVABNSVNESVJFQ1RFRF9SRVFVRVNUAENMSUVOVF9DTE9TRURfUkVRVUVTVABDTElFTlRfQ0xPU0VEX0xPQURfQkFMQU5DRURfUkVRVUVTVABCQURfUkVRVUVTVABIVFRQX1JFUVVFU1RfU0VOVF9UT19IVFRQU19QT1JUAFJFUE9SVABJTV9BX1RFQVBPVABSRVNFVF9DT05URU5UAE5PX0NPTlRFTlQAUEFSVElBTF9DT05URU5UAEhQRV9JTlZBTElEX0NPTlNUQU5UAEhQRV9DQl9SRVNFVABHRVQASFBFX1NUUklDVABDT05GTElDVABURU1QT1JBUllfUkVESVJFQ1QAUEVSTUFORU5UX1JFRElSRUNUAENPTk5FQ1QATVVMVElfU1RBVFVTAEhQRV9JTlZBTElEX1NUQVRVUwBUT09fTUFOWV9SRVFVRVNUUwBFQVJMWV9ISU5UUwBVTkFWQUlMQUJMRV9GT1JfTEVHQUxfUkVBU09OUwBPUFRJT05TAFNXSVRDSElOR19QUk9UT0NPTFMAVkFSSUFOVF9BTFNPX05FR09USUFURVMATVVMVElQTEVfQ0hPSUNFUwBJTlRFUk5BTF9TRVJWRVJfRVJST1IAV0VCX1NFUlZFUl9VTktOT1dOX0VSUk9SAFJBSUxHVU5fRVJST1IASURFTlRJVFlfUFJPVklERVJfQVVUSEVOVElDQVRJT05fRVJST1IAU1NMX0NFUlRJRklDQVRFX0VSUk9SAElOVkFMSURfWF9GT1JXQVJERURfRk9SAFNFVF9QQVJBTUVURVIAR0VUX1BBUkFNRVRFUgBIUEVfVVNFUgBTRUVfT1RIRVIASFBFX0NCX0NIVU5LX0hFQURFUgBNS0NBTEVOREFSAFNFVFVQAFdFQl9TRVJWRVJfSVNfRE9XTgBURUFSRE9XTgBIUEVfQ0xPU0VEX0NPTk5FQ1RJT04ASEVVUklTVElDX0VYUElSQVRJT04ARElTQ09OTkVDVEVEX09QRVJBVElPTgBOT05fQVVUSE9SSVRBVElWRV9JTkZPUk1BVElPTgBIUEVfSU5WQUxJRF9WRVJTSU9OAEhQRV9DQl9NRVNTQUdFX0JFR0lOAFNJVEVfSVNfRlJPWkVOAEhQRV9JTlZBTElEX0hFQURFUl9UT0tFTgBJTlZBTElEX1RPS0VOAEZPUkJJRERFTgBFTkhBTkNFX1lPVVJfQ0FMTQBIUEVfSU5WQUxJRF9VUkwAQkxPQ0tFRF9CWV9QQVJFTlRBTF9DT05UUk9MAE1LQ09MAEFDTABIUEVfSU5URVJOQUwAUkVRVUVTVF9IRUFERVJfRklFTERTX1RPT19MQVJHRV9VTk9GRklDSUFMAEhQRV9PSwBVTkxJTksAVU5MT0NLAFBSSQBSRVRSWV9XSVRIAEhQRV9JTlZBTElEX0NPTlRFTlRfTEVOR1RIAEhQRV9VTkVYUEVDVEVEX0NPTlRFTlRfTEVOR1RIAEZMVVNIAFBST1BQQVRDSABNLVNFQVJDSABVUklfVE9PX0xPTkcAUFJPQ0VTU0lORwBNSVNDRUxMQU5FT1VTX1BFUlNJU1RFTlRfV0FSTklORwBNSVNDRUxMQU5FT1VTX1dBUk5JTkcASFBFX0lOVkFMSURfVFJBTlNGRVJfRU5DT0RJTkcARXhwZWN0ZWQgQ1JMRgBIUEVfSU5WQUxJRF9DSFVOS19TSVpFAE1PVkUAQ09OVElOVUUASFBFX0NCX1NUQVRVU19DT01QTEVURQBIUEVfQ0JfSEVBREVSU19DT01QTEVURQBIUEVfQ0JfVkVSU0lPTl9DT01QTEVURQBIUEVfQ0JfVVJMX0NPTVBMRVRFAEhQRV9DQl9DSFVOS19DT01QTEVURQBIUEVfQ0JfSEVBREVSX1ZBTFVFX0NPTVBMRVRFAEhQRV9DQl9DSFVOS19FWFRFTlNJT05fVkFMVUVfQ09NUExFVEUASFBFX0NCX0NIVU5LX0VYVEVOU0lPTl9OQU1FX0NPTVBMRVRFAEhQRV9DQl9NRVNTQUdFX0NPTVBMRVRFAEhQRV9DQl9NRVRIT0RfQ09NUExFVEUASFBFX0NCX0hFQURFUl9GSUVMRF9DT01QTEVURQBERUxFVEUASFBFX0lOVkFMSURfRU9GX1NUQVRFAElOVkFMSURfU1NMX0NFUlRJRklDQVRFAFBBVVNFAE5PX1JFU1BPTlNFAFVOU1VQUE9SVEVEX01FRElBX1RZUEUAR09ORQBOT1RfQUNDRVBUQUJMRQBTRVJWSUNFX1VOQVZBSUxBQkxFAFJBTkdFX05PVF9TQVRJU0ZJQUJMRQBPUklHSU5fSVNfVU5SRUFDSEFCTEUAUkVTUE9OU0VfSVNfU1RBTEUAUFVSR0UATUVSR0UAUkVRVUVTVF9IRUFERVJfRklFTERTX1RPT19MQVJHRQBSRVFVRVNUX0hFQURFUl9UT09fTEFSR0UAUEFZTE9BRF9UT09fTEFSR0UASU5TVUZGSUNJRU5UX1NUT1JBR0UASFBFX1BBVVNFRF9VUEdSQURFAEhQRV9QQVVTRURfSDJfVVBHUkFERQBTT1VSQ0UAQU5OT1VOQ0UAVFJBQ0UASFBFX1VORVhQRUNURURfU1BBQ0UAREVTQ1JJQkUAVU5TVUJTQ1JJQkUAUkVDT1JEAEhQRV9JTlZBTElEX01FVEhPRABOT1RfRk9VTkQAUFJPUEZJTkQAVU5CSU5EAFJFQklORABVTkFVVEhPUklaRUQATUVUSE9EX05PVF9BTExPV0VEAEhUVFBfVkVSU0lPTl9OT1RfU1VQUE9SVEVEAEFMUkVBRFlfUkVQT1JURUQAQUNDRVBURUQATk9UX0lNUExFTUVOVEVEAExPT1BfREVURUNURUQASFBFX0NSX0VYUEVDVEVEAEhQRV9MRl9FWFBFQ1RFRABDUkVBVEVEAElNX1VTRUQASFBFX1BBVVNFRABUSU1FT1VUX09DQ1VSRUQAUEFZTUVOVF9SRVFVSVJFRABQUkVDT05ESVRJT05fUkVRVUlSRUQAUFJPWFlfQVVUSEVOVElDQVRJT05fUkVRVUlSRUQATkVUV09SS19BVVRIRU5USUNBVElPTl9SRVFVSVJFRABMRU5HVEhfUkVRVUlSRUQAU1NMX0NFUlRJRklDQVRFX1JFUVVJUkVEAFVQR1JBREVfUkVRVUlSRUQAUEFHRV9FWFBJUkVEAFBSRUNPTkRJVElPTl9GQUlMRUQARVhQRUNUQVRJT05fRkFJTEVEAFJFVkFMSURBVElPTl9GQUlMRUQAU1NMX0hBTkRTSEFLRV9GQUlMRUQATE9DS0VEAFRSQU5TRk9STUFUSU9OX0FQUExJRUQATk9UX01PRElGSUVEAE5PVF9FWFRFTkRFRABCQU5EV0lEVEhfTElNSVRfRVhDRUVERUQAU0lURV9JU19PVkVSTE9BREVEAEhFQUQARXhwZWN0ZWQgSFRUUC8AAF4TAAAmEwAAMBAAAPAXAACdEwAAFRIAADkXAADwEgAAChAAAHUSAACtEgAAghMAAE8UAAB/EAAAoBUAACMUAACJEgAAixQAAE0VAADUEQAAzxQAABAYAADJFgAA3BYAAMERAADgFwAAuxQAAHQUAAB8FQAA5RQAAAgXAAAfEAAAZRUAAKMUAAAoFQAAAhUAAJkVAAAsEAAAixkAAE8PAADUDgAAahAAAM4QAAACFwAAiQ4AAG4TAAAcEwAAZhQAAFYXAADBEwAAzRMAAGwTAABoFwAAZhcAAF8XAAAiEwAAzg8AAGkOAADYDgAAYxYAAMsTAACqDgAAKBcAACYXAADFEwAAXRYAAOgRAABnEwAAZRMAAPIWAABzEwAAHRcAAPkWAADzEQAAzw4AAM4VAAAMEgAAsxEAAKURAABhEAAAMhcAALsTAEH5NQsBAQBBkDYL4AEBAQIBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEAAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQBB/TcLAQEAQZE4C14CAwICAgICAAACAgACAgACAgICAgICAgICAAQAAAAAAAICAgICAgICAgICAgICAgICAgICAgICAgICAAAAAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAAgACAEH9OQsBAQBBkToLXgIAAgICAgIAAAICAAICAAICAgICAgICAgIAAwAEAAAAAgICAgICAgICAgICAgICAgICAgICAgICAgIAAAACAgICAgICAgICAgICAgICAgICAgICAgICAgICAgACAAIAQfA7Cw1sb3NlZWVwLWFsaXZlAEGJPAsBAQBBoDwL4AEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQABAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQBBiT4LAQEAQaA+C+cBAQEBAQEBAQEBAQEBAgEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEAAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQFjaHVua2VkAEGwwAALXwEBAAEBAQEBAAABAQABAQABAQEBAQEBAQEBAAAAAAAAAAEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAAAAAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEAAQABAEGQwgALIWVjdGlvbmVudC1sZW5ndGhvbnJveHktY29ubmVjdGlvbgBBwMIACy1yYW5zZmVyLWVuY29kaW5ncGdyYWRlDQoNCg0KU00NCg0KVFRQL0NFL1RTUC8AQfnCAAsFAQIAAQMAQZDDAAvgAQQBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAAEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAEH5xAALBQECAAEDAEGQxQAL4AEEAQEFAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQABAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQBB+cYACwQBAAABAEGRxwAL3wEBAQABAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEAAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAAEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAEH6yAALBAEAAAIAQZDJAAtfAwQAAAQEBAQEBAQEBAQEBQQEBAQEBAQEBAQEBAAEAAYHBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEAAQABAAEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAAAAAQAQfrKAAsEAQAAAQBBkMsACwEBAEGqywALQQIAAAAAAAADAwMDAwMDAwMDAwMDAwMDAwMDAwMDAwMDAwAAAAAAAAMDAwMDAwMDAwMDAwMDAwMDAwMDAwMDAwMDAEH6zAALBAEAAAEAQZDNAAsBAQBBms0ACwYCAAAAAAIAQbHNAAs6AwMDAwMDAwMDAwMDAwMDAwMDAwMDAwMDAwMAAAAAAAADAwMDAwMDAwMDAwMDAwMDAwMDAwMDAwMDAwBB8M4AC5YBTk9VTkNFRUNLT1VUTkVDVEVURUNSSUJFTFVTSEVURUFEU0VBUkNIUkdFQ1RJVklUWUxFTkRBUlZFT1RJRllQVElPTlNDSFNFQVlTVEFUQ0hHRU9SRElSRUNUT1JUUkNIUEFSQU1FVEVSVVJDRUJTQ1JJQkVBUkRPV05BQ0VJTkROS0NLVUJTQ1JJQkVIVFRQL0FEVFAv", "base64"); + } +}); + +// node_modules/undici/lib/llhttp/llhttp_simd-wasm.js +var require_llhttp_simd_wasm2 = __commonJS({ + "node_modules/undici/lib/llhttp/llhttp_simd-wasm.js"(exports2, module2) { + "use strict"; + var { Buffer: Buffer2 } = require("node:buffer"); + module2.exports = Buffer2.from("AGFzbQEAAAABJwdgAX8Bf2ADf39/AX9gAX8AYAJ/fwBgBH9/f38Bf2AAAGADf39/AALLAQgDZW52GHdhc21fb25faGVhZGVyc19jb21wbGV0ZQAEA2VudhV3YXNtX29uX21lc3NhZ2VfYmVnaW4AAANlbnYLd2FzbV9vbl91cmwAAQNlbnYOd2FzbV9vbl9zdGF0dXMAAQNlbnYUd2FzbV9vbl9oZWFkZXJfZmllbGQAAQNlbnYUd2FzbV9vbl9oZWFkZXJfdmFsdWUAAQNlbnYMd2FzbV9vbl9ib2R5AAEDZW52GHdhc21fb25fbWVzc2FnZV9jb21wbGV0ZQAAAy0sBQYAAAIAAAAAAAACAQIAAgICAAADAAAAAAMDAwMBAQEBAQEBAQEAAAIAAAAEBQFwARISBQMBAAIGCAF/AUGA1AQLB9EFIgZtZW1vcnkCAAtfaW5pdGlhbGl6ZQAIGV9faW5kaXJlY3RfZnVuY3Rpb25fdGFibGUBAAtsbGh0dHBfaW5pdAAJGGxsaHR0cF9zaG91bGRfa2VlcF9hbGl2ZQAvDGxsaHR0cF9hbGxvYwALBm1hbGxvYwAxC2xsaHR0cF9mcmVlAAwEZnJlZQAMD2xsaHR0cF9nZXRfdHlwZQANFWxsaHR0cF9nZXRfaHR0cF9tYWpvcgAOFWxsaHR0cF9nZXRfaHR0cF9taW5vcgAPEWxsaHR0cF9nZXRfbWV0aG9kABAWbGxodHRwX2dldF9zdGF0dXNfY29kZQAREmxsaHR0cF9nZXRfdXBncmFkZQASDGxsaHR0cF9yZXNldAATDmxsaHR0cF9leGVjdXRlABQUbGxodHRwX3NldHRpbmdzX2luaXQAFQ1sbGh0dHBfZmluaXNoABYMbGxodHRwX3BhdXNlABcNbGxodHRwX3Jlc3VtZQAYG2xsaHR0cF9yZXN1bWVfYWZ0ZXJfdXBncmFkZQAZEGxsaHR0cF9nZXRfZXJybm8AGhdsbGh0dHBfZ2V0X2Vycm9yX3JlYXNvbgAbF2xsaHR0cF9zZXRfZXJyb3JfcmVhc29uABwUbGxodHRwX2dldF9lcnJvcl9wb3MAHRFsbGh0dHBfZXJybm9fbmFtZQAeEmxsaHR0cF9tZXRob2RfbmFtZQAfEmxsaHR0cF9zdGF0dXNfbmFtZQAgGmxsaHR0cF9zZXRfbGVuaWVudF9oZWFkZXJzACEhbGxodHRwX3NldF9sZW5pZW50X2NodW5rZWRfbGVuZ3RoACIdbGxodHRwX3NldF9sZW5pZW50X2tlZXBfYWxpdmUAIyRsbGh0dHBfc2V0X2xlbmllbnRfdHJhbnNmZXJfZW5jb2RpbmcAJBhsbGh0dHBfbWVzc2FnZV9uZWVkc19lb2YALgkXAQBBAQsRAQIDBAUKBgcrLSwqKSglJyYK77MCLBYAQYjQACgCAARAAAtBiNAAQQE2AgALFAAgABAwIAAgAjYCOCAAIAE6ACgLFAAgACAALwEyIAAtAC4gABAvEAALHgEBf0HAABAyIgEQMCABQYAINgI4IAEgADoAKCABC48MAQd/AkAgAEUNACAAQQhrIgEgAEEEaygCACIAQXhxIgRqIQUCQCAAQQFxDQAgAEEDcUUNASABIAEoAgAiAGsiAUGc0AAoAgBJDQEgACAEaiEEAkACQEGg0AAoAgAgAUcEQCAAQf8BTQRAIABBA3YhAyABKAIIIgAgASgCDCICRgRAQYzQAEGM0AAoAgBBfiADd3E2AgAMBQsgAiAANgIIIAAgAjYCDAwECyABKAIYIQYgASABKAIMIgBHBEAgACABKAIIIgI2AgggAiAANgIMDAMLIAFBFGoiAygCACICRQRAIAEoAhAiAkUNAiABQRBqIQMLA0AgAyEHIAIiAEEUaiIDKAIAIgINACAAQRBqIQMgACgCECICDQALIAdBADYCAAwCCyAFKAIEIgBBA3FBA0cNAiAFIABBfnE2AgRBlNAAIAQ2AgAgBSAENgIAIAEgBEEBcjYCBAwDC0EAIQALIAZFDQACQCABKAIcIgJBAnRBvNIAaiIDKAIAIAFGBEAgAyAANgIAIAANAUGQ0ABBkNAAKAIAQX4gAndxNgIADAILIAZBEEEUIAYoAhAgAUYbaiAANgIAIABFDQELIAAgBjYCGCABKAIQIgIEQCAAIAI2AhAgAiAANgIYCyABQRRqKAIAIgJFDQAgAEEUaiACNgIAIAIgADYCGAsgASAFTw0AIAUoAgQiAEEBcUUNAAJAAkACQAJAIABBAnFFBEBBpNAAKAIAIAVGBEBBpNAAIAE2AgBBmNAAQZjQACgCACAEaiIANgIAIAEgAEEBcjYCBCABQaDQACgCAEcNBkGU0ABBADYCAEGg0ABBADYCAAwGC0Gg0AAoAgAgBUYEQEGg0AAgATYCAEGU0ABBlNAAKAIAIARqIgA2AgAgASAAQQFyNgIEIAAgAWogADYCAAwGCyAAQXhxIARqIQQgAEH/AU0EQCAAQQN2IQMgBSgCCCIAIAUoAgwiAkYEQEGM0ABBjNAAKAIAQX4gA3dxNgIADAULIAIgADYCCCAAIAI2AgwMBAsgBSgCGCEGIAUgBSgCDCIARwRAQZzQACgCABogACAFKAIIIgI2AgggAiAANgIMDAMLIAVBFGoiAygCACICRQRAIAUoAhAiAkUNAiAFQRBqIQMLA0AgAyEHIAIiAEEUaiIDKAIAIgINACAAQRBqIQMgACgCECICDQALIAdBADYCAAwCCyAFIABBfnE2AgQgASAEaiAENgIAIAEgBEEBcjYCBAwDC0EAIQALIAZFDQACQCAFKAIcIgJBAnRBvNIAaiIDKAIAIAVGBEAgAyAANgIAIAANAUGQ0ABBkNAAKAIAQX4gAndxNgIADAILIAZBEEEUIAYoAhAgBUYbaiAANgIAIABFDQELIAAgBjYCGCAFKAIQIgIEQCAAIAI2AhAgAiAANgIYCyAFQRRqKAIAIgJFDQAgAEEUaiACNgIAIAIgADYCGAsgASAEaiAENgIAIAEgBEEBcjYCBCABQaDQACgCAEcNAEGU0AAgBDYCAAwBCyAEQf8BTQRAIARBeHFBtNAAaiEAAn9BjNAAKAIAIgJBASAEQQN2dCIDcUUEQEGM0AAgAiADcjYCACAADAELIAAoAggLIgIgATYCDCAAIAE2AgggASAANgIMIAEgAjYCCAwBC0EfIQIgBEH///8HTQRAIARBJiAEQQh2ZyIAa3ZBAXEgAEEBdGtBPmohAgsgASACNgIcIAFCADcCECACQQJ0QbzSAGohAAJAQZDQACgCACIDQQEgAnQiB3FFBEAgACABNgIAQZDQACADIAdyNgIAIAEgADYCGCABIAE2AgggASABNgIMDAELIARBGSACQQF2a0EAIAJBH0cbdCECIAAoAgAhAAJAA0AgACIDKAIEQXhxIARGDQEgAkEddiEAIAJBAXQhAiADIABBBHFqQRBqIgcoAgAiAA0ACyAHIAE2AgAgASADNgIYIAEgATYCDCABIAE2AggMAQsgAygCCCIAIAE2AgwgAyABNgIIIAFBADYCGCABIAM2AgwgASAANgIIC0Gs0ABBrNAAKAIAQQFrIgBBfyAAGzYCAAsLBwAgAC0AKAsHACAALQAqCwcAIAAtACsLBwAgAC0AKQsHACAALwEyCwcAIAAtAC4LQAEEfyAAKAIYIQEgAC0ALSECIAAtACghAyAAKAI4IQQgABAwIAAgBDYCOCAAIAM6ACggACACOgAtIAAgATYCGAu74gECB38DfiABIAJqIQQCQCAAIgIoAgwiAA0AIAIoAgQEQCACIAE2AgQLIwBBEGsiCCQAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACfwJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAIAIoAhwiA0EBaw7dAdoBAdkBAgMEBQYHCAkKCwwNDtgBDxDXARES1gETFBUWFxgZGhvgAd8BHB0e1QEfICEiIyQl1AEmJygpKiss0wHSAS0u0QHQAS8wMTIzNDU2Nzg5Ojs8PT4/QEFCQ0RFRtsBR0hJSs8BzgFLzQFMzAFNTk9QUVJTVFVWV1hZWltcXV5fYGFiY2RlZmdoaWprbG1ub3BxcnN0dXZ3eHl6e3x9fn+AAYEBggGDAYQBhQGGAYcBiAGJAYoBiwGMAY0BjgGPAZABkQGSAZMBlAGVAZYBlwGYAZkBmgGbAZwBnQGeAZ8BoAGhAaIBowGkAaUBpgGnAagBqQGqAasBrAGtAa4BrwGwAbEBsgGzAbQBtQG2AbcBywHKAbgByQG5AcgBugG7AbwBvQG+Ab8BwAHBAcIBwwHEAcUBxgEA3AELQQAMxgELQQ4MxQELQQ0MxAELQQ8MwwELQRAMwgELQRMMwQELQRQMwAELQRUMvwELQRYMvgELQRgMvQELQRkMvAELQRoMuwELQRsMugELQRwMuQELQR0MuAELQQgMtwELQR4MtgELQSAMtQELQR8MtAELQQcMswELQSEMsgELQSIMsQELQSMMsAELQSQMrwELQRIMrgELQREMrQELQSUMrAELQSYMqwELQScMqgELQSgMqQELQcMBDKgBC0EqDKcBC0ErDKYBC0EsDKUBC0EtDKQBC0EuDKMBC0EvDKIBC0HEAQyhAQtBMAygAQtBNAyfAQtBDAyeAQtBMQydAQtBMgycAQtBMwybAQtBOQyaAQtBNQyZAQtBxQEMmAELQQsMlwELQToMlgELQTYMlQELQQoMlAELQTcMkwELQTgMkgELQTwMkQELQTsMkAELQT0MjwELQQkMjgELQSkMjQELQT4MjAELQT8MiwELQcAADIoBC0HBAAyJAQtBwgAMiAELQcMADIcBC0HEAAyGAQtBxQAMhQELQcYADIQBC0EXDIMBC0HHAAyCAQtByAAMgQELQckADIABC0HKAAx/C0HLAAx+C0HNAAx9C0HMAAx8C0HOAAx7C0HPAAx6C0HQAAx5C0HRAAx4C0HSAAx3C0HTAAx2C0HUAAx1C0HWAAx0C0HVAAxzC0EGDHILQdcADHELQQUMcAtB2AAMbwtBBAxuC0HZAAxtC0HaAAxsC0HbAAxrC0HcAAxqC0EDDGkLQd0ADGgLQd4ADGcLQd8ADGYLQeEADGULQeAADGQLQeIADGMLQeMADGILQQIMYQtB5AAMYAtB5QAMXwtB5gAMXgtB5wAMXQtB6AAMXAtB6QAMWwtB6gAMWgtB6wAMWQtB7AAMWAtB7QAMVwtB7gAMVgtB7wAMVQtB8AAMVAtB8QAMUwtB8gAMUgtB8wAMUQtB9AAMUAtB9QAMTwtB9gAMTgtB9wAMTQtB+AAMTAtB+QAMSwtB+gAMSgtB+wAMSQtB/AAMSAtB/QAMRwtB/gAMRgtB/wAMRQtBgAEMRAtBgQEMQwtBggEMQgtBgwEMQQtBhAEMQAtBhQEMPwtBhgEMPgtBhwEMPQtBiAEMPAtBiQEMOwtBigEMOgtBiwEMOQtBjAEMOAtBjQEMNwtBjgEMNgtBjwEMNQtBkAEMNAtBkQEMMwtBkgEMMgtBkwEMMQtBlAEMMAtBlQEMLwtBlgEMLgtBlwEMLQtBmAEMLAtBmQEMKwtBmgEMKgtBmwEMKQtBnAEMKAtBnQEMJwtBngEMJgtBnwEMJQtBoAEMJAtBoQEMIwtBogEMIgtBowEMIQtBpAEMIAtBpQEMHwtBpgEMHgtBpwEMHQtBqAEMHAtBqQEMGwtBqgEMGgtBqwEMGQtBrAEMGAtBrQEMFwtBrgEMFgtBAQwVC0GvAQwUC0GwAQwTC0GxAQwSC0GzAQwRC0GyAQwQC0G0AQwPC0G1AQwOC0G2AQwNC0G3AQwMC0G4AQwLC0G5AQwKC0G6AQwJC0G7AQwIC0HGAQwHC0G8AQwGC0G9AQwFC0G+AQwEC0G/AQwDC0HAAQwCC0HCAQwBC0HBAQshAwNAAkACQAJAAkACQAJAAkACQAJAIAICfwJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJ/AkACQAJAAkACQAJAAkACQAJAAkACQAJAAkAgAgJ/AkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACfwJAAkACfwJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACfwJAAkACQAJAAn8CQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQCADDsYBAAECAwQFBgcICQoLDA0ODxAREhMUFRYXGBkaGxwdHyAhIyUmKCorLC8wMTIzNDU2Nzk6Ozw9lANAQkRFRklLTk9QUVJTVFVWWFpbXF1eX2BhYmNkZWZnaGpsb3Bxc3V2eHl6e3x/gAGBAYIBgwGEAYUBhgGHAYgBiQGKAYsBjAGNAY4BjwGQAZEBkgGTAZQBlQGWAZcBmAGZAZoBmwGcAZ0BngGfAaABoQGiAaMBpAGlAaYBpwGoAakBqgGrAawBrQGuAa8BsAGxAbIBswG0AbUBtgG3AbgBuQG6AbsBvAG9Ab4BvwHAAcEBwgHDAcQBxQHGAccByAHJAcsBzAHNAc4BzwGKA4kDiAOHA4QDgwOAA/sC+gL5AvgC9wL0AvMC8gLLAsECsALZAQsgASAERw3wAkHdASEDDLMDCyABIARHDcgBQcMBIQMMsgMLIAEgBEcNe0H3ACEDDLEDCyABIARHDXBB7wAhAwywAwsgASAERw1pQeoAIQMMrwMLIAEgBEcNZUHoACEDDK4DCyABIARHDWJB5gAhAwytAwsgASAERw0aQRghAwysAwsgASAERw0VQRIhAwyrAwsgASAERw1CQcUAIQMMqgMLIAEgBEcNNEE/IQMMqQMLIAEgBEcNMkE8IQMMqAMLIAEgBEcNK0ExIQMMpwMLIAItAC5BAUYNnwMMwQILQQAhAAJAAkACQCACLQAqRQ0AIAItACtFDQAgAi8BMCIDQQJxRQ0BDAILIAIvATAiA0EBcUUNAQtBASEAIAItAChBAUYNACACLwEyIgVB5ABrQeQASQ0AIAVBzAFGDQAgBUGwAkYNACADQcAAcQ0AQQAhACADQYgEcUGABEYNACADQShxQQBHIQALIAJBADsBMCACQQA6AC8gAEUN3wIgAkIANwMgDOACC0EAIQACQCACKAI4IgNFDQAgAygCLCIDRQ0AIAIgAxEAACEACyAARQ3MASAAQRVHDd0CIAJBBDYCHCACIAE2AhQgAkGwGDYCECACQRU2AgxBACEDDKQDCyABIARGBEBBBiEDDKQDCyABQQFqIQFBACEAAkAgAigCOCIDRQ0AIAMoAlQiA0UNACACIAMRAAAhAAsgAA3ZAgwcCyACQgA3AyBBEiEDDIkDCyABIARHDRZBHSEDDKEDCyABIARHBEAgAUEBaiEBQRAhAwyIAwtBByEDDKADCyACIAIpAyAiCiAEIAFrrSILfSIMQgAgCiAMWhs3AyAgCiALWA3UAkEIIQMMnwMLIAEgBEcEQCACQQk2AgggAiABNgIEQRQhAwyGAwtBCSEDDJ4DCyACKQMgQgBSDccBIAIgAi8BMEGAAXI7ATAMQgsgASAERw0/QdAAIQMMnAMLIAEgBEYEQEELIQMMnAMLIAFBAWohAUEAIQACQCACKAI4IgNFDQAgAygCUCIDRQ0AIAIgAxEAACEACyAADc8CDMYBC0EAIQACQCACKAI4IgNFDQAgAygCSCIDRQ0AIAIgAxEAACEACyAARQ3GASAAQRVHDc0CIAJBCzYCHCACIAE2AhQgAkGCGTYCECACQRU2AgxBACEDDJoDC0EAIQACQCACKAI4IgNFDQAgAygCSCIDRQ0AIAIgAxEAACEACyAARQ0MIABBFUcNygIgAkEaNgIcIAIgATYCFCACQYIZNgIQIAJBFTYCDEEAIQMMmQMLQQAhAAJAIAIoAjgiA0UNACADKAJMIgNFDQAgAiADEQAAIQALIABFDcQBIABBFUcNxwIgAkELNgIcIAIgATYCFCACQZEXNgIQIAJBFTYCDEEAIQMMmAMLIAEgBEYEQEEPIQMMmAMLIAEtAAAiAEE7Rg0HIABBDUcNxAIgAUEBaiEBDMMBC0EAIQACQCACKAI4IgNFDQAgAygCTCIDRQ0AIAIgAxEAACEACyAARQ3DASAAQRVHDcICIAJBDzYCHCACIAE2AhQgAkGRFzYCECACQRU2AgxBACEDDJYDCwNAIAEtAABB8DVqLQAAIgBBAUcEQCAAQQJHDcECIAIoAgQhAEEAIQMgAkEANgIEIAIgACABQQFqIgEQLSIADcICDMUBCyAEIAFBAWoiAUcNAAtBEiEDDJUDC0EAIQACQCACKAI4IgNFDQAgAygCTCIDRQ0AIAIgAxEAACEACyAARQ3FASAAQRVHDb0CIAJBGzYCHCACIAE2AhQgAkGRFzYCECACQRU2AgxBACEDDJQDCyABIARGBEBBFiEDDJQDCyACQQo2AgggAiABNgIEQQAhAAJAIAIoAjgiA0UNACADKAJIIgNFDQAgAiADEQAAIQALIABFDcIBIABBFUcNuQIgAkEVNgIcIAIgATYCFCACQYIZNgIQIAJBFTYCDEEAIQMMkwMLIAEgBEcEQANAIAEtAABB8DdqLQAAIgBBAkcEQAJAIABBAWsOBMQCvQIAvgK9AgsgAUEBaiEBQQghAwz8AgsgBCABQQFqIgFHDQALQRUhAwyTAwtBFSEDDJIDCwNAIAEtAABB8DlqLQAAIgBBAkcEQCAAQQFrDgTFArcCwwK4ArcCCyAEIAFBAWoiAUcNAAtBGCEDDJEDCyABIARHBEAgAkELNgIIIAIgATYCBEEHIQMM+AILQRkhAwyQAwsgAUEBaiEBDAILIAEgBEYEQEEaIQMMjwMLAkAgAS0AAEENaw4UtQG/Ab8BvwG/Ab8BvwG/Ab8BvwG/Ab8BvwG/Ab8BvwG/Ab8BvwEAvwELQQAhAyACQQA2AhwgAkGvCzYCECACQQI2AgwgAiABQQFqNgIUDI4DCyABIARGBEBBGyEDDI4DCyABLQAAIgBBO0cEQCAAQQ1HDbECIAFBAWohAQy6AQsgAUEBaiEBC0EiIQMM8wILIAEgBEYEQEEcIQMMjAMLQgAhCgJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkAgAS0AAEEwaw43wQLAAgABAgMEBQYH0AHQAdAB0AHQAdAB0AEICQoLDA3QAdAB0AHQAdAB0AHQAdAB0AHQAdAB0AHQAdAB0AHQAdAB0AHQAdAB0AHQAdAB0AHQAdABDg8QERIT0AELQgIhCgzAAgtCAyEKDL8CC0IEIQoMvgILQgUhCgy9AgtCBiEKDLwCC0IHIQoMuwILQgghCgy6AgtCCSEKDLkCC0IKIQoMuAILQgshCgy3AgtCDCEKDLYCC0INIQoMtQILQg4hCgy0AgtCDyEKDLMCC0IKIQoMsgILQgshCgyxAgtCDCEKDLACC0INIQoMrwILQg4hCgyuAgtCDyEKDK0CC0IAIQoCQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAIAEtAABBMGsON8ACvwIAAQIDBAUGB74CvgK+Ar4CvgK+Ar4CCAkKCwwNvgK+Ar4CvgK+Ar4CvgK+Ar4CvgK+Ar4CvgK+Ar4CvgK+Ar4CvgK+Ar4CvgK+Ar4CvgK+Ag4PEBESE74CC0ICIQoMvwILQgMhCgy+AgtCBCEKDL0CC0IFIQoMvAILQgYhCgy7AgtCByEKDLoCC0IIIQoMuQILQgkhCgy4AgtCCiEKDLcCC0ILIQoMtgILQgwhCgy1AgtCDSEKDLQCC0IOIQoMswILQg8hCgyyAgtCCiEKDLECC0ILIQoMsAILQgwhCgyvAgtCDSEKDK4CC0IOIQoMrQILQg8hCgysAgsgAiACKQMgIgogBCABa60iC30iDEIAIAogDFobNwMgIAogC1gNpwJBHyEDDIkDCyABIARHBEAgAkEJNgIIIAIgATYCBEElIQMM8AILQSAhAwyIAwtBASEFIAIvATAiA0EIcUUEQCACKQMgQgBSIQULAkAgAi0ALgRAQQEhACACLQApQQVGDQEgA0HAAHFFIAVxRQ0BC0EAIQAgA0HAAHENAEECIQAgA0EIcQ0AIANBgARxBEACQCACLQAoQQFHDQAgAi0ALUEKcQ0AQQUhAAwCC0EEIQAMAQsgA0EgcUUEQAJAIAItAChBAUYNACACLwEyIgBB5ABrQeQASQ0AIABBzAFGDQAgAEGwAkYNAEEEIQAgA0EocUUNAiADQYgEcUGABEYNAgtBACEADAELQQBBAyACKQMgUBshAAsgAEEBaw4FvgIAsAEBpAKhAgtBESEDDO0CCyACQQE6AC8MhAMLIAEgBEcNnQJBJCEDDIQDCyABIARHDRxBxgAhAwyDAwtBACEAAkAgAigCOCIDRQ0AIAMoAkQiA0UNACACIAMRAAAhAAsgAEUNJyAAQRVHDZgCIAJB0AA2AhwgAiABNgIUIAJBkRg2AhAgAkEVNgIMQQAhAwyCAwsgASAERgRAQSghAwyCAwtBACEDIAJBADYCBCACQQw2AgggAiABIAEQKiIARQ2UAiACQSc2AhwgAiABNgIUIAIgADYCDAyBAwsgASAERgRAQSkhAwyBAwsgAS0AACIAQSBGDRMgAEEJRw2VAiABQQFqIQEMFAsgASAERwRAIAFBAWohAQwWC0EqIQMM/wILIAEgBEYEQEErIQMM/wILIAEtAAAiAEEJRyAAQSBHcQ2QAiACLQAsQQhHDd0CIAJBADoALAzdAgsgASAERgRAQSwhAwz+AgsgAS0AAEEKRw2OAiABQQFqIQEMsAELIAEgBEcNigJBLyEDDPwCCwNAIAEtAAAiAEEgRwRAIABBCmsOBIQCiAKIAoQChgILIAQgAUEBaiIBRw0AC0ExIQMM+wILQTIhAyABIARGDfoCIAIoAgAiACAEIAFraiEHIAEgAGtBA2ohBgJAA0AgAEHwO2otAAAgAS0AACIFQSByIAUgBUHBAGtB/wFxQRpJG0H/AXFHDQEgAEEDRgRAQQYhAQziAgsgAEEBaiEAIAQgAUEBaiIBRw0ACyACIAc2AgAM+wILIAJBADYCAAyGAgtBMyEDIAQgASIARg35AiAEIAFrIAIoAgAiAWohByAAIAFrQQhqIQYCQANAIAFB9DtqLQAAIAAtAAAiBUEgciAFIAVBwQBrQf8BcUEaSRtB/wFxRw0BIAFBCEYEQEEFIQEM4QILIAFBAWohASAEIABBAWoiAEcNAAsgAiAHNgIADPoCCyACQQA2AgAgACEBDIUCC0E0IQMgBCABIgBGDfgCIAQgAWsgAigCACIBaiEHIAAgAWtBBWohBgJAA0AgAUHQwgBqLQAAIAAtAAAiBUEgciAFIAVBwQBrQf8BcUEaSRtB/wFxRw0BIAFBBUYEQEEHIQEM4AILIAFBAWohASAEIABBAWoiAEcNAAsgAiAHNgIADPkCCyACQQA2AgAgACEBDIQCCyABIARHBEADQCABLQAAQYA+ai0AACIAQQFHBEAgAEECRg0JDIECCyAEIAFBAWoiAUcNAAtBMCEDDPgCC0EwIQMM9wILIAEgBEcEQANAIAEtAAAiAEEgRwRAIABBCmsOBP8B/gH+Af8B/gELIAQgAUEBaiIBRw0AC0E4IQMM9wILQTghAwz2AgsDQCABLQAAIgBBIEcgAEEJR3EN9gEgBCABQQFqIgFHDQALQTwhAwz1AgsDQCABLQAAIgBBIEcEQAJAIABBCmsOBPkBBAT5AQALIABBLEYN9QEMAwsgBCABQQFqIgFHDQALQT8hAwz0AgtBwAAhAyABIARGDfMCIAIoAgAiACAEIAFraiEFIAEgAGtBBmohBgJAA0AgAEGAQGstAAAgAS0AAEEgckcNASAAQQZGDdsCIABBAWohACAEIAFBAWoiAUcNAAsgAiAFNgIADPQCCyACQQA2AgALQTYhAwzZAgsgASAERgRAQcEAIQMM8gILIAJBDDYCCCACIAE2AgQgAi0ALEEBaw4E+wHuAewB6wHUAgsgAUEBaiEBDPoBCyABIARHBEADQAJAIAEtAAAiAEEgciAAIABBwQBrQf8BcUEaSRtB/wFxIgBBCUYNACAAQSBGDQACQAJAAkACQCAAQeMAaw4TAAMDAwMDAwMBAwMDAwMDAwMDAgMLIAFBAWohAUExIQMM3AILIAFBAWohAUEyIQMM2wILIAFBAWohAUEzIQMM2gILDP4BCyAEIAFBAWoiAUcNAAtBNSEDDPACC0E1IQMM7wILIAEgBEcEQANAIAEtAABBgDxqLQAAQQFHDfcBIAQgAUEBaiIBRw0AC0E9IQMM7wILQT0hAwzuAgtBACEAAkAgAigCOCIDRQ0AIAMoAkAiA0UNACACIAMRAAAhAAsgAEUNASAAQRVHDeYBIAJBwgA2AhwgAiABNgIUIAJB4xg2AhAgAkEVNgIMQQAhAwztAgsgAUEBaiEBC0E8IQMM0gILIAEgBEYEQEHCACEDDOsCCwJAA0ACQCABLQAAQQlrDhgAAswCzALRAswCzALMAswCzALMAswCzALMAswCzALMAswCzALMAswCzALMAgDMAgsgBCABQQFqIgFHDQALQcIAIQMM6wILIAFBAWohASACLQAtQQFxRQ3+AQtBLCEDDNACCyABIARHDd4BQcQAIQMM6AILA0AgAS0AAEGQwABqLQAAQQFHDZwBIAQgAUEBaiIBRw0AC0HFACEDDOcCCyABLQAAIgBBIEYN/gEgAEE6Rw3AAiACKAIEIQBBACEDIAJBADYCBCACIAAgARApIgAN3gEM3QELQccAIQMgBCABIgBGDeUCIAQgAWsgAigCACIBaiEHIAAgAWtBBWohBgNAIAFBkMIAai0AACAALQAAIgVBIHIgBSAFQcEAa0H/AXFBGkkbQf8BcUcNvwIgAUEFRg3CAiABQQFqIQEgBCAAQQFqIgBHDQALIAIgBzYCAAzlAgtByAAhAyAEIAEiAEYN5AIgBCABayACKAIAIgFqIQcgACABa0EJaiEGA0AgAUGWwgBqLQAAIAAtAAAiBUEgciAFIAVBwQBrQf8BcUEaSRtB/wFxRw2+AkECIAFBCUYNwgIaIAFBAWohASAEIABBAWoiAEcNAAsgAiAHNgIADOQCCyABIARGBEBByQAhAwzkAgsCQAJAIAEtAAAiAEEgciAAIABBwQBrQf8BcUEaSRtB/wFxQe4Aaw4HAL8CvwK/Ar8CvwIBvwILIAFBAWohAUE+IQMMywILIAFBAWohAUE/IQMMygILQcoAIQMgBCABIgBGDeICIAQgAWsgAigCACIBaiEGIAAgAWtBAWohBwNAIAFBoMIAai0AACAALQAAIgVBIHIgBSAFQcEAa0H/AXFBGkkbQf8BcUcNvAIgAUEBRg2+AiABQQFqIQEgBCAAQQFqIgBHDQALIAIgBjYCAAziAgtBywAhAyAEIAEiAEYN4QIgBCABayACKAIAIgFqIQcgACABa0EOaiEGA0AgAUGiwgBqLQAAIAAtAAAiBUEgciAFIAVBwQBrQf8BcUEaSRtB/wFxRw27AiABQQ5GDb4CIAFBAWohASAEIABBAWoiAEcNAAsgAiAHNgIADOECC0HMACEDIAQgASIARg3gAiAEIAFrIAIoAgAiAWohByAAIAFrQQ9qIQYDQCABQcDCAGotAAAgAC0AACIFQSByIAUgBUHBAGtB/wFxQRpJG0H/AXFHDboCQQMgAUEPRg2+AhogAUEBaiEBIAQgAEEBaiIARw0ACyACIAc2AgAM4AILQc0AIQMgBCABIgBGDd8CIAQgAWsgAigCACIBaiEHIAAgAWtBBWohBgNAIAFB0MIAai0AACAALQAAIgVBIHIgBSAFQcEAa0H/AXFBGkkbQf8BcUcNuQJBBCABQQVGDb0CGiABQQFqIQEgBCAAQQFqIgBHDQALIAIgBzYCAAzfAgsgASAERgRAQc4AIQMM3wILAkACQAJAAkAgAS0AACIAQSByIAAgAEHBAGtB/wFxQRpJG0H/AXFB4wBrDhMAvAK8ArwCvAK8ArwCvAK8ArwCvAK8ArwCAbwCvAK8AgIDvAILIAFBAWohAUHBACEDDMgCCyABQQFqIQFBwgAhAwzHAgsgAUEBaiEBQcMAIQMMxgILIAFBAWohAUHEACEDDMUCCyABIARHBEAgAkENNgIIIAIgATYCBEHFACEDDMUCC0HPACEDDN0CCwJAAkAgAS0AAEEKaw4EAZABkAEAkAELIAFBAWohAQtBKCEDDMMCCyABIARGBEBB0QAhAwzcAgsgAS0AAEEgRw0AIAFBAWohASACLQAtQQFxRQ3QAQtBFyEDDMECCyABIARHDcsBQdIAIQMM2QILQdMAIQMgASAERg3YAiACKAIAIgAgBCABa2ohBiABIABrQQFqIQUDQCABLQAAIABB1sIAai0AAEcNxwEgAEEBRg3KASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBjYCAAzYAgsgASAERgRAQdUAIQMM2AILIAEtAABBCkcNwgEgAUEBaiEBDMoBCyABIARGBEBB1gAhAwzXAgsCQAJAIAEtAABBCmsOBADDAcMBAcMBCyABQQFqIQEMygELIAFBAWohAUHKACEDDL0CC0EAIQACQCACKAI4IgNFDQAgAygCPCIDRQ0AIAIgAxEAACEACyAADb8BQc0AIQMMvAILIAItAClBIkYNzwIMiQELIAQgASIFRgRAQdsAIQMM1AILQQAhAEEBIQFBASEGQQAhAwJAAn8CQAJAAkACQAJAAkACQCAFLQAAQTBrDgrFAcQBAAECAwQFBgjDAQtBAgwGC0EDDAULQQQMBAtBBQwDC0EGDAILQQcMAQtBCAshA0EAIQFBACEGDL0BC0EJIQNBASEAQQAhAUEAIQYMvAELIAEgBEYEQEHdACEDDNMCCyABLQAAQS5HDbgBIAFBAWohAQyIAQsgASAERw22AUHfACEDDNECCyABIARHBEAgAkEONgIIIAIgATYCBEHQACEDDLgCC0HgACEDDNACC0HhACEDIAEgBEYNzwIgAigCACIAIAQgAWtqIQUgASAAa0EDaiEGA0AgAS0AACAAQeLCAGotAABHDbEBIABBA0YNswEgAEEBaiEAIAQgAUEBaiIBRw0ACyACIAU2AgAMzwILQeIAIQMgASAERg3OAiACKAIAIgAgBCABa2ohBSABIABrQQJqIQYDQCABLQAAIABB5sIAai0AAEcNsAEgAEECRg2vASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAzOAgtB4wAhAyABIARGDc0CIAIoAgAiACAEIAFraiEFIAEgAGtBA2ohBgNAIAEtAAAgAEHpwgBqLQAARw2vASAAQQNGDa0BIABBAWohACAEIAFBAWoiAUcNAAsgAiAFNgIADM0CCyABIARGBEBB5QAhAwzNAgsgAUEBaiEBQQAhAAJAIAIoAjgiA0UNACADKAIwIgNFDQAgAiADEQAAIQALIAANqgFB1gAhAwyzAgsgASAERwRAA0AgAS0AACIAQSBHBEACQAJAAkAgAEHIAGsOCwABswGzAbMBswGzAbMBswGzAQKzAQsgAUEBaiEBQdIAIQMMtwILIAFBAWohAUHTACEDDLYCCyABQQFqIQFB1AAhAwy1AgsgBCABQQFqIgFHDQALQeQAIQMMzAILQeQAIQMMywILA0AgAS0AAEHwwgBqLQAAIgBBAUcEQCAAQQJrDgOnAaYBpQGkAQsgBCABQQFqIgFHDQALQeYAIQMMygILIAFBAWogASAERw0CGkHnACEDDMkCCwNAIAEtAABB8MQAai0AACIAQQFHBEACQCAAQQJrDgSiAaEBoAEAnwELQdcAIQMMsQILIAQgAUEBaiIBRw0AC0HoACEDDMgCCyABIARGBEBB6QAhAwzIAgsCQCABLQAAIgBBCmsOGrcBmwGbAbQBmwGbAZsBmwGbAZsBmwGbAZsBmwGbAZsBmwGbAZsBmwGbAZsBpAGbAZsBAJkBCyABQQFqCyEBQQYhAwytAgsDQCABLQAAQfDGAGotAABBAUcNfSAEIAFBAWoiAUcNAAtB6gAhAwzFAgsgAUEBaiABIARHDQIaQesAIQMMxAILIAEgBEYEQEHsACEDDMQCCyABQQFqDAELIAEgBEYEQEHtACEDDMMCCyABQQFqCyEBQQQhAwyoAgsgASAERgRAQe4AIQMMwQILAkACQAJAIAEtAABB8MgAai0AAEEBaw4HkAGPAY4BAHwBAo0BCyABQQFqIQEMCwsgAUEBagyTAQtBACEDIAJBADYCHCACQZsSNgIQIAJBBzYCDCACIAFBAWo2AhQMwAILAkADQCABLQAAQfDIAGotAAAiAEEERwRAAkACQCAAQQFrDgeUAZMBkgGNAQAEAY0BC0HaACEDDKoCCyABQQFqIQFB3AAhAwypAgsgBCABQQFqIgFHDQALQe8AIQMMwAILIAFBAWoMkQELIAQgASIARgRAQfAAIQMMvwILIAAtAABBL0cNASAAQQFqIQEMBwsgBCABIgBGBEBB8QAhAwy+AgsgAC0AACIBQS9GBEAgAEEBaiEBQd0AIQMMpQILIAFBCmsiA0EWSw0AIAAhAUEBIAN0QYmAgAJxDfkBC0EAIQMgAkEANgIcIAIgADYCFCACQYwcNgIQIAJBBzYCDAy8AgsgASAERwRAIAFBAWohAUHeACEDDKMCC0HyACEDDLsCCyABIARGBEBB9AAhAwy7AgsCQCABLQAAQfDMAGotAABBAWsOA/cBcwCCAQtB4QAhAwyhAgsgASAERwRAA0AgAS0AAEHwygBqLQAAIgBBA0cEQAJAIABBAWsOAvkBAIUBC0HfACEDDKMCCyAEIAFBAWoiAUcNAAtB8wAhAwy6AgtB8wAhAwy5AgsgASAERwRAIAJBDzYCCCACIAE2AgRB4AAhAwygAgtB9QAhAwy4AgsgASAERgRAQfYAIQMMuAILIAJBDzYCCCACIAE2AgQLQQMhAwydAgsDQCABLQAAQSBHDY4CIAQgAUEBaiIBRw0AC0H3ACEDDLUCCyABIARGBEBB+AAhAwy1AgsgAS0AAEEgRw16IAFBAWohAQxbC0EAIQACQCACKAI4IgNFDQAgAygCOCIDRQ0AIAIgAxEAACEACyAADXgMgAILIAEgBEYEQEH6ACEDDLMCCyABLQAAQcwARw10IAFBAWohAUETDHYLQfsAIQMgASAERg2xAiACKAIAIgAgBCABa2ohBSABIABrQQVqIQYDQCABLQAAIABB8M4Aai0AAEcNcyAAQQVGDXUgAEEBaiEAIAQgAUEBaiIBRw0ACyACIAU2AgAMsQILIAEgBEYEQEH8ACEDDLECCwJAAkAgAS0AAEHDAGsODAB0dHR0dHR0dHR0AXQLIAFBAWohAUHmACEDDJgCCyABQQFqIQFB5wAhAwyXAgtB/QAhAyABIARGDa8CIAIoAgAiACAEIAFraiEFIAEgAGtBAmohBgJAA0AgAS0AACAAQe3PAGotAABHDXIgAEECRg0BIABBAWohACAEIAFBAWoiAUcNAAsgAiAFNgIADLACCyACQQA2AgAgBkEBaiEBQRAMcwtB/gAhAyABIARGDa4CIAIoAgAiACAEIAFraiEFIAEgAGtBBWohBgJAA0AgAS0AACAAQfbOAGotAABHDXEgAEEFRg0BIABBAWohACAEIAFBAWoiAUcNAAsgAiAFNgIADK8CCyACQQA2AgAgBkEBaiEBQRYMcgtB/wAhAyABIARGDa0CIAIoAgAiACAEIAFraiEFIAEgAGtBA2ohBgJAA0AgAS0AACAAQfzOAGotAABHDXAgAEEDRg0BIABBAWohACAEIAFBAWoiAUcNAAsgAiAFNgIADK4CCyACQQA2AgAgBkEBaiEBQQUMcQsgASAERgRAQYABIQMMrQILIAEtAABB2QBHDW4gAUEBaiEBQQgMcAsgASAERgRAQYEBIQMMrAILAkACQCABLQAAQc4Aaw4DAG8BbwsgAUEBaiEBQesAIQMMkwILIAFBAWohAUHsACEDDJICCyABIARGBEBBggEhAwyrAgsCQAJAIAEtAABByABrDggAbm5ubm5uAW4LIAFBAWohAUHqACEDDJICCyABQQFqIQFB7QAhAwyRAgtBgwEhAyABIARGDakCIAIoAgAiACAEIAFraiEFIAEgAGtBAmohBgJAA0AgAS0AACAAQYDPAGotAABHDWwgAEECRg0BIABBAWohACAEIAFBAWoiAUcNAAsgAiAFNgIADKoCCyACQQA2AgAgBkEBaiEBQQAMbQtBhAEhAyABIARGDagCIAIoAgAiACAEIAFraiEFIAEgAGtBBGohBgJAA0AgAS0AACAAQYPPAGotAABHDWsgAEEERg0BIABBAWohACAEIAFBAWoiAUcNAAsgAiAFNgIADKkCCyACQQA2AgAgBkEBaiEBQSMMbAsgASAERgRAQYUBIQMMqAILAkACQCABLQAAQcwAaw4IAGtra2trawFrCyABQQFqIQFB7wAhAwyPAgsgAUEBaiEBQfAAIQMMjgILIAEgBEYEQEGGASEDDKcCCyABLQAAQcUARw1oIAFBAWohAQxgC0GHASEDIAEgBEYNpQIgAigCACIAIAQgAWtqIQUgASAAa0EDaiEGAkADQCABLQAAIABBiM8Aai0AAEcNaCAAQQNGDQEgAEEBaiEAIAQgAUEBaiIBRw0ACyACIAU2AgAMpgILIAJBADYCACAGQQFqIQFBLQxpC0GIASEDIAEgBEYNpAIgAigCACIAIAQgAWtqIQUgASAAa0EIaiEGAkADQCABLQAAIABB0M8Aai0AAEcNZyAAQQhGDQEgAEEBaiEAIAQgAUEBaiIBRw0ACyACIAU2AgAMpQILIAJBADYCACAGQQFqIQFBKQxoCyABIARGBEBBiQEhAwykAgtBASABLQAAQd8ARw1nGiABQQFqIQEMXgtBigEhAyABIARGDaICIAIoAgAiACAEIAFraiEFIAEgAGtBAWohBgNAIAEtAAAgAEGMzwBqLQAARw1kIABBAUYN+gEgAEEBaiEAIAQgAUEBaiIBRw0ACyACIAU2AgAMogILQYsBIQMgASAERg2hAiACKAIAIgAgBCABa2ohBSABIABrQQJqIQYCQANAIAEtAAAgAEGOzwBqLQAARw1kIABBAkYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAyiAgsgAkEANgIAIAZBAWohAUECDGULQYwBIQMgASAERg2gAiACKAIAIgAgBCABa2ohBSABIABrQQFqIQYCQANAIAEtAAAgAEHwzwBqLQAARw1jIABBAUYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAyhAgsgAkEANgIAIAZBAWohAUEfDGQLQY0BIQMgASAERg2fAiACKAIAIgAgBCABa2ohBSABIABrQQFqIQYCQANAIAEtAAAgAEHyzwBqLQAARw1iIABBAUYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAygAgsgAkEANgIAIAZBAWohAUEJDGMLIAEgBEYEQEGOASEDDJ8CCwJAAkAgAS0AAEHJAGsOBwBiYmJiYgFiCyABQQFqIQFB+AAhAwyGAgsgAUEBaiEBQfkAIQMMhQILQY8BIQMgASAERg2dAiACKAIAIgAgBCABa2ohBSABIABrQQVqIQYCQANAIAEtAAAgAEGRzwBqLQAARw1gIABBBUYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAyeAgsgAkEANgIAIAZBAWohAUEYDGELQZABIQMgASAERg2cAiACKAIAIgAgBCABa2ohBSABIABrQQJqIQYCQANAIAEtAAAgAEGXzwBqLQAARw1fIABBAkYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAydAgsgAkEANgIAIAZBAWohAUEXDGALQZEBIQMgASAERg2bAiACKAIAIgAgBCABa2ohBSABIABrQQZqIQYCQANAIAEtAAAgAEGazwBqLQAARw1eIABBBkYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAycAgsgAkEANgIAIAZBAWohAUEVDF8LQZIBIQMgASAERg2aAiACKAIAIgAgBCABa2ohBSABIABrQQVqIQYCQANAIAEtAAAgAEGhzwBqLQAARw1dIABBBUYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAybAgsgAkEANgIAIAZBAWohAUEeDF4LIAEgBEYEQEGTASEDDJoCCyABLQAAQcwARw1bIAFBAWohAUEKDF0LIAEgBEYEQEGUASEDDJkCCwJAAkAgAS0AAEHBAGsODwBcXFxcXFxcXFxcXFxcAVwLIAFBAWohAUH+ACEDDIACCyABQQFqIQFB/wAhAwz/AQsgASAERgRAQZUBIQMMmAILAkACQCABLQAAQcEAaw4DAFsBWwsgAUEBaiEBQf0AIQMM/wELIAFBAWohAUGAASEDDP4BC0GWASEDIAEgBEYNlgIgAigCACIAIAQgAWtqIQUgASAAa0EBaiEGAkADQCABLQAAIABBp88Aai0AAEcNWSAAQQFGDQEgAEEBaiEAIAQgAUEBaiIBRw0ACyACIAU2AgAMlwILIAJBADYCACAGQQFqIQFBCwxaCyABIARGBEBBlwEhAwyWAgsCQAJAAkACQCABLQAAQS1rDiMAW1tbW1tbW1tbW1tbW1tbW1tbW1tbW1sBW1tbW1sCW1tbA1sLIAFBAWohAUH7ACEDDP8BCyABQQFqIQFB/AAhAwz+AQsgAUEBaiEBQYEBIQMM/QELIAFBAWohAUGCASEDDPwBC0GYASEDIAEgBEYNlAIgAigCACIAIAQgAWtqIQUgASAAa0EEaiEGAkADQCABLQAAIABBqc8Aai0AAEcNVyAAQQRGDQEgAEEBaiEAIAQgAUEBaiIBRw0ACyACIAU2AgAMlQILIAJBADYCACAGQQFqIQFBGQxYC0GZASEDIAEgBEYNkwIgAigCACIAIAQgAWtqIQUgASAAa0EFaiEGAkADQCABLQAAIABBrs8Aai0AAEcNViAAQQVGDQEgAEEBaiEAIAQgAUEBaiIBRw0ACyACIAU2AgAMlAILIAJBADYCACAGQQFqIQFBBgxXC0GaASEDIAEgBEYNkgIgAigCACIAIAQgAWtqIQUgASAAa0EBaiEGAkADQCABLQAAIABBtM8Aai0AAEcNVSAAQQFGDQEgAEEBaiEAIAQgAUEBaiIBRw0ACyACIAU2AgAMkwILIAJBADYCACAGQQFqIQFBHAxWC0GbASEDIAEgBEYNkQIgAigCACIAIAQgAWtqIQUgASAAa0EBaiEGAkADQCABLQAAIABBts8Aai0AAEcNVCAAQQFGDQEgAEEBaiEAIAQgAUEBaiIBRw0ACyACIAU2AgAMkgILIAJBADYCACAGQQFqIQFBJwxVCyABIARGBEBBnAEhAwyRAgsCQAJAIAEtAABB1ABrDgIAAVQLIAFBAWohAUGGASEDDPgBCyABQQFqIQFBhwEhAwz3AQtBnQEhAyABIARGDY8CIAIoAgAiACAEIAFraiEFIAEgAGtBAWohBgJAA0AgAS0AACAAQbjPAGotAABHDVIgAEEBRg0BIABBAWohACAEIAFBAWoiAUcNAAsgAiAFNgIADJACCyACQQA2AgAgBkEBaiEBQSYMUwtBngEhAyABIARGDY4CIAIoAgAiACAEIAFraiEFIAEgAGtBAWohBgJAA0AgAS0AACAAQbrPAGotAABHDVEgAEEBRg0BIABBAWohACAEIAFBAWoiAUcNAAsgAiAFNgIADI8CCyACQQA2AgAgBkEBaiEBQQMMUgtBnwEhAyABIARGDY0CIAIoAgAiACAEIAFraiEFIAEgAGtBAmohBgJAA0AgAS0AACAAQe3PAGotAABHDVAgAEECRg0BIABBAWohACAEIAFBAWoiAUcNAAsgAiAFNgIADI4CCyACQQA2AgAgBkEBaiEBQQwMUQtBoAEhAyABIARGDYwCIAIoAgAiACAEIAFraiEFIAEgAGtBA2ohBgJAA0AgAS0AACAAQbzPAGotAABHDU8gAEEDRg0BIABBAWohACAEIAFBAWoiAUcNAAsgAiAFNgIADI0CCyACQQA2AgAgBkEBaiEBQQ0MUAsgASAERgRAQaEBIQMMjAILAkACQCABLQAAQcYAaw4LAE9PT09PT09PTwFPCyABQQFqIQFBiwEhAwzzAQsgAUEBaiEBQYwBIQMM8gELIAEgBEYEQEGiASEDDIsCCyABLQAAQdAARw1MIAFBAWohAQxGCyABIARGBEBBowEhAwyKAgsCQAJAIAEtAABByQBrDgcBTU1NTU0ATQsgAUEBaiEBQY4BIQMM8QELIAFBAWohAUEiDE0LQaQBIQMgASAERg2IAiACKAIAIgAgBCABa2ohBSABIABrQQFqIQYCQANAIAEtAAAgAEHAzwBqLQAARw1LIABBAUYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAyJAgsgAkEANgIAIAZBAWohAUEdDEwLIAEgBEYEQEGlASEDDIgCCwJAAkAgAS0AAEHSAGsOAwBLAUsLIAFBAWohAUGQASEDDO8BCyABQQFqIQFBBAxLCyABIARGBEBBpgEhAwyHAgsCQAJAAkACQAJAIAEtAABBwQBrDhUATU1NTU1NTU1NTQFNTQJNTQNNTQRNCyABQQFqIQFBiAEhAwzxAQsgAUEBaiEBQYkBIQMM8AELIAFBAWohAUGKASEDDO8BCyABQQFqIQFBjwEhAwzuAQsgAUEBaiEBQZEBIQMM7QELQacBIQMgASAERg2FAiACKAIAIgAgBCABa2ohBSABIABrQQJqIQYCQANAIAEtAAAgAEHtzwBqLQAARw1IIABBAkYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAyGAgsgAkEANgIAIAZBAWohAUERDEkLQagBIQMgASAERg2EAiACKAIAIgAgBCABa2ohBSABIABrQQJqIQYCQANAIAEtAAAgAEHCzwBqLQAARw1HIABBAkYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAyFAgsgAkEANgIAIAZBAWohAUEsDEgLQakBIQMgASAERg2DAiACKAIAIgAgBCABa2ohBSABIABrQQRqIQYCQANAIAEtAAAgAEHFzwBqLQAARw1GIABBBEYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAyEAgsgAkEANgIAIAZBAWohAUErDEcLQaoBIQMgASAERg2CAiACKAIAIgAgBCABa2ohBSABIABrQQJqIQYCQANAIAEtAAAgAEHKzwBqLQAARw1FIABBAkYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAyDAgsgAkEANgIAIAZBAWohAUEUDEYLIAEgBEYEQEGrASEDDIICCwJAAkACQAJAIAEtAABBwgBrDg8AAQJHR0dHR0dHR0dHRwNHCyABQQFqIQFBkwEhAwzrAQsgAUEBaiEBQZQBIQMM6gELIAFBAWohAUGVASEDDOkBCyABQQFqIQFBlgEhAwzoAQsgASAERgRAQawBIQMMgQILIAEtAABBxQBHDUIgAUEBaiEBDD0LQa0BIQMgASAERg3/ASACKAIAIgAgBCABa2ohBSABIABrQQJqIQYCQANAIAEtAAAgAEHNzwBqLQAARw1CIABBAkYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAyAAgsgAkEANgIAIAZBAWohAUEODEMLIAEgBEYEQEGuASEDDP8BCyABLQAAQdAARw1AIAFBAWohAUElDEILQa8BIQMgASAERg39ASACKAIAIgAgBCABa2ohBSABIABrQQhqIQYCQANAIAEtAAAgAEHQzwBqLQAARw1AIABBCEYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAz+AQsgAkEANgIAIAZBAWohAUEqDEELIAEgBEYEQEGwASEDDP0BCwJAAkAgAS0AAEHVAGsOCwBAQEBAQEBAQEABQAsgAUEBaiEBQZoBIQMM5AELIAFBAWohAUGbASEDDOMBCyABIARGBEBBsQEhAwz8AQsCQAJAIAEtAABBwQBrDhQAPz8/Pz8/Pz8/Pz8/Pz8/Pz8/AT8LIAFBAWohAUGZASEDDOMBCyABQQFqIQFBnAEhAwziAQtBsgEhAyABIARGDfoBIAIoAgAiACAEIAFraiEFIAEgAGtBA2ohBgJAA0AgAS0AACAAQdnPAGotAABHDT0gAEEDRg0BIABBAWohACAEIAFBAWoiAUcNAAsgAiAFNgIADPsBCyACQQA2AgAgBkEBaiEBQSEMPgtBswEhAyABIARGDfkBIAIoAgAiACAEIAFraiEFIAEgAGtBBmohBgJAA0AgAS0AACAAQd3PAGotAABHDTwgAEEGRg0BIABBAWohACAEIAFBAWoiAUcNAAsgAiAFNgIADPoBCyACQQA2AgAgBkEBaiEBQRoMPQsgASAERgRAQbQBIQMM+QELAkACQAJAIAEtAABBxQBrDhEAPT09PT09PT09AT09PT09Aj0LIAFBAWohAUGdASEDDOEBCyABQQFqIQFBngEhAwzgAQsgAUEBaiEBQZ8BIQMM3wELQbUBIQMgASAERg33ASACKAIAIgAgBCABa2ohBSABIABrQQVqIQYCQANAIAEtAAAgAEHkzwBqLQAARw06IABBBUYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAz4AQsgAkEANgIAIAZBAWohAUEoDDsLQbYBIQMgASAERg32ASACKAIAIgAgBCABa2ohBSABIABrQQJqIQYCQANAIAEtAAAgAEHqzwBqLQAARw05IABBAkYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAz3AQsgAkEANgIAIAZBAWohAUEHDDoLIAEgBEYEQEG3ASEDDPYBCwJAAkAgAS0AAEHFAGsODgA5OTk5OTk5OTk5OTkBOQsgAUEBaiEBQaEBIQMM3QELIAFBAWohAUGiASEDDNwBC0G4ASEDIAEgBEYN9AEgAigCACIAIAQgAWtqIQUgASAAa0ECaiEGAkADQCABLQAAIABB7c8Aai0AAEcNNyAAQQJGDQEgAEEBaiEAIAQgAUEBaiIBRw0ACyACIAU2AgAM9QELIAJBADYCACAGQQFqIQFBEgw4C0G5ASEDIAEgBEYN8wEgAigCACIAIAQgAWtqIQUgASAAa0EBaiEGAkADQCABLQAAIABB8M8Aai0AAEcNNiAAQQFGDQEgAEEBaiEAIAQgAUEBaiIBRw0ACyACIAU2AgAM9AELIAJBADYCACAGQQFqIQFBIAw3C0G6ASEDIAEgBEYN8gEgAigCACIAIAQgAWtqIQUgASAAa0EBaiEGAkADQCABLQAAIABB8s8Aai0AAEcNNSAAQQFGDQEgAEEBaiEAIAQgAUEBaiIBRw0ACyACIAU2AgAM8wELIAJBADYCACAGQQFqIQFBDww2CyABIARGBEBBuwEhAwzyAQsCQAJAIAEtAABByQBrDgcANTU1NTUBNQsgAUEBaiEBQaUBIQMM2QELIAFBAWohAUGmASEDDNgBC0G8ASEDIAEgBEYN8AEgAigCACIAIAQgAWtqIQUgASAAa0EHaiEGAkADQCABLQAAIABB9M8Aai0AAEcNMyAAQQdGDQEgAEEBaiEAIAQgAUEBaiIBRw0ACyACIAU2AgAM8QELIAJBADYCACAGQQFqIQFBGww0CyABIARGBEBBvQEhAwzwAQsCQAJAAkAgAS0AAEHCAGsOEgA0NDQ0NDQ0NDQBNDQ0NDQ0AjQLIAFBAWohAUGkASEDDNgBCyABQQFqIQFBpwEhAwzXAQsgAUEBaiEBQagBIQMM1gELIAEgBEYEQEG+ASEDDO8BCyABLQAAQc4ARw0wIAFBAWohAQwsCyABIARGBEBBvwEhAwzuAQsCQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQCABLQAAQcEAaw4VAAECAz8EBQY/Pz8HCAkKCz8MDQ4PPwsgAUEBaiEBQegAIQMM4wELIAFBAWohAUHpACEDDOIBCyABQQFqIQFB7gAhAwzhAQsgAUEBaiEBQfIAIQMM4AELIAFBAWohAUHzACEDDN8BCyABQQFqIQFB9gAhAwzeAQsgAUEBaiEBQfcAIQMM3QELIAFBAWohAUH6ACEDDNwBCyABQQFqIQFBgwEhAwzbAQsgAUEBaiEBQYQBIQMM2gELIAFBAWohAUGFASEDDNkBCyABQQFqIQFBkgEhAwzYAQsgAUEBaiEBQZgBIQMM1wELIAFBAWohAUGgASEDDNYBCyABQQFqIQFBowEhAwzVAQsgAUEBaiEBQaoBIQMM1AELIAEgBEcEQCACQRA2AgggAiABNgIEQasBIQMM1AELQcABIQMM7AELQQAhAAJAIAIoAjgiA0UNACADKAI0IgNFDQAgAiADEQAAIQALIABFDV4gAEEVRw0HIAJB0QA2AhwgAiABNgIUIAJBsBc2AhAgAkEVNgIMQQAhAwzrAQsgAUEBaiABIARHDQgaQcIBIQMM6gELA0ACQCABLQAAQQprDgQIAAALAAsgBCABQQFqIgFHDQALQcMBIQMM6QELIAEgBEcEQCACQRE2AgggAiABNgIEQQEhAwzQAQtBxAEhAwzoAQsgASAERgRAQcUBIQMM6AELAkACQCABLQAAQQprDgQBKCgAKAsgAUEBagwJCyABQQFqDAULIAEgBEYEQEHGASEDDOcBCwJAAkAgAS0AAEEKaw4XAQsLAQsLCwsLCwsLCwsLCwsLCwsLCwALCyABQQFqIQELQbABIQMMzQELIAEgBEYEQEHIASEDDOYBCyABLQAAQSBHDQkgAkEAOwEyIAFBAWohAUGzASEDDMwBCwNAIAEhAAJAIAEgBEcEQCABLQAAQTBrQf8BcSIDQQpJDQEMJwtBxwEhAwzmAQsCQCACLwEyIgFBmTNLDQAgAiABQQpsIgU7ATIgBUH+/wNxIANB//8Dc0sNACAAQQFqIQEgAiADIAVqIgM7ATIgA0H//wNxQegHSQ0BCwtBACEDIAJBADYCHCACQcEJNgIQIAJBDTYCDCACIABBAWo2AhQM5AELIAJBADYCHCACIAE2AhQgAkHwDDYCECACQRs2AgxBACEDDOMBCyACKAIEIQAgAkEANgIEIAIgACABECYiAA0BIAFBAWoLIQFBrQEhAwzIAQsgAkHBATYCHCACIAA2AgwgAiABQQFqNgIUQQAhAwzgAQsgAigCBCEAIAJBADYCBCACIAAgARAmIgANASABQQFqCyEBQa4BIQMMxQELIAJBwgE2AhwgAiAANgIMIAIgAUEBajYCFEEAIQMM3QELIAJBADYCHCACIAE2AhQgAkGXCzYCECACQQ02AgxBACEDDNwBCyACQQA2AhwgAiABNgIUIAJB4xA2AhAgAkEJNgIMQQAhAwzbAQsgAkECOgAoDKwBC0EAIQMgAkEANgIcIAJBrws2AhAgAkECNgIMIAIgAUEBajYCFAzZAQtBAiEDDL8BC0ENIQMMvgELQSYhAwy9AQtBFSEDDLwBC0EWIQMMuwELQRghAwy6AQtBHCEDDLkBC0EdIQMMuAELQSAhAwy3AQtBISEDDLYBC0EjIQMMtQELQcYAIQMMtAELQS4hAwyzAQtBPSEDDLIBC0HLACEDDLEBC0HOACEDDLABC0HYACEDDK8BC0HZACEDDK4BC0HbACEDDK0BC0HxACEDDKwBC0H0ACEDDKsBC0GNASEDDKoBC0GXASEDDKkBC0GpASEDDKgBC0GvASEDDKcBC0GxASEDDKYBCyACQQA2AgALQQAhAyACQQA2AhwgAiABNgIUIAJB8Rs2AhAgAkEGNgIMDL0BCyACQQA2AgAgBkEBaiEBQSQLOgApIAIoAgQhACACQQA2AgQgAiAAIAEQJyIARQRAQeUAIQMMowELIAJB+QA2AhwgAiABNgIUIAIgADYCDEEAIQMMuwELIABBFUcEQCACQQA2AhwgAiABNgIUIAJBzA42AhAgAkEgNgIMQQAhAwy7AQsgAkH4ADYCHCACIAE2AhQgAkHKGDYCECACQRU2AgxBACEDDLoBCyACQQA2AhwgAiABNgIUIAJBjhs2AhAgAkEGNgIMQQAhAwy5AQsgAkEANgIcIAIgATYCFCACQf4RNgIQIAJBBzYCDEEAIQMMuAELIAJBADYCHCACIAE2AhQgAkGMHDYCECACQQc2AgxBACEDDLcBCyACQQA2AhwgAiABNgIUIAJBww82AhAgAkEHNgIMQQAhAwy2AQsgAkEANgIcIAIgATYCFCACQcMPNgIQIAJBBzYCDEEAIQMMtQELIAIoAgQhACACQQA2AgQgAiAAIAEQJSIARQ0RIAJB5QA2AhwgAiABNgIUIAIgADYCDEEAIQMMtAELIAIoAgQhACACQQA2AgQgAiAAIAEQJSIARQ0gIAJB0wA2AhwgAiABNgIUIAIgADYCDEEAIQMMswELIAIoAgQhACACQQA2AgQgAiAAIAEQJSIARQ0iIAJB0gA2AhwgAiABNgIUIAIgADYCDEEAIQMMsgELIAIoAgQhACACQQA2AgQgAiAAIAEQJSIARQ0OIAJB5QA2AhwgAiABNgIUIAIgADYCDEEAIQMMsQELIAIoAgQhACACQQA2AgQgAiAAIAEQJSIARQ0dIAJB0wA2AhwgAiABNgIUIAIgADYCDEEAIQMMsAELIAIoAgQhACACQQA2AgQgAiAAIAEQJSIARQ0fIAJB0gA2AhwgAiABNgIUIAIgADYCDEEAIQMMrwELIABBP0cNASABQQFqCyEBQQUhAwyUAQtBACEDIAJBADYCHCACIAE2AhQgAkH9EjYCECACQQc2AgwMrAELIAJBADYCHCACIAE2AhQgAkHcCDYCECACQQc2AgxBACEDDKsBCyACKAIEIQAgAkEANgIEIAIgACABECUiAEUNByACQeUANgIcIAIgATYCFCACIAA2AgxBACEDDKoBCyACKAIEIQAgAkEANgIEIAIgACABECUiAEUNFiACQdMANgIcIAIgATYCFCACIAA2AgxBACEDDKkBCyACKAIEIQAgAkEANgIEIAIgACABECUiAEUNGCACQdIANgIcIAIgATYCFCACIAA2AgxBACEDDKgBCyACQQA2AhwgAiABNgIUIAJBxgo2AhAgAkEHNgIMQQAhAwynAQsgAigCBCEAIAJBADYCBCACIAAgARAlIgBFDQMgAkHlADYCHCACIAE2AhQgAiAANgIMQQAhAwymAQsgAigCBCEAIAJBADYCBCACIAAgARAlIgBFDRIgAkHTADYCHCACIAE2AhQgAiAANgIMQQAhAwylAQsgAigCBCEAIAJBADYCBCACIAAgARAlIgBFDRQgAkHSADYCHCACIAE2AhQgAiAANgIMQQAhAwykAQsgAigCBCEAIAJBADYCBCACIAAgARAlIgBFDQAgAkHlADYCHCACIAE2AhQgAiAANgIMQQAhAwyjAQtB1QAhAwyJAQsgAEEVRwRAIAJBADYCHCACIAE2AhQgAkG5DTYCECACQRo2AgxBACEDDKIBCyACQeQANgIcIAIgATYCFCACQeMXNgIQIAJBFTYCDEEAIQMMoQELIAJBADYCACAGQQFqIQEgAi0AKSIAQSNrQQtJDQQCQCAAQQZLDQBBASAAdEHKAHFFDQAMBQtBACEDIAJBADYCHCACIAE2AhQgAkH3CTYCECACQQg2AgwMoAELIAJBADYCACAGQQFqIQEgAi0AKUEhRg0DIAJBADYCHCACIAE2AhQgAkGbCjYCECACQQg2AgxBACEDDJ8BCyACQQA2AgALQQAhAyACQQA2AhwgAiABNgIUIAJBkDM2AhAgAkEINgIMDJ0BCyACQQA2AgAgBkEBaiEBIAItAClBI0kNACACQQA2AhwgAiABNgIUIAJB0wk2AhAgAkEINgIMQQAhAwycAQtB0QAhAwyCAQsgAS0AAEEwayIAQf8BcUEKSQRAIAIgADoAKiABQQFqIQFBzwAhAwyCAQsgAigCBCEAIAJBADYCBCACIAAgARAoIgBFDYYBIAJB3gA2AhwgAiABNgIUIAIgADYCDEEAIQMMmgELIAIoAgQhACACQQA2AgQgAiAAIAEQKCIARQ2GASACQdwANgIcIAIgATYCFCACIAA2AgxBACEDDJkBCyACKAIEIQAgAkEANgIEIAIgACAFECgiAEUEQCAFIQEMhwELIAJB2gA2AhwgAiAFNgIUIAIgADYCDAyYAQtBACEBQQEhAwsgAiADOgArIAVBAWohAwJAAkACQCACLQAtQRBxDQACQAJAAkAgAi0AKg4DAQACBAsgBkUNAwwCCyAADQEMAgsgAUUNAQsgAigCBCEAIAJBADYCBCACIAAgAxAoIgBFBEAgAyEBDAILIAJB2AA2AhwgAiADNgIUIAIgADYCDEEAIQMMmAELIAIoAgQhACACQQA2AgQgAiAAIAMQKCIARQRAIAMhAQyHAQsgAkHZADYCHCACIAM2AhQgAiAANgIMQQAhAwyXAQtBzAAhAwx9CyAAQRVHBEAgAkEANgIcIAIgATYCFCACQZQNNgIQIAJBITYCDEEAIQMMlgELIAJB1wA2AhwgAiABNgIUIAJByRc2AhAgAkEVNgIMQQAhAwyVAQtBACEDIAJBADYCHCACIAE2AhQgAkGAETYCECACQQk2AgwMlAELIAIoAgQhACACQQA2AgQgAiAAIAEQJSIARQ0AIAJB0wA2AhwgAiABNgIUIAIgADYCDEEAIQMMkwELQckAIQMMeQsgAkEANgIcIAIgATYCFCACQcEoNgIQIAJBBzYCDCACQQA2AgBBACEDDJEBCyACKAIEIQBBACEDIAJBADYCBCACIAAgARAlIgBFDQAgAkHSADYCHCACIAE2AhQgAiAANgIMDJABC0HIACEDDHYLIAJBADYCACAFIQELIAJBgBI7ASogAUEBaiEBQQAhAAJAIAIoAjgiA0UNACADKAIwIgNFDQAgAiADEQAAIQALIAANAQtBxwAhAwxzCyAAQRVGBEAgAkHRADYCHCACIAE2AhQgAkHjFzYCECACQRU2AgxBACEDDIwBC0EAIQMgAkEANgIcIAIgATYCFCACQbkNNgIQIAJBGjYCDAyLAQtBACEDIAJBADYCHCACIAE2AhQgAkGgGTYCECACQR42AgwMigELIAEtAABBOkYEQCACKAIEIQBBACEDIAJBADYCBCACIAAgARApIgBFDQEgAkHDADYCHCACIAA2AgwgAiABQQFqNgIUDIoBC0EAIQMgAkEANgIcIAIgATYCFCACQbERNgIQIAJBCjYCDAyJAQsgAUEBaiEBQTshAwxvCyACQcMANgIcIAIgADYCDCACIAFBAWo2AhQMhwELQQAhAyACQQA2AhwgAiABNgIUIAJB8A42AhAgAkEcNgIMDIYBCyACIAIvATBBEHI7ATAMZgsCQCACLwEwIgBBCHFFDQAgAi0AKEEBRw0AIAItAC1BCHFFDQMLIAIgAEH3+wNxQYAEcjsBMAwECyABIARHBEACQANAIAEtAABBMGsiAEH/AXFBCk8EQEE1IQMMbgsgAikDICIKQpmz5syZs+bMGVYNASACIApCCn4iCjcDICAKIACtQv8BgyILQn+FVg0BIAIgCiALfDcDICAEIAFBAWoiAUcNAAtBOSEDDIUBCyACKAIEIQBBACEDIAJBADYCBCACIAAgAUEBaiIBECoiAA0MDHcLQTkhAwyDAQsgAi0AMEEgcQ0GQcUBIQMMaQtBACEDIAJBADYCBCACIAEgARAqIgBFDQQgAkE6NgIcIAIgADYCDCACIAFBAWo2AhQMgQELIAItAChBAUcNACACLQAtQQhxRQ0BC0E3IQMMZgsgAigCBCEAQQAhAyACQQA2AgQgAiAAIAEQKiIABEAgAkE7NgIcIAIgADYCDCACIAFBAWo2AhQMfwsgAUEBaiEBDG4LIAJBCDoALAwECyABQQFqIQEMbQtBACEDIAJBADYCHCACIAE2AhQgAkHkEjYCECACQQQ2AgwMewsgAigCBCEAQQAhAyACQQA2AgQgAiAAIAEQKiIARQ1sIAJBNzYCHCACIAE2AhQgAiAANgIMDHoLIAIgAi8BMEEgcjsBMAtBMCEDDF8LIAJBNjYCHCACIAE2AhQgAiAANgIMDHcLIABBLEcNASABQQFqIQBBASEBAkACQAJAAkACQCACLQAsQQVrDgQDAQIEAAsgACEBDAQLQQIhAQwBC0EEIQELIAJBAToALCACIAIvATAgAXI7ATAgACEBDAELIAIgAi8BMEEIcjsBMCAAIQELQTkhAwxcCyACQQA6ACwLQTQhAwxaCyABIARGBEBBLSEDDHMLAkACQANAAkAgAS0AAEEKaw4EAgAAAwALIAQgAUEBaiIBRw0AC0EtIQMMdAsgAigCBCEAQQAhAyACQQA2AgQgAiAAIAEQKiIARQ0CIAJBLDYCHCACIAE2AhQgAiAANgIMDHMLIAIoAgQhAEEAIQMgAkEANgIEIAIgACABECoiAEUEQCABQQFqIQEMAgsgAkEsNgIcIAIgADYCDCACIAFBAWo2AhQMcgsgAS0AAEENRgRAIAIoAgQhAEEAIQMgAkEANgIEIAIgACABECoiAEUEQCABQQFqIQEMAgsgAkEsNgIcIAIgADYCDCACIAFBAWo2AhQMcgsgAi0ALUEBcQRAQcQBIQMMWQsgAigCBCEAQQAhAyACQQA2AgQgAiAAIAEQKiIADQEMZQtBLyEDDFcLIAJBLjYCHCACIAE2AhQgAiAANgIMDG8LQQAhAyACQQA2AhwgAiABNgIUIAJB8BQ2AhAgAkEDNgIMDG4LQQEhAwJAAkACQAJAIAItACxBBWsOBAMBAgAECyACIAIvATBBCHI7ATAMAwtBAiEDDAELQQQhAwsgAkEBOgAsIAIgAi8BMCADcjsBMAtBKiEDDFMLQQAhAyACQQA2AhwgAiABNgIUIAJB4Q82AhAgAkEKNgIMDGsLQQEhAwJAAkACQAJAAkACQCACLQAsQQJrDgcFBAQDAQIABAsgAiACLwEwQQhyOwEwDAMLQQIhAwwBC0EEIQMLIAJBAToALCACIAIvATAgA3I7ATALQSshAwxSC0EAIQMgAkEANgIcIAIgATYCFCACQasSNgIQIAJBCzYCDAxqC0EAIQMgAkEANgIcIAIgATYCFCACQf0NNgIQIAJBHTYCDAxpCyABIARHBEADQCABLQAAQSBHDUggBCABQQFqIgFHDQALQSUhAwxpC0ElIQMMaAsgAi0ALUEBcQRAQcMBIQMMTwsgAigCBCEAQQAhAyACQQA2AgQgAiAAIAEQKSIABEAgAkEmNgIcIAIgADYCDCACIAFBAWo2AhQMaAsgAUEBaiEBDFwLIAFBAWohASACLwEwIgBBgAFxBEBBACEAAkAgAigCOCIDRQ0AIAMoAlQiA0UNACACIAMRAAAhAAsgAEUNBiAAQRVHDR8gAkEFNgIcIAIgATYCFCACQfkXNgIQIAJBFTYCDEEAIQMMZwsCQCAAQaAEcUGgBEcNACACLQAtQQJxDQBBACEDIAJBADYCHCACIAE2AhQgAkGWEzYCECACQQQ2AgwMZwsgAgJ/IAIvATBBFHFBFEYEQEEBIAItAChBAUYNARogAi8BMkHlAEYMAQsgAi0AKUEFRgs6AC5BACEAAkAgAigCOCIDRQ0AIAMoAiQiA0UNACACIAMRAAAhAAsCQAJAAkACQAJAIAAOFgIBAAQEBAQEBAQEBAQEBAQEBAQEBAMECyACQQE6AC4LIAIgAi8BMEHAAHI7ATALQSchAwxPCyACQSM2AhwgAiABNgIUIAJBpRY2AhAgAkEVNgIMQQAhAwxnC0EAIQMgAkEANgIcIAIgATYCFCACQdULNgIQIAJBETYCDAxmC0EAIQACQCACKAI4IgNFDQAgAygCLCIDRQ0AIAIgAxEAACEACyAADQELQQ4hAwxLCyAAQRVGBEAgAkECNgIcIAIgATYCFCACQbAYNgIQIAJBFTYCDEEAIQMMZAtBACEDIAJBADYCHCACIAE2AhQgAkGnDjYCECACQRI2AgwMYwtBACEDIAJBADYCHCACIAE2AhQgAkGqHDYCECACQQ82AgwMYgsgAigCBCEAQQAhAyACQQA2AgQgAiAAIAEgCqdqIgEQKyIARQ0AIAJBBTYCHCACIAE2AhQgAiAANgIMDGELQQ8hAwxHC0EAIQMgAkEANgIcIAIgATYCFCACQc0TNgIQIAJBDDYCDAxfC0IBIQoLIAFBAWohAQJAIAIpAyAiC0L//////////w9YBEAgAiALQgSGIAqENwMgDAELQQAhAyACQQA2AhwgAiABNgIUIAJBrQk2AhAgAkEMNgIMDF4LQSQhAwxEC0EAIQMgAkEANgIcIAIgATYCFCACQc0TNgIQIAJBDDYCDAxcCyACKAIEIQBBACEDIAJBADYCBCACIAAgARAsIgBFBEAgAUEBaiEBDFILIAJBFzYCHCACIAA2AgwgAiABQQFqNgIUDFsLIAIoAgQhAEEAIQMgAkEANgIEAkAgAiAAIAEQLCIARQRAIAFBAWohAQwBCyACQRY2AhwgAiAANgIMIAIgAUEBajYCFAxbC0EfIQMMQQtBACEDIAJBADYCHCACIAE2AhQgAkGaDzYCECACQSI2AgwMWQsgAigCBCEAQQAhAyACQQA2AgQgAiAAIAEQLSIARQRAIAFBAWohAQxQCyACQRQ2AhwgAiAANgIMIAIgAUEBajYCFAxYCyACKAIEIQBBACEDIAJBADYCBAJAIAIgACABEC0iAEUEQCABQQFqIQEMAQsgAkETNgIcIAIgADYCDCACIAFBAWo2AhQMWAtBHiEDDD4LQQAhAyACQQA2AhwgAiABNgIUIAJBxgw2AhAgAkEjNgIMDFYLIAIoAgQhAEEAIQMgAkEANgIEIAIgACABEC0iAEUEQCABQQFqIQEMTgsgAkERNgIcIAIgADYCDCACIAFBAWo2AhQMVQsgAkEQNgIcIAIgATYCFCACIAA2AgwMVAtBACEDIAJBADYCHCACIAE2AhQgAkHGDDYCECACQSM2AgwMUwtBACEDIAJBADYCHCACIAE2AhQgAkHAFTYCECACQQI2AgwMUgsgAigCBCEAQQAhAyACQQA2AgQCQCACIAAgARAtIgBFBEAgAUEBaiEBDAELIAJBDjYCHCACIAA2AgwgAiABQQFqNgIUDFILQRshAww4C0EAIQMgAkEANgIcIAIgATYCFCACQcYMNgIQIAJBIzYCDAxQCyACKAIEIQBBACEDIAJBADYCBAJAIAIgACABECwiAEUEQCABQQFqIQEMAQsgAkENNgIcIAIgADYCDCACIAFBAWo2AhQMUAtBGiEDDDYLQQAhAyACQQA2AhwgAiABNgIUIAJBmg82AhAgAkEiNgIMDE4LIAIoAgQhAEEAIQMgAkEANgIEAkAgAiAAIAEQLCIARQRAIAFBAWohAQwBCyACQQw2AhwgAiAANgIMIAIgAUEBajYCFAxOC0EZIQMMNAtBACEDIAJBADYCHCACIAE2AhQgAkGaDzYCECACQSI2AgwMTAsgAEEVRwRAQQAhAyACQQA2AhwgAiABNgIUIAJBgww2AhAgAkETNgIMDEwLIAJBCjYCHCACIAE2AhQgAkHkFjYCECACQRU2AgxBACEDDEsLIAIoAgQhAEEAIQMgAkEANgIEIAIgACABIAqnaiIBECsiAARAIAJBBzYCHCACIAE2AhQgAiAANgIMDEsLQRMhAwwxCyAAQRVHBEBBACEDIAJBADYCHCACIAE2AhQgAkHaDTYCECACQRQ2AgwMSgsgAkEeNgIcIAIgATYCFCACQfkXNgIQIAJBFTYCDEEAIQMMSQtBACEAAkAgAigCOCIDRQ0AIAMoAiwiA0UNACACIAMRAAAhAAsgAEUNQSAAQRVGBEAgAkEDNgIcIAIgATYCFCACQbAYNgIQIAJBFTYCDEEAIQMMSQtBACEDIAJBADYCHCACIAE2AhQgAkGnDjYCECACQRI2AgwMSAtBACEDIAJBADYCHCACIAE2AhQgAkHaDTYCECACQRQ2AgwMRwtBACEDIAJBADYCHCACIAE2AhQgAkGnDjYCECACQRI2AgwMRgsgAkEAOgAvIAItAC1BBHFFDT8LIAJBADoALyACQQE6ADRBACEDDCsLQQAhAyACQQA2AhwgAkHkETYCECACQQc2AgwgAiABQQFqNgIUDEMLAkADQAJAIAEtAABBCmsOBAACAgACCyAEIAFBAWoiAUcNAAtB3QEhAwxDCwJAAkAgAi0ANEEBRw0AQQAhAAJAIAIoAjgiA0UNACADKAJYIgNFDQAgAiADEQAAIQALIABFDQAgAEEVRw0BIAJB3AE2AhwgAiABNgIUIAJB1RY2AhAgAkEVNgIMQQAhAwxEC0HBASEDDCoLIAJBADYCHCACIAE2AhQgAkHpCzYCECACQR82AgxBACEDDEILAkACQCACLQAoQQFrDgIEAQALQcABIQMMKQtBuQEhAwwoCyACQQI6AC9BACEAAkAgAigCOCIDRQ0AIAMoAgAiA0UNACACIAMRAAAhAAsgAEUEQEHCASEDDCgLIABBFUcEQCACQQA2AhwgAiABNgIUIAJBpAw2AhAgAkEQNgIMQQAhAwxBCyACQdsBNgIcIAIgATYCFCACQfoWNgIQIAJBFTYCDEEAIQMMQAsgASAERgRAQdoBIQMMQAsgAS0AAEHIAEYNASACQQE6ACgLQawBIQMMJQtBvwEhAwwkCyABIARHBEAgAkEQNgIIIAIgATYCBEG+ASEDDCQLQdkBIQMMPAsgASAERgRAQdgBIQMMPAsgAS0AAEHIAEcNBCABQQFqIQFBvQEhAwwiCyABIARGBEBB1wEhAww7CwJAAkAgAS0AAEHFAGsOEAAFBQUFBQUFBQUFBQUFBQEFCyABQQFqIQFBuwEhAwwiCyABQQFqIQFBvAEhAwwhC0HWASEDIAEgBEYNOSACKAIAIgAgBCABa2ohBSABIABrQQJqIQYCQANAIAEtAAAgAEGD0ABqLQAARw0DIABBAkYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAw6CyACKAIEIQAgAkIANwMAIAIgACAGQQFqIgEQJyIARQRAQcYBIQMMIQsgAkHVATYCHCACIAE2AhQgAiAANgIMQQAhAww5C0HUASEDIAEgBEYNOCACKAIAIgAgBCABa2ohBSABIABrQQFqIQYCQANAIAEtAAAgAEGB0ABqLQAARw0CIABBAUYNASAAQQFqIQAgBCABQQFqIgFHDQALIAIgBTYCAAw5CyACQYEEOwEoIAIoAgQhACACQgA3AwAgAiAAIAZBAWoiARAnIgANAwwCCyACQQA2AgALQQAhAyACQQA2AhwgAiABNgIUIAJB2Bs2AhAgAkEINgIMDDYLQboBIQMMHAsgAkHTATYCHCACIAE2AhQgAiAANgIMQQAhAww0C0EAIQACQCACKAI4IgNFDQAgAygCOCIDRQ0AIAIgAxEAACEACyAARQ0AIABBFUYNASACQQA2AhwgAiABNgIUIAJBzA42AhAgAkEgNgIMQQAhAwwzC0HkACEDDBkLIAJB+AA2AhwgAiABNgIUIAJByhg2AhAgAkEVNgIMQQAhAwwxC0HSASEDIAQgASIARg0wIAQgAWsgAigCACIBaiEFIAAgAWtBBGohBgJAA0AgAC0AACABQfzPAGotAABHDQEgAUEERg0DIAFBAWohASAEIABBAWoiAEcNAAsgAiAFNgIADDELIAJBADYCHCACIAA2AhQgAkGQMzYCECACQQg2AgwgAkEANgIAQQAhAwwwCyABIARHBEAgAkEONgIIIAIgATYCBEG3ASEDDBcLQdEBIQMMLwsgAkEANgIAIAZBAWohAQtBuAEhAwwUCyABIARGBEBB0AEhAwwtCyABLQAAQTBrIgBB/wFxQQpJBEAgAiAAOgAqIAFBAWohAUG2ASEDDBQLIAIoAgQhACACQQA2AgQgAiAAIAEQKCIARQ0UIAJBzwE2AhwgAiABNgIUIAIgADYCDEEAIQMMLAsgASAERgRAQc4BIQMMLAsCQCABLQAAQS5GBEAgAUEBaiEBDAELIAIoAgQhACACQQA2AgQgAiAAIAEQKCIARQ0VIAJBzQE2AhwgAiABNgIUIAIgADYCDEEAIQMMLAtBtQEhAwwSCyAEIAEiBUYEQEHMASEDDCsLQQAhAEEBIQFBASEGQQAhAwJAAkACQAJAAkACfwJAAkACQAJAAkACQAJAIAUtAABBMGsOCgoJAAECAwQFBggLC0ECDAYLQQMMBQtBBAwEC0EFDAMLQQYMAgtBBwwBC0EICyEDQQAhAUEAIQYMAgtBCSEDQQEhAEEAIQFBACEGDAELQQAhAUEBIQMLIAIgAzoAKyAFQQFqIQMCQAJAIAItAC1BEHENAAJAAkACQCACLQAqDgMBAAIECyAGRQ0DDAILIAANAQwCCyABRQ0BCyACKAIEIQAgAkEANgIEIAIgACADECgiAEUEQCADIQEMAwsgAkHJATYCHCACIAM2AhQgAiAANgIMQQAhAwwtCyACKAIEIQAgAkEANgIEIAIgACADECgiAEUEQCADIQEMGAsgAkHKATYCHCACIAM2AhQgAiAANgIMQQAhAwwsCyACKAIEIQAgAkEANgIEIAIgACAFECgiAEUEQCAFIQEMFgsgAkHLATYCHCACIAU2AhQgAiAANgIMDCsLQbQBIQMMEQtBACEAAkAgAigCOCIDRQ0AIAMoAjwiA0UNACACIAMRAAAhAAsCQCAABEAgAEEVRg0BIAJBADYCHCACIAE2AhQgAkGUDTYCECACQSE2AgxBACEDDCsLQbIBIQMMEQsgAkHIATYCHCACIAE2AhQgAkHJFzYCECACQRU2AgxBACEDDCkLIAJBADYCACAGQQFqIQFB9QAhAwwPCyACLQApQQVGBEBB4wAhAwwPC0HiACEDDA4LIAAhASACQQA2AgALIAJBADoALEEJIQMMDAsgAkEANgIAIAdBAWohAUHAACEDDAsLQQELOgAsIAJBADYCACAGQQFqIQELQSkhAwwIC0E4IQMMBwsCQCABIARHBEADQCABLQAAQYA+ai0AACIAQQFHBEAgAEECRw0DIAFBAWohAQwFCyAEIAFBAWoiAUcNAAtBPiEDDCELQT4hAwwgCwsgAkEAOgAsDAELQQshAwwEC0E6IQMMAwsgAUEBaiEBQS0hAwwCCyACIAE6ACwgAkEANgIAIAZBAWohAUEMIQMMAQsgAkEANgIAIAZBAWohAUEKIQMMAAsAC0EAIQMgAkEANgIcIAIgATYCFCACQc0QNgIQIAJBCTYCDAwXC0EAIQMgAkEANgIcIAIgATYCFCACQekKNgIQIAJBCTYCDAwWC0EAIQMgAkEANgIcIAIgATYCFCACQbcQNgIQIAJBCTYCDAwVC0EAIQMgAkEANgIcIAIgATYCFCACQZwRNgIQIAJBCTYCDAwUC0EAIQMgAkEANgIcIAIgATYCFCACQc0QNgIQIAJBCTYCDAwTC0EAIQMgAkEANgIcIAIgATYCFCACQekKNgIQIAJBCTYCDAwSC0EAIQMgAkEANgIcIAIgATYCFCACQbcQNgIQIAJBCTYCDAwRC0EAIQMgAkEANgIcIAIgATYCFCACQZwRNgIQIAJBCTYCDAwQC0EAIQMgAkEANgIcIAIgATYCFCACQZcVNgIQIAJBDzYCDAwPC0EAIQMgAkEANgIcIAIgATYCFCACQZcVNgIQIAJBDzYCDAwOC0EAIQMgAkEANgIcIAIgATYCFCACQcASNgIQIAJBCzYCDAwNC0EAIQMgAkEANgIcIAIgATYCFCACQZUJNgIQIAJBCzYCDAwMC0EAIQMgAkEANgIcIAIgATYCFCACQeEPNgIQIAJBCjYCDAwLC0EAIQMgAkEANgIcIAIgATYCFCACQfsPNgIQIAJBCjYCDAwKC0EAIQMgAkEANgIcIAIgATYCFCACQfEZNgIQIAJBAjYCDAwJC0EAIQMgAkEANgIcIAIgATYCFCACQcQUNgIQIAJBAjYCDAwIC0EAIQMgAkEANgIcIAIgATYCFCACQfIVNgIQIAJBAjYCDAwHCyACQQI2AhwgAiABNgIUIAJBnBo2AhAgAkEWNgIMQQAhAwwGC0EBIQMMBQtB1AAhAyABIARGDQQgCEEIaiEJIAIoAgAhBQJAAkAgASAERwRAIAVB2MIAaiEHIAQgBWogAWshACAFQX9zQQpqIgUgAWohBgNAIAEtAAAgBy0AAEcEQEECIQcMAwsgBUUEQEEAIQcgBiEBDAMLIAVBAWshBSAHQQFqIQcgBCABQQFqIgFHDQALIAAhBSAEIQELIAlBATYCACACIAU2AgAMAQsgAkEANgIAIAkgBzYCAAsgCSABNgIEIAgoAgwhACAIKAIIDgMBBAIACwALIAJBADYCHCACQbUaNgIQIAJBFzYCDCACIABBAWo2AhRBACEDDAILIAJBADYCHCACIAA2AhQgAkHKGjYCECACQQk2AgxBACEDDAELIAEgBEYEQEEiIQMMAQsgAkEJNgIIIAIgATYCBEEhIQMLIAhBEGokACADRQRAIAIoAgwhAAwBCyACIAM2AhxBACEAIAIoAgQiAUUNACACIAEgBCACKAIIEQEAIgFFDQAgAiAENgIUIAIgATYCDCABIQALIAALvgIBAn8gAEEAOgAAIABB3ABqIgFBAWtBADoAACAAQQA6AAIgAEEAOgABIAFBA2tBADoAACABQQJrQQA6AAAgAEEAOgADIAFBBGtBADoAAEEAIABrQQNxIgEgAGoiAEEANgIAQdwAIAFrQXxxIgIgAGoiAUEEa0EANgIAAkAgAkEJSQ0AIABBADYCCCAAQQA2AgQgAUEIa0EANgIAIAFBDGtBADYCACACQRlJDQAgAEEANgIYIABBADYCFCAAQQA2AhAgAEEANgIMIAFBEGtBADYCACABQRRrQQA2AgAgAUEYa0EANgIAIAFBHGtBADYCACACIABBBHFBGHIiAmsiAUEgSQ0AIAAgAmohAANAIABCADcDGCAAQgA3AxAgAEIANwMIIABCADcDACAAQSBqIQAgAUEgayIBQR9LDQALCwtWAQF/AkAgACgCDA0AAkACQAJAAkAgAC0ALw4DAQADAgsgACgCOCIBRQ0AIAEoAiwiAUUNACAAIAERAAAiAQ0DC0EADwsACyAAQcMWNgIQQQ4hAQsgAQsaACAAKAIMRQRAIABB0Rs2AhAgAEEVNgIMCwsUACAAKAIMQRVGBEAgAEEANgIMCwsUACAAKAIMQRZGBEAgAEEANgIMCwsHACAAKAIMCwcAIAAoAhALCQAgACABNgIQCwcAIAAoAhQLFwAgAEEkTwRAAAsgAEECdEGgM2ooAgALFwAgAEEuTwRAAAsgAEECdEGwNGooAgALvwkBAX9B6yghAQJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAIABB5ABrDvQDY2IAAWFhYWFhYQIDBAVhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhBgcICQoLDA0OD2FhYWFhEGFhYWFhYWFhYWFhEWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYRITFBUWFxgZGhthYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhHB0eHyAhIiMkJSYnKCkqKywtLi8wMTIzNDU2YTc4OTphYWFhYWFhYTthYWE8YWFhYT0+P2FhYWFhYWFhQGFhQWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYUJDREVGR0hJSktMTU5PUFFSU2FhYWFhYWFhVFVWV1hZWlthXF1hYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFeYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhX2BhC0HhJw8LQaQhDwtByywPC0H+MQ8LQcAkDwtBqyQPC0GNKA8LQeImDwtBgDAPC0G5Lw8LQdckDwtB7x8PC0HhHw8LQfofDwtB8iAPC0GoLw8LQa4yDwtBiDAPC0HsJw8LQYIiDwtBjh0PC0HQLg8LQcojDwtBxTIPC0HfHA8LQdIcDwtBxCAPC0HXIA8LQaIfDwtB7S4PC0GrMA8LQdQlDwtBzC4PC0H6Lg8LQfwrDwtB0jAPC0HxHQ8LQbsgDwtB9ysPC0GQMQ8LQdcxDwtBoi0PC0HUJw8LQeArDwtBnywPC0HrMQ8LQdUfDwtByjEPC0HeJQ8LQdQeDwtB9BwPC0GnMg8LQbEdDwtBoB0PC0G5MQ8LQbwwDwtBkiEPC0GzJg8LQeksDwtBrB4PC0HUKw8LQfcmDwtBgCYPC0GwIQ8LQf4eDwtBjSMPC0GJLQ8LQfciDwtBoDEPC0GuHw8LQcYlDwtB6B4PC0GTIg8LQcIvDwtBwx0PC0GLLA8LQeEdDwtBjS8PC0HqIQ8LQbQtDwtB0i8PC0HfMg8LQdIyDwtB8DAPC0GpIg8LQfkjDwtBmR4PC0G1LA8LQZswDwtBkjIPC0G2Kw8LQcIiDwtB+DIPC0GeJQ8LQdAiDwtBuh4PC0GBHg8LAAtB1iEhAQsgAQsWACAAIAAtAC1B/gFxIAFBAEdyOgAtCxkAIAAgAC0ALUH9AXEgAUEAR0EBdHI6AC0LGQAgACAALQAtQfsBcSABQQBHQQJ0cjoALQsZACAAIAAtAC1B9wFxIAFBAEdBA3RyOgAtCz4BAn8CQCAAKAI4IgNFDQAgAygCBCIDRQ0AIAAgASACIAFrIAMRAQAiBEF/Rw0AIABBxhE2AhBBGCEECyAECz4BAn8CQCAAKAI4IgNFDQAgAygCCCIDRQ0AIAAgASACIAFrIAMRAQAiBEF/Rw0AIABB9go2AhBBGCEECyAECz4BAn8CQCAAKAI4IgNFDQAgAygCDCIDRQ0AIAAgASACIAFrIAMRAQAiBEF/Rw0AIABB7Ro2AhBBGCEECyAECz4BAn8CQCAAKAI4IgNFDQAgAygCECIDRQ0AIAAgASACIAFrIAMRAQAiBEF/Rw0AIABBlRA2AhBBGCEECyAECz4BAn8CQCAAKAI4IgNFDQAgAygCFCIDRQ0AIAAgASACIAFrIAMRAQAiBEF/Rw0AIABBqhs2AhBBGCEECyAECz4BAn8CQCAAKAI4IgNFDQAgAygCGCIDRQ0AIAAgASACIAFrIAMRAQAiBEF/Rw0AIABB7RM2AhBBGCEECyAECz4BAn8CQCAAKAI4IgNFDQAgAygCKCIDRQ0AIAAgASACIAFrIAMRAQAiBEF/Rw0AIABB9gg2AhBBGCEECyAECz4BAn8CQCAAKAI4IgNFDQAgAygCHCIDRQ0AIAAgASACIAFrIAMRAQAiBEF/Rw0AIABBwhk2AhBBGCEECyAECz4BAn8CQCAAKAI4IgNFDQAgAygCICIDRQ0AIAAgASACIAFrIAMRAQAiBEF/Rw0AIABBlBQ2AhBBGCEECyAEC1kBAn8CQCAALQAoQQFGDQAgAC8BMiIBQeQAa0HkAEkNACABQcwBRg0AIAFBsAJGDQAgAC8BMCIAQcAAcQ0AQQEhAiAAQYgEcUGABEYNACAAQShxRSECCyACC4wBAQJ/AkACQAJAIAAtACpFDQAgAC0AK0UNACAALwEwIgFBAnFFDQEMAgsgAC8BMCIBQQFxRQ0BC0EBIQIgAC0AKEEBRg0AIAAvATIiAEHkAGtB5ABJDQAgAEHMAUYNACAAQbACRg0AIAFBwABxDQBBACECIAFBiARxQYAERg0AIAFBKHFBAEchAgsgAgtzACAAQRBq/QwAAAAAAAAAAAAAAAAAAAAA/QsDACAA/QwAAAAAAAAAAAAAAAAAAAAA/QsDACAAQTBq/QwAAAAAAAAAAAAAAAAAAAAA/QsDACAAQSBq/QwAAAAAAAAAAAAAAAAAAAAA/QsDACAAQd0BNgIcCwYAIAAQMguaLQELfyMAQRBrIgokAEGk0AAoAgAiCUUEQEHk0wAoAgAiBUUEQEHw0wBCfzcCAEHo0wBCgICEgICAwAA3AgBB5NMAIApBCGpBcHFB2KrVqgVzIgU2AgBB+NMAQQA2AgBByNMAQQA2AgALQczTAEGA1AQ2AgBBnNAAQYDUBDYCAEGw0AAgBTYCAEGs0ABBfzYCAEHQ0wBBgKwDNgIAA0AgAUHI0ABqIAFBvNAAaiICNgIAIAIgAUG00ABqIgM2AgAgAUHA0ABqIAM2AgAgAUHQ0ABqIAFBxNAAaiIDNgIAIAMgAjYCACABQdjQAGogAUHM0ABqIgI2AgAgAiADNgIAIAFB1NAAaiACNgIAIAFBIGoiAUGAAkcNAAtBjNQEQcGrAzYCAEGo0ABB9NMAKAIANgIAQZjQAEHAqwM2AgBBpNAAQYjUBDYCAEHM/wdBODYCAEGI1AQhCQsCQAJAAkACQAJAAkACQAJAAkACQAJAAkACQAJAAkACQCAAQewBTQRAQYzQACgCACIGQRAgAEETakFwcSAAQQtJGyIEQQN2IgB2IgFBA3EEQAJAIAFBAXEgAHJBAXMiAkEDdCIAQbTQAGoiASAAQbzQAGooAgAiACgCCCIDRgRAQYzQACAGQX4gAndxNgIADAELIAEgAzYCCCADIAE2AgwLIABBCGohASAAIAJBA3QiAkEDcjYCBCAAIAJqIgAgACgCBEEBcjYCBAwRC0GU0AAoAgAiCCAETw0BIAEEQAJAQQIgAHQiAkEAIAJrciABIAB0cWgiAEEDdCICQbTQAGoiASACQbzQAGooAgAiAigCCCIDRgRAQYzQACAGQX4gAHdxIgY2AgAMAQsgASADNgIIIAMgATYCDAsgAiAEQQNyNgIEIABBA3QiACAEayEFIAAgAmogBTYCACACIARqIgQgBUEBcjYCBCAIBEAgCEF4cUG00ABqIQBBoNAAKAIAIQMCf0EBIAhBA3Z0IgEgBnFFBEBBjNAAIAEgBnI2AgAgAAwBCyAAKAIICyIBIAM2AgwgACADNgIIIAMgADYCDCADIAE2AggLIAJBCGohAUGg0AAgBDYCAEGU0AAgBTYCAAwRC0GQ0AAoAgAiC0UNASALaEECdEG80gBqKAIAIgAoAgRBeHEgBGshBSAAIQIDQAJAIAIoAhAiAUUEQCACQRRqKAIAIgFFDQELIAEoAgRBeHEgBGsiAyAFSSECIAMgBSACGyEFIAEgACACGyEAIAEhAgwBCwsgACgCGCEJIAAoAgwiAyAARwRAQZzQACgCABogAyAAKAIIIgE2AgggASADNgIMDBALIABBFGoiAigCACIBRQRAIAAoAhAiAUUNAyAAQRBqIQILA0AgAiEHIAEiA0EUaiICKAIAIgENACADQRBqIQIgAygCECIBDQALIAdBADYCAAwPC0F/IQQgAEG/f0sNACAAQRNqIgFBcHEhBEGQ0AAoAgAiCEUNAEEAIARrIQUCQAJAAkACf0EAIARBgAJJDQAaQR8gBEH///8HSw0AGiAEQSYgAUEIdmciAGt2QQFxIABBAXRrQT5qCyIGQQJ0QbzSAGooAgAiAkUEQEEAIQFBACEDDAELQQAhASAEQRkgBkEBdmtBACAGQR9HG3QhAEEAIQMDQAJAIAIoAgRBeHEgBGsiByAFTw0AIAIhAyAHIgUNAEEAIQUgAiEBDAMLIAEgAkEUaigCACIHIAcgAiAAQR12QQRxakEQaigCACICRhsgASAHGyEBIABBAXQhACACDQALCyABIANyRQRAQQAhA0ECIAZ0IgBBACAAa3IgCHEiAEUNAyAAaEECdEG80gBqKAIAIQELIAFFDQELA0AgASgCBEF4cSAEayICIAVJIQAgAiAFIAAbIQUgASADIAAbIQMgASgCECIABH8gAAUgAUEUaigCAAsiAQ0ACwsgA0UNACAFQZTQACgCACAEa08NACADKAIYIQcgAyADKAIMIgBHBEBBnNAAKAIAGiAAIAMoAggiATYCCCABIAA2AgwMDgsgA0EUaiICKAIAIgFFBEAgAygCECIBRQ0DIANBEGohAgsDQCACIQYgASIAQRRqIgIoAgAiAQ0AIABBEGohAiAAKAIQIgENAAsgBkEANgIADA0LQZTQACgCACIDIARPBEBBoNAAKAIAIQECQCADIARrIgJBEE8EQCABIARqIgAgAkEBcjYCBCABIANqIAI2AgAgASAEQQNyNgIEDAELIAEgA0EDcjYCBCABIANqIgAgACgCBEEBcjYCBEEAIQBBACECC0GU0AAgAjYCAEGg0AAgADYCACABQQhqIQEMDwtBmNAAKAIAIgMgBEsEQCAEIAlqIgAgAyAEayIBQQFyNgIEQaTQACAANgIAQZjQACABNgIAIAkgBEEDcjYCBCAJQQhqIQEMDwtBACEBIAQCf0Hk0wAoAgAEQEHs0wAoAgAMAQtB8NMAQn83AgBB6NMAQoCAhICAgMAANwIAQeTTACAKQQxqQXBxQdiq1aoFczYCAEH40wBBADYCAEHI0wBBADYCAEGAgAQLIgAgBEHHAGoiBWoiBkEAIABrIgdxIgJPBEBB/NMAQTA2AgAMDwsCQEHE0wAoAgAiAUUNAEG80wAoAgAiCCACaiEAIAAgAU0gACAIS3ENAEEAIQFB/NMAQTA2AgAMDwtByNMALQAAQQRxDQQCQAJAIAkEQEHM0wAhAQNAIAEoAgAiACAJTQRAIAAgASgCBGogCUsNAwsgASgCCCIBDQALC0EAEDMiAEF/Rg0FIAIhBkHo0wAoAgAiAUEBayIDIABxBEAgAiAAayAAIANqQQAgAWtxaiEGCyAEIAZPDQUgBkH+////B0sNBUHE0wAoAgAiAwRAQbzTACgCACIHIAZqIQEgASAHTQ0GIAEgA0sNBgsgBhAzIgEgAEcNAQwHCyAGIANrIAdxIgZB/v///wdLDQQgBhAzIQAgACABKAIAIAEoAgRqRg0DIAAhAQsCQCAGIARByABqTw0AIAFBf0YNAEHs0wAoAgAiACAFIAZrakEAIABrcSIAQf7///8HSwRAIAEhAAwHCyAAEDNBf0cEQCAAIAZqIQYgASEADAcLQQAgBmsQMxoMBAsgASIAQX9HDQUMAwtBACEDDAwLQQAhAAwKCyAAQX9HDQILQcjTAEHI0wAoAgBBBHI2AgALIAJB/v///wdLDQEgAhAzIQBBABAzIQEgAEF/Rg0BIAFBf0YNASAAIAFPDQEgASAAayIGIARBOGpNDQELQbzTAEG80wAoAgAgBmoiATYCAEHA0wAoAgAgAUkEQEHA0wAgATYCAAsCQAJAAkBBpNAAKAIAIgIEQEHM0wAhAQNAIAAgASgCACIDIAEoAgQiBWpGDQIgASgCCCIBDQALDAILQZzQACgCACIBQQBHIAAgAU9xRQRAQZzQACAANgIAC0EAIQFB0NMAIAY2AgBBzNMAIAA2AgBBrNAAQX82AgBBsNAAQeTTACgCADYCAEHY0wBBADYCAANAIAFByNAAaiABQbzQAGoiAjYCACACIAFBtNAAaiIDNgIAIAFBwNAAaiADNgIAIAFB0NAAaiABQcTQAGoiAzYCACADIAI2AgAgAUHY0ABqIAFBzNAAaiICNgIAIAIgAzYCACABQdTQAGogAjYCACABQSBqIgFBgAJHDQALQXggAGtBD3EiASAAaiICIAZBOGsiAyABayIBQQFyNgIEQajQAEH00wAoAgA2AgBBmNAAIAE2AgBBpNAAIAI2AgAgACADakE4NgIEDAILIAAgAk0NACACIANJDQAgASgCDEEIcQ0AQXggAmtBD3EiACACaiIDQZjQACgCACAGaiIHIABrIgBBAXI2AgQgASAFIAZqNgIEQajQAEH00wAoAgA2AgBBmNAAIAA2AgBBpNAAIAM2AgAgAiAHakE4NgIEDAELIABBnNAAKAIASQRAQZzQACAANgIACyAAIAZqIQNBzNMAIQECQAJAAkADQCADIAEoAgBHBEAgASgCCCIBDQEMAgsLIAEtAAxBCHFFDQELQczTACEBA0AgASgCACIDIAJNBEAgAyABKAIEaiIFIAJLDQMLIAEoAgghAQwACwALIAEgADYCACABIAEoAgQgBmo2AgQgAEF4IABrQQ9xaiIJIARBA3I2AgQgA0F4IANrQQ9xaiIGIAQgCWoiBGshASACIAZGBEBBpNAAIAQ2AgBBmNAAQZjQACgCACABaiIANgIAIAQgAEEBcjYCBAwIC0Gg0AAoAgAgBkYEQEGg0AAgBDYCAEGU0ABBlNAAKAIAIAFqIgA2AgAgBCAAQQFyNgIEIAAgBGogADYCAAwICyAGKAIEIgVBA3FBAUcNBiAFQXhxIQggBUH/AU0EQCAFQQN2IQMgBigCCCIAIAYoAgwiAkYEQEGM0ABBjNAAKAIAQX4gA3dxNgIADAcLIAIgADYCCCAAIAI2AgwMBgsgBigCGCEHIAYgBigCDCIARwRAIAAgBigCCCICNgIIIAIgADYCDAwFCyAGQRRqIgIoAgAiBUUEQCAGKAIQIgVFDQQgBkEQaiECCwNAIAIhAyAFIgBBFGoiAigCACIFDQAgAEEQaiECIAAoAhAiBQ0ACyADQQA2AgAMBAtBeCAAa0EPcSIBIABqIgcgBkE4ayIDIAFrIgFBAXI2AgQgACADakE4NgIEIAIgBUE3IAVrQQ9xakE/ayIDIAMgAkEQakkbIgNBIzYCBEGo0ABB9NMAKAIANgIAQZjQACABNgIAQaTQACAHNgIAIANBEGpB1NMAKQIANwIAIANBzNMAKQIANwIIQdTTACADQQhqNgIAQdDTACAGNgIAQczTACAANgIAQdjTAEEANgIAIANBJGohAQNAIAFBBzYCACAFIAFBBGoiAUsNAAsgAiADRg0AIAMgAygCBEF+cTYCBCADIAMgAmsiBTYCACACIAVBAXI2AgQgBUH/AU0EQCAFQXhxQbTQAGohAAJ/QYzQACgCACIBQQEgBUEDdnQiA3FFBEBBjNAAIAEgA3I2AgAgAAwBCyAAKAIICyIBIAI2AgwgACACNgIIIAIgADYCDCACIAE2AggMAQtBHyEBIAVB////B00EQCAFQSYgBUEIdmciAGt2QQFxIABBAXRrQT5qIQELIAIgATYCHCACQgA3AhAgAUECdEG80gBqIQBBkNAAKAIAIgNBASABdCIGcUUEQCAAIAI2AgBBkNAAIAMgBnI2AgAgAiAANgIYIAIgAjYCCCACIAI2AgwMAQsgBUEZIAFBAXZrQQAgAUEfRxt0IQEgACgCACEDAkADQCADIgAoAgRBeHEgBUYNASABQR12IQMgAUEBdCEBIAAgA0EEcWpBEGoiBigCACIDDQALIAYgAjYCACACIAA2AhggAiACNgIMIAIgAjYCCAwBCyAAKAIIIgEgAjYCDCAAIAI2AgggAkEANgIYIAIgADYCDCACIAE2AggLQZjQACgCACIBIARNDQBBpNAAKAIAIgAgBGoiAiABIARrIgFBAXI2AgRBmNAAIAE2AgBBpNAAIAI2AgAgACAEQQNyNgIEIABBCGohAQwIC0EAIQFB/NMAQTA2AgAMBwtBACEACyAHRQ0AAkAgBigCHCICQQJ0QbzSAGoiAygCACAGRgRAIAMgADYCACAADQFBkNAAQZDQACgCAEF+IAJ3cTYCAAwCCyAHQRBBFCAHKAIQIAZGG2ogADYCACAARQ0BCyAAIAc2AhggBigCECICBEAgACACNgIQIAIgADYCGAsgBkEUaigCACICRQ0AIABBFGogAjYCACACIAA2AhgLIAEgCGohASAGIAhqIgYoAgQhBQsgBiAFQX5xNgIEIAEgBGogATYCACAEIAFBAXI2AgQgAUH/AU0EQCABQXhxQbTQAGohAAJ/QYzQACgCACICQQEgAUEDdnQiAXFFBEBBjNAAIAEgAnI2AgAgAAwBCyAAKAIICyIBIAQ2AgwgACAENgIIIAQgADYCDCAEIAE2AggMAQtBHyEFIAFB////B00EQCABQSYgAUEIdmciAGt2QQFxIABBAXRrQT5qIQULIAQgBTYCHCAEQgA3AhAgBUECdEG80gBqIQBBkNAAKAIAIgJBASAFdCIDcUUEQCAAIAQ2AgBBkNAAIAIgA3I2AgAgBCAANgIYIAQgBDYCCCAEIAQ2AgwMAQsgAUEZIAVBAXZrQQAgBUEfRxt0IQUgACgCACEAAkADQCAAIgIoAgRBeHEgAUYNASAFQR12IQAgBUEBdCEFIAIgAEEEcWpBEGoiAygCACIADQALIAMgBDYCACAEIAI2AhggBCAENgIMIAQgBDYCCAwBCyACKAIIIgAgBDYCDCACIAQ2AgggBEEANgIYIAQgAjYCDCAEIAA2AggLIAlBCGohAQwCCwJAIAdFDQACQCADKAIcIgFBAnRBvNIAaiICKAIAIANGBEAgAiAANgIAIAANAUGQ0AAgCEF+IAF3cSIINgIADAILIAdBEEEUIAcoAhAgA0YbaiAANgIAIABFDQELIAAgBzYCGCADKAIQIgEEQCAAIAE2AhAgASAANgIYCyADQRRqKAIAIgFFDQAgAEEUaiABNgIAIAEgADYCGAsCQCAFQQ9NBEAgAyAEIAVqIgBBA3I2AgQgACADaiIAIAAoAgRBAXI2AgQMAQsgAyAEaiICIAVBAXI2AgQgAyAEQQNyNgIEIAIgBWogBTYCACAFQf8BTQRAIAVBeHFBtNAAaiEAAn9BjNAAKAIAIgFBASAFQQN2dCIFcUUEQEGM0AAgASAFcjYCACAADAELIAAoAggLIgEgAjYCDCAAIAI2AgggAiAANgIMIAIgATYCCAwBC0EfIQEgBUH///8HTQRAIAVBJiAFQQh2ZyIAa3ZBAXEgAEEBdGtBPmohAQsgAiABNgIcIAJCADcCECABQQJ0QbzSAGohAEEBIAF0IgQgCHFFBEAgACACNgIAQZDQACAEIAhyNgIAIAIgADYCGCACIAI2AgggAiACNgIMDAELIAVBGSABQQF2a0EAIAFBH0cbdCEBIAAoAgAhBAJAA0AgBCIAKAIEQXhxIAVGDQEgAUEddiEEIAFBAXQhASAAIARBBHFqQRBqIgYoAgAiBA0ACyAGIAI2AgAgAiAANgIYIAIgAjYCDCACIAI2AggMAQsgACgCCCIBIAI2AgwgACACNgIIIAJBADYCGCACIAA2AgwgAiABNgIICyADQQhqIQEMAQsCQCAJRQ0AAkAgACgCHCIBQQJ0QbzSAGoiAigCACAARgRAIAIgAzYCACADDQFBkNAAIAtBfiABd3E2AgAMAgsgCUEQQRQgCSgCECAARhtqIAM2AgAgA0UNAQsgAyAJNgIYIAAoAhAiAQRAIAMgATYCECABIAM2AhgLIABBFGooAgAiAUUNACADQRRqIAE2AgAgASADNgIYCwJAIAVBD00EQCAAIAQgBWoiAUEDcjYCBCAAIAFqIgEgASgCBEEBcjYCBAwBCyAAIARqIgcgBUEBcjYCBCAAIARBA3I2AgQgBSAHaiAFNgIAIAgEQCAIQXhxQbTQAGohAUGg0AAoAgAhAwJ/QQEgCEEDdnQiAiAGcUUEQEGM0AAgAiAGcjYCACABDAELIAEoAggLIgIgAzYCDCABIAM2AgggAyABNgIMIAMgAjYCCAtBoNAAIAc2AgBBlNAAIAU2AgALIABBCGohAQsgCkEQaiQAIAELQwAgAEUEQD8AQRB0DwsCQCAAQf//A3ENACAAQQBIDQAgAEEQdkAAIgBBf0YEQEH80wBBMDYCAEF/DwsgAEEQdA8LAAsL3D8iAEGACAsJAQAAAAIAAAADAEGUCAsFBAAAAAUAQaQICwkGAAAABwAAAAgAQdwIC4otSW52YWxpZCBjaGFyIGluIHVybCBxdWVyeQBTcGFuIGNhbGxiYWNrIGVycm9yIGluIG9uX2JvZHkAQ29udGVudC1MZW5ndGggb3ZlcmZsb3cAQ2h1bmsgc2l6ZSBvdmVyZmxvdwBSZXNwb25zZSBvdmVyZmxvdwBJbnZhbGlkIG1ldGhvZCBmb3IgSFRUUC94LnggcmVxdWVzdABJbnZhbGlkIG1ldGhvZCBmb3IgUlRTUC94LnggcmVxdWVzdABFeHBlY3RlZCBTT1VSQ0UgbWV0aG9kIGZvciBJQ0UveC54IHJlcXVlc3QASW52YWxpZCBjaGFyIGluIHVybCBmcmFnbWVudCBzdGFydABFeHBlY3RlZCBkb3QAU3BhbiBjYWxsYmFjayBlcnJvciBpbiBvbl9zdGF0dXMASW52YWxpZCByZXNwb25zZSBzdGF0dXMASW52YWxpZCBjaGFyYWN0ZXIgaW4gY2h1bmsgZXh0ZW5zaW9ucwBVc2VyIGNhbGxiYWNrIGVycm9yAGBvbl9yZXNldGAgY2FsbGJhY2sgZXJyb3IAYG9uX2NodW5rX2hlYWRlcmAgY2FsbGJhY2sgZXJyb3IAYG9uX21lc3NhZ2VfYmVnaW5gIGNhbGxiYWNrIGVycm9yAGBvbl9jaHVua19leHRlbnNpb25fdmFsdWVgIGNhbGxiYWNrIGVycm9yAGBvbl9zdGF0dXNfY29tcGxldGVgIGNhbGxiYWNrIGVycm9yAGBvbl92ZXJzaW9uX2NvbXBsZXRlYCBjYWxsYmFjayBlcnJvcgBgb25fdXJsX2NvbXBsZXRlYCBjYWxsYmFjayBlcnJvcgBgb25fY2h1bmtfY29tcGxldGVgIGNhbGxiYWNrIGVycm9yAGBvbl9oZWFkZXJfdmFsdWVfY29tcGxldGVgIGNhbGxiYWNrIGVycm9yAGBvbl9tZXNzYWdlX2NvbXBsZXRlYCBjYWxsYmFjayBlcnJvcgBgb25fbWV0aG9kX2NvbXBsZXRlYCBjYWxsYmFjayBlcnJvcgBgb25faGVhZGVyX2ZpZWxkX2NvbXBsZXRlYCBjYWxsYmFjayBlcnJvcgBgb25fY2h1bmtfZXh0ZW5zaW9uX25hbWVgIGNhbGxiYWNrIGVycm9yAFVuZXhwZWN0ZWQgY2hhciBpbiB1cmwgc2VydmVyAEludmFsaWQgaGVhZGVyIHZhbHVlIGNoYXIASW52YWxpZCBoZWFkZXIgZmllbGQgY2hhcgBTcGFuIGNhbGxiYWNrIGVycm9yIGluIG9uX3ZlcnNpb24ASW52YWxpZCBtaW5vciB2ZXJzaW9uAEludmFsaWQgbWFqb3IgdmVyc2lvbgBFeHBlY3RlZCBzcGFjZSBhZnRlciB2ZXJzaW9uAEV4cGVjdGVkIENSTEYgYWZ0ZXIgdmVyc2lvbgBJbnZhbGlkIEhUVFAgdmVyc2lvbgBJbnZhbGlkIGhlYWRlciB0b2tlbgBTcGFuIGNhbGxiYWNrIGVycm9yIGluIG9uX3VybABJbnZhbGlkIGNoYXJhY3RlcnMgaW4gdXJsAFVuZXhwZWN0ZWQgc3RhcnQgY2hhciBpbiB1cmwARG91YmxlIEAgaW4gdXJsAEVtcHR5IENvbnRlbnQtTGVuZ3RoAEludmFsaWQgY2hhcmFjdGVyIGluIENvbnRlbnQtTGVuZ3RoAER1cGxpY2F0ZSBDb250ZW50LUxlbmd0aABJbnZhbGlkIGNoYXIgaW4gdXJsIHBhdGgAQ29udGVudC1MZW5ndGggY2FuJ3QgYmUgcHJlc2VudCB3aXRoIFRyYW5zZmVyLUVuY29kaW5nAEludmFsaWQgY2hhcmFjdGVyIGluIGNodW5rIHNpemUAU3BhbiBjYWxsYmFjayBlcnJvciBpbiBvbl9oZWFkZXJfdmFsdWUAU3BhbiBjYWxsYmFjayBlcnJvciBpbiBvbl9jaHVua19leHRlbnNpb25fdmFsdWUASW52YWxpZCBjaGFyYWN0ZXIgaW4gY2h1bmsgZXh0ZW5zaW9ucyB2YWx1ZQBNaXNzaW5nIGV4cGVjdGVkIExGIGFmdGVyIGhlYWRlciB2YWx1ZQBJbnZhbGlkIGBUcmFuc2Zlci1FbmNvZGluZ2AgaGVhZGVyIHZhbHVlAEludmFsaWQgY2hhcmFjdGVyIGluIGNodW5rIGV4dGVuc2lvbnMgcXVvdGUgdmFsdWUASW52YWxpZCBjaGFyYWN0ZXIgaW4gY2h1bmsgZXh0ZW5zaW9ucyBxdW90ZWQgdmFsdWUAUGF1c2VkIGJ5IG9uX2hlYWRlcnNfY29tcGxldGUASW52YWxpZCBFT0Ygc3RhdGUAb25fcmVzZXQgcGF1c2UAb25fY2h1bmtfaGVhZGVyIHBhdXNlAG9uX21lc3NhZ2VfYmVnaW4gcGF1c2UAb25fY2h1bmtfZXh0ZW5zaW9uX3ZhbHVlIHBhdXNlAG9uX3N0YXR1c19jb21wbGV0ZSBwYXVzZQBvbl92ZXJzaW9uX2NvbXBsZXRlIHBhdXNlAG9uX3VybF9jb21wbGV0ZSBwYXVzZQBvbl9jaHVua19jb21wbGV0ZSBwYXVzZQBvbl9oZWFkZXJfdmFsdWVfY29tcGxldGUgcGF1c2UAb25fbWVzc2FnZV9jb21wbGV0ZSBwYXVzZQBvbl9tZXRob2RfY29tcGxldGUgcGF1c2UAb25faGVhZGVyX2ZpZWxkX2NvbXBsZXRlIHBhdXNlAG9uX2NodW5rX2V4dGVuc2lvbl9uYW1lIHBhdXNlAFVuZXhwZWN0ZWQgc3BhY2UgYWZ0ZXIgc3RhcnQgbGluZQBTcGFuIGNhbGxiYWNrIGVycm9yIGluIG9uX2NodW5rX2V4dGVuc2lvbl9uYW1lAEludmFsaWQgY2hhcmFjdGVyIGluIGNodW5rIGV4dGVuc2lvbnMgbmFtZQBQYXVzZSBvbiBDT05ORUNUL1VwZ3JhZGUAUGF1c2Ugb24gUFJJL1VwZ3JhZGUARXhwZWN0ZWQgSFRUUC8yIENvbm5lY3Rpb24gUHJlZmFjZQBTcGFuIGNhbGxiYWNrIGVycm9yIGluIG9uX21ldGhvZABFeHBlY3RlZCBzcGFjZSBhZnRlciBtZXRob2QAU3BhbiBjYWxsYmFjayBlcnJvciBpbiBvbl9oZWFkZXJfZmllbGQAUGF1c2VkAEludmFsaWQgd29yZCBlbmNvdW50ZXJlZABJbnZhbGlkIG1ldGhvZCBlbmNvdW50ZXJlZABVbmV4cGVjdGVkIGNoYXIgaW4gdXJsIHNjaGVtYQBSZXF1ZXN0IGhhcyBpbnZhbGlkIGBUcmFuc2Zlci1FbmNvZGluZ2AAU1dJVENIX1BST1hZAFVTRV9QUk9YWQBNS0FDVElWSVRZAFVOUFJPQ0VTU0FCTEVfRU5USVRZAENPUFkATU9WRURfUEVSTUFORU5UTFkAVE9PX0VBUkxZAE5PVElGWQBGQUlMRURfREVQRU5ERU5DWQBCQURfR0FURVdBWQBQTEFZAFBVVABDSEVDS09VVABHQVRFV0FZX1RJTUVPVVQAUkVRVUVTVF9USU1FT1VUAE5FVFdPUktfQ09OTkVDVF9USU1FT1VUAENPTk5FQ1RJT05fVElNRU9VVABMT0dJTl9USU1FT1VUAE5FVFdPUktfUkVBRF9USU1FT1VUAFBPU1QATUlTRElSRUNURURfUkVRVUVTVABDTElFTlRfQ0xPU0VEX1JFUVVFU1QAQ0xJRU5UX0NMT1NFRF9MT0FEX0JBTEFOQ0VEX1JFUVVFU1QAQkFEX1JFUVVFU1QASFRUUF9SRVFVRVNUX1NFTlRfVE9fSFRUUFNfUE9SVABSRVBPUlQASU1fQV9URUFQT1QAUkVTRVRfQ09OVEVOVABOT19DT05URU5UAFBBUlRJQUxfQ09OVEVOVABIUEVfSU5WQUxJRF9DT05TVEFOVABIUEVfQ0JfUkVTRVQAR0VUAEhQRV9TVFJJQ1QAQ09ORkxJQ1QAVEVNUE9SQVJZX1JFRElSRUNUAFBFUk1BTkVOVF9SRURJUkVDVABDT05ORUNUAE1VTFRJX1NUQVRVUwBIUEVfSU5WQUxJRF9TVEFUVVMAVE9PX01BTllfUkVRVUVTVFMARUFSTFlfSElOVFMAVU5BVkFJTEFCTEVfRk9SX0xFR0FMX1JFQVNPTlMAT1BUSU9OUwBTV0lUQ0hJTkdfUFJPVE9DT0xTAFZBUklBTlRfQUxTT19ORUdPVElBVEVTAE1VTFRJUExFX0NIT0lDRVMASU5URVJOQUxfU0VSVkVSX0VSUk9SAFdFQl9TRVJWRVJfVU5LTk9XTl9FUlJPUgBSQUlMR1VOX0VSUk9SAElERU5USVRZX1BST1ZJREVSX0FVVEhFTlRJQ0FUSU9OX0VSUk9SAFNTTF9DRVJUSUZJQ0FURV9FUlJPUgBJTlZBTElEX1hfRk9SV0FSREVEX0ZPUgBTRVRfUEFSQU1FVEVSAEdFVF9QQVJBTUVURVIASFBFX1VTRVIAU0VFX09USEVSAEhQRV9DQl9DSFVOS19IRUFERVIATUtDQUxFTkRBUgBTRVRVUABXRUJfU0VSVkVSX0lTX0RPV04AVEVBUkRPV04ASFBFX0NMT1NFRF9DT05ORUNUSU9OAEhFVVJJU1RJQ19FWFBJUkFUSU9OAERJU0NPTk5FQ1RFRF9PUEVSQVRJT04ATk9OX0FVVEhPUklUQVRJVkVfSU5GT1JNQVRJT04ASFBFX0lOVkFMSURfVkVSU0lPTgBIUEVfQ0JfTUVTU0FHRV9CRUdJTgBTSVRFX0lTX0ZST1pFTgBIUEVfSU5WQUxJRF9IRUFERVJfVE9LRU4ASU5WQUxJRF9UT0tFTgBGT1JCSURERU4ARU5IQU5DRV9ZT1VSX0NBTE0ASFBFX0lOVkFMSURfVVJMAEJMT0NLRURfQllfUEFSRU5UQUxfQ09OVFJPTABNS0NPTABBQ0wASFBFX0lOVEVSTkFMAFJFUVVFU1RfSEVBREVSX0ZJRUxEU19UT09fTEFSR0VfVU5PRkZJQ0lBTABIUEVfT0sAVU5MSU5LAFVOTE9DSwBQUkkAUkVUUllfV0lUSABIUEVfSU5WQUxJRF9DT05URU5UX0xFTkdUSABIUEVfVU5FWFBFQ1RFRF9DT05URU5UX0xFTkdUSABGTFVTSABQUk9QUEFUQ0gATS1TRUFSQ0gAVVJJX1RPT19MT05HAFBST0NFU1NJTkcATUlTQ0VMTEFORU9VU19QRVJTSVNURU5UX1dBUk5JTkcATUlTQ0VMTEFORU9VU19XQVJOSU5HAEhQRV9JTlZBTElEX1RSQU5TRkVSX0VOQ09ESU5HAEV4cGVjdGVkIENSTEYASFBFX0lOVkFMSURfQ0hVTktfU0laRQBNT1ZFAENPTlRJTlVFAEhQRV9DQl9TVEFUVVNfQ09NUExFVEUASFBFX0NCX0hFQURFUlNfQ09NUExFVEUASFBFX0NCX1ZFUlNJT05fQ09NUExFVEUASFBFX0NCX1VSTF9DT01QTEVURQBIUEVfQ0JfQ0hVTktfQ09NUExFVEUASFBFX0NCX0hFQURFUl9WQUxVRV9DT01QTEVURQBIUEVfQ0JfQ0hVTktfRVhURU5TSU9OX1ZBTFVFX0NPTVBMRVRFAEhQRV9DQl9DSFVOS19FWFRFTlNJT05fTkFNRV9DT01QTEVURQBIUEVfQ0JfTUVTU0FHRV9DT01QTEVURQBIUEVfQ0JfTUVUSE9EX0NPTVBMRVRFAEhQRV9DQl9IRUFERVJfRklFTERfQ09NUExFVEUAREVMRVRFAEhQRV9JTlZBTElEX0VPRl9TVEFURQBJTlZBTElEX1NTTF9DRVJUSUZJQ0FURQBQQVVTRQBOT19SRVNQT05TRQBVTlNVUFBPUlRFRF9NRURJQV9UWVBFAEdPTkUATk9UX0FDQ0VQVEFCTEUAU0VSVklDRV9VTkFWQUlMQUJMRQBSQU5HRV9OT1RfU0FUSVNGSUFCTEUAT1JJR0lOX0lTX1VOUkVBQ0hBQkxFAFJFU1BPTlNFX0lTX1NUQUxFAFBVUkdFAE1FUkdFAFJFUVVFU1RfSEVBREVSX0ZJRUxEU19UT09fTEFSR0UAUkVRVUVTVF9IRUFERVJfVE9PX0xBUkdFAFBBWUxPQURfVE9PX0xBUkdFAElOU1VGRklDSUVOVF9TVE9SQUdFAEhQRV9QQVVTRURfVVBHUkFERQBIUEVfUEFVU0VEX0gyX1VQR1JBREUAU09VUkNFAEFOTk9VTkNFAFRSQUNFAEhQRV9VTkVYUEVDVEVEX1NQQUNFAERFU0NSSUJFAFVOU1VCU0NSSUJFAFJFQ09SRABIUEVfSU5WQUxJRF9NRVRIT0QATk9UX0ZPVU5EAFBST1BGSU5EAFVOQklORABSRUJJTkQAVU5BVVRIT1JJWkVEAE1FVEhPRF9OT1RfQUxMT1dFRABIVFRQX1ZFUlNJT05fTk9UX1NVUFBPUlRFRABBTFJFQURZX1JFUE9SVEVEAEFDQ0VQVEVEAE5PVF9JTVBMRU1FTlRFRABMT09QX0RFVEVDVEVEAEhQRV9DUl9FWFBFQ1RFRABIUEVfTEZfRVhQRUNURUQAQ1JFQVRFRABJTV9VU0VEAEhQRV9QQVVTRUQAVElNRU9VVF9PQ0NVUkVEAFBBWU1FTlRfUkVRVUlSRUQAUFJFQ09ORElUSU9OX1JFUVVJUkVEAFBST1hZX0FVVEhFTlRJQ0FUSU9OX1JFUVVJUkVEAE5FVFdPUktfQVVUSEVOVElDQVRJT05fUkVRVUlSRUQATEVOR1RIX1JFUVVJUkVEAFNTTF9DRVJUSUZJQ0FURV9SRVFVSVJFRABVUEdSQURFX1JFUVVJUkVEAFBBR0VfRVhQSVJFRABQUkVDT05ESVRJT05fRkFJTEVEAEVYUEVDVEFUSU9OX0ZBSUxFRABSRVZBTElEQVRJT05fRkFJTEVEAFNTTF9IQU5EU0hBS0VfRkFJTEVEAExPQ0tFRABUUkFOU0ZPUk1BVElPTl9BUFBMSUVEAE5PVF9NT0RJRklFRABOT1RfRVhURU5ERUQAQkFORFdJRFRIX0xJTUlUX0VYQ0VFREVEAFNJVEVfSVNfT1ZFUkxPQURFRABIRUFEAEV4cGVjdGVkIEhUVFAvAABeEwAAJhMAADAQAADwFwAAnRMAABUSAAA5FwAA8BIAAAoQAAB1EgAArRIAAIITAABPFAAAfxAAAKAVAAAjFAAAiRIAAIsUAABNFQAA1BEAAM8UAAAQGAAAyRYAANwWAADBEQAA4BcAALsUAAB0FAAAfBUAAOUUAAAIFwAAHxAAAGUVAACjFAAAKBUAAAIVAACZFQAALBAAAIsZAABPDwAA1A4AAGoQAADOEAAAAhcAAIkOAABuEwAAHBMAAGYUAABWFwAAwRMAAM0TAABsEwAAaBcAAGYXAABfFwAAIhMAAM4PAABpDgAA2A4AAGMWAADLEwAAqg4AACgXAAAmFwAAxRMAAF0WAADoEQAAZxMAAGUTAADyFgAAcxMAAB0XAAD5FgAA8xEAAM8OAADOFQAADBIAALMRAAClEQAAYRAAADIXAAC7EwBB+TULAQEAQZA2C+ABAQECAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAAEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEAQf03CwEBAEGROAteAgMCAgICAgAAAgIAAgIAAgICAgICAgICAgAEAAAAAAACAgICAgICAgICAgICAgICAgICAgICAgICAgAAAAICAgICAgICAgICAgICAgICAgICAgICAgICAgICAAIAAgBB/TkLAQEAQZE6C14CAAICAgICAAACAgACAgACAgICAgICAgICAAMABAAAAAICAgICAgICAgICAgICAgICAgICAgICAgICAAAAAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAAgACAEHwOwsNbG9zZWVlcC1hbGl2ZQBBiTwLAQEAQaA8C+ABAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEAAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEAQYk+CwEBAEGgPgvnAQEBAQEBAQEBAQEBAQIBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAAEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBY2h1bmtlZABBsMAAC18BAQABAQEBAQAAAQEAAQEAAQEBAQEBAQEBAQAAAAAAAAABAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQAAAAEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAAEAAQBBkMIACyFlY3Rpb25lbnQtbGVuZ3Rob25yb3h5LWNvbm5lY3Rpb24AQcDCAAstcmFuc2Zlci1lbmNvZGluZ3BncmFkZQ0KDQoNClNNDQoNClRUUC9DRS9UU1AvAEH5wgALBQECAAEDAEGQwwAL4AEEAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQABAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQBB+cQACwUBAgABAwBBkMUAC+ABBAEBBQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEAAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEAQfnGAAsEAQAAAQBBkccAC98BAQEAAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAAEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQABAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQBB+sgACwQBAAACAEGQyQALXwMEAAAEBAQEBAQEBAQEBAUEBAQEBAQEBAQEBAQABAAGBwQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAAEAAQABAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQEBAQAAAAEAEH6ygALBAEAAAEAQZDLAAsBAQBBqssAC0ECAAAAAAAAAwMDAwMDAwMDAwMDAwMDAwMDAwMDAwMDAwMAAAAAAAADAwMDAwMDAwMDAwMDAwMDAwMDAwMDAwMDAwBB+swACwQBAAABAEGQzQALAQEAQZrNAAsGAgAAAAACAEGxzQALOgMDAwMDAwMDAwMDAwMDAwMDAwMDAwMDAwMDAAAAAAAAAwMDAwMDAwMDAwMDAwMDAwMDAwMDAwMDAwMAQfDOAAuWAU5PVU5DRUVDS09VVE5FQ1RFVEVDUklCRUxVU0hFVEVBRFNFQVJDSFJHRUNUSVZJVFlMRU5EQVJWRU9USUZZUFRJT05TQ0hTRUFZU1RBVENIR0VPUkRJUkVDVE9SVFJDSFBBUkFNRVRFUlVSQ0VCU0NSSUJFQVJET1dOQUNFSU5ETktDS1VCU0NSSUJFSFRUUC9BRFRQLw==", "base64"); + } +}); + +// node_modules/undici/lib/web/fetch/constants.js +var require_constants8 = __commonJS({ + "node_modules/undici/lib/web/fetch/constants.js"(exports2, module2) { + "use strict"; + var corsSafeListedMethods = ["GET", "HEAD", "POST"]; + var corsSafeListedMethodsSet = new Set(corsSafeListedMethods); + var nullBodyStatus = [101, 204, 205, 304]; + var redirectStatus = [301, 302, 303, 307, 308]; + var redirectStatusSet = new Set(redirectStatus); + var badPorts = [ + "1", + "7", + "9", + "11", + "13", + "15", + "17", + "19", + "20", + "21", + "22", + "23", + "25", + "37", + "42", + "43", + "53", + "69", + "77", + "79", + "87", + "95", + "101", + "102", + "103", + "104", + "109", + "110", + "111", + "113", + "115", + "117", + "119", + "123", + "135", + "137", + "139", + "143", + "161", + "179", + "389", + "427", + "465", + "512", + "513", + "514", + "515", + "526", + "530", + "531", + "532", + "540", + "548", + "554", + "556", + "563", + "587", + "601", + "636", + "989", + "990", + "993", + "995", + "1719", + "1720", + "1723", + "2049", + "3659", + "4045", + "4190", + "5060", + "5061", + "6000", + "6566", + "6665", + "6666", + "6667", + "6668", + "6669", + "6679", + "6697", + "10080" + ]; + var badPortsSet = new Set(badPorts); + var referrerPolicy = [ + "", + "no-referrer", + "no-referrer-when-downgrade", + "same-origin", + "origin", + "strict-origin", + "origin-when-cross-origin", + "strict-origin-when-cross-origin", + "unsafe-url" + ]; + var referrerPolicySet = new Set(referrerPolicy); + var requestRedirect = ["follow", "manual", "error"]; + var safeMethods = ["GET", "HEAD", "OPTIONS", "TRACE"]; + var safeMethodsSet = new Set(safeMethods); + var requestMode = ["navigate", "same-origin", "no-cors", "cors"]; + var requestCredentials = ["omit", "same-origin", "include"]; + var requestCache = [ + "default", + "no-store", + "reload", + "no-cache", + "force-cache", + "only-if-cached" + ]; + var requestBodyHeader = [ + "content-encoding", + "content-language", + "content-location", + "content-type", + // See https://github.com/nodejs/undici/issues/2021 + // 'Content-Length' is a forbidden header name, which is typically + // removed in the Headers implementation. However, undici doesn't + // filter out headers, so we add it here. + "content-length" + ]; + var requestDuplex = [ + "half" + ]; + var forbiddenMethods = ["CONNECT", "TRACE", "TRACK"]; + var forbiddenMethodsSet = new Set(forbiddenMethods); + var subresource = [ + "audio", + "audioworklet", + "font", + "image", + "manifest", + "paintworklet", + "script", + "style", + "track", + "video", + "xslt", + "" + ]; + var subresourceSet = new Set(subresource); + module2.exports = { + subresource, + forbiddenMethods, + requestBodyHeader, + referrerPolicy, + requestRedirect, + requestMode, + requestCredentials, + requestCache, + redirectStatus, + corsSafeListedMethods, + nullBodyStatus, + safeMethods, + badPorts, + requestDuplex, + subresourceSet, + badPortsSet, + redirectStatusSet, + corsSafeListedMethodsSet, + safeMethodsSet, + forbiddenMethodsSet, + referrerPolicySet + }; + } +}); + +// node_modules/undici/lib/web/fetch/global.js +var require_global3 = __commonJS({ + "node_modules/undici/lib/web/fetch/global.js"(exports2, module2) { + "use strict"; + var globalOrigin = Symbol.for("undici.globalOrigin.1"); + function getGlobalOrigin() { + return globalThis[globalOrigin]; + } + function setGlobalOrigin(newOrigin) { + if (newOrigin === void 0) { + Object.defineProperty(globalThis, globalOrigin, { + value: void 0, + writable: true, + enumerable: false, + configurable: false + }); + return; + } + const parsedURL = new URL(newOrigin); + if (parsedURL.protocol !== "http:" && parsedURL.protocol !== "https:") { + throw new TypeError(`Only http & https urls are allowed, received ${parsedURL.protocol}`); + } + Object.defineProperty(globalThis, globalOrigin, { + value: parsedURL, + writable: true, + enumerable: false, + configurable: false + }); + } + module2.exports = { + getGlobalOrigin, + setGlobalOrigin + }; + } +}); + +// node_modules/undici/lib/web/fetch/data-url.js +var require_data_url = __commonJS({ + "node_modules/undici/lib/web/fetch/data-url.js"(exports2, module2) { + "use strict"; + var assert = require("node:assert"); + var encoder = new TextEncoder(); + var HTTP_TOKEN_CODEPOINTS = /^[!#$%&'*+\-.^_|~A-Za-z0-9]+$/; + var HTTP_WHITESPACE_REGEX = /[\u000A\u000D\u0009\u0020]/; + var ASCII_WHITESPACE_REPLACE_REGEX = /[\u0009\u000A\u000C\u000D\u0020]/g; + var HTTP_QUOTED_STRING_TOKENS = /^[\u0009\u0020-\u007E\u0080-\u00FF]+$/; + function dataURLProcessor(dataURL) { + assert(dataURL.protocol === "data:"); + let input = URLSerializer(dataURL, true); + input = input.slice(5); + const position = { position: 0 }; + let mimeType = collectASequenceOfCodePointsFast( + ",", + input, + position + ); + const mimeTypeLength = mimeType.length; + mimeType = removeASCIIWhitespace(mimeType, true, true); + if (position.position >= input.length) { + return "failure"; + } + position.position++; + const encodedBody = input.slice(mimeTypeLength + 1); + let body = stringPercentDecode(encodedBody); + if (/;(\u0020){0,}base64$/i.test(mimeType)) { + const stringBody = isomorphicDecode(body); + body = forgivingBase64(stringBody); + if (body === "failure") { + return "failure"; + } + mimeType = mimeType.slice(0, -6); + mimeType = mimeType.replace(/(\u0020)+$/, ""); + mimeType = mimeType.slice(0, -1); + } + if (mimeType.startsWith(";")) { + mimeType = "text/plain" + mimeType; + } + let mimeTypeRecord = parseMIMEType(mimeType); + if (mimeTypeRecord === "failure") { + mimeTypeRecord = parseMIMEType("text/plain;charset=US-ASCII"); + } + return { mimeType: mimeTypeRecord, body }; + } + function URLSerializer(url, excludeFragment = false) { + if (!excludeFragment) { + return url.href; + } + const href = url.href; + const hashLength = url.hash.length; + const serialized = hashLength === 0 ? href : href.substring(0, href.length - hashLength); + if (!hashLength && href.endsWith("#")) { + return serialized.slice(0, -1); + } + return serialized; + } + function collectASequenceOfCodePoints(condition, input, position) { + let result = ""; + while (position.position < input.length && condition(input[position.position])) { + result += input[position.position]; + position.position++; + } + return result; + } + function collectASequenceOfCodePointsFast(char, input, position) { + const idx = input.indexOf(char, position.position); + const start = position.position; + if (idx === -1) { + position.position = input.length; + return input.slice(start); + } + position.position = idx; + return input.slice(start, position.position); + } + function stringPercentDecode(input) { + const bytes = encoder.encode(input); + return percentDecode(bytes); + } + function isHexCharByte(byte) { + return byte >= 48 && byte <= 57 || byte >= 65 && byte <= 70 || byte >= 97 && byte <= 102; + } + function hexByteToNumber(byte) { + return ( + // 0-9 + byte >= 48 && byte <= 57 ? byte - 48 : (byte & 223) - 55 + ); + } + function percentDecode(input) { + const length = input.length; + const output = new Uint8Array(length); + let j = 0; + for (let i = 0; i < length; ++i) { + const byte = input[i]; + if (byte !== 37) { + output[j++] = byte; + } else if (byte === 37 && !(isHexCharByte(input[i + 1]) && isHexCharByte(input[i + 2]))) { + output[j++] = 37; + } else { + output[j++] = hexByteToNumber(input[i + 1]) << 4 | hexByteToNumber(input[i + 2]); + i += 2; + } + } + return length === j ? output : output.subarray(0, j); + } + function parseMIMEType(input) { + input = removeHTTPWhitespace(input, true, true); + const position = { position: 0 }; + const type = collectASequenceOfCodePointsFast( + "/", + input, + position + ); + if (type.length === 0 || !HTTP_TOKEN_CODEPOINTS.test(type)) { + return "failure"; + } + if (position.position > input.length) { + return "failure"; + } + position.position++; + let subtype = collectASequenceOfCodePointsFast( + ";", + input, + position + ); + subtype = removeHTTPWhitespace(subtype, false, true); + if (subtype.length === 0 || !HTTP_TOKEN_CODEPOINTS.test(subtype)) { + return "failure"; + } + const typeLowercase = type.toLowerCase(); + const subtypeLowercase = subtype.toLowerCase(); + const mimeType = { + type: typeLowercase, + subtype: subtypeLowercase, + /** @type {Map} */ + parameters: /* @__PURE__ */ new Map(), + // https://mimesniff.spec.whatwg.org/#mime-type-essence + essence: `${typeLowercase}/${subtypeLowercase}` + }; + while (position.position < input.length) { + position.position++; + collectASequenceOfCodePoints( + // https://fetch.spec.whatwg.org/#http-whitespace + (char) => HTTP_WHITESPACE_REGEX.test(char), + input, + position + ); + let parameterName = collectASequenceOfCodePoints( + (char) => char !== ";" && char !== "=", + input, + position + ); + parameterName = parameterName.toLowerCase(); + if (position.position < input.length) { + if (input[position.position] === ";") { + continue; + } + position.position++; + } + if (position.position > input.length) { + break; + } + let parameterValue = null; + if (input[position.position] === '"') { + parameterValue = collectAnHTTPQuotedString(input, position, true); + collectASequenceOfCodePointsFast( + ";", + input, + position + ); + } else { + parameterValue = collectASequenceOfCodePointsFast( + ";", + input, + position + ); + parameterValue = removeHTTPWhitespace(parameterValue, false, true); + if (parameterValue.length === 0) { + continue; + } + } + if (parameterName.length !== 0 && HTTP_TOKEN_CODEPOINTS.test(parameterName) && (parameterValue.length === 0 || HTTP_QUOTED_STRING_TOKENS.test(parameterValue)) && !mimeType.parameters.has(parameterName)) { + mimeType.parameters.set(parameterName, parameterValue); + } + } + return mimeType; + } + function forgivingBase64(data) { + data = data.replace(ASCII_WHITESPACE_REPLACE_REGEX, ""); + let dataLength = data.length; + if (dataLength % 4 === 0) { + if (data.charCodeAt(dataLength - 1) === 61) { + --dataLength; + if (data.charCodeAt(dataLength - 1) === 61) { + --dataLength; + } + } + } + if (dataLength % 4 === 1) { + return "failure"; + } + if (/[^+/0-9A-Za-z]/.test(data.length === dataLength ? data : data.substring(0, dataLength))) { + return "failure"; + } + const buffer = Buffer.from(data, "base64"); + return new Uint8Array(buffer.buffer, buffer.byteOffset, buffer.byteLength); + } + function collectAnHTTPQuotedString(input, position, extractValue) { + const positionStart = position.position; + let value = ""; + assert(input[position.position] === '"'); + position.position++; + while (true) { + value += collectASequenceOfCodePoints( + (char) => char !== '"' && char !== "\\", + input, + position + ); + if (position.position >= input.length) { + break; + } + const quoteOrBackslash = input[position.position]; + position.position++; + if (quoteOrBackslash === "\\") { + if (position.position >= input.length) { + value += "\\"; + break; + } + value += input[position.position]; + position.position++; + } else { + assert(quoteOrBackslash === '"'); + break; + } + } + if (extractValue) { + return value; + } + return input.slice(positionStart, position.position); + } + function serializeAMimeType(mimeType) { + assert(mimeType !== "failure"); + const { parameters, essence } = mimeType; + let serialization = essence; + for (let [name, value] of parameters.entries()) { + serialization += ";"; + serialization += name; + serialization += "="; + if (!HTTP_TOKEN_CODEPOINTS.test(value)) { + value = value.replace(/(\\|")/g, "\\$1"); + value = '"' + value; + value += '"'; + } + serialization += value; + } + return serialization; + } + function isHTTPWhiteSpace(char) { + return char === 13 || char === 10 || char === 9 || char === 32; + } + function removeHTTPWhitespace(str, leading = true, trailing = true) { + return removeChars(str, leading, trailing, isHTTPWhiteSpace); + } + function isASCIIWhitespace(char) { + return char === 13 || char === 10 || char === 9 || char === 12 || char === 32; + } + function removeASCIIWhitespace(str, leading = true, trailing = true) { + return removeChars(str, leading, trailing, isASCIIWhitespace); + } + function removeChars(str, leading, trailing, predicate) { + let lead = 0; + let trail = str.length - 1; + if (leading) { + while (lead < str.length && predicate(str.charCodeAt(lead))) lead++; + } + if (trailing) { + while (trail > 0 && predicate(str.charCodeAt(trail))) trail--; + } + return lead === 0 && trail === str.length - 1 ? str : str.slice(lead, trail + 1); + } + function isomorphicDecode(input) { + const length = input.length; + if ((2 << 15) - 1 > length) { + return String.fromCharCode.apply(null, input); + } + let result = ""; + let i = 0; + let addition = (2 << 15) - 1; + while (i < length) { + if (i + addition > length) { + addition = length - i; + } + result += String.fromCharCode.apply(null, input.subarray(i, i += addition)); + } + return result; + } + function minimizeSupportedMimeType(mimeType) { + switch (mimeType.essence) { + case "application/ecmascript": + case "application/javascript": + case "application/x-ecmascript": + case "application/x-javascript": + case "text/ecmascript": + case "text/javascript": + case "text/javascript1.0": + case "text/javascript1.1": + case "text/javascript1.2": + case "text/javascript1.3": + case "text/javascript1.4": + case "text/javascript1.5": + case "text/jscript": + case "text/livescript": + case "text/x-ecmascript": + case "text/x-javascript": + return "text/javascript"; + case "application/json": + case "text/json": + return "application/json"; + case "image/svg+xml": + return "image/svg+xml"; + case "text/xml": + case "application/xml": + return "application/xml"; + } + if (mimeType.subtype.endsWith("+json")) { + return "application/json"; + } + if (mimeType.subtype.endsWith("+xml")) { + return "application/xml"; + } + return ""; + } + module2.exports = { + dataURLProcessor, + URLSerializer, + collectASequenceOfCodePoints, + collectASequenceOfCodePointsFast, + stringPercentDecode, + parseMIMEType, + collectAnHTTPQuotedString, + serializeAMimeType, + removeChars, + removeHTTPWhitespace, + minimizeSupportedMimeType, + HTTP_TOKEN_CODEPOINTS, + isomorphicDecode + }; + } +}); + +// node_modules/undici/lib/web/fetch/webidl.js +var require_webidl2 = __commonJS({ + "node_modules/undici/lib/web/fetch/webidl.js"(exports2, module2) { + "use strict"; + var { types, inspect } = require("node:util"); + var { toUSVString } = require_util9(); + var webidl = {}; + webidl.converters = {}; + webidl.util = {}; + webidl.errors = {}; + webidl.errors.exception = function(message) { + return new TypeError(`${message.header}: ${message.message}`); + }; + webidl.errors.conversionFailed = function(context) { + const plural = context.types.length === 1 ? "" : " one of"; + const message = `${context.argument} could not be converted to${plural}: ${context.types.join(", ")}.`; + return webidl.errors.exception({ + header: context.prefix, + message + }); + }; + webidl.errors.invalidArgument = function(context) { + return webidl.errors.exception({ + header: context.prefix, + message: `"${context.value}" is an invalid ${context.type}.` + }); + }; + webidl.brandCheck = function(V, I, opts) { + if (opts?.strict !== false) { + if (!(V instanceof I)) { + const err = new TypeError("Illegal invocation"); + err.code = "ERR_INVALID_THIS"; + throw err; + } + } else { + if (V?.[Symbol.toStringTag] !== I.prototype[Symbol.toStringTag]) { + const err = new TypeError("Illegal invocation"); + err.code = "ERR_INVALID_THIS"; + throw err; + } + } + }; + webidl.argumentLengthCheck = function({ length }, min, ctx) { + if (length < min) { + throw webidl.errors.exception({ + message: `${min} argument${min !== 1 ? "s" : ""} required, but${length ? " only" : ""} ${length} found.`, + header: ctx + }); + } + }; + webidl.illegalConstructor = function() { + throw webidl.errors.exception({ + header: "TypeError", + message: "Illegal constructor" + }); + }; + webidl.util.Type = function(V) { + switch (typeof V) { + case "undefined": + return "Undefined"; + case "boolean": + return "Boolean"; + case "string": + return "String"; + case "symbol": + return "Symbol"; + case "number": + return "Number"; + case "bigint": + return "BigInt"; + case "function": + case "object": { + if (V === null) { + return "Null"; + } + return "Object"; + } + } + }; + webidl.util.ConvertToInt = function(V, bitLength, signedness, opts) { + let upperBound; + let lowerBound; + if (bitLength === 64) { + upperBound = Math.pow(2, 53) - 1; + if (signedness === "unsigned") { + lowerBound = 0; + } else { + lowerBound = Math.pow(-2, 53) + 1; + } + } else if (signedness === "unsigned") { + lowerBound = 0; + upperBound = Math.pow(2, bitLength) - 1; + } else { + lowerBound = Math.pow(-2, bitLength) - 1; + upperBound = Math.pow(2, bitLength - 1) - 1; + } + let x = Number(V); + if (x === 0) { + x = 0; + } + if (opts?.enforceRange === true) { + if (Number.isNaN(x) || x === Number.POSITIVE_INFINITY || x === Number.NEGATIVE_INFINITY) { + throw webidl.errors.exception({ + header: "Integer conversion", + message: `Could not convert ${webidl.util.Stringify(V)} to an integer.` + }); + } + x = webidl.util.IntegerPart(x); + if (x < lowerBound || x > upperBound) { + throw webidl.errors.exception({ + header: "Integer conversion", + message: `Value must be between ${lowerBound}-${upperBound}, got ${x}.` + }); + } + return x; + } + if (!Number.isNaN(x) && opts?.clamp === true) { + x = Math.min(Math.max(x, lowerBound), upperBound); + if (Math.floor(x) % 2 === 0) { + x = Math.floor(x); + } else { + x = Math.ceil(x); + } + return x; + } + if (Number.isNaN(x) || x === 0 && Object.is(0, x) || x === Number.POSITIVE_INFINITY || x === Number.NEGATIVE_INFINITY) { + return 0; + } + x = webidl.util.IntegerPart(x); + x = x % Math.pow(2, bitLength); + if (signedness === "signed" && x >= Math.pow(2, bitLength) - 1) { + return x - Math.pow(2, bitLength); + } + return x; + }; + webidl.util.IntegerPart = function(n) { + const r = Math.floor(Math.abs(n)); + if (n < 0) { + return -1 * r; + } + return r; + }; + webidl.util.Stringify = function(V) { + const type = webidl.util.Type(V); + switch (type) { + case "Symbol": + return `Symbol(${V.description})`; + case "Object": + return inspect(V); + case "String": + return `"${V}"`; + default: + return `${V}`; + } + }; + webidl.sequenceConverter = function(converter) { + return (V, prefix, argument, Iterable) => { + if (webidl.util.Type(V) !== "Object") { + throw webidl.errors.exception({ + header: prefix, + message: `${argument} (${webidl.util.Stringify(V)}) is not iterable.` + }); + } + const method = typeof Iterable === "function" ? Iterable() : V?.[Symbol.iterator]?.(); + const seq = []; + let index = 0; + if (method === void 0 || typeof method.next !== "function") { + throw webidl.errors.exception({ + header: prefix, + message: `${argument} is not iterable.` + }); + } + while (true) { + const { done, value } = method.next(); + if (done) { + break; + } + seq.push(converter(value, prefix, `${argument}[${index++}]`)); + } + return seq; + }; + }; + webidl.recordConverter = function(keyConverter, valueConverter) { + return (O, prefix, argument) => { + if (webidl.util.Type(O) !== "Object") { + throw webidl.errors.exception({ + header: prefix, + message: `${argument} ("${webidl.util.Type(O)}") is not an Object.` + }); + } + const result = {}; + if (!types.isProxy(O)) { + const keys2 = [...Object.getOwnPropertyNames(O), ...Object.getOwnPropertySymbols(O)]; + for (const key of keys2) { + const typedKey = keyConverter(key, prefix, argument); + const typedValue = valueConverter(O[key], prefix, argument); + result[typedKey] = typedValue; + } + return result; + } + const keys = Reflect.ownKeys(O); + for (const key of keys) { + const desc = Reflect.getOwnPropertyDescriptor(O, key); + if (desc?.enumerable) { + const typedKey = keyConverter(key, prefix, argument); + const typedValue = valueConverter(O[key], prefix, argument); + result[typedKey] = typedValue; + } + } + return result; + }; + }; + webidl.interfaceConverter = function(i) { + return (V, prefix, argument, opts) => { + if (opts?.strict !== false && !(V instanceof i)) { + throw webidl.errors.exception({ + header: prefix, + message: `Expected ${argument} ("${webidl.util.Stringify(V)}") to be an instance of ${i.name}.` + }); + } + return V; + }; + }; + webidl.dictionaryConverter = function(converters) { + return (dictionary, prefix, argument) => { + const type = webidl.util.Type(dictionary); + const dict = {}; + if (type === "Null" || type === "Undefined") { + return dict; + } else if (type !== "Object") { + throw webidl.errors.exception({ + header: prefix, + message: `Expected ${dictionary} to be one of: Null, Undefined, Object.` + }); + } + for (const options of converters) { + const { key, defaultValue, required, converter } = options; + if (required === true) { + if (!Object.hasOwn(dictionary, key)) { + throw webidl.errors.exception({ + header: prefix, + message: `Missing required key "${key}".` + }); + } + } + let value = dictionary[key]; + const hasDefault = Object.hasOwn(options, "defaultValue"); + if (hasDefault && value !== null) { + value ??= defaultValue(); + } + if (required || hasDefault || value !== void 0) { + value = converter(value, prefix, `${argument}.${key}`); + if (options.allowedValues && !options.allowedValues.includes(value)) { + throw webidl.errors.exception({ + header: prefix, + message: `${value} is not an accepted type. Expected one of ${options.allowedValues.join(", ")}.` + }); + } + dict[key] = value; + } + } + return dict; + }; + }; + webidl.nullableConverter = function(converter) { + return (V, prefix, argument) => { + if (V === null) { + return V; + } + return converter(V, prefix, argument); + }; + }; + webidl.converters.DOMString = function(V, prefix, argument, opts) { + if (V === null && opts?.legacyNullToEmptyString) { + return ""; + } + if (typeof V === "symbol") { + throw webidl.errors.exception({ + header: prefix, + message: `${argument} is a symbol, which cannot be converted to a DOMString.` + }); + } + return String(V); + }; + webidl.converters.ByteString = function(V, prefix, argument) { + const x = webidl.converters.DOMString(V, prefix, argument); + for (let index = 0; index < x.length; index++) { + if (x.charCodeAt(index) > 255) { + throw new TypeError( + `Cannot convert argument to a ByteString because the character at index ${index} has a value of ${x.charCodeAt(index)} which is greater than 255.` + ); + } + } + return x; + }; + webidl.converters.USVString = toUSVString; + webidl.converters.boolean = function(V) { + const x = Boolean(V); + return x; + }; + webidl.converters.any = function(V) { + return V; + }; + webidl.converters["long long"] = function(V, prefix, argument) { + const x = webidl.util.ConvertToInt(V, 64, "signed", void 0, prefix, argument); + return x; + }; + webidl.converters["unsigned long long"] = function(V, prefix, argument) { + const x = webidl.util.ConvertToInt(V, 64, "unsigned", void 0, prefix, argument); + return x; + }; + webidl.converters["unsigned long"] = function(V, prefix, argument) { + const x = webidl.util.ConvertToInt(V, 32, "unsigned", void 0, prefix, argument); + return x; + }; + webidl.converters["unsigned short"] = function(V, prefix, argument, opts) { + const x = webidl.util.ConvertToInt(V, 16, "unsigned", opts, prefix, argument); + return x; + }; + webidl.converters.ArrayBuffer = function(V, prefix, argument, opts) { + if (webidl.util.Type(V) !== "Object" || !types.isAnyArrayBuffer(V)) { + throw webidl.errors.conversionFailed({ + prefix, + argument: `${argument} ("${webidl.util.Stringify(V)}")`, + types: ["ArrayBuffer"] + }); + } + if (opts?.allowShared === false && types.isSharedArrayBuffer(V)) { + throw webidl.errors.exception({ + header: "ArrayBuffer", + message: "SharedArrayBuffer is not allowed." + }); + } + if (V.resizable || V.growable) { + throw webidl.errors.exception({ + header: "ArrayBuffer", + message: "Received a resizable ArrayBuffer." + }); + } + return V; + }; + webidl.converters.TypedArray = function(V, T, prefix, name, opts) { + if (webidl.util.Type(V) !== "Object" || !types.isTypedArray(V) || V.constructor.name !== T.name) { + throw webidl.errors.conversionFailed({ + prefix, + argument: `${name} ("${webidl.util.Stringify(V)}")`, + types: [T.name] + }); + } + if (opts?.allowShared === false && types.isSharedArrayBuffer(V.buffer)) { + throw webidl.errors.exception({ + header: "ArrayBuffer", + message: "SharedArrayBuffer is not allowed." + }); + } + if (V.buffer.resizable || V.buffer.growable) { + throw webidl.errors.exception({ + header: "ArrayBuffer", + message: "Received a resizable ArrayBuffer." + }); + } + return V; + }; + webidl.converters.DataView = function(V, prefix, name, opts) { + if (webidl.util.Type(V) !== "Object" || !types.isDataView(V)) { + throw webidl.errors.exception({ + header: prefix, + message: `${name} is not a DataView.` + }); + } + if (opts?.allowShared === false && types.isSharedArrayBuffer(V.buffer)) { + throw webidl.errors.exception({ + header: "ArrayBuffer", + message: "SharedArrayBuffer is not allowed." + }); + } + if (V.buffer.resizable || V.buffer.growable) { + throw webidl.errors.exception({ + header: "ArrayBuffer", + message: "Received a resizable ArrayBuffer." + }); + } + return V; + }; + webidl.converters.BufferSource = function(V, prefix, name, opts) { + if (types.isAnyArrayBuffer(V)) { + return webidl.converters.ArrayBuffer(V, prefix, name, { ...opts, allowShared: false }); + } + if (types.isTypedArray(V)) { + return webidl.converters.TypedArray(V, V.constructor, prefix, name, { ...opts, allowShared: false }); + } + if (types.isDataView(V)) { + return webidl.converters.DataView(V, prefix, name, { ...opts, allowShared: false }); + } + throw webidl.errors.conversionFailed({ + prefix, + argument: `${name} ("${webidl.util.Stringify(V)}")`, + types: ["BufferSource"] + }); + }; + webidl.converters["sequence"] = webidl.sequenceConverter( + webidl.converters.ByteString + ); + webidl.converters["sequence>"] = webidl.sequenceConverter( + webidl.converters["sequence"] + ); + webidl.converters["record"] = webidl.recordConverter( + webidl.converters.ByteString, + webidl.converters.ByteString + ); + module2.exports = { + webidl + }; + } +}); + +// node_modules/undici/lib/web/fetch/util.js +var require_util10 = __commonJS({ + "node_modules/undici/lib/web/fetch/util.js"(exports2, module2) { + "use strict"; + var { Transform } = require("node:stream"); + var zlib = require("node:zlib"); + var { redirectStatusSet, referrerPolicySet: referrerPolicyTokens, badPortsSet } = require_constants8(); + var { getGlobalOrigin } = require_global3(); + var { collectASequenceOfCodePoints, collectAnHTTPQuotedString, removeChars, parseMIMEType } = require_data_url(); + var { performance: performance2 } = require("node:perf_hooks"); + var { isBlobLike, ReadableStreamFrom, isValidHTTPToken, normalizedMethodRecordsBase } = require_util9(); + var assert = require("node:assert"); + var { isUint8Array } = require("node:util/types"); + var { webidl } = require_webidl2(); + var supportedHashes = []; + var crypto8; + try { + crypto8 = require("node:crypto"); + const possibleRelevantHashes = ["sha256", "sha384", "sha512"]; + supportedHashes = crypto8.getHashes().filter((hash) => possibleRelevantHashes.includes(hash)); + } catch { + } + function responseURL(response) { + const urlList = response.urlList; + const length = urlList.length; + return length === 0 ? null : urlList[length - 1].toString(); + } + function responseLocationURL(response, requestFragment) { + if (!redirectStatusSet.has(response.status)) { + return null; + } + let location = response.headersList.get("location", true); + if (location !== null && isValidHeaderValue(location)) { + if (!isValidEncodedURL(location)) { + location = normalizeBinaryStringToUtf8(location); + } + location = new URL(location, responseURL(response)); + } + if (location && !location.hash) { + location.hash = requestFragment; + } + return location; + } + function isValidEncodedURL(url) { + for (let i = 0; i < url.length; ++i) { + const code = url.charCodeAt(i); + if (code > 126 || // Non-US-ASCII + DEL + code < 32) { + return false; + } + } + return true; + } + function normalizeBinaryStringToUtf8(value) { + return Buffer.from(value, "binary").toString("utf8"); + } + function requestCurrentURL(request2) { + return request2.urlList[request2.urlList.length - 1]; + } + function requestBadPort(request2) { + const url = requestCurrentURL(request2); + if (urlIsHttpHttpsScheme(url) && badPortsSet.has(url.port)) { + return "blocked"; + } + return "allowed"; + } + function isErrorLike(object) { + return object instanceof Error || (object?.constructor?.name === "Error" || object?.constructor?.name === "DOMException"); + } + function isValidReasonPhrase(statusText) { + for (let i = 0; i < statusText.length; ++i) { + const c = statusText.charCodeAt(i); + if (!(c === 9 || // HTAB + c >= 32 && c <= 126 || // SP / VCHAR + c >= 128 && c <= 255)) { + return false; + } + } + return true; + } + var isValidHeaderName = isValidHTTPToken; + function isValidHeaderValue(potentialValue) { + return (potentialValue[0] === " " || potentialValue[0] === " " || potentialValue[potentialValue.length - 1] === " " || potentialValue[potentialValue.length - 1] === " " || potentialValue.includes("\n") || potentialValue.includes("\r") || potentialValue.includes("\0")) === false; + } + function setRequestReferrerPolicyOnRedirect(request2, actualResponse) { + const { headersList } = actualResponse; + const policyHeader = (headersList.get("referrer-policy", true) ?? "").split(","); + let policy = ""; + if (policyHeader.length > 0) { + for (let i = policyHeader.length; i !== 0; i--) { + const token = policyHeader[i - 1].trim(); + if (referrerPolicyTokens.has(token)) { + policy = token; + break; + } + } + } + if (policy !== "") { + request2.referrerPolicy = policy; + } + } + function crossOriginResourcePolicyCheck() { + return "allowed"; + } + function corsCheck() { + return "success"; + } + function TAOCheck() { + return "success"; + } + function appendFetchMetadata(httpRequest) { + let header = null; + header = httpRequest.mode; + httpRequest.headersList.set("sec-fetch-mode", header, true); + } + function appendRequestOriginHeader(request2) { + let serializedOrigin = request2.origin; + if (serializedOrigin === "client" || serializedOrigin === void 0) { + return; + } + if (request2.responseTainting === "cors" || request2.mode === "websocket") { + request2.headersList.append("origin", serializedOrigin, true); + } else if (request2.method !== "GET" && request2.method !== "HEAD") { + switch (request2.referrerPolicy) { + case "no-referrer": + serializedOrigin = null; + break; + case "no-referrer-when-downgrade": + case "strict-origin": + case "strict-origin-when-cross-origin": + if (request2.origin && urlHasHttpsScheme(request2.origin) && !urlHasHttpsScheme(requestCurrentURL(request2))) { + serializedOrigin = null; + } + break; + case "same-origin": + if (!sameOrigin(request2, requestCurrentURL(request2))) { + serializedOrigin = null; + } + break; + default: + } + request2.headersList.append("origin", serializedOrigin, true); + } + } + function coarsenTime(timestamp, crossOriginIsolatedCapability) { + return timestamp; + } + function clampAndCoarsenConnectionTimingInfo(connectionTimingInfo, defaultStartTime, crossOriginIsolatedCapability) { + if (!connectionTimingInfo?.startTime || connectionTimingInfo.startTime < defaultStartTime) { + return { + domainLookupStartTime: defaultStartTime, + domainLookupEndTime: defaultStartTime, + connectionStartTime: defaultStartTime, + connectionEndTime: defaultStartTime, + secureConnectionStartTime: defaultStartTime, + ALPNNegotiatedProtocol: connectionTimingInfo?.ALPNNegotiatedProtocol + }; + } + return { + domainLookupStartTime: coarsenTime(connectionTimingInfo.domainLookupStartTime, crossOriginIsolatedCapability), + domainLookupEndTime: coarsenTime(connectionTimingInfo.domainLookupEndTime, crossOriginIsolatedCapability), + connectionStartTime: coarsenTime(connectionTimingInfo.connectionStartTime, crossOriginIsolatedCapability), + connectionEndTime: coarsenTime(connectionTimingInfo.connectionEndTime, crossOriginIsolatedCapability), + secureConnectionStartTime: coarsenTime(connectionTimingInfo.secureConnectionStartTime, crossOriginIsolatedCapability), + ALPNNegotiatedProtocol: connectionTimingInfo.ALPNNegotiatedProtocol + }; + } + function coarsenedSharedCurrentTime(crossOriginIsolatedCapability) { + return coarsenTime(performance2.now(), crossOriginIsolatedCapability); + } + function createOpaqueTimingInfo(timingInfo) { + return { + startTime: timingInfo.startTime ?? 0, + redirectStartTime: 0, + redirectEndTime: 0, + postRedirectStartTime: timingInfo.startTime ?? 0, + finalServiceWorkerStartTime: 0, + finalNetworkResponseStartTime: 0, + finalNetworkRequestStartTime: 0, + endTime: 0, + encodedBodySize: 0, + decodedBodySize: 0, + finalConnectionTimingInfo: null + }; + } + function makePolicyContainer() { + return { + referrerPolicy: "strict-origin-when-cross-origin" + }; + } + function clonePolicyContainer(policyContainer) { + return { + referrerPolicy: policyContainer.referrerPolicy + }; + } + function determineRequestsReferrer(request2) { + const policy = request2.referrerPolicy; + assert(policy); + let referrerSource = null; + if (request2.referrer === "client") { + const globalOrigin = getGlobalOrigin(); + if (!globalOrigin || globalOrigin.origin === "null") { + return "no-referrer"; + } + referrerSource = new URL(globalOrigin); + } else if (request2.referrer instanceof URL) { + referrerSource = request2.referrer; + } + let referrerURL = stripURLForReferrer(referrerSource); + const referrerOrigin = stripURLForReferrer(referrerSource, true); + if (referrerURL.toString().length > 4096) { + referrerURL = referrerOrigin; + } + const areSameOrigin = sameOrigin(request2, referrerURL); + const isNonPotentiallyTrustWorthy = isURLPotentiallyTrustworthy(referrerURL) && !isURLPotentiallyTrustworthy(request2.url); + switch (policy) { + case "origin": + return referrerOrigin != null ? referrerOrigin : stripURLForReferrer(referrerSource, true); + case "unsafe-url": + return referrerURL; + case "same-origin": + return areSameOrigin ? referrerOrigin : "no-referrer"; + case "origin-when-cross-origin": + return areSameOrigin ? referrerURL : referrerOrigin; + case "strict-origin-when-cross-origin": { + const currentURL = requestCurrentURL(request2); + if (sameOrigin(referrerURL, currentURL)) { + return referrerURL; + } + if (isURLPotentiallyTrustworthy(referrerURL) && !isURLPotentiallyTrustworthy(currentURL)) { + return "no-referrer"; + } + return referrerOrigin; + } + case "strict-origin": + case "no-referrer-when-downgrade": + default: + return isNonPotentiallyTrustWorthy ? "no-referrer" : referrerOrigin; + } + } + function stripURLForReferrer(url, originOnly) { + assert(url instanceof URL); + url = new URL(url); + if (url.protocol === "file:" || url.protocol === "about:" || url.protocol === "blank:") { + return "no-referrer"; + } + url.username = ""; + url.password = ""; + url.hash = ""; + if (originOnly) { + url.pathname = ""; + url.search = ""; + } + return url; + } + function isURLPotentiallyTrustworthy(url) { + if (!(url instanceof URL)) { + return false; + } + if (url.href === "about:blank" || url.href === "about:srcdoc") { + return true; + } + if (url.protocol === "data:") return true; + if (url.protocol === "file:") return true; + return isOriginPotentiallyTrustworthy(url.origin); + function isOriginPotentiallyTrustworthy(origin) { + if (origin == null || origin === "null") return false; + const originAsURL = new URL(origin); + if (originAsURL.protocol === "https:" || originAsURL.protocol === "wss:") { + return true; + } + if (/^127(?:\.[0-9]+){0,2}\.[0-9]+$|^\[(?:0*:)*?:?0*1\]$/.test(originAsURL.hostname) || (originAsURL.hostname === "localhost" || originAsURL.hostname.includes("localhost.")) || originAsURL.hostname.endsWith(".localhost")) { + return true; + } + return false; + } + } + function bytesMatch(bytes, metadataList) { + if (crypto8 === void 0) { + return true; + } + const parsedMetadata = parseMetadata(metadataList); + if (parsedMetadata === "no metadata") { + return true; + } + if (parsedMetadata.length === 0) { + return true; + } + const strongest = getStrongestMetadata(parsedMetadata); + const metadata = filterMetadataListByAlgorithm(parsedMetadata, strongest); + for (const item of metadata) { + const algorithm = item.algo; + const expectedValue = item.hash; + let actualValue = crypto8.createHash(algorithm).update(bytes).digest("base64"); + if (actualValue[actualValue.length - 1] === "=") { + if (actualValue[actualValue.length - 2] === "=") { + actualValue = actualValue.slice(0, -2); + } else { + actualValue = actualValue.slice(0, -1); + } + } + if (compareBase64Mixed(actualValue, expectedValue)) { + return true; + } + } + return false; + } + var parseHashWithOptions = /(?sha256|sha384|sha512)-((?[A-Za-z0-9+/]+|[A-Za-z0-9_-]+)={0,2}(?:\s|$)( +[!-~]*)?)?/i; + function parseMetadata(metadata) { + const result = []; + let empty = true; + for (const token of metadata.split(" ")) { + empty = false; + const parsedToken = parseHashWithOptions.exec(token); + if (parsedToken === null || parsedToken.groups === void 0 || parsedToken.groups.algo === void 0) { + continue; + } + const algorithm = parsedToken.groups.algo.toLowerCase(); + if (supportedHashes.includes(algorithm)) { + result.push(parsedToken.groups); + } + } + if (empty === true) { + return "no metadata"; + } + return result; + } + function getStrongestMetadata(metadataList) { + let algorithm = metadataList[0].algo; + if (algorithm[3] === "5") { + return algorithm; + } + for (let i = 1; i < metadataList.length; ++i) { + const metadata = metadataList[i]; + if (metadata.algo[3] === "5") { + algorithm = "sha512"; + break; + } else if (algorithm[3] === "3") { + continue; + } else if (metadata.algo[3] === "3") { + algorithm = "sha384"; + } + } + return algorithm; + } + function filterMetadataListByAlgorithm(metadataList, algorithm) { + if (metadataList.length === 1) { + return metadataList; + } + let pos = 0; + for (let i = 0; i < metadataList.length; ++i) { + if (metadataList[i].algo === algorithm) { + metadataList[pos++] = metadataList[i]; + } + } + metadataList.length = pos; + return metadataList; + } + function compareBase64Mixed(actualValue, expectedValue) { + if (actualValue.length !== expectedValue.length) { + return false; + } + for (let i = 0; i < actualValue.length; ++i) { + if (actualValue[i] !== expectedValue[i]) { + if (actualValue[i] === "+" && expectedValue[i] === "-" || actualValue[i] === "/" && expectedValue[i] === "_") { + continue; + } + return false; + } + } + return true; + } + function tryUpgradeRequestToAPotentiallyTrustworthyURL(request2) { + } + function sameOrigin(A, B) { + if (A.origin === B.origin && A.origin === "null") { + return true; + } + if (A.protocol === B.protocol && A.hostname === B.hostname && A.port === B.port) { + return true; + } + return false; + } + function createDeferredPromise() { + let res; + let rej; + const promise = new Promise((resolve, reject) => { + res = resolve; + rej = reject; + }); + return { promise, resolve: res, reject: rej }; + } + function isAborted(fetchParams) { + return fetchParams.controller.state === "aborted"; + } + function isCancelled(fetchParams) { + return fetchParams.controller.state === "aborted" || fetchParams.controller.state === "terminated"; + } + function normalizeMethod(method) { + return normalizedMethodRecordsBase[method.toLowerCase()] ?? method; + } + function serializeJavascriptValueToJSONString(value) { + const result = JSON.stringify(value); + if (result === void 0) { + throw new TypeError("Value is not JSON serializable"); + } + assert(typeof result === "string"); + return result; + } + var esIteratorPrototype = Object.getPrototypeOf(Object.getPrototypeOf([][Symbol.iterator]())); + function createIterator(name, kInternalIterator, keyIndex = 0, valueIndex = 1) { + class FastIterableIterator { + /** @type {any} */ + #target; + /** @type {'key' | 'value' | 'key+value'} */ + #kind; + /** @type {number} */ + #index; + /** + * @see https://webidl.spec.whatwg.org/#dfn-default-iterator-object + * @param {unknown} target + * @param {'key' | 'value' | 'key+value'} kind + */ + constructor(target, kind) { + this.#target = target; + this.#kind = kind; + this.#index = 0; + } + next() { + if (typeof this !== "object" || this === null || !(#target in this)) { + throw new TypeError( + `'next' called on an object that does not implement interface ${name} Iterator.` + ); + } + const index = this.#index; + const values = this.#target[kInternalIterator]; + const len = values.length; + if (index >= len) { + return { + value: void 0, + done: true + }; + } + const { [keyIndex]: key, [valueIndex]: value } = values[index]; + this.#index = index + 1; + let result; + switch (this.#kind) { + case "key": + result = key; + break; + case "value": + result = value; + break; + case "key+value": + result = [key, value]; + break; + } + return { + value: result, + done: false + }; + } + } + delete FastIterableIterator.prototype.constructor; + Object.setPrototypeOf(FastIterableIterator.prototype, esIteratorPrototype); + Object.defineProperties(FastIterableIterator.prototype, { + [Symbol.toStringTag]: { + writable: false, + enumerable: false, + configurable: true, + value: `${name} Iterator` + }, + next: { writable: true, enumerable: true, configurable: true } + }); + return function(target, kind) { + return new FastIterableIterator(target, kind); + }; + } + function iteratorMixin(name, object, kInternalIterator, keyIndex = 0, valueIndex = 1) { + const makeIterator = createIterator(name, kInternalIterator, keyIndex, valueIndex); + const properties = { + keys: { + writable: true, + enumerable: true, + configurable: true, + value: function keys() { + webidl.brandCheck(this, object); + return makeIterator(this, "key"); + } + }, + values: { + writable: true, + enumerable: true, + configurable: true, + value: function values() { + webidl.brandCheck(this, object); + return makeIterator(this, "value"); + } + }, + entries: { + writable: true, + enumerable: true, + configurable: true, + value: function entries() { + webidl.brandCheck(this, object); + return makeIterator(this, "key+value"); + } + }, + forEach: { + writable: true, + enumerable: true, + configurable: true, + value: function forEach(callbackfn, thisArg = globalThis) { + webidl.brandCheck(this, object); + webidl.argumentLengthCheck(arguments, 1, `${name}.forEach`); + if (typeof callbackfn !== "function") { + throw new TypeError( + `Failed to execute 'forEach' on '${name}': parameter 1 is not of type 'Function'.` + ); + } + for (const { 0: key, 1: value } of makeIterator(this, "key+value")) { + callbackfn.call(thisArg, value, key, this); + } + } + } + }; + return Object.defineProperties(object.prototype, { + ...properties, + [Symbol.iterator]: { + writable: true, + enumerable: false, + configurable: true, + value: properties.entries.value + } + }); + } + async function fullyReadBody(body, processBody, processBodyError) { + const successSteps = processBody; + const errorSteps = processBodyError; + let reader; + try { + reader = body.stream.getReader(); + } catch (e) { + errorSteps(e); + return; + } + try { + successSteps(await readAllBytes(reader)); + } catch (e) { + errorSteps(e); + } + } + function isReadableStreamLike(stream) { + return stream instanceof ReadableStream || stream[Symbol.toStringTag] === "ReadableStream" && typeof stream.tee === "function"; + } + function readableStreamClose(controller) { + try { + controller.close(); + controller.byobRequest?.respond(0); + } catch (err) { + if (!err.message.includes("Controller is already closed") && !err.message.includes("ReadableStream is already closed")) { + throw err; + } + } + } + var invalidIsomorphicEncodeValueRegex = /[^\x00-\xFF]/; + function isomorphicEncode(input) { + assert(!invalidIsomorphicEncodeValueRegex.test(input)); + return input; + } + async function readAllBytes(reader) { + const bytes = []; + let byteLength = 0; + while (true) { + const { done, value: chunk } = await reader.read(); + if (done) { + return Buffer.concat(bytes, byteLength); + } + if (!isUint8Array(chunk)) { + throw new TypeError("Received non-Uint8Array chunk"); + } + bytes.push(chunk); + byteLength += chunk.length; + } + } + function urlIsLocal(url) { + assert("protocol" in url); + const protocol = url.protocol; + return protocol === "about:" || protocol === "blob:" || protocol === "data:"; + } + function urlHasHttpsScheme(url) { + return typeof url === "string" && url[5] === ":" && url[0] === "h" && url[1] === "t" && url[2] === "t" && url[3] === "p" && url[4] === "s" || url.protocol === "https:"; + } + function urlIsHttpHttpsScheme(url) { + assert("protocol" in url); + const protocol = url.protocol; + return protocol === "http:" || protocol === "https:"; + } + function simpleRangeHeaderValue(value, allowWhitespace) { + const data = value; + if (!data.startsWith("bytes")) { + return "failure"; + } + const position = { position: 5 }; + if (allowWhitespace) { + collectASequenceOfCodePoints( + (char) => char === " " || char === " ", + data, + position + ); + } + if (data.charCodeAt(position.position) !== 61) { + return "failure"; + } + position.position++; + if (allowWhitespace) { + collectASequenceOfCodePoints( + (char) => char === " " || char === " ", + data, + position + ); + } + const rangeStart = collectASequenceOfCodePoints( + (char) => { + const code = char.charCodeAt(0); + return code >= 48 && code <= 57; + }, + data, + position + ); + const rangeStartValue = rangeStart.length ? Number(rangeStart) : null; + if (allowWhitespace) { + collectASequenceOfCodePoints( + (char) => char === " " || char === " ", + data, + position + ); + } + if (data.charCodeAt(position.position) !== 45) { + return "failure"; + } + position.position++; + if (allowWhitespace) { + collectASequenceOfCodePoints( + (char) => char === " " || char === " ", + data, + position + ); + } + const rangeEnd = collectASequenceOfCodePoints( + (char) => { + const code = char.charCodeAt(0); + return code >= 48 && code <= 57; + }, + data, + position + ); + const rangeEndValue = rangeEnd.length ? Number(rangeEnd) : null; + if (position.position < data.length) { + return "failure"; + } + if (rangeEndValue === null && rangeStartValue === null) { + return "failure"; + } + if (rangeStartValue > rangeEndValue) { + return "failure"; + } + return { rangeStartValue, rangeEndValue }; + } + function buildContentRange(rangeStart, rangeEnd, fullLength) { + let contentRange = "bytes "; + contentRange += isomorphicEncode(`${rangeStart}`); + contentRange += "-"; + contentRange += isomorphicEncode(`${rangeEnd}`); + contentRange += "/"; + contentRange += isomorphicEncode(`${fullLength}`); + return contentRange; + } + var InflateStream = class extends Transform { + _transform(chunk, encoding, callback) { + if (!this._inflateStream) { + if (chunk.length === 0) { + callback(); + return; + } + this._inflateStream = (chunk[0] & 15) === 8 ? zlib.createInflate() : zlib.createInflateRaw(); + this._inflateStream.on("data", this.push.bind(this)); + this._inflateStream.on("end", () => this.push(null)); + this._inflateStream.on("error", (err) => this.destroy(err)); + } + this._inflateStream.write(chunk, encoding, callback); + } + _final(callback) { + if (this._inflateStream) { + this._inflateStream.end(); + this._inflateStream = null; + } + callback(); + } + }; + function createInflate() { + return new InflateStream(); + } + function extractMimeType(headers) { + let charset = null; + let essence = null; + let mimeType = null; + const values = getDecodeSplit("content-type", headers); + if (values === null) { + return "failure"; + } + for (const value of values) { + const temporaryMimeType = parseMIMEType(value); + if (temporaryMimeType === "failure" || temporaryMimeType.essence === "*/*") { + continue; + } + mimeType = temporaryMimeType; + if (mimeType.essence !== essence) { + charset = null; + if (mimeType.parameters.has("charset")) { + charset = mimeType.parameters.get("charset"); + } + essence = mimeType.essence; + } else if (!mimeType.parameters.has("charset") && charset !== null) { + mimeType.parameters.set("charset", charset); + } + } + if (mimeType == null) { + return "failure"; + } + return mimeType; + } + function gettingDecodingSplitting(value) { + const input = value; + const position = { position: 0 }; + const values = []; + let temporaryValue = ""; + while (position.position < input.length) { + temporaryValue += collectASequenceOfCodePoints( + (char) => char !== '"' && char !== ",", + input, + position + ); + if (position.position < input.length) { + if (input.charCodeAt(position.position) === 34) { + temporaryValue += collectAnHTTPQuotedString( + input, + position + ); + if (position.position < input.length) { + continue; + } + } else { + assert(input.charCodeAt(position.position) === 44); + position.position++; + } + } + temporaryValue = removeChars(temporaryValue, true, true, (char) => char === 9 || char === 32); + values.push(temporaryValue); + temporaryValue = ""; + } + return values; + } + function getDecodeSplit(name, list) { + const value = list.get(name, true); + if (value === null) { + return null; + } + return gettingDecodingSplitting(value); + } + var textDecoder = new TextDecoder(); + function utf8DecodeBytes(buffer) { + if (buffer.length === 0) { + return ""; + } + if (buffer[0] === 239 && buffer[1] === 187 && buffer[2] === 191) { + buffer = buffer.subarray(3); + } + const output = textDecoder.decode(buffer); + return output; + } + var EnvironmentSettingsObjectBase = class { + get baseUrl() { + return getGlobalOrigin(); + } + get origin() { + return this.baseUrl?.origin; + } + policyContainer = makePolicyContainer(); + }; + var EnvironmentSettingsObject = class { + settingsObject = new EnvironmentSettingsObjectBase(); + }; + var environmentSettingsObject = new EnvironmentSettingsObject(); + module2.exports = { + isAborted, + isCancelled, + isValidEncodedURL, + createDeferredPromise, + ReadableStreamFrom, + tryUpgradeRequestToAPotentiallyTrustworthyURL, + clampAndCoarsenConnectionTimingInfo, + coarsenedSharedCurrentTime, + determineRequestsReferrer, + makePolicyContainer, + clonePolicyContainer, + appendFetchMetadata, + appendRequestOriginHeader, + TAOCheck, + corsCheck, + crossOriginResourcePolicyCheck, + createOpaqueTimingInfo, + setRequestReferrerPolicyOnRedirect, + isValidHTTPToken, + requestBadPort, + requestCurrentURL, + responseURL, + responseLocationURL, + isBlobLike, + isURLPotentiallyTrustworthy, + isValidReasonPhrase, + sameOrigin, + normalizeMethod, + serializeJavascriptValueToJSONString, + iteratorMixin, + createIterator, + isValidHeaderName, + isValidHeaderValue, + isErrorLike, + fullyReadBody, + bytesMatch, + isReadableStreamLike, + readableStreamClose, + isomorphicEncode, + urlIsLocal, + urlHasHttpsScheme, + urlIsHttpHttpsScheme, + readAllBytes, + simpleRangeHeaderValue, + buildContentRange, + parseMetadata, + createInflate, + extractMimeType, + getDecodeSplit, + utf8DecodeBytes, + environmentSettingsObject + }; + } +}); + +// node_modules/undici/lib/web/fetch/symbols.js +var require_symbols7 = __commonJS({ + "node_modules/undici/lib/web/fetch/symbols.js"(exports2, module2) { + "use strict"; + module2.exports = { + kUrl: Symbol("url"), + kHeaders: Symbol("headers"), + kSignal: Symbol("signal"), + kState: Symbol("state"), + kDispatcher: Symbol("dispatcher") + }; + } +}); + +// node_modules/undici/lib/web/fetch/file.js +var require_file2 = __commonJS({ + "node_modules/undici/lib/web/fetch/file.js"(exports2, module2) { + "use strict"; + var { Blob: Blob2, File } = require("node:buffer"); + var { kState } = require_symbols7(); + var { webidl } = require_webidl2(); + var FileLike = class _FileLike { + constructor(blobLike, fileName, options = {}) { + const n = fileName; + const t = options.type; + const d = options.lastModified ?? Date.now(); + this[kState] = { + blobLike, + name: n, + type: t, + lastModified: d + }; + } + stream(...args) { + webidl.brandCheck(this, _FileLike); + return this[kState].blobLike.stream(...args); + } + arrayBuffer(...args) { + webidl.brandCheck(this, _FileLike); + return this[kState].blobLike.arrayBuffer(...args); + } + slice(...args) { + webidl.brandCheck(this, _FileLike); + return this[kState].blobLike.slice(...args); + } + text(...args) { + webidl.brandCheck(this, _FileLike); + return this[kState].blobLike.text(...args); + } + get size() { + webidl.brandCheck(this, _FileLike); + return this[kState].blobLike.size; + } + get type() { + webidl.brandCheck(this, _FileLike); + return this[kState].blobLike.type; + } + get name() { + webidl.brandCheck(this, _FileLike); + return this[kState].name; + } + get lastModified() { + webidl.brandCheck(this, _FileLike); + return this[kState].lastModified; + } + get [Symbol.toStringTag]() { + return "File"; + } + }; + webidl.converters.Blob = webidl.interfaceConverter(Blob2); + function isFileLike(object) { + return object instanceof File || object && (typeof object.stream === "function" || typeof object.arrayBuffer === "function") && object[Symbol.toStringTag] === "File"; + } + module2.exports = { FileLike, isFileLike }; + } +}); + +// node_modules/undici/lib/web/fetch/formdata.js +var require_formdata2 = __commonJS({ + "node_modules/undici/lib/web/fetch/formdata.js"(exports2, module2) { + "use strict"; + var { isBlobLike, iteratorMixin } = require_util10(); + var { kState } = require_symbols7(); + var { kEnumerableProperty } = require_util9(); + var { FileLike, isFileLike } = require_file2(); + var { webidl } = require_webidl2(); + var { File: NativeFile } = require("node:buffer"); + var nodeUtil = require("node:util"); + var File = globalThis.File ?? NativeFile; + var FormData = class _FormData { + constructor(form) { + if (form !== void 0) { + throw webidl.errors.conversionFailed({ + prefix: "FormData constructor", + argument: "Argument 1", + types: ["undefined"] + }); + } + this[kState] = []; + } + append(name, value, filename = void 0) { + webidl.brandCheck(this, _FormData); + const prefix = "FormData.append"; + webidl.argumentLengthCheck(arguments, 2, prefix); + if (arguments.length === 3 && !isBlobLike(value)) { + throw new TypeError( + "Failed to execute 'append' on 'FormData': parameter 2 is not of type 'Blob'" + ); + } + name = webidl.converters.USVString(name, prefix, "name"); + value = isBlobLike(value) ? webidl.converters.Blob(value, prefix, "value", { strict: false }) : webidl.converters.USVString(value, prefix, "value"); + filename = arguments.length === 3 ? webidl.converters.USVString(filename, prefix, "filename") : void 0; + const entry = makeEntry(name, value, filename); + this[kState].push(entry); + } + delete(name) { + webidl.brandCheck(this, _FormData); + const prefix = "FormData.delete"; + webidl.argumentLengthCheck(arguments, 1, prefix); + name = webidl.converters.USVString(name, prefix, "name"); + this[kState] = this[kState].filter((entry) => entry.name !== name); + } + get(name) { + webidl.brandCheck(this, _FormData); + const prefix = "FormData.get"; + webidl.argumentLengthCheck(arguments, 1, prefix); + name = webidl.converters.USVString(name, prefix, "name"); + const idx = this[kState].findIndex((entry) => entry.name === name); + if (idx === -1) { + return null; + } + return this[kState][idx].value; + } + getAll(name) { + webidl.brandCheck(this, _FormData); + const prefix = "FormData.getAll"; + webidl.argumentLengthCheck(arguments, 1, prefix); + name = webidl.converters.USVString(name, prefix, "name"); + return this[kState].filter((entry) => entry.name === name).map((entry) => entry.value); + } + has(name) { + webidl.brandCheck(this, _FormData); + const prefix = "FormData.has"; + webidl.argumentLengthCheck(arguments, 1, prefix); + name = webidl.converters.USVString(name, prefix, "name"); + return this[kState].findIndex((entry) => entry.name === name) !== -1; + } + set(name, value, filename = void 0) { + webidl.brandCheck(this, _FormData); + const prefix = "FormData.set"; + webidl.argumentLengthCheck(arguments, 2, prefix); + if (arguments.length === 3 && !isBlobLike(value)) { + throw new TypeError( + "Failed to execute 'set' on 'FormData': parameter 2 is not of type 'Blob'" + ); + } + name = webidl.converters.USVString(name, prefix, "name"); + value = isBlobLike(value) ? webidl.converters.Blob(value, prefix, "name", { strict: false }) : webidl.converters.USVString(value, prefix, "name"); + filename = arguments.length === 3 ? webidl.converters.USVString(filename, prefix, "name") : void 0; + const entry = makeEntry(name, value, filename); + const idx = this[kState].findIndex((entry2) => entry2.name === name); + if (idx !== -1) { + this[kState] = [ + ...this[kState].slice(0, idx), + entry, + ...this[kState].slice(idx + 1).filter((entry2) => entry2.name !== name) + ]; + } else { + this[kState].push(entry); + } + } + [nodeUtil.inspect.custom](depth, options) { + const state = this[kState].reduce((a, b) => { + if (a[b.name]) { + if (Array.isArray(a[b.name])) { + a[b.name].push(b.value); + } else { + a[b.name] = [a[b.name], b.value]; + } + } else { + a[b.name] = b.value; + } + return a; + }, { __proto__: null }); + options.depth ??= depth; + options.colors ??= true; + const output = nodeUtil.formatWithOptions(options, state); + return `FormData ${output.slice(output.indexOf("]") + 2)}`; + } + }; + iteratorMixin("FormData", FormData, kState, "name", "value"); + Object.defineProperties(FormData.prototype, { + append: kEnumerableProperty, + delete: kEnumerableProperty, + get: kEnumerableProperty, + getAll: kEnumerableProperty, + has: kEnumerableProperty, + set: kEnumerableProperty, + [Symbol.toStringTag]: { + value: "FormData", + configurable: true + } + }); + function makeEntry(name, value, filename) { + if (typeof value === "string") { + } else { + if (!isFileLike(value)) { + value = value instanceof Blob ? new File([value], "blob", { type: value.type }) : new FileLike(value, "blob", { type: value.type }); + } + if (filename !== void 0) { + const options = { + type: value.type, + lastModified: value.lastModified + }; + value = value instanceof NativeFile ? new File([value], filename, options) : new FileLike(value, filename, options); + } + } + return { name, value }; + } + module2.exports = { FormData, makeEntry }; + } +}); + +// node_modules/undici/lib/web/fetch/formdata-parser.js +var require_formdata_parser = __commonJS({ + "node_modules/undici/lib/web/fetch/formdata-parser.js"(exports2, module2) { + "use strict"; + var { isUSVString, bufferToLowerCasedHeaderName } = require_util9(); + var { utf8DecodeBytes } = require_util10(); + var { HTTP_TOKEN_CODEPOINTS, isomorphicDecode } = require_data_url(); + var { isFileLike } = require_file2(); + var { makeEntry } = require_formdata2(); + var assert = require("node:assert"); + var { File: NodeFile } = require("node:buffer"); + var File = globalThis.File ?? NodeFile; + var formDataNameBuffer = Buffer.from('form-data; name="'); + var filenameBuffer = Buffer.from("; filename"); + var dd = Buffer.from("--"); + var ddcrlf = Buffer.from("--\r\n"); + function isAsciiString(chars) { + for (let i = 0; i < chars.length; ++i) { + if ((chars.charCodeAt(i) & ~127) !== 0) { + return false; + } + } + return true; + } + function validateBoundary(boundary) { + const length = boundary.length; + if (length < 27 || length > 70) { + return false; + } + for (let i = 0; i < length; ++i) { + const cp = boundary.charCodeAt(i); + if (!(cp >= 48 && cp <= 57 || cp >= 65 && cp <= 90 || cp >= 97 && cp <= 122 || cp === 39 || cp === 45 || cp === 95)) { + return false; + } + } + return true; + } + function multipartFormDataParser(input, mimeType) { + assert(mimeType !== "failure" && mimeType.essence === "multipart/form-data"); + const boundaryString = mimeType.parameters.get("boundary"); + if (boundaryString === void 0) { + return "failure"; + } + const boundary = Buffer.from(`--${boundaryString}`, "utf8"); + const entryList = []; + const position = { position: 0 }; + if (input[0] === 13 && input[1] === 10) { + position.position += 2; + } + while (true) { + if (input.subarray(position.position, position.position + boundary.length).equals(boundary)) { + position.position += boundary.length; + } else { + return "failure"; + } + if (position.position === input.length - 2 && bufferStartsWith(input, dd, position) || position.position === input.length - 4 && bufferStartsWith(input, ddcrlf, position)) { + return entryList; + } + if (input[position.position] !== 13 || input[position.position + 1] !== 10) { + return "failure"; + } + position.position += 2; + const result = parseMultipartFormDataHeaders(input, position); + if (result === "failure") { + return "failure"; + } + let { name, filename, contentType, encoding } = result; + position.position += 2; + let body; + { + const boundaryIndex = input.indexOf(boundary.subarray(2), position.position); + if (boundaryIndex === -1) { + return "failure"; + } + body = input.subarray(position.position, boundaryIndex - 4); + position.position += body.length; + if (encoding === "base64") { + body = Buffer.from(body.toString(), "base64"); + } + } + if (input[position.position] !== 13 || input[position.position + 1] !== 10) { + return "failure"; + } else { + position.position += 2; + } + let value; + if (filename !== null) { + contentType ??= "text/plain"; + if (!isAsciiString(contentType)) { + contentType = ""; + } + value = new File([body], filename, { type: contentType }); + } else { + value = utf8DecodeBytes(Buffer.from(body)); + } + assert(isUSVString(name)); + assert(typeof value === "string" && isUSVString(value) || isFileLike(value)); + entryList.push(makeEntry(name, value, filename)); + } + } + function parseMultipartFormDataHeaders(input, position) { + let name = null; + let filename = null; + let contentType = null; + let encoding = null; + while (true) { + if (input[position.position] === 13 && input[position.position + 1] === 10) { + if (name === null) { + return "failure"; + } + return { name, filename, contentType, encoding }; + } + let headerName = collectASequenceOfBytes( + (char) => char !== 10 && char !== 13 && char !== 58, + input, + position + ); + headerName = removeChars(headerName, true, true, (char) => char === 9 || char === 32); + if (!HTTP_TOKEN_CODEPOINTS.test(headerName.toString())) { + return "failure"; + } + if (input[position.position] !== 58) { + return "failure"; + } + position.position++; + collectASequenceOfBytes( + (char) => char === 32 || char === 9, + input, + position + ); + switch (bufferToLowerCasedHeaderName(headerName)) { + case "content-disposition": { + name = filename = null; + if (!bufferStartsWith(input, formDataNameBuffer, position)) { + return "failure"; + } + position.position += 17; + name = parseMultipartFormDataName(input, position); + if (name === null) { + return "failure"; + } + if (bufferStartsWith(input, filenameBuffer, position)) { + let check = position.position + filenameBuffer.length; + if (input[check] === 42) { + position.position += 1; + check += 1; + } + if (input[check] !== 61 || input[check + 1] !== 34) { + return "failure"; + } + position.position += 12; + filename = parseMultipartFormDataName(input, position); + if (filename === null) { + return "failure"; + } + } + break; + } + case "content-type": { + let headerValue = collectASequenceOfBytes( + (char) => char !== 10 && char !== 13, + input, + position + ); + headerValue = removeChars(headerValue, false, true, (char) => char === 9 || char === 32); + contentType = isomorphicDecode(headerValue); + break; + } + case "content-transfer-encoding": { + let headerValue = collectASequenceOfBytes( + (char) => char !== 10 && char !== 13, + input, + position + ); + headerValue = removeChars(headerValue, false, true, (char) => char === 9 || char === 32); + encoding = isomorphicDecode(headerValue); + break; + } + default: { + collectASequenceOfBytes( + (char) => char !== 10 && char !== 13, + input, + position + ); + } + } + if (input[position.position] !== 13 && input[position.position + 1] !== 10) { + return "failure"; + } else { + position.position += 2; + } + } + } + function parseMultipartFormDataName(input, position) { + assert(input[position.position - 1] === 34); + let name = collectASequenceOfBytes( + (char) => char !== 10 && char !== 13 && char !== 34, + input, + position + ); + if (input[position.position] !== 34) { + return null; + } else { + position.position++; + } + name = new TextDecoder().decode(name).replace(/%0A/ig, "\n").replace(/%0D/ig, "\r").replace(/%22/g, '"'); + return name; + } + function collectASequenceOfBytes(condition, input, position) { + let start = position.position; + while (start < input.length && condition(input[start])) { + ++start; + } + return input.subarray(position.position, position.position = start); + } + function removeChars(buf, leading, trailing, predicate) { + let lead = 0; + let trail = buf.length - 1; + if (leading) { + while (lead < buf.length && predicate(buf[lead])) lead++; + } + if (trailing) { + while (trail > 0 && predicate(buf[trail])) trail--; + } + return lead === 0 && trail === buf.length - 1 ? buf : buf.subarray(lead, trail + 1); + } + function bufferStartsWith(buffer, start, position) { + if (buffer.length < start.length) { + return false; + } + for (let i = 0; i < start.length; i++) { + if (start[i] !== buffer[position.position + i]) { + return false; + } + } + return true; + } + module2.exports = { + multipartFormDataParser, + validateBoundary + }; + } +}); + +// node_modules/undici/lib/web/fetch/body.js +var require_body2 = __commonJS({ + "node_modules/undici/lib/web/fetch/body.js"(exports2, module2) { + "use strict"; + var util = require_util9(); + var { + ReadableStreamFrom, + isBlobLike, + isReadableStreamLike, + readableStreamClose, + createDeferredPromise, + fullyReadBody, + extractMimeType, + utf8DecodeBytes + } = require_util10(); + var { FormData } = require_formdata2(); + var { kState } = require_symbols7(); + var { webidl } = require_webidl2(); + var { Blob: Blob2 } = require("node:buffer"); + var assert = require("node:assert"); + var { isErrored } = require_util9(); + var { isArrayBuffer } = require("node:util/types"); + var { serializeAMimeType } = require_data_url(); + var { multipartFormDataParser } = require_formdata_parser(); + var textEncoder = new TextEncoder(); + function extractBody(object, keepalive = false) { + let stream = null; + if (object instanceof ReadableStream) { + stream = object; + } else if (isBlobLike(object)) { + stream = object.stream(); + } else { + stream = new ReadableStream({ + async pull(controller) { + const buffer = typeof source === "string" ? textEncoder.encode(source) : source; + if (buffer.byteLength) { + controller.enqueue(buffer); + } + queueMicrotask(() => readableStreamClose(controller)); + }, + start() { + }, + type: "bytes" + }); + } + assert(isReadableStreamLike(stream)); + let action = null; + let source = null; + let length = null; + let type = null; + if (typeof object === "string") { + source = object; + type = "text/plain;charset=UTF-8"; + } else if (object instanceof URLSearchParams) { + source = object.toString(); + type = "application/x-www-form-urlencoded;charset=UTF-8"; + } else if (isArrayBuffer(object)) { + source = new Uint8Array(object.slice()); + } else if (ArrayBuffer.isView(object)) { + source = new Uint8Array(object.buffer.slice(object.byteOffset, object.byteOffset + object.byteLength)); + } else if (util.isFormDataLike(object)) { + const boundary = `----formdata-undici-0${`${Math.floor(Math.random() * 1e11)}`.padStart(11, "0")}`; + const prefix = `--${boundary}\r +Content-Disposition: form-data`; + const escape = (str) => str.replace(/\n/g, "%0A").replace(/\r/g, "%0D").replace(/"/g, "%22"); + const normalizeLinefeeds = (value) => value.replace(/\r?\n|\r/g, "\r\n"); + const blobParts = []; + const rn = new Uint8Array([13, 10]); + length = 0; + let hasUnknownSizeValue = false; + for (const [name, value] of object) { + if (typeof value === "string") { + const chunk2 = textEncoder.encode(prefix + `; name="${escape(normalizeLinefeeds(name))}"\r +\r +${normalizeLinefeeds(value)}\r +`); + blobParts.push(chunk2); + length += chunk2.byteLength; + } else { + const chunk2 = textEncoder.encode(`${prefix}; name="${escape(normalizeLinefeeds(name))}"` + (value.name ? `; filename="${escape(value.name)}"` : "") + `\r +Content-Type: ${value.type || "application/octet-stream"}\r +\r +`); + blobParts.push(chunk2, value, rn); + if (typeof value.size === "number") { + length += chunk2.byteLength + value.size + rn.byteLength; + } else { + hasUnknownSizeValue = true; + } + } + } + const chunk = textEncoder.encode(`--${boundary}--`); + blobParts.push(chunk); + length += chunk.byteLength; + if (hasUnknownSizeValue) { + length = null; + } + source = object; + action = async function* () { + for (const part of blobParts) { + if (part.stream) { + yield* part.stream(); + } else { + yield part; + } + } + }; + type = `multipart/form-data; boundary=${boundary}`; + } else if (isBlobLike(object)) { + source = object; + length = object.size; + if (object.type) { + type = object.type; + } + } else if (typeof object[Symbol.asyncIterator] === "function") { + if (keepalive) { + throw new TypeError("keepalive"); + } + if (util.isDisturbed(object) || object.locked) { + throw new TypeError( + "Response body object should not be disturbed or locked" + ); + } + stream = object instanceof ReadableStream ? object : ReadableStreamFrom(object); + } + if (typeof source === "string" || util.isBuffer(source)) { + length = Buffer.byteLength(source); + } + if (action != null) { + let iterator; + stream = new ReadableStream({ + async start() { + iterator = action(object)[Symbol.asyncIterator](); + }, + async pull(controller) { + const { value, done } = await iterator.next(); + if (done) { + queueMicrotask(() => { + controller.close(); + controller.byobRequest?.respond(0); + }); + } else { + if (!isErrored(stream)) { + const buffer = new Uint8Array(value); + if (buffer.byteLength) { + controller.enqueue(buffer); + } + } + } + return controller.desiredSize > 0; + }, + async cancel(reason) { + await iterator.return(); + }, + type: "bytes" + }); + } + const body = { stream, source, length }; + return [body, type]; + } + function safelyExtractBody(object, keepalive = false) { + if (object instanceof ReadableStream) { + assert(!util.isDisturbed(object), "The body has already been consumed."); + assert(!object.locked, "The stream is locked."); + } + return extractBody(object, keepalive); + } + function cloneBody(body) { + const [out1, out2] = body.stream.tee(); + body.stream = out1; + return { + stream: out2, + length: body.length, + source: body.source + }; + } + function throwIfAborted(state) { + if (state.aborted) { + throw new DOMException("The operation was aborted.", "AbortError"); + } + } + function bodyMixinMethods(instance) { + const methods = { + blob() { + return consumeBody(this, (bytes) => { + let mimeType = bodyMimeType(this); + if (mimeType === null) { + mimeType = ""; + } else if (mimeType) { + mimeType = serializeAMimeType(mimeType); + } + return new Blob2([bytes], { type: mimeType }); + }, instance); + }, + arrayBuffer() { + return consumeBody(this, (bytes) => { + return new Uint8Array(bytes).buffer; + }, instance); + }, + text() { + return consumeBody(this, utf8DecodeBytes, instance); + }, + json() { + return consumeBody(this, parseJSONFromBytes, instance); + }, + formData() { + return consumeBody(this, (value) => { + const mimeType = bodyMimeType(this); + if (mimeType !== null) { + switch (mimeType.essence) { + case "multipart/form-data": { + const parsed = multipartFormDataParser(value, mimeType); + if (parsed === "failure") { + throw new TypeError("Failed to parse body as FormData."); + } + const fd = new FormData(); + fd[kState] = parsed; + return fd; + } + case "application/x-www-form-urlencoded": { + const entries = new URLSearchParams(value.toString()); + const fd = new FormData(); + for (const [name, value2] of entries) { + fd.append(name, value2); + } + return fd; + } + } + } + throw new TypeError( + 'Content-Type was not one of "multipart/form-data" or "application/x-www-form-urlencoded".' + ); + }, instance); + }, + bytes() { + return consumeBody(this, (bytes) => { + return new Uint8Array(bytes); + }, instance); + } + }; + return methods; + } + function mixinBody(prototype) { + Object.assign(prototype.prototype, bodyMixinMethods(prototype)); + } + async function consumeBody(object, convertBytesToJSValue, instance) { + webidl.brandCheck(object, instance); + if (bodyUnusable(object[kState].body)) { + throw new TypeError("Body is unusable: Body has already been read"); + } + throwIfAborted(object[kState]); + const promise = createDeferredPromise(); + const errorSteps = (error) => promise.reject(error); + const successSteps = (data) => { + try { + promise.resolve(convertBytesToJSValue(data)); + } catch (e) { + errorSteps(e); + } + }; + if (object[kState].body == null) { + successSteps(Buffer.allocUnsafe(0)); + return promise.promise; + } + await fullyReadBody(object[kState].body, successSteps, errorSteps); + return promise.promise; + } + function bodyUnusable(body) { + return body != null && (body.stream.locked || util.isDisturbed(body.stream)); + } + function parseJSONFromBytes(bytes) { + return JSON.parse(utf8DecodeBytes(bytes)); + } + function bodyMimeType(requestOrResponse) { + const headers = requestOrResponse[kState].headersList; + const mimeType = extractMimeType(headers); + if (mimeType === "failure") { + return null; + } + return mimeType; + } + module2.exports = { + extractBody, + safelyExtractBody, + cloneBody, + mixinBody + }; + } +}); + +// node_modules/undici/lib/dispatcher/client-h1.js +var require_client_h1 = __commonJS({ + "node_modules/undici/lib/dispatcher/client-h1.js"(exports2, module2) { + "use strict"; + var assert = require("node:assert"); + var util = require_util9(); + var { channels } = require_diagnostics(); + var timers = require_timers2(); + var { + RequestContentLengthMismatchError, + ResponseContentLengthMismatchError, + RequestAbortedError, + HeadersTimeoutError, + HeadersOverflowError, + SocketError, + InformationalError, + BodyTimeoutError, + HTTPParserError, + ResponseExceededMaxSizeError + } = require_errors2(); + var { + kUrl, + kReset, + kClient, + kParser, + kBlocking, + kRunning, + kPending, + kSize, + kWriting, + kQueue, + kNoRef, + kKeepAliveDefaultTimeout, + kHostHeader, + kPendingIdx, + kRunningIdx, + kError, + kPipelining, + kSocket, + kKeepAliveTimeoutValue, + kMaxHeadersSize, + kKeepAliveMaxTimeout, + kKeepAliveTimeoutThreshold, + kHeadersTimeout, + kBodyTimeout, + kStrictContentLength, + kMaxRequests, + kCounter, + kMaxResponseSize, + kOnError, + kResume, + kHTTPContext + } = require_symbols6(); + var constants = require_constants7(); + var EMPTY_BUF = Buffer.alloc(0); + var FastBuffer = Buffer[Symbol.species]; + var addListener = util.addListener; + var removeAllListeners = util.removeAllListeners; + var extractBody; + async function lazyllhttp() { + const llhttpWasmData = process.env.JEST_WORKER_ID ? require_llhttp_wasm2() : void 0; + let mod; + try { + mod = await WebAssembly.compile(require_llhttp_simd_wasm2()); + } catch (e) { + mod = await WebAssembly.compile(llhttpWasmData || require_llhttp_wasm2()); + } + return await WebAssembly.instantiate(mod, { + env: { + /* eslint-disable camelcase */ + wasm_on_url: (p, at, len) => { + return 0; + }, + wasm_on_status: (p, at, len) => { + assert.strictEqual(currentParser.ptr, p); + const start = at - currentBufferPtr + currentBufferRef.byteOffset; + return currentParser.onStatus(new FastBuffer(currentBufferRef.buffer, start, len)) || 0; + }, + wasm_on_message_begin: (p) => { + assert.strictEqual(currentParser.ptr, p); + return currentParser.onMessageBegin() || 0; + }, + wasm_on_header_field: (p, at, len) => { + assert.strictEqual(currentParser.ptr, p); + const start = at - currentBufferPtr + currentBufferRef.byteOffset; + return currentParser.onHeaderField(new FastBuffer(currentBufferRef.buffer, start, len)) || 0; + }, + wasm_on_header_value: (p, at, len) => { + assert.strictEqual(currentParser.ptr, p); + const start = at - currentBufferPtr + currentBufferRef.byteOffset; + return currentParser.onHeaderValue(new FastBuffer(currentBufferRef.buffer, start, len)) || 0; + }, + wasm_on_headers_complete: (p, statusCode, upgrade, shouldKeepAlive) => { + assert.strictEqual(currentParser.ptr, p); + return currentParser.onHeadersComplete(statusCode, Boolean(upgrade), Boolean(shouldKeepAlive)) || 0; + }, + wasm_on_body: (p, at, len) => { + assert.strictEqual(currentParser.ptr, p); + const start = at - currentBufferPtr + currentBufferRef.byteOffset; + return currentParser.onBody(new FastBuffer(currentBufferRef.buffer, start, len)) || 0; + }, + wasm_on_message_complete: (p) => { + assert.strictEqual(currentParser.ptr, p); + return currentParser.onMessageComplete() || 0; + } + /* eslint-enable camelcase */ + } + }); + } + var llhttpInstance = null; + var llhttpPromise = lazyllhttp(); + llhttpPromise.catch(); + var currentParser = null; + var currentBufferRef = null; + var currentBufferSize = 0; + var currentBufferPtr = null; + var TIMEOUT_HEADERS = 1; + var TIMEOUT_BODY = 2; + var TIMEOUT_IDLE = 3; + var Parser = class { + constructor(client, socket, { exports: exports3 }) { + assert(Number.isFinite(client[kMaxHeadersSize]) && client[kMaxHeadersSize] > 0); + this.llhttp = exports3; + this.ptr = this.llhttp.llhttp_alloc(constants.TYPE.RESPONSE); + this.client = client; + this.socket = socket; + this.timeout = null; + this.timeoutValue = null; + this.timeoutType = null; + this.statusCode = null; + this.statusText = ""; + this.upgrade = false; + this.headers = []; + this.headersSize = 0; + this.headersMaxSize = client[kMaxHeadersSize]; + this.shouldKeepAlive = false; + this.paused = false; + this.resume = this.resume.bind(this); + this.bytesRead = 0; + this.keepAlive = ""; + this.contentLength = ""; + this.connection = ""; + this.maxResponseSize = client[kMaxResponseSize]; + } + setTimeout(value, type) { + this.timeoutType = type; + if (value !== this.timeoutValue) { + timers.clearTimeout(this.timeout); + if (value) { + this.timeout = timers.setTimeout(onParserTimeout, value, this); + if (this.timeout.unref) { + this.timeout.unref(); + } + } else { + this.timeout = null; + } + this.timeoutValue = value; + } else if (this.timeout) { + if (this.timeout.refresh) { + this.timeout.refresh(); + } + } + } + resume() { + if (this.socket.destroyed || !this.paused) { + return; + } + assert(this.ptr != null); + assert(currentParser == null); + this.llhttp.llhttp_resume(this.ptr); + assert(this.timeoutType === TIMEOUT_BODY); + if (this.timeout) { + if (this.timeout.refresh) { + this.timeout.refresh(); + } + } + this.paused = false; + this.execute(this.socket.read() || EMPTY_BUF); + this.readMore(); + } + readMore() { + while (!this.paused && this.ptr) { + const chunk = this.socket.read(); + if (chunk === null) { + break; + } + this.execute(chunk); + } + } + execute(data) { + assert(this.ptr != null); + assert(currentParser == null); + assert(!this.paused); + const { socket, llhttp } = this; + if (data.length > currentBufferSize) { + if (currentBufferPtr) { + llhttp.free(currentBufferPtr); + } + currentBufferSize = Math.ceil(data.length / 4096) * 4096; + currentBufferPtr = llhttp.malloc(currentBufferSize); + } + new Uint8Array(llhttp.memory.buffer, currentBufferPtr, currentBufferSize).set(data); + try { + let ret; + try { + currentBufferRef = data; + currentParser = this; + ret = llhttp.llhttp_execute(this.ptr, currentBufferPtr, data.length); + } catch (err) { + throw err; + } finally { + currentParser = null; + currentBufferRef = null; + } + const offset = llhttp.llhttp_get_error_pos(this.ptr) - currentBufferPtr; + if (ret === constants.ERROR.PAUSED_UPGRADE) { + this.onUpgrade(data.slice(offset)); + } else if (ret === constants.ERROR.PAUSED) { + this.paused = true; + socket.unshift(data.slice(offset)); + } else if (ret !== constants.ERROR.OK) { + const ptr = llhttp.llhttp_get_error_reason(this.ptr); + let message = ""; + if (ptr) { + const len = new Uint8Array(llhttp.memory.buffer, ptr).indexOf(0); + message = "Response does not match the HTTP/1.1 protocol (" + Buffer.from(llhttp.memory.buffer, ptr, len).toString() + ")"; + } + throw new HTTPParserError(message, constants.ERROR[ret], data.slice(offset)); + } + } catch (err) { + util.destroy(socket, err); + } + } + destroy() { + assert(this.ptr != null); + assert(currentParser == null); + this.llhttp.llhttp_free(this.ptr); + this.ptr = null; + timers.clearTimeout(this.timeout); + this.timeout = null; + this.timeoutValue = null; + this.timeoutType = null; + this.paused = false; + } + onStatus(buf) { + this.statusText = buf.toString(); + } + onMessageBegin() { + const { socket, client } = this; + if (socket.destroyed) { + return -1; + } + const request2 = client[kQueue][client[kRunningIdx]]; + if (!request2) { + return -1; + } + request2.onResponseStarted(); + } + onHeaderField(buf) { + const len = this.headers.length; + if ((len & 1) === 0) { + this.headers.push(buf); + } else { + this.headers[len - 1] = Buffer.concat([this.headers[len - 1], buf]); + } + this.trackHeader(buf.length); + } + onHeaderValue(buf) { + let len = this.headers.length; + if ((len & 1) === 1) { + this.headers.push(buf); + len += 1; + } else { + this.headers[len - 1] = Buffer.concat([this.headers[len - 1], buf]); + } + const key = this.headers[len - 2]; + if (key.length === 10) { + const headerName = util.bufferToLowerCasedHeaderName(key); + if (headerName === "keep-alive") { + this.keepAlive += buf.toString(); + } else if (headerName === "connection") { + this.connection += buf.toString(); + } + } else if (key.length === 14 && util.bufferToLowerCasedHeaderName(key) === "content-length") { + this.contentLength += buf.toString(); + } + this.trackHeader(buf.length); + } + trackHeader(len) { + this.headersSize += len; + if (this.headersSize >= this.headersMaxSize) { + util.destroy(this.socket, new HeadersOverflowError()); + } + } + onUpgrade(head) { + const { upgrade, client, socket, headers, statusCode } = this; + assert(upgrade); + const request2 = client[kQueue][client[kRunningIdx]]; + assert(request2); + assert(!socket.destroyed); + assert(socket === client[kSocket]); + assert(!this.paused); + assert(request2.upgrade || request2.method === "CONNECT"); + this.statusCode = null; + this.statusText = ""; + this.shouldKeepAlive = null; + assert(this.headers.length % 2 === 0); + this.headers = []; + this.headersSize = 0; + socket.unshift(head); + socket[kParser].destroy(); + socket[kParser] = null; + socket[kClient] = null; + socket[kError] = null; + removeAllListeners(socket); + client[kSocket] = null; + client[kHTTPContext] = null; + client[kQueue][client[kRunningIdx]++] = null; + client.emit("disconnect", client[kUrl], [client], new InformationalError("upgrade")); + try { + request2.onUpgrade(statusCode, headers, socket); + } catch (err) { + util.destroy(socket, err); + } + client[kResume](); + } + onHeadersComplete(statusCode, upgrade, shouldKeepAlive) { + const { client, socket, headers, statusText } = this; + if (socket.destroyed) { + return -1; + } + const request2 = client[kQueue][client[kRunningIdx]]; + if (!request2) { + return -1; + } + assert(!this.upgrade); + assert(this.statusCode < 200); + if (statusCode === 100) { + util.destroy(socket, new SocketError("bad response", util.getSocketInfo(socket))); + return -1; + } + if (upgrade && !request2.upgrade) { + util.destroy(socket, new SocketError("bad upgrade", util.getSocketInfo(socket))); + return -1; + } + assert.strictEqual(this.timeoutType, TIMEOUT_HEADERS); + this.statusCode = statusCode; + this.shouldKeepAlive = shouldKeepAlive || // Override llhttp value which does not allow keepAlive for HEAD. + request2.method === "HEAD" && !socket[kReset] && this.connection.toLowerCase() === "keep-alive"; + if (this.statusCode >= 200) { + const bodyTimeout = request2.bodyTimeout != null ? request2.bodyTimeout : client[kBodyTimeout]; + this.setTimeout(bodyTimeout, TIMEOUT_BODY); + } else if (this.timeout) { + if (this.timeout.refresh) { + this.timeout.refresh(); + } + } + if (request2.method === "CONNECT") { + assert(client[kRunning] === 1); + this.upgrade = true; + return 2; + } + if (upgrade) { + assert(client[kRunning] === 1); + this.upgrade = true; + return 2; + } + assert(this.headers.length % 2 === 0); + this.headers = []; + this.headersSize = 0; + if (this.shouldKeepAlive && client[kPipelining]) { + const keepAliveTimeout = this.keepAlive ? util.parseKeepAliveTimeout(this.keepAlive) : null; + if (keepAliveTimeout != null) { + const timeout = Math.min( + keepAliveTimeout - client[kKeepAliveTimeoutThreshold], + client[kKeepAliveMaxTimeout] + ); + if (timeout <= 0) { + socket[kReset] = true; + } else { + client[kKeepAliveTimeoutValue] = timeout; + } + } else { + client[kKeepAliveTimeoutValue] = client[kKeepAliveDefaultTimeout]; + } + } else { + socket[kReset] = true; + } + const pause = request2.onHeaders(statusCode, headers, this.resume, statusText) === false; + if (request2.aborted) { + return -1; + } + if (request2.method === "HEAD") { + return 1; + } + if (statusCode < 200) { + return 1; + } + if (socket[kBlocking]) { + socket[kBlocking] = false; + client[kResume](); + } + return pause ? constants.ERROR.PAUSED : 0; + } + onBody(buf) { + const { client, socket, statusCode, maxResponseSize } = this; + if (socket.destroyed) { + return -1; + } + const request2 = client[kQueue][client[kRunningIdx]]; + assert(request2); + assert.strictEqual(this.timeoutType, TIMEOUT_BODY); + if (this.timeout) { + if (this.timeout.refresh) { + this.timeout.refresh(); + } + } + assert(statusCode >= 200); + if (maxResponseSize > -1 && this.bytesRead + buf.length > maxResponseSize) { + util.destroy(socket, new ResponseExceededMaxSizeError()); + return -1; + } + this.bytesRead += buf.length; + if (request2.onData(buf) === false) { + return constants.ERROR.PAUSED; + } + } + onMessageComplete() { + const { client, socket, statusCode, upgrade, headers, contentLength, bytesRead, shouldKeepAlive } = this; + if (socket.destroyed && (!statusCode || shouldKeepAlive)) { + return -1; + } + if (upgrade) { + return; + } + const request2 = client[kQueue][client[kRunningIdx]]; + assert(request2); + assert(statusCode >= 100); + this.statusCode = null; + this.statusText = ""; + this.bytesRead = 0; + this.contentLength = ""; + this.keepAlive = ""; + this.connection = ""; + assert(this.headers.length % 2 === 0); + this.headers = []; + this.headersSize = 0; + if (statusCode < 200) { + return; + } + if (request2.method !== "HEAD" && contentLength && bytesRead !== parseInt(contentLength, 10)) { + util.destroy(socket, new ResponseContentLengthMismatchError()); + return -1; + } + request2.onComplete(headers); + client[kQueue][client[kRunningIdx]++] = null; + if (socket[kWriting]) { + assert.strictEqual(client[kRunning], 0); + util.destroy(socket, new InformationalError("reset")); + return constants.ERROR.PAUSED; + } else if (!shouldKeepAlive) { + util.destroy(socket, new InformationalError("reset")); + return constants.ERROR.PAUSED; + } else if (socket[kReset] && client[kRunning] === 0) { + util.destroy(socket, new InformationalError("reset")); + return constants.ERROR.PAUSED; + } else if (client[kPipelining] == null || client[kPipelining] === 1) { + setImmediate(() => client[kResume]()); + } else { + client[kResume](); + } + } + }; + function onParserTimeout(parser) { + const { socket, timeoutType, client } = parser; + if (timeoutType === TIMEOUT_HEADERS) { + if (!socket[kWriting] || socket.writableNeedDrain || client[kRunning] > 1) { + assert(!parser.paused, "cannot be paused while waiting for headers"); + util.destroy(socket, new HeadersTimeoutError()); + } + } else if (timeoutType === TIMEOUT_BODY) { + if (!parser.paused) { + util.destroy(socket, new BodyTimeoutError()); + } + } else if (timeoutType === TIMEOUT_IDLE) { + assert(client[kRunning] === 0 && client[kKeepAliveTimeoutValue]); + util.destroy(socket, new InformationalError("socket idle timeout")); + } + } + async function connectH1(client, socket) { + client[kSocket] = socket; + if (!llhttpInstance) { + llhttpInstance = await llhttpPromise; + llhttpPromise = null; + } + socket[kNoRef] = false; + socket[kWriting] = false; + socket[kReset] = false; + socket[kBlocking] = false; + socket[kParser] = new Parser(client, socket, llhttpInstance); + addListener(socket, "error", function(err) { + const parser = this[kParser]; + assert(err.code !== "ERR_TLS_CERT_ALTNAME_INVALID"); + if (err.code === "ECONNRESET" && parser.statusCode && !parser.shouldKeepAlive) { + parser.onMessageComplete(); + return; + } + this[kError] = err; + this[kClient][kOnError](err); + }); + addListener(socket, "readable", function() { + const parser = this[kParser]; + if (parser) { + parser.readMore(); + } + }); + addListener(socket, "end", function() { + const parser = this[kParser]; + if (parser.statusCode && !parser.shouldKeepAlive) { + parser.onMessageComplete(); + return; + } + util.destroy(this, new SocketError("other side closed", util.getSocketInfo(this))); + }); + addListener(socket, "close", function() { + const client2 = this[kClient]; + const parser = this[kParser]; + if (parser) { + if (!this[kError] && parser.statusCode && !parser.shouldKeepAlive) { + parser.onMessageComplete(); + } + this[kParser].destroy(); + this[kParser] = null; + } + const err = this[kError] || new SocketError("closed", util.getSocketInfo(this)); + client2[kSocket] = null; + client2[kHTTPContext] = null; + if (client2.destroyed) { + assert(client2[kPending] === 0); + const requests = client2[kQueue].splice(client2[kRunningIdx]); + for (let i = 0; i < requests.length; i++) { + const request2 = requests[i]; + util.errorRequest(client2, request2, err); + } + } else if (client2[kRunning] > 0 && err.code !== "UND_ERR_INFO") { + const request2 = client2[kQueue][client2[kRunningIdx]]; + client2[kQueue][client2[kRunningIdx]++] = null; + util.errorRequest(client2, request2, err); + } + client2[kPendingIdx] = client2[kRunningIdx]; + assert(client2[kRunning] === 0); + client2.emit("disconnect", client2[kUrl], [client2], err); + client2[kResume](); + }); + let closed = false; + socket.on("close", () => { + closed = true; + }); + return { + version: "h1", + defaultPipelining: 1, + write(...args) { + return writeH1(client, ...args); + }, + resume() { + resumeH1(client); + }, + destroy(err, callback) { + if (closed) { + queueMicrotask(callback); + } else { + socket.destroy(err).on("close", callback); + } + }, + get destroyed() { + return socket.destroyed; + }, + busy(request2) { + if (socket[kWriting] || socket[kReset] || socket[kBlocking]) { + return true; + } + if (request2) { + if (client[kRunning] > 0 && !request2.idempotent) { + return true; + } + if (client[kRunning] > 0 && (request2.upgrade || request2.method === "CONNECT")) { + return true; + } + if (client[kRunning] > 0 && util.bodyLength(request2.body) !== 0 && (util.isStream(request2.body) || util.isAsyncIterable(request2.body) || util.isFormDataLike(request2.body))) { + return true; + } + } + return false; + } + }; + } + function resumeH1(client) { + const socket = client[kSocket]; + if (socket && !socket.destroyed) { + if (client[kSize] === 0) { + if (!socket[kNoRef] && socket.unref) { + socket.unref(); + socket[kNoRef] = true; + } + } else if (socket[kNoRef] && socket.ref) { + socket.ref(); + socket[kNoRef] = false; + } + if (client[kSize] === 0) { + if (socket[kParser].timeoutType !== TIMEOUT_IDLE) { + socket[kParser].setTimeout(client[kKeepAliveTimeoutValue], TIMEOUT_IDLE); + } + } else if (client[kRunning] > 0 && socket[kParser].statusCode < 200) { + if (socket[kParser].timeoutType !== TIMEOUT_HEADERS) { + const request2 = client[kQueue][client[kRunningIdx]]; + const headersTimeout = request2.headersTimeout != null ? request2.headersTimeout : client[kHeadersTimeout]; + socket[kParser].setTimeout(headersTimeout, TIMEOUT_HEADERS); + } + } + } + } + function shouldSendContentLength(method) { + return method !== "GET" && method !== "HEAD" && method !== "OPTIONS" && method !== "TRACE" && method !== "CONNECT"; + } + function writeH1(client, request2) { + const { method, path, host, upgrade, blocking, reset } = request2; + let { body, headers, contentLength } = request2; + const expectsPayload = method === "PUT" || method === "POST" || method === "PATCH"; + if (util.isFormDataLike(body)) { + if (!extractBody) { + extractBody = require_body2().extractBody; + } + const [bodyStream, contentType] = extractBody(body); + if (request2.contentType == null) { + headers.push("content-type", contentType); + } + body = bodyStream.stream; + contentLength = bodyStream.length; + } else if (util.isBlobLike(body) && request2.contentType == null && body.type) { + headers.push("content-type", body.type); + } + if (body && typeof body.read === "function") { + body.read(0); + } + const bodyLength = util.bodyLength(body); + contentLength = bodyLength ?? contentLength; + if (contentLength === null) { + contentLength = request2.contentLength; + } + if (contentLength === 0 && !expectsPayload) { + contentLength = null; + } + if (shouldSendContentLength(method) && contentLength > 0 && request2.contentLength !== null && request2.contentLength !== contentLength) { + if (client[kStrictContentLength]) { + util.errorRequest(client, request2, new RequestContentLengthMismatchError()); + return false; + } + process.emitWarning(new RequestContentLengthMismatchError()); + } + const socket = client[kSocket]; + const abort = (err) => { + if (request2.aborted || request2.completed) { + return; + } + util.errorRequest(client, request2, err || new RequestAbortedError()); + util.destroy(body); + util.destroy(socket, new InformationalError("aborted")); + }; + try { + request2.onConnect(abort); + } catch (err) { + util.errorRequest(client, request2, err); + } + if (request2.aborted) { + return false; + } + if (method === "HEAD") { + socket[kReset] = true; + } + if (upgrade || method === "CONNECT") { + socket[kReset] = true; + } + if (reset != null) { + socket[kReset] = reset; + } + if (client[kMaxRequests] && socket[kCounter]++ >= client[kMaxRequests]) { + socket[kReset] = true; + } + if (blocking) { + socket[kBlocking] = true; + } + let header = `${method} ${path} HTTP/1.1\r +`; + if (typeof host === "string") { + header += `host: ${host}\r +`; + } else { + header += client[kHostHeader]; + } + if (upgrade) { + header += `connection: upgrade\r +upgrade: ${upgrade}\r +`; + } else if (client[kPipelining] && !socket[kReset]) { + header += "connection: keep-alive\r\n"; + } else { + header += "connection: close\r\n"; + } + if (Array.isArray(headers)) { + for (let n = 0; n < headers.length; n += 2) { + const key = headers[n + 0]; + const val2 = headers[n + 1]; + if (Array.isArray(val2)) { + for (let i = 0; i < val2.length; i++) { + header += `${key}: ${val2[i]}\r +`; + } + } else { + header += `${key}: ${val2}\r +`; + } + } + } + if (channels.sendHeaders.hasSubscribers) { + channels.sendHeaders.publish({ request: request2, headers: header, socket }); + } + if (!body || bodyLength === 0) { + writeBuffer(abort, null, client, request2, socket, contentLength, header, expectsPayload); + } else if (util.isBuffer(body)) { + writeBuffer(abort, body, client, request2, socket, contentLength, header, expectsPayload); + } else if (util.isBlobLike(body)) { + if (typeof body.stream === "function") { + writeIterable(abort, body.stream(), client, request2, socket, contentLength, header, expectsPayload); + } else { + writeBlob(abort, body, client, request2, socket, contentLength, header, expectsPayload); + } + } else if (util.isStream(body)) { + writeStream(abort, body, client, request2, socket, contentLength, header, expectsPayload); + } else if (util.isIterable(body)) { + writeIterable(abort, body, client, request2, socket, contentLength, header, expectsPayload); + } else { + assert(false); + } + return true; + } + function writeStream(abort, body, client, request2, socket, contentLength, header, expectsPayload) { + assert(contentLength !== 0 || client[kRunning] === 0, "stream body cannot be pipelined"); + let finished = false; + const writer = new AsyncWriter({ abort, socket, request: request2, contentLength, client, expectsPayload, header }); + const onData = function(chunk) { + if (finished) { + return; + } + try { + if (!writer.write(chunk) && this.pause) { + this.pause(); + } + } catch (err) { + util.destroy(this, err); + } + }; + const onDrain = function() { + if (finished) { + return; + } + if (body.resume) { + body.resume(); + } + }; + const onClose = function() { + queueMicrotask(() => { + body.removeListener("error", onFinished); + }); + if (!finished) { + const err = new RequestAbortedError(); + queueMicrotask(() => onFinished(err)); + } + }; + const onFinished = function(err) { + if (finished) { + return; + } + finished = true; + assert(socket.destroyed || socket[kWriting] && client[kRunning] <= 1); + socket.off("drain", onDrain).off("error", onFinished); + body.removeListener("data", onData).removeListener("end", onFinished).removeListener("close", onClose); + if (!err) { + try { + writer.end(); + } catch (er) { + err = er; + } + } + writer.destroy(err); + if (err && (err.code !== "UND_ERR_INFO" || err.message !== "reset")) { + util.destroy(body, err); + } else { + util.destroy(body); + } + }; + body.on("data", onData).on("end", onFinished).on("error", onFinished).on("close", onClose); + if (body.resume) { + body.resume(); + } + socket.on("drain", onDrain).on("error", onFinished); + if (body.errorEmitted ?? body.errored) { + setImmediate(() => onFinished(body.errored)); + } else if (body.endEmitted ?? body.readableEnded) { + setImmediate(() => onFinished(null)); + } + if (body.closeEmitted ?? body.closed) { + setImmediate(onClose); + } + } + function writeBuffer(abort, body, client, request2, socket, contentLength, header, expectsPayload) { + try { + if (!body) { + if (contentLength === 0) { + socket.write(`${header}content-length: 0\r +\r +`, "latin1"); + } else { + assert(contentLength === null, "no body must not have content length"); + socket.write(`${header}\r +`, "latin1"); + } + } else if (util.isBuffer(body)) { + assert(contentLength === body.byteLength, "buffer body must have content length"); + socket.cork(); + socket.write(`${header}content-length: ${contentLength}\r +\r +`, "latin1"); + socket.write(body); + socket.uncork(); + request2.onBodySent(body); + if (!expectsPayload) { + socket[kReset] = true; + } + } + request2.onRequestSent(); + client[kResume](); + } catch (err) { + abort(err); + } + } + async function writeBlob(abort, body, client, request2, socket, contentLength, header, expectsPayload) { + assert(contentLength === body.size, "blob body must have content length"); + try { + if (contentLength != null && contentLength !== body.size) { + throw new RequestContentLengthMismatchError(); + } + const buffer = Buffer.from(await body.arrayBuffer()); + socket.cork(); + socket.write(`${header}content-length: ${contentLength}\r +\r +`, "latin1"); + socket.write(buffer); + socket.uncork(); + request2.onBodySent(buffer); + request2.onRequestSent(); + if (!expectsPayload) { + socket[kReset] = true; + } + client[kResume](); + } catch (err) { + abort(err); + } + } + async function writeIterable(abort, body, client, request2, socket, contentLength, header, expectsPayload) { + assert(contentLength !== 0 || client[kRunning] === 0, "iterator body cannot be pipelined"); + let callback = null; + function onDrain() { + if (callback) { + const cb = callback; + callback = null; + cb(); + } + } + const waitForDrain = () => new Promise((resolve, reject) => { + assert(callback === null); + if (socket[kError]) { + reject(socket[kError]); + } else { + callback = resolve; + } + }); + socket.on("close", onDrain).on("drain", onDrain); + const writer = new AsyncWriter({ abort, socket, request: request2, contentLength, client, expectsPayload, header }); + try { + for await (const chunk of body) { + if (socket[kError]) { + throw socket[kError]; + } + if (!writer.write(chunk)) { + await waitForDrain(); + } + } + writer.end(); + } catch (err) { + writer.destroy(err); + } finally { + socket.off("close", onDrain).off("drain", onDrain); + } + } + var AsyncWriter = class { + constructor({ abort, socket, request: request2, contentLength, client, expectsPayload, header }) { + this.socket = socket; + this.request = request2; + this.contentLength = contentLength; + this.client = client; + this.bytesWritten = 0; + this.expectsPayload = expectsPayload; + this.header = header; + this.abort = abort; + socket[kWriting] = true; + } + write(chunk) { + const { socket, request: request2, contentLength, client, bytesWritten, expectsPayload, header } = this; + if (socket[kError]) { + throw socket[kError]; + } + if (socket.destroyed) { + return false; + } + const len = Buffer.byteLength(chunk); + if (!len) { + return true; + } + if (contentLength !== null && bytesWritten + len > contentLength) { + if (client[kStrictContentLength]) { + throw new RequestContentLengthMismatchError(); + } + process.emitWarning(new RequestContentLengthMismatchError()); + } + socket.cork(); + if (bytesWritten === 0) { + if (!expectsPayload) { + socket[kReset] = true; + } + if (contentLength === null) { + socket.write(`${header}transfer-encoding: chunked\r +`, "latin1"); + } else { + socket.write(`${header}content-length: ${contentLength}\r +\r +`, "latin1"); + } + } + if (contentLength === null) { + socket.write(`\r +${len.toString(16)}\r +`, "latin1"); + } + this.bytesWritten += len; + const ret = socket.write(chunk); + socket.uncork(); + request2.onBodySent(chunk); + if (!ret) { + if (socket[kParser].timeout && socket[kParser].timeoutType === TIMEOUT_HEADERS) { + if (socket[kParser].timeout.refresh) { + socket[kParser].timeout.refresh(); + } + } + } + return ret; + } + end() { + const { socket, contentLength, client, bytesWritten, expectsPayload, header, request: request2 } = this; + request2.onRequestSent(); + socket[kWriting] = false; + if (socket[kError]) { + throw socket[kError]; + } + if (socket.destroyed) { + return; + } + if (bytesWritten === 0) { + if (expectsPayload) { + socket.write(`${header}content-length: 0\r +\r +`, "latin1"); + } else { + socket.write(`${header}\r +`, "latin1"); + } + } else if (contentLength === null) { + socket.write("\r\n0\r\n\r\n", "latin1"); + } + if (contentLength !== null && bytesWritten !== contentLength) { + if (client[kStrictContentLength]) { + throw new RequestContentLengthMismatchError(); + } else { + process.emitWarning(new RequestContentLengthMismatchError()); + } + } + if (socket[kParser].timeout && socket[kParser].timeoutType === TIMEOUT_HEADERS) { + if (socket[kParser].timeout.refresh) { + socket[kParser].timeout.refresh(); + } + } + client[kResume](); + } + destroy(err) { + const { socket, client, abort } = this; + socket[kWriting] = false; + if (err) { + assert(client[kRunning] <= 1, "pipeline should only contain this request"); + abort(err); + } + } + }; + module2.exports = connectH1; + } +}); + +// node_modules/undici/lib/dispatcher/client-h2.js +var require_client_h2 = __commonJS({ + "node_modules/undici/lib/dispatcher/client-h2.js"(exports2, module2) { + "use strict"; + var assert = require("node:assert"); + var { pipeline } = require("node:stream"); + var util = require_util9(); + var { + RequestContentLengthMismatchError, + RequestAbortedError, + SocketError, + InformationalError + } = require_errors2(); + var { + kUrl, + kReset, + kClient, + kRunning, + kPending, + kQueue, + kPendingIdx, + kRunningIdx, + kError, + kSocket, + kStrictContentLength, + kOnError, + kMaxConcurrentStreams, + kHTTP2Session, + kResume + } = require_symbols6(); + var kOpenStreams = Symbol("open streams"); + var h2ExperimentalWarned = false; + var http2; + try { + http2 = require("node:http2"); + } catch { + http2 = { constants: {} }; + } + var { + constants: { + HTTP2_HEADER_AUTHORITY, + HTTP2_HEADER_METHOD, + HTTP2_HEADER_PATH, + HTTP2_HEADER_SCHEME, + HTTP2_HEADER_CONTENT_LENGTH, + HTTP2_HEADER_EXPECT, + HTTP2_HEADER_STATUS + } + } = http2; + function parseH2Headers(headers) { + const result = []; + for (const [name, value] of Object.entries(headers)) { + if (Array.isArray(value)) { + for (const subvalue of value) { + result.push(Buffer.from(name), Buffer.from(subvalue)); + } + } else { + result.push(Buffer.from(name), Buffer.from(value)); + } + } + return result; + } + async function connectH2(client, socket) { + client[kSocket] = socket; + if (!h2ExperimentalWarned) { + h2ExperimentalWarned = true; + process.emitWarning("H2 support is experimental, expect them to change at any time.", { + code: "UNDICI-H2" + }); + } + const session = http2.connect(client[kUrl], { + createConnection: () => socket, + peerMaxConcurrentStreams: client[kMaxConcurrentStreams] + }); + session[kOpenStreams] = 0; + session[kClient] = client; + session[kSocket] = socket; + util.addListener(session, "error", onHttp2SessionError); + util.addListener(session, "frameError", onHttp2FrameError); + util.addListener(session, "end", onHttp2SessionEnd); + util.addListener(session, "goaway", onHTTP2GoAway); + util.addListener(session, "close", function() { + const { [kClient]: client2 } = this; + const { [kSocket]: socket2 } = client2; + const err = this[kSocket][kError] || this[kError] || new SocketError("closed", util.getSocketInfo(socket2)); + client2[kHTTP2Session] = null; + if (client2.destroyed) { + assert(client2[kPending] === 0); + const requests = client2[kQueue].splice(client2[kRunningIdx]); + for (let i = 0; i < requests.length; i++) { + const request2 = requests[i]; + util.errorRequest(client2, request2, err); + } + } + }); + session.unref(); + client[kHTTP2Session] = session; + socket[kHTTP2Session] = session; + util.addListener(socket, "error", function(err) { + assert(err.code !== "ERR_TLS_CERT_ALTNAME_INVALID"); + this[kError] = err; + this[kClient][kOnError](err); + }); + util.addListener(socket, "end", function() { + util.destroy(this, new SocketError("other side closed", util.getSocketInfo(this))); + }); + util.addListener(socket, "close", function() { + const err = this[kError] || new SocketError("closed", util.getSocketInfo(this)); + client[kSocket] = null; + if (this[kHTTP2Session] != null) { + this[kHTTP2Session].destroy(err); + } + client[kPendingIdx] = client[kRunningIdx]; + assert(client[kRunning] === 0); + client.emit("disconnect", client[kUrl], [client], err); + client[kResume](); + }); + let closed = false; + socket.on("close", () => { + closed = true; + }); + return { + version: "h2", + defaultPipelining: Infinity, + write(...args) { + writeH2(client, ...args); + }, + resume() { + }, + destroy(err, callback) { + if (closed) { + queueMicrotask(callback); + } else { + socket.destroy(err).on("close", callback); + } + }, + get destroyed() { + return socket.destroyed; + }, + busy() { + return false; + } + }; + } + function onHttp2SessionError(err) { + assert(err.code !== "ERR_TLS_CERT_ALTNAME_INVALID"); + this[kSocket][kError] = err; + this[kClient][kOnError](err); + } + function onHttp2FrameError(type, code, id) { + if (id === 0) { + const err = new InformationalError(`HTTP/2: "frameError" received - type ${type}, code ${code}`); + this[kSocket][kError] = err; + this[kClient][kOnError](err); + } + } + function onHttp2SessionEnd() { + const err = new SocketError("other side closed", util.getSocketInfo(this[kSocket])); + this.destroy(err); + util.destroy(this[kSocket], err); + } + function onHTTP2GoAway(code) { + const err = new RequestAbortedError(`HTTP/2: "GOAWAY" frame received with code ${code}`); + this[kSocket][kError] = err; + this[kClient][kOnError](err); + this.unref(); + util.destroy(this[kSocket], err); + } + function shouldSendContentLength(method) { + return method !== "GET" && method !== "HEAD" && method !== "OPTIONS" && method !== "TRACE" && method !== "CONNECT"; + } + function writeH2(client, request2) { + const session = client[kHTTP2Session]; + const { body, method, path, host, upgrade, expectContinue, signal, headers: reqHeaders } = request2; + if (upgrade) { + util.errorRequest(client, request2, new Error("Upgrade not supported for H2")); + return false; + } + if (request2.aborted) { + return false; + } + const headers = {}; + for (let n = 0; n < reqHeaders.length; n += 2) { + const key = reqHeaders[n + 0]; + const val2 = reqHeaders[n + 1]; + if (Array.isArray(val2)) { + for (let i = 0; i < val2.length; i++) { + if (headers[key]) { + headers[key] += `,${val2[i]}`; + } else { + headers[key] = val2[i]; + } + } + } else { + headers[key] = val2; + } + } + let stream; + const { hostname, port } = client[kUrl]; + headers[HTTP2_HEADER_AUTHORITY] = host || `${hostname}${port ? `:${port}` : ""}`; + headers[HTTP2_HEADER_METHOD] = method; + const abort = (err) => { + if (request2.aborted || request2.completed) { + return; + } + err = err || new RequestAbortedError(); + util.errorRequest(client, request2, err); + if (stream != null) { + util.destroy(stream, err); + } + util.destroy(body, err); + }; + try { + request2.onConnect(abort); + } catch (err) { + util.errorRequest(client, request2, err); + } + if (method === "CONNECT") { + session.ref(); + stream = session.request(headers, { endStream: false, signal }); + if (stream.id && !stream.pending) { + request2.onUpgrade(null, null, stream); + ++session[kOpenStreams]; + } else { + stream.once("ready", () => { + request2.onUpgrade(null, null, stream); + ++session[kOpenStreams]; + }); + } + stream.once("close", () => { + session[kOpenStreams] -= 1; + if (session[kOpenStreams] === 0) session.unref(); + }); + return true; + } + headers[HTTP2_HEADER_PATH] = path; + headers[HTTP2_HEADER_SCHEME] = "https"; + const expectsPayload = method === "PUT" || method === "POST" || method === "PATCH"; + if (body && typeof body.read === "function") { + body.read(0); + } + let contentLength = util.bodyLength(body); + if (contentLength == null) { + contentLength = request2.contentLength; + } + if (contentLength === 0 || !expectsPayload) { + contentLength = null; + } + if (shouldSendContentLength(method) && contentLength > 0 && request2.contentLength != null && request2.contentLength !== contentLength) { + if (client[kStrictContentLength]) { + util.errorRequest(client, request2, new RequestContentLengthMismatchError()); + return false; + } + process.emitWarning(new RequestContentLengthMismatchError()); + } + if (contentLength != null) { + assert(body, "no body must not have content length"); + headers[HTTP2_HEADER_CONTENT_LENGTH] = `${contentLength}`; + } + session.ref(); + const shouldEndStream = method === "GET" || method === "HEAD" || body === null; + if (expectContinue) { + headers[HTTP2_HEADER_EXPECT] = "100-continue"; + stream = session.request(headers, { endStream: shouldEndStream, signal }); + stream.once("continue", writeBodyH2); + } else { + stream = session.request(headers, { + endStream: shouldEndStream, + signal + }); + writeBodyH2(); + } + ++session[kOpenStreams]; + stream.once("response", (headers2) => { + const { [HTTP2_HEADER_STATUS]: statusCode, ...realHeaders } = headers2; + request2.onResponseStarted(); + if (request2.aborted) { + const err = new RequestAbortedError(); + util.errorRequest(client, request2, err); + util.destroy(stream, err); + return; + } + if (request2.onHeaders(Number(statusCode), parseH2Headers(realHeaders), stream.resume.bind(stream), "") === false) { + stream.pause(); + } + stream.on("data", (chunk) => { + if (request2.onData(chunk) === false) { + stream.pause(); + } + }); + }); + stream.once("end", () => { + if (stream.state?.state == null || stream.state.state < 6) { + request2.onComplete([]); + return; + } + if (session[kOpenStreams] === 0) { + session.unref(); + } + abort(new InformationalError("HTTP/2: stream half-closed (remote)")); + }); + stream.once("close", () => { + session[kOpenStreams] -= 1; + if (session[kOpenStreams] === 0) { + session.unref(); + } + }); + stream.once("error", function(err) { + abort(err); + }); + stream.once("frameError", (type, code) => { + abort(new InformationalError(`HTTP/2: "frameError" received - type ${type}, code ${code}`)); + }); + return true; + function writeBodyH2() { + if (!body || contentLength === 0) { + writeBuffer( + abort, + stream, + null, + client, + request2, + client[kSocket], + contentLength, + expectsPayload + ); + } else if (util.isBuffer(body)) { + writeBuffer( + abort, + stream, + body, + client, + request2, + client[kSocket], + contentLength, + expectsPayload + ); + } else if (util.isBlobLike(body)) { + if (typeof body.stream === "function") { + writeIterable( + abort, + stream, + body.stream(), + client, + request2, + client[kSocket], + contentLength, + expectsPayload + ); + } else { + writeBlob( + abort, + stream, + body, + client, + request2, + client[kSocket], + contentLength, + expectsPayload + ); + } + } else if (util.isStream(body)) { + writeStream( + abort, + client[kSocket], + expectsPayload, + stream, + body, + client, + request2, + contentLength + ); + } else if (util.isIterable(body)) { + writeIterable( + abort, + stream, + body, + client, + request2, + client[kSocket], + contentLength, + expectsPayload + ); + } else { + assert(false); + } + } + } + function writeBuffer(abort, h2stream, body, client, request2, socket, contentLength, expectsPayload) { + try { + if (body != null && util.isBuffer(body)) { + assert(contentLength === body.byteLength, "buffer body must have content length"); + h2stream.cork(); + h2stream.write(body); + h2stream.uncork(); + h2stream.end(); + request2.onBodySent(body); + } + if (!expectsPayload) { + socket[kReset] = true; + } + request2.onRequestSent(); + client[kResume](); + } catch (error) { + abort(error); + } + } + function writeStream(abort, socket, expectsPayload, h2stream, body, client, request2, contentLength) { + assert(contentLength !== 0 || client[kRunning] === 0, "stream body cannot be pipelined"); + const pipe = pipeline( + body, + h2stream, + (err) => { + if (err) { + util.destroy(pipe, err); + abort(err); + } else { + util.removeAllListeners(pipe); + request2.onRequestSent(); + if (!expectsPayload) { + socket[kReset] = true; + } + client[kResume](); + } + } + ); + util.addListener(pipe, "data", onPipeData); + function onPipeData(chunk) { + request2.onBodySent(chunk); + } + } + async function writeBlob(abort, h2stream, body, client, request2, socket, contentLength, expectsPayload) { + assert(contentLength === body.size, "blob body must have content length"); + try { + if (contentLength != null && contentLength !== body.size) { + throw new RequestContentLengthMismatchError(); + } + const buffer = Buffer.from(await body.arrayBuffer()); + h2stream.cork(); + h2stream.write(buffer); + h2stream.uncork(); + h2stream.end(); + request2.onBodySent(buffer); + request2.onRequestSent(); + if (!expectsPayload) { + socket[kReset] = true; + } + client[kResume](); + } catch (err) { + abort(err); + } + } + async function writeIterable(abort, h2stream, body, client, request2, socket, contentLength, expectsPayload) { + assert(contentLength !== 0 || client[kRunning] === 0, "iterator body cannot be pipelined"); + let callback = null; + function onDrain() { + if (callback) { + const cb = callback; + callback = null; + cb(); + } + } + const waitForDrain = () => new Promise((resolve, reject) => { + assert(callback === null); + if (socket[kError]) { + reject(socket[kError]); + } else { + callback = resolve; + } + }); + h2stream.on("close", onDrain).on("drain", onDrain); + try { + for await (const chunk of body) { + if (socket[kError]) { + throw socket[kError]; + } + const res = h2stream.write(chunk); + request2.onBodySent(chunk); + if (!res) { + await waitForDrain(); + } + } + h2stream.end(); + request2.onRequestSent(); + if (!expectsPayload) { + socket[kReset] = true; + } + client[kResume](); + } catch (err) { + abort(err); + } finally { + h2stream.off("close", onDrain).off("drain", onDrain); + } + } + module2.exports = connectH2; + } +}); + +// node_modules/undici/lib/handler/redirect-handler.js +var require_redirect_handler = __commonJS({ + "node_modules/undici/lib/handler/redirect-handler.js"(exports2, module2) { + "use strict"; + var util = require_util9(); + var { kBodyUsed } = require_symbols6(); + var assert = require("node:assert"); + var { InvalidArgumentError } = require_errors2(); + var EE = require("node:events"); + var redirectableStatusCodes = [300, 301, 302, 303, 307, 308]; + var kBody = Symbol("body"); + var BodyAsyncIterable = class { + constructor(body) { + this[kBody] = body; + this[kBodyUsed] = false; + } + async *[Symbol.asyncIterator]() { + assert(!this[kBodyUsed], "disturbed"); + this[kBodyUsed] = true; + yield* this[kBody]; + } + }; + var RedirectHandler = class { + constructor(dispatch, maxRedirections, opts, handler) { + if (maxRedirections != null && (!Number.isInteger(maxRedirections) || maxRedirections < 0)) { + throw new InvalidArgumentError("maxRedirections must be a positive number"); + } + util.validateHandler(handler, opts.method, opts.upgrade); + this.dispatch = dispatch; + this.location = null; + this.abort = null; + this.opts = { ...opts, maxRedirections: 0 }; + this.maxRedirections = maxRedirections; + this.handler = handler; + this.history = []; + this.redirectionLimitReached = false; + if (util.isStream(this.opts.body)) { + if (util.bodyLength(this.opts.body) === 0) { + this.opts.body.on("data", function() { + assert(false); + }); + } + if (typeof this.opts.body.readableDidRead !== "boolean") { + this.opts.body[kBodyUsed] = false; + EE.prototype.on.call(this.opts.body, "data", function() { + this[kBodyUsed] = true; + }); + } + } else if (this.opts.body && typeof this.opts.body.pipeTo === "function") { + this.opts.body = new BodyAsyncIterable(this.opts.body); + } else if (this.opts.body && typeof this.opts.body !== "string" && !ArrayBuffer.isView(this.opts.body) && util.isIterable(this.opts.body)) { + this.opts.body = new BodyAsyncIterable(this.opts.body); + } + } + onConnect(abort) { + this.abort = abort; + this.handler.onConnect(abort, { history: this.history }); + } + onUpgrade(statusCode, headers, socket) { + this.handler.onUpgrade(statusCode, headers, socket); + } + onError(error) { + this.handler.onError(error); + } + onHeaders(statusCode, headers, resume, statusText) { + this.location = this.history.length >= this.maxRedirections || util.isDisturbed(this.opts.body) ? null : parseLocation(statusCode, headers); + if (this.opts.throwOnMaxRedirect && this.history.length >= this.maxRedirections) { + if (this.request) { + this.request.abort(new Error("max redirects")); + } + this.redirectionLimitReached = true; + this.abort(new Error("max redirects")); + return; + } + if (this.opts.origin) { + this.history.push(new URL(this.opts.path, this.opts.origin)); + } + if (!this.location) { + return this.handler.onHeaders(statusCode, headers, resume, statusText); + } + const { origin, pathname, search } = util.parseURL(new URL(this.location, this.opts.origin && new URL(this.opts.path, this.opts.origin))); + const path = search ? `${pathname}${search}` : pathname; + this.opts.headers = cleanRequestHeaders(this.opts.headers, statusCode === 303, this.opts.origin !== origin); + this.opts.path = path; + this.opts.origin = origin; + this.opts.maxRedirections = 0; + this.opts.query = null; + if (statusCode === 303 && this.opts.method !== "HEAD") { + this.opts.method = "GET"; + this.opts.body = null; + } + } + onData(chunk) { + if (this.location) { + } else { + return this.handler.onData(chunk); + } + } + onComplete(trailers) { + if (this.location) { + this.location = null; + this.abort = null; + this.dispatch(this.opts, this); + } else { + this.handler.onComplete(trailers); + } + } + onBodySent(chunk) { + if (this.handler.onBodySent) { + this.handler.onBodySent(chunk); + } + } + }; + function parseLocation(statusCode, headers) { + if (redirectableStatusCodes.indexOf(statusCode) === -1) { + return null; + } + for (let i = 0; i < headers.length; i += 2) { + if (headers[i].length === 8 && util.headerNameToString(headers[i]) === "location") { + return headers[i + 1]; + } + } + } + function shouldRemoveHeader(header, removeContent, unknownOrigin) { + if (header.length === 4) { + return util.headerNameToString(header) === "host"; + } + if (removeContent && util.headerNameToString(header).startsWith("content-")) { + return true; + } + if (unknownOrigin && (header.length === 13 || header.length === 6 || header.length === 19)) { + const name = util.headerNameToString(header); + return name === "authorization" || name === "cookie" || name === "proxy-authorization"; + } + return false; + } + function cleanRequestHeaders(headers, removeContent, unknownOrigin) { + const ret = []; + if (Array.isArray(headers)) { + for (let i = 0; i < headers.length; i += 2) { + if (!shouldRemoveHeader(headers[i], removeContent, unknownOrigin)) { + ret.push(headers[i], headers[i + 1]); + } + } + } else if (headers && typeof headers === "object") { + for (const key of Object.keys(headers)) { + if (!shouldRemoveHeader(key, removeContent, unknownOrigin)) { + ret.push(key, headers[key]); + } + } + } else { + assert(headers == null, "headers must be an object or an array"); + } + return ret; + } + module2.exports = RedirectHandler; + } +}); + +// node_modules/undici/lib/interceptor/redirect-interceptor.js +var require_redirect_interceptor = __commonJS({ + "node_modules/undici/lib/interceptor/redirect-interceptor.js"(exports2, module2) { + "use strict"; + var RedirectHandler = require_redirect_handler(); + function createRedirectInterceptor({ maxRedirections: defaultMaxRedirections }) { + return (dispatch) => { + return function Intercept(opts, handler) { + const { maxRedirections = defaultMaxRedirections } = opts; + if (!maxRedirections) { + return dispatch(opts, handler); + } + const redirectHandler = new RedirectHandler(dispatch, maxRedirections, opts, handler); + opts = { ...opts, maxRedirections: 0 }; + return dispatch(opts, redirectHandler); + }; + }; + } + module2.exports = createRedirectInterceptor; + } +}); + +// node_modules/undici/lib/dispatcher/client.js +var require_client2 = __commonJS({ + "node_modules/undici/lib/dispatcher/client.js"(exports2, module2) { + "use strict"; + var assert = require("node:assert"); + var net = require("node:net"); + var http = require("node:http"); + var util = require_util9(); + var { channels } = require_diagnostics(); + var Request2 = require_request3(); + var DispatcherBase = require_dispatcher_base2(); + var { + InvalidArgumentError, + InformationalError, + ClientDestroyedError + } = require_errors2(); + var buildConnector = require_connect2(); + var { + kUrl, + kServerName, + kClient, + kBusy, + kConnect, + kResuming, + kRunning, + kPending, + kSize, + kQueue, + kConnected, + kConnecting, + kNeedDrain, + kKeepAliveDefaultTimeout, + kHostHeader, + kPendingIdx, + kRunningIdx, + kError, + kPipelining, + kKeepAliveTimeoutValue, + kMaxHeadersSize, + kKeepAliveMaxTimeout, + kKeepAliveTimeoutThreshold, + kHeadersTimeout, + kBodyTimeout, + kStrictContentLength, + kConnector, + kMaxRedirections, + kMaxRequests, + kCounter, + kClose, + kDestroy, + kDispatch, + kInterceptors, + kLocalAddress, + kMaxResponseSize, + kOnError, + kHTTPContext, + kMaxConcurrentStreams, + kResume + } = require_symbols6(); + var connectH1 = require_client_h1(); + var connectH2 = require_client_h2(); + var deprecatedInterceptorWarned = false; + var kClosedResolve = Symbol("kClosedResolve"); + function getPipelining(client) { + return client[kPipelining] ?? client[kHTTPContext]?.defaultPipelining ?? 1; + } + var Client = class extends DispatcherBase { + /** + * + * @param {string|URL} url + * @param {import('../../types/client.js').Client.Options} options + */ + constructor(url, { + interceptors, + maxHeaderSize, + headersTimeout, + socketTimeout, + requestTimeout, + connectTimeout, + bodyTimeout, + idleTimeout, + keepAlive, + keepAliveTimeout, + maxKeepAliveTimeout, + keepAliveMaxTimeout, + keepAliveTimeoutThreshold, + socketPath, + pipelining, + tls, + strictContentLength, + maxCachedSessions, + maxRedirections, + connect: connect2, + maxRequestsPerClient, + localAddress, + maxResponseSize, + autoSelectFamily, + autoSelectFamilyAttemptTimeout, + // h2 + maxConcurrentStreams, + allowH2 + } = {}) { + super(); + if (keepAlive !== void 0) { + throw new InvalidArgumentError("unsupported keepAlive, use pipelining=0 instead"); + } + if (socketTimeout !== void 0) { + throw new InvalidArgumentError("unsupported socketTimeout, use headersTimeout & bodyTimeout instead"); + } + if (requestTimeout !== void 0) { + throw new InvalidArgumentError("unsupported requestTimeout, use headersTimeout & bodyTimeout instead"); + } + if (idleTimeout !== void 0) { + throw new InvalidArgumentError("unsupported idleTimeout, use keepAliveTimeout instead"); + } + if (maxKeepAliveTimeout !== void 0) { + throw new InvalidArgumentError("unsupported maxKeepAliveTimeout, use keepAliveMaxTimeout instead"); + } + if (maxHeaderSize != null && !Number.isFinite(maxHeaderSize)) { + throw new InvalidArgumentError("invalid maxHeaderSize"); + } + if (socketPath != null && typeof socketPath !== "string") { + throw new InvalidArgumentError("invalid socketPath"); + } + if (connectTimeout != null && (!Number.isFinite(connectTimeout) || connectTimeout < 0)) { + throw new InvalidArgumentError("invalid connectTimeout"); + } + if (keepAliveTimeout != null && (!Number.isFinite(keepAliveTimeout) || keepAliveTimeout <= 0)) { + throw new InvalidArgumentError("invalid keepAliveTimeout"); + } + if (keepAliveMaxTimeout != null && (!Number.isFinite(keepAliveMaxTimeout) || keepAliveMaxTimeout <= 0)) { + throw new InvalidArgumentError("invalid keepAliveMaxTimeout"); + } + if (keepAliveTimeoutThreshold != null && !Number.isFinite(keepAliveTimeoutThreshold)) { + throw new InvalidArgumentError("invalid keepAliveTimeoutThreshold"); + } + if (headersTimeout != null && (!Number.isInteger(headersTimeout) || headersTimeout < 0)) { + throw new InvalidArgumentError("headersTimeout must be a positive integer or zero"); + } + if (bodyTimeout != null && (!Number.isInteger(bodyTimeout) || bodyTimeout < 0)) { + throw new InvalidArgumentError("bodyTimeout must be a positive integer or zero"); + } + if (connect2 != null && typeof connect2 !== "function" && typeof connect2 !== "object") { + throw new InvalidArgumentError("connect must be a function or an object"); + } + if (maxRedirections != null && (!Number.isInteger(maxRedirections) || maxRedirections < 0)) { + throw new InvalidArgumentError("maxRedirections must be a positive number"); + } + if (maxRequestsPerClient != null && (!Number.isInteger(maxRequestsPerClient) || maxRequestsPerClient < 0)) { + throw new InvalidArgumentError("maxRequestsPerClient must be a positive number"); + } + if (localAddress != null && (typeof localAddress !== "string" || net.isIP(localAddress) === 0)) { + throw new InvalidArgumentError("localAddress must be valid string IP address"); + } + if (maxResponseSize != null && (!Number.isInteger(maxResponseSize) || maxResponseSize < -1)) { + throw new InvalidArgumentError("maxResponseSize must be a positive number"); + } + if (autoSelectFamilyAttemptTimeout != null && (!Number.isInteger(autoSelectFamilyAttemptTimeout) || autoSelectFamilyAttemptTimeout < -1)) { + throw new InvalidArgumentError("autoSelectFamilyAttemptTimeout must be a positive number"); + } + if (allowH2 != null && typeof allowH2 !== "boolean") { + throw new InvalidArgumentError("allowH2 must be a valid boolean value"); + } + if (maxConcurrentStreams != null && (typeof maxConcurrentStreams !== "number" || maxConcurrentStreams < 1)) { + throw new InvalidArgumentError("maxConcurrentStreams must be a positive integer, greater than 0"); + } + if (typeof connect2 !== "function") { + connect2 = buildConnector({ + ...tls, + maxCachedSessions, + allowH2, + socketPath, + timeout: connectTimeout, + ...autoSelectFamily ? { autoSelectFamily, autoSelectFamilyAttemptTimeout } : void 0, + ...connect2 + }); + } + if (interceptors?.Client && Array.isArray(interceptors.Client)) { + this[kInterceptors] = interceptors.Client; + if (!deprecatedInterceptorWarned) { + deprecatedInterceptorWarned = true; + process.emitWarning("Client.Options#interceptor is deprecated. Use Dispatcher#compose instead.", { + code: "UNDICI-CLIENT-INTERCEPTOR-DEPRECATED" + }); + } + } else { + this[kInterceptors] = [createRedirectInterceptor({ maxRedirections })]; + } + this[kUrl] = util.parseOrigin(url); + this[kConnector] = connect2; + this[kPipelining] = pipelining != null ? pipelining : 1; + this[kMaxHeadersSize] = maxHeaderSize || http.maxHeaderSize; + this[kKeepAliveDefaultTimeout] = keepAliveTimeout == null ? 4e3 : keepAliveTimeout; + this[kKeepAliveMaxTimeout] = keepAliveMaxTimeout == null ? 6e5 : keepAliveMaxTimeout; + this[kKeepAliveTimeoutThreshold] = keepAliveTimeoutThreshold == null ? 2e3 : keepAliveTimeoutThreshold; + this[kKeepAliveTimeoutValue] = this[kKeepAliveDefaultTimeout]; + this[kServerName] = null; + this[kLocalAddress] = localAddress != null ? localAddress : null; + this[kResuming] = 0; + this[kNeedDrain] = 0; + this[kHostHeader] = `host: ${this[kUrl].hostname}${this[kUrl].port ? `:${this[kUrl].port}` : ""}\r +`; + this[kBodyTimeout] = bodyTimeout != null ? bodyTimeout : 3e5; + this[kHeadersTimeout] = headersTimeout != null ? headersTimeout : 3e5; + this[kStrictContentLength] = strictContentLength == null ? true : strictContentLength; + this[kMaxRedirections] = maxRedirections; + this[kMaxRequests] = maxRequestsPerClient; + this[kClosedResolve] = null; + this[kMaxResponseSize] = maxResponseSize > -1 ? maxResponseSize : -1; + this[kMaxConcurrentStreams] = maxConcurrentStreams != null ? maxConcurrentStreams : 100; + this[kHTTPContext] = null; + this[kQueue] = []; + this[kRunningIdx] = 0; + this[kPendingIdx] = 0; + this[kResume] = (sync) => resume(this, sync); + this[kOnError] = (err) => onError(this, err); + } + get pipelining() { + return this[kPipelining]; + } + set pipelining(value) { + this[kPipelining] = value; + this[kResume](true); + } + get [kPending]() { + return this[kQueue].length - this[kPendingIdx]; + } + get [kRunning]() { + return this[kPendingIdx] - this[kRunningIdx]; + } + get [kSize]() { + return this[kQueue].length - this[kRunningIdx]; + } + get [kConnected]() { + return !!this[kHTTPContext] && !this[kConnecting] && !this[kHTTPContext].destroyed; + } + get [kBusy]() { + return Boolean( + this[kHTTPContext]?.busy(null) || this[kSize] >= (getPipelining(this) || 1) || this[kPending] > 0 + ); + } + /* istanbul ignore: only used for test */ + [kConnect](cb) { + connect(this); + this.once("connect", cb); + } + [kDispatch](opts, handler) { + const origin = opts.origin || this[kUrl].origin; + const request2 = new Request2(origin, opts, handler); + this[kQueue].push(request2); + if (this[kResuming]) { + } else if (util.bodyLength(request2.body) == null && util.isIterable(request2.body)) { + this[kResuming] = 1; + queueMicrotask(() => resume(this)); + } else { + this[kResume](true); + } + if (this[kResuming] && this[kNeedDrain] !== 2 && this[kBusy]) { + this[kNeedDrain] = 2; + } + return this[kNeedDrain] < 2; + } + async [kClose]() { + return new Promise((resolve) => { + if (this[kSize]) { + this[kClosedResolve] = resolve; + } else { + resolve(null); + } + }); + } + async [kDestroy](err) { + return new Promise((resolve) => { + const requests = this[kQueue].splice(this[kPendingIdx]); + for (let i = 0; i < requests.length; i++) { + const request2 = requests[i]; + util.errorRequest(this, request2, err); + } + const callback = () => { + if (this[kClosedResolve]) { + this[kClosedResolve](); + this[kClosedResolve] = null; + } + resolve(null); + }; + if (this[kHTTPContext]) { + this[kHTTPContext].destroy(err, callback); + this[kHTTPContext] = null; + } else { + queueMicrotask(callback); + } + this[kResume](); + }); + } + }; + var createRedirectInterceptor = require_redirect_interceptor(); + function onError(client, err) { + if (client[kRunning] === 0 && err.code !== "UND_ERR_INFO" && err.code !== "UND_ERR_SOCKET") { + assert(client[kPendingIdx] === client[kRunningIdx]); + const requests = client[kQueue].splice(client[kRunningIdx]); + for (let i = 0; i < requests.length; i++) { + const request2 = requests[i]; + util.errorRequest(client, request2, err); + } + assert(client[kSize] === 0); + } + } + async function connect(client) { + assert(!client[kConnecting]); + assert(!client[kHTTPContext]); + let { host, hostname, protocol, port } = client[kUrl]; + if (hostname[0] === "[") { + const idx = hostname.indexOf("]"); + assert(idx !== -1); + const ip = hostname.substring(1, idx); + assert(net.isIP(ip)); + hostname = ip; + } + client[kConnecting] = true; + if (channels.beforeConnect.hasSubscribers) { + channels.beforeConnect.publish({ + connectParams: { + host, + hostname, + protocol, + port, + version: client[kHTTPContext]?.version, + servername: client[kServerName], + localAddress: client[kLocalAddress] + }, + connector: client[kConnector] + }); + } + try { + const socket = await new Promise((resolve, reject) => { + client[kConnector]({ + host, + hostname, + protocol, + port, + servername: client[kServerName], + localAddress: client[kLocalAddress] + }, (err, socket2) => { + if (err) { + reject(err); + } else { + resolve(socket2); + } + }); + }); + if (client.destroyed) { + util.destroy(socket.on("error", () => { + }), new ClientDestroyedError()); + return; + } + assert(socket); + try { + client[kHTTPContext] = socket.alpnProtocol === "h2" ? await connectH2(client, socket) : await connectH1(client, socket); + } catch (err) { + socket.destroy().on("error", () => { + }); + throw err; + } + client[kConnecting] = false; + socket[kCounter] = 0; + socket[kMaxRequests] = client[kMaxRequests]; + socket[kClient] = client; + socket[kError] = null; + if (channels.connected.hasSubscribers) { + channels.connected.publish({ + connectParams: { + host, + hostname, + protocol, + port, + version: client[kHTTPContext]?.version, + servername: client[kServerName], + localAddress: client[kLocalAddress] + }, + connector: client[kConnector], + socket + }); + } + client.emit("connect", client[kUrl], [client]); + } catch (err) { + if (client.destroyed) { + return; + } + client[kConnecting] = false; + if (channels.connectError.hasSubscribers) { + channels.connectError.publish({ + connectParams: { + host, + hostname, + protocol, + port, + version: client[kHTTPContext]?.version, + servername: client[kServerName], + localAddress: client[kLocalAddress] + }, + connector: client[kConnector], + error: err + }); + } + if (err.code === "ERR_TLS_CERT_ALTNAME_INVALID") { + assert(client[kRunning] === 0); + while (client[kPending] > 0 && client[kQueue][client[kPendingIdx]].servername === client[kServerName]) { + const request2 = client[kQueue][client[kPendingIdx]++]; + util.errorRequest(client, request2, err); + } + } else { + onError(client, err); + } + client.emit("connectionError", client[kUrl], [client], err); + } + client[kResume](); + } + function emitDrain(client) { + client[kNeedDrain] = 0; + client.emit("drain", client[kUrl], [client]); + } + function resume(client, sync) { + if (client[kResuming] === 2) { + return; + } + client[kResuming] = 2; + _resume(client, sync); + client[kResuming] = 0; + if (client[kRunningIdx] > 256) { + client[kQueue].splice(0, client[kRunningIdx]); + client[kPendingIdx] -= client[kRunningIdx]; + client[kRunningIdx] = 0; + } + } + function _resume(client, sync) { + while (true) { + if (client.destroyed) { + assert(client[kPending] === 0); + return; + } + if (client[kClosedResolve] && !client[kSize]) { + client[kClosedResolve](); + client[kClosedResolve] = null; + return; + } + if (client[kHTTPContext]) { + client[kHTTPContext].resume(); + } + if (client[kBusy]) { + client[kNeedDrain] = 2; + } else if (client[kNeedDrain] === 2) { + if (sync) { + client[kNeedDrain] = 1; + queueMicrotask(() => emitDrain(client)); + } else { + emitDrain(client); + } + continue; + } + if (client[kPending] === 0) { + return; + } + if (client[kRunning] >= (getPipelining(client) || 1)) { + return; + } + const request2 = client[kQueue][client[kPendingIdx]]; + if (client[kUrl].protocol === "https:" && client[kServerName] !== request2.servername) { + if (client[kRunning] > 0) { + return; + } + client[kServerName] = request2.servername; + client[kHTTPContext]?.destroy(new InformationalError("servername changed"), () => { + client[kHTTPContext] = null; + resume(client); + }); + } + if (client[kConnecting]) { + return; + } + if (!client[kHTTPContext]) { + connect(client); + return; + } + if (client[kHTTPContext].destroyed) { + return; + } + if (client[kHTTPContext].busy(request2)) { + return; + } + if (!request2.aborted && client[kHTTPContext].write(request2)) { + client[kPendingIdx]++; + } else { + client[kQueue].splice(client[kPendingIdx], 1); + } + } + } + module2.exports = Client; + } +}); + +// node_modules/undici/lib/dispatcher/fixed-queue.js +var require_fixed_queue2 = __commonJS({ + "node_modules/undici/lib/dispatcher/fixed-queue.js"(exports2, module2) { + "use strict"; + var kSize = 2048; + var kMask = kSize - 1; + var FixedCircularBuffer = class { + constructor() { + this.bottom = 0; + this.top = 0; + this.list = new Array(kSize); + this.next = null; + } + isEmpty() { + return this.top === this.bottom; + } + isFull() { + return (this.top + 1 & kMask) === this.bottom; + } + push(data) { + this.list[this.top] = data; + this.top = this.top + 1 & kMask; + } + shift() { + const nextItem = this.list[this.bottom]; + if (nextItem === void 0) + return null; + this.list[this.bottom] = void 0; + this.bottom = this.bottom + 1 & kMask; + return nextItem; + } + }; + module2.exports = class FixedQueue { + constructor() { + this.head = this.tail = new FixedCircularBuffer(); + } + isEmpty() { + return this.head.isEmpty(); + } + push(data) { + if (this.head.isFull()) { + this.head = this.head.next = new FixedCircularBuffer(); + } + this.head.push(data); + } + shift() { + const tail = this.tail; + const next = tail.shift(); + if (tail.isEmpty() && tail.next !== null) { + this.tail = tail.next; + } + return next; + } + }; + } +}); + +// node_modules/undici/lib/dispatcher/pool-stats.js +var require_pool_stats2 = __commonJS({ + "node_modules/undici/lib/dispatcher/pool-stats.js"(exports2, module2) { + var { kFree, kConnected, kPending, kQueued, kRunning, kSize } = require_symbols6(); + var kPool = Symbol("pool"); + var PoolStats = class { + constructor(pool) { + this[kPool] = pool; + } + get connected() { + return this[kPool][kConnected]; + } + get free() { + return this[kPool][kFree]; + } + get pending() { + return this[kPool][kPending]; + } + get queued() { + return this[kPool][kQueued]; + } + get running() { + return this[kPool][kRunning]; + } + get size() { + return this[kPool][kSize]; + } + }; + module2.exports = PoolStats; + } +}); + +// node_modules/undici/lib/dispatcher/pool-base.js +var require_pool_base2 = __commonJS({ + "node_modules/undici/lib/dispatcher/pool-base.js"(exports2, module2) { + "use strict"; + var DispatcherBase = require_dispatcher_base2(); + var FixedQueue = require_fixed_queue2(); + var { kConnected, kSize, kRunning, kPending, kQueued, kBusy, kFree, kUrl, kClose, kDestroy, kDispatch } = require_symbols6(); + var PoolStats = require_pool_stats2(); + var kClients = Symbol("clients"); + var kNeedDrain = Symbol("needDrain"); + var kQueue = Symbol("queue"); + var kClosedResolve = Symbol("closed resolve"); + var kOnDrain = Symbol("onDrain"); + var kOnConnect = Symbol("onConnect"); + var kOnDisconnect = Symbol("onDisconnect"); + var kOnConnectionError = Symbol("onConnectionError"); + var kGetDispatcher = Symbol("get dispatcher"); + var kAddClient = Symbol("add client"); + var kRemoveClient = Symbol("remove client"); + var kStats = Symbol("stats"); + var PoolBase = class extends DispatcherBase { + constructor() { + super(); + this[kQueue] = new FixedQueue(); + this[kClients] = []; + this[kQueued] = 0; + const pool = this; + this[kOnDrain] = function onDrain(origin, targets) { + const queue = pool[kQueue]; + let needDrain = false; + while (!needDrain) { + const item = queue.shift(); + if (!item) { + break; + } + pool[kQueued]--; + needDrain = !this.dispatch(item.opts, item.handler); + } + this[kNeedDrain] = needDrain; + if (!this[kNeedDrain] && pool[kNeedDrain]) { + pool[kNeedDrain] = false; + pool.emit("drain", origin, [pool, ...targets]); + } + if (pool[kClosedResolve] && queue.isEmpty()) { + Promise.all(pool[kClients].map((c) => c.close())).then(pool[kClosedResolve]); + } + }; + this[kOnConnect] = (origin, targets) => { + pool.emit("connect", origin, [pool, ...targets]); + }; + this[kOnDisconnect] = (origin, targets, err) => { + pool.emit("disconnect", origin, [pool, ...targets], err); + }; + this[kOnConnectionError] = (origin, targets, err) => { + pool.emit("connectionError", origin, [pool, ...targets], err); + }; + this[kStats] = new PoolStats(this); + } + get [kBusy]() { + return this[kNeedDrain]; + } + get [kConnected]() { + return this[kClients].filter((client) => client[kConnected]).length; + } + get [kFree]() { + return this[kClients].filter((client) => client[kConnected] && !client[kNeedDrain]).length; + } + get [kPending]() { + let ret = this[kQueued]; + for (const { [kPending]: pending } of this[kClients]) { + ret += pending; + } + return ret; + } + get [kRunning]() { + let ret = 0; + for (const { [kRunning]: running } of this[kClients]) { + ret += running; + } + return ret; + } + get [kSize]() { + let ret = this[kQueued]; + for (const { [kSize]: size } of this[kClients]) { + ret += size; + } + return ret; + } + get stats() { + return this[kStats]; + } + async [kClose]() { + if (this[kQueue].isEmpty()) { + return Promise.all(this[kClients].map((c) => c.close())); + } else { + return new Promise((resolve) => { + this[kClosedResolve] = resolve; + }); + } + } + async [kDestroy](err) { + while (true) { + const item = this[kQueue].shift(); + if (!item) { + break; + } + item.handler.onError(err); + } + return Promise.all(this[kClients].map((c) => c.destroy(err))); + } + [kDispatch](opts, handler) { + const dispatcher = this[kGetDispatcher](); + if (!dispatcher) { + this[kNeedDrain] = true; + this[kQueue].push({ opts, handler }); + this[kQueued]++; + } else if (!dispatcher.dispatch(opts, handler)) { + dispatcher[kNeedDrain] = true; + this[kNeedDrain] = !this[kGetDispatcher](); + } + return !this[kNeedDrain]; + } + [kAddClient](client) { + client.on("drain", this[kOnDrain]).on("connect", this[kOnConnect]).on("disconnect", this[kOnDisconnect]).on("connectionError", this[kOnConnectionError]); + this[kClients].push(client); + if (this[kNeedDrain]) { + queueMicrotask(() => { + if (this[kNeedDrain]) { + this[kOnDrain](client[kUrl], [this, client]); + } + }); + } + return this; + } + [kRemoveClient](client) { + client.close(() => { + const idx = this[kClients].indexOf(client); + if (idx !== -1) { + this[kClients].splice(idx, 1); + } + }); + this[kNeedDrain] = this[kClients].some((dispatcher) => !dispatcher[kNeedDrain] && dispatcher.closed !== true && dispatcher.destroyed !== true); + } + }; + module2.exports = { + PoolBase, + kClients, + kNeedDrain, + kAddClient, + kRemoveClient, + kGetDispatcher + }; + } +}); + +// node_modules/undici/lib/dispatcher/pool.js +var require_pool2 = __commonJS({ + "node_modules/undici/lib/dispatcher/pool.js"(exports2, module2) { + "use strict"; + var { + PoolBase, + kClients, + kNeedDrain, + kAddClient, + kGetDispatcher + } = require_pool_base2(); + var Client = require_client2(); + var { + InvalidArgumentError + } = require_errors2(); + var util = require_util9(); + var { kUrl, kInterceptors } = require_symbols6(); + var buildConnector = require_connect2(); + var kOptions = Symbol("options"); + var kConnections = Symbol("connections"); + var kFactory = Symbol("factory"); + function defaultFactory(origin, opts) { + return new Client(origin, opts); + } + var Pool = class extends PoolBase { + constructor(origin, { + connections, + factory = defaultFactory, + connect, + connectTimeout, + tls, + maxCachedSessions, + socketPath, + autoSelectFamily, + autoSelectFamilyAttemptTimeout, + allowH2, + ...options + } = {}) { + super(); + if (connections != null && (!Number.isFinite(connections) || connections < 0)) { + throw new InvalidArgumentError("invalid connections"); + } + if (typeof factory !== "function") { + throw new InvalidArgumentError("factory must be a function."); + } + if (connect != null && typeof connect !== "function" && typeof connect !== "object") { + throw new InvalidArgumentError("connect must be a function or an object"); + } + if (typeof connect !== "function") { + connect = buildConnector({ + ...tls, + maxCachedSessions, + allowH2, + socketPath, + timeout: connectTimeout, + ...autoSelectFamily ? { autoSelectFamily, autoSelectFamilyAttemptTimeout } : void 0, + ...connect + }); + } + this[kInterceptors] = options.interceptors?.Pool && Array.isArray(options.interceptors.Pool) ? options.interceptors.Pool : []; + this[kConnections] = connections || null; + this[kUrl] = util.parseOrigin(origin); + this[kOptions] = { ...util.deepClone(options), connect, allowH2 }; + this[kOptions].interceptors = options.interceptors ? { ...options.interceptors } : void 0; + this[kFactory] = factory; + } + [kGetDispatcher]() { + for (const client of this[kClients]) { + if (!client[kNeedDrain]) { + return client; + } + } + if (!this[kConnections] || this[kClients].length < this[kConnections]) { + const dispatcher = this[kFactory](this[kUrl], this[kOptions]); + this[kAddClient](dispatcher); + return dispatcher; + } + } + }; + module2.exports = Pool; + } +}); + +// node_modules/undici/lib/dispatcher/balanced-pool.js +var require_balanced_pool2 = __commonJS({ + "node_modules/undici/lib/dispatcher/balanced-pool.js"(exports2, module2) { + "use strict"; + var { + BalancedPoolMissingUpstreamError, + InvalidArgumentError + } = require_errors2(); + var { + PoolBase, + kClients, + kNeedDrain, + kAddClient, + kRemoveClient, + kGetDispatcher + } = require_pool_base2(); + var Pool = require_pool2(); + var { kUrl, kInterceptors } = require_symbols6(); + var { parseOrigin } = require_util9(); + var kFactory = Symbol("factory"); + var kOptions = Symbol("options"); + var kGreatestCommonDivisor = Symbol("kGreatestCommonDivisor"); + var kCurrentWeight = Symbol("kCurrentWeight"); + var kIndex = Symbol("kIndex"); + var kWeight = Symbol("kWeight"); + var kMaxWeightPerServer = Symbol("kMaxWeightPerServer"); + var kErrorPenalty = Symbol("kErrorPenalty"); + function getGreatestCommonDivisor(a, b) { + if (b === 0) return a; + return getGreatestCommonDivisor(b, a % b); + } + function defaultFactory(origin, opts) { + return new Pool(origin, opts); + } + var BalancedPool = class extends PoolBase { + constructor(upstreams = [], { factory = defaultFactory, ...opts } = {}) { + super(); + this[kOptions] = opts; + this[kIndex] = -1; + this[kCurrentWeight] = 0; + this[kMaxWeightPerServer] = this[kOptions].maxWeightPerServer || 100; + this[kErrorPenalty] = this[kOptions].errorPenalty || 15; + if (!Array.isArray(upstreams)) { + upstreams = [upstreams]; + } + if (typeof factory !== "function") { + throw new InvalidArgumentError("factory must be a function."); + } + this[kInterceptors] = opts.interceptors?.BalancedPool && Array.isArray(opts.interceptors.BalancedPool) ? opts.interceptors.BalancedPool : []; + this[kFactory] = factory; + for (const upstream of upstreams) { + this.addUpstream(upstream); + } + this._updateBalancedPoolStats(); + } + addUpstream(upstream) { + const upstreamOrigin = parseOrigin(upstream).origin; + if (this[kClients].find((pool2) => pool2[kUrl].origin === upstreamOrigin && pool2.closed !== true && pool2.destroyed !== true)) { + return this; + } + const pool = this[kFactory](upstreamOrigin, Object.assign({}, this[kOptions])); + this[kAddClient](pool); + pool.on("connect", () => { + pool[kWeight] = Math.min(this[kMaxWeightPerServer], pool[kWeight] + this[kErrorPenalty]); + }); + pool.on("connectionError", () => { + pool[kWeight] = Math.max(1, pool[kWeight] - this[kErrorPenalty]); + this._updateBalancedPoolStats(); + }); + pool.on("disconnect", (...args) => { + const err = args[2]; + if (err && err.code === "UND_ERR_SOCKET") { + pool[kWeight] = Math.max(1, pool[kWeight] - this[kErrorPenalty]); + this._updateBalancedPoolStats(); + } + }); + for (const client of this[kClients]) { + client[kWeight] = this[kMaxWeightPerServer]; + } + this._updateBalancedPoolStats(); + return this; + } + _updateBalancedPoolStats() { + this[kGreatestCommonDivisor] = this[kClients].map((p) => p[kWeight]).reduce(getGreatestCommonDivisor, 0); + } + removeUpstream(upstream) { + const upstreamOrigin = parseOrigin(upstream).origin; + const pool = this[kClients].find((pool2) => pool2[kUrl].origin === upstreamOrigin && pool2.closed !== true && pool2.destroyed !== true); + if (pool) { + this[kRemoveClient](pool); + } + return this; + } + get upstreams() { + return this[kClients].filter((dispatcher) => dispatcher.closed !== true && dispatcher.destroyed !== true).map((p) => p[kUrl].origin); + } + [kGetDispatcher]() { + if (this[kClients].length === 0) { + throw new BalancedPoolMissingUpstreamError(); + } + const dispatcher = this[kClients].find((dispatcher2) => !dispatcher2[kNeedDrain] && dispatcher2.closed !== true && dispatcher2.destroyed !== true); + if (!dispatcher) { + return; + } + const allClientsBusy = this[kClients].map((pool) => pool[kNeedDrain]).reduce((a, b) => a && b, true); + if (allClientsBusy) { + return; + } + let counter = 0; + let maxWeightIndex = this[kClients].findIndex((pool) => !pool[kNeedDrain]); + while (counter++ < this[kClients].length) { + this[kIndex] = (this[kIndex] + 1) % this[kClients].length; + const pool = this[kClients][this[kIndex]]; + if (pool[kWeight] > this[kClients][maxWeightIndex][kWeight] && !pool[kNeedDrain]) { + maxWeightIndex = this[kIndex]; + } + if (this[kIndex] === 0) { + this[kCurrentWeight] = this[kCurrentWeight] - this[kGreatestCommonDivisor]; + if (this[kCurrentWeight] <= 0) { + this[kCurrentWeight] = this[kMaxWeightPerServer]; + } + } + if (pool[kWeight] >= this[kCurrentWeight] && !pool[kNeedDrain]) { + return pool; + } + } + this[kCurrentWeight] = this[kClients][maxWeightIndex][kWeight]; + this[kIndex] = maxWeightIndex; + return this[kClients][maxWeightIndex]; + } + }; + module2.exports = BalancedPool; + } +}); + +// node_modules/undici/lib/dispatcher/agent.js +var require_agent2 = __commonJS({ + "node_modules/undici/lib/dispatcher/agent.js"(exports2, module2) { + "use strict"; + var { InvalidArgumentError } = require_errors2(); + var { kClients, kRunning, kClose, kDestroy, kDispatch, kInterceptors } = require_symbols6(); + var DispatcherBase = require_dispatcher_base2(); + var Pool = require_pool2(); + var Client = require_client2(); + var util = require_util9(); + var createRedirectInterceptor = require_redirect_interceptor(); + var kOnConnect = Symbol("onConnect"); + var kOnDisconnect = Symbol("onDisconnect"); + var kOnConnectionError = Symbol("onConnectionError"); + var kMaxRedirections = Symbol("maxRedirections"); + var kOnDrain = Symbol("onDrain"); + var kFactory = Symbol("factory"); + var kOptions = Symbol("options"); + function defaultFactory(origin, opts) { + return opts && opts.connections === 1 ? new Client(origin, opts) : new Pool(origin, opts); + } + var Agent = class extends DispatcherBase { + constructor({ factory = defaultFactory, maxRedirections = 0, connect, ...options } = {}) { + super(); + if (typeof factory !== "function") { + throw new InvalidArgumentError("factory must be a function."); + } + if (connect != null && typeof connect !== "function" && typeof connect !== "object") { + throw new InvalidArgumentError("connect must be a function or an object"); + } + if (!Number.isInteger(maxRedirections) || maxRedirections < 0) { + throw new InvalidArgumentError("maxRedirections must be a positive number"); + } + if (connect && typeof connect !== "function") { + connect = { ...connect }; + } + this[kInterceptors] = options.interceptors?.Agent && Array.isArray(options.interceptors.Agent) ? options.interceptors.Agent : [createRedirectInterceptor({ maxRedirections })]; + this[kOptions] = { ...util.deepClone(options), connect }; + this[kOptions].interceptors = options.interceptors ? { ...options.interceptors } : void 0; + this[kMaxRedirections] = maxRedirections; + this[kFactory] = factory; + this[kClients] = /* @__PURE__ */ new Map(); + this[kOnDrain] = (origin, targets) => { + this.emit("drain", origin, [this, ...targets]); + }; + this[kOnConnect] = (origin, targets) => { + this.emit("connect", origin, [this, ...targets]); + }; + this[kOnDisconnect] = (origin, targets, err) => { + this.emit("disconnect", origin, [this, ...targets], err); + }; + this[kOnConnectionError] = (origin, targets, err) => { + this.emit("connectionError", origin, [this, ...targets], err); + }; + } + get [kRunning]() { + let ret = 0; + for (const client of this[kClients].values()) { + ret += client[kRunning]; + } + return ret; + } + [kDispatch](opts, handler) { + let key; + if (opts.origin && (typeof opts.origin === "string" || opts.origin instanceof URL)) { + key = String(opts.origin); + } else { + throw new InvalidArgumentError("opts.origin must be a non-empty string or URL."); + } + let dispatcher = this[kClients].get(key); + if (!dispatcher) { + dispatcher = this[kFactory](opts.origin, this[kOptions]).on("drain", this[kOnDrain]).on("connect", this[kOnConnect]).on("disconnect", this[kOnDisconnect]).on("connectionError", this[kOnConnectionError]); + this[kClients].set(key, dispatcher); + } + return dispatcher.dispatch(opts, handler); + } + async [kClose]() { + const closePromises = []; + for (const client of this[kClients].values()) { + closePromises.push(client.close()); + } + this[kClients].clear(); + await Promise.all(closePromises); + } + async [kDestroy](err) { + const destroyPromises = []; + for (const client of this[kClients].values()) { + destroyPromises.push(client.destroy(err)); + } + this[kClients].clear(); + await Promise.all(destroyPromises); + } + }; + module2.exports = Agent; + } +}); + +// node_modules/undici/lib/dispatcher/proxy-agent.js +var require_proxy_agent2 = __commonJS({ + "node_modules/undici/lib/dispatcher/proxy-agent.js"(exports2, module2) { + "use strict"; + var { kProxy, kClose, kDestroy, kInterceptors } = require_symbols6(); + var { URL: URL4 } = require("node:url"); + var Agent = require_agent2(); + var Pool = require_pool2(); + var DispatcherBase = require_dispatcher_base2(); + var { InvalidArgumentError, RequestAbortedError, SecureProxyConnectionError } = require_errors2(); + var buildConnector = require_connect2(); + var kAgent = Symbol("proxy agent"); + var kClient = Symbol("proxy client"); + var kProxyHeaders = Symbol("proxy headers"); + var kRequestTls = Symbol("request tls settings"); + var kProxyTls = Symbol("proxy tls settings"); + var kConnectEndpoint = Symbol("connect endpoint function"); + function defaultProtocolPort(protocol) { + return protocol === "https:" ? 443 : 80; + } + function defaultFactory(origin, opts) { + return new Pool(origin, opts); + } + var ProxyAgent2 = class extends DispatcherBase { + constructor(opts) { + super(); + if (!opts || typeof opts === "object" && !(opts instanceof URL4) && !opts.uri) { + throw new InvalidArgumentError("Proxy uri is mandatory"); + } + const { clientFactory = defaultFactory } = opts; + if (typeof clientFactory !== "function") { + throw new InvalidArgumentError("Proxy opts.clientFactory must be a function."); + } + const url = this.#getUrl(opts); + const { href, origin, port, protocol, username, password, hostname: proxyHostname } = url; + this[kProxy] = { uri: href, protocol }; + this[kInterceptors] = opts.interceptors?.ProxyAgent && Array.isArray(opts.interceptors.ProxyAgent) ? opts.interceptors.ProxyAgent : []; + this[kRequestTls] = opts.requestTls; + this[kProxyTls] = opts.proxyTls; + this[kProxyHeaders] = opts.headers || {}; + if (opts.auth && opts.token) { + throw new InvalidArgumentError("opts.auth cannot be used in combination with opts.token"); + } else if (opts.auth) { + this[kProxyHeaders]["proxy-authorization"] = `Basic ${opts.auth}`; + } else if (opts.token) { + this[kProxyHeaders]["proxy-authorization"] = opts.token; + } else if (username && password) { + this[kProxyHeaders]["proxy-authorization"] = `Basic ${Buffer.from(`${decodeURIComponent(username)}:${decodeURIComponent(password)}`).toString("base64")}`; + } + const connect = buildConnector({ ...opts.proxyTls }); + this[kConnectEndpoint] = buildConnector({ ...opts.requestTls }); + this[kClient] = clientFactory(url, { connect }); + this[kAgent] = new Agent({ + ...opts, + connect: async (opts2, callback) => { + let requestedPath = opts2.host; + if (!opts2.port) { + requestedPath += `:${defaultProtocolPort(opts2.protocol)}`; + } + try { + const { socket, statusCode } = await this[kClient].connect({ + origin, + port, + path: requestedPath, + signal: opts2.signal, + headers: { + ...this[kProxyHeaders], + host: opts2.host + }, + servername: this[kProxyTls]?.servername || proxyHostname + }); + if (statusCode !== 200) { + socket.on("error", () => { + }).destroy(); + callback(new RequestAbortedError(`Proxy response (${statusCode}) !== 200 when HTTP Tunneling`)); + } + if (opts2.protocol !== "https:") { + callback(null, socket); + return; + } + let servername; + if (this[kRequestTls]) { + servername = this[kRequestTls].servername; + } else { + servername = opts2.servername; + } + this[kConnectEndpoint]({ ...opts2, servername, httpSocket: socket }, callback); + } catch (err) { + if (err.code === "ERR_TLS_CERT_ALTNAME_INVALID") { + callback(new SecureProxyConnectionError(err)); + } else { + callback(err); + } + } + } + }); + } + dispatch(opts, handler) { + const headers = buildHeaders(opts.headers); + throwIfProxyAuthIsSent(headers); + if (headers && !("host" in headers) && !("Host" in headers)) { + const { host } = new URL4(opts.origin); + headers.host = host; + } + return this[kAgent].dispatch( + { + ...opts, + headers + }, + handler + ); + } + /** + * @param {import('../types/proxy-agent').ProxyAgent.Options | string | URL} opts + * @returns {URL} + */ + #getUrl(opts) { + if (typeof opts === "string") { + return new URL4(opts); + } else if (opts instanceof URL4) { + return opts; + } else { + return new URL4(opts.uri); + } + } + async [kClose]() { + await this[kAgent].close(); + await this[kClient].close(); + } + async [kDestroy]() { + await this[kAgent].destroy(); + await this[kClient].destroy(); + } + }; + function buildHeaders(headers) { + if (Array.isArray(headers)) { + const headersPair = {}; + for (let i = 0; i < headers.length; i += 2) { + headersPair[headers[i]] = headers[i + 1]; + } + return headersPair; + } + return headers; + } + function throwIfProxyAuthIsSent(headers) { + const existProxyAuth = headers && Object.keys(headers).find((key) => key.toLowerCase() === "proxy-authorization"); + if (existProxyAuth) { + throw new InvalidArgumentError("Proxy-Authorization should be sent in ProxyAgent constructor"); + } + } + module2.exports = ProxyAgent2; + } +}); + +// node_modules/undici/lib/dispatcher/env-http-proxy-agent.js +var require_env_http_proxy_agent = __commonJS({ + "node_modules/undici/lib/dispatcher/env-http-proxy-agent.js"(exports2, module2) { + "use strict"; + var DispatcherBase = require_dispatcher_base2(); + var { kClose, kDestroy, kClosed, kDestroyed, kDispatch, kNoProxyAgent, kHttpProxyAgent, kHttpsProxyAgent } = require_symbols6(); + var ProxyAgent2 = require_proxy_agent2(); + var Agent = require_agent2(); + var DEFAULT_PORTS = { + "http:": 80, + "https:": 443 + }; + var experimentalWarned = false; + var EnvHttpProxyAgent = class extends DispatcherBase { + #noProxyValue = null; + #noProxyEntries = null; + #opts = null; + constructor(opts = {}) { + super(); + this.#opts = opts; + if (!experimentalWarned) { + experimentalWarned = true; + process.emitWarning("EnvHttpProxyAgent is experimental, expect them to change at any time.", { + code: "UNDICI-EHPA" + }); + } + const { httpProxy, httpsProxy, noProxy, ...agentOpts } = opts; + this[kNoProxyAgent] = new Agent(agentOpts); + const HTTP_PROXY = httpProxy ?? process.env.http_proxy ?? process.env.HTTP_PROXY; + if (HTTP_PROXY) { + this[kHttpProxyAgent] = new ProxyAgent2({ ...agentOpts, uri: HTTP_PROXY }); + } else { + this[kHttpProxyAgent] = this[kNoProxyAgent]; + } + const HTTPS_PROXY = httpsProxy ?? process.env.https_proxy ?? process.env.HTTPS_PROXY; + if (HTTPS_PROXY) { + this[kHttpsProxyAgent] = new ProxyAgent2({ ...agentOpts, uri: HTTPS_PROXY }); + } else { + this[kHttpsProxyAgent] = this[kHttpProxyAgent]; + } + this.#parseNoProxy(); + } + [kDispatch](opts, handler) { + const url = new URL(opts.origin); + const agent = this.#getProxyAgentForUrl(url); + return agent.dispatch(opts, handler); + } + async [kClose]() { + await this[kNoProxyAgent].close(); + if (!this[kHttpProxyAgent][kClosed]) { + await this[kHttpProxyAgent].close(); + } + if (!this[kHttpsProxyAgent][kClosed]) { + await this[kHttpsProxyAgent].close(); + } + } + async [kDestroy](err) { + await this[kNoProxyAgent].destroy(err); + if (!this[kHttpProxyAgent][kDestroyed]) { + await this[kHttpProxyAgent].destroy(err); + } + if (!this[kHttpsProxyAgent][kDestroyed]) { + await this[kHttpsProxyAgent].destroy(err); + } + } + #getProxyAgentForUrl(url) { + let { protocol, host: hostname, port } = url; + hostname = hostname.replace(/:\d*$/, "").toLowerCase(); + port = Number.parseInt(port, 10) || DEFAULT_PORTS[protocol] || 0; + if (!this.#shouldProxy(hostname, port)) { + return this[kNoProxyAgent]; + } + if (protocol === "https:") { + return this[kHttpsProxyAgent]; + } + return this[kHttpProxyAgent]; + } + #shouldProxy(hostname, port) { + if (this.#noProxyChanged) { + this.#parseNoProxy(); + } + if (this.#noProxyEntries.length === 0) { + return true; + } + if (this.#noProxyValue === "*") { + return false; + } + for (let i = 0; i < this.#noProxyEntries.length; i++) { + const entry = this.#noProxyEntries[i]; + if (entry.port && entry.port !== port) { + continue; + } + if (!/^[.*]/.test(entry.hostname)) { + if (hostname === entry.hostname) { + return false; + } + } else { + if (hostname.endsWith(entry.hostname.replace(/^\*/, ""))) { + return false; + } + } + } + return true; + } + #parseNoProxy() { + const noProxyValue = this.#opts.noProxy ?? this.#noProxyEnv; + const noProxySplit = noProxyValue.split(/[,\s]/); + const noProxyEntries = []; + for (let i = 0; i < noProxySplit.length; i++) { + const entry = noProxySplit[i]; + if (!entry) { + continue; + } + const parsed = entry.match(/^(.+):(\d+)$/); + noProxyEntries.push({ + hostname: (parsed ? parsed[1] : entry).toLowerCase(), + port: parsed ? Number.parseInt(parsed[2], 10) : 0 + }); + } + this.#noProxyValue = noProxyValue; + this.#noProxyEntries = noProxyEntries; + } + get #noProxyChanged() { + if (this.#opts.noProxy !== void 0) { + return false; + } + return this.#noProxyValue !== this.#noProxyEnv; + } + get #noProxyEnv() { + return process.env.no_proxy ?? process.env.NO_PROXY ?? ""; + } + }; + module2.exports = EnvHttpProxyAgent; + } +}); + +// node_modules/undici/lib/handler/retry-handler.js +var require_retry_handler = __commonJS({ + "node_modules/undici/lib/handler/retry-handler.js"(exports2, module2) { + "use strict"; + var assert = require("node:assert"); + var { kRetryHandlerDefaultRetry } = require_symbols6(); + var { RequestRetryError } = require_errors2(); + var { + isDisturbed, + parseHeaders, + parseRangeHeader, + wrapRequestBody + } = require_util9(); + function calculateRetryAfterHeader(retryAfter) { + const current = Date.now(); + return new Date(retryAfter).getTime() - current; + } + var RetryHandler = class _RetryHandler { + constructor(opts, handlers) { + const { retryOptions, ...dispatchOpts } = opts; + const { + // Retry scoped + retry: retryFn, + maxRetries, + maxTimeout, + minTimeout, + timeoutFactor, + // Response scoped + methods, + errorCodes, + retryAfter, + statusCodes + } = retryOptions ?? {}; + this.dispatch = handlers.dispatch; + this.handler = handlers.handler; + this.opts = { ...dispatchOpts, body: wrapRequestBody(opts.body) }; + this.abort = null; + this.aborted = false; + this.retryOpts = { + retry: retryFn ?? _RetryHandler[kRetryHandlerDefaultRetry], + retryAfter: retryAfter ?? true, + maxTimeout: maxTimeout ?? 30 * 1e3, + // 30s, + minTimeout: minTimeout ?? 500, + // .5s + timeoutFactor: timeoutFactor ?? 2, + maxRetries: maxRetries ?? 5, + // What errors we should retry + methods: methods ?? ["GET", "HEAD", "OPTIONS", "PUT", "DELETE", "TRACE"], + // Indicates which errors to retry + statusCodes: statusCodes ?? [500, 502, 503, 504, 429], + // List of errors to retry + errorCodes: errorCodes ?? [ + "ECONNRESET", + "ECONNREFUSED", + "ENOTFOUND", + "ENETDOWN", + "ENETUNREACH", + "EHOSTDOWN", + "EHOSTUNREACH", + "EPIPE", + "UND_ERR_SOCKET" + ] + }; + this.retryCount = 0; + this.retryCountCheckpoint = 0; + this.start = 0; + this.end = null; + this.etag = null; + this.resume = null; + this.handler.onConnect((reason) => { + this.aborted = true; + if (this.abort) { + this.abort(reason); + } else { + this.reason = reason; + } + }); + } + onRequestSent() { + if (this.handler.onRequestSent) { + this.handler.onRequestSent(); + } + } + onUpgrade(statusCode, headers, socket) { + if (this.handler.onUpgrade) { + this.handler.onUpgrade(statusCode, headers, socket); + } + } + onConnect(abort) { + if (this.aborted) { + abort(this.reason); + } else { + this.abort = abort; + } + } + onBodySent(chunk) { + if (this.handler.onBodySent) return this.handler.onBodySent(chunk); + } + static [kRetryHandlerDefaultRetry](err, { state, opts }, cb) { + const { statusCode, code, headers } = err; + const { method, retryOptions } = opts; + const { + maxRetries, + minTimeout, + maxTimeout, + timeoutFactor, + statusCodes, + errorCodes, + methods + } = retryOptions; + const { counter } = state; + if (code && code !== "UND_ERR_REQ_RETRY" && !errorCodes.includes(code)) { + cb(err); + return; + } + if (Array.isArray(methods) && !methods.includes(method)) { + cb(err); + return; + } + if (statusCode != null && Array.isArray(statusCodes) && !statusCodes.includes(statusCode)) { + cb(err); + return; + } + if (counter > maxRetries) { + cb(err); + return; + } + let retryAfterHeader = headers?.["retry-after"]; + if (retryAfterHeader) { + retryAfterHeader = Number(retryAfterHeader); + retryAfterHeader = Number.isNaN(retryAfterHeader) ? calculateRetryAfterHeader(retryAfterHeader) : retryAfterHeader * 1e3; + } + const retryTimeout = retryAfterHeader > 0 ? Math.min(retryAfterHeader, maxTimeout) : Math.min(minTimeout * timeoutFactor ** (counter - 1), maxTimeout); + setTimeout(() => cb(null), retryTimeout); + } + onHeaders(statusCode, rawHeaders, resume, statusMessage) { + const headers = parseHeaders(rawHeaders); + this.retryCount += 1; + if (statusCode >= 300) { + if (this.retryOpts.statusCodes.includes(statusCode) === false) { + return this.handler.onHeaders( + statusCode, + rawHeaders, + resume, + statusMessage + ); + } else { + this.abort( + new RequestRetryError("Request failed", statusCode, { + headers, + data: { + count: this.retryCount + } + }) + ); + return false; + } + } + if (this.resume != null) { + this.resume = null; + if (statusCode !== 206) { + return true; + } + const contentRange = parseRangeHeader(headers["content-range"]); + if (!contentRange) { + this.abort( + new RequestRetryError("Content-Range mismatch", statusCode, { + headers, + data: { count: this.retryCount } + }) + ); + return false; + } + if (this.etag != null && this.etag !== headers.etag) { + this.abort( + new RequestRetryError("ETag mismatch", statusCode, { + headers, + data: { count: this.retryCount } + }) + ); + return false; + } + const { start, size, end = size } = contentRange; + assert(this.start === start, "content-range mismatch"); + assert(this.end == null || this.end === end, "content-range mismatch"); + this.resume = resume; + return true; + } + if (this.end == null) { + if (statusCode === 206) { + const range = parseRangeHeader(headers["content-range"]); + if (range == null) { + return this.handler.onHeaders( + statusCode, + rawHeaders, + resume, + statusMessage + ); + } + const { start, size, end = size } = range; + assert( + start != null && Number.isFinite(start), + "content-range mismatch" + ); + assert(end != null && Number.isFinite(end), "invalid content-length"); + this.start = start; + this.end = end; + } + if (this.end == null) { + const contentLength = headers["content-length"]; + this.end = contentLength != null ? Number(contentLength) : null; + } + assert(Number.isFinite(this.start)); + assert( + this.end == null || Number.isFinite(this.end), + "invalid content-length" + ); + this.resume = resume; + this.etag = headers.etag != null ? headers.etag : null; + if (this.etag != null && this.etag.startsWith("W/")) { + this.etag = null; + } + return this.handler.onHeaders( + statusCode, + rawHeaders, + resume, + statusMessage + ); + } + const err = new RequestRetryError("Request failed", statusCode, { + headers, + data: { count: this.retryCount } + }); + this.abort(err); + return false; + } + onData(chunk) { + this.start += chunk.length; + return this.handler.onData(chunk); + } + onComplete(rawTrailers) { + this.retryCount = 0; + return this.handler.onComplete(rawTrailers); + } + onError(err) { + if (this.aborted || isDisturbed(this.opts.body)) { + return this.handler.onError(err); + } + if (this.retryCount - this.retryCountCheckpoint > 0) { + this.retryCount = this.retryCountCheckpoint + (this.retryCount - this.retryCountCheckpoint); + } else { + this.retryCount += 1; + } + this.retryOpts.retry( + err, + { + state: { counter: this.retryCount }, + opts: { retryOptions: this.retryOpts, ...this.opts } + }, + onRetry.bind(this) + ); + function onRetry(err2) { + if (err2 != null || this.aborted || isDisturbed(this.opts.body)) { + return this.handler.onError(err2); + } + if (this.start !== 0) { + const headers = { range: `bytes=${this.start}-${this.end ?? ""}` }; + if (this.etag != null) { + headers["if-match"] = this.etag; + } + this.opts = { + ...this.opts, + headers: { + ...this.opts.headers, + ...headers + } + }; + } + try { + this.retryCountCheckpoint = this.retryCount; + this.dispatch(this.opts, this); + } catch (err3) { + this.handler.onError(err3); + } + } + } + }; + module2.exports = RetryHandler; + } +}); + +// node_modules/undici/lib/dispatcher/retry-agent.js +var require_retry_agent = __commonJS({ + "node_modules/undici/lib/dispatcher/retry-agent.js"(exports2, module2) { + "use strict"; + var Dispatcher = require_dispatcher2(); + var RetryHandler = require_retry_handler(); + var RetryAgent = class extends Dispatcher { + #agent = null; + #options = null; + constructor(agent, options = {}) { + super(options); + this.#agent = agent; + this.#options = options; + } + dispatch(opts, handler) { + const retry2 = new RetryHandler({ + ...opts, + retryOptions: this.#options + }, { + dispatch: this.#agent.dispatch.bind(this.#agent), + handler + }); + return this.#agent.dispatch(opts, retry2); + } + close() { + return this.#agent.close(); + } + destroy() { + return this.#agent.destroy(); + } + }; + module2.exports = RetryAgent; + } +}); + +// node_modules/undici/lib/api/readable.js +var require_readable2 = __commonJS({ + "node_modules/undici/lib/api/readable.js"(exports2, module2) { + "use strict"; + var assert = require("node:assert"); + var { Readable } = require("node:stream"); + var { RequestAbortedError, NotSupportedError, InvalidArgumentError, AbortError: AbortError2 } = require_errors2(); + var util = require_util9(); + var { ReadableStreamFrom } = require_util9(); + var kConsume = Symbol("kConsume"); + var kReading = Symbol("kReading"); + var kBody = Symbol("kBody"); + var kAbort = Symbol("kAbort"); + var kContentType = Symbol("kContentType"); + var kContentLength = Symbol("kContentLength"); + var noop = () => { + }; + var BodyReadable = class extends Readable { + constructor({ + resume, + abort, + contentType = "", + contentLength, + highWaterMark = 64 * 1024 + // Same as nodejs fs streams. + }) { + super({ + autoDestroy: true, + read: resume, + highWaterMark + }); + this._readableState.dataEmitted = false; + this[kAbort] = abort; + this[kConsume] = null; + this[kBody] = null; + this[kContentType] = contentType; + this[kContentLength] = contentLength; + this[kReading] = false; + } + destroy(err) { + if (!err && !this._readableState.endEmitted) { + err = new RequestAbortedError(); + } + if (err) { + this[kAbort](); + } + return super.destroy(err); + } + _destroy(err, callback) { + if (!this[kReading]) { + setImmediate(() => { + callback(err); + }); + } else { + callback(err); + } + } + on(ev, ...args) { + if (ev === "data" || ev === "readable") { + this[kReading] = true; + } + return super.on(ev, ...args); + } + addListener(ev, ...args) { + return this.on(ev, ...args); + } + off(ev, ...args) { + const ret = super.off(ev, ...args); + if (ev === "data" || ev === "readable") { + this[kReading] = this.listenerCount("data") > 0 || this.listenerCount("readable") > 0; + } + return ret; + } + removeListener(ev, ...args) { + return this.off(ev, ...args); + } + push(chunk) { + if (this[kConsume] && chunk !== null) { + consumePush(this[kConsume], chunk); + return this[kReading] ? super.push(chunk) : true; + } + return super.push(chunk); + } + // https://fetch.spec.whatwg.org/#dom-body-text + async text() { + return consume(this, "text"); + } + // https://fetch.spec.whatwg.org/#dom-body-json + async json() { + return consume(this, "json"); + } + // https://fetch.spec.whatwg.org/#dom-body-blob + async blob() { + return consume(this, "blob"); + } + // https://fetch.spec.whatwg.org/#dom-body-arraybuffer + async arrayBuffer() { + return consume(this, "arrayBuffer"); + } + // https://fetch.spec.whatwg.org/#dom-body-formdata + async formData() { + throw new NotSupportedError(); + } + // https://fetch.spec.whatwg.org/#dom-body-bodyused + get bodyUsed() { + return util.isDisturbed(this); + } + // https://fetch.spec.whatwg.org/#dom-body-body + get body() { + if (!this[kBody]) { + this[kBody] = ReadableStreamFrom(this); + if (this[kConsume]) { + this[kBody].getReader(); + assert(this[kBody].locked); + } + } + return this[kBody]; + } + async dump(opts) { + let limit = Number.isFinite(opts?.limit) ? opts.limit : 128 * 1024; + const signal = opts?.signal; + if (signal != null && (typeof signal !== "object" || !("aborted" in signal))) { + throw new InvalidArgumentError("signal must be an AbortSignal"); + } + signal?.throwIfAborted(); + if (this._readableState.closeEmitted) { + return null; + } + return await new Promise((resolve, reject) => { + if (this[kContentLength] > limit) { + this.destroy(new AbortError2()); + } + const onAbort = () => { + this.destroy(signal.reason ?? new AbortError2()); + }; + signal?.addEventListener("abort", onAbort); + this.on("close", function() { + signal?.removeEventListener("abort", onAbort); + if (signal?.aborted) { + reject(signal.reason ?? new AbortError2()); + } else { + resolve(null); + } + }).on("error", noop).on("data", function(chunk) { + limit -= chunk.length; + if (limit <= 0) { + this.destroy(); + } + }).resume(); + }); + } + }; + function isLocked(self) { + return self[kBody] && self[kBody].locked === true || self[kConsume]; + } + function isUnusable(self) { + return util.isDisturbed(self) || isLocked(self); + } + async function consume(stream, type) { + assert(!stream[kConsume]); + return new Promise((resolve, reject) => { + if (isUnusable(stream)) { + const rState = stream._readableState; + if (rState.destroyed && rState.closeEmitted === false) { + stream.on("error", (err) => { + reject(err); + }).on("close", () => { + reject(new TypeError("unusable")); + }); + } else { + reject(rState.errored ?? new TypeError("unusable")); + } + } else { + queueMicrotask(() => { + stream[kConsume] = { + type, + stream, + resolve, + reject, + length: 0, + body: [] + }; + stream.on("error", function(err) { + consumeFinish(this[kConsume], err); + }).on("close", function() { + if (this[kConsume].body !== null) { + consumeFinish(this[kConsume], new RequestAbortedError()); + } + }); + consumeStart(stream[kConsume]); + }); + } + }); + } + function consumeStart(consume2) { + if (consume2.body === null) { + return; + } + const { _readableState: state } = consume2.stream; + if (state.bufferIndex) { + const start = state.bufferIndex; + const end = state.buffer.length; + for (let n = start; n < end; n++) { + consumePush(consume2, state.buffer[n]); + } + } else { + for (const chunk of state.buffer) { + consumePush(consume2, chunk); + } + } + if (state.endEmitted) { + consumeEnd(this[kConsume]); + } else { + consume2.stream.on("end", function() { + consumeEnd(this[kConsume]); + }); + } + consume2.stream.resume(); + while (consume2.stream.read() != null) { + } + } + function chunksDecode(chunks, length) { + if (chunks.length === 0 || length === 0) { + return ""; + } + const buffer = chunks.length === 1 ? chunks[0] : Buffer.concat(chunks, length); + const bufferLength = buffer.length; + const start = bufferLength > 2 && buffer[0] === 239 && buffer[1] === 187 && buffer[2] === 191 ? 3 : 0; + return buffer.utf8Slice(start, bufferLength); + } + function consumeEnd(consume2) { + const { type, body, resolve, stream, length } = consume2; + try { + if (type === "text") { + resolve(chunksDecode(body, length)); + } else if (type === "json") { + resolve(JSON.parse(chunksDecode(body, length))); + } else if (type === "arrayBuffer") { + const dst = new Uint8Array(length); + let pos = 0; + for (const buf of body) { + dst.set(buf, pos); + pos += buf.byteLength; + } + resolve(dst.buffer); + } else if (type === "blob") { + resolve(new Blob(body, { type: stream[kContentType] })); + } + consumeFinish(consume2); + } catch (err) { + stream.destroy(err); + } + } + function consumePush(consume2, chunk) { + consume2.length += chunk.length; + consume2.body.push(chunk); + } + function consumeFinish(consume2, err) { + if (consume2.body === null) { + return; + } + if (err) { + consume2.reject(err); + } else { + consume2.resolve(); + } + consume2.type = null; + consume2.stream = null; + consume2.resolve = null; + consume2.reject = null; + consume2.length = 0; + consume2.body = null; + } + module2.exports = { Readable: BodyReadable, chunksDecode }; + } +}); + +// node_modules/undici/lib/api/util.js +var require_util11 = __commonJS({ + "node_modules/undici/lib/api/util.js"(exports2, module2) { + var assert = require("node:assert"); + var { + ResponseStatusCodeError + } = require_errors2(); + var { chunksDecode } = require_readable2(); + var CHUNK_LIMIT = 128 * 1024; + async function getResolveErrorBodyCallback({ callback, body, contentType, statusCode, statusMessage, headers }) { + assert(body); + let chunks = []; + let length = 0; + try { + for await (const chunk of body) { + chunks.push(chunk); + length += chunk.length; + if (length > CHUNK_LIMIT) { + chunks = []; + length = 0; + break; + } + } + } catch { + chunks = []; + length = 0; + } + const message = `Response status code ${statusCode}${statusMessage ? `: ${statusMessage}` : ""}`; + if (statusCode === 204 || !contentType || !length) { + queueMicrotask(() => callback(new ResponseStatusCodeError(message, statusCode, headers))); + return; + } + const stackTraceLimit = Error.stackTraceLimit; + Error.stackTraceLimit = 0; + let payload; + try { + if (isContentTypeApplicationJson(contentType)) { + payload = JSON.parse(chunksDecode(chunks, length)); + } else if (isContentTypeText(contentType)) { + payload = chunksDecode(chunks, length); + } + } catch { + } finally { + Error.stackTraceLimit = stackTraceLimit; + } + queueMicrotask(() => callback(new ResponseStatusCodeError(message, statusCode, headers, payload))); + } + var isContentTypeApplicationJson = (contentType) => { + return contentType.length > 15 && contentType[11] === "/" && contentType[0] === "a" && contentType[1] === "p" && contentType[2] === "p" && contentType[3] === "l" && contentType[4] === "i" && contentType[5] === "c" && contentType[6] === "a" && contentType[7] === "t" && contentType[8] === "i" && contentType[9] === "o" && contentType[10] === "n" && contentType[12] === "j" && contentType[13] === "s" && contentType[14] === "o" && contentType[15] === "n"; + }; + var isContentTypeText = (contentType) => { + return contentType.length > 4 && contentType[4] === "/" && contentType[0] === "t" && contentType[1] === "e" && contentType[2] === "x" && contentType[3] === "t"; + }; + module2.exports = { + getResolveErrorBodyCallback, + isContentTypeApplicationJson, + isContentTypeText + }; + } +}); + +// node_modules/undici/lib/api/api-request.js +var require_api_request2 = __commonJS({ + "node_modules/undici/lib/api/api-request.js"(exports2, module2) { + "use strict"; + var assert = require("node:assert"); + var { Readable } = require_readable2(); + var { InvalidArgumentError, RequestAbortedError } = require_errors2(); + var util = require_util9(); + var { getResolveErrorBodyCallback } = require_util11(); + var { AsyncResource } = require("node:async_hooks"); + var RequestHandler = class extends AsyncResource { + constructor(opts, callback) { + if (!opts || typeof opts !== "object") { + throw new InvalidArgumentError("invalid opts"); + } + const { signal, method, opaque, body, onInfo, responseHeaders, throwOnError, highWaterMark } = opts; + try { + if (typeof callback !== "function") { + throw new InvalidArgumentError("invalid callback"); + } + if (highWaterMark && (typeof highWaterMark !== "number" || highWaterMark < 0)) { + throw new InvalidArgumentError("invalid highWaterMark"); + } + if (signal && typeof signal.on !== "function" && typeof signal.addEventListener !== "function") { + throw new InvalidArgumentError("signal must be an EventEmitter or EventTarget"); + } + if (method === "CONNECT") { + throw new InvalidArgumentError("invalid method"); + } + if (onInfo && typeof onInfo !== "function") { + throw new InvalidArgumentError("invalid onInfo callback"); + } + super("UNDICI_REQUEST"); + } catch (err) { + if (util.isStream(body)) { + util.destroy(body.on("error", util.nop), err); + } + throw err; + } + this.method = method; + this.responseHeaders = responseHeaders || null; + this.opaque = opaque || null; + this.callback = callback; + this.res = null; + this.abort = null; + this.body = body; + this.trailers = {}; + this.context = null; + this.onInfo = onInfo || null; + this.throwOnError = throwOnError; + this.highWaterMark = highWaterMark; + this.signal = signal; + this.reason = null; + this.removeAbortListener = null; + if (util.isStream(body)) { + body.on("error", (err) => { + this.onError(err); + }); + } + if (this.signal) { + if (this.signal.aborted) { + this.reason = this.signal.reason ?? new RequestAbortedError(); + } else { + this.removeAbortListener = util.addAbortListener(this.signal, () => { + this.reason = this.signal.reason ?? new RequestAbortedError(); + if (this.res) { + util.destroy(this.res, this.reason); + } else if (this.abort) { + this.abort(this.reason); + } + if (this.removeAbortListener) { + this.res?.off("close", this.removeAbortListener); + this.removeAbortListener(); + this.removeAbortListener = null; + } + }); + } + } + } + onConnect(abort, context) { + if (this.reason) { + abort(this.reason); + return; + } + assert(this.callback); + this.abort = abort; + this.context = context; + } + onHeaders(statusCode, rawHeaders, resume, statusMessage) { + const { callback, opaque, abort, context, responseHeaders, highWaterMark } = this; + const headers = responseHeaders === "raw" ? util.parseRawHeaders(rawHeaders) : util.parseHeaders(rawHeaders); + if (statusCode < 200) { + if (this.onInfo) { + this.onInfo({ statusCode, headers }); + } + return; + } + const parsedHeaders = responseHeaders === "raw" ? util.parseHeaders(rawHeaders) : headers; + const contentType = parsedHeaders["content-type"]; + const contentLength = parsedHeaders["content-length"]; + const res = new Readable({ + resume, + abort, + contentType, + contentLength: this.method !== "HEAD" && contentLength ? Number(contentLength) : null, + highWaterMark + }); + if (this.removeAbortListener) { + res.on("close", this.removeAbortListener); + } + this.callback = null; + this.res = res; + if (callback !== null) { + if (this.throwOnError && statusCode >= 400) { + this.runInAsyncScope( + getResolveErrorBodyCallback, + null, + { callback, body: res, contentType, statusCode, statusMessage, headers } + ); + } else { + this.runInAsyncScope(callback, null, null, { + statusCode, + headers, + trailers: this.trailers, + opaque, + body: res, + context + }); + } + } + } + onData(chunk) { + return this.res.push(chunk); + } + onComplete(trailers) { + util.parseHeaders(trailers, this.trailers); + this.res.push(null); + } + onError(err) { + const { res, callback, body, opaque } = this; + if (callback) { + this.callback = null; + queueMicrotask(() => { + this.runInAsyncScope(callback, null, err, { opaque }); + }); + } + if (res) { + this.res = null; + queueMicrotask(() => { + util.destroy(res, err); + }); + } + if (body) { + this.body = null; + util.destroy(body, err); + } + if (this.removeAbortListener) { + res?.off("close", this.removeAbortListener); + this.removeAbortListener(); + this.removeAbortListener = null; + } + } + }; + function request2(opts, callback) { + if (callback === void 0) { + return new Promise((resolve, reject) => { + request2.call(this, opts, (err, data) => { + return err ? reject(err) : resolve(data); + }); + }); + } + try { + this.dispatch(opts, new RequestHandler(opts, callback)); + } catch (err) { + if (typeof callback !== "function") { + throw err; + } + const opaque = opts?.opaque; + queueMicrotask(() => callback(err, { opaque })); + } + } + module2.exports = request2; + module2.exports.RequestHandler = RequestHandler; + } +}); + +// node_modules/undici/lib/api/abort-signal.js +var require_abort_signal2 = __commonJS({ + "node_modules/undici/lib/api/abort-signal.js"(exports2, module2) { + var { addAbortListener } = require_util9(); + var { RequestAbortedError } = require_errors2(); + var kListener = Symbol("kListener"); + var kSignal = Symbol("kSignal"); + function abort(self) { if (self.abort) { self.abort(self[kSignal]?.reason); } else { @@ -28116,8 +49363,8 @@ var require_api_stream2 = __commonJS({ var assert = require("node:assert"); var { finished, PassThrough } = require("node:stream"); var { InvalidArgumentError, InvalidReturnValueError } = require_errors2(); - var util = require_util8(); - var { getResolveErrorBodyCallback } = require_util10(); + var util = require_util9(); + var { getResolveErrorBodyCallback } = require_util11(); var { AsyncResource } = require("node:async_hooks"); var { addSignal, removeSignal } = require_abort_signal2(); var StreamHandler = class extends AsyncResource { @@ -28296,7 +49543,7 @@ var require_api_pipeline2 = __commonJS({ InvalidReturnValueError, RequestAbortedError } = require_errors2(); - var util = require_util8(); + var util = require_util9(); var { AsyncResource } = require("node:async_hooks"); var { addSignal, removeSignal } = require_abort_signal2(); var assert = require("node:assert"); @@ -28488,7 +49735,7 @@ var require_api_upgrade2 = __commonJS({ "use strict"; var { InvalidArgumentError, SocketError } = require_errors2(); var { AsyncResource } = require("node:async_hooks"); - var util = require_util8(); + var util = require_util9(); var { addSignal, removeSignal } = require_abort_signal2(); var assert = require("node:assert"); var UpgradeHandler = class extends AsyncResource { @@ -28581,7 +49828,7 @@ var require_api_connect2 = __commonJS({ var assert = require("node:assert"); var { AsyncResource } = require("node:async_hooks"); var { InvalidArgumentError, SocketError } = require_errors2(); - var util = require_util8(); + var util = require_util9(); var { addSignal, removeSignal } = require_abort_signal2(); var ConnectHandler = class extends AsyncResource { constructor(opts, callback) { @@ -28736,7 +49983,7 @@ var require_mock_utils2 = __commonJS({ kOrigin, kGetNetConnect } = require_mock_symbols2(); - var { buildURL } = require_util8(); + var { buildURL } = require_util9(); var { STATUS_CODES } = require("node:http"); var { types: { @@ -28835,23 +50082,23 @@ var require_mock_utils2 = __commonJS({ } function getMockDispatch(mockDispatches, key) { const basePath = key.query ? buildURL(key.path, key.query) : key.path; - const resolvedPath = typeof basePath === "string" ? safeUrl(basePath) : basePath; - let matchedMockDispatches = mockDispatches.filter(({ consumed }) => !consumed).filter(({ path }) => matchValue(safeUrl(path), resolvedPath)); + const resolvedPath2 = typeof basePath === "string" ? safeUrl(basePath) : basePath; + let matchedMockDispatches = mockDispatches.filter(({ consumed }) => !consumed).filter(({ path }) => matchValue(safeUrl(path), resolvedPath2)); if (matchedMockDispatches.length === 0) { - throw new MockNotMatchedError(`Mock dispatch not matched for path '${resolvedPath}'`); + throw new MockNotMatchedError(`Mock dispatch not matched for path '${resolvedPath2}'`); } matchedMockDispatches = matchedMockDispatches.filter(({ method }) => matchValue(method, key.method)); if (matchedMockDispatches.length === 0) { - throw new MockNotMatchedError(`Mock dispatch not matched for method '${key.method}' on path '${resolvedPath}'`); + throw new MockNotMatchedError(`Mock dispatch not matched for method '${key.method}' on path '${resolvedPath2}'`); } matchedMockDispatches = matchedMockDispatches.filter(({ body }) => typeof body !== "undefined" ? matchValue(body, key.body) : true); if (matchedMockDispatches.length === 0) { - throw new MockNotMatchedError(`Mock dispatch not matched for body '${key.body}' on path '${resolvedPath}'`); + throw new MockNotMatchedError(`Mock dispatch not matched for body '${key.body}' on path '${resolvedPath2}'`); } matchedMockDispatches = matchedMockDispatches.filter((mockDispatch2) => matchHeaders(mockDispatch2, key.headers)); if (matchedMockDispatches.length === 0) { const headers = typeof key.headers === "object" ? JSON.stringify(key.headers) : key.headers; - throw new MockNotMatchedError(`Mock dispatch not matched for headers '${headers}' on path '${resolvedPath}'`); + throw new MockNotMatchedError(`Mock dispatch not matched for headers '${headers}' on path '${resolvedPath2}'`); } return matchedMockDispatches[0]; } @@ -29030,7 +50277,7 @@ var require_mock_interceptor2 = __commonJS({ kMockDispatch } = require_mock_symbols2(); var { InvalidArgumentError } = require_errors2(); - var { buildURL } = require_util8(); + var { buildURL } = require_util9(); var MockScope = class { constructor(mockDispatch) { this[kMockDispatch] = mockDispatch; @@ -29611,7 +50858,7 @@ var require_retry3 = __commonJS({ var require_dump = __commonJS({ "node_modules/undici/lib/interceptor/dump.js"(exports2, module2) { "use strict"; - var util = require_util8(); + var util = require_util9(); var { InvalidArgumentError, RequestAbortedError } = require_errors2(); var DecoratorHandler = require_decorator_handler(); var DumpHandler = class extends DecoratorHandler { @@ -29710,12 +50957,12 @@ var require_headers2 = __commonJS({ "node_modules/undici/lib/web/fetch/headers.js"(exports2, module2) { "use strict"; var { kConstruct } = require_symbols6(); - var { kEnumerableProperty } = require_util8(); + var { kEnumerableProperty } = require_util9(); var { iteratorMixin, isValidHeaderName, isValidHeaderValue - } = require_util9(); + } = require_util10(); var { webidl } = require_webidl2(); var assert = require("node:assert"); var util = require("node:util"); @@ -29944,7 +51191,7 @@ var require_headers2 = __commonJS({ } } }; - var Headers = class _Headers { + var Headers2 = class _Headers { #guard; #headersList; constructor(init = void 0) { @@ -30093,13 +51340,13 @@ var require_headers2 = __commonJS({ o.#headersList = list; } }; - var { getHeadersGuard, setHeadersGuard, getHeadersList, setHeadersList } = Headers; - Reflect.deleteProperty(Headers, "getHeadersGuard"); - Reflect.deleteProperty(Headers, "setHeadersGuard"); - Reflect.deleteProperty(Headers, "getHeadersList"); - Reflect.deleteProperty(Headers, "setHeadersList"); - iteratorMixin("Headers", Headers, kHeadersSortedMap, 0, 1); - Object.defineProperties(Headers.prototype, { + var { getHeadersGuard, setHeadersGuard, getHeadersList, setHeadersList } = Headers2; + Reflect.deleteProperty(Headers2, "getHeadersGuard"); + Reflect.deleteProperty(Headers2, "setHeadersGuard"); + Reflect.deleteProperty(Headers2, "getHeadersList"); + Reflect.deleteProperty(Headers2, "setHeadersList"); + iteratorMixin("Headers", Headers2, kHeadersSortedMap, 0, 1); + Object.defineProperties(Headers2.prototype, { append: kEnumerableProperty, delete: kEnumerableProperty, get: kEnumerableProperty, @@ -30117,7 +51364,7 @@ var require_headers2 = __commonJS({ webidl.converters.HeadersInit = function(V, prefix, argument) { if (webidl.util.Type(V) === "Object") { const iterator = Reflect.get(V, Symbol.iterator); - if (!util.types.isProxy(V) && iterator === Headers.prototype.entries) { + if (!util.types.isProxy(V) && iterator === Headers2.prototype.entries) { try { return getHeadersList(V).entriesList; } catch { @@ -30138,7 +51385,7 @@ var require_headers2 = __commonJS({ fill, // for test. compareHeaderName, - Headers, + Headers: Headers2, HeadersList, getHeadersGuard, setHeadersGuard, @@ -30152,9 +51399,9 @@ var require_headers2 = __commonJS({ var require_response2 = __commonJS({ "node_modules/undici/lib/web/fetch/response.js"(exports2, module2) { "use strict"; - var { Headers, HeadersList, fill, getHeadersGuard, setHeadersGuard, setHeadersList } = require_headers2(); + var { Headers: Headers2, HeadersList, fill, getHeadersGuard, setHeadersGuard, setHeadersList } = require_headers2(); var { extractBody, cloneBody, mixinBody } = require_body2(); - var util = require_util8(); + var util = require_util9(); var nodeUtil = require("node:util"); var { kEnumerableProperty } = util; var { @@ -30166,7 +51413,7 @@ var require_response2 = __commonJS({ isErrorLike, isomorphicEncode, environmentSettingsObject: relevantRealm - } = require_util9(); + } = require_util10(); var { redirectStatusSet, nullBodyStatus @@ -30241,7 +51488,7 @@ var require_response2 = __commonJS({ } init = webidl.converters.ResponseInit(init); this[kState] = makeResponse({}); - this[kHeaders] = new Headers(kConstruct); + this[kHeaders] = new Headers2(kConstruct); setHeadersGuard(this[kHeaders], "response"); setHeadersList(this[kHeaders], this[kState].headersList); let bodyWithType = null; @@ -30482,7 +51729,7 @@ var require_response2 = __commonJS({ function fromInnerResponse(innerResponse, guard) { const response = new Response(kConstruct); response[kState] = innerResponse; - response[kHeaders] = new Headers(kConstruct); + response[kHeaders] = new Headers2(kConstruct); setHeadersList(response[kHeaders], innerResponse.headersList); setHeadersGuard(response[kHeaders], guard); if (hasFinalizationRegistry && innerResponse.body?.stream) { @@ -30602,17 +51849,15 @@ var require_request4 = __commonJS({ "node_modules/undici/lib/web/fetch/request.js"(exports2, module2) { "use strict"; var { extractBody, mixinBody, cloneBody } = require_body2(); - var { Headers, fill: fillHeaders, HeadersList, setHeadersGuard, getHeadersGuard, setHeadersList, getHeadersList } = require_headers2(); + var { Headers: Headers2, fill: fillHeaders, HeadersList, setHeadersGuard, getHeadersGuard, setHeadersList, getHeadersList } = require_headers2(); var { FinalizationRegistry: FinalizationRegistry2 } = require_dispatcher_weakref2()(); - var util = require_util8(); + var util = require_util9(); var nodeUtil = require("node:util"); var { isValidHTTPToken, sameOrigin, - normalizeMethod, - environmentSettingsObject, - normalizeMethodRecord - } = require_util9(); + environmentSettingsObject + } = require_util10(); var { forbiddenMethodsSet, corsSafeListedMethodsSet, @@ -30623,7 +51868,7 @@ var require_request4 = __commonJS({ requestCache, requestDuplex } = require_constants8(); - var { kEnumerableProperty } = util; + var { kEnumerableProperty, normalizedMethodRecordsBase, normalizedMethodRecords } = util; var { kHeaders, kSignal, kState, kDispatcher } = require_symbols7(); var { webidl } = require_webidl2(); var { URLSerializer } = require_data_url(); @@ -30660,7 +51905,7 @@ var require_request4 = __commonJS({ } } var patchMethodWarning = false; - var Request = class _Request { + var Request2 = class _Request { // https://fetch.spec.whatwg.org/#dom-request constructor(input, init = {}) { if (input === kConstruct) { @@ -30696,15 +51941,15 @@ var require_request4 = __commonJS({ signal = input[kSignal]; } const origin = environmentSettingsObject.settingsObject.origin; - let window = "client"; + let window2 = "client"; if (request2.window?.constructor?.name === "EnvironmentSettingsObject" && sameOrigin(request2.window, origin)) { - window = request2.window; + window2 = request2.window; } if (init.window != null) { - throw new TypeError(`'window' option '${window}' must be null`); + throw new TypeError(`'window' option '${window2}' must be null`); } if ("window" in init) { - window = "no-window"; + window2 = "no-window"; } request2 = makeRequest({ // URL request’s URL. @@ -30719,7 +51964,7 @@ var require_request4 = __commonJS({ // client This’s relevant settings object. client: environmentSettingsObject.settingsObject, // window window. - window, + window: window2, // priority request’s priority. priority: request2.priority, // origin request’s origin. The propagation of the origin is only significant for navigation requests @@ -30820,17 +52065,18 @@ var require_request4 = __commonJS({ } if (init.method !== void 0) { let method = init.method; - const mayBeNormalized = normalizeMethodRecord[method]; + const mayBeNormalized = normalizedMethodRecords[method]; if (mayBeNormalized !== void 0) { request2.method = mayBeNormalized; } else { if (!isValidHTTPToken(method)) { throw new TypeError(`'${method}' is not a valid HTTP method.`); } - if (forbiddenMethodsSet.has(method.toUpperCase())) { + const upperCase = method.toUpperCase(); + if (forbiddenMethodsSet.has(upperCase)) { throw new TypeError(`'${method}' HTTP method is unsupported.`); } - method = normalizeMethod(method); + method = normalizedMethodRecordsBase[upperCase] ?? method; request2.method = method; } if (!patchMethodWarning && request2.method === "patch") { @@ -30870,7 +52116,7 @@ var require_request4 = __commonJS({ requestFinalizer.register(ac, { signal, abort }, abort); } } - this[kHeaders] = new Headers(kConstruct); + this[kHeaders] = new Headers2(kConstruct); setHeadersList(this[kHeaders], request2.headersList); setHeadersGuard(this[kHeaders], "request"); if (mode === "no-cors") { @@ -31105,7 +52351,7 @@ var require_request4 = __commonJS({ return `Request ${nodeUtil.formatWithOptions(options, properties)}`; } }; - mixinBody(Request); + mixinBody(Request2); function makeRequest(init) { return { method: init.method ?? "GET", @@ -31156,15 +52402,15 @@ var require_request4 = __commonJS({ return newRequest; } function fromInnerRequest(innerRequest, signal, guard) { - const request2 = new Request(kConstruct); + const request2 = new Request2(kConstruct); request2[kState] = innerRequest; request2[kSignal] = signal; - request2[kHeaders] = new Headers(kConstruct); + request2[kHeaders] = new Headers2(kConstruct); setHeadersList(request2[kHeaders], innerRequest.headersList); setHeadersGuard(request2[kHeaders], guard); return request2; } - Object.defineProperties(Request.prototype, { + Object.defineProperties(Request2.prototype, { method: kEnumerableProperty, url: kEnumerableProperty, headers: kEnumerableProperty, @@ -31191,13 +52437,13 @@ var require_request4 = __commonJS({ } }); webidl.converters.Request = webidl.interfaceConverter( - Request + Request2 ); webidl.converters.RequestInfo = function(V, prefix, argument) { if (typeof V === "string") { return webidl.converters.USVString(V, prefix, argument); } - if (V instanceof Request) { + if (V instanceof Request2) { return webidl.converters.Request(V, prefix, argument); } return webidl.converters.USVString(V, prefix, argument); @@ -31288,7 +52534,7 @@ var require_request4 = __commonJS({ converter: webidl.converters.any } ]); - module2.exports = { Request, makeRequest, fromInnerRequest, cloneRequest }; + module2.exports = { Request: Request2, makeRequest, fromInnerRequest, cloneRequest }; } }); @@ -31304,7 +52550,7 @@ var require_fetch2 = __commonJS({ fromInnerResponse } = require_response2(); var { HeadersList } = require_headers2(); - var { Request, cloneRequest } = require_request4(); + var { Request: Request2, cloneRequest } = require_request4(); var zlib = require("node:zlib"); var { bytesMatch, @@ -31340,7 +52586,7 @@ var require_fetch2 = __commonJS({ buildContentRange, createInflate, extractMimeType - } = require_util9(); + } = require_util10(); var { kState, kDispatcher } = require_symbols7(); var assert = require("node:assert"); var { safelyExtractBody, extractBody } = require_body2(); @@ -31353,7 +52599,7 @@ var require_fetch2 = __commonJS({ } = require_constants8(); var EE = require("node:events"); var { Readable, pipeline, finished } = require("node:stream"); - var { addAbortListener, isErrored, isReadable, bufferToLowerCasedHeaderName } = require_util8(); + var { addAbortListener, isErrored, isReadable, bufferToLowerCasedHeaderName } = require_util9(); var { dataURLProcessor, serializeAMimeType, minimizeSupportedMimeType } = require_data_url(); var { getGlobalDispatcher } = require_global4(); var { webidl } = require_webidl2(); @@ -31394,12 +52640,12 @@ var require_fetch2 = __commonJS({ function handleFetchDone(response) { finalizeAndReportTiming(response, "fetch"); } - function fetch(input, init = void 0) { + function fetch2(input, init = void 0) { webidl.argumentLengthCheck(arguments, 1, "globalThis.fetch"); let p = createDeferredPromise(); let requestObject; try { - requestObject = new Request(input, init); + requestObject = new Request2(input, init); } catch (e) { p.reject(e); return p.promise; @@ -32340,7 +53586,7 @@ var require_fetch2 = __commonJS({ } } module2.exports = { - fetch, + fetch: fetch2, Fetch, fetching, finalizeAndReportTiming @@ -32718,7 +53964,7 @@ var require_encoding2 = __commonJS({ }); // node_modules/undici/lib/web/fileapi/util.js -var require_util11 = __commonJS({ +var require_util12 = __commonJS({ "node_modules/undici/lib/web/fileapi/util.js"(exports2, module2) { "use strict"; var { @@ -32733,7 +53979,7 @@ var require_util11 = __commonJS({ var { serializeAMimeType, parseMIMEType } = require_data_url(); var { types } = require("node:util"); var { StringDecoder } = require("string_decoder"); - var { btoa: btoa2 } = require("node:buffer"); + var { btoa } = require("node:buffer"); var staticPropertyDescriptors = { enumerable: true, writable: false, @@ -32825,9 +54071,9 @@ var require_util11 = __commonJS({ dataURL += ";base64,"; const decoder = new StringDecoder("latin1"); for (const chunk of bytes) { - dataURL += btoa2(decoder.write(chunk)); + dataURL += btoa(decoder.write(chunk)); } - dataURL += btoa2(decoder.end()); + dataURL += btoa(decoder.end()); return dataURL; } case "Text": { @@ -32910,7 +54156,7 @@ var require_filereader2 = __commonJS({ staticPropertyDescriptors, readOperation, fireAProgressEvent - } = require_util11(); + } = require_util12(); var { kState, kError, @@ -32919,8 +54165,8 @@ var require_filereader2 = __commonJS({ kAborted } = require_symbols8(); var { webidl } = require_webidl2(); - var { kEnumerableProperty } = require_util8(); - var FileReader = class _FileReader extends EventTarget { + var { kEnumerableProperty } = require_util9(); + var FileReader2 = class _FileReader extends EventTarget { constructor() { super(); this[kState] = "empty"; @@ -33122,10 +54368,10 @@ var require_filereader2 = __commonJS({ } } }; - FileReader.EMPTY = FileReader.prototype.EMPTY = 0; - FileReader.LOADING = FileReader.prototype.LOADING = 1; - FileReader.DONE = FileReader.prototype.DONE = 2; - Object.defineProperties(FileReader.prototype, { + FileReader2.EMPTY = FileReader2.prototype.EMPTY = 0; + FileReader2.LOADING = FileReader2.prototype.LOADING = 1; + FileReader2.DONE = FileReader2.prototype.DONE = 2; + Object.defineProperties(FileReader2.prototype, { EMPTY: staticPropertyDescriptors, LOADING: staticPropertyDescriptors, DONE: staticPropertyDescriptors, @@ -33150,13 +54396,13 @@ var require_filereader2 = __commonJS({ configurable: true } }); - Object.defineProperties(FileReader, { + Object.defineProperties(FileReader2, { EMPTY: staticPropertyDescriptors, LOADING: staticPropertyDescriptors, DONE: staticPropertyDescriptors }); module2.exports = { - FileReader + FileReader: FileReader2 }; } }); @@ -33172,12 +54418,12 @@ var require_symbols9 = __commonJS({ }); // node_modules/undici/lib/web/cache/util.js -var require_util12 = __commonJS({ +var require_util13 = __commonJS({ "node_modules/undici/lib/web/cache/util.js"(exports2, module2) { "use strict"; var assert = require("node:assert"); var { URLSerializer } = require_data_url(); - var { isValidHeaderName } = require_util9(); + var { isValidHeaderName } = require_util10(); function urlEquals(A, B, excludeFragment = false) { const serializedA = URLSerializer(A, excludeFragment); const serializedB = URLSerializer(B, excludeFragment); @@ -33206,14 +54452,14 @@ var require_cache2 = __commonJS({ "node_modules/undici/lib/web/cache/cache.js"(exports2, module2) { "use strict"; var { kConstruct } = require_symbols9(); - var { urlEquals, getFieldValues } = require_util12(); - var { kEnumerableProperty, isDisturbed } = require_util8(); + var { urlEquals, getFieldValues } = require_util13(); + var { kEnumerableProperty, isDisturbed } = require_util9(); var { webidl } = require_webidl2(); var { Response, cloneResponse, fromInnerResponse } = require_response2(); - var { Request, fromInnerRequest } = require_request4(); + var { Request: Request2, fromInnerRequest } = require_request4(); var { kState } = require_symbols7(); var { fetching } = require_fetch2(); - var { urlIsHttpHttpsScheme, createDeferredPromise, readAllBytes } = require_util9(); + var { urlIsHttpHttpsScheme, createDeferredPromise, readAllBytes } = require_util10(); var assert = require("node:assert"); var Cache = class _Cache { /** @@ -33283,7 +54529,7 @@ var require_cache2 = __commonJS({ } const fetchControllers = []; for (const request2 of requests) { - const r = new Request(request2)[kState]; + const r = new Request2(request2)[kState]; if (!urlIsHttpHttpsScheme(r.url)) { throw webidl.errors.exception({ header: prefix, @@ -33367,10 +54613,10 @@ var require_cache2 = __commonJS({ request2 = webidl.converters.RequestInfo(request2, prefix, "request"); response = webidl.converters.Response(response, prefix, "response"); let innerRequest = null; - if (request2 instanceof Request) { + if (request2 instanceof Request2) { innerRequest = request2[kState]; } else { - innerRequest = new Request(request2)[kState]; + innerRequest = new Request2(request2)[kState]; } if (!urlIsHttpHttpsScheme(innerRequest.url) || innerRequest.method !== "GET") { throw webidl.errors.exception({ @@ -33448,14 +54694,14 @@ var require_cache2 = __commonJS({ request2 = webidl.converters.RequestInfo(request2, prefix, "request"); options = webidl.converters.CacheQueryOptions(options, prefix, "options"); let r = null; - if (request2 instanceof Request) { + if (request2 instanceof Request2) { r = request2[kState]; if (r.method !== "GET" && !options.ignoreMethod) { return false; } } else { assert(typeof request2 === "string"); - r = new Request(request2)[kState]; + r = new Request2(request2)[kState]; } const operations = []; const operation = { @@ -33494,13 +54740,13 @@ var require_cache2 = __commonJS({ options = webidl.converters.CacheQueryOptions(options, prefix, "options"); let r = null; if (request2 !== void 0) { - if (request2 instanceof Request) { + if (request2 instanceof Request2) { r = request2[kState]; if (r.method !== "GET" && !options.ignoreMethod) { return []; } } else if (typeof request2 === "string") { - r = new Request(request2)[kState]; + r = new Request2(request2)[kState]; } } const promise = createDeferredPromise(); @@ -33666,13 +54912,13 @@ var require_cache2 = __commonJS({ #internalMatchAll(request2, options, maxResponses = Infinity) { let r = null; if (request2 !== void 0) { - if (request2 instanceof Request) { + if (request2 instanceof Request2) { r = request2[kState]; if (r.method !== "GET" && !options.ignoreMethod) { return []; } } else if (typeof request2 === "string") { - r = new Request(request2)[kState]; + r = new Request2(request2)[kState]; } } const responses = []; @@ -33752,7 +54998,7 @@ var require_cachestorage2 = __commonJS({ var { kConstruct } = require_symbols9(); var { Cache } = require_cache2(); var { webidl } = require_webidl2(); - var { kEnumerableProperty } = require_util8(); + var { kEnumerableProperty } = require_util9(); var CacheStorage = class _CacheStorage { /** * @see https://w3c.github.io/ServiceWorker/#dfn-relevant-name-to-cache-map @@ -33868,7 +55114,7 @@ var require_constants9 = __commonJS({ }); // node_modules/undici/lib/web/cookies/util.js -var require_util13 = __commonJS({ +var require_util14 = __commonJS({ "node_modules/undici/lib/web/cookies/util.js"(exports2, module2) { "use strict"; function isCTLExcludingHtab(value) { @@ -33978,7 +55224,7 @@ var require_util13 = __commonJS({ throw new Error("Invalid cookie max-age"); } } - function stringify2(cookie) { + function stringify3(cookie) { if (cookie.name.length === 0) { return null; } @@ -34032,7 +55278,7 @@ var require_util13 = __commonJS({ validateCookiePath, validateCookieValue, toIMFDate, - stringify: stringify2 + stringify: stringify3 }; } }); @@ -34042,7 +55288,7 @@ var require_parse2 = __commonJS({ "node_modules/undici/lib/web/cookies/parse.js"(exports2, module2) { "use strict"; var { maxNameValuePairSize, maxAttributeValueSize } = require_constants9(); - var { isCTLExcludingHtab } = require_util13(); + var { isCTLExcludingHtab } = require_util14(); var { collectASequenceOfCodePointsFast } = require_data_url(); var assert = require("node:assert"); function parseSetCookie(header) { @@ -34182,12 +55428,12 @@ var require_cookies2 = __commonJS({ "node_modules/undici/lib/web/cookies/index.js"(exports2, module2) { "use strict"; var { parseSetCookie } = require_parse2(); - var { stringify: stringify2 } = require_util13(); + var { stringify: stringify3 } = require_util14(); var { webidl } = require_webidl2(); - var { Headers } = require_headers2(); + var { Headers: Headers2 } = require_headers2(); function getCookies(headers) { webidl.argumentLengthCheck(arguments, 1, "getCookies"); - webidl.brandCheck(headers, Headers, { strict: false }); + webidl.brandCheck(headers, Headers2, { strict: false }); const cookie = headers.get("cookie"); const out = {}; if (!cookie) { @@ -34200,7 +55446,7 @@ var require_cookies2 = __commonJS({ return out; } function deleteCookie(headers, name, attributes) { - webidl.brandCheck(headers, Headers, { strict: false }); + webidl.brandCheck(headers, Headers2, { strict: false }); const prefix = "deleteCookie"; webidl.argumentLengthCheck(arguments, 2, prefix); name = webidl.converters.DOMString(name, prefix, "name"); @@ -34214,7 +55460,7 @@ var require_cookies2 = __commonJS({ } function getSetCookies(headers) { webidl.argumentLengthCheck(arguments, 1, "getSetCookies"); - webidl.brandCheck(headers, Headers, { strict: false }); + webidl.brandCheck(headers, Headers2, { strict: false }); const cookies = headers.getSetCookie(); if (!cookies) { return []; @@ -34223,9 +55469,9 @@ var require_cookies2 = __commonJS({ } function setCookie(headers, cookie) { webidl.argumentLengthCheck(arguments, 2, "setCookie"); - webidl.brandCheck(headers, Headers, { strict: false }); + webidl.brandCheck(headers, Headers2, { strict: false }); cookie = webidl.converters.Cookie(cookie); - const str = stringify2(cookie); + const str = stringify3(cookie); if (str) { headers.append("Set-Cookie", str); } @@ -34311,7 +55557,7 @@ var require_events2 = __commonJS({ "node_modules/undici/lib/web/websocket/events.js"(exports2, module2) { "use strict"; var { webidl } = require_webidl2(); - var { kEnumerableProperty } = require_util8(); + var { kEnumerableProperty } = require_util9(); var { kConstruct } = require_symbols6(); var { MessagePort } = require("node:worker_threads"); var MessageEvent = class _MessageEvent extends Event { @@ -34643,7 +55889,7 @@ var require_symbols10 = __commonJS({ }); // node_modules/undici/lib/web/websocket/util.js -var require_util14 = __commonJS({ +var require_util15 = __commonJS({ "node_modules/undici/lib/web/websocket/util.js"(exports2, module2) { "use strict"; var { kReadyState, kController, kResponse, kBinaryType, kWebSocketURL } = require_symbols10(); @@ -34817,13 +56063,13 @@ var require_frame2 = __commonJS({ "use strict"; var { maxUnsigned16Bit } = require_constants10(); var BUFFER_SIZE = 16386; - var crypto4; + var crypto8; var buffer = null; var bufIdx = BUFFER_SIZE; try { - crypto4 = require("node:crypto"); + crypto8 = require("node:crypto"); } catch { - crypto4 = { + crypto8 = { // not full compatibility, but minimum. randomFillSync: function randomFillSync(buffer2, _offset, _size) { for (let i = 0; i < buffer2.length; ++i) { @@ -34836,7 +56082,7 @@ var require_frame2 = __commonJS({ function generateMask() { if (bufIdx === BUFFER_SIZE) { bufIdx = 0; - crypto4.randomFillSync(buffer ??= Buffer.allocUnsafe(BUFFER_SIZE), 0, BUFFER_SIZE); + crypto8.randomFillSync(buffer ??= Buffer.allocUnsafe(BUFFER_SIZE), 0, BUFFER_SIZE); } return [buffer[bufIdx++], buffer[bufIdx++], buffer[bufIdx++], buffer[bufIdx++]]; } @@ -34900,17 +56146,17 @@ var require_connection2 = __commonJS({ kReceivedClose, kResponse } = require_symbols10(); - var { fireEvent, failWebsocketConnection, isClosing, isClosed, isEstablished, parseExtensions } = require_util14(); + var { fireEvent, failWebsocketConnection, isClosing, isClosed, isEstablished, parseExtensions } = require_util15(); var { channels } = require_diagnostics(); var { CloseEvent } = require_events2(); var { makeRequest } = require_request4(); var { fetching } = require_fetch2(); - var { Headers, getHeadersList } = require_headers2(); - var { getDecodeSplit } = require_util9(); + var { Headers: Headers2, getHeadersList } = require_headers2(); + var { getDecodeSplit } = require_util10(); var { WebsocketFrameSend } = require_frame2(); - var crypto4; + var crypto8; try { - crypto4 = require("node:crypto"); + crypto8 = require("node:crypto"); } catch { } function establishWebSocketConnection(url, protocols, client, ws, onEstablish, options) { @@ -34927,10 +56173,10 @@ var require_connection2 = __commonJS({ redirect: "error" }); if (options.headers) { - const headersList = getHeadersList(new Headers(options.headers)); + const headersList = getHeadersList(new Headers2(options.headers)); request2.headersList = headersList; } - const keyValue = crypto4.randomBytes(16).toString("base64"); + const keyValue = crypto8.randomBytes(16).toString("base64"); request2.headersList.append("sec-websocket-key", keyValue); request2.headersList.append("sec-websocket-version", "13"); for (const protocol of protocols) { @@ -34960,7 +56206,7 @@ var require_connection2 = __commonJS({ return; } const secWSAccept = response.headersList.get("Sec-WebSocket-Accept"); - const digest = crypto4.createHash("sha1").update(keyValue + uid).digest("base64"); + const digest = crypto8.createHash("sha1").update(keyValue + uid).digest("base64"); if (secWSAccept !== digest) { failWebsocketConnection(ws, "Incorrect hash received in Sec-WebSocket-Accept header."); return; @@ -35078,7 +56324,7 @@ var require_permessage_deflate = __commonJS({ "node_modules/undici/lib/web/websocket/permessage-deflate.js"(exports2, module2) { "use strict"; var { createInflateRaw, Z_DEFAULT_WINDOWBITS } = require("node:zlib"); - var { isValidClientWindowBits } = require_util14(); + var { isValidClientWindowBits } = require_util15(); var tail = Buffer.from([0, 0, 255, 255]); var kBuffer = Symbol("kBuffer"); var kLength = Symbol("kLength"); @@ -35146,7 +56392,7 @@ var require_receiver2 = __commonJS({ isControlFrame, isTextBinaryFrame, isContinuationFrame - } = require_util14(); + } = require_util15(); var { WebsocketFrameSend } = require_frame2(); var { closeWebSocketConnection } = require_connection2(); var { PerMessageDeflate } = require_permessage_deflate(); @@ -35521,7 +56767,7 @@ var require_websocket2 = __commonJS({ "use strict"; var { webidl } = require_webidl2(); var { URLSerializer } = require_data_url(); - var { environmentSettingsObject } = require_util9(); + var { environmentSettingsObject } = require_util10(); var { staticPropertyDescriptors, states, sentCloseFrameState, sendHints } = require_constants10(); var { kWebSocketURL, @@ -35538,15 +56784,14 @@ var require_websocket2 = __commonJS({ isClosing, isValidSubprotocol, fireEvent - } = require_util14(); + } = require_util15(); var { establishWebSocketConnection, closeWebSocketConnection } = require_connection2(); var { ByteParser } = require_receiver2(); - var { kEnumerableProperty, isBlobLike } = require_util8(); + var { kEnumerableProperty, isBlobLike } = require_util9(); var { getGlobalDispatcher } = require_global4(); var { types } = require("node:util"); var { ErrorEvent, CloseEvent } = require_events2(); var { SendQueue } = require_sender(); - var experimentalWarned = false; var WebSocket = class _WebSocket extends EventTarget { #events = { open: null, @@ -35567,12 +56812,6 @@ var require_websocket2 = __commonJS({ super(); const prefix = "WebSocket constructor"; webidl.argumentLengthCheck(arguments, 1, prefix); - if (!experimentalWarned) { - experimentalWarned = true; - process.emitWarning("WebSockets are experimental, expect them to change at any time.", { - code: "UNDICI-WS" - }); - } const options = webidl.converters["DOMString or sequence or WebSocketInit"](protocols, prefix, "options"); url = webidl.converters.USVString(url, prefix, "url"); protocols = options.protocols; @@ -35906,7 +57145,7 @@ var require_websocket2 = __commonJS({ }); // node_modules/undici/lib/web/eventsource/util.js -var require_util15 = __commonJS({ +var require_util16 = __commonJS({ "node_modules/undici/lib/web/eventsource/util.js"(exports2, module2) { "use strict"; function isValidLastEventId(value) { @@ -35937,7 +57176,7 @@ var require_eventsource_stream = __commonJS({ "node_modules/undici/lib/web/eventsource/eventsource-stream.js"(exports2, module2) { "use strict"; var { Transform } = require("node:stream"); - var { isASCIINumber, isValidLastEventId } = require_util15(); + var { isASCIINumber, isValidLastEventId } = require_util16(); var BOM = [239, 187, 191]; var LF = 10; var CR = 13; @@ -36070,3737 +57309,1361 @@ var require_eventsource_stream = __commonJS({ this.pos = 0; this.eventEndCheck = true; continue; - } - this.pos++; - } - callback(); - } - /** - * @param {Buffer} line - * @param {EventStreamEvent} event - */ - parseLine(line, event) { - if (line.length === 0) { - return; - } - const colonPosition = line.indexOf(COLON); - if (colonPosition === 0) { - return; - } - let field = ""; - let value = ""; - if (colonPosition !== -1) { - field = line.subarray(0, colonPosition).toString("utf8"); - let valueStart = colonPosition + 1; - if (line[valueStart] === SPACE) { - ++valueStart; - } - value = line.subarray(valueStart).toString("utf8"); - } else { - field = line.toString("utf8"); - value = ""; - } - switch (field) { - case "data": - if (event[field] === void 0) { - event[field] = value; - } else { - event[field] += ` -${value}`; - } - break; - case "retry": - if (isASCIINumber(value)) { - event[field] = value; - } - break; - case "id": - if (isValidLastEventId(value)) { - event[field] = value; - } - break; - case "event": - if (value.length > 0) { - event[field] = value; - } - break; - } - } - /** - * @param {EventSourceStreamEvent} event - */ - processEvent(event) { - if (event.retry && isASCIINumber(event.retry)) { - this.state.reconnectionTime = parseInt(event.retry, 10); - } - if (event.id && isValidLastEventId(event.id)) { - this.state.lastEventId = event.id; - } - if (event.data !== void 0) { - this.push({ - type: event.event || "message", - options: { - data: event.data, - lastEventId: this.state.lastEventId, - origin: this.state.origin - } - }); - } - } - clearEvent() { - this.event = { - data: void 0, - event: void 0, - id: void 0, - retry: void 0 - }; - } - }; - module2.exports = { - EventSourceStream - }; - } -}); - -// node_modules/undici/lib/web/eventsource/eventsource.js -var require_eventsource = __commonJS({ - "node_modules/undici/lib/web/eventsource/eventsource.js"(exports2, module2) { - "use strict"; - var { pipeline } = require("node:stream"); - var { fetching } = require_fetch2(); - var { makeRequest } = require_request4(); - var { webidl } = require_webidl2(); - var { EventSourceStream } = require_eventsource_stream(); - var { parseMIMEType } = require_data_url(); - var { createFastMessageEvent } = require_events2(); - var { isNetworkError: isNetworkError2 } = require_response2(); - var { delay } = require_util15(); - var { kEnumerableProperty } = require_util8(); - var { environmentSettingsObject } = require_util9(); - var experimentalWarned = false; - var defaultReconnectionTime = 3e3; - var CONNECTING = 0; - var OPEN = 1; - var CLOSED = 2; - var ANONYMOUS = "anonymous"; - var USE_CREDENTIALS = "use-credentials"; - var EventSource = class _EventSource extends EventTarget { - #events = { - open: null, - error: null, - message: null - }; - #url = null; - #withCredentials = false; - #readyState = CONNECTING; - #request = null; - #controller = null; - #dispatcher; - /** - * @type {import('./eventsource-stream').eventSourceSettings} - */ - #state; - /** - * Creates a new EventSource object. - * @param {string} url - * @param {EventSourceInit} [eventSourceInitDict] - * @see https://html.spec.whatwg.org/multipage/server-sent-events.html#the-eventsource-interface - */ - constructor(url, eventSourceInitDict = {}) { - super(); - const prefix = "EventSource constructor"; - webidl.argumentLengthCheck(arguments, 1, prefix); - if (!experimentalWarned) { - experimentalWarned = true; - process.emitWarning("EventSource is experimental, expect them to change at any time.", { - code: "UNDICI-ES" - }); - } - url = webidl.converters.USVString(url, prefix, "url"); - eventSourceInitDict = webidl.converters.EventSourceInitDict(eventSourceInitDict, prefix, "eventSourceInitDict"); - this.#dispatcher = eventSourceInitDict.dispatcher; - this.#state = { - lastEventId: "", - reconnectionTime: defaultReconnectionTime - }; - const settings = environmentSettingsObject; - let urlRecord; - try { - urlRecord = new URL(url, settings.settingsObject.baseUrl); - this.#state.origin = urlRecord.origin; - } catch (e) { - throw new DOMException(e, "SyntaxError"); - } - this.#url = urlRecord.href; - let corsAttributeState = ANONYMOUS; - if (eventSourceInitDict.withCredentials) { - corsAttributeState = USE_CREDENTIALS; - this.#withCredentials = true; - } - const initRequest = { - redirect: "follow", - keepalive: true, - // @see https://html.spec.whatwg.org/multipage/urls-and-fetching.html#cors-settings-attributes - mode: "cors", - credentials: corsAttributeState === "anonymous" ? "same-origin" : "omit", - referrer: "no-referrer" - }; - initRequest.client = environmentSettingsObject.settingsObject; - initRequest.headersList = [["accept", { name: "accept", value: "text/event-stream" }]]; - initRequest.cache = "no-store"; - initRequest.initiator = "other"; - initRequest.urlList = [new URL(this.#url)]; - this.#request = makeRequest(initRequest); - this.#connect(); - } - /** - * Returns the state of this EventSource object's connection. It can have the - * values described below. - * @returns {0|1|2} - * @readonly - */ - get readyState() { - return this.#readyState; - } - /** - * Returns the URL providing the event stream. - * @readonly - * @returns {string} - */ - get url() { - return this.#url; - } - /** - * Returns a boolean indicating whether the EventSource object was - * instantiated with CORS credentials set (true), or not (false, the default). - */ - get withCredentials() { - return this.#withCredentials; - } - #connect() { - if (this.#readyState === CLOSED) return; - this.#readyState = CONNECTING; - const fetchParams = { - request: this.#request, - dispatcher: this.#dispatcher - }; - const processEventSourceEndOfBody = (response) => { - if (isNetworkError2(response)) { - this.dispatchEvent(new Event("error")); - this.close(); - } - this.#reconnect(); - }; - fetchParams.processResponseEndOfBody = processEventSourceEndOfBody; - fetchParams.processResponse = (response) => { - if (isNetworkError2(response)) { - if (response.aborted) { - this.close(); - this.dispatchEvent(new Event("error")); - return; - } else { - this.#reconnect(); - return; - } - } - const contentType = response.headersList.get("content-type", true); - const mimeType = contentType !== null ? parseMIMEType(contentType) : "failure"; - const contentTypeValid = mimeType !== "failure" && mimeType.essence === "text/event-stream"; - if (response.status !== 200 || contentTypeValid === false) { - this.close(); - this.dispatchEvent(new Event("error")); - return; - } - this.#readyState = OPEN; - this.dispatchEvent(new Event("open")); - this.#state.origin = response.urlList[response.urlList.length - 1].origin; - const eventSourceStream = new EventSourceStream({ - eventSourceSettings: this.#state, - push: (event) => { - this.dispatchEvent(createFastMessageEvent( - event.type, - event.options - )); - } - }); - pipeline( - response.body.stream, - eventSourceStream, - (error) => { - if (error?.aborted === false) { - this.close(); - this.dispatchEvent(new Event("error")); - } - } - ); - }; - this.#controller = fetching(fetchParams); - } - /** - * @see https://html.spec.whatwg.org/multipage/server-sent-events.html#sse-processing-model - * @returns {Promise} - */ - async #reconnect() { - if (this.#readyState === CLOSED) return; - this.#readyState = CONNECTING; - this.dispatchEvent(new Event("error")); - await delay(this.#state.reconnectionTime); - if (this.#readyState !== CONNECTING) return; - if (this.#state.lastEventId.length) { - this.#request.headersList.set("last-event-id", this.#state.lastEventId, true); - } - this.#connect(); - } - /** - * Closes the connection, if any, and sets the readyState attribute to - * CLOSED. - */ - close() { - webidl.brandCheck(this, _EventSource); - if (this.#readyState === CLOSED) return; - this.#readyState = CLOSED; - this.#controller.abort(); - this.#request = null; - } - get onopen() { - return this.#events.open; - } - set onopen(fn) { - if (this.#events.open) { - this.removeEventListener("open", this.#events.open); - } - if (typeof fn === "function") { - this.#events.open = fn; - this.addEventListener("open", fn); - } else { - this.#events.open = null; + } + this.pos++; } + callback(); } - get onmessage() { - return this.#events.message; - } - set onmessage(fn) { - if (this.#events.message) { - this.removeEventListener("message", this.#events.message); + /** + * @param {Buffer} line + * @param {EventStreamEvent} event + */ + parseLine(line, event) { + if (line.length === 0) { + return; } - if (typeof fn === "function") { - this.#events.message = fn; - this.addEventListener("message", fn); + const colonPosition = line.indexOf(COLON); + if (colonPosition === 0) { + return; + } + let field = ""; + let value = ""; + if (colonPosition !== -1) { + field = line.subarray(0, colonPosition).toString("utf8"); + let valueStart = colonPosition + 1; + if (line[valueStart] === SPACE) { + ++valueStart; + } + value = line.subarray(valueStart).toString("utf8"); } else { - this.#events.message = null; + field = line.toString("utf8"); + value = ""; + } + switch (field) { + case "data": + if (event[field] === void 0) { + event[field] = value; + } else { + event[field] += ` +${value}`; + } + break; + case "retry": + if (isASCIINumber(value)) { + event[field] = value; + } + break; + case "id": + if (isValidLastEventId(value)) { + event[field] = value; + } + break; + case "event": + if (value.length > 0) { + event[field] = value; + } + break; } } - get onerror() { - return this.#events.error; - } - set onerror(fn) { - if (this.#events.error) { - this.removeEventListener("error", this.#events.error); + /** + * @param {EventSourceStreamEvent} event + */ + processEvent(event) { + if (event.retry && isASCIINumber(event.retry)) { + this.state.reconnectionTime = parseInt(event.retry, 10); } - if (typeof fn === "function") { - this.#events.error = fn; - this.addEventListener("error", fn); - } else { - this.#events.error = null; + if (event.id && isValidLastEventId(event.id)) { + this.state.lastEventId = event.id; + } + if (event.data !== void 0) { + this.push({ + type: event.event || "message", + options: { + data: event.data, + lastEventId: this.state.lastEventId, + origin: this.state.origin + } + }); } } - }; - var constantsPropertyDescriptors = { - CONNECTING: { - __proto__: null, - configurable: false, - enumerable: true, - value: CONNECTING, - writable: false - }, - OPEN: { - __proto__: null, - configurable: false, - enumerable: true, - value: OPEN, - writable: false - }, - CLOSED: { - __proto__: null, - configurable: false, - enumerable: true, - value: CLOSED, - writable: false + clearEvent() { + this.event = { + data: void 0, + event: void 0, + id: void 0, + retry: void 0 + }; } }; - Object.defineProperties(EventSource, constantsPropertyDescriptors); - Object.defineProperties(EventSource.prototype, constantsPropertyDescriptors); - Object.defineProperties(EventSource.prototype, { - close: kEnumerableProperty, - onerror: kEnumerableProperty, - onmessage: kEnumerableProperty, - onopen: kEnumerableProperty, - readyState: kEnumerableProperty, - url: kEnumerableProperty, - withCredentials: kEnumerableProperty - }); - webidl.converters.EventSourceInitDict = webidl.dictionaryConverter([ - { - key: "withCredentials", - converter: webidl.converters.boolean, - defaultValue: () => false - }, - { - key: "dispatcher", - // undici only - converter: webidl.converters.any - } - ]); module2.exports = { - EventSource, - defaultReconnectionTime + EventSourceStream }; } }); -// node_modules/undici/index.js -var require_undici2 = __commonJS({ - "node_modules/undici/index.js"(exports2, module2) { +// node_modules/undici/lib/web/eventsource/eventsource.js +var require_eventsource = __commonJS({ + "node_modules/undici/lib/web/eventsource/eventsource.js"(exports2, module2) { "use strict"; - var Client = require_client2(); - var Dispatcher = require_dispatcher2(); - var Pool = require_pool2(); - var BalancedPool = require_balanced_pool2(); - var Agent = require_agent2(); - var ProxyAgent2 = require_proxy_agent2(); - var EnvHttpProxyAgent = require_env_http_proxy_agent(); - var RetryAgent = require_retry_agent(); - var errors = require_errors2(); - var util = require_util8(); - var { InvalidArgumentError } = errors; - var api = require_api2(); - var buildConnector = require_connect2(); - var MockClient = require_mock_client2(); - var MockAgent = require_mock_agent2(); - var MockPool = require_mock_pool2(); - var mockErrors = require_mock_errors2(); - var RetryHandler = require_retry_handler(); - var { getGlobalDispatcher, setGlobalDispatcher } = require_global4(); - var DecoratorHandler = require_decorator_handler(); - var RedirectHandler = require_redirect_handler(); - var createRedirectInterceptor = require_redirect_interceptor(); - Object.assign(Dispatcher.prototype, api); - module2.exports.Dispatcher = Dispatcher; - module2.exports.Client = Client; - module2.exports.Pool = Pool; - module2.exports.BalancedPool = BalancedPool; - module2.exports.Agent = Agent; - module2.exports.ProxyAgent = ProxyAgent2; - module2.exports.EnvHttpProxyAgent = EnvHttpProxyAgent; - module2.exports.RetryAgent = RetryAgent; - module2.exports.RetryHandler = RetryHandler; - module2.exports.DecoratorHandler = DecoratorHandler; - module2.exports.RedirectHandler = RedirectHandler; - module2.exports.createRedirectInterceptor = createRedirectInterceptor; - module2.exports.interceptors = { - redirect: require_redirect(), - retry: require_retry3(), - dump: require_dump() - }; - module2.exports.buildConnector = buildConnector; - module2.exports.errors = errors; - module2.exports.util = { - parseHeaders: util.parseHeaders, - headerNameToString: util.headerNameToString - }; - function makeDispatcher(fn) { - return (url, opts, handler) => { - if (typeof opts === "function") { - handler = opts; - opts = null; - } - if (!url || typeof url !== "string" && typeof url !== "object" && !(url instanceof URL)) { - throw new InvalidArgumentError("invalid url"); - } - if (opts != null && typeof opts !== "object") { - throw new InvalidArgumentError("invalid opts"); - } - if (opts && opts.path != null) { - if (typeof opts.path !== "string") { - throw new InvalidArgumentError("invalid opts.path"); - } - let path = opts.path; - if (!opts.path.startsWith("/")) { - path = `/${path}`; - } - url = new URL(util.parseOrigin(url).origin + path); - } else { - if (!opts) { - opts = typeof url === "object" ? url : {}; - } - url = util.parseURL(url); - } - const { agent, dispatcher = getGlobalDispatcher() } = opts; - if (agent) { - throw new InvalidArgumentError("unsupported opts.agent. Did you mean opts.client?"); - } - return fn.call(dispatcher, { - ...opts, - origin: url.origin, - path: url.search ? `${url.pathname}${url.search}` : url.pathname, - method: opts.method || (opts.body ? "PUT" : "GET") - }, handler); + var { pipeline } = require("node:stream"); + var { fetching } = require_fetch2(); + var { makeRequest } = require_request4(); + var { webidl } = require_webidl2(); + var { EventSourceStream } = require_eventsource_stream(); + var { parseMIMEType } = require_data_url(); + var { createFastMessageEvent } = require_events2(); + var { isNetworkError: isNetworkError2 } = require_response2(); + var { delay } = require_util16(); + var { kEnumerableProperty } = require_util9(); + var { environmentSettingsObject } = require_util10(); + var experimentalWarned = false; + var defaultReconnectionTime = 3e3; + var CONNECTING = 0; + var OPEN = 1; + var CLOSED = 2; + var ANONYMOUS = "anonymous"; + var USE_CREDENTIALS = "use-credentials"; + var EventSource = class _EventSource extends EventTarget { + #events = { + open: null, + error: null, + message: null }; - } - module2.exports.setGlobalDispatcher = setGlobalDispatcher; - module2.exports.getGlobalDispatcher = getGlobalDispatcher; - var fetchImpl = require_fetch2().fetch; - module2.exports.fetch = async function fetch(init, options = void 0) { - try { - return await fetchImpl(init, options); - } catch (err) { - if (err && typeof err === "object") { - Error.captureStackTrace(err); - } - throw err; - } - }; - module2.exports.Headers = require_headers2().Headers; - module2.exports.Response = require_response2().Response; - module2.exports.Request = require_request4().Request; - module2.exports.FormData = require_formdata2().FormData; - module2.exports.File = globalThis.File ?? require("node:buffer").File; - module2.exports.FileReader = require_filereader2().FileReader; - var { setGlobalOrigin, getGlobalOrigin } = require_global3(); - module2.exports.setGlobalOrigin = setGlobalOrigin; - module2.exports.getGlobalOrigin = getGlobalOrigin; - var { CacheStorage } = require_cachestorage2(); - var { kConstruct } = require_symbols9(); - module2.exports.caches = new CacheStorage(kConstruct); - var { deleteCookie, getCookies, getSetCookies, setCookie } = require_cookies2(); - module2.exports.deleteCookie = deleteCookie; - module2.exports.getCookies = getCookies; - module2.exports.getSetCookies = getSetCookies; - module2.exports.setCookie = setCookie; - var { parseMIMEType, serializeAMimeType } = require_data_url(); - module2.exports.parseMIMEType = parseMIMEType; - module2.exports.serializeAMimeType = serializeAMimeType; - var { CloseEvent, ErrorEvent, MessageEvent } = require_events2(); - module2.exports.WebSocket = require_websocket2().WebSocket; - module2.exports.CloseEvent = CloseEvent; - module2.exports.ErrorEvent = ErrorEvent; - module2.exports.MessageEvent = MessageEvent; - module2.exports.request = makeDispatcher(api.request); - module2.exports.stream = makeDispatcher(api.stream); - module2.exports.pipeline = makeDispatcher(api.pipeline); - module2.exports.connect = makeDispatcher(api.connect); - module2.exports.upgrade = makeDispatcher(api.upgrade); - module2.exports.MockClient = MockClient; - module2.exports.MockPool = MockPool; - module2.exports.MockAgent = MockAgent; - module2.exports.mockErrors = mockErrors; - var { EventSource } = require_eventsource(); - module2.exports.EventSource = EventSource; - } -}); - -// main.js -var import_core2 = __toESM(require_core(), 1); - -// node_modules/universal-user-agent/index.js -function getUserAgent() { - if (typeof navigator === "object" && "userAgent" in navigator) { - return navigator.userAgent; - } - if (typeof process === "object" && process.version !== void 0) { - return `Node.js/${process.version.substr(1)} (${process.platform}; ${process.arch})`; - } - return ""; -} - -// node_modules/@octokit/endpoint/dist-bundle/index.js -var VERSION = "0.0.0-development"; -var userAgent = `octokit-endpoint.js/${VERSION} ${getUserAgent()}`; -var DEFAULTS = { - method: "GET", - baseUrl: "https://api.github.com", - headers: { - accept: "application/vnd.github.v3+json", - "user-agent": userAgent - }, - mediaType: { - format: "" - } -}; -function lowercaseKeys(object) { - if (!object) { - return {}; - } - return Object.keys(object).reduce((newObj, key) => { - newObj[key.toLowerCase()] = object[key]; - return newObj; - }, {}); -} -function isPlainObject(value) { - if (typeof value !== "object" || value === null) - return false; - if (Object.prototype.toString.call(value) !== "[object Object]") - return false; - const proto = Object.getPrototypeOf(value); - if (proto === null) - return true; - const Ctor = Object.prototype.hasOwnProperty.call(proto, "constructor") && proto.constructor; - return typeof Ctor === "function" && Ctor instanceof Ctor && Function.prototype.call(Ctor) === Function.prototype.call(value); -} -function mergeDeep(defaults, options) { - const result = Object.assign({}, defaults); - Object.keys(options).forEach((key) => { - if (isPlainObject(options[key])) { - if (!(key in defaults)) - Object.assign(result, { [key]: options[key] }); - else - result[key] = mergeDeep(defaults[key], options[key]); - } else { - Object.assign(result, { [key]: options[key] }); - } - }); - return result; -} -function removeUndefinedProperties(obj) { - for (const key in obj) { - if (obj[key] === void 0) { - delete obj[key]; - } - } - return obj; -} -function merge(defaults, route, options) { - if (typeof route === "string") { - let [method, url] = route.split(" "); - options = Object.assign(url ? { method, url } : { url: method }, options); - } else { - options = Object.assign({}, route); - } - options.headers = lowercaseKeys(options.headers); - removeUndefinedProperties(options); - removeUndefinedProperties(options.headers); - const mergedOptions = mergeDeep(defaults || {}, options); - if (options.url === "/graphql") { - if (defaults && defaults.mediaType.previews?.length) { - mergedOptions.mediaType.previews = defaults.mediaType.previews.filter( - (preview) => !mergedOptions.mediaType.previews.includes(preview) - ).concat(mergedOptions.mediaType.previews); - } - mergedOptions.mediaType.previews = (mergedOptions.mediaType.previews || []).map((preview) => preview.replace(/-preview/, "")); - } - return mergedOptions; -} -function addQueryParameters(url, parameters) { - const separator = /\?/.test(url) ? "&" : "?"; - const names = Object.keys(parameters); - if (names.length === 0) { - return url; - } - return url + separator + names.map((name) => { - if (name === "q") { - return "q=" + parameters.q.split("+").map(encodeURIComponent).join("+"); - } - return `${name}=${encodeURIComponent(parameters[name])}`; - }).join("&"); -} -var urlVariableRegex = /\{[^}]+\}/g; -function removeNonChars(variableName) { - return variableName.replace(/^\W+|\W+$/g, "").split(/,/); -} -function extractUrlVariableNames(url) { - const matches = url.match(urlVariableRegex); - if (!matches) { - return []; - } - return matches.map(removeNonChars).reduce((a, b) => a.concat(b), []); -} -function omit(object, keysToOmit) { - const result = { __proto__: null }; - for (const key of Object.keys(object)) { - if (keysToOmit.indexOf(key) === -1) { - result[key] = object[key]; - } - } - return result; -} -function encodeReserved(str) { - return str.split(/(%[0-9A-Fa-f]{2})/g).map(function(part) { - if (!/%[0-9A-Fa-f]/.test(part)) { - part = encodeURI(part).replace(/%5B/g, "[").replace(/%5D/g, "]"); - } - return part; - }).join(""); -} -function encodeUnreserved(str) { - return encodeURIComponent(str).replace(/[!'()*]/g, function(c) { - return "%" + c.charCodeAt(0).toString(16).toUpperCase(); - }); -} -function encodeValue(operator, value, key) { - value = operator === "+" || operator === "#" ? encodeReserved(value) : encodeUnreserved(value); - if (key) { - return encodeUnreserved(key) + "=" + value; - } else { - return value; - } -} -function isDefined(value) { - return value !== void 0 && value !== null; -} -function isKeyOperator(operator) { - return operator === ";" || operator === "&" || operator === "?"; -} -function getValues(context, operator, key, modifier) { - var value = context[key], result = []; - if (isDefined(value) && value !== "") { - if (typeof value === "string" || typeof value === "number" || typeof value === "boolean") { - value = value.toString(); - if (modifier && modifier !== "*") { - value = value.substring(0, parseInt(modifier, 10)); - } - result.push( - encodeValue(operator, value, isKeyOperator(operator) ? key : "") - ); - } else { - if (modifier === "*") { - if (Array.isArray(value)) { - value.filter(isDefined).forEach(function(value2) { - result.push( - encodeValue(operator, value2, isKeyOperator(operator) ? key : "") - ); - }); - } else { - Object.keys(value).forEach(function(k) { - if (isDefined(value[k])) { - result.push(encodeValue(operator, value[k], k)); - } - }); - } - } else { - const tmp = []; - if (Array.isArray(value)) { - value.filter(isDefined).forEach(function(value2) { - tmp.push(encodeValue(operator, value2)); - }); - } else { - Object.keys(value).forEach(function(k) { - if (isDefined(value[k])) { - tmp.push(encodeUnreserved(k)); - tmp.push(encodeValue(operator, value[k].toString())); - } + #url = null; + #withCredentials = false; + #readyState = CONNECTING; + #request = null; + #controller = null; + #dispatcher; + /** + * @type {import('./eventsource-stream').eventSourceSettings} + */ + #state; + /** + * Creates a new EventSource object. + * @param {string} url + * @param {EventSourceInit} [eventSourceInitDict] + * @see https://html.spec.whatwg.org/multipage/server-sent-events.html#the-eventsource-interface + */ + constructor(url, eventSourceInitDict = {}) { + super(); + const prefix = "EventSource constructor"; + webidl.argumentLengthCheck(arguments, 1, prefix); + if (!experimentalWarned) { + experimentalWarned = true; + process.emitWarning("EventSource is experimental, expect them to change at any time.", { + code: "UNDICI-ES" }); } - if (isKeyOperator(operator)) { - result.push(encodeUnreserved(key) + "=" + tmp.join(",")); - } else if (tmp.length !== 0) { - result.push(tmp.join(",")); + url = webidl.converters.USVString(url, prefix, "url"); + eventSourceInitDict = webidl.converters.EventSourceInitDict(eventSourceInitDict, prefix, "eventSourceInitDict"); + this.#dispatcher = eventSourceInitDict.dispatcher; + this.#state = { + lastEventId: "", + reconnectionTime: defaultReconnectionTime + }; + const settings = environmentSettingsObject; + let urlRecord; + try { + urlRecord = new URL(url, settings.settingsObject.baseUrl); + this.#state.origin = urlRecord.origin; + } catch (e) { + throw new DOMException(e, "SyntaxError"); + } + this.#url = urlRecord.href; + let corsAttributeState = ANONYMOUS; + if (eventSourceInitDict.withCredentials) { + corsAttributeState = USE_CREDENTIALS; + this.#withCredentials = true; } + const initRequest = { + redirect: "follow", + keepalive: true, + // @see https://html.spec.whatwg.org/multipage/urls-and-fetching.html#cors-settings-attributes + mode: "cors", + credentials: corsAttributeState === "anonymous" ? "same-origin" : "omit", + referrer: "no-referrer" + }; + initRequest.client = environmentSettingsObject.settingsObject; + initRequest.headersList = [["accept", { name: "accept", value: "text/event-stream" }]]; + initRequest.cache = "no-store"; + initRequest.initiator = "other"; + initRequest.urlList = [new URL(this.#url)]; + this.#request = makeRequest(initRequest); + this.#connect(); } - } - } else { - if (operator === ";") { - if (isDefined(value)) { - result.push(encodeUnreserved(key)); + /** + * Returns the state of this EventSource object's connection. It can have the + * values described below. + * @returns {0|1|2} + * @readonly + */ + get readyState() { + return this.#readyState; } - } else if (value === "" && (operator === "&" || operator === "?")) { - result.push(encodeUnreserved(key) + "="); - } else if (value === "") { - result.push(""); - } - } - return result; -} -function parseUrl(template) { - return { - expand: expand.bind(null, template) - }; -} -function expand(template, context) { - var operators = ["+", "#", ".", "/", ";", "?", "&"]; - template = template.replace( - /\{([^\{\}]+)\}|([^\{\}]+)/g, - function(_, expression, literal) { - if (expression) { - let operator = ""; - const values = []; - if (operators.indexOf(expression.charAt(0)) !== -1) { - operator = expression.charAt(0); - expression = expression.substr(1); - } - expression.split(/,/g).forEach(function(variable) { - var tmp = /([^:\*]*)(?::(\d+)|(\*))?/.exec(variable); - values.push(getValues(context, operator, tmp[1], tmp[2] || tmp[3])); - }); - if (operator && operator !== "+") { - var separator = ","; - if (operator === "?") { - separator = "&"; - } else if (operator !== "#") { - separator = operator; + /** + * Returns the URL providing the event stream. + * @readonly + * @returns {string} + */ + get url() { + return this.#url; + } + /** + * Returns a boolean indicating whether the EventSource object was + * instantiated with CORS credentials set (true), or not (false, the default). + */ + get withCredentials() { + return this.#withCredentials; + } + #connect() { + if (this.#readyState === CLOSED) return; + this.#readyState = CONNECTING; + const fetchParams = { + request: this.#request, + dispatcher: this.#dispatcher + }; + const processEventSourceEndOfBody = (response) => { + if (isNetworkError2(response)) { + this.dispatchEvent(new Event("error")); + this.close(); } - return (values.length !== 0 ? operator : "") + values.join(separator); - } else { - return values.join(","); + this.#reconnect(); + }; + fetchParams.processResponseEndOfBody = processEventSourceEndOfBody; + fetchParams.processResponse = (response) => { + if (isNetworkError2(response)) { + if (response.aborted) { + this.close(); + this.dispatchEvent(new Event("error")); + return; + } else { + this.#reconnect(); + return; + } + } + const contentType = response.headersList.get("content-type", true); + const mimeType = contentType !== null ? parseMIMEType(contentType) : "failure"; + const contentTypeValid = mimeType !== "failure" && mimeType.essence === "text/event-stream"; + if (response.status !== 200 || contentTypeValid === false) { + this.close(); + this.dispatchEvent(new Event("error")); + return; + } + this.#readyState = OPEN; + this.dispatchEvent(new Event("open")); + this.#state.origin = response.urlList[response.urlList.length - 1].origin; + const eventSourceStream = new EventSourceStream({ + eventSourceSettings: this.#state, + push: (event) => { + this.dispatchEvent(createFastMessageEvent( + event.type, + event.options + )); + } + }); + pipeline( + response.body.stream, + eventSourceStream, + (error) => { + if (error?.aborted === false) { + this.close(); + this.dispatchEvent(new Event("error")); + } + } + ); + }; + this.#controller = fetching(fetchParams); + } + /** + * @see https://html.spec.whatwg.org/multipage/server-sent-events.html#sse-processing-model + * @returns {Promise} + */ + async #reconnect() { + if (this.#readyState === CLOSED) return; + this.#readyState = CONNECTING; + this.dispatchEvent(new Event("error")); + await delay(this.#state.reconnectionTime); + if (this.#readyState !== CONNECTING) return; + if (this.#state.lastEventId.length) { + this.#request.headersList.set("last-event-id", this.#state.lastEventId, true); } - } else { - return encodeReserved(literal); + this.#connect(); } - } - ); - if (template === "/") { - return template; - } else { - return template.replace(/\/$/, ""); - } -} -function parse2(options) { - let method = options.method.toUpperCase(); - let url = (options.url || "/").replace(/:([a-z]\w+)/g, "{$1}"); - let headers = Object.assign({}, options.headers); - let body; - let parameters = omit(options, [ - "method", - "baseUrl", - "url", - "headers", - "request", - "mediaType" - ]); - const urlVariableNames = extractUrlVariableNames(url); - url = parseUrl(url).expand(parameters); - if (!/^http/.test(url)) { - url = options.baseUrl + url; - } - const omittedParameters = Object.keys(options).filter((option) => urlVariableNames.includes(option)).concat("baseUrl"); - const remainingParameters = omit(parameters, omittedParameters); - const isBinaryRequest = /application\/octet-stream/i.test(headers.accept); - if (!isBinaryRequest) { - if (options.mediaType.format) { - headers.accept = headers.accept.split(/,/).map( - (format) => format.replace( - /application\/vnd(\.\w+)(\.v3)?(\.\w+)?(\+json)?$/, - `application/vnd$1$2.${options.mediaType.format}` - ) - ).join(","); - } - if (url.endsWith("/graphql")) { - if (options.mediaType.previews?.length) { - const previewsFromAcceptHeader = headers.accept.match(/[\w-]+(?=-preview)/g) || []; - headers.accept = previewsFromAcceptHeader.concat(options.mediaType.previews).map((preview) => { - const format = options.mediaType.format ? `.${options.mediaType.format}` : "+json"; - return `application/vnd.github.${preview}-preview${format}`; - }).join(","); + /** + * Closes the connection, if any, and sets the readyState attribute to + * CLOSED. + */ + close() { + webidl.brandCheck(this, _EventSource); + if (this.#readyState === CLOSED) return; + this.#readyState = CLOSED; + this.#controller.abort(); + this.#request = null; } - } - } - if (["GET", "HEAD"].includes(method)) { - url = addQueryParameters(url, remainingParameters); - } else { - if ("data" in remainingParameters) { - body = remainingParameters.data; - } else { - if (Object.keys(remainingParameters).length) { - body = remainingParameters; + get onopen() { + return this.#events.open; } - } - } - if (!headers["content-type"] && typeof body !== "undefined") { - headers["content-type"] = "application/json; charset=utf-8"; - } - if (["PATCH", "PUT"].includes(method) && typeof body === "undefined") { - body = ""; - } - return Object.assign( - { method, url, headers }, - typeof body !== "undefined" ? { body } : null, - options.request ? { request: options.request } : null - ); -} -function endpointWithDefaults(defaults, route, options) { - return parse2(merge(defaults, route, options)); -} -function withDefaults(oldDefaults, newDefaults) { - const DEFAULTS2 = merge(oldDefaults, newDefaults); - const endpoint2 = endpointWithDefaults.bind(null, DEFAULTS2); - return Object.assign(endpoint2, { - DEFAULTS: DEFAULTS2, - defaults: withDefaults.bind(null, DEFAULTS2), - merge: merge.bind(null, DEFAULTS2), - parse: parse2 - }); -} -var endpoint = withDefaults(null, DEFAULTS); - -// node_modules/@octokit/request-error/dist-src/index.js -var RequestError = class extends Error { - name; - /** - * http status code - */ - status; - /** - * Request options that lead to the error. - */ - request; - /** - * Response object if a response was received - */ - response; - constructor(message, statusCode, options) { - super(message); - if (Error.captureStackTrace) { - Error.captureStackTrace(this, this.constructor); - } - this.name = "HttpError"; - this.status = statusCode; - if ("response" in options) { - this.response = options.response; - } - const requestCopy = Object.assign({}, options.request); - if (options.request.headers.authorization) { - requestCopy.headers = Object.assign({}, options.request.headers, { - authorization: options.request.headers.authorization.replace( - / .*$/, - " [REDACTED]" - ) - }); - } - requestCopy.url = requestCopy.url.replace(/\bclient_secret=\w+/g, "client_secret=[REDACTED]").replace(/\baccess_token=\w+/g, "access_token=[REDACTED]"); - this.request = requestCopy; - } -}; - -// node_modules/@octokit/request/dist-bundle/index.js -var VERSION2 = "0.0.0-development"; -function isPlainObject2(value) { - if (typeof value !== "object" || value === null) - return false; - if (Object.prototype.toString.call(value) !== "[object Object]") - return false; - const proto = Object.getPrototypeOf(value); - if (proto === null) - return true; - const Ctor = Object.prototype.hasOwnProperty.call(proto, "constructor") && proto.constructor; - return typeof Ctor === "function" && Ctor instanceof Ctor && Function.prototype.call(Ctor) === Function.prototype.call(value); -} -function getBufferResponse(response) { - return response.arrayBuffer(); -} -function fetchWrapper(requestOptions) { - const log = requestOptions.request && requestOptions.request.log ? requestOptions.request.log : console; - const parseSuccessResponseBody = requestOptions.request?.parseSuccessResponseBody !== false; - if (isPlainObject2(requestOptions.body) || Array.isArray(requestOptions.body)) { - requestOptions.body = JSON.stringify(requestOptions.body); - } - let headers = {}; - let status; - let url; - let { fetch } = globalThis; - if (requestOptions.request?.fetch) { - fetch = requestOptions.request.fetch; - } - if (!fetch) { - throw new Error( - "fetch is not set. Please pass a fetch implementation as new Octokit({ request: { fetch }}). Learn more at https://github.com/octokit/octokit.js/#fetch-missing" - ); - } - return fetch(requestOptions.url, { - method: requestOptions.method, - body: requestOptions.body, - redirect: requestOptions.request?.redirect, - // Header values must be `string` - headers: Object.fromEntries( - Object.entries(requestOptions.headers).map(([name, value]) => [ - name, - String(value) - ]) - ), - signal: requestOptions.request?.signal, - // duplex must be set if request.body is ReadableStream or Async Iterables. - // See https://fetch.spec.whatwg.org/#dom-requestinit-duplex. - ...requestOptions.body && { duplex: "half" } - }).then(async (response) => { - url = response.url; - status = response.status; - for (const keyAndValue of response.headers) { - headers[keyAndValue[0]] = keyAndValue[1]; - } - if ("deprecation" in headers) { - const matches = headers.link && headers.link.match(/<([^>]+)>; rel="deprecation"/); - const deprecationLink = matches && matches.pop(); - log.warn( - `[@octokit/request] "${requestOptions.method} ${requestOptions.url}" is deprecated. It is scheduled to be removed on ${headers.sunset}${deprecationLink ? `. See ${deprecationLink}` : ""}` - ); - } - if (status === 204 || status === 205) { - return; - } - if (requestOptions.method === "HEAD") { - if (status < 400) { - return; + set onopen(fn) { + if (this.#events.open) { + this.removeEventListener("open", this.#events.open); + } + if (typeof fn === "function") { + this.#events.open = fn; + this.addEventListener("open", fn); + } else { + this.#events.open = null; + } } - throw new RequestError(response.statusText, status, { - response: { - url, - status, - headers, - data: void 0 - }, - request: requestOptions - }); - } - if (status === 304) { - throw new RequestError("Not modified", status, { - response: { - url, - status, - headers, - data: await getResponseData(response) - }, - request: requestOptions - }); - } - if (status >= 400) { - const data = await getResponseData(response); - const error = new RequestError(toErrorMessage(data), status, { - response: { - url, - status, - headers, - data - }, - request: requestOptions - }); - throw error; - } - return parseSuccessResponseBody ? await getResponseData(response) : response.body; - }).then((data) => { - return { - status, - url, - headers, - data - }; - }).catch((error) => { - if (error instanceof RequestError) - throw error; - else if (error.name === "AbortError") - throw error; - let message = error.message; - if (error.name === "TypeError" && "cause" in error) { - if (error.cause instanceof Error) { - message = error.cause.message; - } else if (typeof error.cause === "string") { - message = error.cause; + get onmessage() { + return this.#events.message; } - } - throw new RequestError(message, 500, { - request: requestOptions - }); - }); -} -async function getResponseData(response) { - const contentType = response.headers.get("content-type"); - if (/application\/json/.test(contentType)) { - return response.json().catch(() => response.text()).catch(() => ""); - } - if (!contentType || /^text\/|charset=utf-8$/.test(contentType)) { - return response.text(); - } - return getBufferResponse(response); -} -function toErrorMessage(data) { - if (typeof data === "string") - return data; - let suffix; - if ("documentation_url" in data) { - suffix = ` - ${data.documentation_url}`; - } else { - suffix = ""; - } - if ("message" in data) { - if (Array.isArray(data.errors)) { - return `${data.message}: ${data.errors.map(JSON.stringify).join(", ")}${suffix}`; - } - return `${data.message}${suffix}`; - } - return `Unknown error: ${JSON.stringify(data)}`; -} -function withDefaults2(oldEndpoint, newDefaults) { - const endpoint2 = oldEndpoint.defaults(newDefaults); - const newApi = function(route, parameters) { - const endpointOptions = endpoint2.merge(route, parameters); - if (!endpointOptions.request || !endpointOptions.request.hook) { - return fetchWrapper(endpoint2.parse(endpointOptions)); - } - const request2 = (route2, parameters2) => { - return fetchWrapper( - endpoint2.parse(endpoint2.merge(route2, parameters2)) - ); - }; - Object.assign(request2, { - endpoint: endpoint2, - defaults: withDefaults2.bind(null, endpoint2) - }); - return endpointOptions.request.hook(request2, endpointOptions); - }; - return Object.assign(newApi, { - endpoint: endpoint2, - defaults: withDefaults2.bind(null, endpoint2) - }); -} -var request = withDefaults2(endpoint, { - headers: { - "user-agent": `octokit-request.js/${VERSION2} ${getUserAgent()}` - } -}); - -// node_modules/@octokit/oauth-methods/dist-bundle/index.js -function requestToOAuthBaseUrl(request2) { - const endpointDefaults = request2.endpoint.DEFAULTS; - return /^https:\/\/(api\.)?github\.com$/.test(endpointDefaults.baseUrl) ? "https://github.com" : endpointDefaults.baseUrl.replace("/api/v3", ""); -} -async function oauthRequest(request2, route, parameters) { - const withOAuthParameters = { - baseUrl: requestToOAuthBaseUrl(request2), - headers: { - accept: "application/json" - }, - ...parameters - }; - const response = await request2(route, withOAuthParameters); - if ("error" in response.data) { - const error = new RequestError( - `${response.data.error_description} (${response.data.error}, ${response.data.error_uri})`, - 400, - { - request: request2.endpoint.merge( - route, - withOAuthParameters - ) + set onmessage(fn) { + if (this.#events.message) { + this.removeEventListener("message", this.#events.message); + } + if (typeof fn === "function") { + this.#events.message = fn; + this.addEventListener("message", fn); + } else { + this.#events.message = null; + } } - ); - error.response = response; - throw error; - } - return response; -} -async function exchangeWebFlowCode(options) { - const request2 = options.request || /* istanbul ignore next: we always pass a custom request in tests */ - request; - const response = await oauthRequest( - request2, - "POST /login/oauth/access_token", - { - client_id: options.clientId, - client_secret: options.clientSecret, - code: options.code, - redirect_uri: options.redirectUrl - } - ); - const authentication = { - clientType: options.clientType, - clientId: options.clientId, - clientSecret: options.clientSecret, - token: response.data.access_token, - scopes: response.data.scope.split(/\s+/).filter(Boolean) - }; - if (options.clientType === "github-app") { - if ("refresh_token" in response.data) { - const apiTimeInMs = new Date(response.headers.date).getTime(); - authentication.refreshToken = response.data.refresh_token, authentication.expiresAt = toTimestamp( - apiTimeInMs, - response.data.expires_in - ), authentication.refreshTokenExpiresAt = toTimestamp( - apiTimeInMs, - response.data.refresh_token_expires_in - ); - } - delete authentication.scopes; - } - return { ...response, authentication }; -} -function toTimestamp(apiTimeInMs, expirationInSeconds) { - return new Date(apiTimeInMs + expirationInSeconds * 1e3).toISOString(); -} -async function createDeviceCode(options) { - const request2 = options.request || /* istanbul ignore next: we always pass a custom request in tests */ - request; - const parameters = { - client_id: options.clientId - }; - if ("scopes" in options && Array.isArray(options.scopes)) { - parameters.scope = options.scopes.join(" "); - } - return oauthRequest(request2, "POST /login/device/code", parameters); -} -async function exchangeDeviceCode(options) { - const request2 = options.request || /* istanbul ignore next: we always pass a custom request in tests */ - request; - const response = await oauthRequest( - request2, - "POST /login/oauth/access_token", - { - client_id: options.clientId, - device_code: options.code, - grant_type: "urn:ietf:params:oauth:grant-type:device_code" - } - ); - const authentication = { - clientType: options.clientType, - clientId: options.clientId, - token: response.data.access_token, - scopes: response.data.scope.split(/\s+/).filter(Boolean) - }; - if ("clientSecret" in options) { - authentication.clientSecret = options.clientSecret; - } - if (options.clientType === "github-app") { - if ("refresh_token" in response.data) { - const apiTimeInMs = new Date(response.headers.date).getTime(); - authentication.refreshToken = response.data.refresh_token, authentication.expiresAt = toTimestamp2( - apiTimeInMs, - response.data.expires_in - ), authentication.refreshTokenExpiresAt = toTimestamp2( - apiTimeInMs, - response.data.refresh_token_expires_in - ); - } - delete authentication.scopes; - } - return { ...response, authentication }; -} -function toTimestamp2(apiTimeInMs, expirationInSeconds) { - return new Date(apiTimeInMs + expirationInSeconds * 1e3).toISOString(); -} -async function checkToken(options) { - const request2 = options.request || /* istanbul ignore next: we always pass a custom request in tests */ - request; - const response = await request2("POST /applications/{client_id}/token", { - headers: { - authorization: `basic ${btoa( - `${options.clientId}:${options.clientSecret}` - )}` - }, - client_id: options.clientId, - access_token: options.token - }); - const authentication = { - clientType: options.clientType, - clientId: options.clientId, - clientSecret: options.clientSecret, - token: options.token, - scopes: response.data.scopes - }; - if (response.data.expires_at) - authentication.expiresAt = response.data.expires_at; - if (options.clientType === "github-app") { - delete authentication.scopes; - } - return { ...response, authentication }; -} -async function refreshToken(options) { - const request2 = options.request || /* istanbul ignore next: we always pass a custom request in tests */ - request; - const response = await oauthRequest( - request2, - "POST /login/oauth/access_token", - { - client_id: options.clientId, - client_secret: options.clientSecret, - grant_type: "refresh_token", - refresh_token: options.refreshToken - } - ); - const apiTimeInMs = new Date(response.headers.date).getTime(); - const authentication = { - clientType: "github-app", - clientId: options.clientId, - clientSecret: options.clientSecret, - token: response.data.access_token, - refreshToken: response.data.refresh_token, - expiresAt: toTimestamp3(apiTimeInMs, response.data.expires_in), - refreshTokenExpiresAt: toTimestamp3( - apiTimeInMs, - response.data.refresh_token_expires_in - ) - }; - return { ...response, authentication }; -} -function toTimestamp3(apiTimeInMs, expirationInSeconds) { - return new Date(apiTimeInMs + expirationInSeconds * 1e3).toISOString(); -} -async function resetToken(options) { - const request2 = options.request || /* istanbul ignore next: we always pass a custom request in tests */ - request; - const auth5 = btoa(`${options.clientId}:${options.clientSecret}`); - const response = await request2( - "PATCH /applications/{client_id}/token", - { - headers: { - authorization: `basic ${auth5}` - }, - client_id: options.clientId, - access_token: options.token - } - ); - const authentication = { - clientType: options.clientType, - clientId: options.clientId, - clientSecret: options.clientSecret, - token: response.data.token, - scopes: response.data.scopes - }; - if (response.data.expires_at) - authentication.expiresAt = response.data.expires_at; - if (options.clientType === "github-app") { - delete authentication.scopes; - } - return { ...response, authentication }; -} -async function deleteToken(options) { - const request2 = options.request || /* istanbul ignore next: we always pass a custom request in tests */ - request; - const auth5 = btoa(`${options.clientId}:${options.clientSecret}`); - return request2( - "DELETE /applications/{client_id}/token", - { - headers: { - authorization: `basic ${auth5}` + get onerror() { + return this.#events.error; + } + set onerror(fn) { + if (this.#events.error) { + this.removeEventListener("error", this.#events.error); + } + if (typeof fn === "function") { + this.#events.error = fn; + this.addEventListener("error", fn); + } else { + this.#events.error = null; + } + } + }; + var constantsPropertyDescriptors = { + CONNECTING: { + __proto__: null, + configurable: false, + enumerable: true, + value: CONNECTING, + writable: false }, - client_id: options.clientId, - access_token: options.token - } - ); -} -async function deleteAuthorization(options) { - const request2 = options.request || /* istanbul ignore next: we always pass a custom request in tests */ - request; - const auth5 = btoa(`${options.clientId}:${options.clientSecret}`); - return request2( - "DELETE /applications/{client_id}/grant", - { - headers: { - authorization: `basic ${auth5}` + OPEN: { + __proto__: null, + configurable: false, + enumerable: true, + value: OPEN, + writable: false }, - client_id: options.clientId, - access_token: options.token - } - ); -} - -// node_modules/@octokit/auth-oauth-device/dist-bundle/index.js -async function getOAuthAccessToken(state, options) { - const cachedAuthentication = getCachedAuthentication(state, options.auth); - if (cachedAuthentication) - return cachedAuthentication; - const { data: verification } = await createDeviceCode({ - clientType: state.clientType, - clientId: state.clientId, - request: options.request || state.request, - // @ts-expect-error the extra code to make TS happy is not worth it - scopes: options.auth.scopes || state.scopes - }); - await state.onVerification(verification); - const authentication = await waitForAccessToken( - options.request || state.request, - state.clientId, - state.clientType, - verification - ); - state.authentication = authentication; - return authentication; -} -function getCachedAuthentication(state, auth22) { - if (auth22.refresh === true) - return false; - if (!state.authentication) - return false; - if (state.clientType === "github-app") { - return state.authentication; - } - const authentication = state.authentication; - const newScope = ("scopes" in auth22 && auth22.scopes || state.scopes).join( - " " - ); - const currentScope = authentication.scopes.join(" "); - return newScope === currentScope ? authentication : false; -} -async function wait(seconds) { - await new Promise((resolve) => setTimeout(resolve, seconds * 1e3)); -} -async function waitForAccessToken(request2, clientId, clientType, verification) { - try { - const options = { - clientId, - request: request2, - code: verification.device_code + CLOSED: { + __proto__: null, + configurable: false, + enumerable: true, + value: CLOSED, + writable: false + } }; - const { authentication } = clientType === "oauth-app" ? await exchangeDeviceCode({ - ...options, - clientType: "oauth-app" - }) : await exchangeDeviceCode({ - ...options, - clientType: "github-app" + Object.defineProperties(EventSource, constantsPropertyDescriptors); + Object.defineProperties(EventSource.prototype, constantsPropertyDescriptors); + Object.defineProperties(EventSource.prototype, { + close: kEnumerableProperty, + onerror: kEnumerableProperty, + onmessage: kEnumerableProperty, + onopen: kEnumerableProperty, + readyState: kEnumerableProperty, + url: kEnumerableProperty, + withCredentials: kEnumerableProperty }); - return { - type: "token", - tokenType: "oauth", - ...authentication + webidl.converters.EventSourceInitDict = webidl.dictionaryConverter([ + { + key: "withCredentials", + converter: webidl.converters.boolean, + defaultValue: () => false + }, + { + key: "dispatcher", + // undici only + converter: webidl.converters.any + } + ]); + module2.exports = { + EventSource, + defaultReconnectionTime }; - } catch (error) { - if (!error.response) - throw error; - const errorType = error.response.data.error; - if (errorType === "authorization_pending") { - await wait(verification.interval); - return waitForAccessToken(request2, clientId, clientType, verification); - } - if (errorType === "slow_down") { - await wait(verification.interval + 5); - return waitForAccessToken(request2, clientId, clientType, verification); - } - throw error; - } -} -async function auth(state, authOptions) { - return getOAuthAccessToken(state, { - auth: authOptions - }); -} -async function hook(state, request2, route, parameters) { - let endpoint2 = request2.endpoint.merge( - route, - parameters - ); - if (/\/login\/(oauth\/access_token|device\/code)$/.test(endpoint2.url)) { - return request2(endpoint2); - } - const { token } = await getOAuthAccessToken(state, { - request: request2, - auth: { type: "oauth" } - }); - endpoint2.headers.authorization = `token ${token}`; - return request2(endpoint2); -} -var VERSION3 = "0.0.0-development"; -function createOAuthDeviceAuth(options) { - const requestWithDefaults = options.request || request.defaults({ - headers: { - "user-agent": `octokit-auth-oauth-device.js/${VERSION3} ${getUserAgent()}` - } - }); - const { request: request2 = requestWithDefaults, ...otherOptions } = options; - const state = options.clientType === "github-app" ? { - ...otherOptions, - clientType: "github-app", - request: request2 - } : { - ...otherOptions, - clientType: "oauth-app", - request: request2, - scopes: options.scopes || [] - }; - if (!options.clientId) { - throw new Error( - '[@octokit/auth-oauth-device] "clientId" option must be set (https://github.com/octokit/auth-oauth-device.js#usage)' - ); - } - if (!options.onVerification) { - throw new Error( - '[@octokit/auth-oauth-device] "onVerification" option must be a function (https://github.com/octokit/auth-oauth-device.js#usage)' - ); } - return Object.assign(auth.bind(null, state), { - hook: hook.bind(null, state) - }); -} +}); -// node_modules/@octokit/auth-oauth-user/dist-bundle/index.js -var VERSION4 = "0.0.0-development"; -async function getAuthentication(state) { - if ("code" in state.strategyOptions) { - const { authentication } = await exchangeWebFlowCode({ - clientId: state.clientId, - clientSecret: state.clientSecret, - clientType: state.clientType, - onTokenCreated: state.onTokenCreated, - ...state.strategyOptions, - request: state.request - }); - return { - type: "token", - tokenType: "oauth", - ...authentication - }; - } - if ("onVerification" in state.strategyOptions) { - const deviceAuth = createOAuthDeviceAuth({ - clientType: state.clientType, - clientId: state.clientId, - onTokenCreated: state.onTokenCreated, - ...state.strategyOptions, - request: state.request - }); - const authentication = await deviceAuth({ - type: "oauth" - }); - return { - clientSecret: state.clientSecret, - ...authentication +// node_modules/undici/index.js +var require_undici2 = __commonJS({ + "node_modules/undici/index.js"(exports2, module2) { + "use strict"; + var Client = require_client2(); + var Dispatcher = require_dispatcher2(); + var Pool = require_pool2(); + var BalancedPool = require_balanced_pool2(); + var Agent = require_agent2(); + var ProxyAgent2 = require_proxy_agent2(); + var EnvHttpProxyAgent = require_env_http_proxy_agent(); + var RetryAgent = require_retry_agent(); + var errors = require_errors2(); + var util = require_util9(); + var { InvalidArgumentError } = errors; + var api = require_api2(); + var buildConnector = require_connect2(); + var MockClient = require_mock_client2(); + var MockAgent = require_mock_agent2(); + var MockPool = require_mock_pool2(); + var mockErrors = require_mock_errors2(); + var RetryHandler = require_retry_handler(); + var { getGlobalDispatcher, setGlobalDispatcher } = require_global4(); + var DecoratorHandler = require_decorator_handler(); + var RedirectHandler = require_redirect_handler(); + var createRedirectInterceptor = require_redirect_interceptor(); + Object.assign(Dispatcher.prototype, api); + module2.exports.Dispatcher = Dispatcher; + module2.exports.Client = Client; + module2.exports.Pool = Pool; + module2.exports.BalancedPool = BalancedPool; + module2.exports.Agent = Agent; + module2.exports.ProxyAgent = ProxyAgent2; + module2.exports.EnvHttpProxyAgent = EnvHttpProxyAgent; + module2.exports.RetryAgent = RetryAgent; + module2.exports.RetryHandler = RetryHandler; + module2.exports.DecoratorHandler = DecoratorHandler; + module2.exports.RedirectHandler = RedirectHandler; + module2.exports.createRedirectInterceptor = createRedirectInterceptor; + module2.exports.interceptors = { + redirect: require_redirect(), + retry: require_retry3(), + dump: require_dump() }; - } - if ("token" in state.strategyOptions) { - return { - type: "token", - tokenType: "oauth", - clientId: state.clientId, - clientSecret: state.clientSecret, - clientType: state.clientType, - onTokenCreated: state.onTokenCreated, - ...state.strategyOptions + module2.exports.buildConnector = buildConnector; + module2.exports.errors = errors; + module2.exports.util = { + parseHeaders: util.parseHeaders, + headerNameToString: util.headerNameToString }; - } - throw new Error("[@octokit/auth-oauth-user] Invalid strategy options"); -} -async function auth2(state, options = {}) { - if (!state.authentication) { - state.authentication = state.clientType === "oauth-app" ? await getAuthentication(state) : await getAuthentication(state); - } - if (state.authentication.invalid) { - throw new Error("[@octokit/auth-oauth-user] Token is invalid"); - } - const currentAuthentication = state.authentication; - if ("expiresAt" in currentAuthentication) { - if (options.type === "refresh" || new Date(currentAuthentication.expiresAt) < /* @__PURE__ */ new Date()) { - const { authentication } = await refreshToken({ - clientType: "github-app", - clientId: state.clientId, - clientSecret: state.clientSecret, - refreshToken: currentAuthentication.refreshToken, - request: state.request - }); - state.authentication = { - tokenType: "oauth", - type: "token", - ...authentication - }; - } - } - if (options.type === "refresh") { - if (state.clientType === "oauth-app") { - throw new Error( - "[@octokit/auth-oauth-user] OAuth Apps do not support expiring tokens" - ); - } - if (!currentAuthentication.hasOwnProperty("expiresAt")) { - throw new Error("[@octokit/auth-oauth-user] Refresh token missing"); - } - await state.onTokenCreated?.(state.authentication, { - type: options.type - }); - } - if (options.type === "check" || options.type === "reset") { - const method = options.type === "check" ? checkToken : resetToken; - try { - const { authentication } = await method({ - // @ts-expect-error making TS happy would require unnecessary code so no - clientType: state.clientType, - clientId: state.clientId, - clientSecret: state.clientSecret, - token: state.authentication.token, - request: state.request - }); - state.authentication = { - tokenType: "oauth", - type: "token", - // @ts-expect-error TBD - ...authentication - }; - if (options.type === "reset") { - await state.onTokenCreated?.(state.authentication, { - type: options.type - }); - } - return state.authentication; - } catch (error) { - if (error.status === 404) { - error.message = "[@octokit/auth-oauth-user] Token is invalid"; - state.authentication.invalid = true; - } - throw error; - } - } - if (options.type === "delete" || options.type === "deleteAuthorization") { - const method = options.type === "delete" ? deleteToken : deleteAuthorization; - try { - await method({ - // @ts-expect-error making TS happy would require unnecessary code so no - clientType: state.clientType, - clientId: state.clientId, - clientSecret: state.clientSecret, - token: state.authentication.token, - request: state.request - }); - } catch (error) { - if (error.status !== 404) - throw error; + function makeDispatcher(fn) { + return (url, opts, handler) => { + if (typeof opts === "function") { + handler = opts; + opts = null; + } + if (!url || typeof url !== "string" && typeof url !== "object" && !(url instanceof URL)) { + throw new InvalidArgumentError("invalid url"); + } + if (opts != null && typeof opts !== "object") { + throw new InvalidArgumentError("invalid opts"); + } + if (opts && opts.path != null) { + if (typeof opts.path !== "string") { + throw new InvalidArgumentError("invalid opts.path"); + } + let path = opts.path; + if (!opts.path.startsWith("/")) { + path = `/${path}`; + } + url = new URL(util.parseOrigin(url).origin + path); + } else { + if (!opts) { + opts = typeof url === "object" ? url : {}; + } + url = util.parseURL(url); + } + const { agent, dispatcher = getGlobalDispatcher() } = opts; + if (agent) { + throw new InvalidArgumentError("unsupported opts.agent. Did you mean opts.client?"); + } + return fn.call(dispatcher, { + ...opts, + origin: url.origin, + path: url.search ? `${url.pathname}${url.search}` : url.pathname, + method: opts.method || (opts.body ? "PUT" : "GET") + }, handler); + }; } - state.authentication.invalid = true; - return state.authentication; - } - return state.authentication; -} -var ROUTES_REQUIRING_BASIC_AUTH = /\/applications\/[^/]+\/(token|grant)s?/; -function requiresBasicAuth(url) { - return url && ROUTES_REQUIRING_BASIC_AUTH.test(url); -} -async function hook2(state, request2, route, parameters = {}) { - const endpoint2 = request2.endpoint.merge( - route, - parameters - ); - if (/\/login\/(oauth\/access_token|device\/code)$/.test(endpoint2.url)) { - return request2(endpoint2); - } - if (requiresBasicAuth(endpoint2.url)) { - const credentials = btoa(`${state.clientId}:${state.clientSecret}`); - endpoint2.headers.authorization = `basic ${credentials}`; - return request2(endpoint2); - } - const { token } = state.clientType === "oauth-app" ? await auth2({ ...state, request: request2 }) : await auth2({ ...state, request: request2 }); - endpoint2.headers.authorization = "token " + token; - return request2(endpoint2); -} -function createOAuthUserAuth({ - clientId, - clientSecret, - clientType = "oauth-app", - request: request2 = request.defaults({ - headers: { - "user-agent": `octokit-auth-oauth-app.js/${VERSION4} ${getUserAgent()}` - } - }), - onTokenCreated, - ...strategyOptions -}) { - const state = Object.assign({ - clientType, - clientId, - clientSecret, - onTokenCreated, - strategyOptions, - request: request2 - }); - return Object.assign(auth2.bind(null, state), { - // @ts-expect-error not worth the extra code needed to appease TS - hook: hook2.bind(null, state) - }); -} -createOAuthUserAuth.VERSION = VERSION4; - -// node_modules/@octokit/auth-oauth-app/dist-bundle/index.js -async function auth3(state, authOptions) { - if (authOptions.type === "oauth-app") { - return { - type: "oauth-app", - clientId: state.clientId, - clientSecret: state.clientSecret, - clientType: state.clientType, - headers: { - authorization: `basic ${btoa( - `${state.clientId}:${state.clientSecret}` - )}` + module2.exports.setGlobalDispatcher = setGlobalDispatcher; + module2.exports.getGlobalDispatcher = getGlobalDispatcher; + var fetchImpl = require_fetch2().fetch; + module2.exports.fetch = async function fetch2(init, options = void 0) { + try { + return await fetchImpl(init, options); + } catch (err) { + if (err && typeof err === "object") { + Error.captureStackTrace(err); + } + throw err; } }; + module2.exports.Headers = require_headers2().Headers; + module2.exports.Response = require_response2().Response; + module2.exports.Request = require_request4().Request; + module2.exports.FormData = require_formdata2().FormData; + module2.exports.File = globalThis.File ?? require("node:buffer").File; + module2.exports.FileReader = require_filereader2().FileReader; + var { setGlobalOrigin, getGlobalOrigin } = require_global3(); + module2.exports.setGlobalOrigin = setGlobalOrigin; + module2.exports.getGlobalOrigin = getGlobalOrigin; + var { CacheStorage } = require_cachestorage2(); + var { kConstruct } = require_symbols9(); + module2.exports.caches = new CacheStorage(kConstruct); + var { deleteCookie, getCookies, getSetCookies, setCookie } = require_cookies2(); + module2.exports.deleteCookie = deleteCookie; + module2.exports.getCookies = getCookies; + module2.exports.getSetCookies = getSetCookies; + module2.exports.setCookie = setCookie; + var { parseMIMEType, serializeAMimeType } = require_data_url(); + module2.exports.parseMIMEType = parseMIMEType; + module2.exports.serializeAMimeType = serializeAMimeType; + var { CloseEvent, ErrorEvent, MessageEvent } = require_events2(); + module2.exports.WebSocket = require_websocket2().WebSocket; + module2.exports.CloseEvent = CloseEvent; + module2.exports.ErrorEvent = ErrorEvent; + module2.exports.MessageEvent = MessageEvent; + module2.exports.request = makeDispatcher(api.request); + module2.exports.stream = makeDispatcher(api.stream); + module2.exports.pipeline = makeDispatcher(api.pipeline); + module2.exports.connect = makeDispatcher(api.connect); + module2.exports.upgrade = makeDispatcher(api.upgrade); + module2.exports.MockClient = MockClient; + module2.exports.MockPool = MockPool; + module2.exports.MockAgent = MockAgent; + module2.exports.mockErrors = mockErrors; + var { EventSource } = require_eventsource(); + module2.exports.EventSource = EventSource; } - if ("factory" in authOptions) { - const { type, ...options } = { - ...authOptions, - ...state - }; - return authOptions.factory(options); - } - const common = { - clientId: state.clientId, - clientSecret: state.clientSecret, - request: state.request, - ...authOptions - }; - const userAuth = state.clientType === "oauth-app" ? await createOAuthUserAuth({ - ...common, - clientType: state.clientType - }) : await createOAuthUserAuth({ - ...common, - clientType: state.clientType - }); - return userAuth(); -} -async function hook3(state, request2, route, parameters) { - let endpoint2 = request2.endpoint.merge( - route, - parameters - ); - if (/\/login\/(oauth\/access_token|device\/code)$/.test(endpoint2.url)) { - return request2(endpoint2); - } - if (state.clientType === "github-app" && !requiresBasicAuth(endpoint2.url)) { - throw new Error( - `[@octokit/auth-oauth-app] GitHub Apps cannot use their client ID/secret for basic authentication for endpoints other than "/applications/{client_id}/**". "${endpoint2.method} ${endpoint2.url}" is not supported.` - ); - } - const credentials = btoa(`${state.clientId}:${state.clientSecret}`); - endpoint2.headers.authorization = `basic ${credentials}`; - try { - return await request2(endpoint2); - } catch (error) { - if (error.status !== 401) - throw error; - error.message = `[@octokit/auth-oauth-app] "${endpoint2.method} ${endpoint2.url}" does not support clientId/clientSecret basic authentication.`; - throw error; - } -} -var VERSION5 = "0.0.0-development"; -function createOAuthAppAuth(options) { - const state = Object.assign( - { - request: request.defaults({ - headers: { - "user-agent": `octokit-auth-oauth-app.js/${VERSION5} ${getUserAgent()}` - } - }), - clientType: "oauth-app" - }, - options - ); - return Object.assign(auth3.bind(null, state), { - hook: hook3.bind(null, state) - }); -} +}); -// node_modules/universal-github-app-jwt/lib/utils.js -function isPkcs1(privateKey2) { - return privateKey2.includes("-----BEGIN RSA PRIVATE KEY-----"); -} -function isOpenSsh(privateKey2) { - return privateKey2.includes("-----BEGIN OPENSSH PRIVATE KEY-----"); -} -function string2ArrayBuffer(str) { - const buf = new ArrayBuffer(str.length); - const bufView = new Uint8Array(buf); - for (let i = 0, strLen = str.length; i < strLen; i++) { - bufView[i] = str.charCodeAt(i); - } - return buf; -} -function getDERfromPEM(pem) { - const pemB64 = pem.trim().split("\n").slice(1, -1).join(""); - const decoded = atob(pemB64); - return string2ArrayBuffer(decoded); -} -function getEncodedMessage(header, payload) { - return `${base64encodeJSON(header)}.${base64encodeJSON(payload)}`; -} -function base64encode(buffer) { - var binary = ""; - var bytes = new Uint8Array(buffer); - var len = bytes.byteLength; - for (var i = 0; i < len; i++) { - binary += String.fromCharCode(bytes[i]); - } - return fromBase64(btoa(binary)); -} -function fromBase64(base64) { - return base64.replace(/=/g, "").replace(/\+/g, "-").replace(/\//g, "_"); -} -function base64encodeJSON(obj) { - return fromBase64(btoa(JSON.stringify(obj))); -} +// main.js +var import_core4 = __toESM(require_core(), 1); -// node_modules/universal-github-app-jwt/lib/crypto-node.js -var crypto_node_exports = {}; -__export(crypto_node_exports, { - convertPrivateKey: () => convertPrivateKey -}); -__reExport(crypto_node_exports, require("node:crypto")); -var import_node_crypto = require("node:crypto"); -function convertPrivateKey(privateKey2) { - if (!isPkcs1(privateKey2)) return privateKey2; - return (0, import_node_crypto.createPrivateKey)(privateKey2).export({ - type: "pkcs8", - format: "pem" - }); -} +// node_modules/p-retry/index.js +var import_retry = __toESM(require_retry2(), 1); -// node_modules/universal-github-app-jwt/lib/get-token.js -async function getToken({ privateKey: privateKey2, payload }) { - const convertedPrivateKey = convertPrivateKey(privateKey2); - if (isPkcs1(convertedPrivateKey)) { - throw new Error( - "[universal-github-app-jwt] Private Key is in PKCS#1 format, but only PKCS#8 is supported. See https://github.com/gr2m/universal-github-app-jwt#private-key-formats" - ); +// node_modules/is-network-error/index.js +var objectToString = Object.prototype.toString; +var isError = (value) => objectToString.call(value) === "[object Error]"; +var errorMessages = /* @__PURE__ */ new Set([ + "network error", + // Chrome + "Failed to fetch", + // Chrome + "NetworkError when attempting to fetch resource.", + // Firefox + "The Internet connection appears to be offline.", + // Safari 16 + "Load failed", + // Safari 17+ + "Network request failed", + // `cross-fetch` + "fetch failed", + // Undici (Node.js) + "terminated" + // Undici (Node.js) +]); +function isNetworkError(error) { + const isValid = error && isError(error) && error.name === "TypeError" && typeof error.message === "string"; + if (!isValid) { + return false; } - if (isOpenSsh(convertedPrivateKey)) { - throw new Error( - "[universal-github-app-jwt] Private Key is in OpenSSH format, but only PKCS#8 is supported. See https://github.com/gr2m/universal-github-app-jwt#private-key-formats" - ); + if (error.message === "Load failed") { + return error.stack === void 0; } - const algorithm = { - name: "RSASSA-PKCS1-v1_5", - hash: { name: "SHA-256" } - }; - const header = { alg: "RS256", typ: "JWT" }; - const privateKeyDER = getDERfromPEM(convertedPrivateKey); - const importedKey = await crypto_node_exports.subtle.importKey( - "pkcs8", - privateKeyDER, - algorithm, - false, - ["sign"] - ); - const encodedMessage = getEncodedMessage(header, payload); - const encodedMessageArrBuf = string2ArrayBuffer(encodedMessage); - const signatureArrBuf = await crypto_node_exports.subtle.sign( - algorithm.name, - importedKey, - encodedMessageArrBuf - ); - const encodedSignature = base64encode(signatureArrBuf); - return `${encodedMessage}.${encodedSignature}`; -} - -// node_modules/universal-github-app-jwt/index.js -async function githubAppJwt({ - id, - privateKey: privateKey2, - now = Math.floor(Date.now() / 1e3) -}) { - const privateKeyWithNewlines = privateKey2.replace(/\\n/g, "\n"); - const nowWithSafetyMargin = now - 30; - const expiration = nowWithSafetyMargin + 60 * 10; - const payload = { - iat: nowWithSafetyMargin, - // Issued at time - exp: expiration, - iss: id - }; - const token = await getToken({ - privateKey: privateKeyWithNewlines, - payload - }); - return { - appId: id, - expiration, - token - }; + return errorMessages.has(error.message); } -// node_modules/lru-cache/dist/esm/index.js -var perf = typeof performance === "object" && performance && typeof performance.now === "function" ? performance : Date; -var warned = /* @__PURE__ */ new Set(); -var PROCESS = typeof process === "object" && !!process ? process : {}; -var emitWarning = (msg, type, code, fn) => { - typeof PROCESS.emitWarning === "function" ? PROCESS.emitWarning(msg, type, code, fn) : console.error(`[${code}] ${type}: ${msg}`); -}; -var AC = globalThis.AbortController; -var AS = globalThis.AbortSignal; -if (typeof AC === "undefined") { - AS = class AbortSignal { - onabort; - _onabort = []; - reason; - aborted = false; - addEventListener(_, fn) { - this._onabort.push(fn); - } - }; - AC = class AbortController { - constructor() { - warnACPolyfill(); - } - signal = new AS(); - abort(reason) { - if (this.signal.aborted) - return; - this.signal.reason = reason; - this.signal.aborted = true; - for (const fn of this.signal._onabort) { - fn(reason); - } - this.signal.onabort?.(reason); - } - }; - let printACPolyfillWarning = PROCESS.env?.LRU_CACHE_IGNORE_AC_WARNING !== "1"; - const warnACPolyfill = () => { - if (!printACPolyfillWarning) - return; - printACPolyfillWarning = false; - emitWarning("AbortController is not defined. If using lru-cache in node 14, load an AbortController polyfill from the `node-abort-controller` package. A minimal polyfill is provided for use by LRUCache.fetch(), but it should not be relied upon in other contexts (eg, passing it to other APIs that use AbortController/AbortSignal might have undesirable effects). You may disable this with LRU_CACHE_IGNORE_AC_WARNING=1 in the env.", "NO_ABORT_CONTROLLER", "ENOTSUP", warnACPolyfill); - }; -} -var shouldWarn = (code) => !warned.has(code); -var TYPE = Symbol("type"); -var isPosInt = (n) => n && n === Math.floor(n) && n > 0 && isFinite(n); -var getUintArray = (max) => !isPosInt(max) ? null : max <= Math.pow(2, 8) ? Uint8Array : max <= Math.pow(2, 16) ? Uint16Array : max <= Math.pow(2, 32) ? Uint32Array : max <= Number.MAX_SAFE_INTEGER ? ZeroArray : null; -var ZeroArray = class extends Array { - constructor(size) { - super(size); - this.fill(0); - } -}; -var Stack = class _Stack { - heap; - length; - // private constructor - static #constructing = false; - static create(max) { - const HeapCls = getUintArray(max); - if (!HeapCls) - return []; - _Stack.#constructing = true; - const s = new _Stack(max, HeapCls); - _Stack.#constructing = false; - return s; - } - constructor(max, HeapCls) { - if (!_Stack.#constructing) { - throw new TypeError("instantiate Stack using Stack.create(n)"); - } - this.heap = new HeapCls(max); - this.length = 0; - } - push(n) { - this.heap[this.length++] = n; - } - pop() { - return this.heap[--this.length]; - } -}; -var LRUCache = class _LRUCache { - // properties coming in from the options of these, only max and maxSize - // really *need* to be protected. The rest can be modified, as they just - // set defaults for various methods. - #max; - #maxSize; - #dispose; - #disposeAfter; - #fetchMethod; - /** - * {@link LRUCache.OptionsBase.ttl} - */ - ttl; - /** - * {@link LRUCache.OptionsBase.ttlResolution} - */ - ttlResolution; - /** - * {@link LRUCache.OptionsBase.ttlAutopurge} - */ - ttlAutopurge; - /** - * {@link LRUCache.OptionsBase.updateAgeOnGet} - */ - updateAgeOnGet; - /** - * {@link LRUCache.OptionsBase.updateAgeOnHas} - */ - updateAgeOnHas; - /** - * {@link LRUCache.OptionsBase.allowStale} - */ - allowStale; - /** - * {@link LRUCache.OptionsBase.noDisposeOnSet} - */ - noDisposeOnSet; - /** - * {@link LRUCache.OptionsBase.noUpdateTTL} - */ - noUpdateTTL; - /** - * {@link LRUCache.OptionsBase.maxEntrySize} - */ - maxEntrySize; - /** - * {@link LRUCache.OptionsBase.sizeCalculation} - */ - sizeCalculation; - /** - * {@link LRUCache.OptionsBase.noDeleteOnFetchRejection} - */ - noDeleteOnFetchRejection; - /** - * {@link LRUCache.OptionsBase.noDeleteOnStaleGet} - */ - noDeleteOnStaleGet; - /** - * {@link LRUCache.OptionsBase.allowStaleOnFetchAbort} - */ - allowStaleOnFetchAbort; - /** - * {@link LRUCache.OptionsBase.allowStaleOnFetchRejection} - */ - allowStaleOnFetchRejection; - /** - * {@link LRUCache.OptionsBase.ignoreFetchAbort} - */ - ignoreFetchAbort; - // computed properties - #size; - #calculatedSize; - #keyMap; - #keyList; - #valList; - #next; - #prev; - #head; - #tail; - #free; - #disposed; - #sizes; - #starts; - #ttls; - #hasDispose; - #hasFetchMethod; - #hasDisposeAfter; - /** - * Do not call this method unless you need to inspect the - * inner workings of the cache. If anything returned by this - * object is modified in any way, strange breakage may occur. - * - * These fields are private for a reason! - * - * @internal - */ - static unsafeExposeInternals(c) { - return { - // properties - starts: c.#starts, - ttls: c.#ttls, - sizes: c.#sizes, - keyMap: c.#keyMap, - keyList: c.#keyList, - valList: c.#valList, - next: c.#next, - prev: c.#prev, - get head() { - return c.#head; - }, - get tail() { - return c.#tail; - }, - free: c.#free, - // methods - isBackgroundFetch: (p) => c.#isBackgroundFetch(p), - backgroundFetch: (k, index, options, context) => c.#backgroundFetch(k, index, options, context), - moveToTail: (index) => c.#moveToTail(index), - indexes: (options) => c.#indexes(options), - rindexes: (options) => c.#rindexes(options), - isStale: (index) => c.#isStale(index) - }; - } - // Protected read-only members - /** - * {@link LRUCache.OptionsBase.max} (read-only) - */ - get max() { - return this.#max; - } - /** - * {@link LRUCache.OptionsBase.maxSize} (read-only) - */ - get maxSize() { - return this.#maxSize; - } - /** - * The total computed size of items in the cache (read-only) - */ - get calculatedSize() { - return this.#calculatedSize; - } - /** - * The number of items stored in the cache (read-only) - */ - get size() { - return this.#size; - } - /** - * {@link LRUCache.OptionsBase.fetchMethod} (read-only) - */ - get fetchMethod() { - return this.#fetchMethod; - } - /** - * {@link LRUCache.OptionsBase.dispose} (read-only) - */ - get dispose() { - return this.#dispose; - } - /** - * {@link LRUCache.OptionsBase.disposeAfter} (read-only) - */ - get disposeAfter() { - return this.#disposeAfter; - } - constructor(options) { - const { max = 0, ttl, ttlResolution = 1, ttlAutopurge, updateAgeOnGet, updateAgeOnHas, allowStale, dispose, disposeAfter, noDisposeOnSet, noUpdateTTL, maxSize = 0, maxEntrySize = 0, sizeCalculation, fetchMethod, noDeleteOnFetchRejection, noDeleteOnStaleGet, allowStaleOnFetchRejection, allowStaleOnFetchAbort, ignoreFetchAbort } = options; - if (max !== 0 && !isPosInt(max)) { - throw new TypeError("max option must be a nonnegative integer"); - } - const UintArray = max ? getUintArray(max) : Array; - if (!UintArray) { - throw new Error("invalid max value: " + max); - } - this.#max = max; - this.#maxSize = maxSize; - this.maxEntrySize = maxEntrySize || this.#maxSize; - this.sizeCalculation = sizeCalculation; - if (this.sizeCalculation) { - if (!this.#maxSize && !this.maxEntrySize) { - throw new TypeError("cannot set sizeCalculation without setting maxSize or maxEntrySize"); - } - if (typeof this.sizeCalculation !== "function") { - throw new TypeError("sizeCalculation set to non-function"); - } - } - if (fetchMethod !== void 0 && typeof fetchMethod !== "function") { - throw new TypeError("fetchMethod must be a function if specified"); - } - this.#fetchMethod = fetchMethod; - this.#hasFetchMethod = !!fetchMethod; - this.#keyMap = /* @__PURE__ */ new Map(); - this.#keyList = new Array(max).fill(void 0); - this.#valList = new Array(max).fill(void 0); - this.#next = new UintArray(max); - this.#prev = new UintArray(max); - this.#head = 0; - this.#tail = 0; - this.#free = Stack.create(max); - this.#size = 0; - this.#calculatedSize = 0; - if (typeof dispose === "function") { - this.#dispose = dispose; - } - if (typeof disposeAfter === "function") { - this.#disposeAfter = disposeAfter; - this.#disposed = []; +// node_modules/p-retry/index.js +var AbortError = class extends Error { + constructor(message) { + super(); + if (message instanceof Error) { + this.originalError = message; + ({ message } = message); } else { - this.#disposeAfter = void 0; - this.#disposed = void 0; - } - this.#hasDispose = !!this.#dispose; - this.#hasDisposeAfter = !!this.#disposeAfter; - this.noDisposeOnSet = !!noDisposeOnSet; - this.noUpdateTTL = !!noUpdateTTL; - this.noDeleteOnFetchRejection = !!noDeleteOnFetchRejection; - this.allowStaleOnFetchRejection = !!allowStaleOnFetchRejection; - this.allowStaleOnFetchAbort = !!allowStaleOnFetchAbort; - this.ignoreFetchAbort = !!ignoreFetchAbort; - if (this.maxEntrySize !== 0) { - if (this.#maxSize !== 0) { - if (!isPosInt(this.#maxSize)) { - throw new TypeError("maxSize must be a positive integer if specified"); - } - } - if (!isPosInt(this.maxEntrySize)) { - throw new TypeError("maxEntrySize must be a positive integer if specified"); - } - this.#initializeSizeTracking(); - } - this.allowStale = !!allowStale; - this.noDeleteOnStaleGet = !!noDeleteOnStaleGet; - this.updateAgeOnGet = !!updateAgeOnGet; - this.updateAgeOnHas = !!updateAgeOnHas; - this.ttlResolution = isPosInt(ttlResolution) || ttlResolution === 0 ? ttlResolution : 1; - this.ttlAutopurge = !!ttlAutopurge; - this.ttl = ttl || 0; - if (this.ttl) { - if (!isPosInt(this.ttl)) { - throw new TypeError("ttl must be a positive integer if specified"); - } - this.#initializeTTLTracking(); - } - if (this.#max === 0 && this.ttl === 0 && this.#maxSize === 0) { - throw new TypeError("At least one of max, maxSize, or ttl is required"); - } - if (!this.ttlAutopurge && !this.#max && !this.#maxSize) { - const code = "LRU_CACHE_UNBOUNDED"; - if (shouldWarn(code)) { - warned.add(code); - const msg = "TTL caching without ttlAutopurge, max, or maxSize can result in unbounded memory consumption."; - emitWarning(msg, "UnboundedCacheWarning", code, _LRUCache); - } - } - } - /** - * Return the remaining TTL time for a given entry key - */ - getRemainingTTL(key) { - return this.#keyMap.has(key) ? Infinity : 0; - } - #initializeTTLTracking() { - const ttls = new ZeroArray(this.#max); - const starts = new ZeroArray(this.#max); - this.#ttls = ttls; - this.#starts = starts; - this.#setItemTTL = (index, ttl, start = perf.now()) => { - starts[index] = ttl !== 0 ? start : 0; - ttls[index] = ttl; - if (ttl !== 0 && this.ttlAutopurge) { - const t = setTimeout(() => { - if (this.#isStale(index)) { - this.delete(this.#keyList[index]); - } - }, ttl + 1); - if (t.unref) { - t.unref(); - } - } - }; - this.#updateItemAge = (index) => { - starts[index] = ttls[index] !== 0 ? perf.now() : 0; - }; - this.#statusTTL = (status, index) => { - if (ttls[index]) { - const ttl = ttls[index]; - const start = starts[index]; - if (!ttl || !start) - return; - status.ttl = ttl; - status.start = start; - status.now = cachedNow || getNow(); - const age = status.now - start; - status.remainingTTL = ttl - age; - } - }; - let cachedNow = 0; - const getNow = () => { - const n = perf.now(); - if (this.ttlResolution > 0) { - cachedNow = n; - const t = setTimeout(() => cachedNow = 0, this.ttlResolution); - if (t.unref) { - t.unref(); - } - } - return n; + this.originalError = new Error(message); + this.originalError.stack = this.stack; + } + this.name = "AbortError"; + this.message = message; + } +}; +var decorateErrorWithCounts = (error, attemptNumber, options) => { + const retriesLeft = options.retries - (attemptNumber - 1); + error.attemptNumber = attemptNumber; + error.retriesLeft = retriesLeft; + return error; +}; +async function pRetry(input, options) { + return new Promise((resolve, reject) => { + options = { + onFailedAttempt() { + }, + retries: 10, + shouldRetry: () => true, + ...options }; - this.getRemainingTTL = (key) => { - const index = this.#keyMap.get(key); - if (index === void 0) { - return 0; - } - const ttl = ttls[index]; - const start = starts[index]; - if (!ttl || !start) { - return Infinity; - } - const age = (cachedNow || getNow()) - start; - return ttl - age; + const operation = import_retry.default.operation(options); + const abortHandler = () => { + operation.stop(); + reject(options.signal?.reason); }; - this.#isStale = (index) => { - const s = starts[index]; - const t = ttls[index]; - return !!t && !!s && (cachedNow || getNow()) - s > t; + if (options.signal && !options.signal.aborted) { + options.signal.addEventListener("abort", abortHandler, { once: true }); + } + const cleanUp = () => { + options.signal?.removeEventListener("abort", abortHandler); + operation.stop(); }; - } - // conditionally set private methods related to TTL - #updateItemAge = () => { - }; - #statusTTL = () => { - }; - #setItemTTL = () => { - }; - /* c8 ignore stop */ - #isStale = () => false; - #initializeSizeTracking() { - const sizes = new ZeroArray(this.#max); - this.#calculatedSize = 0; - this.#sizes = sizes; - this.#removeItemSize = (index) => { - this.#calculatedSize -= sizes[index]; - sizes[index] = 0; - }; - this.#requireSize = (k, v, size, sizeCalculation) => { - if (this.#isBackgroundFetch(v)) { - return 0; - } - if (!isPosInt(size)) { - if (sizeCalculation) { - if (typeof sizeCalculation !== "function") { - throw new TypeError("sizeCalculation must be a function"); + operation.attempt(async (attemptNumber) => { + try { + const result = await input(attemptNumber); + cleanUp(); + resolve(result); + } catch (error) { + try { + if (!(error instanceof Error)) { + throw new TypeError(`Non-error was thrown: "${error}". You should only throw errors.`); + } + if (error instanceof AbortError) { + throw error.originalError; } - size = sizeCalculation(v, k); - if (!isPosInt(size)) { - throw new TypeError("sizeCalculation return invalid (expect positive integer)"); + if (error instanceof TypeError && !isNetworkError(error)) { + throw error; } - } else { - throw new TypeError("invalid size value (must be positive integer). When maxSize or maxEntrySize is used, sizeCalculation or size must be set."); - } - } - return size; - }; - this.#addItemSize = (index, size, status) => { - sizes[index] = size; - if (this.#maxSize) { - const maxSize = this.#maxSize - sizes[index]; - while (this.#calculatedSize > maxSize) { - this.#evict(true); + decorateErrorWithCounts(error, attemptNumber, options); + if (!await options.shouldRetry(error)) { + operation.stop(); + reject(error); + } + await options.onFailedAttempt(error); + if (!operation.retry(error)) { + throw operation.mainError(); + } + } catch (finalError) { + decorateErrorWithCounts(finalError, attemptNumber, options); + cleanUp(); + reject(finalError); } } - this.#calculatedSize += sizes[index]; - if (status) { - status.entrySize = size; - status.totalCalculatedSize = this.#calculatedSize; - } - }; + }); + }); +} + +// lib/main.js +var import_client_kms = __toESM(require_dist_cjs53(), 1); +async function main(appId2, kmsKeyId2, owner2, repositories2, core4, request2, skipTokenRevoke2) { + let parsedOwner = ""; + let parsedRepositoryNames = ""; + if (!owner2 && !repositories2) { + [parsedOwner, parsedRepositoryNames] = String( + process.env.GITHUB_REPOSITORY + ).split("/"); + core4.info( + `owner and repositories not set, creating token for the current repository ("${parsedRepositoryNames}")` + ); } - #removeItemSize = (_i) => { - }; - #addItemSize = (_i, _s, _st) => { - }; - #requireSize = (_k, _v, size, sizeCalculation) => { - if (size || sizeCalculation) { - throw new TypeError("cannot set size without setting maxSize or maxEntrySize on cache"); - } - return 0; - }; - *#indexes({ allowStale = this.allowStale } = {}) { - if (this.#size) { - for (let i = this.#tail; true; ) { - if (!this.#isValidIndex(i)) { - break; - } - if (allowStale || !this.#isStale(i)) { - yield i; - } - if (i === this.#head) { - break; - } else { - i = this.#prev[i]; - } - } - } + if (owner2 && !repositories2) { + parsedOwner = owner2; + core4.info( + `repositories not set, creating token for all repositories for given owner "${owner2}"` + ); } - *#rindexes({ allowStale = this.allowStale } = {}) { - if (this.#size) { - for (let i = this.#head; true; ) { - if (!this.#isValidIndex(i)) { - break; - } - if (allowStale || !this.#isStale(i)) { - yield i; - } - if (i === this.#tail) { - break; - } else { - i = this.#next[i]; - } - } - } + if (!owner2 && repositories2) { + parsedOwner = String(process.env.GITHUB_REPOSITORY_OWNER); + parsedRepositoryNames = repositories2; + core4.info( + `owner not set, creating owner for given repositories "${repositories2}" in current owner ("${parsedOwner}")` + ); } - #isValidIndex(index) { - return index !== void 0 && this.#keyMap.get(this.#keyList[index]) === index; + if (owner2 && repositories2) { + parsedOwner = owner2; + parsedRepositoryNames = repositories2; + core4.info( + `owner and repositories set, creating token for repositories "${repositories2}" owned by "${owner2}"` + ); } - /** - * Return a generator yielding `[key, value]` pairs, - * in order from most recently used to least recently used. - */ - *entries() { - for (const i of this.#indexes()) { - if (this.#valList[i] !== void 0 && this.#keyList[i] !== void 0 && !this.#isBackgroundFetch(this.#valList[i])) { - yield [this.#keyList[i], this.#valList[i]]; - } - } + const jwt = await createJWT({ appId: appId2, kmsKeyId: kmsKeyId2 }); + let authentication, installationId, appSlug; + if (parsedRepositoryNames) { + ({ authentication, installationId, appSlug } = await pRetry(() => getTokenFromRepository(request2, jwt, parsedOwner, parsedRepositoryNames), { + onFailedAttempt: (error) => { + core4.info( + `Failed to create token for "${parsedRepositoryNames}" (attempt ${error.attemptNumber}): ${error.message}` + ); + }, + retries: 3 + })); + } else { + ({ authentication, installationId, appSlug } = await pRetry(() => getTokenFromOwner(request2, jwt, parsedOwner), { + onFailedAttempt: (error) => { + core4.info( + `Failed to create token for "${parsedOwner}" (attempt ${error.attemptNumber}): ${error.message}` + ); + }, + retries: 3 + })); } - /** - * Inverse order version of {@link LRUCache.entries} - * - * Return a generator yielding `[key, value]` pairs, - * in order from least recently used to most recently used. - */ - *rentries() { - for (const i of this.#rindexes()) { - if (this.#valList[i] !== void 0 && this.#keyList[i] !== void 0 && !this.#isBackgroundFetch(this.#valList[i])) { - yield [this.#keyList[i], this.#valList[i]]; - } - } + core4.setSecret(authentication.token); + core4.setOutput("token", authentication.token); + core4.setOutput("installation-id", installationId); + core4.setOutput("app-slug", appSlug); + if (!skipTokenRevoke2) { + core4.saveState("token", authentication.token); + core4.saveState("expiresAt", authentication.expiresAt); } - /** - * Return a generator yielding the keys in the cache, - * in order from most recently used to least recently used. - */ - *keys() { - for (const i of this.#indexes()) { - const k = this.#keyList[i]; - if (k !== void 0 && !this.#isBackgroundFetch(this.#valList[i])) { - yield k; - } +} +async function getTokenFromOwner(request2, jwt, parsedOwner) { + const installationResponse = await request2("GET /orgs/{org}/installation", { + org: parsedOwner, + headers: { + authorization: `bearer ${jwt}` } - } - /** - * Inverse order version of {@link LRUCache.keys} - * - * Return a generator yielding the keys in the cache, - * in order from least recently used to most recently used. - */ - *rkeys() { - for (const i of this.#rindexes()) { - const k = this.#keyList[i]; - if (k !== void 0 && !this.#isBackgroundFetch(this.#valList[i])) { - yield k; + }).catch((error) => { + if (error.status !== 404) throw error; + return request2("GET /users/{username}/installation", { + username: parsedOwner, + headers: { + authorization: `bearer ${jwt}` } + }); + }); + const accessTokenResponse = await request2(`POST /app/installations/${installationResponse.data.id}/access_tokens`, { + headers: { + authorization: `bearer ${jwt}` + }, + installationId: installationResponse.data.id + }).catch((error) => { + core.info(`Error obtaining the installation access token: ${error.message}`); + throw error; + }); + const authentication = accessTokenResponse.data; + const installationId = installationResponse.data.id; + const appSlug = installationResponse.data["app_slug"]; + return { authentication, installationId, appSlug }; +} +async function getTokenFromRepository(request2, jwt, parsedOwner, parsedRepositoryNames) { + const installationResponse = await request2("GET /repos/{owner}/{repo}/installation", { + owner: parsedOwner, + repo: parsedRepositoryNames.split(",")[0], + headers: { + authorization: `bearer ${jwt}` } + }); + const accessTokenResponse = await request2(`POST /app/installations/${installationResponse.data.id}/access_tokens`, { + headers: { + authorization: `bearer ${jwt}` + }, + installationId: installationResponse.data.id, + repositories: parsedRepositoryNames.split(",") + }).catch((error) => { + core.info(`Error obtaining the installation access token: ${error.message}`); + throw error; + }); + const authentication = accessTokenResponse.data; + const installationId = installationResponse.data.id; + const appSlug = installationResponse.data["app_slug"]; + return { authentication, installationId, appSlug }; +} +async function createJWT({ appId: appId2, expirationTime = 600, httpRequestHandler = void 0, kmsKeyId: kmsKeyId2 }) { + const now = Math.floor(Date.now() / 1e3); + const iat = now - 60; + const exp = now + expirationTime; + const header = { + typ: "JWT", + alg: "RS256" + }; + const payload = { + iat, + exp, + iss: appId2 + }; + const headerBase64 = Buffer.from(JSON.stringify(header)).toString("base64").replaceAll("=", "").replaceAll("+", "-").replaceAll("/", "_"); + const payloadBase64 = Buffer.from(JSON.stringify(payload)).toString("base64").replaceAll("=", "").replaceAll("+", "-").replaceAll("/", "_"); + const headerPayload = `${headerBase64}.${payloadBase64}`; + const kmsClient = new import_client_kms.KMSClient({ + requestHandler: httpRequestHandler + }); + const signInput = { + KeyId: kmsKeyId2, + Message: headerPayload, + MessageType: "RAW", + SigningAlgorithm: "RSASSA_PKCS1_V1_5_SHA_256" + }; + try { + const signCommand = new import_client_kms.SignCommand(signInput); + const signatureResponse = await kmsClient.send(signCommand); + const signatureBase64 = Buffer.from(signatureResponse.Signature).toString("base64").replaceAll("=", "").replaceAll("+", "-").replaceAll("/", "_"); + const jwt = `${headerPayload}.${signatureBase64}`; + return jwt; + } catch (error) { + console.error("Error signing JWT:", error.message); + return error; } - /** - * Return a generator yielding the values in the cache, - * in order from most recently used to least recently used. - */ - *values() { - for (const i of this.#indexes()) { - const v = this.#valList[i]; - if (v !== void 0 && !this.#isBackgroundFetch(this.#valList[i])) { - yield this.#valList[i]; - } - } +} + +// lib/request.js +var import_core3 = __toESM(require_core(), 1); + +// node_modules/universal-user-agent/index.js +function getUserAgent() { + if (typeof navigator === "object" && "userAgent" in navigator) { + return navigator.userAgent; } - /** - * Inverse order version of {@link LRUCache.values} - * - * Return a generator yielding the values in the cache, - * in order from least recently used to most recently used. - */ - *rvalues() { - for (const i of this.#rindexes()) { - const v = this.#valList[i]; - if (v !== void 0 && !this.#isBackgroundFetch(this.#valList[i])) { - yield this.#valList[i]; - } - } + if (typeof process === "object" && process.version !== void 0) { + return `Node.js/${process.version.substr(1)} (${process.platform}; ${process.arch})`; } - /** - * Iterating over the cache itself yields the same results as - * {@link LRUCache.entries} - */ - [Symbol.iterator]() { - return this.entries(); + return ""; +} + +// node_modules/@octokit/endpoint/dist-bundle/index.js +var VERSION = "0.0.0-development"; +var userAgent = `octokit-endpoint.js/${VERSION} ${getUserAgent()}`; +var DEFAULTS = { + method: "GET", + baseUrl: "https://api.github.com", + headers: { + accept: "application/vnd.github.v3+json", + "user-agent": userAgent + }, + mediaType: { + format: "" } - /** - * A String value that is used in the creation of the default string description of an object. - * Called by the built-in method Object.prototype.toString. - */ - [Symbol.toStringTag] = "LRUCache"; - /** - * Find a value for which the supplied fn method returns a truthy value, - * similar to Array.find(). fn is called as fn(value, key, cache). - */ - find(fn, getOptions = {}) { - for (const i of this.#indexes()) { - const v = this.#valList[i]; - const value = this.#isBackgroundFetch(v) ? v.__staleWhileFetching : v; - if (value === void 0) - continue; - if (fn(value, this.#keyList[i], this)) { - return this.get(this.#keyList[i], getOptions); - } - } +}; +function lowercaseKeys(object) { + if (!object) { + return {}; } - /** - * Call the supplied function on each item in the cache, in order from - * most recently used to least recently used. fn is called as - * fn(value, key, cache). Does not update age or recenty of use. - * Does not iterate over stale values. - */ - forEach(fn, thisp = this) { - for (const i of this.#indexes()) { - const v = this.#valList[i]; - const value = this.#isBackgroundFetch(v) ? v.__staleWhileFetching : v; - if (value === void 0) - continue; - fn.call(thisp, value, this.#keyList[i], this); + return Object.keys(object).reduce((newObj, key) => { + newObj[key.toLowerCase()] = object[key]; + return newObj; + }, {}); +} +function isPlainObject(value) { + if (typeof value !== "object" || value === null) + return false; + if (Object.prototype.toString.call(value) !== "[object Object]") + return false; + const proto = Object.getPrototypeOf(value); + if (proto === null) + return true; + const Ctor = Object.prototype.hasOwnProperty.call(proto, "constructor") && proto.constructor; + return typeof Ctor === "function" && Ctor instanceof Ctor && Function.prototype.call(Ctor) === Function.prototype.call(value); +} +function mergeDeep(defaults, options) { + const result = Object.assign({}, defaults); + Object.keys(options).forEach((key) => { + if (isPlainObject(options[key])) { + if (!(key in defaults)) + Object.assign(result, { [key]: options[key] }); + else + result[key] = mergeDeep(defaults[key], options[key]); + } else { + Object.assign(result, { [key]: options[key] }); } - } - /** - * The same as {@link LRUCache.forEach} but items are iterated over in - * reverse order. (ie, less recently used items are iterated over first.) - */ - rforEach(fn, thisp = this) { - for (const i of this.#rindexes()) { - const v = this.#valList[i]; - const value = this.#isBackgroundFetch(v) ? v.__staleWhileFetching : v; - if (value === void 0) - continue; - fn.call(thisp, value, this.#keyList[i], this); + }); + return result; +} +function removeUndefinedProperties(obj) { + for (const key in obj) { + if (obj[key] === void 0) { + delete obj[key]; } } - /** - * Delete any stale entries. Returns true if anything was removed, - * false otherwise. - */ - purgeStale() { - let deleted = false; - for (const i of this.#rindexes({ allowStale: true })) { - if (this.#isStale(i)) { - this.delete(this.#keyList[i]); - deleted = true; - } - } - return deleted; + return obj; +} +function merge(defaults, route, options) { + if (typeof route === "string") { + let [method, url] = route.split(" "); + options = Object.assign(url ? { method, url } : { url: method }, options); + } else { + options = Object.assign({}, route); } - /** - * Get the extended info about a given entry, to get its value, size, and - * TTL info simultaneously. Like {@link LRUCache#dump}, but just for a - * single key. Always returns stale values, if their info is found in the - * cache, so be sure to check for expired TTLs if relevant. - */ - info(key) { - const i = this.#keyMap.get(key); - if (i === void 0) - return void 0; - const v = this.#valList[i]; - const value = this.#isBackgroundFetch(v) ? v.__staleWhileFetching : v; - if (value === void 0) - return void 0; - const entry = { value }; - if (this.#ttls && this.#starts) { - const ttl = this.#ttls[i]; - const start = this.#starts[i]; - if (ttl && start) { - const remain = ttl - (perf.now() - start); - entry.ttl = remain; - entry.start = Date.now(); - } - } - if (this.#sizes) { - entry.size = this.#sizes[i]; + options.headers = lowercaseKeys(options.headers); + removeUndefinedProperties(options); + removeUndefinedProperties(options.headers); + const mergedOptions = mergeDeep(defaults || {}, options); + if (options.url === "/graphql") { + if (defaults && defaults.mediaType.previews?.length) { + mergedOptions.mediaType.previews = defaults.mediaType.previews.filter( + (preview) => !mergedOptions.mediaType.previews.includes(preview) + ).concat(mergedOptions.mediaType.previews); } - return entry; + mergedOptions.mediaType.previews = (mergedOptions.mediaType.previews || []).map((preview) => preview.replace(/-preview/, "")); } - /** - * Return an array of [key, {@link LRUCache.Entry}] tuples which can be - * passed to cache.load() - */ - dump() { - const arr = []; - for (const i of this.#indexes({ allowStale: true })) { - const key = this.#keyList[i]; - const v = this.#valList[i]; - const value = this.#isBackgroundFetch(v) ? v.__staleWhileFetching : v; - if (value === void 0 || key === void 0) - continue; - const entry = { value }; - if (this.#ttls && this.#starts) { - entry.ttl = this.#ttls[i]; - const age = perf.now() - this.#starts[i]; - entry.start = Math.floor(Date.now() - age); - } - if (this.#sizes) { - entry.size = this.#sizes[i]; - } - arr.unshift([key, entry]); - } - return arr; + return mergedOptions; +} +function addQueryParameters(url, parameters) { + const separator = /\?/.test(url) ? "&" : "?"; + const names = Object.keys(parameters); + if (names.length === 0) { + return url; } - /** - * Reset the cache and load in the items in entries in the order listed. - * Note that the shape of the resulting cache may be different if the - * same options are not used in both caches. - */ - load(arr) { - this.clear(); - for (const [key, entry] of arr) { - if (entry.start) { - const age = Date.now() - entry.start; - entry.start = perf.now() - age; - } - this.set(key, entry.value, entry); + return url + separator + names.map((name) => { + if (name === "q") { + return "q=" + parameters.q.split("+").map(encodeURIComponent).join("+"); } + return `${name}=${encodeURIComponent(parameters[name])}`; + }).join("&"); +} +var urlVariableRegex = /\{[^}]+\}/g; +function removeNonChars(variableName) { + return variableName.replace(/^\W+|\W+$/g, "").split(/,/); +} +function extractUrlVariableNames(url) { + const matches = url.match(urlVariableRegex); + if (!matches) { + return []; } - /** - * Add a value to the cache. - * - * Note: if `undefined` is specified as a value, this is an alias for - * {@link LRUCache#delete} - */ - set(k, v, setOptions = {}) { - if (v === void 0) { - this.delete(k); - return this; - } - const { ttl = this.ttl, start, noDisposeOnSet = this.noDisposeOnSet, sizeCalculation = this.sizeCalculation, status } = setOptions; - let { noUpdateTTL = this.noUpdateTTL } = setOptions; - const size = this.#requireSize(k, v, setOptions.size || 0, sizeCalculation); - if (this.maxEntrySize && size > this.maxEntrySize) { - if (status) { - status.set = "miss"; - status.maxEntrySizeExceeded = true; - } - this.delete(k); - return this; - } - let index = this.#size === 0 ? void 0 : this.#keyMap.get(k); - if (index === void 0) { - index = this.#size === 0 ? this.#tail : this.#free.length !== 0 ? this.#free.pop() : this.#size === this.#max ? this.#evict(false) : this.#size; - this.#keyList[index] = k; - this.#valList[index] = v; - this.#keyMap.set(k, index); - this.#next[this.#tail] = index; - this.#prev[index] = this.#tail; - this.#tail = index; - this.#size++; - this.#addItemSize(index, size, status); - if (status) - status.set = "add"; - noUpdateTTL = false; - } else { - this.#moveToTail(index); - const oldVal = this.#valList[index]; - if (v !== oldVal) { - if (this.#hasFetchMethod && this.#isBackgroundFetch(oldVal)) { - oldVal.__abortController.abort(new Error("replaced")); - const { __staleWhileFetching: s } = oldVal; - if (s !== void 0 && !noDisposeOnSet) { - if (this.#hasDispose) { - this.#dispose?.(s, k, "set"); - } - if (this.#hasDisposeAfter) { - this.#disposed?.push([s, k, "set"]); - } - } - } else if (!noDisposeOnSet) { - if (this.#hasDispose) { - this.#dispose?.(oldVal, k, "set"); - } - if (this.#hasDisposeAfter) { - this.#disposed?.push([oldVal, k, "set"]); - } - } - this.#removeItemSize(index); - this.#addItemSize(index, size, status); - this.#valList[index] = v; - if (status) { - status.set = "replace"; - const oldValue = oldVal && this.#isBackgroundFetch(oldVal) ? oldVal.__staleWhileFetching : oldVal; - if (oldValue !== void 0) - status.oldValue = oldValue; - } - } else if (status) { - status.set = "update"; - } - } - if (ttl !== 0 && !this.#ttls) { - this.#initializeTTLTracking(); - } - if (this.#ttls) { - if (!noUpdateTTL) { - this.#setItemTTL(index, ttl, start); - } - if (status) - this.#statusTTL(status, index); - } - if (!noDisposeOnSet && this.#hasDisposeAfter && this.#disposed) { - const dt = this.#disposed; - let task; - while (task = dt?.shift()) { - this.#disposeAfter?.(...task); - } + return matches.map(removeNonChars).reduce((a, b) => a.concat(b), []); +} +function omit(object, keysToOmit) { + const result = { __proto__: null }; + for (const key of Object.keys(object)) { + if (keysToOmit.indexOf(key) === -1) { + result[key] = object[key]; } - return this; } - /** - * Evict the least recently used item, returning its value or - * `undefined` if cache is empty. - */ - pop() { - try { - while (this.#size) { - const val = this.#valList[this.#head]; - this.#evict(true); - if (this.#isBackgroundFetch(val)) { - if (val.__staleWhileFetching) { - return val.__staleWhileFetching; - } - } else if (val !== void 0) { - return val; - } - } - } finally { - if (this.#hasDisposeAfter && this.#disposed) { - const dt = this.#disposed; - let task; - while (task = dt?.shift()) { - this.#disposeAfter?.(...task); - } - } + return result; +} +function encodeReserved(str) { + return str.split(/(%[0-9A-Fa-f]{2})/g).map(function(part) { + if (!/%[0-9A-Fa-f]/.test(part)) { + part = encodeURI(part).replace(/%5B/g, "[").replace(/%5D/g, "]"); } + return part; + }).join(""); +} +function encodeUnreserved(str) { + return encodeURIComponent(str).replace(/[!'()*]/g, function(c) { + return "%" + c.charCodeAt(0).toString(16).toUpperCase(); + }); +} +function encodeValue(operator, value, key) { + value = operator === "+" || operator === "#" ? encodeReserved(value) : encodeUnreserved(value); + if (key) { + return encodeUnreserved(key) + "=" + value; + } else { + return value; } - #evict(free) { - const head = this.#head; - const k = this.#keyList[head]; - const v = this.#valList[head]; - if (this.#hasFetchMethod && this.#isBackgroundFetch(v)) { - v.__abortController.abort(new Error("evicted")); - } else if (this.#hasDispose || this.#hasDisposeAfter) { - if (this.#hasDispose) { - this.#dispose?.(v, k, "evict"); - } - if (this.#hasDisposeAfter) { - this.#disposed?.push([v, k, "evict"]); +} +function isDefined(value) { + return value !== void 0 && value !== null; +} +function isKeyOperator(operator) { + return operator === ";" || operator === "&" || operator === "?"; +} +function getValues(context, operator, key, modifier) { + var value = context[key], result = []; + if (isDefined(value) && value !== "") { + if (typeof value === "string" || typeof value === "number" || typeof value === "boolean") { + value = value.toString(); + if (modifier && modifier !== "*") { + value = value.substring(0, parseInt(modifier, 10)); } - } - this.#removeItemSize(head); - if (free) { - this.#keyList[head] = void 0; - this.#valList[head] = void 0; - this.#free.push(head); - } - if (this.#size === 1) { - this.#head = this.#tail = 0; - this.#free.length = 0; + result.push( + encodeValue(operator, value, isKeyOperator(operator) ? key : "") + ); } else { - this.#head = this.#next[head]; - } - this.#keyMap.delete(k); - this.#size--; - return head; - } - /** - * Check if a key is in the cache, without updating the recency of use. - * Will return false if the item is stale, even though it is technically - * in the cache. - * - * Will not update item age unless - * {@link LRUCache.OptionsBase.updateAgeOnHas} is set. - */ - has(k, hasOptions = {}) { - const { updateAgeOnHas = this.updateAgeOnHas, status } = hasOptions; - const index = this.#keyMap.get(k); - if (index !== void 0) { - const v = this.#valList[index]; - if (this.#isBackgroundFetch(v) && v.__staleWhileFetching === void 0) { - return false; - } - if (!this.#isStale(index)) { - if (updateAgeOnHas) { - this.#updateItemAge(index); - } - if (status) { - status.has = "hit"; - this.#statusTTL(status, index); - } - return true; - } else if (status) { - status.has = "stale"; - this.#statusTTL(status, index); - } - } else if (status) { - status.has = "miss"; - } - return false; - } - /** - * Like {@link LRUCache#get} but doesn't update recency or delete stale - * items. - * - * Returns `undefined` if the item is stale, unless - * {@link LRUCache.OptionsBase.allowStale} is set. - */ - peek(k, peekOptions = {}) { - const { allowStale = this.allowStale } = peekOptions; - const index = this.#keyMap.get(k); - if (index === void 0 || !allowStale && this.#isStale(index)) { - return; - } - const v = this.#valList[index]; - return this.#isBackgroundFetch(v) ? v.__staleWhileFetching : v; - } - #backgroundFetch(k, index, options, context) { - const v = index === void 0 ? void 0 : this.#valList[index]; - if (this.#isBackgroundFetch(v)) { - return v; - } - const ac = new AC(); - const { signal } = options; - signal?.addEventListener("abort", () => ac.abort(signal.reason), { - signal: ac.signal - }); - const fetchOpts = { - signal: ac.signal, - options, - context - }; - const cb = (v2, updateCache = false) => { - const { aborted } = ac.signal; - const ignoreAbort = options.ignoreFetchAbort && v2 !== void 0; - if (options.status) { - if (aborted && !updateCache) { - options.status.fetchAborted = true; - options.status.fetchError = ac.signal.reason; - if (ignoreAbort) - options.status.fetchAbortIgnored = true; + if (modifier === "*") { + if (Array.isArray(value)) { + value.filter(isDefined).forEach(function(value2) { + result.push( + encodeValue(operator, value2, isKeyOperator(operator) ? key : "") + ); + }); } else { - options.status.fetchResolved = true; + Object.keys(value).forEach(function(k) { + if (isDefined(value[k])) { + result.push(encodeValue(operator, value[k], k)); + } + }); } - } - if (aborted && !ignoreAbort && !updateCache) { - return fetchFail(ac.signal.reason); - } - const bf2 = p; - if (this.#valList[index] === p) { - if (v2 === void 0) { - if (bf2.__staleWhileFetching) { - this.#valList[index] = bf2.__staleWhileFetching; - } else { - this.delete(k); - } + } else { + const tmp = []; + if (Array.isArray(value)) { + value.filter(isDefined).forEach(function(value2) { + tmp.push(encodeValue(operator, value2)); + }); } else { - if (options.status) - options.status.fetchUpdated = true; - this.set(k, v2, fetchOpts.options); - } - } - return v2; - }; - const eb = (er) => { - if (options.status) { - options.status.fetchRejected = true; - options.status.fetchError = er; - } - return fetchFail(er); - }; - const fetchFail = (er) => { - const { aborted } = ac.signal; - const allowStaleAborted = aborted && options.allowStaleOnFetchAbort; - const allowStale = allowStaleAborted || options.allowStaleOnFetchRejection; - const noDelete = allowStale || options.noDeleteOnFetchRejection; - const bf2 = p; - if (this.#valList[index] === p) { - const del = !noDelete || bf2.__staleWhileFetching === void 0; - if (del) { - this.delete(k); - } else if (!allowStaleAborted) { - this.#valList[index] = bf2.__staleWhileFetching; + Object.keys(value).forEach(function(k) { + if (isDefined(value[k])) { + tmp.push(encodeUnreserved(k)); + tmp.push(encodeValue(operator, value[k].toString())); + } + }); } - } - if (allowStale) { - if (options.status && bf2.__staleWhileFetching !== void 0) { - options.status.returnedStale = true; + if (isKeyOperator(operator)) { + result.push(encodeUnreserved(key) + "=" + tmp.join(",")); + } else if (tmp.length !== 0) { + result.push(tmp.join(",")); } - return bf2.__staleWhileFetching; - } else if (bf2.__returned === bf2) { - throw er; - } - }; - const pcall = (res, rej) => { - const fmp = this.#fetchMethod?.(k, v, fetchOpts); - if (fmp && fmp instanceof Promise) { - fmp.then((v2) => res(v2 === void 0 ? void 0 : v2), rej); } - ac.signal.addEventListener("abort", () => { - if (!options.ignoreFetchAbort || options.allowStaleOnFetchAbort) { - res(void 0); - if (options.allowStaleOnFetchAbort) { - res = (v2) => cb(v2, true); - } - } - }); - }; - if (options.status) - options.status.fetchDispatched = true; - const p = new Promise(pcall).then(cb, eb); - const bf = Object.assign(p, { - __abortController: ac, - __staleWhileFetching: v, - __returned: void 0 - }); - if (index === void 0) { - this.set(k, bf, { ...fetchOpts.options, status: void 0 }); - index = this.#keyMap.get(k); - } else { - this.#valList[index] = bf; } - return bf; - } - #isBackgroundFetch(p) { - if (!this.#hasFetchMethod) - return false; - const b = p; - return !!b && b instanceof Promise && b.hasOwnProperty("__staleWhileFetching") && b.__abortController instanceof AC; - } - async fetch(k, fetchOptions = {}) { - const { - // get options - allowStale = this.allowStale, - updateAgeOnGet = this.updateAgeOnGet, - noDeleteOnStaleGet = this.noDeleteOnStaleGet, - // set options - ttl = this.ttl, - noDisposeOnSet = this.noDisposeOnSet, - size = 0, - sizeCalculation = this.sizeCalculation, - noUpdateTTL = this.noUpdateTTL, - // fetch exclusive options - noDeleteOnFetchRejection = this.noDeleteOnFetchRejection, - allowStaleOnFetchRejection = this.allowStaleOnFetchRejection, - ignoreFetchAbort = this.ignoreFetchAbort, - allowStaleOnFetchAbort = this.allowStaleOnFetchAbort, - context, - forceRefresh = false, - status, - signal - } = fetchOptions; - if (!this.#hasFetchMethod) { - if (status) - status.fetch = "get"; - return this.get(k, { - allowStale, - updateAgeOnGet, - noDeleteOnStaleGet, - status - }); - } - const options = { - allowStale, - updateAgeOnGet, - noDeleteOnStaleGet, - ttl, - noDisposeOnSet, - size, - sizeCalculation, - noUpdateTTL, - noDeleteOnFetchRejection, - allowStaleOnFetchRejection, - allowStaleOnFetchAbort, - ignoreFetchAbort, - status, - signal - }; - let index = this.#keyMap.get(k); - if (index === void 0) { - if (status) - status.fetch = "miss"; - const p = this.#backgroundFetch(k, index, options, context); - return p.__returned = p; - } else { - const v = this.#valList[index]; - if (this.#isBackgroundFetch(v)) { - const stale = allowStale && v.__staleWhileFetching !== void 0; - if (status) { - status.fetch = "inflight"; - if (stale) - status.returnedStale = true; - } - return stale ? v.__staleWhileFetching : v.__returned = v; - } - const isStale = this.#isStale(index); - if (!forceRefresh && !isStale) { - if (status) - status.fetch = "hit"; - this.#moveToTail(index); - if (updateAgeOnGet) { - this.#updateItemAge(index); - } - if (status) - this.#statusTTL(status, index); - return v; - } - const p = this.#backgroundFetch(k, index, options, context); - const hasStale = p.__staleWhileFetching !== void 0; - const staleVal = hasStale && allowStale; - if (status) { - status.fetch = isStale ? "stale" : "refresh"; - if (staleVal && isStale) - status.returnedStale = true; + } else { + if (operator === ";") { + if (isDefined(value)) { + result.push(encodeUnreserved(key)); } - return staleVal ? p.__staleWhileFetching : p.__returned = p; + } else if (value === "" && (operator === "&" || operator === "?")) { + result.push(encodeUnreserved(key) + "="); + } else if (value === "") { + result.push(""); } } - /** - * Return a value from the cache. Will update the recency of the cache - * entry found. - * - * If the key is not found, get() will return `undefined`. - */ - get(k, getOptions = {}) { - const { allowStale = this.allowStale, updateAgeOnGet = this.updateAgeOnGet, noDeleteOnStaleGet = this.noDeleteOnStaleGet, status } = getOptions; - const index = this.#keyMap.get(k); - if (index !== void 0) { - const value = this.#valList[index]; - const fetching = this.#isBackgroundFetch(value); - if (status) - this.#statusTTL(status, index); - if (this.#isStale(index)) { - if (status) - status.get = "stale"; - if (!fetching) { - if (!noDeleteOnStaleGet) { - this.delete(k); - } - if (status && allowStale) - status.returnedStale = true; - return allowStale ? value : void 0; - } else { - if (status && allowStale && value.__staleWhileFetching !== void 0) { - status.returnedStale = true; - } - return allowStale ? value.__staleWhileFetching : void 0; - } - } else { - if (status) - status.get = "hit"; - if (fetching) { - return value.__staleWhileFetching; + return result; +} +function parseUrl(template) { + return { + expand: expand.bind(null, template) + }; +} +function expand(template, context) { + var operators = ["+", "#", ".", "/", ";", "?", "&"]; + template = template.replace( + /\{([^\{\}]+)\}|([^\{\}]+)/g, + function(_, expression, literal) { + if (expression) { + let operator = ""; + const values = []; + if (operators.indexOf(expression.charAt(0)) !== -1) { + operator = expression.charAt(0); + expression = expression.substr(1); } - this.#moveToTail(index); - if (updateAgeOnGet) { - this.#updateItemAge(index); + expression.split(/,/g).forEach(function(variable) { + var tmp = /([^:\*]*)(?::(\d+)|(\*))?/.exec(variable); + values.push(getValues(context, operator, tmp[1], tmp[2] || tmp[3])); + }); + if (operator && operator !== "+") { + var separator = ","; + if (operator === "?") { + separator = "&"; + } else if (operator !== "#") { + separator = operator; + } + return (values.length !== 0 ? operator : "") + values.join(separator); + } else { + return values.join(","); } - return value; - } - } else if (status) { - status.get = "miss"; - } - } - #connect(p, n) { - this.#prev[n] = p; - this.#next[p] = n; - } - #moveToTail(index) { - if (index !== this.#tail) { - if (index === this.#head) { - this.#head = this.#next[index]; } else { - this.#connect(this.#prev[index], this.#next[index]); + return encodeReserved(literal); } - this.#connect(this.#tail, index); - this.#tail = index; } + ); + if (template === "/") { + return template; + } else { + return template.replace(/\/$/, ""); } - /** - * Deletes a key out of the cache. - * Returns true if the key was deleted, false otherwise. - */ - delete(k) { - let deleted = false; - if (this.#size !== 0) { - const index = this.#keyMap.get(k); - if (index !== void 0) { - deleted = true; - if (this.#size === 1) { - this.clear(); - } else { - this.#removeItemSize(index); - const v = this.#valList[index]; - if (this.#isBackgroundFetch(v)) { - v.__abortController.abort(new Error("deleted")); - } else if (this.#hasDispose || this.#hasDisposeAfter) { - if (this.#hasDispose) { - this.#dispose?.(v, k, "delete"); - } - if (this.#hasDisposeAfter) { - this.#disposed?.push([v, k, "delete"]); - } - } - this.#keyMap.delete(k); - this.#keyList[index] = void 0; - this.#valList[index] = void 0; - if (index === this.#tail) { - this.#tail = this.#prev[index]; - } else if (index === this.#head) { - this.#head = this.#next[index]; - } else { - const pi = this.#prev[index]; - this.#next[pi] = this.#next[index]; - const ni = this.#next[index]; - this.#prev[ni] = this.#prev[index]; - } - this.#size--; - this.#free.push(index); - } - } - } - if (this.#hasDisposeAfter && this.#disposed?.length) { - const dt = this.#disposed; - let task; - while (task = dt?.shift()) { - this.#disposeAfter?.(...task); - } - } - return deleted; +} +function parse3(options) { + let method = options.method.toUpperCase(); + let url = (options.url || "/").replace(/:([a-z]\w+)/g, "{$1}"); + let headers = Object.assign({}, options.headers); + let body; + let parameters = omit(options, [ + "method", + "baseUrl", + "url", + "headers", + "request", + "mediaType" + ]); + const urlVariableNames = extractUrlVariableNames(url); + url = parseUrl(url).expand(parameters); + if (!/^http/.test(url)) { + url = options.baseUrl + url; } - /** - * Clear the cache entirely, throwing away all values. - */ - clear() { - for (const index of this.#rindexes({ allowStale: true })) { - const v = this.#valList[index]; - if (this.#isBackgroundFetch(v)) { - v.__abortController.abort(new Error("deleted")); - } else { - const k = this.#keyList[index]; - if (this.#hasDispose) { - this.#dispose?.(v, k, "delete"); - } - if (this.#hasDisposeAfter) { - this.#disposed?.push([v, k, "delete"]); - } - } - } - this.#keyMap.clear(); - this.#valList.fill(void 0); - this.#keyList.fill(void 0); - if (this.#ttls && this.#starts) { - this.#ttls.fill(0); - this.#starts.fill(0); - } - if (this.#sizes) { - this.#sizes.fill(0); + const omittedParameters = Object.keys(options).filter((option) => urlVariableNames.includes(option)).concat("baseUrl"); + const remainingParameters = omit(parameters, omittedParameters); + const isBinaryRequest = /application\/octet-stream/i.test(headers.accept); + if (!isBinaryRequest) { + if (options.mediaType.format) { + headers.accept = headers.accept.split(/,/).map( + (format) => format.replace( + /application\/vnd(\.\w+)(\.v3)?(\.\w+)?(\+json)?$/, + `application/vnd$1$2.${options.mediaType.format}` + ) + ).join(","); } - this.#head = 0; - this.#tail = 0; - this.#free.length = 0; - this.#calculatedSize = 0; - this.#size = 0; - if (this.#hasDisposeAfter && this.#disposed) { - const dt = this.#disposed; - let task; - while (task = dt?.shift()) { - this.#disposeAfter?.(...task); + if (url.endsWith("/graphql")) { + if (options.mediaType.previews?.length) { + const previewsFromAcceptHeader = headers.accept.match(/[\w-]+(?=-preview)/g) || []; + headers.accept = previewsFromAcceptHeader.concat(options.mediaType.previews).map((preview) => { + const format = options.mediaType.format ? `.${options.mediaType.format}` : "+json"; + return `application/vnd.github.${preview}-preview${format}`; + }).join(","); } } } -}; - -// node_modules/@octokit/auth-app/dist-node/index.js -async function getAppAuthentication({ - appId: appId2, - privateKey: privateKey2, - timeDifference -}) { - try { - const appAuthentication = await githubAppJwt({ - id: appId2, - privateKey: privateKey2, - now: timeDifference && Math.floor(Date.now() / 1e3) + timeDifference - }); - return { - type: "app", - token: appAuthentication.token, - appId: appAuthentication.appId, - expiresAt: new Date(appAuthentication.expiration * 1e3).toISOString() - }; - } catch (error) { - if (privateKey2 === "-----BEGIN RSA PRIVATE KEY-----") { - throw new Error( - "The 'privateKey` option contains only the first line '-----BEGIN RSA PRIVATE KEY-----'. If you are setting it using a `.env` file, make sure it is set on a single line with newlines replaced by '\n'" - ); - } else { - throw error; - } - } -} -function getCache() { - return new LRUCache({ - // cache max. 15000 tokens, that will use less than 10mb memory - max: 15e3, - // Cache for 1 minute less than GitHub expiry - ttl: 1e3 * 60 * 59 - }); -} -async function get(cache, options) { - const cacheKey = optionsToCacheKey(options); - const result = await cache.get(cacheKey); - if (!result) { - return; - } - const [ - token, - createdAt, - expiresAt, - repositorySelection, - permissionsString, - singleFileName - ] = result.split("|"); - const permissions = options.permissions || permissionsString.split(/,/).reduce((permissions2, string) => { - if (/!$/.test(string)) { - permissions2[string.slice(0, -1)] = "write"; + if (["GET", "HEAD"].includes(method)) { + url = addQueryParameters(url, remainingParameters); + } else { + if ("data" in remainingParameters) { + body = remainingParameters.data; } else { - permissions2[string] = "read"; + if (Object.keys(remainingParameters).length) { + body = remainingParameters; + } } - return permissions2; - }, {}); - return { - token, - createdAt, - expiresAt, - permissions, - repositoryIds: options.repositoryIds, - repositoryNames: options.repositoryNames, - singleFileName, - repositorySelection - }; -} -async function set(cache, options, data) { - const key = optionsToCacheKey(options); - const permissionsString = options.permissions ? "" : Object.keys(data.permissions).map( - (name) => `${name}${data.permissions[name] === "write" ? "!" : ""}` - ).join(","); - const value = [ - data.token, - data.createdAt, - data.expiresAt, - data.repositorySelection, - permissionsString, - data.singleFileName - ].join("|"); - await cache.set(key, value); -} -function optionsToCacheKey({ - installationId, - permissions = {}, - repositoryIds = [], - repositoryNames = [] -}) { - const permissionsString = Object.keys(permissions).sort().map((name) => permissions[name] === "read" ? name : `${name}!`).join(","); - const repositoryIdsString = repositoryIds.sort().join(","); - const repositoryNamesString = repositoryNames.join(","); - return [ - installationId, - repositoryIdsString, - repositoryNamesString, - permissionsString - ].filter(Boolean).join("|"); -} -function toTokenAuthentication({ - installationId, - token, - createdAt, - expiresAt, - repositorySelection, - permissions, - repositoryIds, - repositoryNames, - singleFileName -}) { - return Object.assign( - { - type: "token", - tokenType: "installation", - token, - installationId, - permissions, - createdAt, - expiresAt, - repositorySelection - }, - repositoryIds ? { repositoryIds } : null, - repositoryNames ? { repositoryNames } : null, - singleFileName ? { singleFileName } : null - ); -} -async function getInstallationAuthentication(state, options, customRequest) { - const installationId = Number(options.installationId || state.installationId); - if (!installationId) { - throw new Error( - "[@octokit/auth-app] installationId option is required for installation authentication." - ); } - if (options.factory) { - const { type, factory, oauthApp, ...factoryAuthOptions } = { - ...state, - ...options - }; - return factory(factoryAuthOptions); + if (!headers["content-type"] && typeof body !== "undefined") { + headers["content-type"] = "application/json; charset=utf-8"; } - const optionsWithInstallationTokenFromState = Object.assign( - { installationId }, - options - ); - if (!options.refresh) { - const result = await get( - state.cache, - optionsWithInstallationTokenFromState - ); - if (result) { - const { - token: token2, - createdAt: createdAt2, - expiresAt: expiresAt2, - permissions: permissions2, - repositoryIds: repositoryIds2, - repositoryNames: repositoryNames2, - singleFileName: singleFileName2, - repositorySelection: repositorySelection2 - } = result; - return toTokenAuthentication({ - installationId, - token: token2, - createdAt: createdAt2, - expiresAt: expiresAt2, - permissions: permissions2, - repositorySelection: repositorySelection2, - repositoryIds: repositoryIds2, - repositoryNames: repositoryNames2, - singleFileName: singleFileName2 - }); - } - } - const appAuthentication = await getAppAuthentication(state); - const request2 = customRequest || state.request; - const { - data: { - token, - expires_at: expiresAt, - repositories: repositories2, - permissions: permissionsOptional, - repository_selection: repositorySelectionOptional, - single_file: singleFileName - } - } = await request2("POST /app/installations/{installation_id}/access_tokens", { - installation_id: installationId, - repository_ids: options.repositoryIds, - repositories: options.repositoryNames, - permissions: options.permissions, - mediaType: { - previews: ["machine-man"] - }, - headers: { - authorization: `bearer ${appAuthentication.token}` - } - }); - const permissions = permissionsOptional || {}; - const repositorySelection = repositorySelectionOptional || "all"; - const repositoryIds = repositories2 ? repositories2.map((r) => r.id) : void 0; - const repositoryNames = repositories2 ? repositories2.map((repo) => repo.name) : void 0; - const createdAt = (/* @__PURE__ */ new Date()).toISOString(); - await set(state.cache, optionsWithInstallationTokenFromState, { - token, - createdAt, - expiresAt, - repositorySelection, - permissions, - repositoryIds, - repositoryNames, - singleFileName - }); - return toTokenAuthentication({ - installationId, - token, - createdAt, - expiresAt, - repositorySelection, - permissions, - repositoryIds, - repositoryNames, - singleFileName - }); -} -async function auth4(state, authOptions) { - switch (authOptions.type) { - case "app": - return getAppAuthentication(state); - case "oauth-app": - return state.oauthApp({ type: "oauth-app" }); - case "installation": - authOptions; - return getInstallationAuthentication(state, { - ...authOptions, - type: "installation" - }); - case "oauth-user": - return state.oauthApp(authOptions); - default: - throw new Error(`Invalid auth type: ${authOptions.type}`); + if (["PATCH", "PUT"].includes(method) && typeof body === "undefined") { + body = ""; } -} -var PATHS = [ - "/app", - "/app/hook/config", - "/app/hook/deliveries", - "/app/hook/deliveries/{delivery_id}", - "/app/hook/deliveries/{delivery_id}/attempts", - "/app/installations", - "/app/installations/{installation_id}", - "/app/installations/{installation_id}/access_tokens", - "/app/installations/{installation_id}/suspended", - "/app/installation-requests", - "/marketplace_listing/accounts/{account_id}", - "/marketplace_listing/plan", - "/marketplace_listing/plans", - "/marketplace_listing/plans/{plan_id}/accounts", - "/marketplace_listing/stubbed/accounts/{account_id}", - "/marketplace_listing/stubbed/plan", - "/marketplace_listing/stubbed/plans", - "/marketplace_listing/stubbed/plans/{plan_id}/accounts", - "/orgs/{org}/installation", - "/repos/{owner}/{repo}/installation", - "/users/{username}/installation" -]; -function routeMatcher(paths) { - const regexes = paths.map( - (p) => p.split("/").map((c) => c.startsWith("{") ? "(?:.+?)" : c).join("/") + return Object.assign( + { method, url, headers }, + typeof body !== "undefined" ? { body } : null, + options.request ? { request: options.request } : null ); - const regex = `^(?:${regexes.map((r) => `(?:${r})`).join("|")})$`; - return new RegExp(regex, "i"); } -var REGEX = routeMatcher(PATHS); -function requiresAppAuth(url) { - return !!url && REGEX.test(url.split("?")[0]); +function endpointWithDefaults(defaults, route, options) { + return parse3(merge(defaults, route, options)); } -var FIVE_SECONDS_IN_MS = 5 * 1e3; -function isNotTimeSkewError(error) { - return !(error.message.match( - /'Expiration time' claim \('exp'\) must be a numeric value representing the future time at which the assertion expires/ - ) || error.message.match( - /'Issued at' claim \('iat'\) must be an Integer representing the time that the assertion was issued/ - )); +function withDefaults(oldDefaults, newDefaults) { + const DEFAULTS2 = merge(oldDefaults, newDefaults); + const endpoint2 = endpointWithDefaults.bind(null, DEFAULTS2); + return Object.assign(endpoint2, { + DEFAULTS: DEFAULTS2, + defaults: withDefaults.bind(null, DEFAULTS2), + merge: merge.bind(null, DEFAULTS2), + parse: parse3 + }); } -async function hook4(state, request2, route, parameters) { - const endpoint2 = request2.endpoint.merge(route, parameters); - const url = endpoint2.url; - if (/\/login\/oauth\/access_token$/.test(url)) { - return request2(endpoint2); - } - if (requiresAppAuth(url.replace(request2.endpoint.DEFAULTS.baseUrl, ""))) { - const { token: token2 } = await getAppAuthentication(state); - endpoint2.headers.authorization = `bearer ${token2}`; - let response; - try { - response = await request2(endpoint2); - } catch (error) { - if (isNotTimeSkewError(error)) { - throw error; - } - if (typeof error.response.headers.date === "undefined") { - throw error; - } - const diff = Math.floor( - (Date.parse(error.response.headers.date) - Date.parse((/* @__PURE__ */ new Date()).toString())) / 1e3 - ); - state.log.warn(error.message); - state.log.warn( - `[@octokit/auth-app] GitHub API time and system time are different by ${diff} seconds. Retrying request with the difference accounted for.` - ); - const { token: token3 } = await getAppAuthentication({ - ...state, - timeDifference: diff - }); - endpoint2.headers.authorization = `bearer ${token3}`; - return request2(endpoint2); +var endpoint = withDefaults(null, DEFAULTS); + +// node_modules/@octokit/request-error/dist-src/index.js +var RequestError = class extends Error { + name; + /** + * http status code + */ + status; + /** + * Request options that lead to the error. + */ + request; + /** + * Response object if a response was received + */ + response; + constructor(message, statusCode, options) { + super(message); + if (Error.captureStackTrace) { + Error.captureStackTrace(this, this.constructor); } - return response; - } - if (requiresBasicAuth(url)) { - const authentication = await state.oauthApp({ type: "oauth-app" }); - endpoint2.headers.authorization = authentication.headers.authorization; - return request2(endpoint2); - } - const { token, createdAt } = await getInstallationAuthentication( - state, - // @ts-expect-error TBD - {}, - request2 - ); - endpoint2.headers.authorization = `token ${token}`; - return sendRequestWithRetries( - state, - request2, - endpoint2, - createdAt - ); -} -async function sendRequestWithRetries(state, request2, options, createdAt, retries = 0) { - const timeSinceTokenCreationInMs = +/* @__PURE__ */ new Date() - +new Date(createdAt); - try { - return await request2(options); - } catch (error) { - if (error.status !== 401) { - throw error; + this.name = "HttpError"; + this.status = statusCode; + if ("response" in options) { + this.response = options.response; } - if (timeSinceTokenCreationInMs >= FIVE_SECONDS_IN_MS) { - if (retries > 0) { - error.message = `After ${retries} retries within ${timeSinceTokenCreationInMs / 1e3}s of creating the installation access token, the response remains 401. At this point, the cause may be an authentication problem or a system outage. Please check https://www.githubstatus.com for status information`; - } - throw error; + const requestCopy = Object.assign({}, options.request); + if (options.request.headers.authorization) { + requestCopy.headers = Object.assign({}, options.request.headers, { + authorization: options.request.headers.authorization.replace( + / .*$/, + " [REDACTED]" + ) + }); } - ++retries; - const awaitTime = retries * 1e3; - state.log.warn( - `[@octokit/auth-app] Retrying after 401 response to account for token replication delay (retry: ${retries}, wait: ${awaitTime / 1e3}s)` - ); - await new Promise((resolve) => setTimeout(resolve, awaitTime)); - return sendRequestWithRetries(state, request2, options, createdAt, retries); + requestCopy.url = requestCopy.url.replace(/\bclient_secret=\w+/g, "client_secret=[REDACTED]").replace(/\baccess_token=\w+/g, "access_token=[REDACTED]"); + this.request = requestCopy; } +}; + +// node_modules/@octokit/request/dist-bundle/index.js +var VERSION2 = "0.0.0-development"; +function isPlainObject2(value) { + if (typeof value !== "object" || value === null) + return false; + if (Object.prototype.toString.call(value) !== "[object Object]") + return false; + const proto = Object.getPrototypeOf(value); + if (proto === null) + return true; + const Ctor = Object.prototype.hasOwnProperty.call(proto, "constructor") && proto.constructor; + return typeof Ctor === "function" && Ctor instanceof Ctor && Function.prototype.call(Ctor) === Function.prototype.call(value); +} +function getBufferResponse(response) { + return response.arrayBuffer(); } -var VERSION6 = "7.1.0"; -function createAppAuth(options) { - if (!options.appId) { - throw new Error("[@octokit/auth-app] appId option is required"); +function fetchWrapper(requestOptions) { + const log = requestOptions.request && requestOptions.request.log ? requestOptions.request.log : console; + const parseSuccessResponseBody = requestOptions.request?.parseSuccessResponseBody !== false; + if (isPlainObject2(requestOptions.body) || Array.isArray(requestOptions.body)) { + requestOptions.body = JSON.stringify(requestOptions.body); } - if (!options.privateKey) { - throw new Error("[@octokit/auth-app] privateKey option is required"); + let headers = {}; + let status; + let url; + let { fetch: fetch2 } = globalThis; + if (requestOptions.request?.fetch) { + fetch2 = requestOptions.request.fetch; } - if ("installationId" in options && !options.installationId) { + if (!fetch2) { throw new Error( - "[@octokit/auth-app] installationId is set to a falsy value" + "fetch is not set. Please pass a fetch implementation as new Octokit({ request: { fetch }}). Learn more at https://github.com/octokit/octokit.js/#fetch-missing" ); } - const log = Object.assign( - { - warn: console.warn.bind(console) - }, - options.log - ); - const request2 = options.request || request.defaults({ - headers: { - "user-agent": `octokit-auth-app.js/${VERSION6} ${getUserAgent()}` + return fetch2(requestOptions.url, { + method: requestOptions.method, + body: requestOptions.body, + redirect: requestOptions.request?.redirect, + // Header values must be `string` + headers: Object.fromEntries( + Object.entries(requestOptions.headers).map(([name, value]) => [ + name, + String(value) + ]) + ), + signal: requestOptions.request?.signal, + // duplex must be set if request.body is ReadableStream or Async Iterables. + // See https://fetch.spec.whatwg.org/#dom-requestinit-duplex. + ...requestOptions.body && { duplex: "half" } + }).then(async (response) => { + url = response.url; + status = response.status; + for (const keyAndValue of response.headers) { + headers[keyAndValue[0]] = keyAndValue[1]; } - }); - const state = Object.assign( - { - request: request2, - cache: getCache() - }, - options, - options.installationId ? { installationId: Number(options.installationId) } : {}, - { - log, - oauthApp: createOAuthAppAuth({ - clientType: "github-app", - clientId: options.clientId || "", - clientSecret: options.clientSecret || "", - request: request2 - }) + if ("deprecation" in headers) { + const matches = headers.link && headers.link.match(/<([^>]+)>; rel="deprecation"/); + const deprecationLink = matches && matches.pop(); + log.warn( + `[@octokit/request] "${requestOptions.method} ${requestOptions.url}" is deprecated. It is scheduled to be removed on ${headers.sunset}${deprecationLink ? `. See ${deprecationLink}` : ""}` + ); } - ); - return Object.assign(auth4.bind(null, state), { - hook: hook4.bind(null, state) - }); -} - -// node_modules/p-retry/index.js -var import_retry = __toESM(require_retry2(), 1); - -// node_modules/is-network-error/index.js -var objectToString = Object.prototype.toString; -var isError = (value) => objectToString.call(value) === "[object Error]"; -var errorMessages = /* @__PURE__ */ new Set([ - "network error", - // Chrome - "Failed to fetch", - // Chrome - "NetworkError when attempting to fetch resource.", - // Firefox - "The Internet connection appears to be offline.", - // Safari 16 - "Load failed", - // Safari 17+ - "Network request failed", - // `cross-fetch` - "fetch failed", - // Undici (Node.js) - "terminated" - // Undici (Node.js) -]); -function isNetworkError(error) { - const isValid = error && isError(error) && error.name === "TypeError" && typeof error.message === "string"; - if (!isValid) { - return false; - } - if (error.message === "Load failed") { - return error.stack === void 0; - } - return errorMessages.has(error.message); -} - -// node_modules/p-retry/index.js -var AbortError = class extends Error { - constructor(message) { - super(); - if (message instanceof Error) { - this.originalError = message; - ({ message } = message); - } else { - this.originalError = new Error(message); - this.originalError.stack = this.stack; + if (status === 204 || status === 205) { + return; } - this.name = "AbortError"; - this.message = message; - } -}; -var decorateErrorWithCounts = (error, attemptNumber, options) => { - const retriesLeft = options.retries - (attemptNumber - 1); - error.attemptNumber = attemptNumber; - error.retriesLeft = retriesLeft; - return error; -}; -async function pRetry(input, options) { - return new Promise((resolve, reject) => { - options = { - onFailedAttempt() { - }, - retries: 10, - shouldRetry: () => true, - ...options - }; - const operation = import_retry.default.operation(options); - const abortHandler = () => { - operation.stop(); - reject(options.signal?.reason); - }; - if (options.signal && !options.signal.aborted) { - options.signal.addEventListener("abort", abortHandler, { once: true }); + if (requestOptions.method === "HEAD") { + if (status < 400) { + return; + } + throw new RequestError(response.statusText, status, { + response: { + url, + status, + headers, + data: void 0 + }, + request: requestOptions + }); } - const cleanUp = () => { - options.signal?.removeEventListener("abort", abortHandler); - operation.stop(); + if (status === 304) { + throw new RequestError("Not modified", status, { + response: { + url, + status, + headers, + data: await getResponseData(response) + }, + request: requestOptions + }); + } + if (status >= 400) { + const data = await getResponseData(response); + const error = new RequestError(toErrorMessage(data), status, { + response: { + url, + status, + headers, + data + }, + request: requestOptions + }); + throw error; + } + return parseSuccessResponseBody ? await getResponseData(response) : response.body; + }).then((data) => { + return { + status, + url, + headers, + data }; - operation.attempt(async (attemptNumber) => { - try { - const result = await input(attemptNumber); - cleanUp(); - resolve(result); - } catch (error) { - try { - if (!(error instanceof Error)) { - throw new TypeError(`Non-error was thrown: "${error}". You should only throw errors.`); - } - if (error instanceof AbortError) { - throw error.originalError; - } - if (error instanceof TypeError && !isNetworkError(error)) { - throw error; - } - decorateErrorWithCounts(error, attemptNumber, options); - if (!await options.shouldRetry(error)) { - operation.stop(); - reject(error); - } - await options.onFailedAttempt(error); - if (!operation.retry(error)) { - throw operation.mainError(); - } - } catch (finalError) { - decorateErrorWithCounts(finalError, attemptNumber, options); - cleanUp(); - reject(finalError); - } + }).catch((error) => { + if (error instanceof RequestError) + throw error; + else if (error.name === "AbortError") + throw error; + let message = error.message; + if (error.name === "TypeError" && "cause" in error) { + if (error.cause instanceof Error) { + message = error.cause.message; + } else if (typeof error.cause === "string") { + message = error.cause; } + } + throw new RequestError(message, 500, { + request: requestOptions }); }); } - -// lib/main.js -async function main(appId2, privateKey2, owner2, repositories2, core3, createAppAuth2, request2, skipTokenRevoke2) { - let parsedOwner = ""; - let parsedRepositoryNames = ""; - if (!owner2 && !repositories2) { - [parsedOwner, parsedRepositoryNames] = String( - process.env.GITHUB_REPOSITORY - ).split("/"); - core3.info( - `owner and repositories not set, creating token for the current repository ("${parsedRepositoryNames}")` - ); - } - if (owner2 && !repositories2) { - parsedOwner = owner2; - core3.info( - `repositories not set, creating token for all repositories for given owner "${owner2}"` - ); - } - if (!owner2 && repositories2) { - parsedOwner = String(process.env.GITHUB_REPOSITORY_OWNER); - parsedRepositoryNames = repositories2; - core3.info( - `owner not set, creating owner for given repositories "${repositories2}" in current owner ("${parsedOwner}")` - ); +async function getResponseData(response) { + const contentType = response.headers.get("content-type"); + if (/application\/json/.test(contentType)) { + return response.json().catch(() => response.text()).catch(() => ""); } - if (owner2 && repositories2) { - parsedOwner = owner2; - parsedRepositoryNames = repositories2; - core3.info( - `owner and repositories set, creating token for repositories "${repositories2}" owned by "${owner2}"` - ); + if (!contentType || /^text\/|charset=utf-8$/.test(contentType)) { + return response.text(); } - const auth5 = createAppAuth2({ - appId: appId2, - privateKey: privateKey2, - request: request2 - }); - let authentication, installationId, appSlug; - if (parsedRepositoryNames) { - ({ authentication, installationId, appSlug } = await pRetry(() => getTokenFromRepository(request2, auth5, parsedOwner, parsedRepositoryNames), { - onFailedAttempt: (error) => { - core3.info( - `Failed to create token for "${parsedRepositoryNames}" (attempt ${error.attemptNumber}): ${error.message}` - ); - }, - retries: 3 - })); + return getBufferResponse(response); +} +function toErrorMessage(data) { + if (typeof data === "string") + return data; + let suffix; + if ("documentation_url" in data) { + suffix = ` - ${data.documentation_url}`; } else { - ({ authentication, installationId, appSlug } = await pRetry(() => getTokenFromOwner(request2, auth5, parsedOwner), { - onFailedAttempt: (error) => { - core3.info( - `Failed to create token for "${parsedOwner}" (attempt ${error.attemptNumber}): ${error.message}` - ); - }, - retries: 3 - })); + suffix = ""; } - core3.setSecret(authentication.token); - core3.setOutput("token", authentication.token); - core3.setOutput("installation-id", installationId); - core3.setOutput("app-slug", appSlug); - if (!skipTokenRevoke2) { - core3.saveState("token", authentication.token); - core3.saveState("expiresAt", authentication.expiresAt); + if ("message" in data) { + if (Array.isArray(data.errors)) { + return `${data.message}: ${data.errors.map(JSON.stringify).join(", ")}${suffix}`; + } + return `${data.message}${suffix}`; } + return `Unknown error: ${JSON.stringify(data)}`; } -async function getTokenFromOwner(request2, auth5, parsedOwner) { - const response = await request2("GET /orgs/{org}/installation", { - org: parsedOwner, - request: { - hook: auth5.hook +function withDefaults2(oldEndpoint, newDefaults) { + const endpoint2 = oldEndpoint.defaults(newDefaults); + const newApi = function(route, parameters) { + const endpointOptions = endpoint2.merge(route, parameters); + if (!endpointOptions.request || !endpointOptions.request.hook) { + return fetchWrapper(endpoint2.parse(endpointOptions)); } - }).catch((error) => { - if (error.status !== 404) throw error; - return request2("GET /users/{username}/installation", { - username: parsedOwner, - request: { - hook: auth5.hook - } + const request2 = (route2, parameters2) => { + return fetchWrapper( + endpoint2.parse(endpoint2.merge(route2, parameters2)) + ); + }; + Object.assign(request2, { + endpoint: endpoint2, + defaults: withDefaults2.bind(null, endpoint2) }); + return endpointOptions.request.hook(request2, endpointOptions); + }; + return Object.assign(newApi, { + endpoint: endpoint2, + defaults: withDefaults2.bind(null, endpoint2) }); - const authentication = await auth5({ - type: "installation", - installationId: response.data.id - }); - const installationId = response.data.id; - const appSlug = response.data["app_slug"]; - return { authentication, installationId, appSlug }; -} -async function getTokenFromRepository(request2, auth5, parsedOwner, parsedRepositoryNames) { - const response = await request2("GET /repos/{owner}/{repo}/installation", { - owner: parsedOwner, - repo: parsedRepositoryNames.split(",")[0], - request: { - hook: auth5.hook - } - }); - const authentication = await auth5({ - type: "installation", - installationId: response.data.id, - repositoryNames: parsedRepositoryNames.split(",") - }); - const installationId = response.data.id; - const appSlug = response.data["app_slug"]; - return { authentication, installationId, appSlug }; } +var request = withDefaults2(endpoint, { + headers: { + "user-agent": `octokit-request.js/${VERSION2} ${getUserAgent()}` + } +}); // lib/request.js -var import_core = __toESM(require_core(), 1); var import_undici = __toESM(require_undici2(), 1); -var baseUrl = import_core.default.getInput("github-api-url").replace(/\/$/, ""); +var baseUrl = import_core3.default.getInput("github-api-url").replace(/\/$/, ""); var proxyUrl = process.env.https_proxy || process.env.HTTPS_PROXY || process.env.http_proxy || process.env.HTTP_PROXY; var proxyFetch = (url, options) => { const urlHost = new URL(url).hostname; @@ -39831,31 +58694,30 @@ if (!process.env.GITHUB_REPOSITORY) { if (!process.env.GITHUB_REPOSITORY_OWNER) { throw new Error("GITHUB_REPOSITORY_OWNER missing, must be set to ''"); } -var appId = import_core2.default.getInput("app-id") || import_core2.default.getInput("app_id"); +var appId = import_core4.default.getInput("app-id") || import_core4.default.getInput("app_id"); if (!appId) { throw new Error("Input required and not supplied: app-id"); } -var privateKey = import_core2.default.getInput("private-key") || import_core2.default.getInput("private_key"); -if (!privateKey) { - throw new Error("Input required and not supplied: private-key"); +var kmsKeyId = import_core4.default.getInput("kms-key-id") || import_core4.default.getInput("kms_key_id"); +if (!kmsKeyId) { + throw new Error("Input required and not supplied: kms-key-id"); } -var owner = import_core2.default.getInput("owner"); -var repositories = import_core2.default.getInput("repositories"); +var owner = import_core4.default.getInput("owner"); +var repositories = import_core4.default.getInput("repositories"); var skipTokenRevoke = Boolean( - import_core2.default.getInput("skip-token-revoke") || import_core2.default.getInput("skip_token_revoke") + import_core4.default.getInput("skip-token-revoke") || import_core4.default.getInput("skip_token_revoke") ); main( appId, - privateKey, + kmsKeyId, owner, repositories, - import_core2.default, - createAppAuth, + import_core4.default, request_default, skipTokenRevoke ).catch((error) => { console.error(error); - import_core2.default.setFailed(error.message); + import_core4.default.setFailed(error.message); }); /*! Bundled license information: diff --git a/dist/post.cjs b/dist/post.cjs index 0307466..090c0f1 100644 --- a/dist/post.cjs +++ b/dist/post.cjs @@ -19943,6 +19943,27 @@ var require_util8 = __commonJS({ } var kEnumerableProperty = /* @__PURE__ */ Object.create(null); kEnumerableProperty.enumerable = true; + var normalizedMethodRecordsBase = { + delete: "DELETE", + DELETE: "DELETE", + get: "GET", + GET: "GET", + head: "HEAD", + HEAD: "HEAD", + options: "OPTIONS", + OPTIONS: "OPTIONS", + post: "POST", + POST: "POST", + put: "PUT", + PUT: "PUT" + }; + var normalizedMethodRecords = { + ...normalizedMethodRecordsBase, + patch: "patch", + PATCH: "PATCH" + }; + Object.setPrototypeOf(normalizedMethodRecordsBase, null); + Object.setPrototypeOf(normalizedMethodRecords, null); module2.exports = { kEnumerableProperty, nop, @@ -19981,6 +20002,8 @@ var require_util8 = __commonJS({ isValidHeaderValue, isTokenCharCode, parseRangeHeader, + normalizedMethodRecordsBase, + normalizedMethodRecords, isValidPort, isHttpOrHttpsPrefixed, nodeMajor, @@ -20196,7 +20219,8 @@ var require_request3 = __commonJS({ isBlobLike, buildURL, validateHandler, - getServerName + getServerName, + normalizedMethodRecords } = require_util8(); var { channels } = require_diagnostics(); var { headerNameLowerCasedRecord } = require_constants6(); @@ -20223,12 +20247,12 @@ var require_request3 = __commonJS({ throw new InvalidArgumentError("path must be a string"); } else if (path[0] !== "/" && !(path.startsWith("http://") || path.startsWith("https://")) && method !== "CONNECT") { throw new InvalidArgumentError("path must be an absolute URL or start with a slash"); - } else if (invalidPathRegex.exec(path) !== null) { + } else if (invalidPathRegex.test(path)) { throw new InvalidArgumentError("invalid request path"); } if (typeof method !== "string") { throw new InvalidArgumentError("method must be a string"); - } else if (!isValidHTTPToken(method)) { + } else if (normalizedMethodRecords[method] === void 0 && !isValidHTTPToken(method)) { throw new InvalidArgumentError("invalid request method"); } if (upgrade && typeof upgrade !== "string") { @@ -20773,7 +20797,7 @@ var require_connect2 = __commonJS({ } }; } - function buildConnector({ allowH2, maxCachedSessions, socketPath, timeout, ...opts }) { + function buildConnector({ allowH2, maxCachedSessions, socketPath, timeout, session: customSession, ...opts }) { if (maxCachedSessions != null && (!Number.isInteger(maxCachedSessions) || maxCachedSessions < 0)) { throw new InvalidArgumentError("maxCachedSessions must be a positive integer or zero"); } @@ -20789,7 +20813,7 @@ var require_connect2 = __commonJS({ } servername = servername || options.servername || util.getServerName(host) || null; const sessionKey = servername || hostname; - const session = sessionCache.get(sessionKey) || null; + const session = customSession || sessionCache.get(sessionKey) || null; assert(sessionKey); socket = tls.connect({ highWaterMark: 16384, @@ -22307,7 +22331,7 @@ var require_util9 = __commonJS({ var { getGlobalOrigin } = require_global3(); var { collectASequenceOfCodePoints, collectAnHTTPQuotedString, removeChars, parseMIMEType } = require_data_url(); var { performance: performance2 } = require("node:perf_hooks"); - var { isBlobLike, ReadableStreamFrom, isValidHTTPToken } = require_util8(); + var { isBlobLike, ReadableStreamFrom, isValidHTTPToken, normalizedMethodRecordsBase } = require_util8(); var assert = require("node:assert"); var { isUint8Array } = require("node:util/types"); var { webidl } = require_webidl2(); @@ -22414,7 +22438,7 @@ var require_util9 = __commonJS({ } function appendRequestOriginHeader(request2) { let serializedOrigin = request2.origin; - if (serializedOrigin === "client") { + if (serializedOrigin === "client" || serializedOrigin === void 0) { return; } if (request2.responseTainting === "cors" || request2.mode === "websocket") { @@ -22695,29 +22719,8 @@ var require_util9 = __commonJS({ function isCancelled(fetchParams) { return fetchParams.controller.state === "aborted" || fetchParams.controller.state === "terminated"; } - var normalizeMethodRecordBase = { - delete: "DELETE", - DELETE: "DELETE", - get: "GET", - GET: "GET", - head: "HEAD", - HEAD: "HEAD", - options: "OPTIONS", - OPTIONS: "OPTIONS", - post: "POST", - POST: "POST", - put: "PUT", - PUT: "PUT" - }; - var normalizeMethodRecord = { - ...normalizeMethodRecordBase, - patch: "patch", - PATCH: "PATCH" - }; - Object.setPrototypeOf(normalizeMethodRecordBase, null); - Object.setPrototypeOf(normalizeMethodRecord, null); function normalizeMethod(method) { - return normalizeMethodRecordBase[method.toLowerCase()] ?? method; + return normalizedMethodRecordsBase[method.toLowerCase()] ?? method; } function serializeJavascriptValueToJSONString(value) { const result = JSON.stringify(value); @@ -22854,7 +22857,7 @@ var require_util9 = __commonJS({ } }); } - async function fullyReadBody(body, processBody, processBodyError, shouldClone) { + async function fullyReadBody(body, processBody, processBodyError) { const successSteps = processBody; const errorSteps = processBodyError; let reader; @@ -22865,7 +22868,7 @@ var require_util9 = __commonJS({ return; } try { - successSteps(await readAllBytes(reader, shouldClone)); + successSteps(await readAllBytes(reader)); } catch (e) { errorSteps(e); } @@ -22888,19 +22891,12 @@ var require_util9 = __commonJS({ assert(!invalidIsomorphicEncodeValueRegex.test(input)); return input; } - async function readAllBytes(reader, shouldClone) { + async function readAllBytes(reader) { const bytes = []; let byteLength = 0; while (true) { const { done, value: chunk } = await reader.read(); if (done) { - if (bytes.length === 1) { - const { buffer, byteOffset, byteLength: byteLength2 } = bytes[0]; - if (shouldClone === false) { - return Buffer.from(buffer, byteOffset, byteLength2); - } - return Buffer.from(buffer.slice(byteOffset, byteOffset + byteLength2), 0, byteLength2); - } return Buffer.concat(bytes, byteLength); } if (!isUint8Array(chunk)) { @@ -23163,7 +23159,6 @@ var require_util9 = __commonJS({ urlHasHttpsScheme, urlIsHttpHttpsScheme, readAllBytes, - normalizeMethodRecord, simpleRangeHeaderValue, buildContentRange, parseMetadata, @@ -23835,18 +23830,18 @@ Content-Type: ${value.type || "application/octet-stream"}\r mimeType = serializeAMimeType(mimeType); } return new Blob2([bytes], { type: mimeType }); - }, instance, false); + }, instance); }, arrayBuffer() { return consumeBody(this, (bytes) => { - return bytes.buffer; - }, instance, true); + return new Uint8Array(bytes).buffer; + }, instance); }, text() { - return consumeBody(this, utf8DecodeBytes, instance, false); + return consumeBody(this, utf8DecodeBytes, instance); }, json() { - return consumeBody(this, parseJSONFromBytes, instance, false); + return consumeBody(this, parseJSONFromBytes, instance); }, formData() { return consumeBody(this, (value) => { @@ -23875,12 +23870,12 @@ Content-Type: ${value.type || "application/octet-stream"}\r throw new TypeError( 'Content-Type was not one of "multipart/form-data" or "application/x-www-form-urlencoded".' ); - }, instance, false); + }, instance); }, bytes() { return consumeBody(this, (bytes) => { - return new Uint8Array(bytes.buffer, 0, bytes.byteLength); - }, instance, true); + return new Uint8Array(bytes); + }, instance); } }; return methods; @@ -23888,7 +23883,7 @@ Content-Type: ${value.type || "application/octet-stream"}\r function mixinBody(prototype) { Object.assign(prototype.prototype, bodyMixinMethods(prototype)); } - async function consumeBody(object, convertBytesToJSValue, instance, shouldClone) { + async function consumeBody(object, convertBytesToJSValue, instance) { webidl.brandCheck(object, instance); if (bodyUnusable(object[kState].body)) { throw new TypeError("Body is unusable: Body has already been read"); @@ -23907,7 +23902,7 @@ Content-Type: ${value.type || "application/octet-stream"}\r successSteps(Buffer.allocUnsafe(0)); return promise.promise; } - await fullyReadBody(object[kState].body, successSteps, errorSteps, shouldClone); + await fullyReadBody(object[kState].body, successSteps, errorSteps); return promise.promise; } function bodyUnusable(body) { @@ -24660,25 +24655,25 @@ upgrade: ${upgrade}\r channels.sendHeaders.publish({ request: request2, headers: header, socket }); } if (!body || bodyLength === 0) { - writeBuffer({ abort, body: null, client, request: request2, socket, contentLength, header, expectsPayload }); + writeBuffer(abort, null, client, request2, socket, contentLength, header, expectsPayload); } else if (util.isBuffer(body)) { - writeBuffer({ abort, body, client, request: request2, socket, contentLength, header, expectsPayload }); + writeBuffer(abort, body, client, request2, socket, contentLength, header, expectsPayload); } else if (util.isBlobLike(body)) { if (typeof body.stream === "function") { - writeIterable({ abort, body: body.stream(), client, request: request2, socket, contentLength, header, expectsPayload }); + writeIterable(abort, body.stream(), client, request2, socket, contentLength, header, expectsPayload); } else { - writeBlob({ abort, body, client, request: request2, socket, contentLength, header, expectsPayload }); + writeBlob(abort, body, client, request2, socket, contentLength, header, expectsPayload); } } else if (util.isStream(body)) { - writeStream({ abort, body, client, request: request2, socket, contentLength, header, expectsPayload }); + writeStream(abort, body, client, request2, socket, contentLength, header, expectsPayload); } else if (util.isIterable(body)) { - writeIterable({ abort, body, client, request: request2, socket, contentLength, header, expectsPayload }); + writeIterable(abort, body, client, request2, socket, contentLength, header, expectsPayload); } else { assert(false); } return true; } - function writeStream({ abort, body, client, request: request2, socket, contentLength, header, expectsPayload }) { + function writeStream(abort, body, client, request2, socket, contentLength, header, expectsPayload) { assert(contentLength !== 0 || client[kRunning] === 0, "stream body cannot be pipelined"); let finished = false; const writer = new AsyncWriter({ abort, socket, request: request2, contentLength, client, expectsPayload, header }); @@ -24747,7 +24742,7 @@ upgrade: ${upgrade}\r setImmediate(onClose); } } - function writeBuffer({ abort, body, client, request: request2, socket, contentLength, header, expectsPayload }) { + function writeBuffer(abort, body, client, request2, socket, contentLength, header, expectsPayload) { try { if (!body) { if (contentLength === 0) { @@ -24778,7 +24773,7 @@ upgrade: ${upgrade}\r abort(err); } } - async function writeBlob({ abort, body, client, request: request2, socket, contentLength, header, expectsPayload }) { + async function writeBlob(abort, body, client, request2, socket, contentLength, header, expectsPayload) { assert(contentLength === body.size, "blob body must have content length"); try { if (contentLength != null && contentLength !== body.size) { @@ -24801,7 +24796,7 @@ upgrade: ${upgrade}\r abort(err); } } - async function writeIterable({ abort, body, client, request: request2, socket, contentLength, header, expectsPayload }) { + async function writeIterable(abort, body, client, request2, socket, contentLength, header, expectsPayload) { assert(contentLength !== 0 || client[kRunning] === 0, "iterator body cannot be pipelined"); let callback = null; function onDrain() { @@ -25264,81 +25259,79 @@ var require_client_h2 = __commonJS({ return true; function writeBodyH2() { if (!body || contentLength === 0) { - writeBuffer({ + writeBuffer( abort, + stream, + null, client, - request: request2, + request2, + client[kSocket], contentLength, - expectsPayload, - h2stream: stream, - body: null, - socket: client[kSocket] - }); + expectsPayload + ); } else if (util.isBuffer(body)) { - writeBuffer({ + writeBuffer( abort, + stream, + body, client, - request: request2, + request2, + client[kSocket], contentLength, - body, - expectsPayload, - h2stream: stream, - socket: client[kSocket] - }); + expectsPayload + ); } else if (util.isBlobLike(body)) { if (typeof body.stream === "function") { - writeIterable({ + writeIterable( abort, + stream, + body.stream(), client, - request: request2, + request2, + client[kSocket], contentLength, - expectsPayload, - h2stream: stream, - body: body.stream(), - socket: client[kSocket] - }); + expectsPayload + ); } else { - writeBlob({ + writeBlob( abort, + stream, body, client, - request: request2, + request2, + client[kSocket], contentLength, - expectsPayload, - h2stream: stream, - socket: client[kSocket] - }); + expectsPayload + ); } } else if (util.isStream(body)) { - writeStream({ + writeStream( abort, + client[kSocket], + expectsPayload, + stream, body, client, - request: request2, - contentLength, - expectsPayload, - socket: client[kSocket], - h2stream: stream, - header: "" - }); + request2, + contentLength + ); } else if (util.isIterable(body)) { - writeIterable({ + writeIterable( abort, + stream, body, client, - request: request2, + request2, + client[kSocket], contentLength, - expectsPayload, - header: "", - h2stream: stream, - socket: client[kSocket] - }); + expectsPayload + ); } else { assert(false); } } } - function writeBuffer({ abort, h2stream, body, client, request: request2, socket, contentLength, expectsPayload }) { + function writeBuffer(abort, h2stream, body, client, request2, socket, contentLength, expectsPayload) { try { if (body != null && util.isBuffer(body)) { assert(contentLength === body.byteLength, "buffer body must have content length"); @@ -25357,7 +25350,7 @@ var require_client_h2 = __commonJS({ abort(error); } } - function writeStream({ abort, socket, expectsPayload, h2stream, body, client, request: request2, contentLength }) { + function writeStream(abort, socket, expectsPayload, h2stream, body, client, request2, contentLength) { assert(contentLength !== 0 || client[kRunning] === 0, "stream body cannot be pipelined"); const pipe = pipeline( body, @@ -25381,7 +25374,7 @@ var require_client_h2 = __commonJS({ request2.onBodySent(chunk); } } - async function writeBlob({ abort, h2stream, body, client, request: request2, socket, contentLength, expectsPayload }) { + async function writeBlob(abort, h2stream, body, client, request2, socket, contentLength, expectsPayload) { assert(contentLength === body.size, "blob body must have content length"); try { if (contentLength != null && contentLength !== body.size) { @@ -25402,7 +25395,7 @@ var require_client_h2 = __commonJS({ abort(err); } } - async function writeIterable({ abort, h2stream, body, client, request: request2, socket, contentLength, expectsPayload }) { + async function writeIterable(abort, h2stream, body, client, request2, socket, contentLength, expectsPayload) { assert(contentLength !== 0 || client[kRunning] === 0, "iterator body cannot be pipelined"); let callback = null; function onDrain() { @@ -27147,7 +27140,7 @@ var require_retry_handler = __commonJS({ this.abort( new RequestRetryError("Content-Range mismatch", statusCode, { headers, - count: this.retryCount + data: { count: this.retryCount } }) ); return false; @@ -27156,7 +27149,7 @@ var require_retry_handler = __commonJS({ this.abort( new RequestRetryError("ETag mismatch", statusCode, { headers, - count: this.retryCount + data: { count: this.retryCount } }) ); return false; @@ -30380,9 +30373,7 @@ var require_request4 = __commonJS({ var { isValidHTTPToken, sameOrigin, - normalizeMethod, - environmentSettingsObject, - normalizeMethodRecord + environmentSettingsObject } = require_util9(); var { forbiddenMethodsSet, @@ -30394,7 +30385,7 @@ var require_request4 = __commonJS({ requestCache, requestDuplex } = require_constants8(); - var { kEnumerableProperty } = util; + var { kEnumerableProperty, normalizedMethodRecordsBase, normalizedMethodRecords } = util; var { kHeaders, kSignal, kState, kDispatcher } = require_symbols7(); var { webidl } = require_webidl2(); var { URLSerializer } = require_data_url(); @@ -30591,17 +30582,18 @@ var require_request4 = __commonJS({ } if (init.method !== void 0) { let method = init.method; - const mayBeNormalized = normalizeMethodRecord[method]; + const mayBeNormalized = normalizedMethodRecords[method]; if (mayBeNormalized !== void 0) { request2.method = mayBeNormalized; } else { if (!isValidHTTPToken(method)) { throw new TypeError(`'${method}' is not a valid HTTP method.`); } - if (forbiddenMethodsSet.has(method.toUpperCase())) { + const upperCase = method.toUpperCase(); + if (forbiddenMethodsSet.has(upperCase)) { throw new TypeError(`'${method}' HTTP method is unsupported.`); } - method = normalizeMethod(method); + method = normalizedMethodRecordsBase[upperCase] ?? method; request2.method = method; } if (!patchMethodWarning && request2.method === "patch") { @@ -35317,7 +35309,6 @@ var require_websocket2 = __commonJS({ var { types } = require("node:util"); var { ErrorEvent, CloseEvent } = require_events2(); var { SendQueue } = require_sender(); - var experimentalWarned = false; var WebSocket = class _WebSocket extends EventTarget { #events = { open: null, @@ -35338,12 +35329,6 @@ var require_websocket2 = __commonJS({ super(); const prefix = "WebSocket constructor"; webidl.argumentLengthCheck(arguments, 1, prefix); - if (!experimentalWarned) { - experimentalWarned = true; - process.emitWarning("WebSockets are experimental, expect them to change at any time.", { - code: "UNDICI-WS" - }); - } const options = webidl.converters["DOMString or sequence or WebSocketInit"](protocols, prefix, "options"); url = webidl.converters.USVString(url, prefix, "url"); protocols = options.protocols; diff --git a/package.json b/package.json index bc3b5ed..a42090f 100644 --- a/package.json +++ b/package.json @@ -2,7 +2,7 @@ "name": "create-github-app-token-aws", "private": true, "type": "module", - "version": "1.10.3", + "version": "1.0.0", "description": "GitHub Action for creating a GitHub App Installation Access Token using AWS KMS", "scripts": { "build": "esbuild main.js post.js --bundle --outdir=dist --out-extension:.js=.cjs --platform=node --target=node20.0.0 --packages=bundle",